diff --git a/wp-content/mu-plugins/coach-payment-cards.php b/wp-content/mu-plugins/coach-payment-cards.php new file mode 100644 index 0000000..1e191bd --- /dev/null +++ b/wp-content/mu-plugins/coach-payment-cards.php @@ -0,0 +1,129 @@ + .wp-block-group__inner-container { + display: grid; + gap: 1rem; +} +body.coaching-mvp-active .coach-payment-section h2.wp-block-heading { + margin: 0 !important; + max-width: 14ch; + font-size: clamp(2rem, 4.3vw, 3rem) !important; + line-height: .98 !important; + letter-spacing: -.04em !important; +} +body.coaching-mvp-active .coach-payment-section > .wp-block-group__inner-container > p:not(.coach-badge) { + max-width: 42rem; + margin: 0 !important; + color: var(--coach-muted) !important; +} +body.coaching-mvp-active .coach-payment-note { + padding: 1rem 1.1rem !important; +} +body.coaching-mvp-active .coach-payment-note p { + margin: 0 !important; + color: var(--coach-text) !important; +} +body.coaching-mvp-active .coach-payment-grid, +body.coaching-mvp-active .coach-payment-grid > .wp-block-group__inner-container { + display: grid !important; + grid-template-columns: repeat(auto-fit, minmax(220px, 1fr)); + gap: 1rem; +} +body.coaching-mvp-active .coach-payment-grid > .wp-block-group__inner-container > * { + margin: 0 !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_item { + display: flex; + flex-direction: column; + gap: .9rem; + min-height: 100%; + margin: 0 !important; + padding: clamp(1.2rem, 2.2vw, 1.45rem) !important; + background: var(--coach-surface) !important; + border: 1px solid var(--coach-border) !important; + border-radius: 8px !important; + box-shadow: none !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_item_top { + display: block !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_item_thumbnail, +body.coaching-mvp-active .coach-payment-grid .asp_under_price_line, +body.coaching-mvp-active .coach-payment-grid .asp_product_description:empty, +body.coaching-mvp-active .coach-payment-grid .asp_product_item > div[style*="clear:both"] { + display: none !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_name { + margin: 0 !important; + color: var(--coach-text) !important; + font-size: clamp(1.14rem, 1.8vw, 1.34rem) !important; + line-height: 1.18 !important; + font-weight: 600 !important; + letter-spacing: -.02em !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_price_container { + margin-top: auto; + padding-top: .25rem; +} +body.coaching-mvp-active .coach-payment-grid .asp_price_amount { + display: inline-block; + color: var(--coach-text) !important; + font-size: clamp(1.75rem, 3vw, 2.2rem) !important; + line-height: 1 !important; + font-weight: 700 !important; + letter-spacing: -.04em !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_buy_button { + margin-top: .1rem; +} +body.coaching-mvp-active .coach-payment-grid .asp_all_buttons_container, +body.coaching-mvp-active .coach-payment-grid .asp_product_buy_btn_container { + width: 100%; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_buy_btn { + width: 100%; + min-height: 48px; + padding: .85rem 1rem !important; + border-radius: 6px !important; + border: 1px solid var(--coach-border) !important; + background: var(--color-button-secondary-bg) !important; + color: var(--color-button-secondary-text) !important; + box-shadow: none !important; + font-weight: 600 !important; + transition: border-color .16s ease, background-color .16s ease, color .16s ease, opacity .16s ease !important; +} +body.coaching-mvp-active .coach-payment-grid .asp_product_buy_btn:hover, +body.coaching-mvp-active .coach-payment-grid .asp_product_buy_btn:focus-visible { + background: var(--color-button-secondary-hover-bg) !important; + border-color: var(--coach-border) !important; + color: var(--coach-text) !important; +} +@media (max-width: 781px) { + body.coaching-mvp-active .coach-payment-section { + padding: 1rem !important; + } + body.coaching-mvp-active .coach-payment-grid, + body.coaching-mvp-active .coach-payment-grid > .wp-block-group__inner-container { + grid-template-columns: 1fr; + } +} +CSS; + + wp_add_inline_style('coach-payment-cards', $css); +}, 30); diff --git a/wp-content/plugins/stripe-payments/accept-stripe-payments.php b/wp-content/plugins/stripe-payments/accept-stripe-payments.php new file mode 100644 index 0000000..747a0a6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/accept-stripe-payments.php @@ -0,0 +1,104 @@ + + + + + + + + + + + \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/admin/assets/css/index.php b/wp-content/plugins/stripe-payments/admin/assets/css/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/assets/css/index.php @@ -0,0 +1 @@ + { + props.setAttributes({ prodId: value }); + }, + }) + ), + el(InspectorControls, {}, + el(ToggleControl, { + label: aspBlockProdStr.button_only, + help: aspBlockProdStr.button_only_help, + checked: props.attributes.btnOnly, + onChange: (state) => { + props.setAttributes({ btnOnly: state }); + }, + }) + ), + ]; + }, + + save: function () { + return null; + }, +}); \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/admin/assets/js/edit-product.js b/wp-content/plugins/stripe-payments/admin/assets/js/edit-product.js new file mode 100644 index 0000000..ad87e29 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/assets/js/edit-product.js @@ -0,0 +1,313 @@ +/* global jQuery, aspEditProdData, aspTaxVarData, aspShippingVarData */ + +jQuery(document).ready(function ($) { + var aspVariationsGroups = aspEditProdData.varGroups; + var aspVariationsNames = aspEditProdData.varNames; + var aspVariationsPrices = aspEditProdData.varPrices; + var aspVariationsUrls = aspEditProdData.varUrls; + var aspVariationsOpts = aspEditProdData.varOpts; + var aspVariationsGroupsId = 0; + var aspVariationsVarId = 0; + + function asp_variations_get_type(groupId) { + var varType = 0; + if (typeof aspVariationsOpts[groupId] !== 'undefined') { + if (typeof aspVariationsOpts[groupId] === 'object') { + varType = aspVariationsOpts[groupId].type; + } else { + varType = aspVariationsOpts[groupId]; + } + } + return varType; + } + + function asp_create_variations_group(aspGroupId, groupName, focus) { + $('span.asp-variations-no-variations-msg').hide(); + var tpl_html = $('div.asp-html-tpl-variations-group').html(); + tpl_html = $.parseHTML(tpl_html); + $(tpl_html).find('input.asp-variations-group-name').attr('name', 'asp-variations-group-names[' + aspGroupId + ']'); + $(tpl_html).find('input.asp-variations-group-name').val(groupName); + var displayType = asp_variations_get_type(aspGroupId); + + $(tpl_html).find('select.asp-variations-display-type').attr('name', 'asp-variations-opts[' + aspGroupId + '][type]'); + $(tpl_html).find('select.asp-variations-display-type').val(displayType); + $(tpl_html).closest('div.asp-variations-group-cont').attr('data-asp-group-id', aspGroupId); + $('div#asp-variations-cont').append(tpl_html); + if (focus) { + asp_add_variation(aspGroupId, '', 0, '', false); + $(tpl_html).find('input.asp-variations-group-name').focus(); + } + } + function asp_add_variation(aspGroupId, variationName, variationPrice, variationUrl, focus) { + var tpl_html = $('table.asp-html-tpl-variation-row tbody').html(); + tpl_html = $.parseHTML(tpl_html); + $(tpl_html).find('input.asp-variation-name').attr('name', 'asp-variation-names[' + aspGroupId + '][]'); + $(tpl_html).find('input.asp-variation-name').val(variationName); + $(tpl_html).find('input.asp-variation-price').attr('name', 'asp-variation-prices[' + aspGroupId + '][]'); + $(tpl_html).find('input.asp-variation-price').val(variationPrice); + $(tpl_html).find('input.asp-variation-url').attr('name', 'asp-variation-urls[' + aspGroupId + '][]'); + $(tpl_html).find('input.asp-variation-url').val(variationUrl); + + var var_opt_tpl = $('div.asp-html-tpl-variation-options-2').html(); + var_opt_tpl = var_opt_tpl.replace(/%_group_id_%/g, aspGroupId); + var_opt_tpl = $.parseHTML(var_opt_tpl); + $(var_opt_tpl).find('input').prop('disabled', false); + $(tpl_html).find('input.asp-variation-name').after(var_opt_tpl); + + $('div.asp-variations-group-cont[data-asp-group-id="' + aspGroupId + '"]').find('table.asp-variations-tbl').append(tpl_html); + + var varType = $(tpl_html).closest('.asp-variations-group-cont').find('select.asp-variations-display-type').val(); + $(tpl_html).closest('.asp-variations-group-cont').find('div[data-asp-var-type="' + varType + '"]').show(); + + if (focus) { + $(tpl_html).find('input.asp-variation-name').focus(); + } else { + if (varType === '2') { + if (aspVariationsOpts[aspGroupId][aspVariationsVarId]['checked'] === '1') { + $(var_opt_tpl).find('input[type="checkbox"]').prop('checked', true); + $(var_opt_tpl).find('input[type="checkbox"]').trigger('change'); + } + } + } + } + $('button#asp-create-variations-group-btn').click(function (e) { + e.preventDefault(); + asp_create_variations_group(aspVariationsGroupsId, '', true); + aspVariationsGroupsId++; + }); + $(document).on('click', 'button.asp-variations-delete-group-btn', function (e) { + e.preventDefault(); + if (!confirm(aspEditProdData.str.groupDeleteConfirm)) { + return false; + } + $(this).closest('div.asp-variations-group-cont').remove(); + if ($('div.asp-variations-group-cont').length <= 1) { + $('span.asp-variations-no-variations-msg').show(); + } + }); + $(document).on('click', 'button.asp-variations-delete-variation-btn', function (e) { + e.preventDefault(); + if (!confirm(aspEditProdData.str.varDeleteConfirm)) { + return false; + } + + const variationTable = $(this).closest('table'); + + $(this).closest('tr').remove(); + + // Check if it was the last variation item. If so, remove the variation group as well. + if (variationTable.children('tr').length < 1) { + variationTable.closest('.asp-variations-group-cont').remove(); + } + }); + $(document).on('click', 'button.asp-variations-add-variation-btn', function (e) { + e.preventDefault(); + var aspGroupId = $(this).closest('div.asp-variations-group-cont').data('asp-group-id'); + asp_add_variation(aspGroupId, '', 0, '', true); + }); + $(document).on('click', 'button.asp-variations-select-from-ml-btn', function (e) { + e.preventDefault(); + var asp_selectVarFile = wp.media({ + title: 'Select File', + button: { + text: 'Insert' + }, + multiple: false + }); + var buttonEl = $(this); + asp_selectVarFile.open(); + asp_selectVarFile.on('select', function () { + var attachment_var = asp_selectVarFile.state().get('selection').first().toJSON(); + $(buttonEl).closest('tr').children().find('input.asp-variation-url').val(attachment_var.url); + }); + return false; + }); + $(document).on('change', 'input.asp-variations-opts-checked', function (e) { + $(this).siblings('input.asp-variations-opts-checked-hidden').attr('disabled', $(this).prop('checked')); + }); + $(document).on('change', 'select.asp-variations-display-type', function (e) { + $(this).closest('.asp-variations-group-cont').find('div[data-asp-var-type]').hide(); + $(this).closest('.asp-variations-group-cont').find('div[data-asp-var-type="' + $(this).val() + '"]').show(); + }); + + if (aspVariationsGroups.length !== 0) { + $.each(aspVariationsGroups, function (index, item) { + aspVariationsGroupsId = index; + asp_create_variations_group(index, item, false); + if (aspVariationsNames !== null) { + aspVariationsVarId = 0; + $.each(aspVariationsNames[index], function (index, item) { + asp_add_variation(aspVariationsGroupsId, item, aspVariationsPrices[aspVariationsGroupsId][index], aspVariationsUrls[aspVariationsGroupsId][index], false); + aspVariationsVarId++; + }); + } + }); + aspVariationsGroupsId++; + } + $('input[name="asp_product_collect_billing_addr"]').change(function () { + var checked = $(this).is(':checked'); + $('input[data-addr-radio="1"]').prop('disabled', !checked); + }); + + $('a.wp-asp-product-menu-nav-item').on('click', function (e) { + e.preventDefault(); + if ($(this).hasClass('nav-tab-active')) { + if (!$('#wp-asp-product-settings-menu-icon').is(':visible')) { + return false; + } + $('#wp-asp-product-settings-menu-icon').click(); + return; + } + if ($('#wp-asp-product-settings-menu-icon').hasClass('menu-visible')) { + $('#wp-asp-product-settings-menu-icon').click(); + } + var itemId = $(this).data('asp-nav-item'); + $('.wp-asp-product-tab-item').removeClass('wp-asp-product-tab-item-visible'); + $('#' + itemId).addClass('wp-asp-product-tab-item-visible'); + $('a.wp-asp-product-menu-nav-item').removeClass('nav-tab-active'); + $(this).addClass('nav-tab-active'); + + }); + + $('#wp-asp-product-settings-menu-icon').on('click', function (e) { + if ($(this).hasClass('menu-visible')) { + $('a.wp-asp-product-menu-nav-item').css('display', 'none'); + $(this).find('span').removeClass('dashicons-menu-alt').addClass('dashicons-menu'); + $(this).removeClass('menu-visible'); + } else { + $(this).addClass('menu-visible'); + $(this).find('span').removeClass('dashicons-menu').addClass('dashicons-menu-alt'); + $('a.wp-asp-product-menu-nav-item').css('display', 'block'); + } + }); + + var aspPriceInputChange = function () { + $('input[name="asp_product_hide_amount_input"]').prop('disabled', !($(this).val() == 0)); + }; + + $('input[name="asp_product_price"]').on('change', aspPriceInputChange); + $('input[name="asp_product_price"]').on('keyup', aspPriceInputChange); + + $('input[name="asp_product_price"]').trigger('change'); + + $('input[name="asp_product_type_radio"]').on('change', function (e) { + aspProductTypeChange(this.value); + }); + aspProductTypeChange($('input[name="asp_product_type_radio"]:checked').val()); + + $('input[name="asp_use_other_stripe_acc"]').on('change', function (e) { + $('input[data-asp-other-acc]').prop('disabled', !this.checked); + }); + $('input[name="asp_use_other_stripe_acc"]').trigger('change'); + + $('input[name="asp_product_enable_stock"]').on('change', function (e) { + $('input[name="asp_product_show_remaining_items"]').prop('disabled', !this.checked); + }); + $('input[name="asp_product_enable_stock"]').trigger('change'); + + function aspProductTypeChange(val) { + if (val === 'subscription') { + $('.asp-other-stripe-acc').hide(); + if (aspTaxVarData.disabledForSub) { + jQuery('#wp-asp-tax-variations-cont').hide(); + jQuery('#wp-asp-tax-variations-disabled-msg').show(); + } + } else { + $('.asp-other-stripe-acc').show(); + if (aspTaxVarData.disabledForSub) { + jQuery('#wp-asp-tax-variations-cont').show(); + jQuery('#wp-asp-tax-variations-disabled-msg').hide(); + } + } + } + + jQuery('#wp-asp-tax-variations-add-btn').click(function (e) { + e.preventDefault(); + var tplLine = aspTaxVarData.tplLine; + tplLine = tplLine.replaceAll('%1$s', aspTaxVarData.cOpts); + tplLine = tplLine.replaceAll('%2$s', 0); + tplLine = tplLine.replaceAll('%4$s', 'display:none;'); + tplLine = tplLine.replaceAll('%5$s', 'display:none;'); + tplLine = tplLine.replaceAll('%7$s', 'disabled'); + tplLine = tplLine.replaceAll('%8$s', 'disabled'); + tplLine = tplLine.replaceAll(/%[0-9]*\$s/g, ''); + var tplLineHide = jQuery(tplLine).css('display', 'none'); + jQuery('#wp-asp-tax-variations-tbl').find('tbody').append(tplLineHide); + jQuery('#wp-asp-tax-variations-tbl').show(); + tplLineHide.fadeIn(200); + }); + + jQuery('#wp-asp-tax-variations-tbl').on('click', 'button.wp-asp-tax-variations-del-btn', function (e) { + e.preventDefault(); + if (confirm(aspTaxVarData.str.delConfirm)) { + jQuery(this).closest('tr').fadeOut(300, function () { jQuery(this).remove(); }); + + // Check if the variation table gets empty. If so, hide the table. + const tableBody = jQuery('#wp-asp-tax-variations-tbl tbody tr'); + if(tableBody.length < 2){ + jQuery('#wp-asp-tax-variations-tbl').fadeOut(300); + } + } + }); + + jQuery('#wp-asp-tax-variations-tbl').on('change', 'select.wp-asp-tax-variation-base', function (e) { + var selBase = jQuery(this).val(); + jQuery(this).closest('tr').find('div').hide(); + jQuery(this).closest('tr').find('div').find('input,select').prop('disabled', true); + jQuery(this).closest('tr').find('.wp-asp-tax-variation-cont-type-' + selBase).show(); + jQuery(this).closest('tr').find('.wp-asp-tax-variation-cont-type-' + selBase).find('input,select').prop('disabled', false); + }); + + jQuery('#wp-asp-shipping-variations-add-btn').click(function (e) { + e.preventDefault(); + var tplLine = aspShippingVarData.tplLine; + tplLine = tplLine.replaceAll('%1$s', aspShippingVarData.cOpts); + tplLine = tplLine.replaceAll('%2$s', 0); + tplLine = tplLine.replaceAll('%4$s', 'display:none;'); + tplLine = tplLine.replaceAll('%5$s', 'display:none;'); + tplLine = tplLine.replaceAll('%7$s', 'disabled'); + tplLine = tplLine.replaceAll('%8$s', 'disabled'); + tplLine = tplLine.replaceAll(/%[0-9]*\$s/g, ''); + var tplLineHide = jQuery(tplLine).css('display', 'none'); + jQuery('#wp-asp-shipping-variations-tbl').find('tbody').append(tplLineHide); + jQuery('#wp-asp-shipping-variations-tbl').show(); + tplLineHide.fadeIn(200); + }); + + jQuery('#wp-asp-shipping-variations-tbl').on('click', 'button.wp-asp-shipping-variations-del-btn', function (e) { + e.preventDefault(); + if (confirm(aspShippingVarData.str.delConfirm)) { + jQuery(this).closest('tr').fadeOut(300, function () { jQuery(this).remove(); }); + + // Check if the variation table gets empty. If so, hide the table. + const tableBody = jQuery('#wp-asp-shipping-variations-tbl tbody tr'); + if(tableBody.length < 2){ + jQuery('#wp-asp-shipping-variations-tbl').fadeOut(300); + } + } + }); + + jQuery('#wp-asp-shipping-variations-tbl').on('change', 'select.wp-asp-shipping-variation-base', function (e) { + var selBase = jQuery(this).val(); + jQuery(this).closest('tr').find('div').hide(); + jQuery(this).closest('tr').find('div').find('input,select').prop('disabled', true); + jQuery(this).closest('tr').find('.wp-asp-shipping-variation-cont-type-' + selBase).show(); + jQuery(this).closest('tr').find('.wp-asp-shipping-variation-cont-type-' + selBase).find('input,select').prop('disabled', false); + }); +}); + +document.addEventListener('DOMContentLoaded', function () { + const auth_only_checkbox = document.getElementById('asp_product_authorize_only_checkbox'); + const extended_authorization_checkbox = document.getElementById('asp_product_extended_authorization_checkbox'); + if (!auth_only_checkbox || !extended_authorization_checkbox){ + return; + } + + auth_only_checkbox.addEventListener('change', function () { + if (auth_only_checkbox.checked){ + extended_authorization_checkbox.disabled = false; + } else { + extended_authorization_checkbox.disabled = true; + } + }) +}) diff --git a/wp-content/plugins/stripe-payments/admin/assets/js/index.php b/wp-content/plugins/stripe-payments/admin/assets/js/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/assets/js/index.php @@ -0,0 +1 @@ +'); + var ajax_action = 'asp_order_capture_' + action; + var req = jQuery.ajax({ + url: ajaxurl, + type: 'post', + data: { action: ajax_action, 'order_id': order_id, 'nonce': nonce } + }); + req.done(function (data) { + console.log(data); + if (data.success) { + } else { + alert(data.err_msg); + } + status_td.html(status_html); + if (data.order_status) { + console.log(data.order_status); + status_td.html(data.order_status); + } + }); + req.fail(function (data) { + alert(aspOrdersVars.str.errorOccurred); + status_td.html(status_html); + }); + } + }); +}); \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/admin/assets/js/settings.js b/wp-content/plugins/stripe-payments/admin/assets/js/settings.js new file mode 100644 index 0000000..16ac66b --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/assets/js/settings.js @@ -0,0 +1,99 @@ +var wp_asp_urlHash = window.location.hash.substr(1); +var wp_asp_transHash = aspSettingsData.transHash; + +var wp_asp_currencies = aspSettingsData.currencies; + +if (wp_asp_urlHash === '') { + if (wp_asp_transHash !== '') { + wp_asp_urlHash = wp_asp_transHash; + } else { + wp_asp_urlHash = 'general'; + } +} +jQuery(function ($) { + var wp_asp_activeTab = ""; + $('div.asp-settings-spinner-container').remove(); + $('a.nav-tab').click(function (e) { + if ($(this).attr('data-tab-name') !== wp_asp_activeTab) { + $('div.wp-asp-tab-container[data-tab-name="' + wp_asp_activeTab + '"]').hide(); + $('a.nav-tab[data-tab-name="' + wp_asp_activeTab + '"]').removeClass('nav-tab-active'); + wp_asp_activeTab = $(this).attr('data-tab-name'); + $('div.wp-asp-tab-container[data-tab-name="' + wp_asp_activeTab + '"]').show(); + $(this).addClass('nav-tab-active'); + $('input#wp-asp-urlHash').val(wp_asp_activeTab); + if (window.location.hash !== wp_asp_activeTab) { + window.location.hash = wp_asp_activeTab; + } + } + }); + + $('.wp-asp-curr-sel-all-btn').click(function (e) { + e.preventDefault(); + $('.wp-asp-allowed-currencies').find('input[type="checkbox"]').prop('checked', true); + }); + $('.wp-asp-curr-sel-none-btn').click(function (e) { + e.preventDefault(); + $('.wp-asp-allowed-currencies').find('input[type="checkbox"]').prop('checked', false); + }); + $('.wp-asp-curr-sel-invert-btn').click(function (e) { + e.preventDefault(); + $('.wp-asp-allowed-currencies').find('input[type="checkbox"]').each(function (ind, el) { + $(el).prop('checked', !$(el).prop('checked')); + }); + }); + + $('select[name="AcceptStripePayments-settings[custom_field_type]"]').change(function () { + if ($(this).val() === 'text') { + $(this).parents('tr').next().show(); + } else { + $(this).parents('tr').next().hide(); + } + }); + + $('select[name="AcceptStripePayments-settings[custom_field_validation]"]').change(function () { + if ($(this).val() === 'custom') { + $('div.wp-asp-custom-field-validation-custom-input-cont').show(); + } else { + $('div.wp-asp-custom-field-validation-custom-input-cont').hide(); + } + }); + + $('#asp_clear_log_btn').click(function (e) { + e.preventDefault(); + if (confirm(aspSettingsData.str.logClearConfirm)) { + var req = jQuery.ajax({ + url: ajaxurl, + type: "post", + data: { action: "asp_clear_log", nonce: aspSettingsData.asp_settings_ajax_nonce } + }); + req.done(function (data) { + if (data === '1') { + alert(aspSettingsData.str.logCleared); + } else { + alert(aspSettingsData.str.errorOccured + ' ' + data); + } + }); + } + }); + + $('#wp_asp_curr_code').change(function () { + $('#wp_asp_curr_symb').val(wp_asp_currencies[$('#wp_asp_curr_code').val()][1]); + }); + + $('input[name="AcceptStripePayments-settings[captcha_type]"]').change(function () { + $('[data-captcha-section]').slideUp('fast'); + if (($(this).val())) { + $('div[data-captcha-section="' + $(this).val() + '"]').slideDown('fast'); + } + }); + + $('#wp_asp_curr_code').change(); + + $('select[name="AcceptStripePayments-settings[custom_field_validation]"]').change(); + + $('select[name="AcceptStripePayments-settings[custom_field_type]"]').change(); + + $('a.nav-tab[data-tab-name="' + wp_asp_urlHash + '"]').trigger('click'); + + $('div.wp-asp-settings-cont').show(); +}); diff --git a/wp-content/plugins/stripe-payments/admin/assets/js/tinymce/asp_editor_plugin.js b/wp-content/plugins/stripe-payments/admin/assets/js/tinymce/asp_editor_plugin.js new file mode 100644 index 0000000..64d64b2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/assets/js/tinymce/asp_editor_plugin.js @@ -0,0 +1,214 @@ +var aspVarsData = {}; +aspVarsData.dataReceived = false; + +function asp_show_tab(tabid) { + jQuery('[data-tabid]').hide(); + jQuery('[data-tabid=' + tabid + ']').show(); + jQuery('a[data-switch-to-tab]').removeClass('nav-tab-active'); + jQuery('a[data-switch-to-tab="' + tabid + '"]').addClass('nav-tab-active'); +} + +function asp_shortcode_type_button_handler() { + jQuery('#asp-shortcode-type-container').hide(); + jQuery('#' + jQuery(this).attr('data-asp-display')).show(); +} + +function asp_get_content_and_settings() { +// Run an ajax call to the main.php to get all current CPT items + if (aspVarsData.dataReceived === false) { + jQuery.post( + asp_admin_ajax_url, + { + action: 'asp_tinymce_get_settings' + }, + function (response) { + if (response) { // ** If response was successful + aspVarsData.dataReceived = true; + var res = JSON.parse(response); + jQuery('#asp-tinymce-container').append(res.content); + if (res.products_sel === '') { + jQuery('#asp_product_select').hide(); + jQuery('#asp_product_select').siblings('p').hide(); + jQuery('#asp-error-no-products').show(); + jQuery('#asp-tinymce-product-submit').attr('disabled', true); + } else { + jQuery('#asp_product_select').append(res.products_sel); + } + jQuery('#asp_currency').append(res.currency_opts); + //bind shortcode select button click event + jQuery('button.asp-sc-type-sel-btn').on('click', asp_shortcode_type_button_handler); + //bind event to tab buttons click + jQuery('a[data-switch-to-tab]').on('click', asp_tab_click_handler); + // handles the click event of the submit button + jQuery('#asp-tinymce-submit').on('click', asp_form_submit_hanlder); + // habdles the click event of the product submit button + + jQuery('#asp-tinymce-product-submit').on('click', asp_product_submit_handler); + asp_show_tab(1); + + } else { // ** Else response was unsuccessful + alert('Stripe Payments Button AJAX Error! Please deactivate the plugin to permanently dismiss this alert.'); + } + } + ); + } +} + +(function () { + + tinymce.create('tinymce.plugins.aspShortcode', { + /** + * Initializes the plugin, this will be executed after the plugin has been created. + * This call is done before the editor instance has finished it's initialization so use the onInit event + * of the editor instance to intercept that event. + * + * @param {tinymce.Editor} ed Editor instance that the plugin is initialized in. + * @param {string} url Absolute URL to where the plugin is located. + */ + init: function (ed, url) { + ed.addButton('asp_shortcode', { + icon: 'asp-shortcode-icon', + tooltip: 'Stripe Payments Shortcode', + cmd: 'asp_shortcode' + }); + ed.addCommand('asp_shortcode', function () { + + // bind event on modal close + jQuery(window).one('tb_unload', function () { + jQuery('#asp-tinymce-container').html(''); + aspVarsData.dataReceived = false; + }); + var width = jQuery(window).width(), + H = jQuery(window).height(), + W = (720 < width) ? 720 : width; + // W = W - 80; + H = H - 84; + asp_get_content_and_settings(); + tb_show('Stripe Payments Insert Shortcode', '#TB_inline?width=' + W + '&height=' + H + '&inlineId=asp-highlight-form'); + }); + }, + /** + * Creates control instances based in the incomming name. This method is normally not + * needed since the addButton method of the tinymce.Editor class is a more easy way of adding buttons + * but you sometimes need to create more complex controls like listboxes, split buttons etc then this + * method can be used to create those. + * + * @param {String} n Name of the control to create. + * @param {tinymce.ControlManager} cm Control manager to use inorder to create new control. + * @return {tinymce.ui.Control} New control instance or null if no control was created. + */ + createControl: function (n, cm) { + return null; + }, + /** + * Returns information about the plugin as a name/value array. + * The current keys are longname, author, authorurl, infourl and version. + * + * @return {Object} Name/value array containing information about the plugin. + */ + getInfo: function () { + return { + longname: 'Simple Stripe Payment Button', + author: 'Tips and Tricks HQ', + authorurl: 'http://www.tipsandtricks-hq.com/development-center', + infourl: 'https://www.tipsandtricks-hq.com/ecommerce/wordpress-stripe-plugin-accept-payments-using-stripe', + version: "1.0" + }; + } + }); + // Register plugin + tinymce.PluginManager.add('asp_shortcode', tinymce.plugins.aspShortcode); +})(); + +function asp_tab_click_handler(e) { + e.preventDefault(); + asp_show_tab(jQuery(this).data('switch-to-tab')); +} + +function asp_product_submit_handler() { + var product_id = jQuery('#asp_product_select').val(); + var shortcode = '[asp_product id="' + product_id + '"]'; + // inserts the shortcode into the active editor + tinyMCE.activeEditor.execCommand('mceInsertContent', 0, shortcode); // Send processed shortcode to editor +// close WP thickbox window + tb_remove(); +} + +function asp_form_submit_hanlder() { + + var name = jQuery('#asp_name').val(); + var price = jQuery('#asp_price').val(); + var currency = jQuery('#asp_currency').val(); + var quantity = jQuery('#asp_quantity').val(); + var url = jQuery('#asp_url').val(); + var thankyou_page_url = jQuery('#asp_thankyou_page_url').val(); + var description = jQuery('#asp_description').val(); + var button_text = jQuery('#asp_button_text').val(); + var item_logo = jQuery('#asp_item_logo').val(); + var billing_address = jQuery('#asp_billing_address').is(':checked'); + var shipping_address = jQuery('#asp_shipping_address').is(':checked'); + var css_class = jQuery('#asp_css_class').val(); + //Build the shortcode with parameters according to the options + var shortcode = '[accept_stripe_payment'; + //Add the fancy parameter to the shortcode (if needed + if (name != '') { + shortcode += ' name="' + name + '"'; + } else { + jQuery('#asp_form_err').html('* You must specify item name.'); + return false; + } + + if (price != '') { + shortcode += ' price="' + price + '"'; + } + + if (currency != '') { + shortcode += ' currency="' + currency + '"'; + } + if (quantity != '') { + shortcode += ' quantity="' + quantity + '"'; + } + + if (url != '') { + shortcode += ' url="' + url + '"'; + } + + if (thankyou_page_url != '') { + shortcode += ' thankyou_page_url="' + thankyou_page_url + '"'; + } + + if (description != '') { + shortcode += ' description="' + description + '"'; + } + + if (button_text != '') { + shortcode += ' button_text="' + button_text + '"'; + } + if (item_logo != '') { + shortcode += ' item_logo="' + item_logo + '"'; + } + if (billing_address) { + shortcode += ' billing_address="1"'; + } + if (shipping_address) { + shortcode += ' shipping_address="1"'; + } + if (css_class != '') { + shortcode += ' class="' + css_class + '"'; + } + shortcode = shortcode + ']';//End the shortcode + +// inserts the shortcode into the active editor + tinyMCE.activeEditor.execCommand('mceInsertContent', 0, shortcode); // Send processed shortcode to editor +// close WP thickbox window + tb_remove(); +} + +jQuery(function () { + + // Instantiate a form in the wp thickbox window (hidden at start) + var form = jQuery('
'); + + form.appendTo('body').hide(); // Hide form + +}); \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/admin/class-asp-admin.php b/wp-content/plugins/stripe-payments/admin/class-asp-admin.php new file mode 100644 index 0000000..c6fa6ad --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/class-asp-admin.php @@ -0,0 +1,2177 @@ +plugin_slug = $plugin->get_plugin_slug(); + $this->asp_main = $plugin; + + // add_action( 'admin_enqueue_scripts', array( $this, 'enqueue_admin_scripts' ) ); + // Add the options page and menu item. + add_action( 'admin_menu', array( $this, 'add_plugin_admin_menu' ) ); + + //Enqueue required scripts and styles + add_action( 'admin_enqueue_scripts', array( $this, 'enqueue_scripts' ) ); + + //Add any required inline JS code in the admin dashboard side. + add_action( 'admin_print_scripts', array( $this, 'asp_print_admin_scripts' ) ); + + add_action( 'admin_init', array( $this, 'admin_init' ) ); + + add_action( 'admin_notices', array( $this, 'show_admin_notices' ), 1 ); + + //TinyMCE button related + add_action( 'init', array( $this, 'tinymce_shortcode_button' ) ); + add_action( 'current_screen', array( $this, 'check_current_screen' ) ); + add_action( 'wp_ajax_asp_tinymce_get_settings', array( $this, 'tinymce_ajax_handler' ) ); // Add ajax action handler for tinymce + //Settings link + add_filter( 'plugin_action_links_' . plugin_basename( WP_ASP_PLUGIN_FILE ), array( $this, 'add_settings_link' ) ); + } + + public function add_settings_link( $links ) { + $settings_link = sprintf( '', ASPMain::$products_slug ) . __( 'Settings', 'stripe-payments' ) . ''; + array_unshift( $links, $settings_link ); + return $links; + } + + function enqueue_scripts( $hook ) { + //this script is requested on all plugin admin pages + wp_register_script( 'asp-admin-general-js', WP_ASP_PLUGIN_URL . '/admin/assets/js/admin.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + //include admin style + wp_register_style( 'asp-admin-styles', WP_ASP_PLUGIN_URL . '/admin/assets/css/admin.css', array(), WP_ASP_PLUGIN_VERSION ); + + switch ( $hook ) { + case ASPMain::$products_slug . '_page_stripe-payments-settings': + case ASPMain::$products_slug . '_page_stripe-payments-addons': + //settings page + wp_register_script( 'asp-admin-settings-js', WP_ASP_PLUGIN_URL . '/admin/assets/js/settings.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + wp_enqueue_script( 'asp-admin-general-js' ); + wp_enqueue_style( 'asp-admin-styles' ); + break; + case 'post.php': + case 'edit.php': + case 'post-new.php': + global $post_type; + if ( ASPMain::$products_slug === $post_type ) { + wp_enqueue_script( 'asp-admin-general-js' ); + wp_enqueue_style( 'asp-admin-styles' ); + wp_register_script( 'asp-admin-edit-product-js', WP_ASP_PLUGIN_URL . '/admin/assets/js/edit-product.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + } + + if ( 'stripe_order' === $post_type ) { + wp_enqueue_script( 'asp-admin-general-js' ); + wp_enqueue_style( 'asp-admin-styles' ); + //Confirm capturing authorized funds for order #%s + wp_register_script( 'asp-admin-orders-js', WP_ASP_PLUGIN_URL . '/admin/assets/js/orders.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + wp_localize_script( + 'asp-admin-orders-js', + 'aspOrdersVars', + array( + 'str' => array( + // translators: %s is order ID + 'confirmCapture' => __( 'Confirm capturing authorized funds for order #%s', 'stripe-payments' ), + // translators: %s is order ID + 'confirmCancel' => __( 'Confirm cancel authorized funds for order #%s', 'stripe-payments' ), + 'errorOccurred' => __( 'Error occurred during request. Please refresh page and try again.', 'stripe-payments' ), + ), + ) + ); + wp_enqueue_script( 'asp-admin-orders-js' ); + + wp_register_style( 'asp-admin-orders-styles', WP_ASP_PLUGIN_URL . '/admin/assets/css/orders.css', array(), WP_ASP_PLUGIN_VERSION ); + wp_enqueue_style( 'asp-admin-orders-styles' ); + + wp_register_style( 'asp-admin-balloon-css', WP_ASP_PLUGIN_URL . '/admin/assets/css/balloon.min.css', array(), WP_ASP_PLUGIN_VERSION ); + wp_enqueue_style( 'asp-admin-balloon-css' ); + } + break; + } + } + + function show_admin_notices() { + //check minimum add-ons versions + // translators: %s is add-on name + $addon_update_str = __( 'Please update %s to latest version.', 'stripe-payments' ); + //check minimum Subscriptions add-on version + $addon_name = 'Stripe Payments Subscriptions Addon'; + if ( class_exists( 'ASPSUB_Main' ) && version_compare( ASPSUB_main::ADDON_VER, '2.0.26' ) < 0 ) { + self::add_admin_notice( + 'warning', + sprintf( + $addon_update_str, + '' . $addon_name . '' + ), + false + ); + } + //check minimum APM add-on version + $addon_name = 'Stripe Additional Payment Methods Addon'; + if ( class_exists( 'ASPAPM_main' ) && version_compare( ASPAPM_main::ADDON_VER, '2.0.15' ) < 0 ) { + self::add_admin_notice( + 'warning', + sprintf( + $addon_update_str, + '' . $addon_name . '' + ), + false + ); + } + + $msg_arr = get_transient( 'asp_admin_msg_arr' ); + if ( ! empty( $msg_arr ) ) { + delete_transient( 'asp_admin_msg_arr' ); + $tpl = '

%2$s

'; + foreach ( $msg_arr as $msg ) { + if ( ! empty( $msg ) ) { + echo wp_kses( sprintf( $tpl, $msg['type'], $msg['text'], true === $msg['dism'] ? ' is-dismissible' : '' ), ASP_Utils::asp_allowed_tags() ); + } + } + } + + $notice_dismissed_get = filter_input( INPUT_GET, 'asp_dismiss_new_api_msg', FILTER_SANITIZE_NUMBER_INT ); + if ( $notice_dismissed_get ) { + update_option( 'asp_new_api_notice_dismissed1', true ); + } + + $notice_dismissed_get = filter_input( INPUT_GET, 'asp_dismiss_auc_msg', FILTER_SANITIZE_NUMBER_INT ); + if ( ! empty( $notice_dismissed_get ) && check_admin_referer( 'asp_dismiss_auc_msg' ) ) { + $user_id = get_current_user_id(); + if ( ! empty( $user_id ) ) { + update_user_meta( $user_id, 'asp_dismiss_auc_msg', true ); + wp_safe_redirect( get_admin_url() ); + exit; + } + } + + // Show new API notice + // $opt = get_option( 'AcceptStripePayments-settings' ); + // if ( isset( $opt['use_old_checkout_api1'] ) && $opt['use_old_checkout_api1'] ) { + // $notice_dismissed = get_option( 'asp_new_api_notice_dismissed1' ); + // if ( ! $notice_dismissed ) { + // $tpl = '
%2$s
'; + // $msg = '

The new version of the Stripe Payments plugin has the SCA compliant API support. However, you\'re still using the legacy API.

' . + // 'Click here to check whether your business needs to support Strong Customer Authentication (SCA). If it does, disable legacy API by unchecking the "Enable Legacy Checkout API" checkbox in the Advanced Settings tab of the plugin.

'; + // //here's link to advanced settings tab you can use in the message: + // // advanced settings + // $admin_url = get_admin_url(); + // $dismiss_url = add_query_arg( 'asp_dismiss_new_api_msg', '1', $admin_url ); + // $msg .= '

Don\'t show this message again

'; + // echo wp_kses( sprintf( $tpl, 'warning', $msg, '' ), ASP_Utils::asp_allowed_tags() ); + // } + // } + } + + + static function add_admin_notice( $type, $text, $dism = true ) { + $msg_arr = get_transient( 'asp_admin_msg_arr' ); + $msg_arr = empty( $msg_arr ) ? array() : $msg_arr; + $arr_item = array( + 'type' => $type, + 'text' => $text, + 'dism' => $dism, + ); + + $item_hash = md5( json_encode( $arr_item ) ); + + if ( ! isset( $msg_arr[ $item_hash ] ) ) { + $msg_arr[ $item_hash ] = $arr_item; + set_transient( 'asp_admin_msg_arr', $msg_arr ); + } + + return $item_hash; + } + + static function remove_admin_notice_by_hash( $item_hash ) { + $msg_arr = get_transient( 'asp_admin_msg_arr' ); + $msg_arr = empty( $msg_arr ) ? array() : $msg_arr; + + if ( isset( $msg_arr[ $item_hash ] ) ) { + $msg_arr[ $item_hash ] = ''; + set_transient( 'asp_admin_msg_arr', $msg_arr ); + } + } + + function admin_init() { + if ( current_user_can( ASP_MANAGEMENT_PERMISSION ) ) { + add_action( 'wp_ajax_asp_clear_log', array( 'ASP_Debug_Logger', 'clear_log' ) ); + //view log file + $asp_action = isset( $_GET['asp_action'] ) ? sanitize_text_field( $_GET['asp_action'] ) : ''; + if ( ! empty( $asp_action ) ) { + if ( 'view_log' === $asp_action ) { + //Lets check nonce + check_admin_referer( 'asp_view_log_nonce' ); + + ASP_Debug_Logger::view_log(); + } + } + } + if ( ! wp_doing_ajax() && is_admin() ) { + //check if PHP version meets minimum required + if ( version_compare( PHP_VERSION, WP_ASP_MIN_PHP_VERSION, '<' ) ) { + add_action( 'admin_notices', array( $this, 'add_php_version_notice' ) ); + } + //check if required php modules are installed + $this->check_php_modules(); + + //check if captcha is enabled + $this->check_captcha_settings_and_show_msg(); + } + + //Handle feedback in the admin area. + include_once WP_ASP_PLUGIN_PATH . 'admin/includes/class-asp-admin-user-feedback.php'; + $user_feedback = new ASP_Admin_User_Feedback(); + $user_feedback->init(); + + } + + private function check_captcha_settings_and_show_msg() { + $hide_captcha_disabled_warning = apply_filters('asp_hide_captcha_disabled_warning_notice_in_admin', false); + if ($hide_captcha_disabled_warning){ + return; + } + + $asp_main = AcceptStripePayments::get_instance(); + $captcha_type = $asp_main->get_setting('captcha_type'); + + if ( empty( $captcha_type ) || $captcha_type == 'none' ) { + //Captcha is not enabled. Show warning message. + $msg = __( 'Accept Stripe Payments: the captcha feature is not enabled. ', 'stripe-payments' ); + $msg .= __( 'It is strongly recommended that you enable the captcha feature from the captcha settings tab to prevent bots trying to do card testing.', 'stripe-payments' ); + $msg .= ' ' . __( 'Go to captcha settings', 'stripe-payments' ) . ''; + self::add_admin_notice( 'error', $msg ); + } + } + + private function check_php_modules() { + $missing_modules = array(); + $php_modules = apply_filters( 'asp_required_php_modules_array', $this->requiered_php_modules ); + foreach ( $php_modules as $module ) { + if ( ! extension_loaded( $module ) ) { + $missing_modules[] = $module; + } + } + if ( ! empty( $missing_modules ) ) { + $msg = __( 'Stripe Payments: following extentions are required by the plugin to operate properly but aren\'t installed on your system:', 'stripe-payments' ); + $msg .= '

' . implode( ', ', $missing_modules ) . '

'; + $msg .= '

' . __( 'You need to communicate this information to your system administrator or hosting provider.', 'stripe-payments' ) . '

'; + self::add_admin_notice( 'error', $msg ); + } + } + + public function add_php_version_notice() { + $msg = ''; + $msg .= '

' . __( 'Warning: Stripe Payments plugin', 'stripe-payments' ) . '

'; + $msg .= '

' . __( "PHP version installed on your server doesn't meet minimum required for Stripe Payments plugin to operate properly.", 'stripe-payments' ) . '

'; + $msg .= '

' . __( 'You need to communicate this information to your system administrator or hosting provider.', 'stripe-payments' ) . '

'; + $msg .= '

' . __( 'PHP Version Installed:', 'stripe-payments' ) . ' %s

'; + $msg .= '

' . __( 'PHP Version Required:', 'stripe-payments' ) . ' %s ' . _x( 'or higher.', 'Used in "PHP Version Required: X.X or higher"', 'stripe-payments' ) . '

'; + $msg = sprintf( $msg, PHP_VERSION, WP_ASP_MIN_PHP_VERSION ); + self::add_admin_notice( 'error', $msg, false ); + } + + public function check_current_screen() { + if ( function_exists( 'get_current_screen' ) ) { + $screen = get_current_screen(); + if ( 'post' === $screen->base ) { + //we're on post edit page, let's do some things for shortcode inserter + if ( ! wp_doing_ajax() ) { + // Load admin style sheet + add_action( 'admin_enqueue_scripts', array( $this, 'enqueue_admin_styles' ) ); + } + } + } + } + + public function asp_print_admin_scripts() { + //The following is used by the TinyMCE button. + ?> + + ASPMain::$products_slug, + 'post_status' => 'publish', + 'posts_per_page' => -1, + ) + ); + $products_sel = ''; + + while ( $query->have_posts() ) { + $query->the_post(); + $products_sel .= ''; + } + wp_reset_postdata(); + + $opt = get_option( 'AcceptStripePayments-settings' ); + $ret['button_text'] = $opt['button_text']; + $ret['currency_opts'] = self::get_currency_options(); + $ret['content'] = $content; + $ret['products_sel'] = $products_sel; + echo json_encode( $ret ); + wp_die(); + } + + public function tinymce_shortcode_button() { + + add_filter( 'mce_external_plugins', array( $this, 'add_shortcode_button' ) ); + add_filter( 'mce_buttons', array( $this, 'register_shortcode_button' ) ); + } + + public function add_shortcode_button( $plugin_array ) { + + $plugin_array['asp_shortcode'] = plugins_url( 'assets/js/tinymce/asp_editor_plugin.js', __FILE__ ); + return $plugin_array; + } + + public function register_shortcode_button( $buttons ) { + + $buttons[] = 'asp_shortcode'; + return $buttons; + } + + /** + * Return an instance of this class. + * + * @since 1.0.0 + * + * @return object A single instance of this class. + */ + public static function get_instance() { + + // If the single instance hasn't been set, set it now. + if ( null === self::$instance ) { + self::$instance = new self(); + } + + return self::$instance; + } + + /** + * Register and enqueue admin-specific style sheet. + * + * @since 1.0.0 + * + * @return null Return early if no settings page is registered. + */ + public function enqueue_admin_styles() { + + // if (!isset($this->plugin_screen_hook_suffix)) { + // return; + // } + // + // $screen = get_current_screen(); + // if ($this->plugin_screen_hook_suffix == $screen->id) { + wp_enqueue_style( 'asp-admin-styles' ); + // } + } + + /** + * Register and enqueue admin-specific JavaScript. + * + * @return null Return early if no settings page is registered. + */ + public function enqueue_admin_scripts() { + + if ( ! isset( $this->plugin_screen_hook_suffix ) ) { + return; + } + + $screen = get_current_screen(); + if ( $this->plugin_screen_hook_suffix === $screen->id ) { + wp_enqueue_script( $this->plugin_slug . '-admin-script', plugins_url( 'assets/js/admin.js', __FILE__ ), array( 'jquery' ), AcceptStripePayments::VERSION ); + } + } + + /** + * Register the administration menu for this plugin into the WordPress Dashboard menu. + * + * @since 1.0.0 + */ + public function add_plugin_admin_menu() { + + /* + * Add a settings page for this plugin to the Settings menu. + * + * NOTE: Alternative menu locations are available via WordPress administration menu functions. + * + * Administration Menus: http://codex.wordpress.org/Administration_Menus + * + * @TODO: + * + * - Change 'Page Title' to the title of your plugin admin page + * - Change 'Menu Text' to the text for menu item for the plugin settings page + * - Change 'manage_options' to the capability you see fit + * For reference: http://codex.wordpress.org/Roles_and_Capabilities + */ + //Products submenu + // add_submenu_page( 'edit.php?post_type=stripe_order', __( 'Products', 'stripe-payments' ), __( 'Products', 'stripe-payments' ), ASP_MANAGEMENT_PERMISSION, 'edit.php?post_type=stripe_order', array( $this, 'display_plugin_admin_page' ) ); + //Trigger filter hook to allow overriding of the settings menu capability. + $asp_settings_menu_capability = apply_filters( 'asp_settings_menu_capability', ASP_MANAGEMENT_PERMISSION ); + $this->plugin_screen_hook_suffix = add_submenu_page( + 'edit.php?post_type=' . ASPMain::$products_slug, + __( 'Settings', 'stripe-payments' ), + __( 'Settings', 'stripe-payments' ), + $asp_settings_menu_capability, + 'stripe-payments-settings', + array( $this, 'display_plugin_admin_page' ) + ); + + //Trigger filter hook to allow overriding of the add-ons menu capability. + $asp_addons_menu_capability = apply_filters( 'asp_addons_menu_capability', ASP_MANAGEMENT_PERMISSION ); + add_submenu_page( 'edit.php?post_type=' . ASPMain::$products_slug, __( 'Add-ons', 'stripe-payments' ), __( 'Add-ons', 'stripe-payments' ), $asp_addons_menu_capability, 'stripe-payments-addons', array( $this, 'display_addons_menu_page' ) ); + + add_action( 'admin_init', array( &$this, 'register_settings' ) ); + } + + /** + * Register Admin page settings + * + * @since 1.0.0 + */ + public function register_settings( $value = '' ) { + + register_setting( 'AcceptStripePayments-settings-group', 'AcceptStripePayments-settings', array( &$this, 'settings_sanitize_field_callback' ) ); + + // Add/define the various section/groups (the fields will go under these sections). + + add_settings_section( 'AcceptStripePayments-global-section', __( 'Global Settings', 'stripe-payments' ), null, $this->plugin_slug ); + add_settings_section( 'AcceptStripePayments-credentials-section', __( 'Credentials', 'stripe-payments' ), null, $this->plugin_slug ); + add_settings_section( 'AcceptStripePayments-debug-section', __( 'Debug', 'stripe-payments' ), null, $this->plugin_slug ); + + add_settings_section( 'AcceptStripePayments-email-section', __( 'Email Settings', 'stripe-payments' ), null, $this->plugin_slug . '-email' ); + add_settings_section( 'AcceptStripePayments-error-email-section', __( 'Transaction Error Email Settings', 'stripe-payments' ), null, $this->plugin_slug . '-email' ); + add_settings_section( 'AcceptStripePayments-daily-txn-rate-limit-email-section', __( 'Daily Transaction Rate Limit Email Settings', 'stripe-payments' ), null, $this->plugin_slug . '-email' ); + add_settings_section( 'AcceptStripePayments-additional-email-section', __( 'Additional Email Settings', 'stripe-payments' ), null, $this->plugin_slug . '-email' ); + + add_settings_section( 'AcceptStripePayments-price-display', __( 'Price Display Settings', 'stripe-payments' ), null, $this->plugin_slug . '-advanced' ); + add_settings_section( 'AcceptStripePayments-payment-popup-related', __( 'Payment Popup Related', 'stripe-payments' ), null, $this->plugin_slug . '-advanced' ); + add_settings_section( 'AcceptStripePayments-tos', __( 'Terms and Conditions', 'stripe-payments' ), array( $this, 'tos_description' ), $this->plugin_slug . '-advanced' ); + add_settings_section( 'AcceptStripePayments-custom-field', __( 'Custom Field Settings', 'stripe-payments' ), null, $this->plugin_slug . '-advanced' ); + add_settings_section( 'AcceptStripePayments-additional-settings', __( 'Additional Settings', 'stripe-payments' ), null, $this->plugin_slug . '-advanced' ); + add_settings_section( 'AcceptStripePayments-experimental-settings', __( 'Experimental Settings', 'stripe-payments' ), array( $this, 'experemintal_section_description' ), $this->plugin_slug . '-advanced' ); + + add_settings_section( 'AcceptStripePayments-captcha', __( 'Captcha Settings', 'stripe-payments' ), array( $this, 'captcha_section_description' ), $this->plugin_slug . '-captcha' ); + add_settings_section( 'AcceptStripePayments-txn-rate-limiting', __( 'Transaction Rate Limiting', 'stripe-payments' ), array( $this, 'txn_rate_limiting_section_description' ), $this->plugin_slug . '-txn-rate-limit' ); + + // Global settings section + + //Thank You Page URL + $ty_description = __( 'This is the thank you page. This page is automatically created for you when you install the plugin. Do not delete this page as the plugin will send the customer to this page after the payment. If you have accidentally deleted this page, then re-create it using this documentation.', 'stripe-payments' ); + $ty_description .= '
' . __( 'Important Note: ', 'stripe-payments' ) . ' ' . __( 'If you are using a caching solution on your site (e.g., WP Super Cache), you must exclude this page from caching. Failing to do so can result in unpredictable behavior on the Thank You page.', 'stripe-payments' ); + add_settings_field( + 'checkout_url', + __( 'Checkout Result Page URL', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'checkout_url', + 'desc' => $ty_description, + 'size' => 100, + ) + ); + + //Products Page URL. + add_settings_field( + 'products_page_id', + __( 'Products Page URL', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'products_page_id', + 'desc' => __( 'All your products will be listed here in a grid display. When you create new products, they will show up in this page. This page is automatically created for you when you install the plugin. You can add this page to your navigation menu if you want the site visitors to find it easily.', 'stripe-payments' ), + 'size' => 100, + ) + ); + + //Currency Code. + add_settings_field( + 'currency_code', + __( 'Currency', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'currency_code', + 'desc' => '', + 'size' => 10, + ) + ); + add_settings_field( + 'currency_symbol', + __( 'Currency Symbol', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'currency_symbol', + 'desc' => __( 'Example: $, €, £ etc.', 'stripe-payments' ), + 'size' => 10, + ) + ); + add_settings_field( + 'button_text', + __( 'Button Text', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'button_text', + 'desc' => __( + 'Example: Buy Now, Pay Now etc.', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'popup_button_text', + __( 'Payment Popup Button Text', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'popup_button_text', + 'desc' => __( + '%s is replaced by formatted payment amount (example: Pay $29.90). If this field is empty, it defaults to "Pay %s"', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'dont_save_card', + __( 'Do Not Save Card Data on Stripe', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'dont_save_card', + 'desc' => __( + 'When this checkbox is checked, the transaction won\'t create the customer (no card will be saved for that).', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'disable_remember_me', + __( 'Turn Off "Remember me" Option', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'disable_remember_me', + 'desc' => __( + 'When enabled, "Remember me" checkbox will be removed from Stripe\'s checkout popup.', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'enable_zip_validation', + __( 'Validate ZIP Code', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'enable_zip_validation', + 'desc' => sprintf( + // translators: %s is link to Stripe Radar rules page + __( + 'For additional protection, you can opt to have Stripe collect the billing ZIP code. Make sure that ZIP code verification is turned on for your account. Click here to check it in your Stripe Dashboard.', + 'stripe-payments' + ), + 'https://dashboard.stripe.com/radar/rules' + ), + ) + ); + // add_settings_field( 'use_new_button_method', __( 'Use New Method To Display Buttons', 'stripe-payments' ), array( &$this, 'settings_field_callback' ), $this->plugin_slug, 'AcceptStripePayments-global-section', array( 'field' => 'use_new_button_method', + // 'desc' => __( 'Use new method to display Stripe buttons. It makes connection to Stripe website only when button is clicked, which makes the page with buttons load faster. A little drawback is that Stripe pop-up is displayed with a small delay after button click. If you have more than one button on a page, enabling this option is highly recommended.', 'stripe-payments' ) . '
' . __( 'Note:', 'stripe-payments' ) . ' ' . __( 'old method doesn\'t support custom price and quantity. If your shortcode or product is using one of those features, the new method will be used automatically for that entity.', 'stripe-payments' ) ) ); + add_settings_field( + 'checkout_lang', + __( 'Stripe Checkout Language', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-global-section', + array( + 'field' => 'checkout_lang', + 'desc' => __( + 'Specify language to be used in Stripe checkout pop-up or select "Autodetect" to let Stripe handle it.', + 'stripe-payments' + ) . '
Note this currently only affects "Card Number", "MM/YY" and "CVC" placeholders.', + ) + ); + $country_autodetect_addon_txt = ''; + if ( ! class_exists( 'ASPCOUNTRYAUTODETECT_main' ) ) { + $country_autodetect_addon_txt = sprintf( + // translators: %s is link to Country Autodetect add-on page + '
' . __( 'You can install the free Country Autodetect Addon to detect customer\'s country automatically.', 'stripe-payments' ), + 'https://s-plugins.com/stripe-country-autodetect-addon/' + ); + } + + // Credentials section + add_settings_field( + 'is_live', + __( 'Live Mode', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-credentials-section', + array( + 'field' => 'is_live', + 'desc' => __( + 'Check this to run the transaction in live mode. When unchecked it will run in test mode.', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'api_publishable_key', + __( 'Live Stripe Publishable Key', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-credentials-section', + array( + 'field' => 'api_publishable_key', + 'desc' => '', + ) + ); + add_settings_field( + 'api_secret_key', + __( 'Live Stripe Secret Key', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-credentials-section', + array( + 'field' => 'api_secret_key', + 'desc' => '', + ) + ); + add_settings_field( + 'api_publishable_key_test', + __( 'Test Stripe Publishable Key', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-credentials-section', + array( + 'field' => 'api_publishable_key_test', + 'desc' => '', + ) + ); + add_settings_field( + 'api_secret_key_test', + __( 'Test Stripe Secret Key', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-credentials-section', + array( + 'field' => 'api_secret_key_test', + 'desc' => '', + ) + ); + + //Debug section + add_settings_field( + 'debug_log_enable', + __( 'Enable Debug Logging', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-debug-section', + array( + 'field' => 'debug_log_enable', + 'desc' => __( 'Check this option to enable debug logging. This is useful for troubleshooting post payment failures.', 'stripe-payments' ) . + '
' . __( 'View Log', 'stripe-payments' ) . ' | ' . __( 'Clear Log', 'stripe-payments' ) . '', + ) + ); + add_settings_field( + 'debug_log_link_enable', + __( 'Debug Log Shareable Link', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug, + 'AcceptStripePayments-debug-section', + array( + 'field' => 'debug_log_link_enable', + 'desc' => __( + 'Normally, the debug log is only accessible to you if you are logged-in as admin. However, in some situations it might be required for support personnel to view it without having admin credentials. This link can be helpful in that situation.', + 'stripe-payments' + ), + ) + ); + + // Email section + add_settings_field( + 'stripe_receipt_email', + __( 'Send Receipt Email From Stripe', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'stripe_receipt_email', + 'desc' => __( 'If checked, Stripe will send email receipts to your customers whenever they make successful payment.
Note: Receipts are not sent in test mode.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'send_emails_to_buyer', + __( 'Send Emails to Buyer After Purchase', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'send_emails_to_buyer', + 'desc' => __( 'If checked the plugin will send an email to the buyer with the sale details. If digital goods are purchased then the email will contain the download links for the purchased products.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'buyer_email_type', + __( 'Buyer Email Content Type', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'buyer_email_type', + 'desc' => __( 'Choose which format of email to send.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'from_email_address', + __( 'From Email Address', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'from_email_address', + 'desc' => __( 'Example: Your Name <sales@your-domain.com> This is the email address that will be used to send the email to the buyer. This name and email address will appear in the from field of the email.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'buyer_email_subject', + __( 'Buyer Email Subject', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'buyer_email_subject', + 'desc' => __( 'This is the subject of the email that will be sent to the buyer.', 'stripe-payments' ), + ) + ); + + $email_tags_descr = self::get_email_tags_descr(); + + add_settings_field( + 'buyer_email_body', + __( 'Buyer Email Body', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'buyer_email_body', + 'desc' => __( 'This is the body of the email that will be sent to the buyer.', 'stripe-payments' ) . ' ' . __( 'Do not change the text within the braces {}. You can use the following email tags in this email body field:', 'stripe-payments' ) . $email_tags_descr, + ) + ); + add_settings_field( + 'send_emails_to_seller', + __( 'Send Emails to Seller After Purchase', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'send_emails_to_seller', + 'desc' => __( 'If checked the plugin will send an email to the seller with the sale details.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'seller_notification_email', + __( 'Notification Email Address', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'seller_notification_email', + 'desc' => __( 'This is the email address where the seller will be notified of product sales. You can put multiple email addresses separated by comma (,) in the above field to send the notification to multiple email addresses.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'seller_email_type', + __( 'Seller Email Content Type', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'seller_email_type', + 'desc' => __( 'Choose which format of email to send.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'seller_email_subject', + __( 'Seller Email Subject', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'seller_email_subject', + 'desc' => __( 'This is the subject of the email that will be sent to the seller for record.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'seller_email_body', + __( 'Seller Email Body', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-email-section', + array( + 'field' => 'seller_email_body', + 'desc' => __( 'This is the body of the email that will be sent to the seller.', 'stripe-payments' ) . ' ' . __( 'Do not change the text within the braces {}. You can use the following email tags in this email body field:', 'stripe-payments' ) . $email_tags_descr, + ) + ); + + add_settings_field( + 'send_email_on_error', + __( 'Send Email On Payment Failure', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-error-email-section', + array( + 'field' => 'send_email_on_error', + 'desc' => __( 'If enabled, the plugin will send a notification email whenever an error occurs during payment processing. Please note that automated bots can sometimes trigger these errors. For this reason, it is best to keep this option enabled only while troubleshooting transaction issues on your site.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'send_email_on_error_to', + __( 'Send Error Email To', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-error-email-section', + array( + 'field' => 'send_email_on_error_to', + 'desc' => __( 'Enter the email address where error notifications should be sent.', 'stripe-payments' ), + ) + ); + + //Daily Transaction Rate Limit Email + add_settings_field( + 'send_email_on_daily_txn_rate_limit', + __( 'Send Email On Daily Transaction Rate Limit', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-daily-txn-rate-limit-email-section', + array( + 'field' => 'send_email_on_daily_txn_rate_limit', + 'desc' => __( 'If checked, the plugin will send a notification email if the daily transaction rate limit is reached. This is only applicable if you are not using any captcha option. The email will be sent to the email address specified below.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'send_email_on_daily_txn_rate_limit_to', + __( 'Send Transaction Rate Limit Email To', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-daily-txn-rate-limit-email-section', + array( + 'field' => 'send_email_on_daily_txn_rate_limit_to', + 'desc' => __( 'Enter the recipient address for the rate limit notification email.', 'stripe-payments' ), + ) + ); + + // Additional Email Settings + add_settings_field( + 'enable_email_schedule', + __( 'Send Emails in Parallel', 'stripe-payments' ) , + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-email', + 'AcceptStripePayments-additional-email-section', + array( + 'field' => 'enable_email_schedule', + 'desc' => __( 'This option is not recommended for most sites. Enabling this option can speed up the checkout process for customers. Test this before enabling on production as it may not work properly on some servers.', 'stripe-payments' ), + ) + ); + + // Price Display section + add_settings_field( + 'price_currency_pos', + __( 'Currency Position', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-price-display', + array( + 'field' => 'price_currency_pos', + 'desc' => __( 'This controls the position of the currency symbol.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'price_decimal_sep', + __( 'Decimal Separator', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-price-display', + array( + 'field' => 'price_decimal_sep', + 'desc' => __( 'This sets the decimal separator of the displayed price.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'price_thousand_sep', + __( 'Thousand Separator', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-price-display', + array( + 'field' => 'price_thousand_sep', + 'desc' => __( 'This sets the thousand separator of the displayed price.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'price_decimals_num', + __( 'Number of Decimals', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-price-display', + array( + 'field' => 'price_decimals_num', + 'desc' => __( 'This sets the number of decimal points shown in the displayed price.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'price_apply_for_input', + __( 'Apply Separators Settings To Customer Input', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-price-display', + array( + 'field' => 'price_apply_for_input', + 'desc' => __( 'If enabled, separator settings will be applied to customer input as well. For example, if you have donation button where customers can enter amount and you set "," as decimal separator, customers will need to enter values correspondigly - 12,23 instead of 12.23.', 'stripe-payments' ), + ) + ); + + // Custom Field section + add_settings_field( + 'custom_field_enabled', + __( 'Enable For All Buttons and Products', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_enabled', + 'desc' => __( 'If enabled, makes the following field enabled by default for all buttons and products.', 'stripe-payments' ) . '
' . + __( 'You can control per-product or per-button behaviour by editing the product and selecting enabled or disabled option under the Custom Field section.', 'stripe-payments' ) . '
' . + __( 'View the custom field usage documentation.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_name', + __( 'Field Name', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_name', + 'desc' => __( 'Enter name for the field. It will be displayed in order info and emails.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_descr', + __( 'Field Description', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_descr', + 'desc' => __( 'Enter field description. It will be displayed for users to let them know what is required from them. Leave it blank if you don\'t want to display description.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_descr_location', + __( 'Text Field Description Location', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_descr_location', + 'desc' => __( 'Select field description location. Placeholder: description is displayed inside text input (default). Below Input: description is displayed below text input.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_type', + __( 'Field Type', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_type', + 'desc' => __( 'Select custom field type.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_validation', + __( 'Field Validation', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_validation', + 'desc' => __( 'Select custom field validation if needed.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'custom_field_mandatory', + __( 'Mandatory', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-custom-field', + array( + 'field' => 'custom_field_mandatory', + 'desc' => __( "If enabled, makes the field mandatory - user can't proceed with the payment before it's filled.", 'stripe-payments' ), + ) + ); + + //Terms and Conditions + add_settings_field( + 'tos_enabled', + __( 'Enable Terms and Conditions', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-tos', + array( + 'field' => 'tos_enabled', + 'desc' => __( 'Enable Terms and Conditions checkbox.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'tos_text', + __( 'Checkbox Text', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-tos', + array( + 'field' => 'tos_text', + 'desc' => __( 'Text to be displayed on checkbox. It accepts HTML code so you can put a link to your terms and conditions page.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'tos_store_ip', + __( 'Store Customer\'s IP Address', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-tos', + array( + 'field' => 'tos_store_ip', + 'desc' => __( 'If enabled, customer\'s IP address from which TOS were accepted will be stored in order info.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'tos_position', + __( 'Position', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-tos', + array( + 'field' => 'tos_position', + 'desc' => __( 'Select TOS checkbox position.', 'stripe-payments' ), + ) + ); + + // Additional Settings + // add_settings_field( + // 'use_old_checkout_api1', + // __( 'Enable Legacy Checkout API', 'stripe-payments' ), + // array( $this, 'settings_field_callback' ), + // $this->plugin_slug . '-advanced', + // 'AcceptStripePayments-additional-settings', + // array( + // 'field' => 'use_old_checkout_api1', + // 'desc' => __( "Use the legacy API to process payments. Note that the legacy API is not compatible with 3-D Secure and EU's Strong Customer Authentication (SCA) requirements. Stripe may disable this legacy API in the future. If there is a bug in the new API, then continue to use the legacy API while we fix the bug.", 'stripe-payments' ), + // ) + // ); + add_settings_field( + 'new_product_edit_interface', + __( 'Enable Compact Product Edit Interface', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-additional-settings', + array( + 'field' => 'new_product_edit_interface', + 'desc' => __( 'Switch to the compact product edit interface.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'frontend_prefetch_scripts', + __( 'Prefetch Payment Popup Scripts', 'stripe-payments' ) , + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-additional-settings', + array( + 'field' => 'frontend_prefetch_scripts', + 'desc' => __( + 'Enable this to speed up payment popup display after customer clicks payment button.', + 'stripe-payments' + ), + ) + ); + add_settings_field( + 'dont_use_cookie', + __( 'Don\'t Use Cookie', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-additional-settings', + array( + 'field' => 'dont_use_cookie', + 'desc' => __( 'If enabled, cookie will not be used by the plugin.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'dont_create_order', + __( 'Don\'t Create Order', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-additional-settings', + array( + 'field' => 'dont_create_order', + 'desc' => __( 'If enabled, no transaction info is saved to the orders menu of the plugin. The transaction data will still be available in your Stripe dashboard. Useful if you don\'t want to store purchase and customer data in your site.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'allowed_currencies', + __( 'Allowed Currencies', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-additional-settings', + array( + 'field' => 'allowed_currencies', + ) + ); + + // Payment Popup Related section + add_settings_field( + 'popup_default_country', + __( 'Popup Default Country', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'popup_default_country', + 'desc' => __( + 'Select the default country that should be set on the payment popup window for billing and shipping address.', + 'stripe-payments' + ) . $country_autodetect_addon_txt, + ) + ); + + add_settings_field( + 'prefill_wp_user_details', + __( 'Prefill Logged In User Name and Email', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'prefill_wp_user_details', + 'desc' => __( + 'When payment is made by logged in WordPress user, his\her name and email are prefilled to corresponding payment popup fields.', + 'stripe-payments' + ), + ) + ); + + add_settings_field( + 'hide_state_field', + __( 'Hide the State Field', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'hide_state_field', + 'desc' => __( + 'Hide the State field on the payment popup window. The State field for the address is an optional field.', + 'stripe-payments' + ), + ) + ); + + add_settings_field( + 'use_separate_name_fields_enabled', + __( 'Use Separate Name Fields', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'use_separate_name_fields_enabled', + 'desc' => __( 'When enabled, the checkout form will display separate fields for first and last names instead of a single full name field.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'display_security_badge', + __( 'Display Security Badge and Message', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'display_security_badge', + 'desc' => __( 'When enabled, the Security Badge and Message Content are displayed below the Pay button in the payment popup window.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'security_badge_and_message_content', + __( 'Security Badge and Message Content', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'security_badge_and_message_content', + 'desc' => __( 'This content will appear below the Pay button in the payment popup window. Allowed HTML tags are p, img, ul, li, and br.', 'stripe-payments' ), + ) + ); + add_settings_field( + 'pp_additional_css', + __( 'Payment Popup Additional CSS', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-payment-popup-related', + array( + 'field' => 'pp_additional_css', + 'desc' => __( 'Enter additional CSS code to be applied to the payment popup page.', 'stripe-payments' ), + ) + ); + + //Experimental Settings + add_settings_field( + 'dont_use_stripe_php_sdk', + __( 'Do Not Use Stripe PHP SDK Library', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'dont_use_stripe_php_sdk', + 'desc' => __( 'Enable this if you\'re experiencing conflicts with other plugins that use Stripe PHP SDK Library. Internal Stripe API wrapper would be used instead.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'disable_security_token_check', + __( 'Disable Security Token Check', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'disable_security_token_check', + 'desc' => __( 'Helps when you are getting "Invalid Security Token" errors due to caching being done on your server.', 'stripe-payments' ) . '
' . + __( 'It is not recommended to disable security tokens. You should change your server cache settings to not cache payment popup URLs.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'disable_page_load_signature_check', + __( 'Disable Page Load Signature Check', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'disable_page_load_signature_check', + 'desc' => __( 'It is not recommended to disable the page load signature check. The signature check helps to prevent some bots from abusing your payment buttons.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'disable_request_limit_per_ip_check', + __( 'Disable Transaction Limit per IP Address Check', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'disable_request_limit_per_ip_check', + 'desc' => __( 'It is not recommended to disable the transaction request limit per IP address check. This check helps to prevent some bots from abusing your payment buttons.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'show_incomplete_orders', + __( 'Show Incomplete Orders', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'show_incomplete_orders', + 'desc' => __( 'If enabled, incomplete transactions are also displayed in the Orders listing page of the plugin. If Stripe declines a card transaction because the customer entered incorrect card info, it will be considered to be an incomplete transaction.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'disable_3ds_iframe', + __( 'Disable 3D Secure Iframe', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'disable_3ds_iframe', + 'desc' => __( 'If enabled, payment popup redirects browser to 3D Secure check page instead of showing it in an iframe. This might help if your server configuration prevents displaying iframes from other websites.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'disable_buttons_before_js_loads', + __( 'Disable Buttons Before Javascript Loads', 'stripe-payments' ), + array( $this, 'settings_field_callback' ), + $this->plugin_slug . '-advanced', + 'AcceptStripePayments-experimental-settings', + array( + 'field' => 'disable_buttons_before_js_loads', + 'desc' => __( 'If enabled, payment buttons are not clickable until Javascript libraries are loaded on page view. This prevents "Invalid Stripe Token" errors on some configurations.', 'stripe-payments' ), + ) + ); + + //Captcha Tab + add_settings_field( + 'captcha_type', + __( 'Captcha Type', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-captcha', + 'AcceptStripePayments-captcha', + array( + 'field' => 'captcha_type', + 'desc' => __( 'Select Captcha type you want to use.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'daily_txn_limit_without_captcha', + __( 'Daily Transaction Limit without Captcha', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-txn-rate-limit', + 'AcceptStripePayments-txn-rate-limiting', + array( + 'field' => 'daily_txn_limit_without_captcha', + 'desc' => __( 'Maximum number of transactions allowed per day when captcha is disabled (default value is 25). This value cannot be greater than 50 at the moment. You can enable and configure a captcha option to remove this limit.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'daily_txn_limit_with_captcha', + __( ' Daily Transaction Limit with Captcha', 'stripe-payments' ), + array( &$this, 'settings_field_callback' ), + $this->plugin_slug . '-txn-rate-limit', + 'AcceptStripePayments-txn-rate-limiting', + array( + 'field' => 'daily_txn_limit_with_captcha', + 'desc' => __( 'Maximum number of transactions allowed per day when captcha is enabled (default value is 100). This value can be any number. You can enter -1 to remove this limit.', 'stripe-payments' ) + ) + ); + + } + + function tos_description() { + echo '

' . __( 'This section allows you to configure Terms and Conditions or Privacy Policy that customer must accept before making payment. This, for example, can be used to comply with EU GDPR.', 'stripe-payments' ) . '

'; + } + + public function experemintal_section_description() { + echo '

' . esc_html( __( "Warning: don't change options in this section unless you know what you're doing!", 'stripe-payments' ) ) . '

'; + } + + public function captcha_section_description() { + $tutorial_link = 'protection from card testing'; + echo __('Please read this tutorial on ', 'stripe-payments') . wp_kses_post( $tutorial_link ). __(' to understand why Captcha is recommended.', 'stripe-payments'); + echo '

'; + } + + public function txn_rate_limiting_section_description() { + $documentation_link = 'card testing'; + echo __('The plugin will apply a daily transaction rate limiting to prevent a bot from doing excessive ','stripe-payments'); + echo wp_kses_post($documentation_link) . __(' transactions. This should allow you to look into the situation and make adjustments if rate limiting is reached.', 'stripe-payments'); + echo __(' It is recommended to start off by setting a low number based on the expected number of transactions. If you hit the limit then you can increase it.','stripe-payments'); + echo '

'; + + $email_settings_link = sprintf( '', ASPMain::$products_slug ) . __( 'Email Settings', 'stripe-payments' ) . ''; + echo __('If you want to customize the daily transaction rate limiting email notification option, go to the ' . wp_kses_post( $email_settings_link ) . ' menu tab and scroll down to the Rate Limit Email Settings section.', 'stripe-payments'); + } + + static function get_currency_options( $selected_value = '', $show_default = true ) { + + $currencies = AcceptStripePayments::get_currencies(); + + if ( false === $show_default ) { + unset( $currencies[''] ); + } + $opt_tpl = ''; + $opts = ''; + foreach ( $currencies as $key => $value ) { + $selected = $selected_value === $key ? ' selected' : ''; + $opts .= str_replace( array( '%curr_code%', '%curr_name%', '%selected%' ), array( $key, $value[0], $selected ), $opt_tpl ); + } + + return $opts; + } + + public function get_checkout_lang_options( $selected_value = '' ) { + $languages_arr = array( + 'ar' => __( 'Arabic', 'stripe-payments' ), + 'bg' => __( 'Bulgarian', 'stripe-payments' ), + 'he' => __( 'Hebrew', 'stripe-payments' ), + 'lv' => __( 'Latvian', 'stripe-payments' ), + 'lt' => __( 'Lithuanian', 'stripe-payments' ), + 'ms' => __( 'Malay', 'stripe-payments' ), + 'nb' => __( 'Norwegian Bokmal', 'stripe-payments' ), + 'pl' => __( 'Polish', 'stripe-payments' ), + 'pt' => __( 'Portuguese', 'stripe-payments' ), + 'ru' => __( 'Russian', 'stripe-payments' ), + 'da' => __( 'Danish', 'stripe-payments' ), + 'nl' => __( 'Dutch', 'stripe-payments' ), + 'en' => __( 'English', 'stripe-payments' ), + 'fi' => __( 'Finnish', 'stripe-payments' ), + 'fr' => __( 'French', 'stripe-payments' ), + 'de' => __( 'German', 'stripe-payments' ), + 'it' => __( 'Italian', 'stripe-payments' ), + 'ja' => __( 'Japanese', 'stripe-payments' ), + 'no' => __( 'Norwegian', 'stripe-payments' ), + 'zh' => __( 'Simplified Chinese', 'stripe-payments' ), + 'es' => __( 'Spanish', 'stripe-payments' ), + 'sv' => __( 'Swedish', 'stripe-payments' ), + ); + asort( $languages_arr ); + $data_arr = array( '' => __( 'Autodetect', 'stripe-payments' ) ); + $data_arr = $data_arr + $languages_arr; + + $opt_tpl = ''; + $opts = false === $selected_value ? '' : ''; + foreach ( $data_arr as $key => $value ) { + $selected = $selected_value === $key ? ' selected' : ''; + $opts .= str_replace( array( '%val%', '%name%', '%selected%' ), array( $key, $value, $selected ), $opt_tpl ); + } + + return $opts; + } + + /** + * Settings HTML + */ + public function settings_field_callback( $args ) { + + $settings = (array) get_option( 'AcceptStripePayments-settings' ); + + $field = esc_attr( isset( $args['field'] ) ? $args['field'] : '' ); + + $field_value = esc_attr( isset( $settings[ $field ] ) ? $settings[ $field ] : '' ); + + // Show default content for security badge. + if ($field == 'security_badge_and_message_content' && empty(trim($field_value))){ + $field_value = ASP_Utils_Misc::secure_badge_default_content(); + } + + $desc = isset( $args['desc'] ) ? $args['desc'] : ''; + + $size = esc_attr( isset( $args['size'] ) ? $args['size'] : 40 ); + + $addon_field = apply_filters( 'asp-admin-settings-addon-field-display', $field, $field_value ); + + if ( is_array( $addon_field ) ) { + $field = $addon_field['field']; + $field_name = $addon_field['field_name']; + } + + switch ( $field ) { + case 'checkbox': + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'custom': + echo wp_kses( $addon_field['field_data'], ASP_Utils::asp_allowed_tags_expanded() ); + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'custom_field_type': + echo "'; + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'custom_field_descr_location': + echo "'; + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'custom_field_validation': + echo "'; + echo '
' + . '
' + . '

' . __( 'No Validation', 'stripe-payments' ) . ': ' . __( 'no validation performed', 'stripe-payments' ) . '

' + . '

' . __( 'Numbers Only', 'stripe-payments' ) . ': ' . __( 'only accepts numbers 0-9', 'stripe-payments' ) . '

' + // translators: %s is a link to JavaScript RegExp page + . '

' . __( 'Custom Validation', 'stripe-payments' ) . ': ' . sprintf( __( 'you can enter your own validation rules using JavaScript RegExp format.', 'stripe-payments' ), 'https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions' ) . '

' + . '
' + . '
'; + echo "

" . wp_kses_post( $desc ) . "

"; + $opts = get_option( 'AcceptStripePayments-settings' ); + $custom_regex = ''; + if ( ! empty( $opts['custom_field_custom_validation_regex'] ) ) { + $custom_regex = $opts['custom_field_custom_validation_regex']; + } + $custom_regex_err_msg = __( 'Please enter valid data', 'stripe-payments' ); + if ( ! empty( $opts['custom_field_custom_validation_err_msg'] ) ) { + $custom_regex_err_msg = $opts['custom_field_custom_validation_err_msg']; + } + echo ''; + break; + case 'tos_position': + echo "'; + echo "

" . esc_attr( $desc ) . "

"; + break; + case 'price_apply_for_input': + case 'tos_enabled': + case 'tos_store_ip': + case 'debug_log_enable': + case 'send_emails_to_seller': + case 'send_emails_to_buyer': + case 'stripe_receipt_email': + case 'send_email_on_error': + case 'send_email_on_daily_txn_rate_limit': + case 'use_new_button_method': + case 'is_live': + case 'disable_remember_me': + case 'use_old_checkout_api1': + case 'new_product_edit_interface': + case 'disable_3ds_iframe': + case 'disable_buttons_before_js_loads': + case 'show_incomplete_orders': + case 'disable_security_token_check': + case 'disable_page_load_signature_check': + case 'disable_request_limit_per_ip_check': + case 'dont_save_card': + case 'custom_field_mandatory': + case 'enable_zip_validation': + case 'dont_use_cookie': + case 'dont_create_order': + case 'use_separate_name_fields_enabled': + case 'display_security_badge': + case 'enable_email_schedule': + case 'frontend_prefetch_scripts': + case 'hide_state_field': + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'dont_use_stripe_php_sdk': + $desc = apply_filters( 'asp_int_dont_use_stripe_php_sdk_option_desc', $desc ); + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'prefill_wp_user_details': + echo "

" . esc_attr( $desc ) . "

"; + $last_name_first = $this->asp_main->get_setting( 'prefill_wp_user_last_name_first' ); + echo ''; + echo '

' . esc_html__( 'When enabled, last name is placed before first name.', 'stripe-payments' ) . '

'; + break; + case 'custom_field_enabled': + echo "

" . wp_kses_post( $desc ) . "

"; + //do action so ACF addon can display its message if needed + do_action( 'asp_acf_settings_page_display_msg' ); + break; + case 'buyer_email_type': + case 'seller_email_type': + $checked_text = empty( $field_value ) || ( 'text' === $field_value ) ? ' selected' : ''; + $checked_html = 'html' === $field_value ? ' selected' : ''; + echo ''; + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'buyer_email_body': + case 'seller_email_body': + $email_type_field_key = rtrim($field, 'body') . 'type'; // results to buyer_email_type or seller_email_type + $email_body_type = isset($settings[$email_type_field_key]) ? sanitize_text_field($settings[$email_type_field_key]) : ''; + if ($email_body_type == 'html'){ + add_filter( 'wp_default_editor', array( $this, 'set_default_editor' ) ); + wp_editor( + html_entity_decode( $field_value ), + $field, + array( + 'textarea_name' => 'AcceptStripePayments-settings[' . $field . ']', + 'teeny' => true, + ) + ); + remove_filter( 'wp_default_editor', array( $this, 'set_default_editor' ) ); + } else { + echo ''; + } + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'products_page_id': + //We save the products page ID internally but we show the URL of that page to the user (its user-friendly). + $products_page_id = $field_value; + $products_page_url = get_permalink( $products_page_id ); + //show the URL in a text field for display purpose. This field's value can't be updated as we store the page ID internally. + echo "

" . esc_attr( $desc ) . "

"; + break; + case 'currency_code': + echo ''; + //echo "

" . esc_attr( $desc ) . "

"; + break; + case 'currency_symbol': + echo ''; + echo "

" . esc_attr( $desc ) . "

"; + break; + case 'allowed_currencies': + $all_curr = ASP_Utils::get_currencies(); + unset( $all_curr[''] ); + $allowed_curr = empty( $field_value ) ? $all_curr : json_decode( html_entity_decode( $field_value ), true ); + if ( empty( array_diff_key( $all_curr, $allowed_curr ) ) ) { + $allowed = __( 'All', 'stripe-payments' ); + } else { + $allowed = __( 'Selected', 'stripe-payments' ); + } + echo esc_attr( $allowed ); + echo '
'; + echo '' . __( 'Click here to select currencies', 'stripe-payments' ) . ''; + echo ''; + echo '
'; + echo '

' . __( 'You can select currencies you want to be available for your customers for variable currencies products. Useful for donation type products.', 'stripe-payments' ) . '

'; + break; + case 'price_decimals_num': + echo ''; + echo wp_kses( $this->get_checkout_lang_options( $field_value ), ASP_Utils::asp_allowed_tags() ); + echo ''; + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'popup_default_country': + echo ''; + echo "

" . wp_kses_post( $desc ) . "

"; + break; + case 'price_currency_pos': + ?> + +

+ %s', esc_attr( $field ), esc_attr( $field_value ) ); + echo '

' . wp_kses_post( $desc ) . '

'; + break; + case 'tos_text': + echo ''; + echo '

' . wp_kses_post( $desc ) . '

'; + break; + case 'debug_log_link_enable': + echo ''; + echo ''; + echo '

'; + //check if we have token generated + $token = $this->asp_main->get_setting( 'debug_log_access_token' ); + if ( ! $token ) { + //let's generate debug log access token + $token = substr( md5( uniqid() ), 16 ); + $opts = get_option( 'AcceptStripePayments-settings' ); + $opts['debug_log_access_token'] = $token; + unregister_setting( 'AcceptStripePayments-settings-group', 'AcceptStripePayments-settings' ); + update_option( 'AcceptStripePayments-settings', $opts ); + } + echo ''; + echo '

' . esc_html( $desc ) . '

'; + ?> + + > + +

+
+ > + +

+
+ > + +

+
+ > + +

+

" . wp_kses_post( $desc ) . "

"; + break; + } + } + + public function set_default_editor( $r ) { + $r = 'html'; + return $r; + } + + /** + * Validates the admin data + * + * @since 1.0.0 + */ + public function settings_sanitize_field_callback( $input ) { + + $output = get_option( 'AcceptStripePayments-settings' ); + + $output = apply_filters( 'apm-admin-settings-sanitize-field', $output, $input ); + + $output ['price_apply_for_input'] = empty( $input['price_apply_for_input'] ) ? 0 : 1; + + $output ['tos_enabled'] = empty( $input['tos_enabled'] ) ? 0 : 1; + + $output ['tos_position'] = sanitize_text_field( $input['tos_position'] ); + + $output ['tos_store_ip'] = empty( $input['tos_store_ip'] ) ? 0 : 1; + + $output ['enable_email_schedule'] = empty( $input['enable_email_schedule'] ) ? 0 : 1; + + $output ['frontend_prefetch_scripts'] = empty( $input['frontend_prefetch_scripts'] ) ? 0 : 1; + + $output['pp_additional_css'] = ! empty( $input['pp_additional_css'] ) ? $input['pp_additional_css'] : ''; + + $output['security_badge_and_message_content'] = isset( $input['security_badge_and_message_content'] ) && !empty( trim($input['security_badge_and_message_content']) ) ? wp_kses($input['security_badge_and_message_content'], ASP_Utils_Misc::secure_badge_allowed_tags() ) : ASP_Utils_Misc::secure_badge_default_content(); + + $output['tos_text'] = ! empty( $input['tos_text'] ) ? $input['tos_text'] : ''; + + $output['custom_field_enabled'] = empty( $input['custom_field_enabled'] ) ? 0 : 1; + + $output['custom_field_type'] = empty( $input['custom_field_type'] ) ? 'text' : sanitize_text_field( $input['custom_field_type'] ); + + $output['custom_field_name'] = empty( $input['custom_field_name'] ) ? '' : sanitize_text_field( $input['custom_field_name'] ); + + $output['custom_field_descr'] = empty( $input['custom_field_descr'] ) ? '' : $input['custom_field_descr']; + + $output['custom_field_descr_location'] = empty( $input['custom_field_descr_location'] ) ? 'placeholder' : $input['custom_field_descr_location']; + + $output ['custom_field_validation'] = sanitize_text_field( $input['custom_field_validation'] ); + + if ( ! empty( $output['custom_field_validation'] ) && $output['custom_field_validation'] === 'custom' ) { + $custom_regex = sanitize_text_field( $input['custom_field_custom_validation_regex'] ); + $regex_error = false; + try { + if ( preg_match( '/' . $custom_regex . '/', '' ) === false ) { + $regex_error = true; + } + } catch ( Exception $ex ) { + $regex_error = true; + } + if ( $regex_error ) { + //error occurred during regex test + // translators: %s is replaced by invalid RegExp value + add_settings_error( 'custom_field_custom_validation_regex', 'custom_field_custom_validation_regex', sprintf( __( 'Invalid custom RegExp for Custom Field validation provided: %s', 'stripe-payments' ), $custom_regex ) ); + } + $output['custom_field_custom_validation_regex'] = $custom_regex; + $output['custom_field_custom_validation_err_msg'] = sanitize_text_field( $input['custom_field_custom_validation_err_msg'] ); + } + + $output['captcha_type'] = $input['captcha_type']; + + $output['custom_field_mandatory'] = empty( $input['custom_field_mandatory'] ) ? 0 : 1; + + $output['is_live'] = empty( $input['is_live'] ) ? 0 : 1; + + $output['debug_log_enable'] = empty( $input['debug_log_enable'] ) ? 0 : 1; + + $output['debug_log_link_enable'] = empty( $input['debug_log_link_enable'] ) ? 0 : 1; + + $output['dont_save_card'] = empty( $input['dont_save_card'] ) ? 0 : 1; + + $output['disable_remember_me'] = empty( $input['disable_remember_me'] ) ? 0 : 1; + + $output['use_new_button_method'] = empty( $input['use_new_button_method'] ) ? 0 : 1; + + $output['prefill_wp_user_details'] = empty( $input['prefill_wp_user_details'] ) ? 0 : 1; + $output['prefill_wp_user_last_name_first'] = empty( $input['prefill_wp_user_last_name_first'] ) ? 0 : 1; + + $output['hide_state_field'] = empty( $input['hide_state_field'] ) ? 0 : 1; + + $output['send_emails_to_buyer'] = empty( $input['send_emails_to_buyer'] ) ? 0 : 1; + + $output['stripe_receipt_email'] = empty( $input['stripe_receipt_email'] ) ? 0 : 1; + + $output['send_email_on_error'] = empty( $input['send_email_on_error'] ) ? 0 : 1; + + $output['send_email_on_daily_txn_rate_limit'] = empty( $input['send_email_on_daily_txn_rate_limit'] ) ? 0 : 1; + + $output['send_emails_to_seller'] = empty( $input['send_emails_to_seller'] ) ? 0 : 1; + + $output['send_email_on_error_to'] = sanitize_text_field( $input['send_email_on_error_to'] ); + + $output['send_email_on_daily_txn_rate_limit_to'] = sanitize_text_field( $input['send_email_on_daily_txn_rate_limit_to'] ); + + $output['disable_3ds_iframe'] = empty( $input['disable_3ds_iframe'] ) ? 0 : 1; + + $output['disable_buttons_before_js_loads'] = empty( $input['disable_buttons_before_js_loads'] ) ? 0 : 1; + + $output['show_incomplete_orders'] = empty( $input['show_incomplete_orders'] ) ? 0 : 1; + + $output['disable_security_token_check'] = empty( $input['disable_security_token_check'] ) ? 0 : 1; + + $output['disable_page_load_signature_check'] = empty( $input['disable_page_load_signature_check'] ) ? 0 : 1; + + $output['disable_request_limit_per_ip_check'] = empty( $input['disable_request_limit_per_ip_check'] ) ? 0 : 1; + + $output['dont_use_stripe_php_sdk'] = empty( $input['dont_use_stripe_php_sdk'] ) ? 0 : 1; + + //$output['use_old_checkout_api1'] = empty( $input['use_old_checkout_api1'] ) ? 0 : 1; + $output['use_old_checkout_api1']=0; + + $output['new_product_edit_interface'] = empty( $input['new_product_edit_interface'] ) ? 0 : 1; + + $output['dont_use_cookie'] = empty( $input['dont_use_cookie'] ) ? 0 : 1; + + $output['dont_create_order'] = empty( $input['dont_create_order'] ) ? 0 : 1; + + $output['use_separate_name_fields_enabled'] = empty( $input['use_separate_name_fields_enabled'] ) ? 0 : 1; + + $output['display_security_badge'] = isset($input['display_security_badge']) && !empty( $input['display_security_badge'] ) ? 1 : 0; + + $output['enable_zip_validation'] = empty( $input['enable_zip_validation'] ) ? 0 : 1; + + $input['api_secret_key'] = sanitize_text_field( $input['api_secret_key'] ); + $input ['api_publishable_key'] = sanitize_text_field( $input['api_publishable_key'] ); + $input['api_secret_key_test'] = sanitize_text_field( $input['api_secret_key_test'] ); + $input['api_publishable_key_test'] = sanitize_text_field( $input['api_publishable_key_test'] ); + + if ( ! empty( $output['is_live'] ) ) { + if ( empty( $input['api_secret_key'] ) || empty( $input['api_publishable_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'You must fill Live API credentials for plugin to work correctly.', 'stripe-payments' ) ); + } + } else { + if ( empty( $input['api_secret_key_test'] ) || empty( $input['api_publishable_key_test'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'You must fill Test API credentials for plugin to work correctly.', 'stripe-payments' ) ); + } + } + + if ( ! empty( $input['checkout_url'] ) ) { + $output['checkout_url'] = $input['checkout_url']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-checkout_url', __( 'Please specify a checkout page.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['button_text'] ) ) { + $output['button_text'] = $input['button_text']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-button-text', __( 'Button text should not be empty.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['popup_button_text'] ) ) { + $output['popup_button_text'] = $input['popup_button_text']; + } else { + // translators: %s is not a placeholder + $output['popup_button_text'] = __( 'Pay %s', 'stripe-payments' ); + } + + if ( ! empty( $input['currency_code'] ) ) { + $input['currency_code'] = sanitize_text_field( $input['currency_code'] ); + $output['currency_code'] = sanitize_text_field( $input['currency_code'] ); + $currencies = AcceptStripePayments::get_currencies(); + $opts = get_option( 'AcceptStripePayments-settings' ); + if ( isset( $opts['custom_currency_symbols'] ) && is_array( $opts['custom_currency_symbols'] ) ) { + $custom_curr_symb = $opts['custom_currency_symbols']; + } else { + $custom_curr_symb = array(); + } + if ( $currencies[ $output['currency_code'] ][1] !== $input['currency_symbol'] ) { + $custom_curr_symb[ $output['currency_code'] ] = array( $currencies[ $output['currency_code'] ][0], $input['currency_symbol'] ); + } else { + if ( isset( $custom_curr_symb['currency_code'] ) ) { + unset( $custom_curr_symb['currency_code'] ); + } + } + $output['custom_currency_symbols'] = $custom_curr_symb; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-currency-code', __( 'You must specify payment currency.', 'stripe-payments' ) ); + } + + $curr_arr = ASP_Utils::get_currencies(); + if ( ! empty( $input['allowed_currencies'] ) ) { + if ( empty( array_diff_key( $curr_arr, $input['allowed_currencies'] ) ) ) { + $output['allowed_currencies'] = false; + } else { + $output['allowed_currencies'] = is_array( $input['allowed_currencies'] ) ? wp_json_encode( $input['allowed_currencies'] ) : false; + } + } + + $output['checkout_lang'] = $input['checkout_lang']; + + $output['popup_default_country'] = $input['popup_default_country']; + + $output['api_publishable_key'] = $input['api_publishable_key']; + + $output['api_secret_key'] = $input['api_secret_key']; + + $output['api_publishable_key_test'] = $input['api_publishable_key_test']; + + $output['api_secret_key_test'] = $input['api_secret_key_test']; + + $output['buyer_email_type'] = $input['buyer_email_type']; + + $output['seller_email_type'] = $input['seller_email_type']; + + if ( ! empty( $input['from_email_address'] ) ) { + $output['from_email_address'] = $input['from_email_address']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-from-email-address', __( 'You must specify from email address.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['buyer_email_subject'] ) ) { + $output['buyer_email_subject'] = $input['buyer_email_subject']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-buyer-email-subject', __( 'You must specify buyer email subject.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['buyer_email_body'] ) ) { + $output['buyer_email_body'] = $input['buyer_email_body']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-buyer-email-body', __( 'You must fill in buyer email body.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['seller_notification_email'] ) ) { + $output['seller_notification_email'] = $input['seller_notification_email']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-seller-notification-email', __( 'You must specify seller notification email address.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['seller_email_subject'] ) ) { + $output['seller_email_subject'] = $input['seller_email_subject']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-seller-email-subject', __( 'You must specify seller email subject.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['seller_email_body'] ) ) { + $output['seller_email_body'] = $input['seller_email_body']; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-seller-email-body', __( 'You must fill in seller email body.', 'stripe-payments' ) ); + } + + // Price display + + $output['price_currency_pos'] = $input['price_currency_pos']; + + if ( ! empty( $input['price_decimal_sep'] ) ) { + $output['price_decimal_sep'] = esc_attr( $input['price_decimal_sep'] ); + } else { + add_settings_error( 'AcceptStripePayments-settings', 'empty-price-decimals-sep', __( 'Price decimal separator can\'t be empty.', 'stripe-payments' ) ); + } + + if ( ! empty( $input['price_thousand_sep'] ) ) { + $output['price_thousand_sep'] = esc_attr( $input['price_thousand_sep'] ); + } else { + $output['price_thousand_sep'] = ''; + } + + if ( isset( $input['price_decimals_num'] ) ) { + $price_decimals_num = intval( $input['price_decimals_num'] ); + $price_decimals_num = $price_decimals_num < 0 ? 0 : $price_decimals_num; + $output['price_decimals_num'] = $price_decimals_num; + } else { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-price-decimals-num', __( 'Price number of decimals can\'t be empty.', 'stripe-payments' ) ); + } + + //Daily transaction rate limiting + if ( isset( $input['daily_txn_limit_without_captcha'] ) ) { + $daily_txn_limit_without_captcha = intval( $input['daily_txn_limit_without_captcha'] ); + + + if($daily_txn_limit_without_captcha>50) + { + $output['daily_txn_limit_without_captcha'] = 25; + add_settings_error( 'AcceptStripePayments-settings', 'daily-txn-limit-wihout-captcha-error', __( 'Daily transaction rate limit without captcha cannot be greater than 50', 'stripe-payments' ) ); + } + else{ + $daily_txn_limit_without_captcha = $daily_txn_limit_without_captcha <= 0 ? 25 : $daily_txn_limit_without_captcha; + $output['daily_txn_limit_without_captcha'] = $daily_txn_limit_without_captcha; + } + } else { + add_settings_error( 'AcceptStripePayments-settings', 'daily-txn-limit-wihout-captcha-error', __( 'Daily Transaction rate limit cannot be empty', 'stripe-payments' ) ); + } + + //Daily transaction rate limiting with captcha + if (isset( $input['daily_txn_limit_with_captcha'] ) && intval( $input['daily_txn_limit_with_captcha'] ) != 0 ) { + $daily_txn_limit_with_captcha = intval( $input['daily_txn_limit_with_captcha'] ); + $output['daily_txn_limit_with_captcha'] = $daily_txn_limit_with_captcha; + } + else{ + $output['daily_txn_limit_with_captcha'] =100; + add_settings_error( 'AcceptStripePayments-settings', 'daily-txn-limit-with-captcha-error', __( 'Daily Transaction Limit with Captcha cannot be empty or 0. If you wish to disable this setting, please enter -1', 'stripe-payments' ) ); + } + + $url_hash = isset( $_POST['wp-asp-urlHash'] ) ? sanitize_text_field( stripslashes ( $_POST['wp-asp-urlHash'] ) ) : ''; + + if ( ! empty( $url_hash ) ) { + set_transient( 'wp-asp-urlHash', $url_hash, 300 ); + } + + //regen ckey + ASP_Utils::get_ckey( true ); + + //clear caching plugins cache if this is settings save action + $submit = isset( $_POST['submit'] ) ? sanitize_text_field( $_POST['submit'] ) : ''; + if ( ! empty( $submit ) ) { + ASP_Utils::clear_external_caches(); + } + + //Since 2.5.3 + $output = apply_filters( 'asp_admin_settings_sanitize_field_end', $output, $input ); + + return $output; + } + + /** + * Render the settings page for this plugin. + * + * @since 1.0.0 + */ + public function display_plugin_admin_page() { + include_once 'views/admin.php'; + } + + public function display_addons_menu_page() { + include_once 'views/addons-listing.php'; + } + + /** + * Helper function for addons to generate custom email tags + * + * @since 1.9.21t1 + */ + static function get_email_tags_descr_out( $email_tags = array(), $apply_filters = true ) { + return self::get_email_tags_descr( $email_tags, $apply_filters ); + } + + static function get_email_tags_descr( $email_tags = array(), $apply_filters = true ) { + if ( empty( $email_tags ) ) { + $email_tags = array( + '{item_name}' => __( 'Name of the purchased item', 'stripe-payments' ), + '{item_short_desc}' => __( 'Short description of the item', 'stripe-payments' ), + '{item_description}' => __( 'The product description field\'s content.', 'stripe-payments' ), + '{item_quantity}' => __( 'Number of items purchased', 'stripe-payments' ), + '{item_price}' => __( 'Item price. Example: 1000,00', 'stripe-payments' ), + '{item_price_curr}' => __( 'Item price with currency symbol. Example: $1,000.00', 'stripe-payments' ), + '{purchase_amt}' => __( 'The amount paid for the current transaction. Example: 1,000.00', 'stripe-payments' ), + '{purchase_amt_curr}' => __( 'The amount paid for the current transaction with currency symbol. Example: $1,000.00', 'stripe-payments' ), + '{tax}' => __( 'Tax in percent. Example: 10%', 'stripe-payments' ), + '{tax_amt}' => __( 'Formatted tax amount for single item. Example: $0.25', 'stripe-payments' ), + '{shipping_amt}' => __( 'Formatted shipping amount. Example: $2.50', 'stripe-payments' ), + '{download_url}' => __( 'The download URL of the item (if configured)', 'stripe-payments' ), + '{product_details}' => __( 'The item details of the purchased product (this will include the download link for digital items)', 'stripe-payments' ), + '{product_variations}' => __( 'The selected product variations (if any) of the purchased product.', 'stripe-payments' ), + '{product_url}' => __( 'The permalink to the product\'s single page', 'stripe-payments' ), + '{transaction_id}' => __( 'The unique transaction ID of the purchase', 'stripe-payments' ), + '{shipping_address}' => __( 'Shipping address of the buyer', 'stripe-payments' ), + '{billing_address}' => __( 'Billing address of the buyer', 'stripe-payments' ), + '{customer_name}' => __( 'Customer name. Available only if collect billing address option is enabled', 'stripe-payments' ), + '{first_name}' => __( 'Customer\'s first name. Available only if collect billing address option is enabled', 'stripe-payments' ), + '{last_name}' => __( 'Customer\'s last name. Available only if collect billing address option is enabled', 'stripe-payments' ), + '{payer_email}' => __( 'Email Address of the buyer', 'stripe-payments' ), + '{currency}' => __( 'Currency symbol. Example: $', 'stripe-payments' ), + '{currency_code}' => __( '3-letter currency code. Example: USD', 'stripe-payments' ), + '{purchase_date}' => __( 'The date of the purchase', 'stripe-payments' ), + '{custom_field}' => __( 'Custom field name and value (if enabled)', 'stripe-payments' ), + '{coupon_code}' => __( 'Coupon code (if available)', 'stripe-payments' ), + '{payment_method}' => __( 'Paymend method used to make the payment. Example: card, alipay' ), + '{card_brand}' => __( 'Brand of the card used to make the payment. Example: visa, mastercard, amex' ), + '{card_last_4}' => __( 'Last 4 digits of the card. Example: 4242' ), + '{logged_in_user_id}' => __( 'User/Member ID of the currently logged in user. This field will be empty if the user is not logged in while doing the transaction.' ), + '{logged_in_user_name}' => __( 'Username of the currently logged in user. This field will be empty if the user is not logged in while doing the transaction.' ), + '{surcharge_total_amt}' => __( 'The total surcharge amount for the transaction. Applicable only to one-time or donation type products.' ), + '{surcharge_label}' => __( 'The surcharge label. Applicable only to one-time or donation type products.' ), + ); + } + + //apply filters so addons can add their hints if needed + if ( $apply_filters ) { + $email_tags = apply_filters( 'asp_get_email_tags_descr', $email_tags ); + } + + $email_tags_descr = ''; + + foreach ( $email_tags as $tag => $descr ) { + if ( $descr === '' ) { + //this means we need to add addon title which is in $tag var + $email_tags_descr .= sprintf( '%s', $tag ); + } else { + $email_tags_descr .= sprintf( '%s%s', $tag, $descr ); + } + } + + $email_tags_descr = sprintf( '

%s

', __( 'Click here to toggle tags hint', 'stripe-payments' ), $email_tags_descr ); + return $email_tags_descr; + } + +} diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-order-meta-boxes.php b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-order-meta-boxes.php new file mode 100644 index 0000000..5a75331 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-order-meta-boxes.php @@ -0,0 +1,55 @@ +ID, 'asp_order_events', true ); + if ( ! empty( $order_events ) && is_array( $order_events ) ) { + $i = 0; + foreach ( $order_events as $event ) { + $i++; + if ( 1 === $i && empty( $event['comment'] ) ) { + $event['comment'] = __( 'Order created.', 'stripe-payments' ); + } + if ( 'paid' === $event['status'] && empty( $event['comment'] ) ) { + $event['comment'] = __( 'Payment completed.', 'stripe-payments' ); + } + echo sprintf( + '

+
+ %s + %s +
+
%s
+
', + ' os-' . $event['status'], + ASPOrder::get_status_str( $event['status'] ), + gmdate( 'Y-m-d H:i:s', $event['date'] ), + gmdate( 'M d H:i', $event['date'] ), + $event['comment'] + ); + if ( count( $order_events ) !== $i ) { + echo '
'; + } + } + } else { + echo __( 'No data available.', 'stripe-payments' ); + } + } +} + +new ASP_Admin_Order_Meta_Boxes(); diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-product-meta-boxes.php b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-product-meta-boxes.php new file mode 100644 index 0000000..7c6bf46 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-product-meta-boxes.php @@ -0,0 +1,1399 @@ +asp_main = AcceptStripePayments::get_instance(); + remove_post_type_support( ASPMain::$products_slug, 'editor' ); + add_action( 'add_meta_boxes_' . ASPMain::$products_slug, array( $this, 'add_meta_boxes' ), 0 ); + //products post save action + add_action( 'save_post_' . ASPMain::$products_slug, array( $this, 'save_product_handler' ), 10, 3 ); + + add_action( 'admin_footer', array( $this, 'admin_footer' ) ); + } + + public function admin_footer() { + $screen = get_current_screen(); + $is_post_edit_page = !is_null($screen) && $screen->base == 'post'; + + if (is_admin() && $is_post_edit_page) { + // Do something only on post edit pages + wp_enqueue_script( 'asp-admin-edit-product-js' ); + } + } + + public function add_meta_boxes() { + add_meta_box( 'wsp_content', __( 'Description', 'stripe-payments' ), array( $this, 'display_description_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_short_description_meta_box', __( 'Short Description', 'stripe-payments' ), array( $this, 'display_short_description_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + if ( class_exists( 'ASPSUB_main' ) && version_compare( ASPSUB_main::ADDON_VER, '2.0.16' ) <= 0 ) { + add_meta_box( 'asp_price_meta_box', esc_html( __( 'Price & Currency', 'stripe-payments' ) ), array( $this, 'display_price_meta_box_deprecated' ), ASPMain::$products_slug, 'normal', 'default' ); + } else { + add_meta_box( 'asp_price_meta_box', esc_html( __( 'Price & Currency', 'stripe-payments' ) ), array( $this, 'display_price_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + } + add_meta_box( 'asp_variations_meta_box', esc_html( __( 'Variations', 'stripe-payments' ) ), array( $this, 'display_variations_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_quantity_meta_box', esc_html( __( 'Quantity & Stock', 'stripe-payments' ) ), array( $this, 'display_quantity_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_shipping_tax_meta_box', esc_html( __( 'Shipping & Tax', 'stripe-payments' ) ), array( $this, 'display_shipping_tax_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_surcharge_meta_box', esc_html( __( 'Transaction Surcharge (Beta)', 'stripe-payments' ) ), array( $this, 'display_surcharge_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_address_meta_box', __( 'Collect Address', 'stripe-payments' ), array( $this, 'display_address_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_upload_meta_box', __( 'Download URL', 'stripe-payments' ), array( $this, 'display_upload_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_thumbnail_meta_box', __( 'Product Thumbnail', 'stripe-payments' ), array( $this, 'display_thumbnail_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_thankyou_page_meta_box', __( 'Thank You Page URL', 'stripe-payments' ), array( $this, 'display_thankyou_page_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_appearance_meta_box', __( 'Appearance', 'stripe-payments' ), array( $this, 'display_appearance_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_coupons_meta_box', __( 'Coupons Settings', 'stripe-payments' ), array( $this, 'display_coupons_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_custom_field_meta_box', __( 'Custom Field', 'stripe-payments' ), array( $this, 'display_custom_field_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_advanced_settings', __( 'Advanced Settings', 'stripe-payments' ), array( $this, 'display_advanced_settings_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + add_meta_box( 'asp_embed_meta_box', __( 'Embed Product', 'stripe-payments' ), array( $this, 'display_embed_meta_box' ), ASPMain::$products_slug, 'side', 'default' ); + + //check if eMember installed + if ( function_exists( 'wp_eMember_install' ) ) { + //if it is, let's add metabox where admin can select membership level + add_meta_box( 'asp_emember_meta_box', __( 'WP eMember Membership Level', 'stripe-payments' ), array( $this, 'display_emember_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + } + + //check if Simple Membership installed + if ( defined( 'SIMPLE_WP_MEMBERSHIP_VER' ) ) { + //if it is, let's add metabox where admin can select membership level + add_meta_box( 'asp_swpm_meta_box', __( 'Simple Membership Level', 'stripe-payments' ), array( $this, 'display_swpm_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + } + + //check if WP PDF Stamper is installed + if ( defined( 'WP_PDF_STAMP_VERSION' ) ) { + //if it is, let's add metabox where admin can select additional options + add_meta_box( 'asp_pdf_stamper_meta_box', __( 'PDF Stamper Integration', 'stripe-payments' ), array( $this, 'display_pdf_stamper_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + } + + do_action( 'asp_edit_product_metabox' ); + $new_product_edit_interface = $this->asp_main->get_setting( 'new_product_edit_interface' ); + if ( $new_product_edit_interface ) { + global $wp_meta_boxes; + global $post; + $skip_metaboxes = array( 'wsp_content', 'asp_short_description_meta_box' ); + foreach ( $wp_meta_boxes[ ASPMain::$products_slug ]['normal']['default'] as $box ) { + if ( in_array( $box['id'], $skip_metaboxes, true ) ) { + continue; + } + if ( 'asp_' === substr( $box['id'], 0, 4 ) ) { + $this->metaboxes[] = $box; + unset( $wp_meta_boxes[ ASPMain::$products_slug ]['normal']['default'][ $box['id'] ] ); + } + } + add_meta_box( 'asp_product_metaboxes_meta_box', __( 'Product Options', 'stripe-payments' ), array( $this, 'display_metaboxes_meta_box' ), ASPMain::$products_slug, 'normal', 'default' ); + } + } + + public function display_metaboxes_meta_box( $post ) { + echo '
'; + echo '
'; + echo '
'; + $first = true; + foreach ( $this->metaboxes as $box ) { + if ( ! is_callable( array( $box['callback'][0], $box['callback'][1] ) ) ) { + continue; + } + echo wp_kses( + sprintf( '%s', $first ? ' nav-tab-active' : '', $box['id'], $box['title'] ), + array( + 'a' => array( + 'class' => array(), + 'data-asp-nav-item' => array(), + 'href' => array(), + ), + 'span' => array(), + ) + ); + $first = false; + } + echo '
'; + $first = true; + foreach ( $this->metaboxes as $box ) { + if ( ! is_callable( array( $box['callback'][0], $box['callback'][1] ) ) ) { + continue; + } + echo wp_kses( + sprintf( '
', $box['id'], $first ? ' wp-asp-product-tab-item-visible' : '' ), + array( + 'div' => array( + 'id' => array(), + 'class' => array(), + ), + ) + ); + echo '' . esc_html( $box['title'] ) . ''; + echo '
'; + call_user_func( array( $box['callback'][0], $box['callback'][1] ), $post ); + echo '
'; + $first = false; + } + echo '
'; + } + + public function display_swpm_meta_box( $post ) { + $current_val = get_post_meta( $post->ID, 'asp_product_swpm_level', true ); + ?> +

+ + ID, 'asp_product_emember_level', true ); + + $all_levels = dbAccess::findAll( WP_EMEMBER_MEMBERSHIP_LEVEL_TABLE, ' id != 1 ', ' id DESC ' ); + $levels_str = '' . "\r\n"; + + foreach ( $all_levels as $level ) { + $levels_str .= '' . "\r\n"; + } + ?> +

+ + ID, 'asp_product_pdf_stamper_enabled', true ); + ?> + +

+ + WP PDF Stamper plugin to be installed on this site.', 'stripe-payments' ); ?> +

+
'; + wp_editor( $post->post_content, 'content', array( 'textarea_name' => 'content' ) ); + } + + public function display_short_description_meta_box( $post ) { + $current_val = get_post_meta( $post->ID, 'asp_product_description', true ); + ?> + +

+ ID, 'asp_product_price', true ); + $current_curr = get_post_meta( $post->ID, 'asp_product_currency', true ); + $current_curr_var = get_post_meta( $post->ID, 'asp_product_currency_variable', true ); + $min_amount = get_post_meta( $post->ID, 'asp_product_min_amount', true ); + + $min_amount = empty( $min_amount ) ? 0 : floatval( $min_amount ); + $post_status = get_post_status( $post ); + $hide_amount_input = get_post_meta( $post->ID, 'asp_product_hide_amount_input', true ); + + $product_types = array(); + $product_types['one_time'] = __( 'One-time payment' ); + $product_types['donation'] = __( 'Donation' ); + + $product_types = apply_filters( 'asp_product_edit_product_types', $product_types, $post ); + + $product_type = get_post_meta( $post->ID, 'asp_product_type', true ); + + $product_type = apply_filters( 'asp_product_edit_product_type_selected', $product_type, $post ); + + if ( ! isset( $product_types[ $product_type ] ) || empty( $product_type ) ) { + $product_type = 'one_time'; + if ( 'auto-draft' !== $post_status && empty( $current_price ) && ! $hide_amount_input ) { + $product_type = 'donation'; + } + } + + $cont = ''; + + echo '

'; + + foreach ( $product_types as $type => $name ) { + ?> + + ', $type === $product_type ? ' asp_product_type_active' : '', $type ); + ob_start(); + switch ( $type ) { + case 'one_time': + ?> + +
+ +

+ +

+
+
+
+ +
+ +

+
+
+ + +
+ +

+ tags + ' ' . sprintf( __( 'If set to 0 then %1$s Stripe\'s minimum amount limit%2$s will be applied.', 'stripe-payments' ), '', '' ); + ?> +

+
+
+ +

+ '; + } + echo '

'; + $allowed_tags = ASP_Utils::asp_allowed_tags(); + echo wp_kses( $cont, $allowed_tags ); + ?> + + ID, 'asp_product_price', true ); + $current_curr = get_post_meta( $post->ID, 'asp_product_currency', true ); + $current_curr_var = get_post_meta( $post->ID, 'asp_product_currency_variable', true ); + do_action( 'asp_product_price_metabox_before_content', $post ); + ?> + +
+ +

+ ' . esc_html( __( 'Leave it blank if you want your customers to enter the amount themselves (e.g. for donation button).', 'stripe-payments' ) ); + ?> +

+
+ +
+ +

+ +

+
'; + $price_mod_help .= __( 'Put negative value if you want to substract the amount instead.', 'stripe-payments' ); + ?> +

+ here.', 'stripe-payments' ), 'https://s-plugins.com/creating-variable-products-using-the-stripe-payments-plugin' ); + ?> +

+ ' . esc_html_e( 'Note: variations for subscription products are currently not supported.', 'stripe-payments' ) . '

'; + } + $current_hide_amount_input = get_post_meta( $post->ID, 'asp_product_hide_amount_input', true ); + ?> + + > + +

+ +
+ +

+
+ ID, 'asp_variations_groups', true ); + $variations_names = get_post_meta( $post->ID, 'asp_variations_names', true ); + $variations_prices = get_post_meta( $post->ID, 'asp_variations_prices', true ); + $variations_urls = get_post_meta( $post->ID, 'asp_variations_urls', true ); + $variations_opts = get_post_meta( $post->ID, 'asp_variations_opts', true ); + if ( empty( $variations_groups ) ) { + $variations_str = __( 'No variations configured for this product.', 'stripe-payments' ); + } + ?> +
+
+ +
+ +
+
+
+
+ + + +
+ + +
+
+ + + + + + + +
+
+ +
+
+
+ + + + + + + + + +
+ + + + +
+
+ +
+ ! empty( $variations_groups ) ? $variations_groups : '', + 'varNames' => $variations_names, + 'varPrices' => $variations_prices, + 'varUrls' => $variations_urls, + 'varOpts' => $variations_opts, + 'str' => array( + 'groupDeleteConfirm' => __( 'Are you sure you want to delete this group?', 'stripe-payments' ), + 'varDeleteConfirm' => __( 'Are you sure you want to delete this variation?', 'stripe-payments' ), + ), + ) + ); + } + + public function display_shipping_tax_meta_box( $post ) { + $current_shipping = get_post_meta( $post->ID, 'asp_product_shipping', true ); + $is_physical_product = get_post_meta( $post->ID, 'asp_is_physical_product', true ); + $current_tax = get_post_meta( $post->ID, 'asp_product_tax', true ); + $tax_variations_type = get_post_meta( $post->ID, 'asp_product_tax_variations_type', true ); + $tax_variations_arr = get_post_meta( $post->ID, 'asp_product_tax_variations', true ); + $shipping_variations_arr = get_post_meta( $post->ID, 'asp_product_shipping_variations', true ); + + $s_var_line_tpl = ' + + + + + +
+ +
+
+ +
+
+ +
+ + + + + + + + '; + + $shipping_out = ''; + if ( ! empty( $shipping_variations_arr ) ) { + foreach ( $shipping_variations_arr as $v ) { + $c_code = '0' === $v['type'] ? $c_code = $v['loc'] : $c_code = ''; + $shipping_out .= sprintf( + $s_var_line_tpl, + ASP_Utils::get_countries_opts( $c_code ), + $v['amount'], + '0' === $v['type'] ? '' : 'display:none', + '1' === $v['type'] ? '' : 'display:none', + '2' === $v['type'] ? '' : 'display:none', + '0' === $v['type'] ? '' : 'disabled', + '1' === $v['type'] ? '' : 'disabled', + '2' === $v['type'] ? '' : 'disabled', + '1' === $v['type'] ? $v['loc'] : '', + '2' === $v['type'] ? $v['loc'] : '', + '0' === $v['type'] ? 'selected' : '', + '1' === $v['type'] ? 'selected' : '', + '2' === $v['type'] ? 'selected' : '' + ); + } + } + + wp_localize_script( + 'asp-admin-edit-product-js', + 'aspShippingVarData', + array( + 'tplLine' => $s_var_line_tpl, + 'cOpts' => ASP_Utils::get_countries_opts(), + 'disabledForSub' => false, + 'str' => array( + 'delConfirm' => __( 'Are you sure you want to delete this variation?', 'stripe-payments' ), + ), + ) + ); + + $t_var_line_tpl = ' + + + + + +
+ +
+
+ +
+
+ +
+ + + + + + + + + '; + + $tax_out = ''; + if ( ! empty( $tax_variations_arr ) ) { + foreach ( $tax_variations_arr as $v ) { + $c_code = '0' === $v['type'] ? $c_code = $v['loc'] : $c_code = ''; + $tax_out .= sprintf( + $t_var_line_tpl, + ASP_Utils::get_countries_opts( $c_code ), + $v['amount'], + '0' === $v['type'] ? '' : 'display:none', + '1' === $v['type'] ? '' : 'display:none', + '2' === $v['type'] ? '' : 'display:none', + '0' === $v['type'] ? '' : 'disabled', + '1' === $v['type'] ? '' : 'disabled', + '2' === $v['type'] ? '' : 'disabled', + '1' === $v['type'] ? $v['loc'] : '', + '2' === $v['type'] ? $v['loc'] : '', + '0' === $v['type'] ? 'selected' : '', + '1' === $v['type'] ? 'selected' : '', + '2' === $v['type'] ? 'selected' : '' + ); + } + } + + $tax_variations_disabled = false; + + $prod_type = get_post_meta( $post->ID, 'asp_product_type', true ); + $prod_type = apply_filters( 'asp_product_edit_product_type_selected', $prod_type, $post ); + if ( 'subscription' === $prod_type + && class_exists( 'ASPSUB_main' ) + && version_compare( ASPSUB_main::ADDON_VER, '2.0.35', '<' ) ) { + $tax_variations_disabled = true; + } + + wp_localize_script( + 'asp-admin-edit-product-js', + 'aspTaxVarData', + array( + 'tplLine' => $t_var_line_tpl, + 'cOpts' => ASP_Utils::get_countries_opts(), + 'disabledForSub' => $tax_variations_disabled, + 'str' => array( + 'delConfirm' => __( 'Are you sure you want to delete this variation?', 'stripe-payments' ), + ), + ) + ); + + ?> +
+

+ here.', 'stripe-payments' ), 'https://s-plugins.com/use-shipping-tax-stripe-payments/' ); + ?> +

+ +
+ +
+ +
+
+ +
+ +

+ '; + esc_html_e( 'Leave it blank if you are not shipping your product or not charging additional shipping costs.', 'stripe-payments' ); + ?> +

+
+ +
+
+ +
+ +

+ +

+ > + + + + + + + + + + + +
+

+ +

+

+ +

+
+
+ +
+ +
+
+ +
+ + +

+ '; + esc_html_e( 'Leave it blank if you don\'t want to apply tax.', 'stripe-payments' ); + ?> +

+ +
+ +
+
+ +
+ +
+ ID, 'asp_surcharge_type', true );; + $surcharge_amount = get_post_meta( $post->ID, 'asp_surcharge_amount', true );; + $surcharge_label = get_post_meta( $post->ID, 'asp_surcharge_label', true );; + ?> +
+

+ + in this tutorial.', 'stripe-payments' ), 'https://s-plugins.com/transaction-surcharge-feature-collect-processing-fees-for-products/' ); + ?> +

+
+ +
+ + +
+ +
+
+ +
+ +

+ +

+
+
+ +
+ +

+ +

+
+
+
+ ID, 'asp_product_quantity', true ); + $allow_custom_quantity = get_post_meta( $post->ID, 'asp_product_custom_quantity', true ); + $enable_stock = get_post_meta( $post->ID, 'asp_product_enable_stock', true ); + $show_remaining = get_post_meta( $post->ID, 'asp_product_show_remaining_items', true ); + $stock_items = get_post_meta( $post->ID, 'asp_product_stock_items', true ); + ?> +

+ + +

+ + +
+ +

+ +
+ +
+ + +

+ + +
+ +

+ +

+ ID, 'asp_product_upload', true ); + ?> +

+ +
+ + +

+ +

+
+

+ + +

+
+ +
    +
  1. +
  2. +
  3. +
+
+ + ID, 'asp_product_thumbnail', true ); + $current_no_popup_thumb = get_post_meta( $post->ID, 'asp_product_no_popup_thumbnail', true ); + ?> +
+ + +

+ +

+
+

+ + +

+
+ + + + + +
+ +

+ +

+ + ID, 'asp_product_collect_billing_addr', true ); + $collect_shipping_addr = get_post_meta( $post->ID, 'asp_product_collect_shipping_addr', true ); + ?> + +

+
+ +

+ +
+ ID, 'asp_product_thankyou_page', true ); + ?> + +

+
+ in this documentation.', 'stripe-payments' ); ?> +

+ ID, 'asp_product_button_text', true ); + $button_class = get_post_meta( $post->ID, 'asp_product_button_class', true ); + $button_only = get_post_meta( $post->ID, 'asp_product_button_only', true ); + + $popup_button_txt = get_post_meta( $post->ID, 'asp_product_popup_button_text', true ); + $show_your_order = get_post_meta( $post->ID, 'asp_product_show_your_order', true ); + ?> +
+ + +
+ +

+ +
+ +

in this tutorial.', 'stripe-payments' ); ?>

+ +

+
+
+ + +
+ +

+ +

+
+ + ID, 'asp_product_custom_field', true ); + + $show_custom_field_settings = ''; + $field_name = $this->asp_main->get_setting( 'custom_field_enabled' ); + if ( ! empty( $field_name ) ) {//Custom field configured so show product specific settings + $show_custom_field_settings = '1'; + } + $show_custom_field_settings = apply_filters( 'asp_show_product_custom_field_settings', $show_custom_field_settings ); //Filter to allow addon to override this + if ( empty( $show_custom_field_settings ) ) { + //Custom field isn't configured. Don't show the settings + _e( 'Custom field is disabled. Configure custom field in the settings menu of this plugin to enable it.', 'stripe-payments' ); + return; + } + ?> +

+ + + + ID ); + } + + public function display_coupons_meta_box( $post ) { + $current_val = get_post_meta( $post->ID, 'asp_product_coupons_setting', true ); + ?> +

+ + + + ID, 'asp_product_force_test_mode', true ); + $plan_id = get_post_meta( $post->ID, 'asp_sub_plan_id', true ); + $auth_only = get_post_meta( $post->ID, 'asp_product_authorize_only', true ); + $extended_authorization = get_post_meta( $post->ID, 'asp_product_extended_authorization', true ); + + $use_other_stripe_acc = get_post_meta( $post->ID, 'asp_use_other_stripe_acc', true ); + + $live_pub_key = get_post_meta( $post->ID, 'asp_stripe_live_pub_key', true ); + $live_sec_key = get_post_meta( $post->ID, 'asp_stripe_live_sec_key', true ); + $test_pub_key = get_post_meta( $post->ID, 'asp_stripe_test_pub_key', true ); + $test_sec_key = get_post_meta( $post->ID, 'asp_stripe_test_sec_key', true ); + ?> +
+ +

+ +
+ +

+ + +

+ +
+ +

+ + +

+
+
+ +

+ +

+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ $post->ID, + ), + ASP_Utils::get_base_pp_url() + ); + $css_class = sprintf( 'asp-attach-product-%d', $post->ID ); + ?> +
+ + +

Usage instructions here.

+
+
+ + +

+
+
+ + +

+
+ $type ) { + $l = filter_var( $shipping_variations_l[ $i ], FILTER_DEFAULT ); + $shipping = floatval( filter_var( $shipping_variations_a[ $i ], FILTER_DEFAULT ) ); + $shipping_variations_arr[] = array( + 'type' => $type, + 'loc' => $l, + 'amount' => $shipping, + ); + } + } + + update_post_meta( $post_id, 'asp_product_shipping_variations', $shipping_variations_arr ); + + $tax = isset( $_POST['asp_product_tax'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_tax'] ) ) : ''; + $tax = floatval( $tax ); + $tax = empty( $tax ) ? '' : $tax; + update_post_meta( $post_id, 'asp_product_tax', $tax ); + + $tax_variations_base = filter_input( INPUT_POST, 'asp_product_tax_variations_base', FILTER_DEFAULT, FILTER_REQUIRE_ARRAY ); + $tax_variations_l = filter_input( INPUT_POST, 'asp_product_tax_variations_l', FILTER_DEFAULT, FILTER_REQUIRE_ARRAY ); + $tax_variations_a = filter_input( INPUT_POST, 'asp_product_tax_variations_a', FILTER_DEFAULT, FILTER_REQUIRE_ARRAY ); + + $tax_variations_arr = array(); + + if ( ! empty( $tax_variations_base ) && ! empty( $tax_variations_l ) && ! empty( $tax_variations_a ) ) { + foreach ( $tax_variations_base as $i => $type ) { + $l = filter_var( $tax_variations_l[ $i ], FILTER_DEFAULT ); + $tax = floatval( filter_var( $tax_variations_a[ $i ], FILTER_DEFAULT ) ); + $tax_variations_arr[] = array( + 'type' => $type, + 'loc' => $l, + 'amount' => $tax, + ); + } + } + + update_post_meta( $post_id, 'asp_product_tax_variations', $tax_variations_arr ); + + $tax_variations_type = isset( $_POST['asp_product_tax_variations_type'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_tax_variations_type'] ) ) : ''; + update_post_meta( $post_id, 'asp_product_tax_variations_type', $tax_variations_type ); + + $quantity = filter_input( INPUT_POST, 'asp_product_quantity', FILTER_SANITIZE_NUMBER_INT ); + $quantity = empty( $quantity ) ? '' : $quantity; + update_post_meta( $post_id, 'asp_product_quantity', $quantity ); + + update_post_meta( $post_id, 'asp_product_custom_quantity', isset( $_POST['asp_product_custom_quantity'] ) ? '1' : false ); + update_post_meta( $post_id, 'asp_product_enable_stock', isset( $_POST['asp_product_enable_stock'] ) ? '1' : false ); + update_post_meta( $post_id, 'asp_product_stock_items', sanitize_text_field( absint( $_POST['asp_product_stock_items'] ) ) ); + + $surcharge_type = isset($_POST['asp_surcharge_type']) ? sanitize_text_field($_POST['asp_surcharge_type']) : ''; + update_post_meta( $post_id, 'asp_surcharge_type', $surcharge_type ); + $surcharge_amount = isset($_POST['asp_surcharge_amount']) ? sanitize_text_field($_POST['asp_surcharge_amount']) : ''; + update_post_meta( $post_id, 'asp_surcharge_amount', $surcharge_amount ); + $surcharge_label = isset($_POST['asp_surcharge_label']) && !empty($_POST['asp_surcharge_label']) ? sanitize_text_field($_POST['asp_surcharge_label']) : ''; + update_post_meta( $post_id, 'asp_surcharge_label', $surcharge_label ); + + $show_remaining = filter_input( INPUT_POST, 'asp_product_show_remaining_items', FILTER_SANITIZE_NUMBER_INT ); + $show_remaining = ! empty( $show_remaining ) ? true : false; + update_post_meta( $post_id, 'asp_product_show_remaining_items', $show_remaining ); + + $force_test_mode = isset( $_POST['asp_product_force_test_mode'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_force_test_mode'] ) ) : ''; + $force_test_mode = ! empty( $force_test_mode ) ? true : false; + update_post_meta( $post_id, 'asp_product_force_test_mode', $force_test_mode ); + + $auth_only = isset( $_POST['asp_product_authorize_only'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_authorize_only'] ) ) : ''; + $auth_only = ! empty( $auth_only ) ? true : false; + update_post_meta( $post_id, 'asp_product_authorize_only', $auth_only ); + + $extended_autorization = isset( $_POST['asp_product_extended_authorization'] ) ? sanitize_text_field($_POST['asp_product_extended_authorization']) : ''; + $extended_autorization = ! empty( $extended_autorization ) ? true : false; + update_post_meta( $post_id, 'asp_product_extended_authorization', $extended_autorization ); + + $use_other_stripe_acc = isset( $_POST['asp_use_other_stripe_acc'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_use_other_stripe_acc'] ) ) : ''; + $use_other_stripe_acc = ! empty( $use_other_stripe_acc ) ? true : false; + update_post_meta( $post_id, 'asp_use_other_stripe_acc', $use_other_stripe_acc ); + + $live_pub_key = isset( $_POST['asp_stripe_live_pub_key'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_stripe_live_pub_key'] ) ) : ''; + update_post_meta( $post_id, 'asp_stripe_live_pub_key', $live_pub_key ); + $live_sec_key = isset( $_POST['asp_stripe_live_sec_key'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_stripe_live_sec_key'] ) ) : ''; + update_post_meta( $post_id, 'asp_stripe_live_sec_key', $live_sec_key ); + $test_pub_key = isset( $_POST['asp_stripe_test_pub_key'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_stripe_test_pub_key'] ) ) : ''; + update_post_meta( $post_id, 'asp_stripe_test_pub_key', $test_pub_key ); + $test_sec_key = isset( $_POST['asp_stripe_test_sec_key'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_stripe_test_sec_key'] ) ) : ''; + update_post_meta( $post_id, 'asp_stripe_test_sec_key', $test_sec_key ); + + if ( $use_other_stripe_acc && ( empty( $live_pub_key ) || empty( $live_sec_key ) || empty( $test_pub_key ) || empty( $test_sec_key ) ) ) { + $text = __( 'Please enter all API keys for other Stripe account.', 'stripe-payments' ); + AcceptStripePayments_Admin::add_admin_notice( 'error', $text, false ); + } + + $pdf_stamper_enabled = isset( $_POST['asp_product_pdf_stamper_enabled'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_pdf_stamper_enabled'] ) ) : ''; + $pdf_stamper_enabled = ! empty( $pdf_stamper_enabled ) ? true : false; + update_post_meta( $post_id, 'asp_product_pdf_stamper_enabled', $pdf_stamper_enabled ); + + update_post_meta( $post_id, 'asp_product_coupons_setting', isset( $_POST['asp_product_coupons_setting'] ) ? sanitize_text_field( $_POST['asp_product_coupons_setting'] ) : '0' ); + update_post_meta( $post_id, 'asp_product_custom_field', isset( $_POST['asp_product_custom_field'] ) ? sanitize_text_field( $_POST['asp_product_custom_field'] ) : '0' ); + update_post_meta( $post_id, 'asp_product_button_text', sanitize_text_field( $_POST['asp_product_button_text'] ) ); + update_post_meta( $post_id, 'asp_product_button_class', sanitize_text_field( $_POST['asp_product_button_class'] ) ); + update_post_meta( $post_id, 'asp_product_button_only', isset( $_POST['asp_product_button_only'] ) ? 1 : 0 ); + update_post_meta( $post_id, 'asp_product_popup_button_text', sanitize_text_field( $_POST['asp_product_popup_button_text'] ) ); + update_post_meta( $post_id, 'asp_product_show_your_order', isset( $_POST['asp_product_show_your_order'] ) ? 1 : 0 ); + update_post_meta( $post_id, 'asp_product_description', sanitize_text_field( $_POST['asp_product_description'] ) ); + update_post_meta( $post_id, 'asp_product_upload', sanitize_url( $_POST['asp_product_upload'], array( 'http', 'https', 'dropbox' ) ) ); + + $thumb_url_raw = filter_input( INPUT_POST, 'asp_product_thumbnail', FILTER_DEFAULT ); + $thumb_url = esc_url_raw( $thumb_url_raw, array( 'http', 'https' ) ); + + if ( ! empty( $thumb_url ) ) { + $curr_thumb = get_post_meta( $post_id, 'asp_product_thumbnail', true ); + $force_regen = $thumb_url === $curr_thumb ? false : true; + update_post_meta( $post_id, 'asp_product_thumbnail', $thumb_url ); + //generate small 100x100 thumbnail + ASP_Utils::get_small_product_thumb( $post_id, $force_regen ); + } else { + //thumbnail is removed + update_post_meta( $post_id, 'asp_product_thumbnail', '' ); + update_post_meta( $post_id, 'asp_product_thumbnail_thumb', '' ); + } + + update_post_meta( $post_id, 'asp_product_no_popup_thumbnail', isset( $_POST['asp_product_no_popup_thumbnail'] ) ? '1' : false ); + update_post_meta( $post_id, 'asp_product_thankyou_page', isset( $_POST['asp_product_thankyou_page'] ) && ! empty( $_POST['asp_product_thankyou_page'] ) ? esc_url_raw( $_POST['asp_product_thankyou_page'] ) : '' ); + $shipping_addr = false; + + if ( isset( $_POST['asp_product_collect_shipping_addr'] ) ) { + $shipping_addr = $_POST['asp_product_collect_shipping_addr']; + } + + update_post_meta( $post_id, 'asp_product_collect_shipping_addr', $shipping_addr ); + update_post_meta( $post_id, 'asp_product_collect_billing_addr', isset( $_POST['asp_product_collect_billing_addr'] ) ? '1' : false ); + update_post_meta( $post_id, 'asp_product_emember_level', ! empty( $_POST['asp_product_emember_level'] ) ? intval( $_POST['asp_product_emember_level'] ) : '' ); + update_post_meta( $post_id, 'asp_product_swpm_level', ! empty( $_POST['asp_product_swpm_level'] ) ? intval( $_POST['asp_product_swpm_level'] ) : '' ); + + do_action( 'asp_save_product_handler', $post_id, $post, $update ); + + //check if this is not subscription product + $asp_plan_id = get_post_meta( $post_id, 'asp_sub_plan_id', true ); + + $product_type = isset( $_POST['asp_product_type_radio'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_type_radio'] ) ) : ''; + + if ( empty( $asp_plan_id ) || ( ! empty( $product_type ) && 'subscription' !== $product_type ) ) { + update_post_meta( $post_id, 'asp_sub_plan_id', 0 ); + + //handle variations + $variations_groups = filter_input( INPUT_POST, 'asp-variations-group-names', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + if ( is_array( $variations_groups ) && ! empty( $variations_groups ) ) { + //we got variations groups. Let's process them + update_post_meta( $post_id, 'asp_variations_groups', array_values( $variations_groups ) ); + $variations_names = filter_input( INPUT_POST, 'asp-variation-names', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + update_post_meta( $post_id, 'asp_variations_names', array_values( $variations_names ) ); + $variations_prices = filter_input( INPUT_POST, 'asp-variation-prices', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + update_post_meta( $post_id, 'asp_variations_prices', array_values( $variations_prices ) ); + $variations_urls = filter_input( INPUT_POST, 'asp-variation-urls', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + update_post_meta( $post_id, 'asp_variations_urls', array_values( $variations_urls ) ); + $variations_opts = filter_input( INPUT_POST, 'asp-variations-opts', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + update_post_meta( $post_id, 'asp_variations_opts', array_values( $variations_opts ) ); + } else { + //we got no variations groups. Let's clear meta values + update_post_meta( $post_id, 'asp_variations_groups', false ); + update_post_meta( $post_id, 'asp_variations_names', false ); + update_post_meta( $post_id, 'asp_variations_prices', false ); + update_post_meta( $post_id, 'asp_variations_urls', false ); + update_post_meta( $post_id, 'asp_variations_opts', false ); + } + + $hide_amount_input = isset( $_POST['asp_product_hide_amount_input'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_hide_amount_input'] ) ) : ''; + $hide_amount_input = ! empty( $hide_amount_input ) ? true : false; + update_post_meta( $post_id, 'asp_product_hide_amount_input', $hide_amount_input ); + + //check if price is in min-max range for the currency set by Stripe: https://stripe.com/docs/currencies#minimum-and-maximum-charge-amounts + $price = sanitize_text_field( $_POST['asp_product_price'] ); + $price = AcceptStripePayments::tofloat( $price ); + $currency = sanitize_text_field( $_POST['asp_product_currency'] ); + + if ( ! empty( $product_type ) ) { + update_post_meta( $post_id, 'asp_product_type', $product_type ); + if ( 'donation' === $product_type ) { + $min_amount = isset( $_POST['asp_product_min_amount'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_min_amount'] ) ) : ''; + $min_amount = abs( floatval( $min_amount ) ); + update_post_meta( $post_id, 'asp_product_min_amount', $min_amount ); + update_post_meta( $post_id, 'asp_product_price', 0 ); + $currency_variable = isset( $_POST['asp_product_currency_variable'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_currency_variable'] ) ) : ''; + $currency_variable = ! empty( $currency_variable ) ? true : false; + update_post_meta( $post_id, 'asp_product_currency_variable', $currency_variable ); + return true; + } + } else { + $currency_variable = isset( $_POST['asp_product_currency_variable'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_product_currency_variable'] ) ) : ''; + $currency_variable = ! empty( $currency_variable ) ? true : false; + update_post_meta( $post_id, 'asp_product_currency_variable', $currency_variable ); + } + + if ( ! empty( $price ) ) { + $price_cents = AcceptStripePayments::is_zero_cents( $currency ) ? round( $price ) : round( $price * 100 ); + //check if we have currency set + if ( empty( $currency ) ) { + //we have not. This means default currency should be used + $currency = $this->asp_main->get_setting( 'currency_code' ); + } + $currency = strtoupper( $currency ); + //let's see if currency has specific minimum set + if ( isset( $this->asp_main->minAmounts[ $currency ] ) ) { + //check if price < minAmount + if ( $price_cents < $this->asp_main->minAmounts[ $currency ] ) { + // it is. Let's add error message + // translators: %1$s - currency code, %2$s - minimum amount, %3$s - current amount + $text = sprintf( __( 'Invalid product price: minimum price in %1$s should be %2$s, you specified %3$s. This price limitation comes from Stripe.', 'stripe-payments' ), $currency, AcceptStripePayments::formatted_price( $this->asp_main->minAmounts[ $currency ], $currency, true ), AcceptStripePayments::formatted_price( $price_cents, $currency, true ) ); + AcceptStripePayments_Admin::add_admin_notice( 'error', $text, false ); + // we don't save invalid price + return false; + } + } + //check if value is not above maximum allowed by Stripe (8 digits; e.g. 99999999 in cents) + if ( $price_cents > 99999999 ) { + // it is. Let's add error message + // translators: %1$s - maximum allowed amount, %2$s - current amount + $text = sprintf( __( 'Invalid product price: maximum allowed product price is %1$s, you specified %2$s', 'stripe-payments' ), $this->asp_main->formatted_price( 99999999, $currency, true ), AcceptStripePayments::formatted_price( $price_cents, $currency, true ) ); + AcceptStripePayments_Admin::add_admin_notice( 'error', $text, false ); + // we don't save invalid price + return false; + } + } elseif ( ! empty( $product_type ) && 'one_time' === $product_type && ! $hide_amount_input ) { + //price cannot be 0 + $text = __( 'Invalid product price: one-time payment product price cannot be zero.', 'stripe-payments' ); + AcceptStripePayments_Admin::add_admin_notice( 'error', $text, false ); + return false; + } + //price seems to be valid, let's save it + update_post_meta( $post_id, 'asp_product_price', $price ); + } + } + } + +} + +new ASP_Admin_Product_Meta_Boxes(); diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-products.php b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-products.php new file mode 100644 index 0000000..4bb8561 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-asp-admin-products.php @@ -0,0 +1,217 @@ + _x( 'Products', 'Post Type General Name', 'stripe-payments' ), + 'singular_name' => _x( 'Product', 'Post Type Singular Name', 'stripe-payments' ), + 'menu_name' => __( 'Stripe Payments', 'stripe-payments' ), + 'all_items' => __( 'Products', 'stripe-payments' ), + 'view_item' => __( 'View Product', 'stripe-payments' ), + 'add_new_item' => __( 'Add New Product', 'stripe-payments' ), + 'add_new' => __( 'Add New Product', 'stripe-payments' ), + 'edit_item' => __( 'Edit Product', 'stripe-payments' ), + 'update_item' => __( 'Update Products', 'stripe-payments' ), + 'search_items' => __( 'Search Product', 'stripe-payments' ), + 'not_found' => __( 'Not found', 'stripe-payments' ), + 'not_found_in_trash' => __( 'Not found in Trash', 'stripe-payments' ), + ); + $menu_icon = WP_ASP_PLUGIN_URL . '/assets/asp-dashboard-menu-icon.png'; + $asp_slug = untrailingslashit( ASPMain::$products_slug ); + + //Trigger filter hook to allow overriding of the default ASP Products Post Type capability. + $asp_post_capability = apply_filters( 'asp_post_type_capability', ASP_MANAGEMENT_PERMISSION ); + $capabilities = array( + 'edit_post' => $asp_post_capability, + 'delete_post' => $asp_post_capability, + 'read_post' => $asp_post_capability, + 'edit_posts' => $asp_post_capability, + 'edit_others_posts' => $asp_post_capability, + 'delete_posts' => $asp_post_capability, + 'publish_posts' => $asp_post_capability, + 'read_private_posts' => $asp_post_capability, + ); + + $args = array( + 'labels' => $labels, + 'capability_type' => 'post', + 'capabilities' => $capabilities, + 'public' => true, + 'publicly_queryable' => true, + 'query_var' => true, + 'has_archive' => false, + 'hierarchical' => false, + 'rewrite' => array( 'slug' => $asp_slug ), + 'supports' => array( 'title' ), + 'show_ui' => true, + 'show_in_nav_menus' => true, + 'show_in_admin_bar' => true, + 'menu_position' => 80, + 'menu_icon' => $menu_icon, + ); + + $args = apply_filters( 'asp_products_post_type_before_register', $args ); + + register_post_type( ASPMain::$products_slug, $args ); + + //add custom columns for list view + add_filter( 'manage_' . ASPMain::$products_slug . '_posts_columns', array( $this, 'manage_columns' ) ); + add_action( 'manage_' . ASPMain::$products_slug . '_posts_custom_column', array( $this, 'manage_custom_columns' ), 10, 2 ); + //set custom columns sortable + add_filter( 'manage_edit-' . ASPMain::$products_slug . '_sortable_columns', array( $this, 'manage_sortable_columns' ) ); + //set custom messages on post save\update etc. + add_filter( 'post_updated_messages', array( $this, 'post_updated_messages' ) ); + + // Temp products post type + $labels = array( + 'name' => _x( 'Products', 'Post Type General Name', 'stripe-payments' ), + 'singular_name' => _x( 'Product', 'Post Type Singular Name', 'stripe-payments' ), + 'all_items' => __( 'Products', 'stripe-payments' ), + 'view_item' => __( 'View Product', 'stripe-payments' ), + 'add_new_item' => __( 'Add New Product', 'stripe-payments' ), + 'add_new' => __( 'Add New Product', 'stripe-payments' ), + 'edit_item' => __( 'Edit Product', 'stripe-payments' ), + 'update_item' => __( 'Update Products', 'stripe-payments' ), + 'search_items' => __( 'Search Product', 'stripe-payments' ), + 'not_found' => __( 'Not found', 'stripe-payments' ), + 'not_found_in_trash' => __( 'Not found in Trash', 'stripe-payments' ), + ); + $asp_slug = untrailingslashit( ASPMain::$temp_prod_slug ); + $args = array( + 'labels' => $labels, + 'capability_type' => 'post', + 'public' => false, + 'publicly_queryable' => false, + 'capability_type' => 'post', + 'query_var' => true, + 'has_archive' => false, + 'hierarchical' => false, + 'rewrite' => array( 'slug' => $asp_slug ), + 'supports' => array( 'title' ), + 'show_ui' => false, + 'show_in_nav_menus' => false, + 'show_in_admin_bar' => false, + 'menu_position' => 80, + 'menu_icon' => $menu_icon, + ); + } + + public function post_updated_messages( $messages ) { + $post = get_post(); + $post_type = get_post_type( $post ); + $slug = ASPMain::$products_slug; + if ( ASPMain::$products_slug === $post_type ) { + $permalink = get_permalink( $post->ID ); + $view_link = sprintf( ' %s', esc_url( $permalink ), __( 'View product', 'stripe-payments' ) ); + $preview_permalink = add_query_arg( 'preview', 'true', $permalink ); + $preview_link = sprintf( ' %s', esc_url( $preview_permalink ), __( 'Preview product', 'stripe-payments' ) ); + $messages[ $slug ] = $messages['post']; + $messages[ $slug ][1] = __( 'Product updated.', 'stripe-payments' ) . $view_link; + $messages[ $slug ][4] = __( 'Product updated.', 'stripe-payments' ); + $messages[ $slug ][6] = __( 'Product published.', 'stripe-payments' ) . $view_link; + $messages[ $slug ][7] = __( 'Product saved.', 'stripe-payments' ); + $messages[ $slug ][8] = __( 'Product submitted.', 'stripe-payments' ) . $preview_link; + $messages[ $slug ][10] = __( 'Product draft updated.', 'stripe-payments' ) . $preview_link; + } + return $messages; + } + + public function manage_columns( $columns ) { + unset( $columns ); + $columns = array( + 'thumbnail' => __( 'Thumbnail', 'stripe-payments' ), + 'title' => __( 'Product Name', 'stripe-payments' ), + 'id' => __( 'ID', 'stripe-payments' ), + 'price' => __( 'Price', 'stripe-payments' ), + 'stock' => __( 'Stock', 'stripe-payments' ), + 'shortcode' => __( 'Shortcode', 'stripe-payments' ), + 'date' => __( 'Date', 'stripe-payments' ), + ); + return $columns; + } + + public function manage_custom_columns( $column, $post_id ) { + switch ( $column ) { + case 'id': + echo esc_html( $post_id ); + break; + case 'stock': + if ( get_post_meta( $post_id, 'asp_product_enable_stock', true ) ) { + $stock_items = get_post_meta( $post_id, 'asp_product_stock_items', true ); + echo ! $stock_items ? __( 'Out of stock', 'stripe-payments' ) : esc_attr( $stock_items ); + } else { + echo '—'; + } + break; + case 'thumbnail': + $thumb_url = ASP_Utils::get_small_product_thumb( $post_id ); + if ( ! $thumb_url ) { + $thumb_url = WP_ASP_PLUGIN_URL . '/assets/product-thumb-placeholder.png'; + } + $edit_link = get_edit_post_link( $post_id ); + $title = __( 'Edit Product', 'stripe-payments' ); + ?> + + + + + + get_setting( 'currency_code' ); + } + if ( $price ) { + $output = AcceptStripePayments::formatted_price( $price, $currency ); + } else { + $output = __( 'Custom', 'stripe-payments' ); + } + //let's apply filter to let addons change price column output if needed + $output = apply_filters( 'asp_products_table_price_column', $output, $price, $currency, $post_id ); + echo wp_kses_post( $output ); + break; + case 'shortcode': + ?> + + time(), + 'dismissed' => false, + ); + update_option( self::OPTION_NAME, $options ); + } + + // Check if the feedback notice was not dismissed already. + if ( isset( $options['dismissed'] ) && ! $options['dismissed'] ) { + $this->display(); + } + + } + + /** + * Display the user feedback notice. + */ + private function display() { + + // Skip if plugin is not being utilized. + if ( ! $this->is_plugin_configured() ) { + return; + } + + // Fetch when plugin was initially activated. + $activated = get_option( 'asp_plugin_activated_time' ); + if(empty($activated)){ + add_option( 'asp_plugin_activated_time', time() ); + } + + // Skip if the plugin is active for less than a defined number of days. + if ( empty( $activated ) || ( $activated + ( DAY_IN_SECONDS * self::DELAY_NOTICE ) ) > time() ) { + // Not enough time; + return; + } + + ?> +
+
+

+

+
+ +

+
+ + +
+ + ASPMain::$products_slug, + 'post_status' => 'publish', + 'posts_per_page' => -1, + ) + ); + + if( $loop->have_posts() ){ + //Products have been configured. + return true; + } + return false; + } + + /** + * Dismiss the user feedback admin notice. + */ + public function feedback_notice_dismiss() { + + $options = get_option( self::OPTION_NAME, array() ); + $options['time'] = time(); + $options['dismissed'] = true; + + update_option( self::OPTION_NAME, $options ); + + if ( is_super_admin() && is_multisite() ) { + $site_list = get_sites(); + foreach ( (array) $site_list as $site ) { + switch_to_blog( $site->blog_id ); + + update_option( self::OPTION_NAME, $options ); + + restore_current_blog(); + } + } + + wp_send_json_success(); + } +} diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-coupons-list-table.php b/wp-content/plugins/stripe-payments/admin/includes/class-coupons-list-table.php new file mode 100644 index 0000000..9b55071 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-coupons-list-table.php @@ -0,0 +1,127 @@ +get_columns(); + // $hidden = $this->get_hidden_columns(); + $sortable = $this->get_sortable_columns(); + + $args = array( + 'posts_per_page' => -1, + 'offset' => 0, + 'post_type' => 'asp_coupons', + ); + + $coupons = get_posts( $args ); + + $data = array(); + + foreach ( $coupons as $coupon ) { + $id = $coupon->ID; + $data[] = array( + 'id' => $id, + 'coupon' => get_post_meta( $id, 'asp_coupon_code', true ), + 'active' => get_post_meta( $id, 'asp_coupon_active', true ), + 'discount' => get_post_meta( $id, 'asp_coupon_discount', true ), + 'discount_type' => get_post_meta( $id, 'asp_coupon_discount_type', true ), + 'red_limit' => get_post_meta( $id, 'asp_coupon_red_limit', true ), + 'red_count' => get_post_meta( $id, 'asp_coupon_red_count', true ), + 'start_date' => get_post_meta( $id, 'asp_coupon_start_date', true ), + 'exp_date' => get_post_meta( $id, 'asp_coupon_exp_date', true ), + ); + } + wp_reset_postdata(); + usort( $data, array( &$this, 'sort_data' ) ); + $perPage = 10; + $currentPage = $this->get_pagenum(); + $totalItems = count( $data ); + $this->set_pagination_args( + array( + 'total_items' => $totalItems, + 'per_page' => $perPage, + ) + ); + $data = array_slice( $data, ( ( $currentPage - 1 ) * $perPage ), $perPage ); + $this->_column_headers = array( $columns, array(), $sortable ); + $this->items = $data; + } + + public function get_columns() { + $columns = array( + 'coupon' => __( 'Coupon Code', 'stripe-payments' ), + 'id' => 'ID', + 'active' => __( 'Active', 'stripe-payments' ), + 'discount' => __( 'Discount Value', 'stripe-payments' ), + 'red_count' => __( 'Redemption Count', 'stripe-payments' ), + 'red_limit' => __( 'Redemption Limit', 'stripe-payments' ), + 'start_date' => __( 'Start Date', 'stripe-payments' ), + 'exp_date' => __( 'Expiry Date', 'stripe-payments' ), + ); + return $columns; + } + + public function column_default( $item, $column_name ) { + switch ( $column_name ) { + case 'exp_date': + return $item[ $column_name ] == 0 ? __( 'No expiry', 'stripe-payments' ) : $item[ $column_name ]; + case 'active': + return $item[ $column_name ] == 0 ? __( 'No', 'stripe-payments' ) : __( 'Yes', 'stripe-payments' ); + case 'coupon': + $str = ''; + // translators: %s is coupon code + $confirm_coupon_delete_msg = sprintf( __( 'Are you sure you want to delete "%s" coupon? This can\'t be undone.', 'stripe-payments' ), $item['coupon'] ); + ob_start(); + ?> + +
+ + | + + + + +
+ array( 'id', false ), + 'coupon' => array( 'coupon', false ), + 'active' => array( 'active', false ), + ); + } + + private function sort_data( $a, $b ) { + // Set defaults + $orderby = 'id'; + $order = 'desc'; + // If orderby is set, use this as the sort column + if ( ! empty( $_GET['orderby'] ) ) { + $orderby = sanitize_text_field($_GET['orderby']); + } + // If order is set use this as the order + if ( ! empty( $_GET['order'] ) ) { + $order = sanitize_text_field($_GET['order']); + } + $result = strcmp( $a[ $orderby ], $b[ $orderby ] ); + if ( $order === 'asc' ) { + return $result; + } + return -$result; + } + +} diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-coupons.php b/wp-content/plugins/stripe-payments/admin/includes/class-coupons.php new file mode 100644 index 0000000..23d0b54 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-coupons.php @@ -0,0 +1,577 @@ + $coupon_code, + 'valid' => true, + ); + //let's find coupon + $coupon = get_posts( + array( + 'meta_key' => 'asp_coupon_code', + 'meta_value' => $coupon_code, + 'posts_per_page' => 1, + 'offset' => 0, + 'post_type' => self::$post_slug, + ) + ); + wp_reset_postdata(); + if ( empty( $coupon ) ) { + //coupon not found + $out['valid'] = false; + $out['err_msg'] = __( 'Coupon not found.', 'stripe-payments' ); + return $out; + } + $coupon = $coupon[0]; + //check if coupon is active + if ( ! get_post_meta( $coupon->ID, 'asp_coupon_active', true ) ) { + $out['valid'] = false; + $out['err_msg'] = __( 'Coupon is not active.', 'stripe-payments' ); + return $out; + } + //check if coupon start date has come + $start_date = get_post_meta( $coupon->ID, 'asp_coupon_start_date', true ); + if ( empty( $start_date ) || strtotime( $start_date ) > time() ) { + $out['valid'] = false; + $out['err_msg'] = __( 'Coupon is not available yet.', 'stripe-payments' ); + return $out; + } + //check if coupon has expired + $exp_date = get_post_meta( $coupon->ID, 'asp_coupon_exp_date', true ); + if ( ! empty( $exp_date ) && strtotime( $exp_date ) < time() ) { + $out['valid'] = false; + $out['err_msg'] = __( 'Coupon has expired.', 'stripe-payments' ); + return $out; + } + //check if redemption limit is reached + $red_limit = get_post_meta( $coupon->ID, 'asp_coupon_red_limit', true ); + $red_count = get_post_meta( $coupon->ID, 'asp_coupon_red_count', true ); + if ( ! empty( $red_limit ) && intval( $red_count ) >= intval( $red_limit ) ) { + $out['valid'] = false; + $out['err_msg'] = __( 'Coupon redemption limit is reached.', 'stripe-payments' ); + return $out; + } + $out['id'] = $coupon->ID; + $out['discount'] = get_post_meta( $coupon->ID, 'asp_coupon_discount', true ); + $out['discountType'] = get_post_meta( $coupon->ID, 'asp_coupon_discount_type', true ); + return $out; + } + + public static function is_coupon_allowed_for_product( $coupon_id, $prod_id ) { + //check if coupon is only available for specific products + $only_for_allowed_products = get_post_meta( $coupon_id, 'asp_coupon_only_for_allowed_products', true ); + if ( $only_for_allowed_products ) { + $allowed_products = get_post_meta( $coupon_id, 'asp_coupon_allowed_products', true ); + if ( is_array( $allowed_products ) && ! in_array( $prod_id, $allowed_products, true ) ) { + return false; + } + } + return true; + } + + public function frontend_check_coupon() { + $out = array(); + + $coupon_code = isset( $_POST['coupon_code'] ) ? sanitize_text_field( stripslashes ( $_POST['coupon_code'] ) ) : ''; + + if ( empty( $coupon_code ) ) { + $out['success'] = false; + $out['msg'] = __( 'Empty coupon code', 'stripe-payments' ); + wp_send_json( $out ); + } + + $coupon_code = strtoupper( $coupon_code ); + + $tax = filter_input( INPUT_POST, 'tax', FILTER_SANITIZE_NUMBER_INT ); + $tax = empty( $tax ) ? 0 : absint( $tax ); + + $shipping = filter_input( INPUT_POST, 'shipping', FILTER_SANITIZE_NUMBER_INT ); + $shipping = empty( $shipping ) ? 0 : absint( $shipping ); + + $coupon = self::get_coupon( $coupon_code ); + + if ( ! $coupon['valid'] ) { + $out['success'] = false; + $out['msg'] = $coupon['err_msg']; + wp_send_json( $out ); + } + + $prod_id = filter_input( INPUT_POST, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + if ( empty( $prod_id ) ) { + $out['success'] = false; + $out['msg'] = __( 'No product ID specified.', 'stripe-payments' ); + wp_send_json( $out ); + } + if ( ! self::is_coupon_allowed_for_product( $coupon['id'], $prod_id ) ) { + $out['success'] = false; + $out['msg'] = __( 'Coupon is not allowed for this product.', 'stripe-payments' ); + wp_send_json( $out ); + } + + $curr = isset( $_POST['curr'] ) ? sanitize_text_field( stripslashes ( $_POST['curr'] ) ) : ''; + $curr = isset( $curr ) ? $curr : ''; + + $discount = $coupon['discount']; + $discount_type = $coupon['discountType']; + + $amount = filter_input( INPUT_POST, 'amount', FILTER_SANITIZE_NUMBER_INT ); + + $perc = AcceptStripePayments::is_zero_cents( $curr ) ? 0 : 2; + + if ( $coupon['discountType'] === 'perc' ) { + $discount_amount = round( $amount * ( $coupon['discount'] / 100 ), 0 ); + } else { + $discount_amount = $coupon['discount'] * ( $perc === 0 ? 1 : 100 ); + } + $out['discountAmount'] = $discount_amount; + $amount = round( ( $amount - $discount_amount ) / ( $perc === 0 ? 1 : 100 ), $perc ); + + $amount = AcceptStripePayments::apply_tax( $amount, $tax, AcceptStripePayments::is_zero_cents( $curr ) ); + + $amount = round( $amount + $shipping / 100, 2 ); + + $out['tax'] = $tax; + $out['shipping'] = $shipping; + $out['amount'] = $amount; + $out['success'] = true; + $out['code'] = $coupon_code; + $out['discount'] = $discount; + $out['discountType'] = $discount_type; + $out['discountStr'] = $coupon_code . ': - ' . ( $discount_type === 'perc' ? $discount . '%' : AcceptStripePayments::formatted_price( $discount, $curr ) ); + $out['newAmountFmt'] = AcceptStripePayments::formatted_price( $amount, $curr ); + wp_send_json( $out ); + } + + public function init_handler() { + $args = array( + 'supports' => array( '' ), + 'hierarchical' => false, + 'public' => false, + 'show_ui' => false, + 'can_export' => false, + 'has_archive' => false, + 'exclude_from_search' => true, + 'publicly_queryable' => false, + 'capability_type' => 'post', + ); + register_post_type( self::$post_slug, $args ); + + if ( ! is_admin() ) { + return; + } + + $post_action = isset( $_POST['asp_coupon_action'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_coupon_action'] ) ) : ''; + $post_action = empty( $post_action ) ? '0' : $post_action; + + switch ( $post_action ) { + case 'save_coupon': + $this->save_coupon(); + break; + case 'save_settings': + $this->save_settings(); + break; + default: + break; + } + + $action = isset( $_GET['action'] ) ? sanitize_text_field( stripslashes ( $_GET['action'] ) ) : ''; + $action = empty( $action ) ? '' : $action; + + if ( $action === 'asp_delete_coupon' ) { + $this->delete_coupon(); + } + } + + public function add_menu() { + //Trigger filter hook to allow overriding of the add-ons menu capability. + $asp_coupons_menu_capability = apply_filters( 'asp_coupons_menu_capability', ASP_MANAGEMENT_PERMISSION ); + add_submenu_page( 'edit.php?post_type=' . ASPMain::$products_slug, __( 'Coupons', 'stripe-payments' ), __( 'Coupons', 'stripe-payments' ), $asp_coupons_menu_capability, 'stripe-payments-coupons', array( $this, 'display_coupons_menu_page' ) ); + } + + public function save_settings() { + check_admin_referer( 'asp-coupons-settings' ); + $settings = get_option( 'AcceptStripePayments-settings' ); + $opts = filter_input( INPUT_POST, 'asp_coupons_opts', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + $settings['coupons_enabled'] = isset( $opts['coupons_enabled'] ) ? 1 : 0; + update_option( 'AcceptStripePayments-settings', $settings ); + + AcceptStripePayments_Admin::add_admin_notice( + 'success', + __( 'Settings updated.', 'stripe-payments' ), + false + ); + } + + public function display_coupons_menu_page() { + + $action = isset( $_GET['action'] ) ? sanitize_text_field( stripslashes ( $_GET['action'] ) ) : ''; + + if ( ! empty( $action ) ) { + if ( $action === 'asp_add_edit_coupon' ) { + //coupon add or edit content + $this->display_coupon_add_edit_page(); + return; + } + } + + $asp_main = AcceptStripePayments::get_instance(); + $coupons_enabled = $asp_main->get_setting( 'coupons_enabled' ); + + if ( ! class_exists( 'WP_List_Table' ) ) { + require_once ABSPATH . 'wp-admin/includes/class-wp-list-table.php'; + } + + require_once WP_ASP_PLUGIN_PATH . 'admin/includes/class-coupons-list-table.php'; + + $coupons_tbl = new ASP_Coupons_Table(); + $coupons_tbl->prepare_items(); + ?> + +
+

+
+
+
+

+
+
+ + + + + + +
+ > +

+
+ +
+
+
+
+
+

+ display(); ?> +
+ $coupon_id, + 'code' => get_post_meta( $coupon_id, 'asp_coupon_code', true ), + 'active' => get_post_meta( $coupon_id, 'asp_coupon_active', true ), + 'discount' => get_post_meta( $coupon_id, 'asp_coupon_discount', true ), + 'discount_type' => get_post_meta( $coupon_id, 'asp_coupon_discount_type', true ), + 'red_limit' => get_post_meta( $coupon_id, 'asp_coupon_red_limit', true ), + 'red_count' => get_post_meta( $coupon_id, 'asp_coupon_red_count', true ), + 'start_date' => get_post_meta( $coupon_id, 'asp_coupon_start_date', true ), + 'exp_date' => get_post_meta( $coupon_id, 'asp_coupon_exp_date', true ), + 'only_for_allowed_products' => get_post_meta( $coupon_id, 'asp_coupon_only_for_allowed_products', true ), + 'allowed_products' => get_post_meta( $coupon_id, 'asp_coupon_allowed_products', true ), + 'per_order' => get_post_meta( $coupon_id, 'asp_coupon_per_order', true ), + ); + } + //generate array with all products + $posts = get_posts( + array( + 'post_type' => untrailingslashit( ASPMain::$products_slug ), + 'post_status' => 'publish', + 'numberposts' => -1, + ) + ); + + $prod_inputs = ''; + $input_tpl = ''; + if ( $posts ) { + foreach ( $posts as $the_post ) { + $checked = ''; + if ( ! empty( $coupon ) && is_array( $coupon['allowed_products'] ) ) { + if ( in_array( strval( $the_post->ID ), $coupon['allowed_products'], true ) ) { + $checked = ' checked'; + } + } + $prod_inputs .= sprintf( $input_tpl, $the_post->ID, $checked, $the_post->post_title ); + $prod_inputs .= '
'; + } + } else { + $prod_inputs = __( 'No products created yet.', 'stripe-payments' ); + } + wp_reset_postdata(); + ?> +
+

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ > +

+
+ + +

+
+ +

+
+ value=""> + +

+ +
+ +

+
+ +

+
+ +

+
+ +

+
+ +
+ + +

+
+ +
+
+ + post_type !== self::$post_slug ) { + AcceptStripePayments_Admin::add_admin_notice( + 'error', + // translators: %d is coupon ID + sprintf( __( 'Can\'t delete coupon: post #%d is not a coupon.', 'stripe-payments' ), $coupon_id ), + false + ); + return false; + } + check_admin_referer( 'delete-coupon_' . $coupon_id ); + wp_delete_post( $coupon_id, true ); + + AcceptStripePayments_Admin::add_admin_notice( + 'success', + // translators: %d is coupon ID + sprintf( __( 'Coupon #%d has been deleted.', 'stripe-payments' ), $coupon_id ), + false + ); + + wp_safe_redirect( remove_query_arg( array( 'action', 'asp_coupon_id', '_wpnonce' ) ) ); + exit(); + } + + public function save_coupon() { + check_admin_referer( 'asp-add-edit-coupon' ); + + $coupon = filter_input( INPUT_POST, 'asp_coupon', FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + + $coupon_id = isset( $_POST['asp_coupon_id'] ) ? absint( $_POST['asp_coupon_id'] ) : false; + + $is_edit = $coupon_id ? true : false; + + $err_msg = array(); + + $coupon['active'] = isset( $coupon['active'] ) ? 1 : 0; + + $coupon['per_order'] = isset( $coupon['per_order'] ) ? 1 : 0; + + $coupon['code'] = ! empty( $coupon['code'] ) ? sanitize_text_field( $coupon['code'] ) : ''; + + if ( empty( $coupon['code'] ) ) { + $err_msg[] = __( 'Please enter coupon code.', 'stripe-payments' ); + } + + if ( empty( $coupon['discount'] ) ) { + $err_msg[] = __( 'Please enter discount.', 'stripe-payments' ); + } + + if ( $coupon['discount_type'] === 'perc' && $coupon['discount'] > 100 ) { + $err_msg[] = __( "Discount can't be more than 100%.", 'stripe-payments' ); + } + + if ( ! empty( $err_msg ) ) { + foreach ( $err_msg as $msg ) { + AcceptStripePayments_Admin::add_admin_notice( 'error', $msg, false ); + } + return false; + } + + if ( ! $is_edit ) { + $post = array(); + $post['post_title'] = ''; + $post['post_status'] = 'publish'; + $post['content'] = ''; + $post['post_type'] = self::$post_slug; + $coupon_id = wp_insert_post( $post ); + } + + if ( empty( $coupon['allowed_products'] ) ) { + $coupon['allowed_products'] = array(); + } + + foreach ( $coupon as $key => $value ) { + update_post_meta( $coupon_id, 'asp_coupon_' . $key, $value ); + } + do_action( 'asp_admin_save_coupon', $coupon_id, $coupon ); + + AcceptStripePayments_Admin::add_admin_notice( + 'success', + // translators: %s is coupon code + sprintf( $is_edit ? __( 'Coupon "%s" has been updated.', 'stripe-payments' ) : __( 'Coupon "%s" has been created.', 'stripe-payments' ), $coupon['code'] ), + false + ); + + wp_safe_redirect( 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-coupons' ); + exit; + } + +} + +new AcceptStripePayments_CouponsAdmin(); diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-order.php b/wp-content/plugins/stripe-payments/admin/includes/class-order.php new file mode 100644 index 0000000..481fce2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-order.php @@ -0,0 +1,408 @@ +%s'; + public $AcceptStripePayments; + + + public function __construct() { + self::$instance = $this; + + $this->AcceptStripePayments = AcceptStripePayments::get_instance(); + + if ( is_admin() ) { + //products meta boxes handler + require_once WP_ASP_PLUGIN_PATH . 'admin/includes/class-asp-admin-order-meta-boxes.php'; + + $show_incomplete = $this->AcceptStripePayments->get_setting( 'show_incomplete_orders' ); + + if ( ! $show_incomplete ) { + add_filter( 'pre_get_posts', array( $this, 'filter_posts' ) ); + add_filter( 'views_edit-stripe_order', array( $this, 'remove_views' ) ); + } + } + } + + public function register_post_type() { + $labels = array( + 'name' => _x( 'Orders', 'Post Type General Name', 'stripe-payments' ), + 'singular_name' => _x( 'Order', 'Post Type Singular Name', 'stripe-payments' ), + 'parent_item_colon' => __( 'Parent Order:', 'stripe-payments' ), + 'all_items' => __( 'Orders', 'stripe-payments' ), + 'view_item' => __( 'View Order', 'stripe-payments' ), + 'add_new_item' => __( 'Add New Order', 'stripe-payments' ), + 'add_new' => __( 'Add New', 'stripe-payments' ), + 'edit_item' => __( 'Edit Order', 'stripe-payments' ), + 'update_item' => __( 'Update Order', 'stripe-payments' ), + 'search_items' => __( 'Search Order', 'stripe-payments' ), + 'not_found' => __( 'Not found', 'stripe-payments' ), + 'not_found_in_trash' => __( 'Not found in Trash', 'stripe-payments' ), + ); + $args = array( + 'label' => __( 'orders', 'stripe-payments' ), + 'description' => __( 'Stripe Orders', 'stripe-payments' ), + 'labels' => $labels, + 'supports' => array( 'title', 'editor', 'excerpt', 'revisions', 'custom-fields' ), + 'hierarchical' => false, + 'public' => false, + 'show_ui' => true, + 'show_in_menu' => 'edit.php?post_type=' . ASPMain::$products_slug, + 'can_export' => true, + 'has_archive' => false, + 'exclude_from_search' => true, + 'publicly_queryable' => false, + 'capability_type' => 'post', + 'capabilities' => array( + 'create_posts' => false, // Removes support for the "Add New" function + ), + 'map_meta_cap' => true, + ); + + $args = apply_filters( 'asp_stripe_order_register_post_type_args', $args ); + + register_post_type( 'stripe_order', $args ); + + add_filter( 'manage_stripe_order_posts_columns', array( $this, 'manage_columns' ) ); + add_action( 'manage_stripe_order_posts_custom_column', array( $this, 'manage_custom_columns' ), 10, 2 ); + //set custom columns sortable + // add_filter( 'manage_edit-stripe_order_sortable_columns', array( $this, 'manage_sortable_columns' ) ); + + if ( wp_doing_ajax() ) { + add_action( 'wp_ajax_asp_order_capture_confirm', array( $this, 'order_capture_confirm' ) ); + add_action( 'wp_ajax_asp_order_capture_cancel', array( $this, 'order_capture_cancel' ) ); + } + + } + + /** + * Return an instance of this class. + * + * @since 1.0.0 + * + * @return object A single instance of this class. + */ + public static function get_instance() { + + // If the single instance hasn't been set, set it now. + if ( null === self::$instance ) { + self::$instance = new self(); + } + + return self::$instance; + } + + public function filter_posts( $wp_query ) { + global $pagenow; + + if ( 'edit.php' !== $pagenow ) { + return; + } + + if ( ! is_admin() ) { + return; + } + + if ( $wp_query->is_main_query() && 'stripe_order' === $wp_query->query['post_type'] ) { + if ( empty( $wp_query->query_vars['post_status'] ) ) { + $wp_query->query_vars['post_status'] = array( + 'publish', + 'private', + 'trash', + ); + } + } + } + + public function remove_views( $views ) { + if ( ! current_user_can( ASP_MANAGEMENT_PERMISSION ) ) { + return $views; + } + + $remove_views = array( 'mine', 'pending', 'draft' ); + + foreach ( (array) $remove_views as $view ) { + if ( isset( $views[ $view ] ) ) { + unset( $views[ $view ] ); + } + } + return $views; + } + + public function manage_columns( $columns ) { + $custom_columns = array( + 'total' => __( 'Total', 'stripe-payments' ), + 'status' => __( 'Status', 'stripe-payments' ), + ); + $columns = array_merge( $columns, $custom_columns ); + return $columns; + } + + public function manage_custom_columns( $column, $post_id ) { + switch ( $column ) { + case 'status': + $data = get_post_meta( $post_id, 'order_data', true ); + $status = get_post_meta( $post_id, 'asp_order_status', true ); + + if ( empty( $status ) ) { + + if ( ! isset( $data['charge']->paid ) || + ( isset( $data['charge']->paid ) && $data['charge']->paid && + $data['charge']->captured ) ) { + echo sprintf( $this->order_status_tpl, ' paid', __( 'Paid', 'stripe-payments' ) ); + } else { + if ( isset( $data['charge']->captured ) && false === $data['charge']->captured && + empty( $data['charge']->amount_refunded ) ) { + echo sprintf( $this->order_status_tpl, ' authorized', __( 'Authorized', 'stripe-payments' ) ); + $action_nonce = wp_create_nonce( 'asp-order-actions-' . $post_id ); + echo '
'; + echo sprintf( '' . __( 'Capture', 'stripe-payments' ) . ' | ', $post_id, $action_nonce ); + echo sprintf( '' . __( 'Cancel', 'stripe-payments' ) . '', $post_id, $action_nonce ); + echo '
'; + } else { + echo sprintf( $this->order_status_tpl, ' canceled', __( 'Canceled', 'stripe-payments' ) ); + } + } + } else { + //we have status set + switch ( $status ) { + case 'authorized': + echo sprintf( $this->order_status_tpl, ' ' . $status, self::get_status_str( $status ) ); + $action_nonce = wp_create_nonce( 'asp-order-actions-' . $post_id ); + echo '
'; + echo sprintf( '' . __( 'Capture', 'stripe-payments' ) . ' | ', $post_id, $action_nonce ); + echo sprintf( '' . __( 'Cancel', 'stripe-payments' ) . '', $post_id, $action_nonce ); + echo '
'; + break; + case 'error': + $order_events = get_post_meta( $post_id, 'asp_order_events', false ); + if ( ! empty( $order_events ) && is_array( $order_events ) ) { + echo sprintf( '%s', ' ' . $status, end( $order_events[0] )['comment'], self::get_status_str( $status ) ); + } else { + echo sprintf( $this->order_status_tpl, ' ' . $status, self::get_status_str( $status ) ); + } + break; + default: + echo sprintf( $this->order_status_tpl, ' ' . $status, self::get_status_str( $status ) ); + break; + } + } + break; + case 'total': + $data = get_post_meta( $post_id, 'order_data', true ); + if ( $data ) { + echo ASP_Utils::formatted_price( $data['paid_amount'], $data['currency_code'] ); + } else { + echo '—'; + } + break; + } + } + + public function order_capture_confirm() { + $post_id = filter_input( INPUT_POST, 'order_id', FILTER_SANITIZE_NUMBER_INT ); + if ( empty( $post_id ) ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Invalid order ID', 'stripe-payments' ), + ) + ); + } + + $nonce = isset( $_POST['nonce'] ) ? sanitize_text_field( stripslashes ( $_POST['nonce'] ) ) : ''; + if ( empty( $nonce ) || false === wp_verify_nonce( $nonce, 'asp-order-actions-' . $post_id ) ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Nonce check failed', 'stripe-payments' ), + ) + ); + } + + $order = new ASP_Order_Item(); + $order->set_id( $post_id ); + + ASP_Utils::load_stripe_php_sdk_if_enabled();//Load the Stripe SDK (if enabled) so it can read the Stripe classes in the order object. + $data = get_post_meta( $post_id, 'order_data', true ); + + $asp_main = AcceptStripePayments::get_instance(); + + try { + ASP_Utils::load_stripe_lib(); + $key = $data['is_live'] ? $asp_main->APISecKey : $asp_main->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + $api = ASP_Stripe_API::get_instance(); + $api->set_api_key( $key ); + + if ( ASP_Utils::use_internal_api() ) { + $intent = $api->get( 'payment_intents/' . $data['charge']->payment_intent ); + } else { + $intent = \Stripe\PaymentIntent::retrieve( $data['charge']->payment_intent ); + } + + if ( 'requires_capture' !== $intent->status ) { + //already captured or canceled + $data['charge'] = $intent->charges->data[0]; + update_post_meta( $post_id, 'order_data', $data ); + + if ( 'canceled' === $intent->status ) { + $order->change_status( 'canceled' ); + } + + if ( 'succeeded' === $intent->status ) { + $order->change_status( 'paid' ); + } + + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Funds already captured or refunded', 'stripe-payments' ), + 'order_status' => sprintf( $this->order_status_tpl, ' ' . $order->get_status(), self::get_status_str( $order->get_status() ) ), + ) + ); + } + + if ( ASP_Utils::use_internal_api() ) { + $intent = $api->post( 'payment_intents/' . $data['charge']->payment_intent . '/capture' ); + } else { + $intent->capture(); + } + } catch ( \Exception $e ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => $e->getMessage(), + ) + ); + } + + $data['charge'] = $intent->charges->data[0]; + update_post_meta( $post_id, 'order_data', $data ); + + $order->change_status( 'paid' ); + + wp_send_json( + array( + 'success' => true, + 'order_status' => sprintf( $this->order_status_tpl, ' ' . $order->get_status(), self::get_status_str( $order->get_status() ) ), + ) + ); + } + + public function order_capture_cancel() { + $post_id = filter_input( INPUT_POST, 'order_id', FILTER_SANITIZE_NUMBER_INT ); + if ( empty( $post_id ) ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Invalid order ID', 'stripe-payments' ), + ) + ); + } + + $nonce = isset( $_POST['nonce'] ) ? sanitize_text_field( stripslashes ( $_POST['nonce'] ) ) : ''; + if ( empty( $nonce ) || false === wp_verify_nonce( $nonce, 'asp-order-actions-' . $post_id ) ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Nonce check failed', 'stripe-payments' ), + ) + ); + } + + $order = new ASP_Order_Item(); + $order->set_id( $post_id ); + + ASP_Utils::load_stripe_php_sdk_if_enabled();//Load the Stripe SDK (if enabled) so it can read the Stripe classes in the order object. + $data = get_post_meta( $post_id, 'order_data', true ); + + $asp_main = AcceptStripePayments::get_instance(); + + try { + ASP_Utils::load_stripe_lib(); + $key = $data['is_live'] ? $asp_main->APISecKey : $asp_main->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + $api = ASP_Stripe_API::get_instance(); + $api->set_api_key( $key ); + + if ( ASP_Utils::use_internal_api() ) { + $intent = $api->get( 'payment_intents/' . $data['charge']->payment_intent ); + } else { + $intent = \Stripe\PaymentIntent::retrieve( $data['charge']->payment_intent ); + } + + if ( 'requires_capture' !== $intent->status ) { + //already captured or canceled + $data['charge'] = $intent->charges->data[0]; + update_post_meta( $post_id, 'order_data', $data ); + + if ( 'canceled' === $intent->status ) { + $order->change_status( 'canceled' ); + } + + if ( 'succeeded' === $intent->status ) { + $order->change_status( 'paid' ); + } + + wp_send_json( + array( + 'success' => false, + 'err_msg' => __( 'Funds already captured or refunded', 'stripe-payments' ), + 'order_status' => sprintf( $this->order_status_tpl, ' ' . $order->get_status(), self::get_status_str( $order->get_status() ) ), + ) + ); + } + + if ( ASP_Utils::use_internal_api() ) { + $intent = $api->post( 'payment_intents/' . $data['charge']->payment_intent . '/cancel' ); + } else { + $intent->cancel(); + } + } catch ( \Exception $e ) { + wp_send_json( + array( + 'success' => false, + 'err_msg' => $e->getMessage(), + ) + ); + } + + $data['charge'] = $intent->charges->data[0]; + update_post_meta( $post_id, 'order_data', $data ); + + $order->change_status( 'canceled' ); + + wp_send_json( + array( + 'success' => true, + 'order_status' => sprintf( $this->order_status_tpl, ' ' . $order->get_status(), self::get_status_str( $order->get_status() ) ), + ) + ); + } + + public static function get_status_str( $status ) { + $status_str = array( + 'incomplete' => __( 'Incomplete', 'stripe-payments' ), + 'paid' => __( 'Paid', 'stripe-payments' ), + 'authorized' => __( 'Authorized', 'stripe-payments' ), + 'canceled' => __( 'Canceled', 'stripe-payments' ), + 'error' => __( 'Error', 'stripe-payments' ), + ); + if ( isset( $status_str[ $status ] ) ) { + return $status_str[ $status ]; + } + return false; + } + +} diff --git a/wp-content/plugins/stripe-payments/admin/includes/class-variations.php b/wp-content/plugins/stripe-payments/admin/includes/class-variations.php new file mode 100644 index 0000000..a8cca03 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/class-variations.php @@ -0,0 +1,70 @@ +prod_id = $prod_id; + $this->_get_variations(); + } + + private function _get_variations() { + $variations_groups = get_post_meta( $this->prod_id, 'asp_variations_groups', true ); + if ( empty( $variations_groups ) ) { + return false; + } + $this->groups = $variations_groups; + foreach ( $variations_groups as $grp_id => $group ) { + $variations_names = get_post_meta( $this->prod_id, 'asp_variations_names', true ); + if ( ! empty( $variations_names ) ) { + $variations_prices_orig = get_post_meta( $this->prod_id, 'asp_variations_prices', true ); + $variations_prices = apply_filters( 'asp_variations_prices_filter', $variations_prices_orig, $this->prod_id ); + $variations_urls = get_post_meta( $this->prod_id, 'asp_variations_urls', true ); + $variations_opts = get_post_meta( $this->prod_id, 'asp_variations_opts', true ); + $this->variations[ $grp_id ]['names'] = $variations_names[ $grp_id ]; + $this->variations[ $grp_id ]['prices'] = $variations_prices[ $grp_id ]; + $this->variations[ $grp_id ]['urls'] = $variations_urls[ $grp_id ]; + $this->variations[ $grp_id ]['opts'] = isset( $variations_opts[ $grp_id ] ) ? $variations_opts[ $grp_id ] : 0; + } + } + } + + public function get_variation( $grp_id, $var_id ) { + + if ( empty( $this->variations[ $grp_id ] ) ) { + return false; + } + if ( empty( $this->variations[ $grp_id ]['names'][ $var_id ] ) ) { + return false; + } + $var = array( + 'grp_id' => $grp_id, + 'id' => $var_id, + 'group_name' => $this->groups[ $grp_id ], + 'name' => $this->variations[ $grp_id ]['names'][ $var_id ], + 'price' => $this->variations[ $grp_id ]['prices'][ $var_id ], + 'url' => $this->variations[ $grp_id ]['urls'][ $var_id ], + 'opts' => isset( $this->variations[ $grp_id ]['opts'][ $var_id ] ) ? $this->variations[ $grp_id ]['opts'][ $var_id ] : array(), + ); + return $var; + } + + public function get_group( $grp_id ) { + if ( empty( $this->variations[ $grp_id ] ) ) { + return false; + } + + $grp = array( + 'id' => $grp_id, + 'group_name' => $this->groups[ $grp_id ], + 'type' => isset( $this->variations[ $grp_id ]['opts']['type'] ) ? $this->variations[ $grp_id ]['opts']['type'] : $this->variations[ $grp_id ]['opts'], + 'opts' => isset( $this->variations[ $grp_id ]['opts'] ) ? $this->variations[ $grp_id ]['opts'] : array(), + ); + + return $grp; + } + +} diff --git a/wp-content/plugins/stripe-payments/admin/includes/index.php b/wp-content/plugins/stripe-payments/admin/includes/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/includes/index.php @@ -0,0 +1 @@ + + +
+

+ +
+
+ + __( 'Subscription Payments', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/subscription-payments.png', + 'description' => __( 'This addon allows you to configure and sell subscription and recurring payments to your customers.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-subscription-payments-addon/', + 'settings_url' => sprintf( 'edit.php?post_type=%s&page=stripe-payments-settings#sub', ASPMain::$products_slug ), + 'installed' => class_exists( 'ASPSUB_main' ) ? true : false, + ); + array_push( $addons_data, $addon_1 ); + + $addon_2 = array( + 'name' => __( 'Apple and Google Pay', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/apple-android-pay.png', + 'description' => __( 'This addon allows you to accept payments from your customers using Apple and Google Pay.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-additional-payment-methods-addon/', + 'settings_url' => sprintf( 'edit.php?post_type=%s&page=stripe-payments-settings#apm', ASPMain::$products_slug ), + 'installed' => class_exists( 'ASPAPM_main' ) ? true : false, + ); + array_push( $addons_data, $addon_2 ); + + $addon_3 = array( + 'name' => __( 'Secure Downloads', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/secure-downloads.png', + 'description' => __( 'Digital products sold to your customers are secured by an encrypted download link that expires automatically.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/protecting-your-digital-downloads-using-the-secure-downloads-addon/', + 'settings_url' => sprintf( 'edit.php?post_type=%s&page=stripe-payments-settings#securedownloads', ASPMain::$products_slug ), + 'installed' => class_exists( 'ASPSD_main' ) ? true : false, + ); + array_push( $addons_data, $addon_3 ); + + $addon_4 = array( + 'name' => __( 'MailChimp Integration', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/maichimp-integration.png', + 'description' => __( 'This extension allows you to add customers to your Mailchimp list after they purchase a product.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/mailchimp-integration-addon-stripe-payments/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#mailchimp', + 'installed' => class_exists( 'ASPMCI_main' ) ? true : false, + ); + array_push( $addons_data, $addon_4 ); + + $addon_6 = array( + 'name' => __( 'Alipay Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/alipay-stripe-payments-addon.png', + 'description' => __( 'When you enable this addon, it gives you the ability to accept payments via Alipay on your website', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/alipay-addon-stripe-payments-plugin/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#alipay', + 'installed' => class_exists( 'ASPALI_main' ) ? true : false, + ); + array_push( $addons_data, $addon_6 ); + + $addon_7 = array( + 'name' => __( 'WP Affiliate Integration', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/wp-affiliate-integration.png', + 'description' => __( 'The affiliate plugin will track customers that purchase items and award the affiliate that referred the customer.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-wp-affiliate-plugin-integration/', + 'settings_url' => '', + 'installed' => false, + ); + array_push( $addons_data, $addon_7 ); + + $addon_8 = array( + 'name' => __( 'Multi-Currency Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/stripe-multi-currency-addon.png', + 'description' => __( 'The multi-currency addon allows your customers to pick a currency and pay for the item in that currency.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-multi-currency-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#multicurr', + 'installed' => class_exists( 'ASPMULTICURR_main' ) ? true : false, + ); + array_push( $addons_data, $addon_8 ); + + $addon_9 = array( + 'name' => __( 'Custom Messages Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/stripe-custom-messages-addon.png', + 'description' => __( 'This addon allows you to customize a number of common messages displayed by the Stripe Payments Plugin.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-custom-messages-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#custmsg', + 'installed' => class_exists( 'ASPCUSTMSG_main' ) ? true : false, + ); + array_push( $addons_data, $addon_9 ); + + $addon_10 = array( + 'name' => __( 'AWeber Integration Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/aweber-integration-addon.png', + 'description' => __( 'This addon allows you to add customers to your AWeber list after they purchase a product.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/aweber-integration-addon-for-stripe-payments/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#aweber', + 'installed' => class_exists( 'ASPAWEBER_main' ) ? true : false, + ); + array_push( $addons_data, $addon_10 ); + + $addon_11 = array( + 'name' => __( 'ConvertKit Integration Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/convertkit-integration.png', + 'description' => __( 'This addon allows you to add customers to your ConvertKit list after they purchase a product.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-convertkit-integration-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#convertkit', + 'installed' => class_exists( 'ASPCK_main' ) ? true : false, + ); + array_push( $addons_data, $addon_11 ); + + $addon_12 = array( + 'name' => __( 'Post Payment Actions Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/post-payment-actions.png', + 'description' => __( 'Post Payment Actions are triggered after a successful Stripe Payments transaction has been completed.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/post-payment-actions-addon-for-stripe-payments/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#ppa', + 'installed' => class_exists( 'ASPPPA_main' ) ? true : false, + ); + array_push( $addons_data, $addon_12 ); + + $addon_13 = array( + 'name' => __( 'SOFORT Payments Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/sofort-payments.png', + 'description' => __( 'The SOFORT Addon can be used along side the Stripe Payments Plugin to allow your customers to pay using SOFORT.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-sofort-payment-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#sofort', + 'installed' => class_exists( 'ASPSOFORT_main' ) ? true : false, + ); + array_push( $addons_data, $addon_13 ); + + $addon_14 = array( + 'name' => __( 'iDEAL Payments Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/iDEAL-payment-gateway-addon.png', + 'description' => __( 'The iDEAL Addon can be used along side the Stripe Payments Plugin to allow your customers to pay using iDEAL gateway.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-ideal-payment-addon/', + 'settings_url' => sprintf( 'edit.php?post_type=%s&page=stripe-payments-settings#ideal', ASPMain::$products_slug ), + 'installed' => class_exists( 'ASPIDEAL_main' ) ? true : false, + ); + array_push( $addons_data, $addon_14 ); + + $addon_15 = array( + 'name' => __( 'Additional Custom Fields', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/additional-custom-fields.png', + 'description' => __( 'The Additional Custom Fields Addon allows you to collect information from your customers before they proceed to checkout.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-additional-custom-fields-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#acf', + 'installed' => class_exists( 'ASPACF_main' ) ? true : false, + ); + array_push( $addons_data, $addon_15 ); + + $addon_16 = array( + 'name' => __( 'MailerLite Addon', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/mailer-lite-integration.png', + 'description' => __( 'This addon allows you to add customers to your MailerLite group after they purchase a product.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-mailerlite-integration-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#mailerlite', + 'installed' => class_exists( 'ASP_Mailerlite_Main' ) ? true : false, + ); + array_push( $addons_data, $addon_16 ); + + $addon_17 = array( + 'name' => __( 'Google Analytics Tracking', 'stripe-payments' ), + 'thumbnail' => WP_ASP_PLUGIN_URL . '/admin/assets/images/google-analytics-ecommerce-tracking.png', + 'description' => __( 'This addon allows you to do Google analytics eCommerce tracking for our Stripe plugin transactions.', 'stripe-payments' ), + 'page_url' => 'https://s-plugins.com/stripe-payments-google-analytics-ecommerce-tracking-addon/', + 'settings_url' => 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-settings#gaet', + 'installed' => class_exists( 'ASPGAET_main' ) ? true : false, + ); + array_push( $addons_data, $addon_17 ); + + /* Show the addons list */ + foreach ( $addons_data as $addon ) { + $output .= '
'; + + $output .= '
'; + if ( $addon['installed'] ) { + $output .= '
'; + } + + $img_src = $addon['thumbnail']; + $output .= '' . $addon['name'] . ''; + $output .= '
'; //end thumbnail + + $output .= '
'; + $output .= '
'; + $output .= '' . $addon['name'] . ''; + $output .= '
'; //end name + + $output .= '
'; + $output .= $addon['description']; + $output .= '
'; //end description + + $output .= ''; //end detils link + $output .= '
'; //end body + + $output .= '
'; //end canvas + } + + echo wp_kses( $output, ASP_Utils::asp_allowed_tags() ); + ?> + +
+
+
diff --git a/wp-content/plugins/stripe-payments/admin/views/admin.php b/wp-content/plugins/stripe-payments/admin/views/admin.php new file mode 100644 index 0000000..72f9056 --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/views/admin.php @@ -0,0 +1,161 @@ +get_setting('captcha_type'); + + ?> +
+ +

+ + + +
+ + + + + +
+
Loading...
+
+
+
+
+ + +
+
+ +
+
+ +
+
+ +
> + plugin_slug . '-recaptcha' ); ?> +
+
> + plugin_slug . '-eprecaptcha' ); ?> +
+
> + plugin_slug . '-hcaptcha' ); ?> +
+
+ plugin_slug . '-txn-rate-limit' ); ?> +
+
+ +
+
+
+

+
+ Stripe Payments plugin setup instructions and tutorials to learn how to configure and use it.', 'stripe-payments' ), 'https://s-plugins.com/stripe-payments-plugin-tutorials/' ); + ?> +
+
+
+

+
+ Add-Ons!', 'stripe-payments' ), 'edit.php?post_type=' . ASPMain::$products_slug . '&page=stripe-payments-addons' ); + ?> +
+
+ +
+

+
+ %s', __( 'rating!', 'stripe-payments' ) ) ); + ?> + +
+
+
+

+
+ %s', _x( 'Testing Version', 'Link for testing version of the plugin', 'stripe-payments' ) ) ); + ?> +
+
+
+ +
+ +
+ + + $tab, + 'currencies' => AcceptStripePayments::get_currencies(), + 'str' => array( + 'logClearConfirm' => __( 'Are you sure you want to clear log?', 'stripe-payments' ), + 'logCleared' => __( 'Log cleared.', 'stripe-payments' ), + 'errorOccurred' => __( 'Error occurred:', 'stripe-payments' ), + ), + 'asp_settings_ajax_nonce' => wp_create_nonce('asp_settings_ajax_nonce'), + ) + ); + wp_enqueue_script( 'asp-admin-settings-js' ); +} +?> +
diff --git a/wp-content/plugins/stripe-payments/admin/views/blocks.php b/wp-content/plugins/stripe-payments/admin/views/blocks.php new file mode 100644 index 0000000..5e580bf --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/views/blocks.php @@ -0,0 +1,109 @@ +get_products_array() ); + wp_localize_script( + 'stripe-payments-product-block', + 'aspBlockProdStr', + array( + 'title' => 'Stripe Payments Product', + 'product' => __( 'Product', 'stripe-payments' ), + 'button_only' => __( 'Show Button Only', 'stripe-payments' ), + 'button_only_help' => __( 'Check this box if you just want to show the button only without any additional product info.', 'stripe-payments' ), + ) + ); + + register_block_type( + 'stripe-payments/product-block', + array( + 'attributes' => array( + 'prodId' => array( + 'type' => 'string', + 'default' => 0, + ), + 'btnOnly' => array( + 'type' => 'boolean', + 'default' => false, + ), + ), + 'editor_script' => 'stripe-payments-product-block', + 'render_callback' => array( $this, 'render_product_block' ), + ) + ); + } + + function render_product_block( $atts ) { + + $prodId = ! empty( $atts['prodId'] ) ? intval( $atts['prodId'] ) : 0; + + if ( empty( $prodId ) ) { + return '

' . __( 'Select product to view', 'stripe-payments' ) . '

'; + } + + $sc_str = 'asp_product id="%d"'; + $sc_str = sprintf( $sc_str, $prodId ); + + if ( ! empty( $atts['btnOnly'] ) ) { + $sc_str .= ' button_only="1"'; + } + + return do_shortcode( '[' . $sc_str . ']' ); + } + + private function get_products_array() { + $q = get_posts( + array( + 'post_type' => ASPMain::$products_slug, + 'post_status' => 'publish', + 'posts_per_page' => -1, + 'orderby' => 'title', + 'order' => 'ASC', + ) + ); + $prodArr = array( + array( + 'label' => __( '(Select product)', 'stripe-payments' ), + 'value' => 0, + ), + ); + foreach ( $q as $post ) { + $title = html_entity_decode( $post->post_title ); + $prodArr[] = array( + 'label' => esc_attr( $title ), + 'value' => $post->ID, + ); + } + wp_reset_postdata(); + return $prodArr; + } + +} + +new AcceptStripePayments_Blocks(); diff --git a/wp-content/plugins/stripe-payments/admin/views/index.php b/wp-content/plugins/stripe-payments/admin/views/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/admin/views/index.php @@ -0,0 +1 @@ + + div#asp-shortcode-type-container { + text-align: center; + margin: 0 auto; + } + #asp-default-shortcode-container, #asp-product-shortcode-container { + display: none; + } + table.asp-shortcode-options-table sup { + color: red; + } + div#asp-type-select-buttons button.asp-sc-type-sel-btn { + padding: 5px 20px; + height: auto; + font-size: 14px; + } + div#asp-type-select-buttons div { + margin-top: 20px; + margin-bottom: 10px; + } + #asp-error-no-products { + display: none; + color: red; + } + +
+

Please select shortcode type you want to insert

+
+
+ +
+
+ +
+
+
+
+ + + + + +
Product +

Select product you want to insert.

+ No products found. You need to create a product first. +
+

+ +

+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Item Name * +

Your item name. This value should be unique so this item can be identified uniquely on the page.

+
Price +

Item price. Numbers only, no need to put currency symbol. Example: 99.95
+ Leave it blank if you want your customers to enter the amount themselves (e.g. for donation button). +

+
Currency +

Leave "(Default)" option selected if you want to use currency specified on settings page.

+
Quantity +

Specify a custom quantity for the item.

+
Button Text +

Specify text to be displayed on the button. Leave it blank to use button text specified on settings page.

+
URL +

URL of your product (if you're selling digital products).

+
Thank You Page URL +

Page URL where users will be redirected after the payment is processed for this item. Useful if you want to make a custom "Thank you" page for this item. Leave it blank if you want to use the default URL specified in plugin settings.

+
Description +

You can optionally add a custom description for the item/product/service that will get shown in the stripe checkout/payment window of the item.

+
Billing Address +

Enable this option to collect customer's billing address during the transaction.

+
Shipping Address +

Enable this option to collect customer's shipping address during the transaction.

+
Item Logo +

You can optionally show an item logo in the Stripe payment window. Specify the logo image URL.

+
Button CSS Class +

CSS class to be assigned to the button. This is used for styling purposes. You can get additional information in this tutorial.

+
+

 

+

+ +

+
\ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/assets/asp-dashboard-menu-icon.png b/wp-content/plugins/stripe-payments/assets/asp-dashboard-menu-icon.png new file mode 100644 index 0000000..f334185 Binary files /dev/null and b/wp-content/plugins/stripe-payments/assets/asp-dashboard-menu-icon.png differ diff --git a/wp-content/plugins/stripe-payments/assets/circle-check-solid.svg b/wp-content/plugins/stripe-payments/assets/circle-check-solid.svg new file mode 100644 index 0000000..bf0cb23 --- /dev/null +++ b/wp-content/plugins/stripe-payments/assets/circle-check-solid.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/assets/index.html b/wp-content/plugins/stripe-payments/assets/index.html new file mode 100644 index 0000000..e69de29 diff --git a/wp-content/plugins/stripe-payments/assets/index.php b/wp-content/plugins/stripe-payments/assets/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/assets/index.php @@ -0,0 +1 @@ +1. +- Coupons are supported for trial subscriptions now. +- Front-end card errors are now also sent via error email. +- Countries displayed in alphabetical order now. +- Prevented backend access to Legacy API functions if it's disabled. +- Added extra note to the "error email" body explaining what an "error email" means. + += 2.0.36 = +- Added "Apply Per-Order" option for fixed amount coupons. +- `2020-08-27` Stripe API version compatibility. +- Improved compatibility with caching plugins (W3 Total Cache, SG Optimizer, WP Rocket etc). +- Payment popup refreshes itself if its left inactive for too long. Should resolve issues related to "Invalid security token". +- Fixed rare payment popup closing issue in Safari browser. +- Success payment animation is now properly displayed in Safari browser. +- Added Egyptian Pound (EGP) currency. + += 2.0.35 = +- Donation type products using zero-decimal currencies no longer cause payment error. +- Products with applied coupons that reduce amount to 0 are properly handled now. +- Symbols with accents in product thumbnail URLs are no longer removed. +- Added Romanian Leu (RON) currency support. +- Fixed minor incompatibility issue with WP 5.5 on Settings page. + += 2.0.34 = +- `Currency not supported for this payment method` error message is now removed when another payment method is selected. +- Billing address postcode is no longer missing in the orders menu. +- Fixed an issue with the Order Events interface showing the "Paid" label twice. +- Payment popup blocks can now be rearranged via CSS tweaks. +- Minor payment popup appearance improvements. + += 2.0.33 = +- Fixed payment error when Legacy API option is still enabled. +- Changed the way security tokens are generated. Should help prevent `Invalid security token` error on servers with aggressive caching. +- Added `Disable Security Token Check` settings option (if the above fails). +- Fixed rare issue affecting `Authorize Only` products and payment methods that do not support it. + += 2.0.32 = +- reCAPTCHA add-on functionality is now built into the core plugin. You can enable reCAPTCHA from the settings menu of the plugin. +- Added security token check for subscriptions payments. + += 2.0.31 = +- Added `Authorize Only` option in the product configuration interface. You can use it to hold funds on a card and then capture it later from the Orders page. +- Added `Donation` product type and `Minimum Donation Amount` product option. +- Re-styled the Orders menu a little. +- Added `Order Events` meta-box to the Order menu. +- Added `Allowed Currencies` global settings option. +- Added `{payment_method}`, `{card_brand}` and `{card_last_4}` email merge tags. +- Payment popup `Close` button is now displayed instantly. +- Browser's `Back` button closes popup if it's open. +- Custom translations are properly loaded on payment popup window now. +- Currency format settings are no longer ignored on the payment popup. +- Empty value is now allowed for "Thousand Separator" option. +- Popup init errors are properly displayed now. +- Added Bulgarian Lev (BGN) currency. +- Minor improvements, bugfixes and optimizations. + += 2.0.30 = +- Added Argentine Peso (ARS), Chilean Peso (CLP), Colombian Peso (COP), Peruvian Nuevo Sol (PEN) and Uruguayan Peso (UYU) currencies. +- Fixed PHP 7.4 deprecation notices. +- Added `asp_ng_pp_countries_list` filter to programmatically modify countries list on payment popup. +- Minor fixes and improvements. + += 2.0.29 = +- Added `Do Not Use Stripe PHP SDK Library` experimental option. +- Plugin now shows warning if required PHP modules are not installed on the server. +- Minor code optimizations and improvements. +- Added subscriptions support for Additional Payment Methods addon. + += 2.0.28 = +- Coupon code is now saved in Stripe metadata. +- Restored `Don't Create Order` settings option (was hidden by mistake few versions back). +- Attempt to fix `mixed content` browser error on payment popup when product thumbnail is using `http` instead of `https`. +- Resolved issue with APM addon when shipping address collection is enabled. + += 2.0.27 = +- Added workaround for servers with aggressive caching when "Prefetch Payment Popup Scripts" option is enabled. +- Removed dev debug lines from the code. +- Fixed typos in text descriptions. + += 2.0.26.1 = +- Fixed a minor checkout issue with the Subscription addon when the `State` field is disabled. + += 2.0.26 = +- Added option to construct product price using variations only. +- Added support for Lebanese Pound (LBP) and Saudi Riyal (SAR) currencies. +- Added 'tax' parameter support for [asp_product] shortcode. +- Added {coupon_code} email merge tag. +- 'thankyou_page_url' parameter is no longer ignored by [asp_product] shortcode. +- State value is now properly handled. +- Shipping address is now properly saved if payment is made via payment addons. +- Made prefetch work for products attached via CSS and link URL. +- Upgraded Stripe PHP SDK to version 7.28.1. +- PHP 7.4 support. +- Minor improvements, bugfixes and optimizations. +- Added built-in integration with [WP PDF Stamper plugin](https://www.tipsandtricks-hq.com/wp-pdf-stamper-plugin-2332) + += 2.0.25 = +- Added "State" field for billing and shipping address. +- Added "Hide State Field" option to the settings menu. It's enabled by default for existing installations. This new option can be used to hide the field. +- Bundled translation files are properly loaded now. +- Minor improvements and optimizations. +- Added Italian language translation file. + += 2.0.24 = +- Empty lines in billing and shipping address are no longer displayed. +- Error is displayed when viewing subscription product with Subscriptions add-on disabled. +- Added Japanese language translation file. + += 2.0.23 = +- Added "Last Name First" option for user name prefill. Useful for languages where last name comes first (Japanese). +- Coupon discount amount was improperly displayed on checkout results page for products with variations. +- Additional functionality added for addons. +- Various minor improvements and bugfixes. +- Minimum PHP version requirement is set to PHP 5.6 + += 2.0.22 = +- New Stripe API is now enabled by default on fresh new plugin installation. +- Added check if card details are properly filled in before making any backend requests (prevents excess Stripe API calls). +- Added "Force Test Mode" product option (located in Advanced Settings metabox on product edit page). +- Speed up payment popup display by removing unneeded Stripe library init. +- Added built-in integration with [Simple Membership plugin](https://wordpress.org/plugins/simple-membership/) +- WP eMember integration now works with new Stripe API and it handles customer's name and address properly. +- Some visual payment popup form tweaks. + += 2.0.21 = +- Added a new feature to insert custom CSS to payment popup window (it can be found in the advanced settings tab). +- Updated the code to remove a conflict with other plugins when "Enable Compact Product Edit Interface" option is enabled. +- Minor improvements and optimizations. + += 2.0.20 = +- Added validation for values on product edit page (tax, price, quantity etc). +- Discount coupons will now work with subscription products (requires Subscriptions addon 2.0.9+). + += 2.0.19 = +- Added 100% discount coupons support. +- Made amount rounding more consistent between frontend and backend. +- Added payment popup animation to indicate payment is accepted. +- Added quantity support for subscription products (requires Subscriptions addon 2.0.8+). +- Improved payment popup appearance on mobile devices. +- Made payment popup compatible with some older browsers (like IE11). +- Minor backend improvements and fixes. + += 2.0.18 = +- The invalid price display for subscription items on the "All products" page is fixed. +- Updated the code to remove a conflict with other plugins when "Enable Compact Product Edit Interface" option is enabled. +- Shipping value miscalculation during payment processing is fixed. +- Fixed an issue where the customer was getting redirected to login page instead of "checkout results" page on some configurations. +- Improved some text messages on the product edit interface. + += 2.0.17 = +- Improved prefetch payment scripts functionality. +- Optimization improvement to speed up the payment popup display by adding the essential CSS code directly into HTML page. +- Fixed coupon discount was improperly calculated for fixed amount coupons. +- Fixed Stripe receipt is not sent when "Send Receipt Email From Stripe" option enabled (new API only). +- On some servers, the update checker was causing an error. This has been fixed. +- Subscription product: removed the excess "Incomplete" payment entry that was being created in the Stripe Dashboard for the initial subscription charge. + += 2.0.16 = +- Replaced deprecated stripe.js functions to prevent potential issues with payments. +- Forced payment token regeneration if payment amount or currency changed. +- Made more strings available for translation. +- Fixed "Incomplete" subscription status when 3D Secure card is used for payments. +- Fixed an issue with email duplication (caused by multiple execution of some code parts). + += 2.0.15 = +- Payment popup now considers "Stripe Checkout Language" settings option. +- Made most admin interface pages responsive. +- Added MailerLite addon to addons listing menu. +- Fixed potential addon update checking issues on some servers. +- Some minor bugfixes and optimizations. +- Fixed issues with zero-cents currency amounts display and payment processing. + += 2.0.14 = +- Added "Embed Product" metabox to product edit page with available options to embed/attach payment buttons to any page or HTML element. +- Added a new feature that allows you to use a URL to make the payment button. Tutorial https://s-plugins.com/using-a-text-link-instead-of-the-buy-now-button-shortcode/ +- Fixed payment popup issue when variable currency was set for subscription product. +- Addons update checker library is now bundled with core plugin. + += 2.0.13 = +- Fixed malformed download URL when [accept_stripe_payment] shortcode is used with new API. +- Added custom field validation support on payment popup. +- Added "Prefetch Payment Popup Scripts" option to speed up payment popup display when customer clicks payment button. +- Proper error message is now displayed if error occurs during frontend Stripe scripts init on payment popup. +- Removed excess output when payment button is displayed. + += 2.0.12 = +- Fixed subscription payment with tax validity check. +- Fixed subscription payment invalid tax amount displayed on checkout results page. +- Added support for [iDEAL](https://s-plugins.com/stripe-ideal-payment-addon/) and [Country Autodetect](https://s-plugins.com/stripe-country-autodetect-addon/) addons. + += 2.0.11 = +- Fixed an issue with duplicate buy emails being sent on some browsers. +- Fixed "Processing" text was showing in the product insert block. +- Added the Spanish language translation file. +- Fixed subscription payment with tax not processing correctly. + += 2.0.10 = +- [New API]: Fixed selected variations weren't properly passed upon payment form submission. +- [New API]: Fixed "Invalid email address" error when APM addon is installed and "Send Receipt Email From Stripe" option enabled. +- [New API]: Added Alipay addon support. Requires Alipay addon version 2.0.0+. +- Legacy API is disabled by default for fresh plugin installations. +- Added admin area notice regarding SCA compatibility. +- Added Bosnia and Herzegovina Convertible Mark (BAM) currency. + += 2.0.9 = +- [New API]: Fixed zero cents currencies were divided by 100 on payments result page and order info. +- [New API]: Fixed Stripe receipt wasn't sent if "Do Not Save Card Data on Stripe" option enabled. +- [New API]: ZIP\postal code is now requested on credit card input when "Validate ZIP Code" option enabled and address collection disabled for a product. +- [New API]: Product name and ID are now saved in payment metadata on Stripe Dashboard. +- [New API]: If product short description is empty, product name is used for payment details "Description" on Stripe Dashboard. +- [New API]: Added spinner after payment popup form submission. +- [New API]: Single variation in a row is now full-width (instead of half-width before). +- [New API]: Adjusted payment popup display on mobile devices. + += 2.0.8 = +- [New API]: Added compatibility with optimization plugins that do minify\combine JavaScript. +- [New API]: Fixed currency wasn't properly updated for variable currency payments in some situations. +- [New API]: Fixed product with stock control enabled could produce fatal error during payment process under some circumstances. +- [New API]: Fixed checkbox custom field display issue. +- [New API]: Added mandatory inputs validation for browsers that don't provide it. +- [New API]: Fixed rare issue that could break payment process if payment button was clicked multiple times. +- [New API]: Added per-product "Show Order Total On Payment Popup" option. When enabled, it displays detailed financial info (tax, variations, coupon etc) on payment popup. +- [New API]: Added support for reCaptcha addon. reCatpcha addon version 2.0.0+ is required to work with new payment popup. +- [New API]: Added support for Additional Payment Methods addon. APM addon version 2.0.0+ is required to work with new payment popup. +- [New API]: Some visual tweaks and fixes for payment popup. +- Fixed custom input wasn't properly validating and honoring "Mandatory" option if position was "Below Button" (legacy API only). +- Added new product edit interface. To see it in action, check the "Enable Compact Product Edit Interface" checkbox in the Advanced Settings tab. + += 2.0.7.1 = +- [New API]: Fixed visual bug on payment popup when coupons are enabled. + += 2.0.7 = +- [New API]: Moved process_ipn action to wp_loaded hook. Should fix issues with "The site is experiencing technical problems" error during payment processing on some configurations. +- [New API]: Restyled payment popup for better responsiveness on mobile devices. +- [New API]: Updated Stripe PHP SDK library to 6.43.1. +- [New API]: Added debug log warning when another Stripe PHP SDK is loaded. Warning is logged once per 6 hours in order to not flood the log. +- [New API]: Payment popup server interaction errors are now more informative. +- [New Api]: Removed excess "Coupon is invalid for the product" debug log message when no coupon code provided. + += 2.0.6 = +- [New API]: Customer info and card data is now saved on Stripe unless "Do Not Save Card Data on Stripe" option is enabled. +- [New API]: Added "Prefill Logged In User Name and Email" option to prefill corresponding payment popup fields with logged in user's name and email. +- Added 'asp_stripe_order_register_post_type_args' filter to override 'stripe-order' post type args. + += 2.0.5 = +- [New API]: Fixed payment popup was not scrollable on Apple devices. +- [New API]: Added "Send Emails In Parallel" option that should speed up checkout process. +- [New API]: Removed excess output for buttons when new API is used. + += 2.0.4 = +- [New API]: Added "Popup Default Country" option that sets default country on payment popup for billing and shipping address. +- Minor bugfixes for the new API. + += 2.0.3 = +- [New API]: Fixed new API was enabled by default. Now you need to disable "Enable Legacy Checkout API" option on Advanced Settings tab to use new API. +- [New API]: Fixed popup button text was empty on plugin update. +- [New API]: Fixed popup form was not scrollable on some mobile devices. +- [New API]: Added white background for popup item logo. +- [New API]: Fixed product description wasn't passed to Stripe. +- [New API]: Fixed customer_email shortcode parameter was ignored. +- [New API]: Added customer_name shortcode parameter to prefill customer name in payment popup. + += 2.0.2 = +- [New API]: Fixed checkout error when both billing and shipping address collection enabled. +- [New API]: Fixed popup JavaScript caching issue. + += 2.0.1 = +- Important: This is a major upgrade. We advise that you backup your site before upgrading the plugin. +- Added new SCA compliant API for checkout. There is a new payment popup that utilizes SCA-complaint payment process. +- You can enable the new SCA compliant checkout by going to the "Advanced Settings Menu" of the plugin then unchecking the "Enable Legacy Checkout API" checkbox. +- By default it uses the legacy API to ensure that it is a smooth upgrade. We don't want your checkout process to be broken after the upgrade. + += 1.9.25 = +- Fixed improper frontend total amount display in some circumstances. +- Fixed total amount was displayed instead of item price in some circumstances. +- Fixed issues that could lead to "button key mismatch" error when [accept_stripe_payment] shortcode is used. +- Paragraphs are automatically added to product description when needed. + += 1.9.24 = +- Added {item_url} email tag support. +- Fixed issue with the_content filter usage in product shortcode output that could cause some content duplication. +- Added checkout_lang shortcode parameter which sets checkout popup language for a product. + += 1.9.23 = +- PHP sessions are no longer used for security and better caching purposes. +- Disabled nonce checking for buttons. +- Fixed thankyou_page_url parameter was ignored for [asp_product] shortcode and by some addons. +- Fixed item URL wasn't processed by Secure Downloads addon when some other addons are enabled. +- Fixed frontend total amount calculation display for products with variations and custom amount enabled. +- Custom amount validation errors no longer displayed on page load for products with variations and custom amount enabled. +- Checkout results page no longer displays "Download links" message if there are no downloads set for variations. +- Checkout error message is now displayed even if no [accept_stripe_payment_checkout_error] shortcode inserted on custom checkout results page. +- Frontend amount and quantity inputs are disabled on payment form submit to prevent "Token can't be used more than once" error. +- Fixed zero-cent currencies displaying and handling issues. +- Product description now supports WP embeds. +- Tweaks for better compatibility with various page builders. +- Other minor bugfixes. + += 1.9.22 = +- Fixed archive pages list could be messed up when plugin is enabled. +- Fixed the "asp_stripe_payments_checkout_page_result" filter hook not triggering correctly. + += 1.9.21 = +- Fixed frontend discount amount display when custom quantity is enabled and initial quantity is set to 0 or empty. +- Fixed adding groups to existing product with variations caused improper variations placement. +- Fixed tax amount was displayed rounded down on frontend under some circumstances (wasn't affecting actual payment amount). +- Product variations are now added to payment metadata in Stripe account. +- Added admin side notice if required PHP modules are not installed on the server. + += 1.9.20 = +- Added Stripe Payments Product Gutenberg block. +- Added button_only parameter to [asp_product] shortcode. When set to "1", no product title and info is displayed. +- Fixed PHP notices when viewing some products with variations. + += 1.9.19 = +- Fixed issues on Settings page that prevented it from being properly displayed in some versions of Safari browser. +- Stripe Payments menu icon color changed to white to have better contrast with dark menu background. +- Fixed minor HTML-related admin interface issues. + += 1.9.18 = +- Trial subscriptions are now displaying 0 as payment amount on checkout results and email receipts. +Payment button in Stripe pop-up for those now shows "Start Free Trial" instead of payment amount. +Requires Subscriptions addon 1.4.5+ +- Added validation for custom filed. You can use your own validation rules via custom JavaScript RegExp. +- Fixed invalid amount was displayed on Stripe pop-up when variable price and quantity is used. +- {product_details} merge tag is available for custom checkout results page. +- Purchase date is now displayed using WP date\time format settings and considers timezone. +- Added option to display product variations as radio buttons (can be set per product on product edit page). + += 1.9.17 = +- Fixed frontend stock control. Now customers cannot order more items than available in stock. +- Added [asp_show_my_transactions] shortcode to display transactions made by user. +- Added support for addons' email merge tags. They are also displayed in tags hint if available. + += 1.9.16 = +- Fixed coupon was still applied to the product even if it's not allowed for it. + += 1.9.15.1 = +- Fixed tax value was displayed rounded down on frontend. +- Fixed PHP notices displayed on products page. + += 1.9.15 = +- Updated Stripe PHP SDK to latest version. PHP versions below 5.4 are no longer supported. +- Some minor admin interface modifications. + += 1.9.14.2 = +- Fixed price consistency check for payment button shortcodes. + += 1.9.14.1 = +- Fixed Stripe mode was improperly set during subscriptions payment processing sometimes (requires Subscriptions addon 1.3.5+). + += 1.9.14 = +- Added product option that lets the customers select payment currency. +- Added support for variable amount subscriptions (requires Subscriptions addon version 1.3.4+). +- Added order info link to seller email. +- Fixed [accept_stripe_payment] shortcode was ignoring shipping_address option. +- Fixed quantity set for a product was ignored under some circumstances. + += 1.9.13 = +- Payment buttons are now replaced by a spinner during payment processing for better user experience. +- Added option to disable Order creation after purchase. Useful if you don't want to save purchase info on your website. +- Variable amount input is now considers only two digits after decimal separator. +- Customer shipping address is added to payment metadata if available. You can see it in your Stripe Dashboard. +- Added dismissible notice if PHP version is older than 5.4. +- Fixed a couple of issues with variations. + += 1.9.12 = +- Fixed product price could not be set to zero or empty value (for donation purposes). +- Added option to send buyer and seller emails in HTML format. +- Added spinner for settings page to indicate it's being loaded. +- Added support for upcoming Additional Custom Fields addon. +- If custom field enabled but its name is not set, it would be called "Custom Field". +- Made more strings available for translation. +- Minor bigfixes and imporvements. + += 1.9.11 = +- Price and shipping cost is being converted to appropriate format on product edit page. +- Fixed some buttons were not clickable when TOS enabled. + += 1.9.10 = +- Added {tax}, {tax_amt}, {currency} and {shipping_amt} checkout page customization tags. More tags [can be found here](https://s-plugins.com/customize-the-thank-page-message-of-stripe-payments-plugin/). +- Added {item_name} and {item_quantity} email tags. +- Added position settings options for custom field and TOS. You can display those below payment button now. + += 1.9.9 = +- Fixed incompatability with older PHP versions (prior to 5.4). +- Added SOFORT and Post Payment Actions addons to the list. +- Made more strings available for translations, regenerated .pot file. + += 1.9.8 = +- Fixed blank payment results page was displayed under some circumstances if customized [accept_stripe_payment_checkout] shortcode was used. +- Added ability to allow coupon usage only for specific products. +- Added option to store customer's IP address in order info. +- Plugin tries to create and use small product thumbnail for Stripe pop-up if available. This removes noticeable pop-up window lag when large image is being used. + += 1.9.7 = +- Fixed improper tax value calculation under some circumstances. +- Fixed session_start() error that occurs on some configurations after customer made a payment. +- Removed some of the CSS styles from the coupon field. So the style of the coupon field fits better with the theme you are using. + += 1.9.6 = +- Fixed zero amount was displayed on products with custom amount. +- Fixed products table display when viewed from mobile. +- Products table is now properly displaying large images for newly created or updated products. +- Added CSS to add some spacing after the variation label. + += 1.9.5 = +- Added product variations feature. Documentation here - https://s-plugins.com/creating-variable-products-using-the-stripe-payments-plugin/ +- Added ability to offer 100% discount coupon. Plugin won't produce "Invalid positive integer" error if it is used. +- Fixed rare bug when customer wasn't redirected to results page on error if "Send Email On Payment Failure" option is not enabled. +- Billing name (if available) is now properly passed to MailChimp, AWeber, ConvertKit etc. addons if payment is made via Advanced Payment Methods addon. +- Added the necessary changes for the convertkit addon. + += 1.9.4 = +- Added "Debug Log Shareable Link" to share debug log without having to share WP Dashboard credentials. +- Added error message on product edit page if price is below or above Stripe's allowed min/max for selected currency. +- Installed add-ons are now marked on Add-ons page and have Settings button displayed. +- Compressed images to decrease plugin package size. +- Fixed coupon discount was visually applied on all products on page, not just the one where coupon was entered. +- Added spinner after "Apply" coupon button is clicked to indicate that coupon is being checked. + += 1.9.3 = +- Coupon discount is now applied to the product price, not the total amount. +- Coupon input is no longer displayed for custom amount products. +- Added Dropbox support for Secure Downloads addon (requires addon version 1.1.7+). +- Added WP eMember plugin integration options. + += 1.9.2 = +- Added Russian Ruble (RUB) currency. +- Fixed Secure Downloads addon was showing real download URL for products. +- Fixed per-product thank you page setting was ignored when payment error occurs. +- Added {paid_amount_curr} custom checkout result page merge tag. It displays formatted amount with currency code (example: $12.99). + += 1.9.1.1 = +- Fixed per-product coupons settings were set to "Disabled" in some circumstances (thanks to abelfinance for reporting). + += 1.9.1 = +- Added Coupons functionality. Coupons for subscriptions are not supported at the moment, we're working on it. +- Added {charge_date} checkout result merge tag. +- Advanced Payment Methods addon is now properly collecting Billing and\or shipping addresses. +- Clicking on "Shortcode" input on product page now selects the shortcode. + += 1.9.0 = +- Added "Validate ZIP code" option. In order for this to work, corresponding option should be enabled in your Stripe Dashboard as well. +- Added support for Custom Messages addon. You can use it to customize various text messages displayed by the plugin. +- Added {customer_name} email merge tag. + += 1.8.9 = +- Fixed "You passed an empty string for referrer" error which was caused by recent changes in Stripe API. +- Added option to apply decimal separator settings to customer input as well. + += 1.8.8 = +- Added option to add mandatory "I accept the Terms and Conditions" checkbox. Should help to comply with the EU GDPR. Go to Settings -> Advanced Settings tab to configure it as per your needs. +- Fixed zero-decimal currencies tax value was calculated improperly. +- More text available for translation. You can help in translating the plugin to your language [here](https://translate.wordpress.org/projects/wp-plugins/stripe-payments) +- Inline CSS is now minified. +- Some addons-related changes. + += 1.8.7 = +- Added some debug logging message after the notification email is sent by the plugin. This will be useful for troubleshooting email related issue. +- Added Alipay payment option as a free addon - https://s-plugins.com/alipay-addon-stripe-payments-plugin/ + += 1.8.6 = +- Added basic products stock control functionality. +- Added option to select custom text field description location (placeholder or below input). +- Added links to documentation and add-ons on Settings page. + += 1.8.5 = +- Fixed "Invalid Stripe token" error in Safari on iPad (thanks to temparcweb for reporting and helping to debug). +- Fixed IE11 incompatibility (thanks to temparcweb). +- Additional information is put into debug log and error email if error occurs. +- Customer no longer redirected to download URL if error occurs during payment process. + += 1.8.4 = +- Fixed "Invalid positive integer" error when price is set to 0 in [accept_stripe_payment name] shortcode. + += 1.8.3 = +- Added some more hooks for better addons support. + += 1.8.2 = +- Tax and shipping info is now displayed in standard checkout result page, emails and order info (if applicable). +- New email tags added: {tax}, {tax_amt}, {shipping_amt}. +- Added proper check for minimum amount for following currencies: DKK (2.50-kr.), GPB (£0.30), HKD ($4.00), JPY (¥50), MXN ($10), NOK (3.00-kr.), SEK (3.00-kr.). +- Fixed products page was displaying incorrect number of products per row. +- Fixed product template was improperly displaying price if quantity was greater than 1. +- Fixed tax and shipping being improperly calculated when custom quantity was enabled. +- Various small bugfixes and improvements. + += 1.8.1 = +- New shortcode parameter added: compat_mode="1". Useful if you get "Invalid Stripe Token" error if using visual page builders. +- Added additional email tags: {item_price}, {item_price_curr}, {currency}, {currency_code}. +- Added {purchase_amt_curr} email tag to display formatted amount with currency symbol. +- Fixed {purchase_amt} email tag wasn't showing total purchase amount (was showing item price instead). Also made {purchase_amt} to be formatted according to Price Display Settings. + += 1.8.0 = +- Fixed variable price was improperly handled for products in some cases. +- Added option to make payment buttons not clickable until Javascript libraries are loaded on page view. This prevents "Invalid Stripe Token" errors on some configurations. +- You can customize currency symbol on settings page now. +- Prioritized button_text parameter for product shortcode (useful if you want to have several buttons with different text for same product). +- {custom_field} tag is now supported on custom Thank You page. +- Custom field name and value are now added to Stripe metadata. + += 1.7.9.1 = +- Fixed minor bug related to product quantity. + += 1.7.9 = +- "Send Error Email To" field now accepts coma-separated emails (thanks to pitfallindimate3746 for reporting). +- Added customer_email shortcode parameter which allows to specify customer email in Stripe pop-up (useful if you're dynamically generating payment buttons via do_shortcode() function). +- Minor bug fixes (mostly related to addons). + += 1.7.8 = +- Added Shipping and Tax support for products. +- Merged Price and Currency sections on product edit page. +- Product thumbnail is now displayed in Stripe pop-up. This can be disabled using corresponding option on product edit page. + += 1.7.7 = +- Added "Button CSS Class" and "Show Button Only" parameters to product edit page. +- Added "Thank You Page URL" field to product edit page. +- Added debug logging option to the settings. + += 1.7.6 = +- Fixed PHP warning displayed upon saving product when custom field is not configured (thanks to falcon13 for reporting). +- Plugin text domain is now properly set. + += 1.7.5 = +- Changed some currencies symbols to be more distinctive (e.g. Australian Dollar was using '$' symbol before, now is using 'AU$'). +- Updated the language translation POT file. +- Made additional strings available for translation via translate.wordpress.org. +[Click here](https://translate.wordpress.org/projects/wp-plugins/stripe-payments) if you want to help in translating plugin to your language. + += 1.7.4 = +- Added "Send Email On Payment Failure" option to notify admin if payment failed. +- Fixed plugin conflict with WordPress Themes Editor (thanks to natecarlson1 for reporting). + += 1.7.3 = +- Stripe PHP Library updated to v5.8.0. +- Minimum PHP version required is PHP5.3. + += 1.7.2 = +- Added Custom Field to the advanced settings. Custom Field can be used to add an additional text field or checkbox to your buttons to collect an input from your customer. +- Fixed scripts were called too early, which rarely resulted in conflicts with other plugins and themes (thanks to mmeida for reporting and helping out). + += 1.7.1 = +- Fixed "Button key mismatch" error when special characters (like '&') are used in button name (thanks to damhnait for reporting and helping out). +- Removed "Use New Method To Display Buttons" setting. Now all buttons are displayed using the new method. + += 1.7.0 = +- Fixed a PHP warning in the settings menu of the plugin. + += 1.6.9 = +- Added "Send Receipt Email From Stripe" option. You can find this option under the "Email Settings" menu of the plugin. +- [asp_product] shortcode now supports "class" parameter that allows to assign CSS class to the payment button. + += 1.6.8 = +- Added language text-domain to the plugin file header. +- Hopefully fixed plugin conflict with Yoast SEO (thanks to rogbiz for reporting and helping out). +- Added sanitization to the button output. Thanks to Mikko. + += 1.6.7 = +- Amount in order title is formatted corresponding to Price Display Settings. +- Added [Test Mode] to the order title if payment was made in Test mode. +- Notice added to the settings regarding caching plugins. +- A small bug introduced in previous version has been fixed. + += 1.6.6 = +- Separate fields for Stripe Test keys added to the settings page. +- Plugin will now properly handle buttons with same name but different price (thanks to nourrirsafoi for reporting). +- Fixed "Warning: A non-numeric value encountered" when custom amount is used (thanks to rogbiz for reporting). + += 1.6.5 = +- Fixed improper handling of custom amount feature (thanks to triode33 for reporting). +- Added "Processing.." text to payment button to let user know the payment is being processed. + += 1.6.4 = +- The email related settings options have been moved to a separate tab in the settings menu. +- Added a new configuration option to allow customization of the price display settings in the advanced settings tab. +- The price of the item now gets displayed in the product description. +- The plugin automatically creates a "products" page where all your Stripe items/products are listed in a grid display. + += 1.6.3 = +- Improved the description that gets shown in the stripe checkout window when a product has no "short description" specified for it. + += 1.6.2 = +- Updated the Quantity field box in the product edit interface to add more explanation as to how that field works. + += 1.6.1 = +- Stripe plugin's admin menu interface has been reworked to facilitate the addition of new features. +- Added a new interface to add/edit products from the wp admin dashboard. Usage instructions at the following URL: + https://s-plugins.com/creating-product-stripe-payments-plugin/ + +- There is a new shortcode to embed a Stripe payment button for the products you create in the admin dashboard. +- The existing shortcodes will continue to work as is (no change there). +- The shortcode inserter (in the post/page editor) has been updated. It will allow you to insert both the shortcodes. + += 1.6.0 = +- Stripe button CSS is now inserted before the form to prevent payment buttons from having default theme style for a second before the CSS file actually loaded. +- Updated the settings menu link slug to make it unique. + += 1.5.9 = +- Added "Turn Off "Remember me" Option" setting. When enabled, "Remember me" checkbox will be removed from Stripe's checkout popup. +- Moved "Settings" menu item from WP Settings to a new independent menu called "Stripe Payments". +- Added "thankyou_page_url" shortcode parameter to specify a custom thank you page URL for an item. This can be used to override the default thank you page URL on a per item basis. +- Extended checkout results page customization using [accept_stripe_payment_checkout] and [accept_stripe_payment_checkout_error] shortcodes. +- Instructions on how to customize the thank you page using tags can be found at the following URL: +https://s-plugins.com/customize-the-thank-page-message-of-stripe-payments-plugin/ + += 1.5.8 = +- Zero-decimal currencies (like JPY) are no longer multiplied by 100. +- Added Italian language translation file to the plugin. Translation was submitted by Daniele Oneta. + += 1.5.7 = +- Added "Stripe Checkout Language" option to the settings. +- The 'asp_stripe_payment_completed' hook now passes the order post ID in the $post_data array. + += 1.5.6 = +- The shipping and billing address email merge tags are usable again (if you use the address parameters in the shortcode). +- The address will be stored correctly in the Stripe Orders menu (if you are collecting address). + += 1.5.5 = +- Reworked the TinyMCE shortcode inserter code a little to fix an issue with saving a post in WP v4.8. + += 1.5.4 = +- Added filter hooks for the notification email subject and body. +- Currency Code on settings page changed from input to select. +- Added "Do Not Save Card Data on Stripe" setting to tell Stripe to not save card information. +- Added a shortcode inserter button to the TinyMCE editor ("Visual" tab on Edit Post\Page screen). +- Updated the Stripe Orders dashboard menu icon. + += 1.5.3 = +- Updated the French language translation file. +- Updated the translation POT file. +- The plugin will show an error if the shortcode doesn't have the "name" field present. This is a required field for the plugin to process the checkout. + += 1.5.2 = +- Added a new option to display the Stripe buttons. It makes connection to Stripe website only when button is clicked, this makes the page with Stripe buttons load a little faster. +- Added French language translation file to the plugin. Translation file was submitted by Claudy GALAIS. + += 1.5.1 = +- There is now an option to send a notification email to the buyer and seller after the purchase. You can configure it in the settings menu of this plugin. +- A custom css class can be specified for the Stripe button to customize the button style. +- The "price" parameter can be omitted in the shortcode to allow the visitors to specify a custom price or donation amount for an item. + += 1.4 = +- Added an improvement so the description also gets captured with the stripe charge (so you can see it in your Stripe account). +- It will also save the description in the stripe orders menu of the plugin. + += 1.3 = +- The transaction ID will now get shown on the thank you page also (after the payment). +- Added more CSS classes on the thank you page message. +- Added a new parameter in the shortcode so you can specify a custom description for the item checkout (if you want to). + += 1.2 = +* Added a new option to show the item logo or thumbnail image in the stripe checkout window. +* Added a new filter so you can add extra Stripe checkout data parameters (if you want to customize it). +* Added a new action hook that is triggered after the payment is complete (asp_stripe_payment_completed). + += 1.1 = +* Added new option to show shipping and billing address in the stipe payment popup window. You can specify a parameter in the shortcode to collect the address. + += 1.0.5 = +* Added a new filter so the checkout result page's output can be customized. +* Added extra details to the thank you page that shows the details of the item that was purchased. + += 1.0.4 = +* Added more instructions to the checkout result page explaining what that page is for. +* Added settings link in the plugins listing page. + += 1.0.3 = +* Added some enhanced security in the form submission. + += 1.0.2 = +* Updated the payment shortcode parameter. + += 1.0.1 = +* First Release \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-addons-helper.php b/wp-content/plugins/stripe-payments/includes/class-asp-addons-helper.php new file mode 100644 index 0000000..821268f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-addons-helper.php @@ -0,0 +1,147 @@ +addon = $addon; + + if ( is_admin() ) { + $this->asp_admin = AcceptStripePayments_Admin::get_instance(); + add_action( 'activate_' . $this->auc_plugin_path, array( $this, 'remove_auc_notice' ) ); + } + } + + public function remove_auc_notice() { + if ( ! empty( $this->item_hash ) ) { + AcceptStripePayments_Admin::remove_admin_notice_by_hash( $this->item_hash ); + } + } + + public function init_tasks() { + add_action( 'init', array( $this, 'load_text_domain' ) ); + if ( is_admin() ) { + $this->add_settings_link(); + $this->check_updates(); + } + } + + public function log( $msg, $success = true ) { + if ( method_exists( 'ASP_Debug_Logger', 'log' ) ) { + ASP_Debug_Logger::log( $msg, $success, $this->addon->ADDON_SHORT_NAME ); + } + } + + public function check_updates() { + //Note: This function can get called from an addon before init. So we don't do any translation strings here. + + if ( ! is_admin() ) { + //We are not in admin-dashboard area so just return (We only need to check updates in admin area). + return; + } + if ( class_exists( 'ASP_Addons_Update_Checker' ) ) { + if ( empty( $this->addon->SLUG ) || empty( $this->addon->file ) ) { + return; + } + ASP_Addons_Update_Checker::check_updates( $this->addon->SLUG, $this->addon->file ); + } else { + // let's display admin notice to install Addons Update Checker (if the message is not yet dismissed) + $user_id = get_current_user_id(); + if ( empty( $user_id ) ) { + return; + } + if ( ! current_user_can( 'install_plugins' ) && ! current_user_can( 'activate_plugins' ) ) { + return; + } + + $notice_dismissed = get_user_meta( $user_id, 'asp_dismiss_auc_msg', true ); + if ( ! empty( $notice_dismissed ) ) { + return; + } + $admin_url = get_admin_url(); + $dismiss_url = add_query_arg( 'asp_dismiss_auc_msg', '1', $admin_url ); + $dismiss_url = wp_nonce_url( $dismiss_url, 'asp_dismiss_auc_msg' ); + $dismiss_msg = '' . 'Don\'t show this message again' . ''; + + //This function can get called from an addon before init. So we don't do any translation strings here. + $this->item_hash = AcceptStripePayments_Admin::add_admin_notice( + 'warning', + 'Accept Stripe Payments
Please install the Stripe Payments Addons Update Checker plugin to keep your addons upto date.' . + $dismiss_msg, + false + ); + } + } + + public function check_ver() { + if ( version_compare( WP_ASP_PLUGIN_VERSION, $this->addon->MIN_ASP_VER ) < 0 ) { + add_action( 'admin_notices', array( $this, 'display_min_version_error' ) ); + return false; + } + return true; + } + + public function add_settings_link() { + add_filter( 'plugin_action_links', array( $this, 'settings_link' ), 10, 2 ); + } + + public function load_text_domain() { + if ( ! empty( $this->addon->file ) && ! empty( $this->addon->textdomain ) ) { + load_plugin_textdomain( $this->addon->textdomain, false, dirname( plugin_basename( $this->addon->file ) ) . '/languages/' ); + } + } + + public function settings_link( $links, $file ) { + if ( plugin_basename( $this->addon->file ) === $file && ! empty( $this->addon->SETTINGS_TAB_NAME ) ) { + $settings_link = sprintf( '%s', $this->addon->SETTINGS_TAB_NAME, __( 'Settings', 'stripe-payments' ) ); + array_unshift( $links, $settings_link ); + } + return $links; + } + + public function display_min_version_error() { + $class = 'notice notice-error'; + // translators: %1$s - plugin name, %2$s - min core plugin version, %3$s - installed core plugin version + $message = sprintf( __( '%1$s requires Stripe Payments plugin minimum version to be %2$s (you have version %3$s installed). Please update Stripe Payments plugin.', 'stripe-payments' ), $this->addon->ADDON_FULL_NAME, $this->addon->MIN_ASP_VER, WP_ASP_PLUGIN_VERSION ); + + printf( '

%2$s

', esc_attr( $class ), esc_html( $message ) ); + } + + public function add_settings_section( $title, $descr_callback = null ) { + //$descr_callback added since 1.9.8 + add_settings_section( 'AcceptStripePayments-' . $this->addon->SETTINGS_TAB_NAME . '-section', $title, $descr_callback, $this->asp_admin->plugin_slug . '-' . $this->addon->SETTINGS_TAB_NAME ); + $this->section = 'AcceptStripePayments-' . $this->addon->SETTINGS_TAB_NAME . '-section'; + } + + public function add_settings_field( $name, $title, $desc, $size = 10 ) { + $this->asp_admin = AcceptStripePayments_Admin::get_instance(); + add_settings_field( + $name, + $title, + array( $this->asp_admin, 'settings_field_callback' ), + $this->asp_admin->plugin_slug . '-' . $this->addon->SETTINGS_TAB_NAME, + $this->section, + array( + 'field' => $name, + 'size' => $size, + 'desc' => $desc, + ) + ); + } + +} + +class_alias( 'ASP_Addons_Helper', 'ASPAddonsHelper' ); diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-daily-txn-counter.php b/wp-content/plugins/stripe-payments/includes/class-asp-daily-txn-counter.php new file mode 100644 index 0000000..cebb8a2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-daily-txn-counter.php @@ -0,0 +1,90 @@ +txn_counter_option_name = 'asp_daily_txn_count_args'; + $this->asp_main = AcceptStripePayments::get_instance(); + $this->today = date("Y-m-d"); + } + + //Resets or get the current counter + public function asp_get_daily_txn_counter_args() { + + $txn_counter_args = get_option($this->txn_counter_option_name); + + if (!$txn_counter_args) { + //If txn_counter don't exists , create and return new as zero + return $this->asp_reset_daily_txn_counter(); + } else { + + if (isset($txn_counter_args["counter_date"]) == false || $this->today != $txn_counter_args["counter_date"] ) { + return $this->asp_reset_daily_txn_counter(); + } + } + + return $txn_counter_args; + } + + public function asp_increment_daily_txn_counter() { + $txn_counter_args = $this->asp_get_daily_txn_counter_args(); + + $txn_counter_args["counter"]++; + update_option($this->txn_counter_option_name, $txn_counter_args); + + return $txn_counter_args; + } + + public function asp_set_txn_counter_value( $count ) { + $txn_counter_args = $this->asp_get_daily_txn_counter_args(); + $txn_counter_args["counter"] = $count; + update_option($this->txn_counter_option_name, $txn_counter_args); + } + + public function asp_is_daily_txn_limit_reached($is_captcha_enabled=false) { + $txn_counter_args = $this->asp_get_daily_txn_counter_args(); + $txn_counter_limit = 0; + + if( $is_captcha_enabled == true ) { + $txn_counter_limit = $this->asp_main->get_setting('daily_txn_limit_with_captcha'); + } else { + $txn_counter_limit = $this->asp_main->get_setting('daily_txn_limit_without_captcha'); + } + + if ( !$txn_counter_limit ) { + $txn_counter_limit = 25; + } + + if ( $txn_counter_args["counter"] >= $txn_counter_limit ) { + return true; + } + + return false; + } + + public function asp_is_daily_tnx_limit_with_captcha_enabled() + { + $daily_txn_limit_with_captcha = $this->asp_main->get_setting('daily_txn_limit_with_captcha'); + + if(empty($daily_txn_limit_with_captcha)){ + return true; + } + if($daily_txn_limit_with_captcha && $daily_txn_limit_with_captcha >= 0) { + return true; + } + return false; + } + + private function asp_reset_daily_txn_counter() { + $txn_counter_args = array('counter_date' => $this->today, 'counter' => 0); + update_option($this->txn_counter_option_name, $txn_counter_args); + + return $txn_counter_args; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-debug-logger.php b/wp-content/plugins/stripe-payments/includes/class-asp-debug-logger.php new file mode 100644 index 0000000..ad1fff4 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-debug-logger.php @@ -0,0 +1,122 @@ +asp_main = AcceptStripePayments::get_instance(); + } + + public function create( $product_id, $pi_id = false ) { + $item = new ASP_Product_Item( $product_id ); + + $post = array(); + $post['post_title'] = '[Incomplete]' . $item->get_name(); + if ( ! $this->asp_main->is_live ) { + //Test Mode is on, we should add this to post title + $post['post_title'] = '[Test Mode] ' . $post['post_title']; + } + + $post['post_status'] = 'pending'; + $post['post_type'] = 'stripe_order'; + + $this->id = wp_insert_post( $post ); + + if ( false !== $pi_id ) { + update_post_meta( $this->id, 'pi_id', $pi_id ); + } + + update_post_meta( $this->id, 'asp_product_id', $product_id ); + + $this->change_status( 'incomplete' ); + + //let's insert WP user ID into order details. Can be used to display user's transaction history. + $user_id = get_current_user_id(); + if ( $user_id ) { + update_post_meta( $this->id, 'asp_user_id', $user_id ); + } + + return $this->id; + } + + public function find( $meta, $value ) { + $order = get_posts( + array( + 'post_type' => 'stripe_order', + 'meta_key' => $meta, + 'meta_value' => $value, + 'post_status' => 'any', + ) + ); + + if ( $order ) { + $this->id = $order[0]->ID; + return $this->id; + } + + return false; + } + + public function set_id( $id ) { + $this->id = $id; + } + + public function change_status( $new_status, $comment = false, $date = false ) { + update_post_meta( $this->id, 'asp_order_status', $new_status ); + + $order_events = get_post_meta( $this->id, 'asp_order_events', true ); + if ( empty( $order_events ) ) { + $order_events = array(); + } + + $order_events[] = array( + 'status' => $new_status, + 'comment' => $comment, + 'date' => false === $date ? time() : $date, + ); + + update_post_meta( $this->id, 'asp_order_events', $order_events ); + } + + public function get_id() { + return $this->id; + } + + public function get_status() { + return get_post_meta( $this->id, 'asp_order_status', true ); + } + + public function can_create( $prod_id = false ) { + $dont_create_order = $this->asp_main->get_setting( 'dont_create_order' ); + return ! $dont_create_order; + } + + public function update_legacy( $order_details, $charge_details ) { + $post = array(); + $post['post_title'] = $order_details['item_quantity'] . ' x ' . $order_details['item_name'] . ' - ' . AcceptStripePayments::formatted_price( $order_details['paid_amount'], $order_details['currency_code'] ); + if ( $order_details['is_live'] == 0 ) { + //Test Mode is on, we should add this to post title + $post['post_title'] = '[Test Mode] ' . $post['post_title']; + } + + $post['post_status'] = 'pending'; + + $output = ''; + + // Add error info in case of failure + if ( ! empty( $charge_details->failure_code ) ) { + + $output .= '

Payment Failure Details

' . "\n"; + $output .= $charge_details->failure_code . ': ' . $charge_details->failure_message; + $output .= "\n\n"; + } else { + $post['post_status'] = 'publish'; + } + + $order_date = date( 'Y-m-d H:i:s', $charge_details->created ); + $order_date = get_date_from_gmt( $order_date, get_option( 'date_format' ) . ', ' . get_option( 'time_format' ) ); + + $output .= '

' . __( 'Order Details', 'stripe-payments' ) . "

\n"; + $output .= __( 'Order Time', 'stripe-payments' ) . ': ' . $order_date . "\n"; + $output .= __( 'Transaction ID', 'stripe-payments' ) . ': ' . $charge_details->id . "\n"; + $output .= __( 'Description', 'stripe-payments' ) . ': ' . $order_details['charge_description'] . "\n"; + $output .= '--------------------------------' . "\n"; + $output .= __( 'Product Name', 'stripe-payments' ) . ': ' . $order_details['item_name'] . "\n"; + $output .= __( 'Quantity', 'stripe-payments' ) . ': ' . $order_details['item_quantity'] . "\n"; + $output .= __( 'Item Price', 'stripe-payments' ) . ': ' . AcceptStripePayments::formatted_price( $order_details['item_price'], $order_details['currency_code'] ) . "\n"; + //check if there are any additional items available like tax and shipping cost + $output .= AcceptStripePayments::gen_additional_items( $order_details ); + $output .= '--------------------------------' . "\n"; + $output .= __( 'Total Amount', 'stripe-payments' ) . ': ' . AcceptStripePayments::formatted_price( ( $order_details['paid_amount'] ), $order_details['currency_code'] ) . "\n"; + + $output .= "\n\n"; + + $output .= '

' . __( 'Customer Details', 'stripe-payments' ) . "

\n"; + // translators: %s is email address + $output .= sprintf( __( 'E-Mail Address: %s', 'stripe-payments' ), $order_details['stripeEmail'] ) . "\n"; + + if (isset($order_details['customer_name']) && !empty($order_details['customer_name'])){ + $output .= sprintf( __( 'Customer\'s Name: %s', 'stripe-payments' ), $order_details['customer_name'] ) . "\n"; + } + + // translators: %s is payment source (e.g. 'card' etc) + $output .= sprintf( __( 'Payment Source: %s', 'stripe-payments' ), $order_details['stripeTokenType'] ) . "\n"; + + if (isset($order_details['logged_in_user_id']) && !empty($order_details['logged_in_user_id'])) { + // translators: %s is ID + $output .= __( 'Logged-in User\'s Type: ', 'stripe-payments' ) . $order_details['logged_in_user_type'] . "\n"; + $output .= __( 'Logged-in User\'s User ID: ', 'stripe-payments' ) . $order_details['logged_in_user_id'] . "\n"; + } + if (isset($order_details['logged_in_user_name']) && !empty($order_details['logged_in_user_name'])) { + // translators: %s is username + $output .= __( 'Logged-in User\'s Username: ', 'stripe-payments' ) . $order_details['logged_in_user_name'] . "\n"; + } + + //Custom Fields (if set) + if ( isset( $order_details['custom_fields'] ) ) { + $custom_fields = ''; + foreach ( $order_details['custom_fields'] as $cf ) { + $custom_fields .= $cf['name'] . ': ' . $cf['value'] . "\r\n"; + } + // $custom_fields = rtrim( $custom_fields, "\r\n" ); + $output .= $custom_fields; + } + + //Check if we have TOS enabled and need to store customer's IP and timestamp + $tos_enabled = $this->asp_main->get_setting( 'tos_enabled' ); + $tos_store = $this->asp_main->get_setting( 'tos_store_ip' ); + + if ( $tos_enabled && $tos_store ) { + $ip = ! empty( $_SERVER['REMOTE_ADDR'] ) ? sanitize_text_field( $_SERVER['REMOTE_ADDR'] ) : __( 'Unknown', 'stripe-payments' ); + // translators: %s is IP address + $output .= sprintf( __( 'IP Address: %s', 'stripe-payments' ), $ip ) . "\n"; + } + + //Billing address data (if any) + if ( isset( $order_details['billing_address'] ) && strlen( $order_details['billing_address'] ) > 5 ) { + $output .= '

' . __( 'Billing Address', 'stripe-payments' ) . "

\n"; + $output .= $order_details['billing_address']; + } + + //Shipping address data (if any) + if ( isset( $order_details['shipping_address'] ) && strlen( $order_details['shipping_address'] ) > 5 ) { + $output .= '

' . __( 'Shipping Address', 'stripe-payments' ) . "

\n"; + $output .= $order_details['shipping_address']; + } + + $post['post_content'] = $output; + + $post = apply_filters( 'asp_order_before_insert', $post, $order_details, $charge_details ); + + $c_post = get_post( $this->id ); + + $c_post->post_title = $post['post_title']; + $c_post->post_status = $post['post_status']; + $c_post->post_content = $post['post_content']; + + wp_update_post( $c_post, true ); + + //let's insert WP user ID into order details. Can be used to display user's transaction history. + $user_id = get_current_user_id(); + if ( $user_id ) { + update_post_meta( $this->id, 'asp_user_id', $user_id ); + } + + return $this->id; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-payment-data.php b/wp-content/plugins/stripe-payments/includes/class-asp-payment-data.php new file mode 100644 index 0000000..a50b948 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-payment-data.php @@ -0,0 +1,303 @@ +obj_id = $obj_id; + } + if ( $zero_value ) { + $this->construct_zero_value(); + } else { + $this->load_from_obj(); + } + } + + public function get_last_error() { + return $this->last_error; + } + + public function get_price() { + $price = $this->get_amount(); + return $price; + } + + public function get_amount() { + if ( false === $this->amount ) { + $this->amount = $this->obj->charges->data[0]->amount; + } + return $this->amount; + } + + /** + * Get the surcharge data from payment intent metadata. + * + * @param $key string The key to get the value of. + * + * @return string Get the value as string if found. Otherwise, empty string. + */ + public function get_surcharge_data( string $key ) + { + if ( empty($this->surcharge_data) ) { + $metadata = isset($this->obj->charges->data[0]->metadata) ? $this->obj->charges->data[0]->metadata : array(); + if (isset($metadata['Surcharge Amount'])){ + $this->surcharge_data['amount'] = $metadata['Surcharge Amount']; + } + if (isset($metadata['Surcharge Label'])){ + $this->surcharge_data['label'] = $metadata['Surcharge Label']; + } + } + return isset($this->surcharge_data[$key]) ? (string) $this->surcharge_data[$key] : ''; + } + + public function get_currency() { + if ( false === $this->currency ) { + $this->currency = $this->obj->charges->data[0]->currency; + } + return $this->currency; + } + + public function get_charge_data() { + if ( false === $this->charge_data ) { + $this->charge_data = $this->obj->charges->data[0]; + } + return $this->charge_data; + } + + public function get_charge_created() { + if ( false === $this->charge_created ) { + $this->charge_created = $this->obj->charges->data[0]->created; + } + return $this->charge_created; + } + + public function get_trans_id() { + if ( false === $this->trans_id ) { + $this->trans_id = $this->obj->charges->data[0]->id; + } + return $this->trans_id; + } + + public function get_billing_details() { + if ( ! empty( $this->billing_details_obj ) ) { + return $this->billing_details_obj; + } + $billing_addr = new stdClass(); + $bd = $this->obj->charges->data[0]->billing_details; + + $billing_addr->name = ! empty( $bd->name ) ? sanitize_text_field($bd->name) : ( isset( $this->obj->customer->name ) ? sanitize_text_field( $this->obj->customer->name ): '' ); + $billing_addr->email = ! empty( $bd->email ) ? sanitize_text_field($bd->email) : ( isset( $this->obj->customer->email ) ? sanitize_text_field( $this->obj->customer->email) : '' ); + $billing_addr->line1 = isset( $bd->address->line1 ) ? sanitize_text_field($bd->address->line1) : ( isset( $this->obj->customer->address->line1 ) ? sanitize_text_field($this->obj->customer->address->line1) : '' ); + $billing_addr->line2 = isset( $bd->address->line2 ) ? sanitize_text_field($bd->address->line2) : ( isset( $this->obj->customer->address->line2 ) ? sanitize_text_field($this->obj->customer->address->line2) : '' ); + $billing_addr->postal_code = isset( $bd->address->postal_code ) ? sanitize_text_field($bd->address->postal_code) : ''; + $billing_addr->city = isset( $bd->address->city ) ? sanitize_text_field($bd->address->city) : ( isset( $this->obj->customer->address->city ) ? sanitize_text_field( $this->obj->customer->address->city ): '' ); + $billing_addr->state = isset( $bd->address->state ) ? sanitize_text_field($bd->address->state) : ( isset( $this->obj->customer->address->state ) ? sanitize_text_field($this->obj->customer->address->state) : '' ); + $billing_addr->country = isset( $bd->address->country ) ? sanitize_text_field( $bd->address->country) : ( isset( $this->obj->customer->address->country ) ? sanitize_text_field($this->obj->customer->address->country) : '' ); + + $this->billing_details_obj = $billing_addr; + return $this->billing_details_obj; + } + + public function set_billing_details(object $billing_addr) { + return $this->billing_details_obj = $billing_addr; + } + + public function get_shipping_details() { + if ( ! empty( $this->shipping_details_obj ) ) { + return $this->shipping_details_obj; + } + $shipping_addr = new stdClass(); + + $sd = $this->obj->charges->data[0]->shipping; + if ( empty( $sd ) ) { + if ( ! empty( $this->obj->customer ) ) { + $sd = $this->obj->customer->shipping; + } + } + + $shipping_addr->name = isset( $sd->name ) ? sanitize_text_field($sd->name) : ''; + $shipping_addr->line1 = isset( $sd->address->line1 ) ? sanitize_text_field($sd->address->line1) : ''; + $shipping_addr->line2 = isset( $sd->address->line2 ) ? sanitize_text_field($sd->address->line2) : ''; + $shipping_addr->postal_code = isset( $sd->address->postal_code ) ? sanitize_text_field($sd->address->postal_code) : ''; + $shipping_addr->city = isset( $sd->address->city ) ? sanitize_text_field($sd->address->city) : ''; + $shipping_addr->state = isset( $sd->address->state ) ? sanitize_text_field($sd->address->state) : ''; + $shipping_addr->country = isset( $sd->address->country ) ? sanitize_text_field($sd->address->country) : ''; + + $this->shipping_details_obj = $shipping_addr; + return $this->shipping_details_obj; + } + + public function get_billing_addr_str() { + $this->get_billing_details(); + $billing_address = ''; + $bd = $this->billing_details_obj; + $billing_address .= ! empty( $bd->name ) ? $bd->name . "\n" : ''; + $billing_address .= ! empty( $bd->line1 ) ? $bd->line1 . "\n" : ''; + $billing_address .= ! empty( $bd->line2 ) ? $bd->line2 . "\n" : ''; + $billing_address .= ! empty( $bd->postal_code ) ? $bd->postal_code . "\n" : ''; + $billing_address .= ! empty( $bd->city ) ? $bd->city . "\n" : ''; + $billing_address .= ! empty( $bd->state ) ? $bd->state . "\n" : ''; + $billing_address .= ! empty( $bd->country ) ? $bd->country . "\n" : ''; + return $billing_address; + } + + public function get_shipping_addr_str() { + $this->get_shipping_details(); + $shipping_address = ''; + $bd = $this->shipping_details_obj; + $shipping_address .= ! empty( $bd->name ) ? $bd->name . "\n" : ''; + $shipping_address .= ! empty( $bd->line1 ) ? $bd->line1 . "\n" : ''; + $shipping_address .= ! empty( $bd->line2 ) ? $bd->line2 . "\n" : ''; + $shipping_address .= ! empty( $bd->postal_code ) ? $bd->postal_code . "\n" : ''; + $shipping_address .= ! empty( $bd->city ) ? $bd->city . "\n" : ''; + $shipping_address .= ! empty( $bd->state ) ? $bd->state . "\n" : ''; + $shipping_address .= ! empty( $bd->country ) ? $bd->country . "\n" : ''; + return $shipping_address; + } + + public function get_customer_details() { + if ( false === $this->customer_obj ) { + $this->customer_obj = $this->obj->customer; + } + return $this->customer_obj; + } + + protected function load_from_obj() { + try { + if ( ASP_Utils::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $obj = $api->get( 'payment_intents/' . $this->obj_id . '?expand[]=customer' ); + + if ( false === $obj ) { + $error = $api->get_last_error(); + $this->last_error = $error['message']; + return false; + } + } else { + $obj = \Stripe\PaymentIntent::retrieve( + array( + 'id' => $this->obj_id, + 'expand' => array( 'customer' ), + ) + ); + } + } catch ( Exception $e ) { + $this->last_error = $e->getMessage(); + $this->last_error_obj = $e; + return false; + } + + // Check if associated charges aren't set for this payment intent object. + if( !isset ( $obj->charges ) ){ + //Using the new Stripe API version 2022-11-15 or later + ASP_Debug_Logger::log( 'Using the Stripe API version 2022-11-15 or later for Payment Intents object. Need to retrieve the charge object separately.' ); + //For Stripe API version 2022-11-15 or later, the charge object is not included in the payment intents object. It needs to be retrieved using the charge ID. + try { + //Retrieve the charges related to this payment intent as Stripe\Collection object. + $charges = \Stripe\Charge::all([ + 'payment_intent' => $this->obj_id, + ]);; + + // Add the charges to the payment intent object. + $obj->charges = $charges; + } catch (\Stripe\Exception\ApiErrorException $e) { + // Handle the error + ASP_Debug_Logger::log( 'Stripe error occurred trying to retrieve the associated charges for the payment intent. ' . $e->getMessage(), false ); + } + } + + $this->obj = $obj; + } + + public function get_obj() { + return $this->obj; + } + + public function construct_zero_value() { + $this->charge_data = new stdClass(); + $this->charge_data->id = $this->obj_id; + $this->trans_id = $this->charge_data->id; + $this->charge_data->created = time(); + $this->charge_created = $this->charge_data->created; + + $ipn_ng_class = ASP_Process_IPN_NG::get_instance(); + + $bd = new stdClass(); + + //Billing details + $b_name = $ipn_ng_class->get_post_var( 'asp_billing_name' ); + $bd->name = empty( $b_name ) ? '' : sanitize_text_field( stripslashes ( $b_name )); + + $b_email = $ipn_ng_class->get_post_var( 'asp_email' ); + $bd->email = empty( $b_email ) ? '' : sanitize_text_field( stripslashes($b_email)); + + $b_addr = $ipn_ng_class->get_post_var( 'asp_address' ); + $bd->line1 = empty( $b_addr ) ? '' : sanitize_text_field( stripslashes($b_addr)); + $bd->line2 = ''; + + $b_postal_code = $ipn_ng_class->get_post_var( 'asp_postcode' ); + $bd->postal_code = empty( $b_postal_code ) ? '' : sanitize_text_field( stripslashes($b_postal_code)); + + $b_city = $ipn_ng_class->get_post_var( 'asp_city' ); + $bd->city = empty( $b_city ) ? '' : sanitize_text_field( stripslashes($b_city)); + + $b_state = $ipn_ng_class->get_post_var( 'asp_state' ); + $bd->state = empty( $b_state ) ? '' : sanitize_text_field( stripslashes($b_state)); + + $b_country = $ipn_ng_class->get_post_var( 'asp_country' ); + $bd->country = empty( $b_country ) ? '' : sanitize_text_field( stripslashes($b_country)); + + $this->billing_details_obj = $bd; + + //Shipping details + $same_addr = $ipn_ng_class->get_post_var( 'asp_same-bill-ship-addr' ); + + if ( ! empty( $same_addr ) ) { + $this->shipping_details_obj = $this->billing_details_obj; + } else { + $sd = new stdClass(); + + $s_addr = $ipn_ng_class->get_post_var( 'asp_shipping_address' ); + $sd->line1 = empty( $s_addr ) ? '' : sanitize_text_field( stripslashes($s_addr)); + $sd->line2 = ''; + + $s_postal_code = $ipn_ng_class->get_post_var( 'asp_shipping_postcode' ); + $sd->postal_code = empty( $s_postal_code ) ? '' : sanitize_text_field( stripslashes($s_postal_code)); + + $s_city = $ipn_ng_class->get_post_var( 'asp_shipping_city' ); + $sd->city = empty( $s_city ) ? '' : sanitize_text_field( stripslashes($s_city)); + + $s_state = $ipn_ng_class->get_post_var( 'asp_shipping_state' ); + $sd->state = empty( $s_state ) ? '' : sanitize_text_field( stripslashes($s_state)); + + $s_country = $ipn_ng_class->get_post_var( 'asp_shipping_country' ); + $sd->country = empty( $s_country ) ? '' : sanitize_text_field( stripslashes($s_country)); + + $this->shipping_details_obj = $sd; + } + + $this->amount = 0; + + $this->currency = $ipn_ng_class->item->get_currency(); + + $ipn_ng_class->item->set_shipping( 0 ); + + $this->is_zero_value = true; + + } +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-pp-ajax.php b/wp-content/plugins/stripe-payments/includes/class-asp-pp-ajax.php new file mode 100644 index 0000000..32d92da --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-pp-ajax.php @@ -0,0 +1,709 @@ +process_ipn()" is called which does the post payment processing on our end. + */ + +class ASP_PP_Ajax { + + protected $asp_main; + + public function __construct() { + if ( wp_doing_ajax() ) { + // ASP_Utils::set_custom_lang_if_needed(); + $this->asp_main = AcceptStripePayments::get_instance(); + add_action( 'init', array( $this, 'add_ajax_handlers' ), 2147483647 ); + } + } + + public function add_ajax_handlers() { + add_action( 'wp_ajax_asp_pp_create_pi', array( $this, 'handle_create_pi' ) ); + add_action( 'wp_ajax_nopriv_asp_pp_create_pi', array( $this, 'handle_create_pi' ) ); + + add_action( 'wp_ajax_asp_pp_confirm_pi', array( $this, 'handle_confirm_pi' ) ); + add_action( 'wp_ajax_nopriv_asp_pp_confirm_pi', array( $this, 'handle_confirm_pi' ) ); + + add_action( 'wp_ajax_asp_3ds_result', array( $this, 'handle_3ds_result' ) ); + add_action( 'wp_ajax_nopriv_asp_3ds_result', array( $this, 'handle_3ds_result' ) ); + + add_action( 'wp_ajax_asp_pp_save_form_data', array( $this, 'save_form_data' ) ); + add_action( 'wp_ajax_nopriv_asp_pp_save_form_data', array( $this, 'save_form_data' ) ); + + add_action( 'wp_ajax_asp_pp_payment_error', array( $this, 'pp_payment_error' ) ); + add_action( 'wp_ajax_nopriv_asp_pp_payment_error', array( $this, 'pp_payment_error' ) ); + + add_action( 'wp_ajax_asp_pp_check_coupon', array( $this, 'handle_check_coupon' ) ); + add_action( 'wp_ajax_nopriv_asp_pp_check_coupon', array( $this, 'handle_check_coupon' ) ); + } + + public function handle_3ds_result() { + $pi_cs = isset( $_GET['payment_intent_client_secret'] ) ? sanitize_text_field( stripslashes ( $_GET['payment_intent_client_secret'] ) ) : ''; + $pi_cs = empty( $pi_cs ) ? '' : $pi_cs; + ?> + + + + + + + + + + asp_main->get_setting('captcha_type'); + if (empty( $captcha_type ) || $captcha_type == 'none' ) { + //Captcha is not enabled. Lets check txn rate limiting. + if($asp_daily_txn_counter_obj->asp_is_daily_txn_limit_reached()) { + $out['err'] = __( 'Error occurred: The transaction limit that you have set in settings has been reached for the day.', 'stripe-payments' ); + ASP_Debug_Logger::log($out['err'], false ); + + if($this->asp_main->get_setting("send_email_on_daily_txn_rate_limit")) { + ASP_Utils::send_daily_txn_rate_limit_email($out['err']); + } + wp_send_json( $out ); + } + } + else if($asp_daily_txn_counter_obj->asp_is_daily_tnx_limit_with_captcha_enabled()){ + //Captcha is enabled. Lets check txn rate limiting. + if ($asp_daily_txn_counter_obj->asp_is_daily_txn_limit_reached(true)) { + $out['err'] = __('Error occurred: The transaction limit that you have set in settings (with captcha) has been reached for the day.', 'stripe-payments'); + ASP_Debug_Logger::log($out['err'], false); + + if ($this->asp_main->get_setting("send_email_on_daily_txn_rate_limit")) { + ASP_Utils::send_daily_txn_rate_limit_email($out['err']); + } + wp_send_json($out); + } + } + + $product_id = filter_input( INPUT_POST, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + + $item = new ASP_Product_Item( $product_id ); + + if ( $item->get_last_error() ) { + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $item->get_last_error(); + wp_send_json( $out ); + } + + //Log initial confirm_pi debug logging data (if debug feature is enabled). + $txn_counter_args = $asp_daily_txn_counter_obj->asp_get_daily_txn_counter_args(); + $txn_counter_val = isset($txn_counter_args['counter'])? $txn_counter_args['counter'] : '-'; + $request_ip = ASP_Utils::get_user_ip_address(); + $confirm_pi_initial_debug = 'handle_confirm_pi() - Product ID: ' . $product_id . ', Captcha Type: ' . $captcha_type . ', Txn Counter: ' . $txn_counter_val . ', IP: ' . $request_ip; + ASP_Debug_Logger::log( $confirm_pi_initial_debug, true ); + //End initial confirm_pi debug logging. + + //Check page load signature data + if( !ASP_Utils_Bot_Mitigation::is_page_load_signature_data_valid($product_id) ){ + //Signature is invalid. + //Exit out if feature is enabled + $disable_signature_check = $this->asp_main->get_setting( 'disable_page_load_signature_check' ); + if ( $disable_signature_check ) { + //The signature check feature is disabled. We will allow this request to go through. + ASP_Debug_Logger::log( 'Notice! The page load signature check feature is disabled in the advanced settings menu so this request will not be blocked.', false ); + } else { + $out['err'] = __( 'Error! Page load signature check failed.', 'stripe-payments' ); + wp_send_json( $out ); + } + } + + //Check request limit count per IP address + if( !ASP_Utils_Bot_Mitigation::is_request_limit_reached_for_ip() ){ + //Request limit reached for this IP. + //Exit out if feature is enabled + $disable_request_limit_check = $this->asp_main->get_setting( 'disable_request_limit_per_ip_check' ); + if ( $disable_request_limit_check ) { + //The request limit check feature is disabled. We will allow this request to go through. + ASP_Debug_Logger::log( 'Notice! The transaction request limit per IP address feature is disabled in the advanced settings menu so this request will not be blocked.', false ); + } else { + $out['err'] = __( 'Error! Transaction request limit reached for this IP address.', 'stripe-payments' ); + wp_send_json( $out ); + } + } + + $item = apply_filters( 'asp_ng_pp_product_item_override', $item ); + + //Trigger some action hooks (useful for other checks). + do_action( 'asp_ng_before_token_request', $item ); + //ASP_Debug_Logger::log( 'handle_confirm_pi() - Captcha response checked.', true ); + + //This hook will be used to do additional captcha (if enabled) parameter checks for bot mitigation. + $params = array(); + do_action( 'asp_ng_do_additional_captcha_response_check', $item, $params ); + + do_action( 'asp_ng_product_mode_keys', $product_id ); + + $pi_id = isset( $_POST['pi_id'] ) ? sanitize_text_field( stripslashes ( $_POST['pi_id'] ) ) : ''; + $opts = isset( $_POST['opts'] ) ? sanitize_text_field( stripslashes ( $_POST['opts'] ) ) : ''; + + if ( ! empty( $opts ) ) { + $opts = html_entity_decode( $opts ); + $opts = json_decode( $opts, true ); + } else { + $opts = array(); + } + + $opts['use_stripe_sdk'] = false; + + $home_url = admin_url( 'admin-ajax.php' ); + + $disable_3ds_iframe = $this->asp_main->get_setting( 'disable_3ds_iframe' ); + + if ( ! $disable_3ds_iframe ) { + $url_opts = array( 'action' => 'asp_3ds_result' ); + } else { + $url_opts = array( + 'action' => 'asp_next_action_results', + 'is_live' => $this->asp_main->is_live, + ); + } + + $return_url = add_query_arg( $url_opts, $home_url ); + + $opts['return_url'] = $return_url; + + $opts = apply_filters( 'asp_ng_confirm_pi_opts', $opts, $pi_id ); + + try { + ASP_Utils::load_stripe_lib(); + $key = $this->asp_main->is_live ? $this->asp_main->APISecKey : $this->asp_main->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + $api->set_api_key( $key ); + + if ( ! ASP_Utils::use_internal_api() ) { + $pi = \Stripe\PaymentIntent::retrieve( $pi_id ); + } else { + $pi = $api->get( 'payment_intents/' . $pi_id ); + if ( false === $pi ) { + $err = $api->get_last_error(); + throw new \Exception( $err['message'], isset( $err['error_code'] ) ? $err['error_code'] : null ); + } + } + if ( 'succeeded' === $pi->status ) { + $out['pi_id'] = $pi->id; + wp_send_json( $out ); + } + if ( ! ASP_Utils::use_internal_api() ) { + $pi->confirm( $opts ); + } else { + $pi = $api->post( + 'payment_intents/' . $pi_id . '/confirm', + $opts + ); + if ( false === $pi ) { + $err = $api->get_last_error(); + throw new \Exception( $err['message'], isset( $err['error_code'] ) ? $err['error_code'] : null ); + } + } + } catch ( \Throwable $e ) { + $out['err'] = __( 'Stripe API error occurred:', 'stripe-payments' ) . ' ' . $e->getMessage(); + $order = new ASP_Order_Item(); + if ( false !== $order->find( 'pi_id', $pi_id ) ) { + $order->change_status( 'error', $out['err'] ); + } + $body = __( 'Following error occurred during payment processing:', 'stripe-payments' ) . "\r\n\r\n"; + $body .= $out['err'] . "\r\n\r\n"; + $body .= __( 'Debug data:', 'stripe-payments' ) . "\r\n"; + $post_data = filter_var( $_POST, FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + $post_data_str = http_build_query( $post_data, '', '; ' ); + $body .= sanitize_text_field( stripslashes($post_data_str)); + ASP_Debug_Logger::log( __( 'Following error occurred during payment processing:', 'stripe-payments' ) . ' ' . $out['err'], false ); + ASP_Utils::send_error_email( $body ); + wp_send_json( $out ); + } + + $out['pi_id'] = $pi->id; + + if ( isset( $pi->next_action ) ) { + $out['redirect_to'] = $pi->next_action->redirect_to_url->url; + $out['use_iframe'] = ! $disable_3ds_iframe; + } + + $out = apply_filters( 'asp_ng_confirm_pi_result_out', $out, $pi_id ); + + wp_send_json( $out ); + } + + public function handle_create_pi() { + + $out = array(); + $out['success'] = false; + $product_id = filter_input( INPUT_POST, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + $amount = filter_input( INPUT_POST, 'amount', FILTER_SANITIZE_NUMBER_FLOAT ); + $surcharge_amount = filter_input( INPUT_POST, 'surcharge_amount', FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION ); + $curr = isset( $_POST['curr'] ) ? sanitize_text_field( stripslashes ( $_POST['curr'] ) ) : ''; + $pi_id = isset( $_POST['pi'] ) ? sanitize_text_field( stripslashes ( $_POST['pi'] ) ) : ''; + $cust_id = isset( $_POST['cust_id'] ) ? sanitize_text_field( stripslashes ( $_POST['cust_id'] ) ) : ''; + $quantity = isset( $_POST['quantity'] ) ? sanitize_text_field( stripslashes ( $_POST['quantity'] ) ) : ''; + $nonce = isset( $_POST['nonce'] ) ? sanitize_text_field( stripslashes ( $_POST['nonce'] ) ) : ''; + $coupon_code = isset( $_POST['coupon'] ) ? sanitize_text_field( stripslashes ( $_POST['coupon'] ) ) : ''; + $price_variation = isset( $_POST['pvar'] ) ? sanitize_text_field( stripslashes ( $_POST['pvar'] ) ) : ''; + $post_billing_details = isset( $_POST['billing_details'] ) ? sanitize_text_field( stripslashes ( $_POST['billing_details'] ) ) : ''; + $post_shipping_details = isset( $_POST['shipping_details'] ) ? sanitize_text_field( stripslashes ( $_POST['shipping_details'] ) ) : ''; + $post_customer_details = isset( $_POST['customer_details'] ) ? sanitize_text_field( stripslashes ( $_POST['customer_details'] ) ) : ''; + + //Check create_pi nonce + if ( ! wp_verify_nonce( $nonce, 'asp_pp_ajax_create_pi_nonce' ) ) { + $out['err'] = __( 'Error occurred: Nonce security verification failed.', 'stripe-payments' ); + wp_send_json( $out ); + } + $asp_daily_txn_counter_obj = new ASP_Daily_Txn_Counter(); + $captcha_type = $this->asp_main->get_setting('captcha_type'); + if (empty($captcha_type) || $captcha_type == 'none') { + //Captcha is not enabled. Lets check txn rate limiting. + if ($asp_daily_txn_counter_obj->asp_is_daily_txn_limit_reached()) { + $out['err'] = __('Error occurred: The transaction limit that you have set in settings has been reached for the day.', 'stripe-payments'); + ASP_Debug_Logger::log($out['err'], false); + + if ($this->asp_main->get_setting("send_email_on_daily_txn_rate_limit")) { + ASP_Utils::send_daily_txn_rate_limit_email($out['err']); + } + wp_send_json($out); + } + } else if ($asp_daily_txn_counter_obj->asp_is_daily_tnx_limit_with_captcha_enabled()) { + //Captcha is enabled. Lets check txn rate limiting. + if ($asp_daily_txn_counter_obj->asp_is_daily_txn_limit_reached(true)) { + $out['err'] = __('Error occurred: The transaction limit that you have set in settings (with captcha) has been reached for the day.', 'stripe-payments'); + ASP_Debug_Logger::log($out['err'], false); + + if ($this->asp_main->get_setting("send_email_on_daily_txn_rate_limit")) { + ASP_Utils::send_daily_txn_rate_limit_email($out['err']); + } + wp_send_json($out); + } + } + + //Log initial create_pi debug logging data (if debug feature is enabled). + $txn_counter_args = $asp_daily_txn_counter_obj->asp_get_daily_txn_counter_args(); + $txn_counter_val = isset($txn_counter_args['counter'])? $txn_counter_args['counter'] : '-'; + $request_ip = ASP_Utils::get_user_ip_address(); + $create_pi_initial_debug = 'handle_create_pi() - Product ID: ' . $product_id . ', Captcha Type: ' . $captcha_type . ', Txn Counter: ' . $txn_counter_val . ', IP: ' . $request_ip; + ASP_Debug_Logger::log( $create_pi_initial_debug, true ); + //End initial create_pi debug logging. + + //Check page load signature data + if( !ASP_Utils_Bot_Mitigation::is_page_load_signature_data_valid($product_id) ){ + //Signature is invalid. + //Exit out if feature is enabled + $disable_signature_check = $this->asp_main->get_setting( 'disable_page_load_signature_check' ); + if ( $disable_signature_check ) { + //The signature check feature is disabled. We will allow this request to go through. + ASP_Debug_Logger::log( 'Notice! The page load signature check feature is disabled in the advanced settings menu so this request will not be blocked.', false ); + } else { + $out['err'] = __( 'Error! Page load signature check failed.', 'stripe-payments' ); + wp_send_json( $out ); + } + } + + //Check request usage count per IP address + if( !ASP_Utils_Bot_Mitigation::is_request_limit_reached_for_ip() ){ + //Request limit reached for this IP. + //Exit out if feature is enabled + $disable_request_limit_check = $this->asp_main->get_setting( 'disable_request_limit_per_ip_check' ); + if ( $disable_request_limit_check ) { + //The request limit check feature is disabled. We will allow this request to go through. + ASP_Debug_Logger::log( 'Notice! The transaction request limit per IP address feature is disabled in the advanced settings menu so this request will not be blocked.', false ); + } else { + $out['err'] = __( 'Error! Transaction request limit reached for this IP address.', 'stripe-payments' ); + wp_send_json( $out ); + } + } + + // >>>> Start of pre API submission validation. + $item_for_validation = new ASP_Product_Item( $product_id ); + //Do the API pre-submission price/amount validation. + if ( $item_for_validation->get_type() === 'one_time' ) { + //It's a one-time payment product. + + $custom_inputs = array( + 'coupon_code' => $coupon_code, + 'price_variation' => $price_variation, + 'billing_details' => json_decode( html_entity_decode( $post_billing_details ) , true), + 'shipping_details' => json_decode( html_entity_decode( $post_shipping_details ) , true), + ); + + if( ! $item_for_validation->validate_total_amount( $amount, $quantity, $custom_inputs) ){ + //Error condition. The validation function already set the error message which we will send back to the client. + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $item_for_validation->get_last_error(); + wp_send_json( $out ); + } + + //Validation passed. + + } else if ( $item_for_validation->get_type() === 'donation' ) { + //It's a donation product. Don't need to validate the amount since the user can enter any amount to donate. + ASP_Debug_Logger::log( "This is a donation type product. API pre-submission amount validation is not required.", true ); + } + //Trigger action hook that can be used to do additional API pre-submission validation from an addon. + do_action( 'asp_ng_before_api_pre_submission_validation', $item_for_validation ); + // <<<< End of pre API submission validation. + + $item = new ASP_Product_Item( $product_id ); + + if ( $item->get_last_error() ) { + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $item->get_last_error(); + wp_send_json( $out ); + } + + if ( $item->stock_control_enabled() ) { + $stock_items = $item->get_stock_items(); + $out['stock_items'] = $stock_items; + if ( $quantity > $stock_items ) { + // translators: %d is number of items in stock + $msg = apply_filters( 'asp_customize_text_msg', __( 'You cannot order more items than available: %d', 'stripe-payments' ), 'stock_not_available' ); + $out['err'] = sprintf( $msg, $stock_items ); + wp_send_json( $out ); + } + } + + $min_amount = $item->get_min_amount( true ); + $prod_type = $item->get_type(); + $configured_currency = $item->get_currency(); + $is_currency_variable = $item->is_currency_variable(); + + //Check configured currency matches with the request currency. + //Trigger filter that can be used to check this from the subscription addon (if needed). + $configured_currency = apply_filters( 'asp_create_pi_check_currency_configured', $configured_currency, $curr, $item ); + if ( $configured_currency !== $curr ) { + //Check if the currency variable option is enabled. + //Trigger filter that can be used to check this from the subscription addon (if needed). + $is_currency_variable = apply_filters( 'asp_create_pi_is_currency_variable', $is_currency_variable, $item ); + if ( $is_currency_variable ){ + //The currency variable option is enabled. We will allow this request to go through. + ASP_Debug_Logger::log( 'Note: The currency variable option is enabled in the product settings for this product.', true ); + } else { + //Error condition + ASP_Debug_Logger::log( 'Currency mismatch. The expected currency is: '.$configured_currency.', Received: '.$curr, false ); + $msg = apply_filters( 'asp_customize_text_msg', __( 'Currency mismatch. The product is configured to use', 'stripe-payments' ), 'currency_mismatch' ); + $out['err'] = $msg . ' ' . $configured_currency; + wp_send_json( $out ); + } + } + + //Check minimum amount. + if ( 'donation' === $prod_type && 0 !== $min_amount && $min_amount > $amount ) { + ASP_Debug_Logger::log( 'Minimum amount is: ' . $min_amount . ' ' . $curr, false ); + $msg = apply_filters( 'asp_customize_text_msg', __( 'Minimum amount is', 'stripe-payments' ), 'min_amount_is' ); + $out['err'] = $msg . ' ' . ASP_Utils::formatted_price( $min_amount, $curr, true ); + wp_send_json( $out ); + } + + //Trigger some action hooks (useful for other checks). + do_action( 'asp_ng_before_token_request', $item ); + //ASP_Debug_Logger::log( 'handle_create_pi() - Captcha response checked.', true ); + + //This hook will be used to do additional captcha (if enabled) parameter checks for bot mitigation. + $params = array(); + do_action( 'asp_ng_do_additional_captcha_response_check', $item, $params ); + + do_action( 'asp_ng_product_mode_keys', $product_id ); + + try { + ASP_Utils::load_stripe_lib(); + $key = $this->asp_main->is_live ? $this->asp_main->APISecKey : $this->asp_main->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + $api->set_api_key( $key ); + + } catch ( \Exception $e ) { + $out['err'] = __( 'Stripe API error occurred:', 'stripe-payments' ) . ' ' . $e->getMessage(); + wp_send_json( $out ); + } catch ( \Throwable $e ) { + $out['err'] = __( 'Stripe API error occurred:', 'stripe-payments' ) . ' ' . $e->getMessage(); + wp_send_json( $out ); + } + + $metadata = array(); + + try { + + $pi_params = array( + 'amount' => $amount, + 'currency' => $curr, + 'confirmation_method' => 'manual', + ); + + if ( isset( $post_billing_details ) ) { + $post_billing_details = html_entity_decode( $post_billing_details ); + + $billing_details = json_decode( $post_billing_details ); + } + + if ( isset( $post_customer_details ) ) { + $post_customer_details = html_entity_decode( $post_customer_details ); + + $customer_details = json_decode( $post_customer_details ); + } + + $dont_save_card = $this->asp_main->get_setting( 'dont_save_card' ); + + if ( ! $dont_save_card ) { + $customer_opts = array(); + + if ( isset( $billing_details ) ) { + + if ( ! empty( $billing_details->name ) ) { + $customer_opts['name'] = $billing_details->name; + } + + if ( ! empty( $billing_details->email ) ) { + $customer_opts['email'] = $billing_details->email; + } + + if ( isset( $billing_details->address ) && isset( $billing_details->address->line1 ) ) { + //we have address + $addr = array( + 'line1' => $billing_details->address->line1, + 'state' => isset( $billing_details->address->state ) ? $billing_details->address->state : null, + 'city' => isset( $billing_details->address->city ) ? $billing_details->address->city : null, + 'country' => isset( $billing_details->address->country ) ? $billing_details->address->country : null, + ); + + if ( isset( $billing_details->address->postal_code ) ) { + $addr['postal_code'] = $billing_details->address->postal_code; + } + + $customer_opts['address'] = $addr; + } + } + + if ( isset( $post_shipping_details ) ) { + $post_shipping_details = html_entity_decode( $post_shipping_details ); + + $shipping_details = json_decode( $post_shipping_details ); + + $shipping = array(); + + if ( isset($shipping_details->name) && $shipping_details->name ) { + $shipping['name'] = $shipping_details->name; + } elseif ( ! empty( $customer_opts['name'] ) ) { + $shipping['name'] = $customer_opts['name']; + } + + if ( isset( $shipping_details->address ) && isset( $shipping_details->address->line1 ) ) { + //we have address + $addr = array( + 'line1' => $shipping_details->address->line1, + 'state' => isset( $shipping_details->address->state ) ? $shipping_details->address->state : null, + 'city' => isset( $shipping_details->address->city ) ? $shipping_details->address->city : null, + 'country' => isset( $shipping_details->address->country ) ? $shipping_details->address->country : null, + ); + + if ( isset( $shipping_details->address->postal_code ) ) { + $addr['postal_code'] = $shipping_details->address->postal_code; + } + + $shipping['address'] = $addr; + + if ( ! empty( $shipping['name'] ) ) { + $customer_opts['shipping'] = $shipping; + } + } + } + + $is_use_separate_name_fields_enabled = \AcceptStripePayments::get_instance()->get_setting('use_separate_name_fields_enabled', false); + if ($is_use_separate_name_fields_enabled){ + $customer_opts['metadata'] = array( + 'First Name' => isset($customer_details->firstName) ? sanitize_text_field($customer_details->firstName) : '', + 'Last Name' => isset($customer_details->lastName) ? sanitize_text_field($customer_details->lastName) : '', + ); + } + $customer_opts = apply_filters( 'asp_ng_before_customer_create_update', $customer_opts, empty( $cust_id ) ? false : $cust_id ); + + if ( empty( $cust_id ) ) { + if ( ASP_Utils::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + + $customer = $api->post( 'customers', $customer_opts ); + + } else { + $customer = \Stripe\Customer::create( $customer_opts ); + } + + $cust_id = $customer->id; + } else { + + if ( ASP_Utils::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + + $customer = $api->post( 'customers/' . $cust_id, $customer_opts ); + + } else { + $customer = \Stripe\Customer::update( $cust_id, $customer_opts ); + } + } + $pi_params['customer'] = $cust_id; + } + + $metadata['Product Name'] = $item->get_name(); + $metadata['Product ID'] = $product_id; + + $metadata['Surcharge Amount'] = $surcharge_amount; + $metadata['Surcharge Label'] = $item->get_surcharge_label(); + + $tax_amount = $item->get_tax_amount(); + if (!empty($tax_amount)){ + $metadata['Tax Amount'] = \ASP_Utils::formatted_price( $tax_amount, $curr ); + } + + if ( isset( $metadata ) && ! empty( $metadata ) ) { + $pi_params['metadata'] = $metadata; + } + $description = $item->get_description(); + if ( ! empty( $description ) ) { + $pi_params['description'] = $description; + } else { + $pi_params['description'] = $item->get_name(); + } + + $stripe_receipt_email = $this->asp_main->get_setting( 'stripe_receipt_email' ); + + if ( $stripe_receipt_email ) { + if ( isset( $billing_details ) && isset( $billing_details->email ) && ! empty( $billing_details->email ) ) { + $pi_params['receipt_email'] = $billing_details->email; + } + } + + $order = new ASP_Order_Item(); + + if ( $order->can_create( $product_id ) ) { + + if ( ! $pi_id ) { + //create new incomplete order for this payment + $order->create( $product_id, $pi_id ); + } else { + //find order for this PaymentIntent + $order->find( 'pi_id', $pi_id ); + } + } + + $pi_params = apply_filters( 'asp_ng_before_pi_create_update', $pi_params ); + if ( $pi_id ) { + if ( ASP_Utils::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + + $intent = $api->post( 'payment_intents/' . $pi_id, $pi_params ); + } else { + $intent = \Stripe\PaymentIntent::update( $pi_id, $pi_params ); + } + } else { + if ( ASP_Utils::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $api->set_param( 'throw_exception', true ); + + $intent = $api->post( 'payment_intents', $pi_params ); + } else { + $intent = \Stripe\PaymentIntent::create( $pi_params ); + } + } + } catch ( \Exception $e ) { + $out['shipping'] = isset( $shipping ) ? wp_json_encode( $shipping ) : null; + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $e->getMessage(); + wp_send_json( $out ); + } catch ( \Throwable $e ) { + $out['shipping'] = isset( $shipping ) ? wp_json_encode( $shipping ) : null; + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $e->getMessage(); + wp_send_json( $out ); + } + + if ( $order->get_id() ) { + update_post_meta( $order->get_id(), 'pi_id', $intent->id ); + } + + $out['success'] = true; + $out['clientSecret'] = $intent->client_secret; + $out['pi_id'] = $intent->id; + $out['cust_id'] = $cust_id; + $out = apply_filters( 'asp_ng_before_pi_result_send', $out, $intent ); + wp_send_json( $out ); + } + + public function save_form_data() { + if ( ! check_ajax_referer( 'asp_pp_ajax_nonce', 'nonce', false ) ) { + $out['err'] = __( 'Error occurred: Nonce verification failed on save_form_data().', 'stripe-payments' ); + wp_send_json( $out ); + } + $out['success'] = true; + $sess = ASP_Session::get_instance(); + + wp_parse_str( $_POST['form_data'], $form_data ); + $filtered_form_data = $this->sanitize_nested_form_data($form_data); + + $sess->set_transient_data( 'asp_pp_form_data', $filtered_form_data ); + //ASP_Debug_Logger::log( 'Saved form data: ' . json_encode( $filtered_form_data ) ); + wp_send_json( $out ); + } + + public function sanitize_nested_form_data($data) { + foreach ($data as $key => $value) { + if (is_array($value)) { + $data[$key] = $this->sanitize_nested_form_data($value); + } else { + $data[$key] = sanitize_text_field($value); + } + } + return $data; + } + + + public function handle_check_coupon() { + $product_id = filter_input( INPUT_POST, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + $item = new ASP_Product_Item( $product_id ); + + if ( $item->get_last_error() ) { + $out['err'] = __( 'Error occurred:', 'stripe-payments' ) . ' ' . $item->get_last_error(); + wp_send_json( $out ); + } + + $coupon_code = isset( $_POST['coupon_code'] ) ? sanitize_text_field( stripslashes ( $_POST['coupon_code'] ) ) : ''; + + $coupon_valid = $item->check_coupon( $coupon_code ); + if ( ! $coupon_valid ) { + $out['err'] = $item->get_last_error(); + wp_send_json( $out ); + } + + $coupon = $item->get_coupon(); + + $zero_value_id = str_replace( '.', '', uniqid( 'free_', true ) ); + $coupon['zero_value_id'] = $zero_value_id; + + wp_send_json( $coupon ); + + } + +} + +new ASP_PP_Ajax(); diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-pp-display.php b/wp-content/plugins/stripe-payments/includes/class-asp-pp-display.php new file mode 100644 index 0000000..fcd781b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-pp-display.php @@ -0,0 +1,719 @@ +asp_main = AcceptStripePayments::get_instance(); + add_action( 'init', array( $this, 'showpp' ), 2147483647 ); + } else { + add_action( 'wp', array( $this, 'handle_wp' ) ); + } + + add_filter( 'pre_handle_404', array( $this, 'pre_handle_404' ), 10, 2 ); + } + + public function pre_handle_404( $preempt, $wp_query ) { + global $wp; + $custom_pages = array( AcceptStripePayments::$pp_slug ); + + if ( in_array( $wp->request, $custom_pages, true ) ) { + $preempt = true; + } + + return $preempt; + } + + public function handle_wp() { + global $wp; + $current_slug = $wp->request; + if ( AcceptStripePayments::$pp_slug === $current_slug ) { + $this->asp_main = AcceptStripePayments::get_instance(); + $this->showpp(); + } + } + + public function showpp() { + if ( ! defined( 'DONOTCACHEPAGE' ) ) { + define( 'DONOTCACHEPAGE', true ); + } + + if ( ! headers_sent() ) { + status_header( 200 ); + // disable WPEngine cache for the page + if ( class_exists( 'WpeCommon' ) ) { + $cookiepath = parse_url( get_home_url( null, AcceptStripePayments::$pp_slug ), PHP_URL_PATH ); + $cookie_domain = ! defined( 'COOKIE_DOMAIN' ) ? false : COOKIE_DOMAIN; + setcookie( 'wordpress_wpe_no_cache', 1, 0, $cookiepath, $cookie_domain, true, true ); + } + // set no-cache headers + header( 'Cache-Control: no-cache, must-revalidate, max-age=0' ); + header( 'Cache-Control: post-check=0, pre-check=0', false ); + header( 'Pragma: no-cache' ); + } + + $product_id = filter_input( INPUT_GET, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + + $this->item = new ASP_Product_Item( $product_id ); + + $this->item = apply_filters( 'asp_ng_pp_product_item_override', $this->item ); + + if ( $this->item->get_last_error() ) { + echo esc_html( $this->item->get_last_error() ); + exit; + } + + $plan_id = get_post_meta( $product_id, 'asp_sub_plan_id', true ); + + if ( ! empty( $plan_id ) && ! class_exists( 'ASPSUB_main' ) ) { + //Subs addon not installed or disabled. Show corresponding error message + echo ( 'This product requires Stripe Payments Subscription addon.' ); + exit; + } + + if ( ! empty( $plan_id ) && class_exists( 'ASPSUB_main' ) && version_compare( ASPSUB_main::ADDON_VER, '2.0.0t1' ) < 0 ) { + echo ( 'Stripe Subscriptions addon version 2.0.0 or newer is required.' ); + exit; + } + + $post_status = get_post_status( $product_id ); + if ( 'trash' === $post_status ) { + wp_die( __( 'This product is in the trash. Please restore this product from the trash if you want to use it', 'stripe-payments' ), '', 404 ); + } + + $a = array(); + + $a['prod_id'] = $product_id; + + do_action( 'asp_ng_product_mode_keys', $product_id ); + + $a['is_live'] = $this->asp_main->is_live; + + $this->uniq_id = uniqid(); + + $a['page_title'] = $this->item->get_name(); + $a['plugin_url'] = WP_ASP_PLUGIN_URL; + $a['item_name'] = $this->item->get_name(); + $a['stripe_key'] = $this->asp_main->is_live ? $this->asp_main->APIPubKey : $this->asp_main->APIPubKeyTest; + + //Save the payment popup load for this poduct in the temporary transient data (so it can be checked later). + ASP_Utils_Bot_Mitigation::record_page_load_signature_data($product_id); + + //Custom Field if needed + $custom_field = get_post_meta( $product_id, 'asp_product_custom_field', true ); + $cf_enabled = $this->asp_main->get_setting( 'custom_field_enabled' ); + if ( ( '' === $custom_field ) || '2' === $custom_field ) { + $custom_field = $cf_enabled; + } else { + $custom_field = intval( $custom_field ); + } + if ( ! $cf_enabled ) { + $custom_field = $cf_enabled; + } + + $this->custom_field = $custom_field; + $this->prod_id = $product_id; + + $cf_validation_regex = ''; + $cf_validation_err_msg = ''; + + if ( $custom_field ) { + + $show_custom_fields_below = $this->asp_main->get_setting( 'acf_show_fields_below' ); + if ($show_custom_fields_below){ + $a['custom_fields_below'] = $this->tpl_get_cf(); + }else{ + $a['custom_fields'] = $this->tpl_get_cf(); + } + //check if we have custom field validation enabled + $custom_validation = $this->asp_main->get_setting( 'custom_field_validation' ); + if ( ! empty( $custom_validation ) ) { + if ( 'num' === $custom_validation ) { + $cf_validation_regex = '^[0-9]+$'; + $cf_validation_err_msg = __( 'Only numbers are allowed: 0-9', 'stripe-payments' ); + } elseif ( 'custom' === $custom_validation ) { + $cf_validation_regex = $this->asp_main->get_setting( 'custom_field_custom_validation_regex' ); + $cf_validation_err_msg = $this->asp_main->get_setting( 'custom_field_custom_validation_err_msg' ); + } + } + } + + $currency = $this->item->get_currency(); + + //Currency Display settings + $display_settings = array(); + $display_settings['c'] = $this->asp_main->get_setting( 'price_decimals_num', 2 ); + $display_settings['d'] = $this->asp_main->get_setting( 'price_decimal_sep' ); + $display_settings['t'] = $this->asp_main->get_setting( 'price_thousand_sep' ); + $currencies = AcceptStripePayments::get_currencies(); + if ( isset( $currencies[ $currency ] ) ) { + $curr_sym = $currencies[ $currency ][1]; + } else { + //no currency code found, let's just use currency code instead of symbol + $curr_sym = $currency; + } + $curr_pos = $this->asp_main->get_setting( 'price_currency_pos' ); + $display_settings['s'] = $curr_sym; + $display_settings['pos'] = $curr_pos; + + $a['amount_variable'] = false; + if ( $this->item->is_variable() ) { + $a['amount_variable'] = true; + } + + if ( $this->item->get_price() === 0 ) { + //let's check to see if he have item_price passed via URL parameter + $passed_item_price = isset( $_GET['price'] ) ? sanitize_text_field( stripslashes ( $_GET['price'] ) ) : ''; + $passed_item_price = abs( floatval( $passed_item_price ) ); + if ( ! empty( $passed_item_price ) ) { + $this->item->set_price( $passed_item_price ); + } + } + + $a['currency_variable'] = false; + if ( $this->item->is_currency_variable() ) { + $a['currency_variable'] = true; + } + + $a['currency'] = $this->item->get_currency(); + + $billing_address = get_post_meta( $product_id, 'asp_product_collect_billing_addr', true ); + $shipping_address = get_post_meta( $product_id, 'asp_product_collect_shipping_addr', true ); + + $billing_address = empty( $billing_address ) ? false : true; + $shipping_address = empty( $shipping_address ) ? false : true; + + if ( ! $billing_address ) { + $shipping_address = false; + } + + $tos = $this->asp_main->get_setting( 'tos_enabled' ); + + if ( $tos ) { + $a['tos'] = true; + $a['tos_text'] = $this->asp_main->get_setting( 'tos_text' ); + } + + //Is coupon option enabled? + $coupons_enabled = get_post_meta( $product_id, 'asp_product_coupons_setting', true ); + if ( ( '' === $coupons_enabled ) || '2' === $coupons_enabled ) { + $coupons_enabled = $this->asp_main->get_setting( 'coupons_enabled' ); + } + if ( $a['amount_variable'] ) { + //Allow the coupon option for variable amount as well (in the past it was always disabled for variable amount). + //Commenting it out means it can be disabled via the product specific settings (see the above section of the code). + //$coupons_enabled = false; + } + $coupons_enabled = empty( $coupons_enabled ) ? false : true; + + $item_logo = ''; + + if ( ! get_post_meta( $product_id, 'asp_product_no_popup_thumbnail', true ) ) { + $item_logo = ASP_Utils::get_small_product_thumb( $product_id ); + if ( $a['is_live'] ) { + $item_logo = ASP_Utils::url_to_https( $item_logo ); + } + } + + //stock control + $stock_control_enabled = false; + $show_remaining = false; + $stock_items = 0; + if ( $this->item->stock_control_enabled() ) { + $stock_items = $this->item->get_stock_items(); + if ( empty( $stock_items ) ) { + $a['fatal_error'] = __( 'Out of stock', 'stripe-payments' ); + } else { + $stock_control_enabled = true; + $stock_items = $stock_items; + $show_remaining = get_post_meta( $product_id, 'asp_product_show_remaining_items', true ); + } + } + + //variations + $this->variations = array(); + $v = new ASPVariations( $product_id ); + if ( ! empty( $v->groups ) && empty( $plan_id ) ) { + $this->variations['groups'] = $v->groups; + $variations_names = get_post_meta( $product_id, 'asp_variations_names', true ); + $variations_prices_orig = get_post_meta( $product_id, 'asp_variations_prices', true ); + $variations_prices = apply_filters( 'asp_variations_prices_filter', $variations_prices_orig, $product_id ); + $variations_urls = get_post_meta( $product_id, 'asp_variations_urls', true ); + $variations_opts = get_post_meta( $product_id, 'asp_variations_opts', true ); + $this->variations['names'] = $variations_names; + $this->variations['prices'] = $variations_prices; + $this->variations['urls'] = $variations_urls; + $this->variations['opts'] = $variations_opts; + } + + $thankyou_page = get_post_meta( $product_id, 'asp_product_thankyou_page', true ); + $a['thankyou_page'] = $thankyou_page; + + $cust_email_hardcoded = get_post_meta( $product_id, 'asp_product_customer_email_hardcoded', true ); + $cust_name_hardcoded = get_post_meta( $product_id, 'asp_product_customer_name_hardcoded', true ); + + $user_id = get_current_user_id(); + $prefill_user_details = $this->asp_main->get_setting( 'prefill_wp_user_details' ); + + if ( $user_id && $prefill_user_details ) { + $user_info = get_userdata( $user_id ); + if ( false !== $user_info ) { + if ( empty( $cust_email_hardcoded ) ) { + $cust_email_hardcoded = $user_info->user_email; + } + if ( empty( $cust_name_hardcoded ) ) { + $last_name_first = $this->asp_main->get_setting( 'prefill_wp_user_last_name_first' ); + $cust_name_hardcoded = $last_name_first ? $user_info->last_name . ' ' . $user_info->first_name : $user_info->first_name . ' ' . $user_info->last_name; + } + } + } + + $default_country = $this->asp_main->get_setting( 'popup_default_country' ); + + $dont_save_card = $this->asp_main->get_setting( 'dont_save_card' ); + + $verify_zip = $this->asp_main->get_setting( 'enable_zip_validation' ); + + $checkout_lang = $this->asp_main->get_setting( 'checkout_lang' ); + + $checkout_lang = empty( $checkout_lang ) ? 'auto' : $checkout_lang; + + $data = array(); + $data['initTime'] = time(); + + $data['product_id'] = $product_id; + $data['item_name'] = $this->item->get_name(); + + $quantity = get_post_meta( $product_id, 'asp_product_quantity', true ); + if ( ! $quantity ) { + $quantity = 1; + } + $data['quantity'] = $quantity; + $data['custom_quantity'] = get_post_meta( $product_id, 'asp_product_custom_quantity', true ); + $data['amount_variable'] = $a['amount_variable']; + $data['currency_variable'] = $a['currency_variable']; + $data['currency'] = $a['currency']; + + $data['stock_control_enabled'] = $stock_control_enabled; + $data['stock_items'] = $stock_items; + $data['show_remaining'] = $show_remaining; + + $data['billing_address'] = $billing_address; + $data['shipping_address'] = $shipping_address; + + $data['coupons_enabled'] = $coupons_enabled; + $data['tos'] = $tos; + $data['item_logo'] = $item_logo; + + $data['url'] = base64_encode( $this->item->get_download_url() ); + + $data['client_secret'] = ''; + $data['pi_id'] = ''; + + $data['amount'] = $this->item->get_total( true ); + + $data['item_price'] = $this->item->get_price( true ); + + $data['min_amount'] = $this->item->get_min_amount( true ); + + $data['tax'] = $this->item->get_tax(); + $data['shipping'] = $this->item->get_shipping( true ); + + $data['is_physical_product'] = $this->item->is_physical_product(); + + + $data['surcharge'] = $this->item->get_surcharge(); + $data['surcharge_type'] = $this->item->get_surcharge_type(); + $data['surcharge_amount'] = $this->item->calculate_total_surcharge( true ); + $data['surcharge_label'] = $this->item->get_meta( 'asp_surcharge_label' ); + + $data['descr'] = $this->item->get_description(); + + $data['tax_variations'] = $this->item->get_meta( 'asp_product_tax_variations' ); + $data['shipping_variations'] = $this->item->get_meta( 'asp_product_shipping_variations' ); + + $tax_variations_type = $this->item->get_meta( 'asp_product_tax_variations_type' ); + + $data['tax_variations_type'] = empty( $tax_variations_type ) ? 'b' : $tax_variations_type; + + $data['custom_field'] = $custom_field; + $data['custom_field_validation_regex'] = $cf_validation_regex; + $data['custom_field_validation_err_msg'] = $cf_validation_err_msg; + + $data['stripe_receipt_email'] = $this->asp_main->get_setting( 'stripe_receipt_email' ); + + $data['variations'] = $this->variations; + + $data['is_live'] = $this->asp_main->is_live; + + $data['button_key'] = $this->item->get_button_key(); + + $data['create_token'] = false; + + $data['customer_email'] = $cust_email_hardcoded; + $data['customer_name'] = $cust_name_hardcoded; + + $data['dont_save_card'] = ! $dont_save_card ? false : true; + + $data['verify_zip'] = ! $verify_zip ? false : true; + + $data['checkout_lang'] = $checkout_lang; + + $data['customer_default_country'] = $default_country; + + $data['hide_amount_input'] = $this->item->get_meta( 'asp_product_hide_amount_input' ); + + $data['show_your_order'] = get_post_meta( $product_id, 'asp_product_show_your_order', true ); + $data['show_your_order'] = $data['show_your_order'] ? 1 : 0; + + $data['addons'] = array(); + + $data['payment_methods'][] = array( + 'id' => 'def', + 'title' => __( 'Credit or debit card', 'stripe-payments' ), + 'before_title' => ' + + + ', + ); + + $data['addonHooks'] = array(); + + $data = apply_filters( 'asp-button-output-data-ready', $data, array( 'product_id' => $product_id ) ); + + $data = apply_filters( 'asp_ng_pp_data_ready', $data, array( 'product_id' => $product_id ) ); + + // Authorize Only + $auth_only = get_post_meta( $product_id, 'asp_product_authorize_only', true ); + + if ( $auth_only ) { + //disable payment methods that do not support placing a hold on card + foreach ( $data['addons'] as $key => $addon ) { + if ( in_array( strtoupper( $addon['name'] ), $this->auth_not_supported, true ) ) { + unset( $data['addons'][ $key ] ); + } + } + + $data['addons'] = array_values( $data['addons'] ); + + foreach ( $data['payment_methods'] as $key => $pm ) { + if ( in_array( strtoupper( $pm['id'] ), $this->auth_not_supported, true ) ) { + unset( $data['payment_methods'][ $key ] ); + } + } + + $data['payment_methods'] = array_values( $data['payment_methods'] ); + + } + + //APM < 2.0.17 does not support tax variations + if ( ! empty( $data['tax_variations'] ) + && class_exists( 'ASPAPM_main' ) + && version_compare( ASPAPM_main::ADDON_VER, '2.0.17', '<' ) ) { + foreach ( $data['addons'] as $key => $addon ) { + if ( 'APM' === $addon['name'] ) { + unset( $data['addons'][ $key ] ); + } + } + + $data['addons'] = array_values( $data['addons'] ); + + foreach ( $data['payment_methods'] as $key => $pm ) { + if ( 'APM' === strtoupper( $pm['id'] ) ) { + unset( $data['payment_methods'][ $key ] ); + } + } + + $data['payment_methods'] = array_values( $data['payment_methods'] ); + ASP_Debug_Logger::log( sprintf( 'APM disabled for product %d: need APM 2.0.17+ for tax variation support.', $data['product_id'] ) ); + } + + //APM < 2.0.17 does not support checkbox variation type + if ( ! empty( $data['variations'] ) && class_exists( 'ASPAPM_main' ) && version_compare( ASPAPM_main::ADDON_VER, '2.0.17', '<' ) ) { + foreach ( $data['variations']['opts'] as $v_opt ) { + if ( $v_opt['type'] === '2' ) { + foreach ( $data['addons'] as $key => $addon ) { + if ( 'APM' === $addon['name'] ) { + unset( $data['addons'][ $key ] ); + } + } + + $data['addons'] = array_values( $data['addons'] ); + + foreach ( $data['payment_methods'] as $key => $pm ) { + if ( 'APM' === strtoupper( $pm['id'] ) ) { + unset( $data['payment_methods'][ $key ] ); + } + } + + $data['payment_methods'] = array_values( $data['payment_methods'] ); + + ASP_Debug_Logger::log( sprintf( 'APM disabled for product %d: need APM 2.0.17+ for checkbox variation type support.', $data['product_id'] ) ); + break; + } + } + } + + if ( empty( $plan_id ) ) { + $this->item->set_currency( $data['currency'] ); + $this->item->set_price( $data['item_price'], true ); + $data['item_price'] = $this->item->get_price( true ); + $this->item->set_shipping( $data['shipping'], true ); + $data['shipping'] = $this->item->get_shipping( true ); + + $tmp_curr = strtoupper( $data['currency'] ); + if ( isset( $currencies[ $tmp_curr ] ) ) { + $curr_sym = $currencies[ $tmp_curr ][1]; + } else { + //no currency code found, let's just use currency code instead of symbol + $curr_sym = $tmp_curr; + } + $display_settings['s'] = $curr_sym; + } + + $data['items'] = $this->item->get_items(); + + $a['data'] = $data; + + if ( isset( $data['fatal_error'] ) ) { + $a['fatal_error'] = $data['fatal_error']; + } + + $a['scripts'] = array(); + $a['styles'] = array(); + $a['vars'] = array(); + + // Stripe script should come first + $a['scripts'][] = array( + 'footer' => true, + 'src' => 'https://js.stripe.com/v3/', + ); + + $site_url = $data['is_live'] ? get_site_url( null, '', 'https' ) : get_site_url(); + $a['scripts'][] = array( + 'src' => $site_url . '/wp-includes/js/jquery/jquery.js?ver=1.12.4-wp', + 'footer' => true, + ); + + //filters for addons to add styles, scripts and vars + $a['styles'] = apply_filters( 'asp_ng_pp_output_add_styles', $a['styles'] ); + $a['scripts'] = apply_filters( 'asp_ng_pp_output_add_scripts', $a['scripts'] ); + $a['vars'] = apply_filters( 'asp_ng_pp_output_add_vars', $a['vars'] ); + + if ( ! defined( 'WP_ASP_DEV_MODE' ) ) { + $a['styles'][] = array( + 'footer' => false, + 'src' => WP_ASP_PLUGIN_URL . '/public/views/templates/default/pp-combined.min.css?ver=' . WP_ASP_PLUGIN_VERSION, + ); + $a['scripts'][] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/public/assets/js/pp-handler.min.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + } else { + $a['styles'][] = array( + 'footer' => false, + 'src' => WP_ASP_PLUGIN_URL . '/public/views/templates/default/pure.css?ver=' . WP_ASP_PLUGIN_VERSION, + ); + $a['styles'][] = array( + 'footer' => false, + 'src' => WP_ASP_PLUGIN_URL . '/public/views/templates/default/pp-style.css?ver=' . WP_ASP_PLUGIN_VERSION, + ); + $a['scripts'][] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/public/assets/js/md5.min.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + $a['scripts'][] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/public/assets/js/add-ons/tax-variations.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + $a['scripts'][] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/public/assets/js/pp-handler.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + } + + $a['hide_state_field'] = $this->asp_main->get_setting( 'hide_state_field' ); + + $pay_btn_text = $this->asp_main->get_setting( 'popup_button_text' ); + + if ( empty( $pay_btn_text ) ) { + // translators: %s is not a placeholder + $pay_btn_text = __( 'Pay %s', 'stripe-payments' ); + } else { + $pay_btn_text = __( $pay_btn_text, 'stripe-payments' ); + } + + if ( $auth_only ) { + // translators: %s is not a placeholder + $pay_btn_text = __( 'Authorize %s', 'stripe-payments' ); + } + + if ( isset( $data['is_trial'] ) && $data['is_trial'] ) { + if ( empty( $plan_id ) ) { + $data['amount_variable'] = false; + if ( $this->item->get_price() === 0 ) { + $data['amount_variable'] = false; + } + } + $pay_btn_text = apply_filters( 'asp_customize_text_msg', __( 'Start Free Trial', 'stripe-payments' ), 'start_free_trial' ); + } + + // Check user has specified any popup-payment button text for individual product. + $per_product_pay_btn_text = $this->item->get_meta( 'asp_product_popup_button_text' ); + if (!empty($per_product_pay_btn_text)) { + $pay_btn_text = __( $per_product_pay_btn_text, 'stripe-payments' ); + } + + //filter to change pay button text + $pay_btn_text = apply_filters( 'asp_ng_pp_pay_button_text', $pay_btn_text ); + + $a['item'] = $this->item; + + $btn_uniq_id = isset( $_GET['btn_uniq_id'] ) ? sanitize_text_field( stripslashes ( $_GET['btn_uniq_id'] ) ) : ''; + if ( ! empty( $btn_uniq_id ) ) { + $a['btn_uniq_id'] = $btn_uniq_id; + } + + $a['vars']['vars'] = array( + 'data' => $data, + 'stripe_key' => ! empty( $data['stripe_key'] ) ? $data['stripe_key'] : $a['stripe_key'], + 'stripe_api_ver' => ASPMain::$stripe_api_ver, + 'minAmounts' => $this->asp_main->minAmounts, + 'zeroCents' => $this->asp_main->zeroCents, + 'ajaxURL' => admin_url( 'admin-ajax.php' ), + 'asp_pp_ajax_nonce' => wp_create_nonce( 'asp_pp_ajax_nonce' ), + 'asp_pp_ajax_create_pi_nonce' => wp_create_nonce( 'asp_pp_ajax_create_pi_nonce' ), + 'currencyFormat' => $display_settings, + 'payBtnText' => $pay_btn_text, + 'amountOpts' => array( + 'applySepOpts' => $this->asp_main->get_setting( 'price_apply_for_input' ), + 'decimalSep' => $this->asp_main->get_setting( 'price_decimal_sep' ), + 'thousandSep' => $this->asp_main->get_setting( 'price_thousand_sep' ), + ), + 'str' => array( + 'strEnterValidAmount' => apply_filters( 'asp_customize_text_msg', __( 'Please enter a valid amount', 'stripe-payments' ), 'enter_valid_amount' ), + 'strMinAmount' => apply_filters( 'asp_customize_text_msg', __( 'Minimum amount is', 'stripe-payments' ), 'min_amount_is' ), + 'strEnterQuantity' => apply_filters( 'asp_customize_text_msg', __( 'Please enter quantity.', 'stripe-payments' ), 'enter_quantity' ), + 'strQuantityIsZero' => apply_filters( 'asp_customize_text_msg', __( 'Quantity can\'t be zero.', 'stripe-payments' ), 'quantity_is_zero' ), + 'strQuantityIsFloat' => apply_filters( 'asp_customize_text_msg', __( 'Quantity should be integer value.', 'stripe-payments' ), 'quantity_is_float' ), + // translators: %d is number of items in stock + 'strStockNotAvailable' => apply_filters( 'asp_customize_text_msg', __( 'You cannot order more items than available: %d', 'stripe-payments' ), 'stock_not_available' ), + 'strTax' => apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ), + 'strShipping' => apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ), + 'strSurcharge' => apply_filters( 'asp_customize_text_msg', __( 'Surcharge', 'stripe-payments' ), 'surcharge_str' ), + 'strTotal' => __( 'Total:', 'stripe-payments' ), + 'strPleaseFillIn' => apply_filters( 'asp_customize_text_msg', __( 'Please fill in this field.', 'stripe-payments' ), 'fill_in_field' ), + 'strPleaseCheckCheckbox' => __( 'Please check this checkbox.', 'stripe-payments' ), + 'strMustAcceptTos' => apply_filters( 'asp_customize_text_msg', __( 'You must accept the terms before you can proceed.', 'stripe-payments' ), 'accept_terms' ), + 'strCoupon' => __( 'Coupon', 'stripe-payments' ), + 'strRemoveCoupon' => apply_filters( 'asp_customize_text_msg', __( 'Remove coupon', 'stripe-payments' ), 'remove_coupon' ), + 'strRemove' => apply_filters( 'asp_customize_text_msg', __( 'Remove', 'stripe-payments' ), 'remove' ), + 'strStartFreeTrial' => apply_filters( 'asp_customize_text_msg', __( 'Start Free Trial', 'stripe-payments' ), 'start_free_trial' ), + 'strInvalidCFValidationRegex' => __( 'Invalid validation RegEx: ', 'stripe-payments' ), + 'strGetForFree' => __( 'Purchase for Free', 'stripe-payments' ), + 'strCurrencyNotSupported' => __( 'Currency not supported for this payment method.', 'stripe-payments' ), + 'strforRecurringPayments' => __( ' for upcoming recurring payments', 'stripe-payments' ), + 'str3DSecureFailed' => __( '3D Secure failed.', 'stripe-payments' ), + 'strAbort3DSecure' => __( 'Abort 3D Secure check?', 'stripe-payments' ), + ), + ); + + if ( isset( $a['fatal_error'] ) ) { + $a['vars']['vars']['fatal_error'] = $a['fatal_error']; + } + + $a ['pay_btn_text'] = str_replace( '%s', AcceptStripePayments::formatted_price( $this->item->get_total(), $this->item->get_currency() ), $pay_btn_text ); + + //output custom PP CSS if needed + add_action( 'asp_ng_pp_output_before_closing_body', array( $this, 'output_custom_css' ), 1000 ); + + require_once WP_ASP_PLUGIN_PATH . 'public/views/templates/default/payment-popup.php'; + exit; + } + + public function output_custom_css( $a ) { + $pp_additional_css = $this->asp_main->get_setting( 'pp_additional_css' ); + if ( empty( $pp_additional_css ) ) { + return; + } + echo sprintf( "\r\n", wp_kses( str_replace( array( "\t", "\r\n" ), '', $pp_additional_css ), array() ) ); + } + + public function tpl_get_cf( $output = '' ) { + if ( empty( $this->tpl_cf ) ) { + $replace_cf = apply_filters( + 'asp_ng_button_output_replace_custom_field', + '', + array( + 'product_id' => $this->prod_id, + 'custom_field' => $this->custom_field, + ) + ); + if ( ! empty( $replace_cf ) ) { + //we got custom field replaced + $this->tpl_cf = $replace_cf; + $output .= $this->tpl_cf; + $this->tpl_cf = ''; + return $output; + } + $field_type = $this->asp_main->get_setting( 'custom_field_type' ); + $field_name = $this->asp_main->get_setting( 'custom_field_name' ); + $field_name = empty( $field_name ) ? __( 'Custom Field', 'stripe-payments' ) : $field_name; + $field_descr = $this->asp_main->get_setting( 'custom_field_descr' ); + $descr_loc = $this->asp_main->get_setting( 'custom_field_descr_location' ); + $mandatory = $this->asp_main->get_setting( 'custom_field_mandatory' ); + $tpl_cf = ''; + $tpl_cf .= "
"; + $tpl_cf .= '
'; + $tpl_cf .= ''; + switch ( $field_type ) { + case 'text': + if ( 'below' !== $descr_loc ) { + $tpl_cf .= sprintf( + '', + esc_html( $field_name ), + ( $mandatory ? ' data-asp-custom-mandatory' : '' ), + esc_attr( $field_descr ), + ( $mandatory ? ' required' : '' ) + ); + } else { + $tpl_cf .= sprintf( + '', + esc_html( $field_name ), + ( $mandatory ? ' data-asp-custom-mandatory' : '' ), + ( $mandatory ? ' required' : '' ) + ); + $tpl_cf .= sprintf( '
%s
', $field_descr ); + } + break; + case 'checkbox': + $tpl_cf .= ''; + break; + } + $tpl_cf .= '' . + '
' . + '
'; + $this->tpl_cf = $tpl_cf; + } + $output .= $this->tpl_cf; + $this->tpl_cf = ''; + return $output; + } +} + +new ASP_PP_Display(); diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-process-ipn-ng.php b/wp-content/plugins/stripe-payments/includes/class-asp-process-ipn-ng.php new file mode 100644 index 0000000..b979f78 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-process-ipn-ng.php @@ -0,0 +1,926 @@ +asp_class = AcceptStripePayments::get_instance(); + $this->sess = ASP_Session::get_instance(); + $this->asp_redirect_url = $this->asp_class->get_setting( 'checkout_url' ); + + $process_ipn = filter_input( INPUT_POST, 'asp_process_ipn', FILTER_SANITIZE_NUMBER_INT ); + if ( $process_ipn ) { + add_action( 'asp_ng_process_ipn_payment_data_item_override', array( $this, 'payment_data_override' ), 10, 2 ); + add_action( 'wp_loaded', array( $this, 'process_ipn' ), 2147483647 ); + } + + if ( wp_doing_ajax() ) { + add_action( 'wp_ajax_asp_next_action_results', array( $this, 'handle_next_action_results' ) ); + add_action( 'wp_ajax_nopriv_asp_next_action_results', array( $this, 'handle_next_action_results' ) ); + } + + } + + public static function get_instance() { + if ( null === self::$instance ) { + self::$instance = new self(); + } + return self::$instance; + } + + public function handle_next_action_results() { + ASP_Debug_Logger::log( 'handle_next_action_results() - processing.', true); + + $pi_id = isset( $_GET['payment_intent'] ) ? sanitize_text_field( stripslashes ( $_GET['payment_intent'] ) ) : ''; + + $is_live = isset( $_GET['is_live'] ) ? sanitize_text_field( stripslashes ( $_GET['is_live'] ) ) : ''; + $is_live = 'false' === $is_live ? 0 : 1; + + $sess = ASP_Session::get_instance(); + $form_data = $sess->get_transient_data( 'asp_pp_form_data' ); + + foreach ( $form_data as $name => $value ) { + $post_data[ 'asp_' . $name ] = $value; + } + + unset( $post_data['asp_process_ipn'] ); + + $post_data['asp_payment_intent'] = $pi_id; + + $_POST = $post_data; + + $this->post_data = $post_data; + + $product_id = $this->get_post_var( 'asp_product_id', FILTER_SANITIZE_NUMBER_INT ); + + do_action( 'asp_ng_product_mode_keys', $product_id ); + + try { + + ASPMain::load_stripe_lib(); + $key = $is_live ? $this->asp_class->APISecKey : $this->asp_class->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + if ( ASP_Utils::use_internal_api() ) { + + $api = ASP_Stripe_API::get_instance(); + $api->set_api_key( $key ); + + $intent = $api->get( 'payment_intents/' . $pi_id ); + + if ( 'succeeded' !== $intent->status ) { + $res = $api->post( + 'payment_intents/' . $pi_id . '/confirm', + array() + ); + if ( false === $res ) { + $err = $api->get_last_error(); + $this->err = $err['message']; + } + } + } else { + $intent = \Stripe\PaymentIntent::retrieve( $pi_id ); + if ( 'succeeded' !== $intent->status ) { + $intent->confirm(); + } + } + } catch ( \Throwable $e ) { + $this->err = $e->getMessage(); + } + + $this->process_ipn( $post_data ); + } + + public function ipn_completed( $err_msg = '' ) { + if ( ! empty( $err_msg ) ) { + $asp_data = array( 'error_msg' => $err_msg ); + ASP_Debug_Logger::log( $err_msg, false ); //Log the error + + $this->sess->set_transient_data( 'asp_data', $asp_data ); + + //Trigger an action hook for this error condition. + //The $_POST data is available in the global $_POST variable which may contain additional details. + do_action( 'asp_stripe_process_ipn_error', $err_msg ); + + //send email to notify site admin (if option enabled) + $opt = get_option( 'AcceptStripePayments-settings' ); + if ( isset( $opt['send_email_on_error'] ) && $opt['send_email_on_error'] ) { + $body = ''; + $body .= __( 'Following error occurred during payment processing:', 'stripe-payments' ) . "\r\n\r\n"; + $body .= $err_msg . "\r\n\r\n"; + $body .= __( 'Debug data:', 'stripe-payments' ) . "\r\n"; + $post = filter_var( $_POST, FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + foreach ( $post as $key => $value ) { + //Make sure the value is not an array. + $value = is_array( $value ) ? wp_json_encode( $value ) : $value; + + $key = sanitize_text_field( stripslashes( $key )); + $value = sanitize_text_field( stripslashes( $value )); + + $body .= $key . ': ' . $value . "\r\n"; + } + ASP_Utils::send_error_email( $body ); + } + } else { + ASP_Debug_Logger::log( 'Payment has been processed successfully.' ); + } + + $structure = get_option( 'permalink_structure' ); + + $url_host = str_replace( 'www.', '', parse_url( $this->asp_redirect_url, PHP_URL_HOST ) ); + $home_url_host = str_replace( 'www.', '', parse_url( home_url(), PHP_URL_HOST ) ); + + if ( empty( $structure && ( $url_host && $url_host === $home_url_host ) ) ) { + $path = basename( parse_url( $this->asp_redirect_url, PHP_URL_PATH ) ); + $r_post = get_page_by_path( $path ); + if ( ! empty( $r_post ) ) { + $this->asp_redirect_url = get_permalink( $r_post->ID ); + } + } + + if ( is_ssl() ) { + $this->asp_redirect_url = ASP_Utils::url_to_https( $this->asp_redirect_url ); + } + + ASP_Debug_Logger::log( sprintf( 'Redirecting to results page "%s"', $this->asp_redirect_url ) . "\r\n" ); + wp_redirect( $this->asp_redirect_url ); + exit; + } + + public function get_post_var( $var, $filter = FILTER_UNSAFE_RAW, $opts = 0 ) { + if ( isset( $this->post_data ) ) { + if ( isset( $this->post_data[ $var ] ) ) { + return filter_var( $this->post_data[ $var ], $filter, $opts ); + } else { + return null; + } + } + $val = filter_input( INPUT_POST, $var, $filter, $opts ); + return $val; + } + + private function paid_amount_valid( $expected_amount_in_cents, $amount_paid, $item ) { + //Check if paid amount is less than expected amount. + if ( $amount_paid < $expected_amount_in_cents ) { + //Incorrect amount paid. Flag the transaction. + + //Check if this is a subs product + if ( method_exists( $item, 'get_plan_id' ) ) { + //This is a subsription product. Let's check if subs addon version is prior to 2.0.1. + if ( version_compare( ASPSUB_main::ADDON_VER, '2.0.1' ) < 0 ) { + //subs addon version is prior to 2.0.1. This means error is most likely not legit. + return true; + } + } + return false; + } + //Paid amount looks good. + return true; + } + + private function paid_currency_valid( $p_curr, $configured_currency, $item ){ + //$item object can be used to retreive the product details. + //Trigger filter that can be used to check this from the subscription addon (if needed). + $configured_currency = apply_filters( 'asp_ipn_check_currency_configured', $configured_currency, $p_curr, $item ); + + if ( strtolower($p_curr) !== strtolower($configured_currency) ) { + return false; + } + return true; + } + + public function process_ipn( $post_data = array() ) { + ASP_Debug_Logger::log( 'Payment processing started.' ); + + if ( ! empty( $post_data ) ) { + $post_data = filter_var( $post_data, FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + $post_data_str = http_build_query( $post_data, '', '; ' ); + ASP_Debug_Logger::log( 'Custom $_POST data: ' . $post_data_str ); + $this->post_data = $post_data; + } else { + $post_data = filter_var( $_POST, FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + $post_data_str = http_build_query( $post_data, '', '; ' ); + //ASP_Debug_Logger::log( 'Original $_POST data: ' . $post_data_str ); + } + + do_action( 'asp_ng_before_payment_processing', $post_data ); + + $this->sess = ASP_Session::get_instance(); + + $post_thankyou_page_url = $this->get_post_var( 'asp_thankyou_page_url' ); + $post_thankyou_page_url = sanitize_text_field( stripslashes( $post_thankyou_page_url ) ); + $this->asp_redirect_url = empty( $post_thankyou_page_url ) ? $this->asp_class->get_setting( 'checkout_url' ) : base64_decode( $post_thankyou_page_url ); + + $prod_id = $this->get_post_var( 'asp_product_id', FILTER_SANITIZE_NUMBER_INT ); + + if ( ! empty( $prod_id ) ) { + ASP_Debug_Logger::log( sprintf( 'Got product ID: %d', $prod_id ) ); + } + + $item = new ASP_Product_Item( $prod_id ); + + ASP_Debug_Logger::log( 'Firing asp_ng_process_ipn_product_item_override filter.' ); + + $item = apply_filters( 'asp_ng_process_ipn_product_item_override', $item ); + + $err = $item->get_last_error(); + + if ( ! empty( $err ) ) { + $this->ipn_completed( $err ); + } + + $this->item = $item; + + if ( empty( $this->asp_redirect_url ) && $item->get_redir_url() ) { + $this->asp_redirect_url = $item->get_redir_url(); + } + + if ( $this->err ) { + $this->ipn_completed( $this->err ); + } + + $pi = $this->get_post_var( 'asp_payment_intent' ); + $pi = sanitize_text_field( stripslashes( $pi ) ); + + $completed_order = get_posts( + array( + 'post_type' => 'stripe_order', + 'meta_key' => 'pi_id', + 'meta_value' => $pi, + ) + ); + + wp_reset_postdata(); + + if ( ! empty( $completed_order ) ) { + //already processed - let's redirect to results page + $this->ipn_completed(); + exit; + } + + $is_live = $this->get_post_var( 'asp_is_live', FILTER_VALIDATE_BOOLEAN ); + + do_action( 'asp_ng_product_mode_keys', $prod_id ); + + ASP_Utils::load_stripe_lib(); + $key = $is_live ? $this->asp_class->APISecKey : $this->asp_class->APISecKeyTest; + \Stripe\Stripe::setApiKey( $key ); + + $api = ASP_Stripe_API::get_instance(); + $api->set_api_key( $key ); + + //Get Payment Data + ASP_Debug_Logger::log( 'Firing asp_ng_process_ipn_payment_data_item_override filter.' ); + + $p_data = apply_filters( 'asp_ng_process_ipn_payment_data_item_override', false, $pi ); + + if ( false === $p_data ) { + //Payment data override filter did not return any data. Let's get the data from the payment intent object. + //The billing details [example: ASP_Payment_Data->get_billing_details()] and some other transaction data are read from the payment intent object within the ASP_Payment_Data class. + $p_data = new ASP_Payment_Data( $pi ); + } + + $p_last_err = $p_data->get_last_error(); + + if ( ! empty( $p_last_err ) ) { + $this->ipn_completed( $p_last_err ); + } + + $this->p_data = $p_data; + //End retrieval of payment data + + //Mechanism to lock the txn that is being processed. + $txn_being_processed = get_option( 'asp_ng_ipn_txn_being_processed' ); + $notification_txn_id = $p_data->get_trans_id(); + ASP_Debug_Logger::log( 'The transaction ID of this notification is: ' . $notification_txn_id ); + if ( ! empty( $txn_being_processed ) && $txn_being_processed === $notification_txn_id ) { + //No need to process this transaction as it is already being processed. + ASP_Debug_Logger::log( 'This transaction (' . $notification_txn_id . ') is already being procesed. This is likely a duplicate notification. Nothing to do.' ); + return true; + } + update_option( 'asp_ng_ipn_txn_being_processed', $notification_txn_id ); + //End of transaction processing lock mechanism + + //Button key + $button_key = $item->get_button_key(); + + //Item quantity + $post_quantity = $this->get_post_var( 'asp_quantity', FILTER_SANITIZE_NUMBER_INT ); + if ( $post_quantity ) { + $item->set_quantity( $post_quantity ); + } + + //Item price + $price = $item->get_price(); + $curr = $item->get_currency(); + $shipping = $item->get_shipping(); + + if ( ! method_exists( $item, 'get_plan_id' ) ) { + $price_arr = apply_filters( + 'asp_modify_price_currency_shipping', + array( + 'price' => $price, + 'currency' => $curr, + 'shipping' => empty( $shipping ) ? false : $shipping, + 'variable' => empty( $price ) ? true : false, + ) + ); + $item->set_price( $price_arr['price'] ); + $item->set_currency( $price_arr['currency'] ); + $item->set_shipping( $price_arr['shipping'] ); + } + + $tax_variations_arr = $item->get_meta( 'asp_product_tax_variations' ); + + $tax_variations_type = $this->item->get_meta( 'asp_product_tax_variations_type' ); + + $tax_variations_type = empty( $tax_variations_type ) ? 'b' : $tax_variations_type; + + if ( 'b' === $tax_variations_type ) { + $bs_details = $p_data->get_billing_details(); + } else { + $bs_details = $p_data->get_shipping_details(); + } + + if ( ! empty( $bs_details ) && ! empty( $tax_variations_arr ) ) { + $new_tax = ASP_Utils::get_tax_variations_tax( + $tax_variations_arr, + empty( $bs_details->country ) ? '' : $bs_details->country, + empty( $bs_details->state ) ? '' : $bs_details->state, + empty( $bs_details->city ) ? '' : $bs_details->city + ); + if ( false !== $new_tax ) { + $item->set_tax( $new_tax ); + } + } + + // Check and calculate regional shipping amount if available. + $calculate_shipping_amount = apply_filters('asp_calculate_shipping_amount_on_ipn_process', true, $prod_id); // Useful for subscription addon. + if ($calculate_shipping_amount){ + $base_shipping_amount = $item->get_shipping(true); + $total_shipping_amount = $base_shipping_amount; + + $collect_shipping_addr_enabled = $item->get_meta('asp_product_collect_shipping_addr'); + + if ($collect_shipping_addr_enabled == '1' ){ + // ASP_Debug_Logger::log('Calculation regional shipping amount.', true); + $shipping_region = get_object_vars($p_data->get_shipping_details()); + $regional_shipping_amount = $item->calculate_regional_shipping_amount($shipping_region, true); + $total_shipping_amount += $regional_shipping_amount; + } + + $item->set_shipping( $total_shipping_amount, true ); + } + + if ( empty( $price ) ) { + $post_price = $this->get_post_var( 'asp_amount', FILTER_SANITIZE_NUMBER_FLOAT ); + if ( $post_price ) { + $price = $post_price; + } else { + if ( ! $item->get_meta( 'asp_product_hide_amount_input' ) ) { + $price = $p_data->get_price(); + } else { + $price = 0; + } + } + $price = AcceptStripePayments::from_cents( $price, $item->get_currency() ); + $item->set_price( $price ); + } + + $item_price = $item->get_price(); + + //Variatoions + $variations = array(); + $posted_variations = $this->get_post_var( 'asp_stripeVariations', FILTER_DEFAULT, FILTER_REQUIRE_ARRAY ); + if ( $posted_variations ) { + // we got variations posted. Let's get variations from product + $v = new ASPVariations( $prod_id ); + if ( ! empty( $v->variations ) ) { + //there are variations configured for the product + ASP_Debug_Logger::log( 'Processing variations.' ); + foreach ( $posted_variations as $grp_id => $var_id ) { + if ( is_array( $var_id ) && ! empty( $var_id ) ) { + foreach ( $var_id as $p_var ) { + $var = $v->get_variation( $grp_id, $p_var ); + if ( ! empty( $var ) ) { + $item->add_item( $var['name'], $var['price'] ); + $variations[] = array( $var['group_name'] . ' - ' . $var['name'], $var['price'] ); + $var_applied[] = $var; + } + } + } + } + } + } + + //Coupon + $coupon_code = $this->get_post_var( 'asp_coupon-code' ); + $coupon_valid = false; + if ( isset($coupon_code) && !empty($coupon_code)) { + $coupon_code = sanitize_text_field( stripslashes( $coupon_code )); + ASP_Debug_Logger::log( sprintf( 'Coupon code provided: %s', $coupon_code ) ); + $coupon_valid = $item->check_coupon( $coupon_code ); + + if ( $coupon_valid ) { + ASP_Debug_Logger::log( 'Coupon is valid for the product.' ); + } else { + ASP_Debug_Logger::log( 'Coupon is invalid for the product.' ); + } + } + + $amount_in_cents = intval( $item->get_total( true ) ); + $amount_paid = intval( $p_data->get_amount() ); + + $configured_currency = $item->get_currency();//Currency configured in product/general settings + $is_currency_variable = $item->is_currency_variable(); + $p_curr = $p_data->get_currency();//Currency from payment data + + //Check currency + $paid_currency_valid = $this->paid_currency_valid( $p_curr, $configured_currency, $item ); + //Trigger filter that can be used to check this from the subscription addon (if needed). + $paid_currency_valid = apply_filters( 'asp_process_ipn_paid_currency_valid', $paid_currency_valid, $item ); + if ( !$paid_currency_valid ) { + //Check if the currency variable option is enabled. + $is_currency_variable = apply_filters( 'asp_process_ipn_is_currency_variable', $is_currency_variable, $item ); + if ( $is_currency_variable ){ + //The currency variable option is enabled. We will allow this request to go through. + //ASP_Debug_Logger::log( 'Note! The currency variable option is enabled in the product settings', true ); + } else { + $err = sprintf( + // translators: placeholders are expected and received currencies + __( 'Invalid currency received. Expected %1$s, got %2$s.', 'stripe-payments' ), + $configured_currency, + $p_curr + ); + //The following function will also log the error to the debug log. + $this->ipn_completed( $err ); + } + } + + //Check paid amount + $paid_amount_valid = $this->paid_amount_valid( $amount_in_cents, $amount_paid, $item ); + if ( ! $paid_amount_valid ) { + $err = sprintf( + // translators: placeholders are expected and received amounts + __( 'Invalid payment amount received. Expected %1$s, got %2$s.', 'stripe-payments' ), + AcceptStripePayments::formatted_price( $amount_in_cents, $p_curr, true ), + AcceptStripePayments::formatted_price( $amount_paid, $p_curr, true ) + ); + //The following function will also log the error to the debug log. + $this->ipn_completed( $err ); + } + + $opt = get_option( 'AcceptStripePayments-settings' ); + + ASP_Debug_Logger::log( 'Constructing checkout result and order data.' ); + + $p_curr = $p_data->get_currency(); + $p_amount = $p_data->get_amount(); + $p_charge_data = $p_data->get_charge_data(); + $p_charge_created = $p_data->get_charge_created(); + $p_trans_id = $p_data->get_trans_id(); + $p_billing_details = $p_data->get_billing_details(); + $p_customer_details = $p_data->get_customer_details(); + + if ( empty( $p_billing_details->email ) ) { + $email = $this->get_post_var( 'asp_email', FILTER_SANITIZE_EMAIL ); + if ( ! empty( $email ) ) { + $p_billing_details->email = $email; + } + } + + if ( empty( $p_billing_details->name ) ) { + $name = $this->get_post_var( 'asp_billing_name' ); + $name = sanitize_text_field( stripslashes( $name )); + if ( ! empty( $name ) ) { + $p_billing_details->name = $name; + } + } + + $data = array(); + $data['product_id'] = $prod_id ? $prod_id : null; + $data['paid_amount'] = AcceptStripePayments::is_zero_cents( $p_curr ) ? $p_amount : AcceptStripePayments::from_cents( $p_amount, $p_curr ); + $data['currency_code'] = strtoupper( $p_curr ); + $data['item_quantity'] = $item->get_quantity(); + $data['charge'] = $p_charge_data; + // $data['stripeToken'] = ''; + $data['stripeTokenType'] = 'card'; + $data['is_live'] = $is_live; + $data['charge_description'] = $item->get_description(); + $data['item_name'] = $item->get_name(); + $data['item_price'] = $item->get_price( AcceptStripePayments::is_zero_cents( $data['currency_code'] ) ); + $data['stripeEmail'] = $p_billing_details->email; + $data['customer_name'] = $p_billing_details->name; + $purchase_date = gmdate( 'Y-m-d H:i:s', $p_charge_created ); + $purchase_date = get_date_from_gmt( $purchase_date, get_option( 'date_format' ) . ', ' . get_option( 'time_format' ) ); + $data['purchase_date'] = $purchase_date; + $data['charge_date'] = $purchase_date; + $data['charge_date_raw'] = $p_charge_created; + $data['txn_id'] = $p_trans_id; + $data['button_key'] = $button_key; + + //Type casting to an array to prevent any potential PHP warnings. + $customer_metadata = isset($p_customer_details->metadata) ? (array)$p_customer_details->metadata : array(); + if ( !empty($customer_metadata) ){ + $data['customer_first_name'] = isset($customer_metadata['First Name']) ? sanitize_text_field($customer_metadata['First Name']) : ''; + $data['customer_last_name'] = isset($customer_metadata['Last Name']) ? sanitize_text_field($customer_metadata['Last Name']) : ''; + } + + $item_url = $item->get_download_url(); + + $data['item_url'] = $item_url; + + $data['billing_address'] = $p_data->get_billing_addr_str(); + + $data['shipping_address'] = $p_data->get_shipping_addr_str(); + + //Check if there is a logged in user who is making the purchase. + $logged_in_user_info = ASP_Utils::get_logged_in_user_info(); + if ( is_array($logged_in_user_info) && !empty($logged_in_user_info) ) { + $data['logged_in_user_type'] = isset($logged_in_user_info['type']) ? $logged_in_user_info['type'] : ''; + $data['logged_in_user_id'] = isset($logged_in_user_info['id']) ? $logged_in_user_info['id'] : ''; + $data['logged_in_user_name'] = isset($logged_in_user_info['username']) ? $logged_in_user_info['username'] : ''; + ASP_Debug_Logger::log( 'Logged-in user\'s Username: ' . $data['logged_in_user_name'] ); + } + + $data['additional_items'] = array(); + + ASP_Debug_Logger::log( 'Firing asp_ng_payment_completed filter.' ); + + $data = apply_filters( 'asp_ng_payment_completed', $data, $prod_id ); + + $currency_code = $item->get_currency(); + $item_price = $item->get_price( AcceptStripePayments::is_zero_cents( $currency_code ) ); + + $custom_fields = array(); + $cf_name = $this->get_post_var( 'asp_stripeCustomFieldName' ); + if ( $cf_name ) { + $cf_name = sanitize_text_field( stripslashes( $cf_name )); + + $cf_value = $this->get_post_var( 'asp_stripeCustomField' ); + $cf_value = sanitize_text_field( stripslashes( $cf_value )); + $custom_fields[] = array( + 'name' => $cf_name, + 'value' => $cf_value, + ); + } + + //Compatability with the ACF addon + //Note: This $acf_fields input is now handled directly in the new version of the ACF addon. So it is commented out here. + //$acf_fields = $this->get_post_var( 'asp_stripeCustomFields', FILTER_DEFAULT, FILTER_REQUIRE_ARRAY ); + + $custom_fields = apply_filters( 'asp_process_custom_fields', $custom_fields, array( 'product_id' => $prod_id ) ); + + if ( ! empty( $custom_fields ) ) { + $data['custom_fields'] = $custom_fields; + } + + if ( ! empty( $var_applied ) ) { + //process variations URLs if needed + foreach ( $var_applied as $key => $var ) { + if ( ! empty( $var['url'] ) ) { + $var = apply_filters( 'asp_variation_url_process', $var, $data ); + $var_applied[ $key ] = $var; + } + } + $data['var_applied'] = $var_applied; + foreach ( $variations as $variation ) { + $data['additional_items'][ $variation[0] ] = $variation[1]; + } + } + + //check if coupon was used + if ( $coupon_valid ) { + $coupon = $item->get_coupon(); + } + if ( isset( $coupon ) ) { + // Get subtotal amount + $subtotal = $item->get_price( false, false ) + $item->get_items_total( false, false ); + $subtotal = $subtotal < 0 ? 0 : $subtotal; + + // Get total coupon discount amount + $coupon_discount_amount = $item->get_coupon_discount_amount(); + + if(!empty($item->get_quantity()) && is_numeric($item->get_quantity())){ + $subtotal = $subtotal * $item->get_quantity(); + + if (isset($coupon['discount_type']) && $coupon['discount_type'] === 'perc' ){ // NOTE: Flat discount doesn't need to multiply with quantity + $coupon_discount_amount = $coupon_discount_amount * $item->get_quantity(); + } + } + + // Append subtotal info + $data['additional_items'][ __( 'Subtotal', 'stripe-payments' ) ] = $subtotal; + + // Append coupon info + $data['coupon'] = $coupon; + $data['coupon_code'] = $coupon['code']; + $coupon_discount_str = apply_filters( 'asp_ng_coupon_discount_str', floatval( '-' . $coupon_discount_amount ), $coupon ); + // translators: %s is coupon code + $data['additional_items'][ sprintf( __( 'Coupon "%s"', 'stripe-payments' ), $coupon['code'] ) ] = $coupon_discount_str; + + //increase coupon redeem count + $curr_redeem_cnt = get_post_meta( $coupon['id'], 'asp_coupon_red_count', true ); + $curr_redeem_cnt++; + update_post_meta( $coupon['id'], 'asp_coupon_red_count', $curr_redeem_cnt ); + } + $tax = $item->get_tax(); + if ( ! empty( $tax ) ) { + $tax_str = apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ); + $tax_amt = $item->get_tax_amount( false, true ); + $data['additional_items'][ ucfirst( $tax_str ) ] = $tax_amt; + $data['tax_perc'] = $item->get_tax(); + $data['tax'] = $tax_amt; + } + $ship = $item->get_shipping(); + if ( ! empty( $ship ) ) { + $ship_str = apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ); + $data['additional_items'][ ucfirst( $ship_str ) ] = $item->get_shipping(); + $data['shipping'] = $item->get_shipping(); + } + + $product_type = $item->get_type(); + //Check if surcharge is enabled for this product (if one-time or donations type product). + if ( in_array($product_type, array('one_time', 'donation')) ){ + //Surcharge feature is currently supported for one_time and donation products only. + $surcharge_amount = $p_data->get_surcharge_data('amount'); + if ( !empty($surcharge_amount) ){ + $surcharge_label = $p_data->get_surcharge_data('label'); + $data['additional_items'][$surcharge_label] = $surcharge_amount; + } + } + + //custom fields + $custom_fields = $this->sess->get_transient_data( 'custom_fields' ); + if ( ! empty( $custom_fields ) ) { + $data['custom_fields'] = $custom_fields; + $this->sess->set_transient_data( 'custom_fields', array() ); + } + + $metadata = array(); + + //Check if we need to include custom field in metadata + if ( ! empty( $data['custom_fields'] ) ) { + $cf_str = ''; + foreach ( $data['custom_fields'] as $cf ) { + $cf_str .= $cf['name'] . ': ' . $cf['value'] . ' | '; + } + $cf_str = rtrim( $cf_str, ' | ' ); + //trim the string as metadata value cannot exceed 500 chars + $cf_str = substr( $cf_str, 0, 499 ); + //add custom fields string to metadata + ASP_Debug_Logger::log( 'Adding custom fields string to metadata - ' . $cf_str ); + $metadata['Custom Fields'] = $cf_str; + } + + //Check if we need to include variations data into metadata + if ( ! empty( $variations ) ) { + $var_str = ''; + foreach ( $variations as $variation ) { + $var_str .= '[' . $variation[0] . '], '; + } + $var_str = rtrim( $var_str, ', ' ); + //trim the string as metadata value cannot exceed 500 chars + $var_str = substr( $var_str, 0, 499 ); + $metadata['Variations'] = $var_str; + } + + if ( ! empty( $data['shipping_address'] ) ) { + //add shipping address to metadata + $shipping_address = str_replace( "\n", ', ', $data['shipping_address'] ); + $shipping_address = rtrim( $shipping_address, ', ' ); + $metadata['Shipping Address'] = $shipping_address; + } + + //Save coupon info to metadata if applicable + if ( $coupon_valid ) { + $metadata['Coupon Code'] = strtoupper( $coupon['code'] ); + } + + $update_opts = array(); + + if ( ! empty( $metadata ) ) { + ASP_Debug_Logger::log( 'Firing asp_ng_handle_metadata filter.' ); + $metadata_handled = apply_filters( 'asp_ng_handle_metadata', $metadata ); + if ( true !== $metadata_handled ) { + ASP_Debug_Logger::log( 'Updating payment metadata.' ); + $update_opts['metadata'] = $metadata; + } + } + + ASP_Debug_Logger::log( 'Firing asp_ng_payment_completed_update_pi filter.' ); + $update_opts = apply_filters( 'asp_ng_payment_completed_update_pi', $update_opts, $data ); + + if ( ! empty( $update_opts && ! $p_data->is_zero_value ) ) { + ASP_Debug_Logger::log( 'Updating payment intent data.' ); + if ( ASP_Utils::use_internal_api() ) { + $intent = $api->post( 'payment_intents/' . $pi, $update_opts ); + } else { + $intent = \Stripe\PaymentIntent::update( $pi, $update_opts ); + } + } + + $product_details = __( 'Product Name: ', 'stripe-payments' ) . $data['item_name'] . "\n"; + $product_details .= __( 'Quantity: ', 'stripe-payments' ) . $data['item_quantity'] . "\n"; + $product_details .= __( 'Item Price: ', 'stripe-payments' ) . AcceptStripePayments::formatted_price( $data['item_price'], $data['currency_code'] ) . "\n"; + + //check if there are any additional items available like tax and shipping cost + $product_details .= AcceptStripePayments::gen_additional_items( $data ); + $product_details .= '--------------------------------' . "\n"; + $product_details .= __( 'Total Amount: ', 'stripe-payments' ) . AcceptStripePayments::formatted_price( $data['paid_amount'], $data['currency_code'] ) . "\n"; + $data['product_details'] = nl2br( $product_details ); + + //Insert the order data to the custom post + $order = new ASP_Order_Item(); + if ( $order->can_create() ) { + $order_post_id = $order->find( 'pi_id', $pi ); + + if ( false === $order_post_id ) { + //no order was created. Let's create one + $order->create( $prod_id, $pi ); + } + + $order_post_id = $order->update_legacy( $data, $data['charge'] ); + + $intent = $p_data->get_obj(); + if ( isset( $intent ) && isset( $intent->status ) && 'requires_capture' === $intent->status ) { + $order->change_status( 'authorized' ); + } else { + $order->change_status( 'paid' ); + } + + $data['order_post_id'] = $order_post_id; + update_post_meta( $order_post_id, 'order_data', $data ); + update_post_meta( $order_post_id, 'charge_data', $data['charge'] ); + update_post_meta( $order_post_id, 'trans_id', $p_trans_id ); + } + + //stock control + if ( get_post_meta( $data['product_id'], 'asp_product_enable_stock', true ) ) { + $stock_items = intval( get_post_meta( $data['product_id'], 'asp_product_stock_items', true ) ); + $stock_items = $stock_items - $data['item_quantity']; + if ( $stock_items < 0 ) { + $stock_items = 0; + } + update_post_meta( $data['product_id'], 'asp_product_stock_items', $stock_items ); + $data['stock_items'] = $stock_items; + } + + //Action hook with the checkout post data parameters. + ASP_Debug_Logger::log( 'Firing asp_stripe_payment_completed action.' ); + do_action( 'asp_stripe_payment_completed', $data, $data['charge'] ); + + //Let's handle email sending stuff + $send_emails_to_buyer = apply_filters( 'asp_allow_send_emails_to_buyer', $opt['send_emails_to_buyer'], $prod_id); + if ( ! empty( $send_emails_to_buyer ) ) { + $from = $opt['from_email_address']; + $to = $data['stripeEmail']; + $subj = $opt['buyer_email_subject']; + $body = $opt['buyer_email_body']; + + // * since 2.0.47 + $email_data = array( + 'from' => $from, + 'to' => $to, + 'subj' => $subj, + 'body' => $body, + ); + $email_data = apply_filters( 'asp_buyer_email_data', $email_data, $data ); + + $from = $email_data['from']; + $to = $email_data['to']; + $subj = $email_data['subj']; + $body = $email_data['body']; + // * end since + + $body = asp_apply_dynamic_tags_on_email_body( $body, $data ); + + $subj = apply_filters( 'asp_buyer_email_subject', $subj, $data ); + $body = apply_filters( 'asp_buyer_email_body', $body, $data ); + $from = apply_filters( 'asp_buyer_email_from', $from, $data ); + + $headers = array(); + if ( ! empty( $opt['buyer_email_type'] ) && 'html' === $opt['buyer_email_type'] ) { + $headers[] = 'Content-Type: text/html; charset=UTF-8'; + $body = nl2br( $body ); + } + $headers[] = 'From: ' . $from; + //Trigger filter to allow modification of the buyer email headers. + $headers = apply_filters( 'asp_buyer_email_headers', $headers, $email_data, $data ); + + $schedule_result = ASP_Utils::mail( $to, $subj, $body, $headers ); + + if ( ! $schedule_result ) { + ASP_Debug_Logger::log( 'Notification email sent to buyer: ' . $to . ', from email address used: ' . $from ); + } else { + ASP_Debug_Logger::log( 'Notification email to buyer scheduled: ' . $to . ', from email address used: ' . $from ); + } + } + + $send_emails_to_seller = apply_filters( 'asp_allow_send_emails_to_seller', $opt['send_emails_to_seller'], $prod_id); + if ( ! empty( $send_emails_to_seller ) ) { + $from = $opt['from_email_address']; + $to = $opt['seller_notification_email']; + $subj = $opt['seller_email_subject']; + $body = $opt['seller_email_body']; + + // * since 2.0.47 + $email_data = array( + 'from' => $from, + 'to' => $to, + 'subj' => $subj, + 'body' => $body, + ); + $email_data = apply_filters( 'asp_seller_email_data', $email_data, $data ); + + $from = $email_data['from']; + $to = $email_data['to']; + $subj = $email_data['subj']; + $body = $email_data['body']; + // * end since + + $body = asp_apply_dynamic_tags_on_email_body( $body, $data, true ); + + $subj = apply_filters( 'asp_seller_email_subject', $subj, $data ); + $body = apply_filters( 'asp_seller_email_body', $body, $data ); + $from = apply_filters( 'asp_seller_email_from', $from, $data ); + + $headers = array(); + if ( ! empty( $opt['seller_email_type'] ) && 'html' === $opt['seller_email_type'] ) { + $headers[] = 'Content-Type: text/html; charset=UTF-8'; + $body = nl2br( $body ); + } + $headers[] = 'From: ' . $from; + $headers[] = 'Reply-To: ' . $data['stripeEmail'];//For admin notification emails, we set the reply-to header to the buyer's email address. + //Trigger filter to allow modification of the seller email headers. + $headers = apply_filters( 'asp_seller_email_headers', $headers, $email_data, $data ); + + //Send the email to the seller + $schedule_result = ASP_Utils::mail( $to, $subj, $body, $headers ); + if ( ! $schedule_result ) { + ASP_Debug_Logger::log( 'Notification email sent to seller: ' . $to . ', from email address used: ' . $from ); + } else { + ASP_Debug_Logger::log( 'Notification email to seller scheduled: ' . $to . ', from email address used: ' . $from ); + } + } + + $this->sess->set_transient_data( 'asp_data', $data ); + + $this->sess->set_transient_data( 'asp_pp_form_data', array() ); + + //Clear the txn lock + update_option( 'asp_ng_ipn_txn_being_processed', '' ); + + $this->ipn_completed(); + } + + public function payment_data_override( $p_data, $pi ) { + //check if this is zero-value transaction + if ( 'free' === substr( $pi, 0, 4 ) ) { + //this is zero-value transaction + $coupon_code = $this->get_post_var( 'asp_coupon-code' ); + $coupon_code = sanitize_text_field( stripslashes( $coupon_code )); + if ( empty( $coupon_code ) ) { + return $p_data; + } + $coupon_valid = $this->item->check_coupon( $coupon_code ); + + if ( ! $coupon_valid ) { + return $p_data; + } + + $coupon_discount_amount = $this->item->get_coupon_discount_amount(); + + $price_no_discount = $this->item->get_price(); + + if ( $coupon_discount_amount < $price_no_discount ) { + return $p_data; + } + + $prod_id = $this->item->get_product_id(); + + $order = new ASP_Order_Item(); + + if ( $order->can_create( $prod_id ) ) { + $order->create( $prod_id, $pi ); + } + + $p_data = new ASP_Payment_Data( $pi, true ); + } + return $p_data; + } +} + +new ASP_Process_IPN_NG(); diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-product-item.php b/wp-content/plugins/stripe-payments/includes/class-asp-product-item.php new file mode 100644 index 0000000..4102bfa --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-product-item.php @@ -0,0 +1,816 @@ +asp_main = AcceptStripePayments::get_instance(); + if ( false !== $post_id ) { + //let's try to load item from product + $this->post_id = $post_id; + $this->load_from_product(); + + $btn_uniq_id = isset( $_GET['btn_uniq_id'] ) ? sanitize_text_field( stripslashes ( $_GET['btn_uniq_id'] ) ) : ''; + if ( ! empty( $btn_uniq_id ) ) { + ASP_Debug_Logger::log( 'Using the btn_uniq_id parameter. Value of btn_uniq_id: ' . $btn_uniq_id, true ); + $this->sess = ASP_Session::get_instance(); + $this->overriden_data = $this->sess->get_transient_data( 'overriden_data_' . $btn_uniq_id ); + } + } + } + + private function in_cents( $amount ) { + if ( ! $this->zero_cent ) { + $amount = round( $amount * 100, 2 ); + } else { + $amount = round( $amount, 0 ); + } + return $amount; + } + + private function from_cents( $amount ) { + if ( ! $this->zero_cent ) { + $amount = round( $amount / 100, 2 ); + } else { + $amount = round( $amount, 0 ); + } + return $amount; + } + + public function get_last_error() { + return $this->last_error; + } + + public function get_product_id() { + return $this->post_id; + } + + public function get_button_text() { + $button_text = get_post_meta( $this->post_id, 'asp_product_button_text', true ); + if ( empty( $button_text ) ) { + $button_text = $this->asp_main->get_setting( 'button_text' ); + } + return $button_text; + } + + public function get_button_class() { + $button_class = get_post_meta( $this->post_id, 'asp_product_button_class', true ); + return $button_class; + } + + public function get_stock_items() { + $stock_items = get_post_meta( $this->post_id, 'asp_product_stock_items', true ); + return $stock_items; + } + + public function stock_control_enabled() { + $stock_control_enabled = get_post_meta( $this->post_id, 'asp_product_enable_stock', true ); + return $stock_control_enabled; + } + + public function get_tax() { + if ( false !== $this->overriden_data && isset( $this->overriden_data['tax'] ) ) { + return $this->overriden_data['tax']; + } + if ( ! empty( $this->tax ) ) { + return $this->tax; + } + $this->tax = get_post_meta( $this->post_id, 'asp_product_tax', true ); + if ( empty( $this->tax ) ) { + $this->tax = 0; + } + return $this->tax; + } + + public function set_tax( $tax ) { + $this->tax = $tax; + } + + public function get_shipping( $in_cents = false ) { + if ( ! isset( $this->shipping ) ) { + $this->shipping = get_post_meta( $this->post_id, 'asp_product_shipping', true ); + } + if ( empty( $this->shipping ) ) { + $this->shipping = 0; + } + if ( $in_cents ) { + return $this->in_cents( $this->shipping ); + } + return $this->shipping; + } + + public function set_shipping( $shipping, $in_cents = false ) { + $this->shipping = $in_cents ? $this->from_cents( $shipping ) : $shipping; + } + + public function get_items_total( $in_cents = false, $with_discount = false ) { + $items_total = 0; + if ( ! empty( $this->items ) ) { + foreach ( $this->items as $item ) { + $items_total += $item['price']; + } + } else { + return 0; + } + + if ( $with_discount && $this->coupon && 'perc' === $this->coupon['discount_type'] ) { + $items_total = $this->apply_discount_to_amount( $items_total, false ); + } + + return $in_cents ? $this->in_cents( $items_total ) : $items_total; + } + + public function get_items() { + return $this->items; + } + + public function add_item( $name, $price ) { + $this->items[] = array( + 'name' => $name, + 'price' => floatval( $price ), + ); + } + + public function get_thumb() { + $this->thumb = get_post_meta( $this->post_id, 'asp_product_thumbnail', true ); + return $this->thumb; + } + + public function get_name() { + $this->name = $this->post->post_title; + return $this->name; + } + + public function get_description() { + $this->description = get_post_meta( $this->post_id, 'asp_product_description', true ); + return $this->description; + } + + public function get_quantity() { + $this->quantity = get_post_meta( $this->post_id, 'asp_product_quantity', true ); + if ( ! is_numeric( $this->quantity ) ) { + $this->quantity = absint( $this->quantity ); + } + if ( empty( $this->quantity ) ) { + $this->quantity = 1; + } + if ( $this->cust_quantity ) { + $this->quantity = $this->cust_quantity; + } + return $this->quantity; + } + + public function get_coupon_discount_amount() { + $price = $this->get_price(); + $items_total = $this->get_items_total(); + $discount_amount = $this->get_discount_amount( $price + $items_total ); + return $discount_amount; + } + + public function get_price( $in_cents = false, $price_with_discount = false ) { + if ( is_null( $this->price ) ) { + $this->price = get_post_meta( $this->post_id, 'asp_product_price', true ); + $this->price = empty( $this->price ) ? 0 : round( $this->price * 100 ) / 100; + } + if ( $price_with_discount && $this->coupon ) { + $discount_amount = $this->get_discount_amount( $this->price, $in_cents ); + $this->price_with_discount = $this->price - $discount_amount; + } + if ( $in_cents ) { + if ( $price_with_discount && $this->coupon ) { + return $this->in_cents( $this->price_with_discount ); + } + return $this->in_cents( $this->price ); + } + if ( $price_with_discount && $this->coupon ) { + return $this->price_with_discount; + } + return $this->price; + } + + public function get_surcharge() + { + $surcharge_amount = get_post_meta( $this->post_id, 'asp_surcharge_amount', true ); + + return !empty($surcharge_amount) && is_numeric($surcharge_amount) ? $surcharge_amount : 0; + } + + public function get_surcharge_label() + { + $surcharge_label = get_post_meta( $this->post_id, 'asp_surcharge_label', true ); + + return !empty($surcharge_label) ? $surcharge_label : __("Surcharge", 'stripe-payments'); + } + + public function get_surcharge_type() + { + $surcharge_type = get_post_meta( $this->post_id, 'asp_surcharge_type', true ); + + return empty($surcharge_type) ? 'flat' : $surcharge_type; + } + + /** + * Calculate the total surcharge amount based on the surcharge type and amount. + * + * @param bool $in_cents Whether to return the result in cents. + * + * @return float|int + */ + public function calculate_total_surcharge(bool $in_cents = false) + { + $surcharge_amount = $this->get_surcharge(); + $surcharge_type = $this->get_surcharge_type(); + + if ( $surcharge_type == 'perc' ){ + $calculate_from_amount = $this->get_total(); + $surcharge_percentage = floatval($surcharge_amount); + $amount = ( $calculate_from_amount / 100 ) * $surcharge_percentage; + } else { + $amount = floatval($surcharge_amount); + } + + return $in_cents ? $this->in_cents( $amount ) : $amount; + } + + /** + * Returns min amount for donation product + * + * @param bool $in_cents Return amount in cents if set to `true` + * + * @return integer|float + */ + public function get_min_amount( $in_cents = false ) { + $min_amount = get_post_meta( $this->post_id, 'asp_product_min_amount', true ); + $min_amount = empty( $min_amount ) ? 0 : $min_amount; + return $in_cents ? $this->in_cents( $min_amount ) : $min_amount; + } + + /** + * Returns product type + * + * @return string + */ + public function get_type() { + $type = get_post_meta( $this->post_id, 'asp_product_type', true ); + return $type; + } + + public function apply_discount_to_amount( $amount, $in_cents = false ) { + if ( $this->coupon ) { + if ( 'perc' === $this->coupon['discount_type'] ) { + $perc = AcceptStripePayments::is_zero_cents( $this->get_currency() ) ? 0 : 2; + $discount_amount = round( $amount * ( $this->coupon['discount'] / 100 ), $perc ); + } else { + $discount_amount = $this->coupon['discount']; + if ( $in_cents && ! AcceptStripePayments::is_zero_cents( $this->get_currency() ) ) { + $discount_amount = $discount_amount * 100; + } + } + if ( $in_cents ) { + $discount_amount = round( $discount_amount, 0 ); + } + $amount = $amount - $discount_amount; + } + return $amount; + } + + public function get_discount_amount( $total, $in_cents = false ) { + $discount_amount = 0; + if ( $this->coupon ) { + if ( 'perc' === $this->coupon['discount_type'] ) { + $perc = AcceptStripePayments::is_zero_cents( $this->get_currency() ) ? 0 : 2; + $discount_amount = round( $total * ( $this->coupon['discount'] / 100 ), $perc ); + } else { + $discount_amount = $this->coupon['discount']; + if ( ! $this->coupon['per_order'] ) { + $discount_amount = $discount_amount * $this->get_quantity(); + } + if ( $in_cents && ! AcceptStripePayments::is_zero_cents( $this->get_currency() ) ) { + $discount_amount = $discount_amount * 100; + } + } + if ( $in_cents ) { + $discount_amount = round( $discount_amount, 0 ); + } + $this->coupon['discountAmount'] = $discount_amount; + } + return $discount_amount; + } + + /* + * Returns the total amount for the product (including tax, shipping, item quantity, and discount if any) + * + * @param bool $in_cents Return amount in cents if set to `true` + */ + public function get_total( $in_cents = false ) { + $total = $this->get_price( $in_cents ); + + $items_total = $this->get_items_total( $in_cents ); + + $total += $items_total; + + $total = $total * $this->get_quantity(); + + $total = $total - $this->get_discount_amount( $total, $in_cents ); + + if ( $this->get_tax() ) { + $total = $total + $this->get_tax_amount( $in_cents, true ); + } + + $shipping = $this->get_shipping( $in_cents ); + + if ( ! empty( $shipping ) ) { + $total = $total + $this->get_shipping( $in_cents ); + } + + if ( $total < 0 ) { + $total = 0; + } + + return $total; + } + + public function set_price( $price, $in_cents = false ) { + //workaround for zero-cents currencies for Sub addon 2.0.10 or less + $this->zero_cent = AcceptStripePayments::is_zero_cents( $this->get_currency() ); + if ( $this->zero_cent && class_exists( 'ASPSUB_main' ) && isset( $this->plan ) && version_compare( ASPSUB_main::ADDON_VER, '2.0.10' ) <= 0 ) { + $price = $price * 100; + } + //end workaround + if ( $in_cents ) { + $price = $this->from_cents( $price ); + } + $this->price = $price; + + } + + public function set_quantity( $quantity ) { + $this->cust_quantity = $quantity; + } + + public function get_tax_amount( $in_cents = false, $price_with_discount = false ) { + $total = $this->get_price( false ); + + $items_total = $this->get_items_total( false ); + + $total += $items_total; + + $total = $total * $this->get_quantity(); + + $total = $total - $this->get_discount_amount( $total, false ); + + $this->tax_amount = AcceptStripePayments::get_tax_amount( $total, $this->get_tax(), $this->zero_cent ); + if ( $in_cents ) { + return $this->in_cents( $this->tax_amount ); + } + return $this->tax_amount; + } + + public function get_currency() { + if ( empty( $this->currency ) ) { + $this->currency = get_post_meta( $this->post_id, 'asp_product_currency', true ); + $this->currency = empty( $this->currency ) ? $this->asp_main->get_setting( 'currency_code' ) : $this->currency; + } + $this->zero_cent = AcceptStripePayments::is_zero_cents( $this->currency ); + return $this->currency; + } + + public function set_currency( $curr ) { + $this->currency = $curr; + $this->zero_cent = AcceptStripePayments::is_zero_cents( $curr ); + } + + public function is_variable() { + return $this->get_price() === 0; + } + + public function is_currency_variable() { + if ( $this->get_type() !== 'donation' ) { + return false; + } + $currency_variable = get_post_meta( $this->post_id, 'asp_product_currency_variable', true ); + return $currency_variable; + } + + public function get_redir_url() { + $url = get_post_meta( $this->post_id, 'asp_product_thankyou_page', true ); + if ( empty( $url ) ) { + $url = $this->asp_main->get_setting( 'checkout_url' ); + } + return $url; + } + + public function collect_billing_addr() { + return get_post_meta( $this->post_id, 'asp_product_collect_billing_addr', true ); + } + + public function gen_item_data() { + $ret = array(); + $item_info = array( + 'name' => $this->get_name(), + 'amount' => $this->get_price( true ), + 'currency' => $this->get_currency(), + 'quantity' => $this->get_quantity(), + ); + $thumb = $this->get_thumb(); + if ( ! empty( $thumb ) ) { + $item_info['images'] = array( $this->get_thumb() ); + } + $descr = $this->get_description(); + if ( ! empty( $descr ) ) { + $item_info['description'] = $this->get_description(); + } + $ret[] = $item_info; + $tax = $this->get_tax(); + if ( ! empty( $tax ) ) { + $tax_str = apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ); + $tax_info = array( + 'name' => sprintf( '%s (%s%%)', $tax_str, $this->get_tax() ), + 'amount' => $this->get_tax_amount( true ), + 'currency' => $this->get_currency(), + 'quantity' => $this->get_quantity(), + ); + $ret[] = $tax_info; + } + $ship = $this->get_shipping(); + if ( ! empty( $ship ) ) { + $ship_str = apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ); + $tax_info = array( + 'name' => sprintf( '%s', $ship_str ), + 'amount' => $this->get_shipping( true ), + 'currency' => $this->get_currency(), + 'quantity' => $this->get_quantity(), + ); + $ret[] = $tax_info; + } + return $ret; + } + + public function get_coupon() { + return $this->coupon; + } + + private function load_coupon( $coupon_code ) { + //let's find coupon + $coupon = get_posts( + array( + 'meta_key' => 'asp_coupon_code', + 'meta_value' => $coupon_code, + 'posts_per_page' => 1, + 'offset' => 0, + 'post_type' => 'asp_coupons', + ) + ); + wp_reset_postdata(); + if ( empty( $coupon ) ) { + //coupon not found + $this->last_error = __( 'Coupon not found.', 'stripe-payments' ); + return false; + } + $coupon = $coupon[0]; + //check if coupon is active + if ( ! get_post_meta( $coupon->ID, 'asp_coupon_active', true ) ) { + $this->last_error = __( 'Coupon is not active.', 'stripe-payments' ); + return false; + } + //check if coupon start date has come + $start_date = get_post_meta( $coupon->ID, 'asp_coupon_start_date', true ); + if ( empty( $start_date ) || strtotime( $start_date ) > time() ) { + $this->last_error = __( 'Coupon is not available yet.', 'stripe-payments' ); + return false; + } + //check if coupon has expired + $exp_date = get_post_meta( $coupon->ID, 'asp_coupon_exp_date', true ); + if ( ! empty( $exp_date ) && strtotime( $exp_date ) < time() ) { + $this->last_error = __( 'Coupon has expired.', 'stripe-payments' ); + return false; + } + //check if redemption limit is reached + $red_limit = get_post_meta( $coupon->ID, 'asp_coupon_red_limit', true ); + $red_count = get_post_meta( $coupon->ID, 'asp_coupon_red_count', true ); + if ( ! empty( $red_limit ) && intval( $red_count ) >= intval( $red_limit ) ) { + $this->last_error = __( 'Coupon redemption limit is reached.', 'stripe-payments' ); + return false; + } + + $per_order = get_post_meta( $coupon->ID, 'asp_coupon_per_order', true ); + + $this->coupon = array( + 'code' => $coupon_code, + 'id' => $coupon->ID, + 'discount' => get_post_meta( $coupon->ID, 'asp_coupon_discount', true ), + 'discount_type' => get_post_meta( $coupon->ID, 'asp_coupon_discount_type', true ), + 'per_order' => empty( $per_order ) ? 0 : 1, + ); + return true; + } + + public function check_coupon( $coupon_code = false ) { + if ( ! $coupon_code ) { + $this->last_error = 'No coupon code provided'; + return false; + } + $coupon_code = trim( $coupon_code ); + $this->load_coupon( $coupon_code ); + if ( ! $this->coupon ) { + return false; + } + //check if coupon is allowed for the product + $only_for_allowed_products = get_post_meta( $this->coupon['id'], 'asp_coupon_only_for_allowed_products', true ); + if ( $only_for_allowed_products ) { + $allowed_products = get_post_meta( $this->coupon['id'], 'asp_coupon_allowed_products', true ); + if ( is_array( $allowed_products ) && ! in_array( strval( $this->post_id ), $allowed_products, true ) ) { + $this->last_error = __( 'Coupon is not allowed for this product.', 'stripe-payments' ); + $this->coupon = false; + return false; + } + } + return true; + } + + public function get_download_url() { + $post_url = isset( $_POST['asp_item_url'] ) ? sanitize_text_field( stripslashes ( $_POST['asp_item_url'] ) ) : ''; + if ( $post_url ) { + $item_url = $post_url; + } else { + $item_url = get_post_meta( $this->post_id, 'asp_product_upload', true ); + $item_url = $item_url ? $item_url : ''; + + if ( ! $item_url ) { + return ''; + } + $item_url = base64_encode( $item_url ); + } + $item_url = apply_filters( + 'asp_item_url_process', + $item_url, + array( + 'button_key' => $this->get_button_key(), + 'product_id' => $this->post_id, + ) + ); + $item_url = base64_decode( $item_url ); + return $item_url; + } + + public function get_button_key() { + if ( ! $this->button_key ) { + // ASP_Debug_Logger::log("Get Button Key - Name:". $this->get_name() . ", Price:", $this->get_price(true)); + $this->button_key = md5( htmlspecialchars_decode( $this->get_name() ) . $this->get_price( true ) ); + } + return $this->button_key; + } + + public function is_physical_product() { + if(!empty($this->get_meta('asp_is_physical_product'))) { + return true; + } else if (!empty($this->get_meta('asp_product_shipping'))) { + return true; + } else if (!empty($this->get_meta('asp_product_shipping_variations'))) { + return true; + } + + return false; + } + + public function load_from_product( $post_id = false ) { + if ( false === $post_id ) { + $post_id = $this->post_id; + } + if ( false === $post_id ) { + $this->last_error = __( 'No product ID provided.', 'stripe-payments' ); + return false; + } + + $post_id = intval( $post_id ); + $this->post = get_post( $post_id ); + if ( ! $this->post || ( get_post_type( $post_id ) !== ASPMain::$products_slug && get_post_type( $post_id ) !== ASPMain::$temp_prod_slug ) ) { + // translators: %d is product id + $this->last_error = sprintf( __( "Can't find product with ID %d", 'stripe-payments' ), $post_id ); + ASP_Debug_Logger::log( "Can't find product with ID: " . $post_id, false ); + return false; + } + $this->zero_cent = AcceptStripePayments::is_zero_cents( $this->get_currency() ); + return true; + } + + public function get_meta( $meta, $single = true ) { + return get_post_meta( $this->post_id, $meta, $single ); + } + + /** + * Calculate regional shipping amount by the provided region. + * + * @param $shipping_region array + * @param $in_cents bool + * + * @return float|int + */ + public function calculate_regional_shipping_amount($shipping_region, $in_cents = false) { + + $regional_shipping_amount = 0; + $configured_variations = $this->get_meta('asp_product_shipping_variations'); + // Evaluate variable shipping if enabled. + if (is_array($configured_variations) && count($configured_variations)) { + // Iterate through the available shipping variation option to find if there is amy matching. + foreach ($configured_variations as $variation) { + $variation['amount'] = (float) $variation['amount']; + $location = strtolower($variation['loc']); + switch ($variation['type']) { + case '0': + if (!empty($shipping_region['country']) && $location == strtolower($shipping_region['country']) ) + // Matched by country, get shipping amount for this location. + $regional_shipping_amount += $variation['amount']; + break; + case '1': + if (!empty($shipping_region['state']) && $location == strtolower($shipping_region['state']) ) + // Matched by state, get shipping amount for this location. + $regional_shipping_amount += $variation['amount']; + break; + case '2': + if (!empty($shipping_region['city']) && $location == strtolower($shipping_region['city']) ) + // Matched by city, get shipping amount for this location. + $regional_shipping_amount += $variation['amount']; + break; + default: + break; + + } + } + } + + return $in_cents ? $this->in_cents($regional_shipping_amount) : $regional_shipping_amount; + } + + /** + * Validates the total checkout amount for a product against amounts from ajax. + * + * @param int $amount The price to validate. + * @param int $quantity Product quantity. + * @param array $custom_inputs Custom input from customer such as applied coupon code, billing/shipping details, price variation etc. + * + * @return bool TRUE if validation is successful, FALSE otherwise. + */ + public function validate_total_amount( $amount, $quantity, $custom_inputs) { + //ASP_Debug_Logger::log("Amount submitted by customer (in cents): ". $amount, true); + $product_price = (float) $this->get_meta('asp_product_price'); + $quantity = (int) $quantity; + $product_price_in_cents = $this->in_cents($product_price); + //ASP_Debug_Logger::log("Raw product price: ". $product_price_in_cents , true); + + $this->set_price($product_price_in_cents, true); + + $this->set_quantity( $quantity ); + + $price_variation = $custom_inputs['price_variation']; + if ( isset($price_variation) && !empty( $price_variation ) ) { + $variations_groups = $this->get_meta('asp_variations_groups'); + $variations_names = $this->get_meta('asp_variations_names'); + $variations_prices = $this->get_meta('asp_variations_prices'); + + $construct_final_price = ! empty( $this->get_meta('asp_product_hide_amount_input') ); + + $pvars = explode(',', $price_variation ); // Hold data like this: ['-', ....] + + $variation_price = 0; + foreach ($pvars as $pvar_str) { + $separator = '_'; + // Use the last index of the separator to explode the $pvar_str. This is to avoid collision if $pvar_str contains (from the group name) more than one $separator. + $last_separator_index = strrpos($pvar_str, $separator); + + $option_group = substr($pvar_str, 0, $last_separator_index); // Group name; + $applied_option = (int) substr($pvar_str, $last_separator_index + strlen($separator));// Applied option + + $group_index = array_search($option_group, $variations_groups); + $applied_price = (float) $variations_prices[$group_index][$applied_option]; + $applied_price = $this->in_cents( $applied_price ); + $variation_price += $applied_price; + // ASP_Debug_Logger::log("Applied variation price for ". $variations_names[$group_index][$applied_option]. ' : ' .$applied_price, true); + } + // ASP_Debug_Logger::log("Applied total variation price : ". $variation_price, true); + + $price_with_applied_variation = 0; + if ($construct_final_price) { + $price_with_applied_variation = $variation_price; + }else{ + $price_with_applied_variation = $variation_price + $product_price_in_cents; + } + $this->set_price($price_with_applied_variation, true); + // ASP_Debug_Logger::log("Applied total variation price with base price : ". $price_with_applied_variation, true); + } + // ASP_Debug_Logger::log("Amount current total (after price variation): ". $this->get_total(true), true); + + $tax_variations_type = $this->get_meta('asp_product_tax_variations_type'); + $tax_variations_arr = $this->get_meta('asp_product_tax_variations'); + $collect_billing_addr_enabled = $this->get_meta('asp_product_collect_billing_addr'); + $collect_shipping_addr_enabled = $this->get_meta('asp_product_collect_shipping_addr'); + // ASP_Debug_Logger::log("Applied tax amount (before tax variation apply): ". $this->get_tax_amount(true), true); + + // Evaluate variable tax if enabled. + if (is_array($tax_variations_arr) && count($tax_variations_arr) && $collect_billing_addr_enabled === '1') { + $applied_tax_percentage = 0; + $tax_region = ($tax_variations_type === 's' && $collect_shipping_addr_enabled === '1') ? $custom_inputs['shipping_details']['address'] : $custom_inputs['billing_details']['address']; + + // Iterate through the available tax variation option to find if there is amy matching. + foreach ($tax_variations_arr as $tax_variation) { + $tax_variation['amount'] = (float) $tax_variation['amount']; + switch ($tax_variation['loc']) { + case $tax_region['city']: + // Matched by city, get tax amount for this location. + $applied_tax_percentage += $tax_variation['amount']; + break; + case $tax_region['state']: + // Matched by state, get tax amount for this location. + $applied_tax_percentage += $tax_variation['amount']; + break; + case $tax_region['country']: + // Matched by country, get tax amount for this location. + $applied_tax_percentage += $tax_variation['amount']; + break; + } + } + + if ($applied_tax_percentage > 0) { + $this->set_tax($applied_tax_percentage); + } + + } + //ASP_Debug_Logger::log("Applied tax amount (after tax variation): ". $this->get_tax_amount(true), true); + //ASP_Debug_Logger::log("Amount current total (after tax variation): ". $this->get_total(true), true); + + $base_shipping_amount = get_post_meta( $this->post_id, 'asp_product_shipping', true ); + if (empty($base_shipping_amount)){ + $base_shipping_amount = 0; + } else { + $base_shipping_amount = $this->in_cents(floatval($base_shipping_amount)); + } + $shipping_amount = $base_shipping_amount; + + $collect_shipping_addr_enabled = $this->get_meta('asp_product_collect_shipping_addr'); + if ( $collect_shipping_addr_enabled == '1'){ + $regional_shipping_amount = $this->calculate_regional_shipping_amount($custom_inputs['shipping_details']['address'], true); + $shipping_amount += $regional_shipping_amount; + } + + $this->set_shipping( $shipping_amount, true ); + + //ASP_Debug_Logger::log("Amount current total (after base shipping): ". $this->get_total(true), true); + + $coupon_code = $custom_inputs['coupon_code']; + if ( !empty( $coupon_code ) ) { + // Get the coupon and evaluate it (if submitted). + if ( !$this->load_coupon( $coupon_code ) ) { + // Invalid coupon. The 'load_coupon' method will handle appending appropriate error message. + return false; + }; + } + + // Calculate the expected total amount. + $expected_total_amount = $this->get_total(true); + + // Check if surcharge feature is enabled. + if ( !empty($this->get_surcharge()) ){ + // Surcharge is enabled. Calculate the surcharge amount then adjust the expected total. + $surcharge_amount = round($this->calculate_total_surcharge(true));//This is in cents so round it to 0 decimal place. + + ASP_Debug_Logger::log("The surcharge feature is enabled. Applied surcharge amount (in cents): ". $surcharge_amount, true); + $expected_total_amount += $surcharge_amount; + } + + // Trigger a filter so addons can override it. + $expected_total_amount = apply_filters('asp_pre_api_submission_expected_amount', $expected_total_amount, $amount, $this->post_id); + + // Check if the expected total amount matches the given amount. + if ( $amount != $expected_total_amount ){ + ASP_Debug_Logger::log("Pre-API Submission validation amount mismatch. Expected amount (in cents): ". $expected_total_amount . ", Submitted amount (in cents): " . $amount, false); + // Set the last error message that will be displayed to the user. + $mismatch_err_msg = __( "Price validation failed. The submitted amount does not match the product's configured price. ", 'stripe-payments' ); + $mismatch_err_msg .= "Expected: " . $this->from_cents($expected_total_amount) . ", Submitted: " . $this->from_cents($amount); + $this->last_error = $mismatch_err_msg; + return false; + } + + ASP_Debug_Logger::log("Pre-API Submission validation successful. Expected: " . $this->from_cents($expected_total_amount) . ", Submitted: " . $this->from_cents($amount), true); + return true; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-self-hooks-handler.php b/wp-content/plugins/stripe-payments/includes/class-asp-self-hooks-handler.php new file mode 100644 index 0000000..4d877b0 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-self-hooks-handler.php @@ -0,0 +1,412 @@ +main = AcceptStripePayments::get_instance(); + add_action( 'asp_ng_product_mode_keys', array( $this, 'ng_product_mode_keys_handler' ) ); + + add_action( 'plugins_loaded', array( $this, 'plugins_loaded' ), 0 ); + + add_filter( 'asp_ng_before_pi_create_update', array( $this, 'pi_update' ) ); + + add_filter( 'asp_ng_available_currencies', array( $this, 'filter_available_currencies' ) ); + + add_action( 'asp_ng_before_token_request', array( $this, 'check_token' ), 100 ); + add_action( 'asp_ng_before_token_request', array( $this, 'check_rate_limit' ), 101 ); + + add_action( 'asp_ng_before_token_request', array( $this, 'tax_variations' ) ); + + add_filter( 'asp_ng_pp_data_ready', array( $this, 'tax_variations_addon' ), 100, 2 ); + + add_action( 'asp_stripe_payment_completed', array( $this, 'daily_txn_limit' ), 102, 2 ); + + } + + public function plugins_loaded() { + //WP eMember integration + if ( function_exists( 'wp_emember_install' ) ) { + add_action( 'asp_stripe_payment_completed', array( $this, 'handle_eMember_signup' ), 10, 2 ); + } + + //WP PDF Stamper integration + if ( function_exists( 'pdf_stamper_stamp_internal_file' ) ) { + add_action( 'asp_ng_payment_completed', array( $this, 'handle_wp_pdf_stamper' ), 1000, 2 ); + } + } + + public function pi_update( $pi_params ) { + $product_id = filter_input( INPUT_POST, 'product_id', FILTER_SANITIZE_NUMBER_INT ); + + $plan_id = get_post_meta( $product_id, 'asp_sub_plan_id', true ); + if ( ! empty( $plan_id ) ) { + //ignoring option for Subscription product + return $pi_params; + } + + $auth_only = get_post_meta( $product_id, 'asp_product_authorize_only', true ); + if ( $auth_only ) { + $pi_params['capture_method'] = 'manual'; + + $extended_authorization = get_post_meta( $product_id, 'asp_product_extended_authorization', true ); + if ( ! empty( $extended_authorization ) ) { + if ( isset( $pi_params['payment_method_options']['card'] ) && is_array( $pi_params['payment_method_options']['card'] ) ) { + $pi_params['payment_method_options']['card']['request_extended_authorization'] = 'if_available'; + } else if ( isset( $pi_params['payment_method_options'] ) && is_array( $pi_params['payment_method_options'] ) ) { + $pi_params['payment_method_options']['card'] = array( + 'request_extended_authorization' => 'if_available', + ); + } else { + $pi_params['payment_method_options'] = array( + 'card' => array( + 'request_extended_authorization' => 'if_available', + ), + ); + } + } + } + return $pi_params; + } + + public function filter_available_currencies( $curr_arr ) { + $allowed_curr = $this->main->get_setting( 'allowed_currencies' ); + $allowed_curr = empty( $allowed_curr ) ? array() : json_decode( html_entity_decode( $allowed_curr ), true ); + + if ( empty( $allowed_curr ) || empty( array_diff_key( $curr_arr, $allowed_curr ) ) ) { + return $curr_arr; + } + + foreach ( $curr_arr as $key => $value ) { + if ( ! isset( $allowed_curr[ $key ] ) ) { + unset( $curr_arr[ $key ] ); + } + } + + return $curr_arr; + } + + public function ng_product_mode_keys_handler( $product_id ) { + if ( empty( $product_id ) ) { + return; + } + + $product = get_post( $product_id ); + + if ( ! $product ) { + return; + } + + $prod = new ASP_Product_Item( $product_id ); + + $type = $prod->get_type(); + + if ( 'subscription' !== $type ) { + $use_other_acc = get_post_meta( $product_id, 'asp_use_other_stripe_acc', true ); + if ( ! empty( $use_other_acc ) ) { + $this->main->APIPubKeyTest = get_post_meta( $product_id, 'asp_stripe_test_pub_key', true ); + $this->main->APIPubKeyLive = get_post_meta( $product_id, 'asp_stripe_live_pub_key', true ); + $this->main->APISecKeyTest = get_post_meta( $product_id, 'asp_stripe_test_sec_key', true ); + $this->main->APISecKeyLive = get_post_meta( $product_id, 'asp_stripe_live_sec_key', true ); + $this->main->APIPubKey = $this->main->APIPubKeyLive; + $this->main->APISecKey = $this->main->APISecKeyLive; + } + } + + $plan_id = get_post_meta( $product_id, 'asp_sub_plan_id', true ); + + if ( ! empty( $plan_id ) ) { + //check if Subs addon enabled + if ( class_exists( 'ASPSUB_main' ) ) { + $asp_sub = ASPSUB_main::get_instance(); + $plan = $asp_sub->get_plan_data( $plan_id ); + if ( ! ( $plan ) || $plan->livemode ) { + return; + } + } + } else { + //check if force test mode option set for the product + $force_test = get_post_meta( $product_id, 'asp_product_force_test_mode', true ); + if ( empty( $force_test ) ) { + return; + } + } + + $this->main->is_live = false; + $this->main->APIPubKey = $this->main->APIPubKeyTest; + $this->main->APISecKey = $this->main->APISecKeyTest; + } + + public function handle_emember_signup( $data, $charge ) { + + if ( empty( $data['product_id'] ) ) { + return; + } + + //let's check if Membership Level is set for this product + $level_id = get_post_meta( $data['product_id'], 'asp_product_emember_level', true ); + if ( empty( $level_id ) ) { + return; + } + + //let's form data required for eMember_handle_subsc_signup_stand_alone function and call it + $first_name = ''; + $last_name = ''; + if ( ! empty( $data['customer_name'] ) ) { + // let's try to create first name and last name from full name + $parts = explode( ' ', $data['customer_name'] ); + $last_name = array_pop( $parts ); + $first_name = implode( ' ', $parts ); + } + $addr_street = isset( $_POST['stripeBillingAddressLine1'] ) ? sanitize_text_field( $_POST['stripeBillingAddressLine1'] ) : ''; + $addr_zip = isset( $_POST['stripeBillingAddressZip'] ) ? sanitize_text_field( $_POST['stripeBillingAddressZip'] ) : ''; + $addr_city = isset( $_POST['stripeBillingAddressCity'] ) ? sanitize_text_field( $_POST['stripeBillingAddressCity'] ) : ''; + $addr_state = isset( $_POST['stripeBillingAddressState'] ) ? sanitize_text_field( $_POST['stripeBillingAddressState'] ) : ''; + $addr_country = isset( $_POST['stripeBillingAddressCountry'] ) ? sanitize_text_field( $_POST['stripeBillingAddressCountry'] ) : ''; + + if ( empty( $addr_street ) && ! empty( $charge->source->address_line1 ) ) { + $addr_street = $charge->source->address_line1; + } + + if ( empty( $addr_zip ) && ! empty( $charge->source->address_zip ) ) { + $addr_zip = $charge->source->address_zip; + } + + if ( empty( $addr_city ) && ! empty( $charge->source->address_city ) ) { + $addr_city = $charge->source->address_city; + } + + if ( empty( $addr_state ) && ! empty( $charge->source->address_state ) ) { + $addr_state = $charge->source->address_state; + } + + if ( empty( $addr_country ) && ! empty( $charge->source->address_country ) ) { + $addr_country = $charge->source->address_country; + } + + //get address from new API payment data + $ipn = ASP_Process_IPN_NG::get_instance(); + + if ( isset( $ipn->p_data ) ) { + $addr = $ipn->p_data->get_billing_details(); + if ( $addr ) { + if ( empty( $addr_street ) && ! empty( $addr->line1 ) ) { + $addr_street = $addr->line1; + } + if ( empty( $addr_zip ) && ! empty( $addr->postal_code ) ) { + $addr_zip = $addr->postal_code; + } + + if ( empty( $addr_city ) && ! empty( $addr->city ) ) { + $addr_city = $addr->city; + } + + if ( empty( $addr_state ) && ! empty( $addr->state ) ) { + $addr_state = $addr->state; + } + + if ( empty( $addr_country ) && ! empty( $addr->country ) ) { + $addr_country = $addr->country; + } + } + } + + if ( ! empty( $addr_country ) ) { + //convert country code to country name + $countries = ASP_Utils::get_countries_untranslated(); + if ( isset( $countries[ $addr_country ] ) ) { + $addr_country = $countries[ $addr_country ]; + } + } + + $ipn_data = array( + 'payer_email' => $data['stripeEmail'], + 'first_name' => $first_name, + 'last_name' => $last_name, + 'txn_id' => $data['txn_id'], + 'address_street' => $addr_street, + 'address_city' => $addr_city, + 'address_state' => $addr_state, + 'address_zip' => $addr_zip, + 'address_country' => $addr_country, + ); + + ASP_Debug_Logger::log( 'Calling eMember_handle_subsc_signup_stand_alone' ); + + $emember_id = ''; + if ( class_exists( 'Emember_Auth' ) ) { + //Check if the user is logged in as a member. + $emember_auth = Emember_Auth::getInstance(); + $emember_id = $emember_auth->getUserInfo( 'member_id' ); + } + + if ( defined( 'WP_EMEMBER_PATH' ) ) { + require_once WP_EMEMBER_PATH . 'ipn/eMember_handle_subsc_ipn_stand_alone.php'; + eMember_handle_subsc_signup_stand_alone( $ipn_data, $level_id, $data['txn_id'], $emember_id ); + } + + } + + public function handle_wp_pdf_stamper( $data, $prod_id ) { + $pdf_stamper_enabled = get_post_meta( $prod_id, 'asp_product_pdf_stamper_enabled', true ); + $item_url = get_post_meta( $prod_id, 'asp_product_upload', true ); + + if ( $pdf_stamper_enabled && ! empty( $item_url ) && strpos( strtolower( basename( $item_url ) ), '.pdf' ) !== false ) { + $ipn = ASP_Process_IPN_NG::get_instance(); + + $billing_addr = $ipn->p_data->get_billing_details(); + + $b_addr = $billing_addr->line1 . ', ' . $billing_addr->city . ', ' . ( isset( $billing_addr->state ) ? $billing_addr->state . ', ' : '' ) . $billing_addr->postal_code . ', ' . $billing_addr->country; + + $additional_params = array( + 'product_name' => $data['item_name'], + 'transaction_id' => $data['txn_id'], + ); + + $res = pdf_stamper_stamp_internal_file( $item_url, $data['customer_name'], $data['stripeEmail'], '', $b_addr, '', '', '', '', $additional_params ); + + if ( empty( $res ) ) { + return $data; + } + + $res_arr = explode( " \n", $res ); + + if ( isset( $res_arr[0] ) && 'Success!' === $res_arr[0] ) { + $data['item_url'] = $res_arr[1]; + } + } + return $data; + } + + public function check_token( $item ) { + $disable_token_check = $this->main->get_setting( 'disable_security_token_check' ); + + if ( $disable_token_check ) { + return; + } + + $button_key = $item->get_button_key(); + $token = isset( $_POST['token'] ) ? sanitize_text_field( stripslashes ( $_POST['token'] ) ) : ''; + $g_token = ASP_Utils::get_visitor_token( $button_key ); + if ( empty( $token ) || $g_token !== $token ) { + $out = array(); + $out['success'] = false; + $out['err'] = __( 'Invalid security token.', 'stripe-payments' ); + wp_send_json( $out ); + } + } + + public function check_rate_limit() { + //disabled for now + return; + + $limit = 5; + + $tdata = get_transient( 'asp_ng_throttle_data' ); + $tdata = empty( $tdata ) ? array() : $tdata; + + array_push( $tdata, time() ); + + foreach ( $tdata as $key => $req ) { + if ( $req < ( time() + 60 ) ) { + unset( $tdata[ $key ] ); + } + } + + set_transient( 'asp_ng_throttle_data', $tdata ); + + if ( count( $tdata ) > $limit ) { + $out = array(); + $out['success'] = false; + $out['err'] = __( 'Rate limit exceeded. Please try again later.', 'stripe-payments' ); + wp_send_json( $out ); + } + + } + + public function tax_variations( $item ) { + + $tax_variations_arr = $item->get_meta( 'asp_product_tax_variations' ); + + if ( empty( $tax_variations_arr ) ) { + return $item; + } + + $this->tax_variations_arr = $tax_variations_arr; + + $this->item = $item; + + add_filter( 'asp_ng_before_customer_create_update', array( $this, 'tax_variations_check_apply' ), 10, 2 ); + + add_filter( 'asp_ng_sub_confirm_token_customer_opts', array( $this, 'tax_variations_check_apply' ) ); + + return $this->item; + + } + + public function tax_variations_check_apply( $cust_opts ) { + ASP_Debug_Logger::log_array_data( $cust_opts ); + + if ( empty( $cust_opts['address'] ) ) { + return $cust_opts; + } + + if ( empty( $this->tax_variations_arr ) ) { + return $cust_opts; + } + + $tax_variations_type = $this->item->get_meta('asp_product_tax_variations_type'); + + if ($tax_variations_type == 's'){ + $new_tax = ASP_Utils::get_tax_variations_tax( + $this->tax_variations_arr, + empty( $cust_opts['shipping']['address']['country'] ) ? '' : $cust_opts['shipping']['address']['country'], + empty( $cust_opts['shipping']['address']['state'] ) ? '' : $cust_opts['shipping']['address']['state'], + empty( $cust_opts['shipping']['address']['city'] ) ? '' : $cust_opts['shipping']['address']['city'] + ); + } else { + $new_tax = ASP_Utils::get_tax_variations_tax( + $this->tax_variations_arr, + empty( $cust_opts['address']['country'] ) ? '' : $cust_opts['address']['country'], + empty( $cust_opts['address']['state'] ) ? '' : $cust_opts['address']['state'], + empty( $cust_opts['address']['city'] ) ? '' : $cust_opts['address']['city'] + ); + } + + if ( false !== $new_tax ) { + $this->item->set_tax( $new_tax ); + } + + return $cust_opts; + } + + public function tax_variations_addon( $data, $prod_id ) { + if ( empty( $data['tax_variations'] ) ) { + return $data; + } + $addon = array( + 'name' => 'aspTaxVariations', + 'handler' => 'aspTaxVariationsNG', + ); + $data['addons'][] = $addon; + + return $data; + } + + public function daily_txn_limit($data,$charge) + { + $captcha_type = $this->main->get_setting('captcha_type'); + $asp_daily_txn_counter_obj = new ASP_Daily_Txn_Counter(); + + if (empty( $captcha_type ) || $captcha_type == 'none' ) { + $asp_daily_txn_counter_obj->asp_increment_daily_txn_counter(); + } + else if($asp_daily_txn_counter_obj->asp_is_daily_tnx_limit_with_captcha_enabled()){ + $asp_daily_txn_counter_obj->asp_increment_daily_txn_counter(); + } + } + +} + +new ASP_Self_Hooks_Handler(); diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-stripe-api.php b/wp-content/plugins/stripe-payments/includes/class-asp-stripe-api.php new file mode 100644 index 0000000..09626c3 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-stripe-api.php @@ -0,0 +1,196 @@ + 'Stripe Payments', + 'partner_id' => 'pp_partner_Fvas9OJ0jQ2oNQ', + 'url' => 'https://wordpress.org/plugins/stripe-payments/', + 'version' => WP_ASP_PLUGIN_VERSION, + ); + + public static function get_instance() { + if ( null === self::$instance ) { + self::$instance = new self(); + } + return self::$instance; + } + + public function set_api_key( $key ) { + $this->api_key = $key; + } + + public function set_param( $param, $value ) { + $this->$param = $value; + } + + private function encode_params( $d ) { + if ( true === $d ) { + return 'true'; + } + if ( false === $d ) { + return 'false'; + } + if ( is_array( $d ) ) { + $res = array(); + foreach ( $d as $k => $v ) { + $res[ $k ] = $this->encode_params( $v ); + } + return $res; + } + + return $d; + } + + private function before_request() { + $this->last_error = array(); + } + + private function get_headers() { + $ua_string = 'Stripe/v1 PhpBindings/0.0.0'; + + $ua_string .= ' ' . $this->format_app_info( $this->app_info ); + + $lang_version = PHP_VERSION; + $uname_disabled = in_array( 'php_uname', explode( ',', ini_get( 'disable_functions' ) ), true ); + $uname = $uname_disabled ? '(disabled)' : php_uname(); + + $ua = array( + 'bindings_version' => '0.0.0', + 'lang' => 'php', + 'lang_version' => $lang_version, + 'publisher' => 'stripe', + 'uname' => $uname, + 'application' => $this->app_info, + ); + + $headers = array( + 'X-Stripe-Client-User-Agent' => json_encode( $ua ), + 'User-Agent' => $ua_string, + 'Authorization' => 'Basic ' . base64_encode( $this->api_key . ':' ), + 'Stripe-Version' => ASPMain::$stripe_api_ver, + ); + return $headers; + } + + private function process_result( $res ) { + if ( is_wp_error( $res ) ) { + $this->last_error['message'] = $res->get_error_message(); + $this->last_error['error_code'] = $res->get_error_code(); + if ( $this->throw_exception ) { + throw new \Exception( $res->get_error_message(), $res->get_error_code() ); + } + return false; + } + + if ( 200 !== $res['response']['code'] ) { + if ( ! empty( $res['body'] ) ) { + $body = json_decode( $res['body'], true ); + if ( isset( $body['error'] ) ) { + $this->last_error = $body['error']; + $this->last_error['http_code'] = $res['response']['code']; + if ( $this->throw_exception ) { + throw new \Exception( $body['error']['message'], $res['response']['code'] ); + } + } + } + return false; + } + + $return = json_decode( $res['body'] ); + + return $return; + } + + /** + * Make GET API request + * + * @param string $endpoint + * Endpoint to make request to. Example: 'customers/' + * @param array $params + * Parameters to send. Was ignored before 2.0.44 + * @return mixed + * `object` on success, `false` on error + */ + public function get( $endpoint, $params = array() ) { + + $this->before_request(); + + $headers = $this->get_headers(); + + $res = wp_remote_get( + $this->api_url . $endpoint, + array( + 'headers' => $headers, + 'body' => $this->encode_params( $params ), + ) + ); + + $return = $this->process_result( $res ); + + return $return; + + } + + /** + * Make POST API request + * + * @param string $endpoint + * Endpoint to make request to. Example: 'customers/' + * @param array $params + * Parameters to send + * @param string $method + * Since 2.0.51 + * Request method. Default is 'POST' + * @return mixed + * `object` on success, `false` on error + */ + public function post( $endpoint, $params = array(), $method = 'POST' ) { + + $this->before_request(); + + $headers = $this->get_headers(); + + $res = wp_remote_get( + $this->api_url . $endpoint, + array( + 'method' => $method, + 'headers' => $headers, + 'body' => $this->encode_params( $params ), + ) + ); + + $return = $this->process_result( $res ); + return $return; + + } + + public function get_last_error() { + return $this->last_error; + } + + private function format_app_info( $app_info ) { + if ( null !== $app_info ) { + $string = $app_info['name']; + if ( null !== $app_info['version'] ) { + $string .= '/' . $app_info['version']; + } + if ( null !== $app_info['url'] ) { + $string .= ' (' . $app_info['url'] . ')'; + } + + return $string; + } + + return null; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-utils-bot-mitigation.php b/wp-content/plugins/stripe-payments/includes/class-asp-utils-bot-mitigation.php new file mode 100644 index 0000000..46eeca7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-utils-bot-mitigation.php @@ -0,0 +1,184 @@ + 300 ){ + //Time expired + ASP_Debug_Logger::log( 'Captcha response check - The captcha solve data for this IP address ('.$ip_address_to_check.') expired. Time difference (seconds): ' . $time_diff, false ); + return false; + } + + //Entry for the given IP address exists and time is valid. + return true; + } + + public static function get_page_load_signature_data() { + $page_load_signature_arr = get_transient('asp_page_load_signature'); + if (!isset($page_load_signature_arr) || empty($page_load_signature_arr)) { + $page_load_signature_arr = array(); + } + return $page_load_signature_arr; + } + + public static function record_page_load_signature_data($product_id) { + $ip_address = ASP_Utils::get_user_ip_address(); + //$current_wp_time = current_time('mysql'); + + if (!isset($ip_address) || empty($ip_address)) { + ASP_Debug_Logger::log('IP address value missing (could not read the IP address of the user). Cannot record this page load signature. The extra security check later may fail.', false); + return; + } + + $page_load_signature_arr = ASP_Utils_Bot_Mitigation::get_page_load_signature_data(); + //ASP_Debug_Logger::log_array_data($page_load_signature_arr); + + $hp_key = ASP_Utils_Bot_Mitigation::get_asp_hash_private_key_one(); + + $index = $product_id. '_'.$ip_address; + $signature = sha1($hp_key.$product_id.$ip_address); + $page_load_signature_arr[$index] = $signature; + //ASP_Debug_Logger::log('Index: ' . $index . ', Signature: ' . $signature . ', IP Address: ' . $ip_address, true); + //ASP_Debug_Logger::log_array_data($page_load_signature_arr); + + //Save the page load signature data with an expiry of 1 hour. + set_transient('asp_page_load_signature', $page_load_signature_arr, 3600); + } + + public static function is_page_load_signature_data_valid($product_id) { + $page_load_signature_arr = get_transient('asp_page_load_signature'); + if (!isset($page_load_signature_arr) || empty($page_load_signature_arr)) { + ASP_Debug_Logger::log( 'Page load signature check - currently there are no entries in the saved data for page load signature.', false ); + return false; + } + + $ip_address_to_check = ASP_Utils::get_user_ip_address(); + if (!isset($ip_address_to_check) || empty($ip_address_to_check)) { + ASP_Debug_Logger::log( 'Page load signature check - IP address value for this request is missing.', false ); + return false; + } + + $index = $product_id. '_'.$ip_address_to_check; + + if (!isset($page_load_signature_arr[$index]) || empty ($page_load_signature_arr[$index])){ + ASP_Debug_Logger::log( 'Page load signature check - cannot find this Product ID and IP address index ('.$index.') in the saved data.', false ); + return false; + } + + $hp_key = ASP_Utils_Bot_Mitigation::get_asp_hash_private_key_one(); + + $expected_signature = $page_load_signature_arr[$index]; + $received = sha1($hp_key.$product_id.$ip_address_to_check); + //ASP_Debug_Logger::log('Index: ' . $index . ', Signature Received: ' . $received . ', Expected: ' . $expected_signature, true); + //ASP_Debug_Logger::log_array_data($page_load_signature_arr); + + if (!hash_equals($expected_signature, $received)){ + //Mis-match + ASP_Debug_Logger::log( 'Page load signature check - the signature hash does not match.', false ); + return false; + } + + //Entry for the received signature exists + ASP_Debug_Logger::log( 'Page load signature check done!', true ); + + return true; + } + + public static function get_request_limit_count_data() { + $asp_request_usage_count = get_transient('asp_request_usage_count'); + if (!isset($asp_request_usage_count) || empty($asp_request_usage_count)) { + $asp_request_usage_count = array(); + } + return $asp_request_usage_count; + } + + public static function is_request_limit_reached_for_ip(){ + $ip_address_to_check = ASP_Utils::get_user_ip_address(); + if (!isset($ip_address_to_check) || empty($ip_address_to_check)) { + ASP_Debug_Logger::log( 'Request usage count check - IP address value for this request is missing.', false ); + return false; + } + + //Count and check usage. + $asp_request_usage_count = ASP_Utils_Bot_Mitigation::get_request_limit_count_data(); + $index = $ip_address_to_check; + if( !isset($asp_request_usage_count[$index]) ){ + //Index not set so initialize with 0 count. + $asp_request_usage_count[$index] = 0; + } + $asp_request_usage_count[$index] = $asp_request_usage_count[$index] + 1; + //ASP_Debug_Logger::log('Index: ' . $index . ', Count: ' . $asp_request_usage_count[$index], true); + + //Save the request usage count data with an expiry of 12 hours. + set_transient('asp_request_usage_count', $asp_request_usage_count, 43200); + + //Check limit + $limit = apply_filters('asp_request_usage_count_by_ip_limit', 20);//Trigger a filter so this can be customized. + if ($asp_request_usage_count[$index] > $limit){ + //Limit reached/exceeded. Reject this. + ASP_Debug_Logger::log( 'Request usage count limit reached for this IP address. IP: ' . $index . ', Request Count: ' . $asp_request_usage_count[$index], false ); + return false; + } + + ASP_Debug_Logger::log( 'Request usage count is valid for this IP addresss. IP: ' . $index . ', Request Count: ' . $asp_request_usage_count[$index], true ); + return true; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-utils-misc.php b/wp-content/plugins/stripe-payments/includes/class-asp-utils-misc.php new file mode 100644 index 0000000..3d73e5b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-utils-misc.php @@ -0,0 +1,78 @@ +request ) ) { + //Try to get the URL from WP + $pageURL = home_url( add_query_arg( array(), $wp->request ) ); + $pageURL = apply_filters( 'asp_get_current_page_url_filter', $pageURL ); + return $pageURL; + } + } + + //Construct the URL value from the $_SERVER array values. + if ( isset( $_SERVER['HTTPS'] ) && ( $_SERVER['HTTPS'] == 'on' ) ) { + $pageURL .= 's'; + } + $pageURL .= '://'; + if ( isset( $_SERVER['SERVER_PORT'] ) && ( $_SERVER['SERVER_PORT'] != '80' ) && ( $_SERVER['SERVER_PORT'] != '443' ) ) { + $pageURL .= ltrim( $_SERVER['SERVER_NAME'], '.*' ) . ':' . $_SERVER['SERVER_PORT'] . $_SERVER['REQUEST_URI']; + } else { + $pageURL .= ltrim( $_SERVER['SERVER_NAME'], '.*' ) . $_SERVER['REQUEST_URI']; + } + + //Clean any known port numbers from the URL (some hosts may include these port numbers). + $pageURL = str_replace( ':8080', '', $pageURL ); + + //Trigger filter + $pageURL = apply_filters( 'asp_get_current_page_url_filter', $pageURL ); + + return $pageURL; + } + + public static function secure_badge_allowed_tags() { + return array( + 'img' => array( + 'src' => array(), + 'alt' => array(), + 'class' => array(), + 'id' => array(), + ), + 'ul' => array( + 'class' => array(), + 'id' => array(), + ), + 'li' => array( + 'class' => array(), + 'id' => array(), + ), + 'p' => array( + 'class' => array(), + 'id' => array(), + ), + 'br' => array() + ); + } + + public static function secure_badge_default_content() { + $output = ''; + + return $output; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp-utils.php b/wp-content/plugins/stripe-payments/includes/class-asp-utils.php new file mode 100644 index 0000000..d635a5d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp-utils.php @@ -0,0 +1,1230 @@ + 'fr_FR', + 'de' => 'de_DE', + 'da' => 'da_DK', + 'nl' => 'nl_NL', + 'en' => 'en_US', + 'he' => 'he_IL', + 'it' => 'it_IT', + 'lt' => 'lt_LT', + 'ms' => 'ms_MY', + 'nb' => 'nb_NO', + 'pl' => 'pl_PL', + 'pt' => 'pt_PT', + 'ru' => 'ru_RU', + 'zh' => 'zh_CN', + 'es' => 'es_ES', + 'sv' => 'sv_SE', + ); + + protected static $textdomain_backup; + + public static function get_countries_untranslated() { + $countries = array( + '' => '', + 'AF' => 'Afghanistan', + 'AX' => 'Aland Islands', + 'AL' => 'Albania', + 'DZ' => 'Algeria', + 'AS' => 'American Samoa', + 'AD' => 'Andorra', + 'AO' => 'Angola', + 'AI' => 'Anguilla', + 'AQ' => 'Antarctica', + 'AG' => 'Antigua and Barbuda', + 'AR' => 'Argentina', + 'AM' => 'Armenia', + 'AW' => 'Aruba', + 'AU' => 'Australia', + 'AT' => 'Austria', + 'AZ' => 'Azerbaijan', + 'BS' => 'Bahamas', + 'BH' => 'Bahrain', + 'BD' => 'Bangladesh', + 'BB' => 'Barbados', + 'BY' => 'Belarus', + 'BE' => 'Belgium', + 'BZ' => 'Belize', + 'BJ' => 'Benin', + 'BM' => 'Bermuda', + 'BT' => 'Bhutan', + 'BO' => 'Bolivia', + 'BQ' => 'Bonaire', + 'BA' => 'Bosnia and Herzegovina', + 'BW' => 'Botswana', + 'BV' => 'Bouvet Island', + 'BR' => 'Brazil', + 'IO' => 'British Indian Ocean Territory', + 'VG' => 'British Virgin Islands', + 'BN' => 'Brunei', + 'BG' => 'Bulgaria', + 'BF' => 'Burkina Faso', + 'BI' => 'Burundi', + 'KH' => 'Cambodia', + 'CM' => 'Cameroon', + 'CA' => 'Canada', + 'CV' => 'Cape Verde', + 'KY' => 'Cayman Islands', + 'CF' => 'Central African Republic', + 'TD' => 'Chad', + 'CL' => 'Chile', + 'CN' => 'China', + 'CX' => 'Christmas Island', + 'CC' => 'Cocos (Keeling) Islands', + 'CO' => 'Colombia', + 'KM' => 'Comoros', + 'CD' => 'Congo, Democratic Republic of', + 'CG' => 'Congo, Republic of', + 'CK' => 'Cook Islands', + 'CR' => 'Costa Rica', + 'HR' => 'Croatia', + 'CU' => 'Cuba', + 'CW' => 'Curacao', + 'CY' => 'Cyprus', + 'CZ' => 'Czech Republic', + 'DK' => 'Denmark', + 'DJ' => 'Djibouti', + 'DM' => 'Dominica', + 'DO' => 'Dominican Republic', + 'EC' => 'Ecuador', + 'EG' => 'Egypt', + 'SV' => 'El Salvador', + 'GQ' => 'Equatorial Guinea', + 'ER' => 'Eritrea', + 'EE' => 'Estonia', + 'ET' => 'Ethiopia', + 'FK' => 'Falkland Islands', + 'FO' => 'Faroe Islands', + 'FJ' => 'Fiji', + 'FI' => 'Finland', + 'FR' => 'France', + 'GF' => 'French Guiana', + 'PF' => 'French Polynesia', + 'TF' => 'French Southern and Antarctic Lands', + 'GA' => 'Gabon', + 'GM' => 'Gambia', + 'GE' => 'Georgia', + 'DE' => 'Germany', + 'GH' => 'Ghana', + 'GI' => 'Gibraltar', + 'GR' => 'Greece', + 'GL' => 'Greenland', + 'GD' => 'Grenada', + 'GP' => 'Guadeloupe', + 'GU' => 'Guam', + 'GT' => 'Guatemala', + 'GG' => 'Guernsey', + 'GN' => 'Guinea', + 'GW' => 'Guinea-Bissau', + 'GY' => 'Guyana', + 'HT' => 'Haiti', + 'HM' => 'Heard Island and McDonald Islands', + 'HN' => 'Honduras', + 'HK' => 'Hong Kong', + 'HU' => 'Hungary', + 'IS' => 'Iceland', + 'IN' => 'India', + 'ID' => 'Indonesia', + 'IR' => 'Iran', + 'IQ' => 'Iraq', + 'IE' => 'Ireland', + 'IM' => 'Isle of Man', + 'IL' => 'Israel', + 'IT' => 'Italy', + 'CI' => 'Ivory Coast', + 'JM' => 'Jamaica', + 'JP' => 'Japan', + 'JE' => 'Jersey', + 'JO' => 'Jordan', + 'KZ' => 'Kazakhstan', + 'KE' => 'Kenya', + 'KI' => 'Kiribati', + 'KP' => "Korea, Democratic People's Republic of", + 'KR' => 'Korea, Republic of', + 'XK' => 'Kosovo', + 'KW' => 'Kuwait', + 'KG' => 'Kyrgyzstan', + 'LA' => 'Laos', + 'LV' => 'Latvia', + 'LB' => 'Lebanon', + 'LS' => 'Lesotho', + 'LR' => 'Liberia', + 'LY' => 'Libya', + 'LI' => 'Liechtenstein', + 'LT' => 'Lithuania', + 'LU' => 'Luxembourg', + 'MO' => 'Macau', + 'MK' => 'Macedonia', + 'MG' => 'Madagascar', + 'MW' => 'Malawi', + 'MY' => 'Malaysia', + 'MV' => 'Maldives', + 'ML' => 'Mali', + 'MT' => 'Malta', + 'MH' => 'Marshall Islands', + 'MQ' => 'Martinique', + 'MR' => 'Mauritania', + 'MU' => 'Mauritius', + 'YT' => 'Mayotte', + 'MX' => 'Mexico', + 'FM' => 'Micronesia', + 'MD' => 'Moldova', + 'MC' => 'Monaco', + 'MN' => 'Mongolia', + 'ME' => 'Montenegro', + 'MS' => 'Montserrat', + 'MA' => 'Morocco', + 'MZ' => 'Mozambique', + 'MM' => 'Myanmar', + 'NA' => 'Namibia', + 'NR' => 'Nauru', + 'NP' => 'Nepal', + 'NL' => 'Netherlands', + 'NC' => 'New Caledonia', + 'NZ' => 'New Zealand', + 'NI' => 'Nicaragua', + 'NE' => 'Niger', + 'NG' => 'Nigeria', + 'NU' => 'Niue', + 'NF' => 'Norfolk Island', + 'MP' => 'Northern Mariana Islands', + 'NO' => 'Norway', + 'OM' => 'Oman', + 'PK' => 'Pakistan', + 'PW' => 'Palau', + 'PS' => 'Palestine', + 'PA' => 'Panama', + 'PG' => 'Papua New Guinea', + 'PY' => 'Paraguay', + 'PE' => 'Peru', + 'PH' => 'Philippines', + 'PN' => 'Pitcairn Islands', + 'PL' => 'Poland', + 'PT' => 'Portugal', + 'PR' => 'Puerto Rico', + 'QA' => 'Qatar', + 'RE' => 'Reunion', + 'RO' => 'Romania', + 'RU' => 'Russia', + 'RW' => 'Rwanda', + 'BL' => 'Saint Barthelemy', + 'SH' => 'Saint Helena, Ascension, and Tristan da Cunha', + 'KN' => 'Saint Kitts and Nevis', + 'LC' => 'Saint Lucia', + 'MF' => 'Saint Martin', + 'PM' => 'Saint Pierre and Miquelon', + 'VC' => 'Saint Vincent and the Grenadines', + 'WS' => 'Samoa', + 'SM' => 'San Marino', + 'ST' => 'Sao Tome and Principe', + 'SA' => 'Saudi Arabia', + 'SN' => 'Senegal', + 'RS' => 'Serbia', + 'SC' => 'Seychelles', + 'SL' => 'Sierra Leone', + 'SG' => 'Singapore', + 'SX' => 'Sint Maarten', + 'SK' => 'Slovakia', + 'SI' => 'Slovenia', + 'SB' => 'Solomon Islands', + 'SO' => 'Somalia', + 'ZA' => 'South Africa', + 'GS' => 'South Georgia', + 'SS' => 'South Sudan', + 'ES' => 'Spain', + 'LK' => 'Sri Lanka', + 'SD' => 'Sudan', + 'SR' => 'Suriname', + 'SJ' => 'Svalbard and Jan Mayen', + 'SZ' => 'Swaziland', + 'SE' => 'Sweden', + 'CH' => 'Switzerland', + 'SY' => 'Syria', + 'TW' => 'Taiwan', + 'TJ' => 'Tajikistan', + 'TZ' => 'Tanzania', + 'TH' => 'Thailand', + 'TL' => 'Timor-Leste', + 'TG' => 'Togo', + 'TK' => 'Tokelau', + 'TO' => 'Tonga', + 'TT' => 'Trinidad and Tobago', + 'TN' => 'Tunisia', + 'TR' => 'Turkey', + 'TM' => 'Turkmenistan', + 'TC' => 'Turks and Caicos Islands', + 'TV' => 'Tuvalu', + 'UG' => 'Uganda', + 'UA' => 'Ukraine', + 'AE' => 'United Arab Emirates', + 'GB' => 'United Kingdom', + 'US' => 'United States', + 'UM' => 'United States Minor Outlying Islands', + 'VI' => 'United States Virgin Islands', + 'UY' => 'Uruguay', + 'UZ' => 'Uzbekistan', + 'VU' => 'Vanuatu', + 'VA' => 'Vatican City', + 'VE' => 'Venezuela', + 'VN' => 'Vietnam', + 'WF' => 'Wallis and Futuna', + 'EH' => 'Western Sahara', + 'YE' => 'Yemen', + 'ZM' => 'Zambia', + 'ZW' => 'Zimbabwe', + ); + return $countries; + } + + public static function get_countries() { + $countries = array( + '' => '—', + 'AF' => __( 'Afghanistan', 'stripe-payments' ), + 'AX' => __( 'Aland Islands', 'stripe-payments' ), + 'AL' => __( 'Albania', 'stripe-payments' ), + 'DZ' => __( 'Algeria', 'stripe-payments' ), + 'AS' => __( 'American Samoa', 'stripe-payments' ), + 'AD' => __( 'Andorra', 'stripe-payments' ), + 'AO' => __( 'Angola', 'stripe-payments' ), + 'AI' => __( 'Anguilla', 'stripe-payments' ), + 'AQ' => __( 'Antarctica', 'stripe-payments' ), + 'AG' => __( 'Antigua and Barbuda', 'stripe-payments' ), + 'AR' => __( 'Argentina', 'stripe-payments' ), + 'AM' => __( 'Armenia', 'stripe-payments' ), + 'AW' => __( 'Aruba', 'stripe-payments' ), + 'AU' => __( 'Australia', 'stripe-payments' ), + 'AT' => __( 'Austria', 'stripe-payments' ), + 'AZ' => __( 'Azerbaijan', 'stripe-payments' ), + 'BS' => __( 'Bahamas', 'stripe-payments' ), + 'BH' => __( 'Bahrain', 'stripe-payments' ), + 'BD' => __( 'Bangladesh', 'stripe-payments' ), + 'BB' => __( 'Barbados', 'stripe-payments' ), + 'BY' => __( 'Belarus', 'stripe-payments' ), + 'BE' => __( 'Belgium', 'stripe-payments' ), + 'BZ' => __( 'Belize', 'stripe-payments' ), + 'BJ' => __( 'Benin', 'stripe-payments' ), + 'BM' => __( 'Bermuda', 'stripe-payments' ), + 'BT' => __( 'Bhutan', 'stripe-payments' ), + 'BO' => __( 'Bolivia', 'stripe-payments' ), + 'BQ' => __( 'Bonaire', 'stripe-payments' ), + 'BA' => __( 'Bosnia and Herzegovina', 'stripe-payments' ), + 'BW' => __( 'Botswana', 'stripe-payments' ), + 'BV' => __( 'Bouvet Island', 'stripe-payments' ), + 'BR' => __( 'Brazil', 'stripe-payments' ), + 'IO' => __( 'British Indian Ocean Territory', 'stripe-payments' ), + 'VG' => __( 'British Virgin Islands', 'stripe-payments' ), + 'BN' => __( 'Brunei', 'stripe-payments' ), + 'BG' => __( 'Bulgaria', 'stripe-payments' ), + 'BF' => __( 'Burkina Faso', 'stripe-payments' ), + 'BI' => __( 'Burundi', 'stripe-payments' ), + 'KH' => __( 'Cambodia', 'stripe-payments' ), + 'CM' => __( 'Cameroon', 'stripe-payments' ), + 'CA' => __( 'Canada', 'stripe-payments' ), + 'CV' => __( 'Cape Verde', 'stripe-payments' ), + 'KY' => __( 'Cayman Islands', 'stripe-payments' ), + 'CF' => __( 'Central African Republic', 'stripe-payments' ), + 'TD' => __( 'Chad', 'stripe-payments' ), + 'CL' => __( 'Chile', 'stripe-payments' ), + 'CN' => __( 'China', 'stripe-payments' ), + 'CX' => __( 'Christmas Island', 'stripe-payments' ), + 'CC' => __( 'Cocos (Keeling) Islands', 'stripe-payments' ), + 'CO' => __( 'Colombia', 'stripe-payments' ), + 'KM' => __( 'Comoros', 'stripe-payments' ), + 'CD' => __( 'Congo, Democratic Republic of', 'stripe-payments' ), + 'CG' => __( 'Congo, Republic of', 'stripe-payments' ), + 'CK' => __( 'Cook Islands', 'stripe-payments' ), + 'CR' => __( 'Costa Rica', 'stripe-payments' ), + 'HR' => __( 'Croatia', 'stripe-payments' ), + 'CU' => __( 'Cuba', 'stripe-payments' ), + 'CW' => __( 'Curacao', 'stripe-payments' ), + 'CY' => __( 'Cyprus', 'stripe-payments' ), + 'CZ' => __( 'Czech Republic', 'stripe-payments' ), + 'DK' => __( 'Denmark', 'stripe-payments' ), + 'DJ' => __( 'Djibouti', 'stripe-payments' ), + 'DM' => __( 'Dominica', 'stripe-payments' ), + 'DO' => __( 'Dominican Republic', 'stripe-payments' ), + 'EC' => __( 'Ecuador', 'stripe-payments' ), + 'EG' => __( 'Egypt', 'stripe-payments' ), + 'SV' => __( 'El Salvador', 'stripe-payments' ), + 'GQ' => __( 'Equatorial Guinea', 'stripe-payments' ), + 'ER' => __( 'Eritrea', 'stripe-payments' ), + 'EE' => __( 'Estonia', 'stripe-payments' ), + 'ET' => __( 'Ethiopia', 'stripe-payments' ), + 'FK' => __( 'Falkland Islands', 'stripe-payments' ), + 'FO' => __( 'Faroe Islands', 'stripe-payments' ), + 'FJ' => __( 'Fiji', 'stripe-payments' ), + 'FI' => __( 'Finland', 'stripe-payments' ), + 'FR' => __( 'France', 'stripe-payments' ), + 'GF' => __( 'French Guiana', 'stripe-payments' ), + 'PF' => __( 'French Polynesia', 'stripe-payments' ), + 'TF' => __( 'French Southern and Antarctic Lands', 'stripe-payments' ), + 'GA' => __( 'Gabon', 'stripe-payments' ), + 'GM' => __( 'Gambia', 'stripe-payments' ), + 'GE' => __( 'Georgia', 'stripe-payments' ), + 'DE' => __( 'Germany', 'stripe-payments' ), + 'GH' => __( 'Ghana', 'stripe-payments' ), + 'GI' => __( 'Gibraltar', 'stripe-payments' ), + 'GR' => __( 'Greece', 'stripe-payments' ), + 'GL' => __( 'Greenland', 'stripe-payments' ), + 'GD' => __( 'Grenada', 'stripe-payments' ), + 'GP' => __( 'Guadeloupe', 'stripe-payments' ), + 'GU' => __( 'Guam', 'stripe-payments' ), + 'GT' => __( 'Guatemala', 'stripe-payments' ), + 'GG' => __( 'Guernsey', 'stripe-payments' ), + 'GN' => __( 'Guinea', 'stripe-payments' ), + 'GW' => __( 'Guinea-Bissau', 'stripe-payments' ), + 'GY' => __( 'Guyana', 'stripe-payments' ), + 'HT' => __( 'Haiti', 'stripe-payments' ), + 'HM' => __( 'Heard Island and McDonald Islands', 'stripe-payments' ), + 'HN' => __( 'Honduras', 'stripe-payments' ), + 'HK' => __( 'Hong Kong', 'stripe-payments' ), + 'HU' => __( 'Hungary', 'stripe-payments' ), + 'IS' => __( 'Iceland', 'stripe-payments' ), + 'IN' => __( 'India', 'stripe-payments' ), + 'ID' => __( 'Indonesia', 'stripe-payments' ), + 'IR' => __( 'Iran', 'stripe-payments' ), + 'IQ' => __( 'Iraq', 'stripe-payments' ), + 'IE' => __( 'Ireland', 'stripe-payments' ), + 'IM' => __( 'Isle of Man', 'stripe-payments' ), + 'IL' => __( 'Israel', 'stripe-payments' ), + 'IT' => __( 'Italy', 'stripe-payments' ), + 'CI' => __( 'Ivory Coast', 'stripe-payments' ), + 'JM' => __( 'Jamaica', 'stripe-payments' ), + 'JP' => __( 'Japan', 'stripe-payments' ), + 'JE' => __( 'Jersey', 'stripe-payments' ), + 'JO' => __( 'Jordan', 'stripe-payments' ), + 'KZ' => __( 'Kazakhstan', 'stripe-payments' ), + 'KE' => __( 'Kenya', 'stripe-payments' ), + 'KI' => __( 'Kiribati', 'stripe-payments' ), + 'KP' => __( "Korea, Democratic People's Republic of", 'stripe-payments' ), + 'KR' => __( 'Korea, Republic of', 'stripe-payments' ), + 'XK' => __( 'Kosovo', 'stripe-payments' ), + 'KW' => __( 'Kuwait', 'stripe-payments' ), + 'KG' => __( 'Kyrgyzstan', 'stripe-payments' ), + 'LA' => __( 'Laos', 'stripe-payments' ), + 'LV' => __( 'Latvia', 'stripe-payments' ), + 'LB' => __( 'Lebanon', 'stripe-payments' ), + 'LS' => __( 'Lesotho', 'stripe-payments' ), + 'LR' => __( 'Liberia', 'stripe-payments' ), + 'LY' => __( 'Libya', 'stripe-payments' ), + 'LI' => __( 'Liechtenstein', 'stripe-payments' ), + 'LT' => __( 'Lithuania', 'stripe-payments' ), + 'LU' => __( 'Luxembourg', 'stripe-payments' ), + 'MO' => __( 'Macau', 'stripe-payments' ), + 'MK' => __( 'Macedonia', 'stripe-payments' ), + 'MG' => __( 'Madagascar', 'stripe-payments' ), + 'MW' => __( 'Malawi', 'stripe-payments' ), + 'MY' => __( 'Malaysia', 'stripe-payments' ), + 'MV' => __( 'Maldives', 'stripe-payments' ), + 'ML' => __( 'Mali', 'stripe-payments' ), + 'MT' => __( 'Malta', 'stripe-payments' ), + 'MH' => __( 'Marshall Islands', 'stripe-payments' ), + 'MQ' => __( 'Martinique', 'stripe-payments' ), + 'MR' => __( 'Mauritania', 'stripe-payments' ), + 'MU' => __( 'Mauritius', 'stripe-payments' ), + 'YT' => __( 'Mayotte', 'stripe-payments' ), + 'MX' => __( 'Mexico', 'stripe-payments' ), + 'FM' => __( 'Micronesia', 'stripe-payments' ), + 'MD' => __( 'Moldova', 'stripe-payments' ), + 'MC' => __( 'Monaco', 'stripe-payments' ), + 'MN' => __( 'Mongolia', 'stripe-payments' ), + 'ME' => __( 'Montenegro', 'stripe-payments' ), + 'MS' => __( 'Montserrat', 'stripe-payments' ), + 'MA' => __( 'Morocco', 'stripe-payments' ), + 'MZ' => __( 'Mozambique', 'stripe-payments' ), + 'MM' => __( 'Myanmar', 'stripe-payments' ), + 'NA' => __( 'Namibia', 'stripe-payments' ), + 'NR' => __( 'Nauru', 'stripe-payments' ), + 'NP' => __( 'Nepal', 'stripe-payments' ), + 'NL' => __( 'Netherlands', 'stripe-payments' ), + 'NC' => __( 'New Caledonia', 'stripe-payments' ), + 'NZ' => __( 'New Zealand', 'stripe-payments' ), + 'NI' => __( 'Nicaragua', 'stripe-payments' ), + 'NE' => __( 'Niger', 'stripe-payments' ), + 'NG' => __( 'Nigeria', 'stripe-payments' ), + 'NU' => __( 'Niue', 'stripe-payments' ), + 'NF' => __( 'Norfolk Island', 'stripe-payments' ), + 'MP' => __( 'Northern Mariana Islands', 'stripe-payments' ), + 'NO' => __( 'Norway', 'stripe-payments' ), + 'OM' => __( 'Oman', 'stripe-payments' ), + 'PK' => __( 'Pakistan', 'stripe-payments' ), + 'PW' => __( 'Palau', 'stripe-payments' ), + 'PS' => __( 'Palestine', 'stripe-payments' ), + 'PA' => __( 'Panama', 'stripe-payments' ), + 'PG' => __( 'Papua New Guinea', 'stripe-payments' ), + 'PY' => __( 'Paraguay', 'stripe-payments' ), + 'PE' => __( 'Peru', 'stripe-payments' ), + 'PH' => __( 'Philippines', 'stripe-payments' ), + 'PN' => __( 'Pitcairn Islands', 'stripe-payments' ), + 'PL' => __( 'Poland', 'stripe-payments' ), + 'PT' => __( 'Portugal', 'stripe-payments' ), + 'PR' => __( 'Puerto Rico', 'stripe-payments' ), + 'QA' => __( 'Qatar', 'stripe-payments' ), + 'RE' => __( 'Reunion', 'stripe-payments' ), + 'RO' => __( 'Romania', 'stripe-payments' ), + 'RU' => __( 'Russia', 'stripe-payments' ), + 'RW' => __( 'Rwanda', 'stripe-payments' ), + 'BL' => __( 'Saint Barthelemy', 'stripe-payments' ), + 'SH' => __( 'Saint Helena, Ascension, and Tristan da Cunha', 'stripe-payments' ), + 'KN' => __( 'Saint Kitts and Nevis', 'stripe-payments' ), + 'LC' => __( 'Saint Lucia', 'stripe-payments' ), + 'MF' => __( 'Saint Martin', 'stripe-payments' ), + 'PM' => __( 'Saint Pierre and Miquelon', 'stripe-payments' ), + 'VC' => __( 'Saint Vincent and the Grenadines', 'stripe-payments' ), + 'WS' => __( 'Samoa', 'stripe-payments' ), + 'SM' => __( 'San Marino', 'stripe-payments' ), + 'ST' => __( 'Sao Tome and Principe', 'stripe-payments' ), + 'SA' => __( 'Saudi Arabia', 'stripe-payments' ), + 'SN' => __( 'Senegal', 'stripe-payments' ), + 'RS' => __( 'Serbia', 'stripe-payments' ), + 'SC' => __( 'Seychelles', 'stripe-payments' ), + 'SL' => __( 'Sierra Leone', 'stripe-payments' ), + 'SG' => __( 'Singapore', 'stripe-payments' ), + 'SX' => __( 'Sint Maarten', 'stripe-payments' ), + 'SK' => __( 'Slovakia', 'stripe-payments' ), + 'SI' => __( 'Slovenia', 'stripe-payments' ), + 'SB' => __( 'Solomon Islands', 'stripe-payments' ), + 'SO' => __( 'Somalia', 'stripe-payments' ), + 'ZA' => __( 'South Africa', 'stripe-payments' ), + 'GS' => __( 'South Georgia', 'stripe-payments' ), + 'SS' => __( 'South Sudan', 'stripe-payments' ), + 'ES' => __( 'Spain', 'stripe-payments' ), + 'LK' => __( 'Sri Lanka', 'stripe-payments' ), + 'SD' => __( 'Sudan', 'stripe-payments' ), + 'SR' => __( 'Suriname', 'stripe-payments' ), + 'SJ' => __( 'Svalbard and Jan Mayen', 'stripe-payments' ), + 'SZ' => __( 'Swaziland', 'stripe-payments' ), + 'SE' => __( 'Sweden', 'stripe-payments' ), + 'CH' => __( 'Switzerland', 'stripe-payments' ), + 'SY' => __( 'Syria', 'stripe-payments' ), + 'TW' => __( 'Taiwan', 'stripe-payments' ), + 'TJ' => __( 'Tajikistan', 'stripe-payments' ), + 'TZ' => __( 'Tanzania', 'stripe-payments' ), + 'TH' => __( 'Thailand', 'stripe-payments' ), + 'TL' => __( 'Timor-Leste', 'stripe-payments' ), + 'TG' => __( 'Togo', 'stripe-payments' ), + 'TK' => __( 'Tokelau', 'stripe-payments' ), + 'TO' => __( 'Tonga', 'stripe-payments' ), + 'TT' => __( 'Trinidad and Tobago', 'stripe-payments' ), + 'TN' => __( 'Tunisia', 'stripe-payments' ), + 'TR' => __( 'Turkey', 'stripe-payments' ), + 'TM' => __( 'Turkmenistan', 'stripe-payments' ), + 'TC' => __( 'Turks and Caicos Islands', 'stripe-payments' ), + 'TV' => __( 'Tuvalu', 'stripe-payments' ), + 'UG' => __( 'Uganda', 'stripe-payments' ), + 'UA' => __( 'Ukraine', 'stripe-payments' ), + 'AE' => __( 'United Arab Emirates', 'stripe-payments' ), + 'GB' => __( 'United Kingdom', 'stripe-payments' ), + 'US' => __( 'United States', 'stripe-payments' ), + 'UM' => __( 'United States Minor Outlying Islands', 'stripe-payments' ), + 'VI' => __( 'United States Virgin Islands', 'stripe-payments' ), + 'UY' => __( 'Uruguay', 'stripe-payments' ), + 'UZ' => __( 'Uzbekistan', 'stripe-payments' ), + 'VU' => __( 'Vanuatu', 'stripe-payments' ), + 'VA' => __( 'Vatican City', 'stripe-payments' ), + 'VE' => __( 'Venezuela', 'stripe-payments' ), + 'VN' => __( 'Vietnam', 'stripe-payments' ), + 'WF' => __( 'Wallis and Futuna', 'stripe-payments' ), + 'EH' => __( 'Western Sahara', 'stripe-payments' ), + 'YE' => __( 'Yemen', 'stripe-payments' ), + 'ZM' => __( 'Zambia', 'stripe-payments' ), + 'ZW' => __( 'Zimbabwe', 'stripe-payments' ), + ); + return $countries; + } + + public static function get_countries_opts( $selected = false ) { + $countries = self::get_countries(); + asort( $countries ); + if ( isset( $countries[''] ) ) { + array_unshift( $countries, array_pop( $countries ) ); + } + + $countries = apply_filters( 'asp_ng_pp_countries_list', $countries ); + $out = ''; + $tpl = ''; + foreach ( $countries as $c_code => $c_name ) { + $selected_str = ''; + if ( false !== $selected ) { + if ( $c_code === $selected ) { + $selected_str = ' selected'; + } + } + $out .= sprintf( $tpl, esc_attr( $c_code ), $selected_str, esc_html( $c_name ) ); + } + return $out; + } + + public static function get_currencies() { + $currencies = array( + '' => array( __( '(Default)', 'stripe-payments' ), '' ), + 'USD' => array( __( 'US Dollars (USD)', 'stripe-payments' ), '$' ), + 'EUR' => array( __( 'Euros (EUR)', 'stripe-payments' ), '€' ), + 'GBP' => array( __( 'Pounds Sterling (GBP)', 'stripe-payments' ), '£' ), + 'AUD' => array( __( 'Australian Dollars (AUD)', 'stripe-payments' ), 'AU$' ), + 'AED' => array( __( 'United Arab Emirates Dirham (AED)', 'stripe-payments' ), 'د.إ' ), + 'ARS' => array( __( 'Argentine Peso (ARS)', 'stripe-payments' ), 'ARS' ), + 'BAM' => array( __( 'Bosnia and Herzegovina Convertible Mark (BAM)', 'stripe-payments' ), 'KM' ), + 'BGN' => array( __( 'Bulgarian Lev (BGN)', 'stripe-payments' ), 'Лв.' ), + 'BRL' => array( __( 'Brazilian Real (BRL)', 'stripe-payments' ), 'R$' ), + 'CAD' => array( __( 'Canadian Dollars (CAD)', 'stripe-payments' ), 'CA$' ), + 'CLP' => array( __( 'Chilean Peso (CLP)', 'stripe-payments' ), 'CLP' ), + 'CNY' => array( __( 'Chinese Yuan (CNY)', 'stripe-payments' ), 'CN¥' ), + 'COP' => array( __( 'Colombian Peso (COP)', 'stripe-payments' ), 'COL$' ), + 'CZK' => array( __( 'Czech Koruna (CZK)', 'stripe-payments' ), 'Kč' ), + 'DKK' => array( __( 'Danish Krone (DKK)', 'stripe-payments' ), 'kr' ), + 'DOP' => array( __( 'Dominican Peso (DOP)', 'stripe-payments' ), 'RD$' ), + 'EGP' => array( __( 'Egyptian Pound (EGP)', 'stripe-payments' ), 'E£' ), + 'HKD' => array( __( 'Hong Kong Dollar (HKD)', 'stripe-payments' ), 'HK$' ), + 'HUF' => array( __( 'Hungarian Forint (HUF)', 'stripe-payments' ), 'Ft' ), + 'INR' => array( __( 'Indian Rupee (INR)', 'stripe-payments' ), '₹' ), + 'IDR' => array( __( 'Indonesia Rupiah (IDR)', 'stripe-payments' ), 'Rp' ), + 'ILS' => array( __( 'Israeli Shekel (ILS)', 'stripe-payments' ), '₪' ), + 'JPY' => array( __( 'Japanese Yen (JPY)', 'stripe-payments' ), '¥' ), + 'LBP' => array( __( 'Lebanese Pound (LBP)', 'stripe-payments' ), 'ل.ل' ), + 'MYR' => array( __( 'Malaysian Ringgits (MYR)', 'stripe-payments' ), 'RM' ), + 'MXN' => array( __( 'Mexican Peso (MXN)', 'stripe-payments' ), 'MX$' ), + 'NZD' => array( __( 'New Zealand Dollar (NZD)', 'stripe-payments' ), 'NZ$' ), + 'NOK' => array( __( 'Norwegian Krone (NOK)', 'stripe-payments' ), 'kr' ), + 'PEN' => array( __( 'Peruvian Nuevo Sol (PEN)', 'stripe-payments' ), 'S/' ), + 'PHP' => array( __( 'Philippine Pesos (PHP)', 'stripe-payments' ), '₱' ), + 'PLN' => array( __( 'Polish Zloty (PLN)', 'stripe-payments' ), 'zł' ), + 'RON' => array( __( 'Romanian Leu (RON)', 'stripe-payments' ), 'lei' ), + 'RUB' => array( __( 'Russian Ruble (RUB)', 'stripe-payments' ), '₽' ), + 'SAR' => array( __( 'Saudi Riyal (SAR)', 'stripe-payments' ), 'ر.س' ), + 'SGD' => array( __( 'Singapore Dollar (SGD)', 'stripe-payments' ), 'SG$' ), + 'ZAR' => array( __( 'South African Rand (ZAR)', 'stripe-payments' ), 'R' ), + 'KRW' => array( __( 'South Korean Won (KRW)', 'stripe-payments' ), '₩' ), + 'SEK' => array( __( 'Swedish Krona (SEK)', 'stripe-payments' ), 'kr' ), + 'CHF' => array( __( 'Swiss Franc (CHF)', 'stripe-payments' ), 'CHF' ), + 'TWD' => array( __( 'Taiwan New Dollars (TWD)', 'stripe-payments' ), 'NT$' ), + 'THB' => array( __( 'Thai Baht (THB)', 'stripe-payments' ), '฿' ), + 'TRY' => array( __( 'Turkish Lira (TRY)', 'stripe-payments' ), '₺' ), + 'UYU' => array( __( 'Uruguayan Peso (UYU)', 'stripe-payments' ), '$U' ), + 'VND' => array( __( 'Vietnamese Dong (VND)', 'stripe-payments' ), '₫' ), + ); + $opts = get_option( 'AcceptStripePayments-settings' ); + if ( isset( $opts['custom_currency_symbols'] ) && is_array( $opts['custom_currency_symbols'] ) ) { + $currencies = array_merge( $currencies, $opts['custom_currency_symbols'] ); + } + + return $currencies; + } + + public static function mail( $to, $subj, $body, $headers, $do_not_schedule = false ) { + $opts = get_option( 'AcceptStripePayments-settings' ); + $schedule_result = false; + if ( ! $do_not_schedule && isset( $opts['enable_email_schedule'] ) && $opts['enable_email_schedule'] ) { + $schedule_result = wp_schedule_single_event( time() - 10, 'asp_send_scheduled_email', array( $to, $subj, $body, $headers ) ); + } + if ( ! $schedule_result ) { + // can't schedule event for email notification. Let's send email without scheduling + wp_mail( $to, $subj, $body, $headers ); + } + return $schedule_result; + } + + public static function send_error_email( $body ) { + $opt = get_option( 'AcceptStripePayments-settings' ); + $to = $opt['send_email_on_error_to']; + $from = $opt['from_email_address']; + $headers = 'From: ' . $from . "\r\n"; + $subj = __( 'Stripe Payments Error Details', 'stripe-payments' ); + + //Add a general note to the error email adding more explanation to the site admin as to what this error email means. + $general_note_for_error_email = __( 'Note: It is normal for transaction errors like this to happen. For example - if a customer enters an incorrect card number or an expired card details, it will trigger an error.', 'stripe-payments' ) . "\r\n"; + $general_note_for_error_email .= __( 'The customer will be requested to enter valid details for the transaction to proceed.', 'stripe-payments' ) . "\r\n"; + $general_note_for_error_email .= __( 'This email contains some raw transaction data just for the site admin to be aware of the incident.', 'stripe-payments' ) . "\r\n"; + $general_note_for_error_email .= '-----' . "\r\n\r\n"; + + $body = $general_note_for_error_email . $body; + + $schedule_result = ASP_Utils::mail( $to, $subj, $body, $headers, true ); + ASP_Debug_Logger::log( 'Error email sent to ' . $to . ', from email address used: ' . $from ); + } + + public static function send_daily_txn_rate_limit_email($body) { + $admin_email = get_option( 'admin_email' ); + $opt = get_option( 'AcceptStripePayments-settings' ); + + $to = $admin_email; + if($opt['send_email_on_daily_txn_rate_limit_to']) { + $to = $opt['send_email_on_daily_txn_rate_limit_to']; + } + + ASP_Debug_Logger::log("To email address is: ".$to); + + $from = $opt['from_email_address']; + $headers = 'From: ' . $from . "\r\n"; + $subj = __( 'Daily transaction rate limit reached for the Accept Stripe Payments plugin', 'stripe-payments' ); + + //Add a general note to the error email adding more explanation to the site admin as to what this error email means. + $general_note_for_error_email = ""; + $general_note_for_error_email .= "\r\n\r\n" . '-----' . "\r\n\r\n"; + $general_note_for_error_email .= __( 'Note: If you are not using any captcha option in the plugin then it uses a daily transaction limit functionality to limit a bot trying to do excessive card testing transactions on your site. This should allow you to look into the issue and make any necessary adjustments.', 'stripe-payments' ) . "\r\n\r\n"; + $general_note_for_error_email .= __( 'You can adjust the daily transaction limit in the captcha settings menu of the plugin.', 'stripe-payments' ) . "\r\n"; + $general_note_for_error_email .= __( 'You can remove this daily transaction limit by enabling a captcha option from the Accept Stripe Payment\'s settings menu.', 'stripe-payments' ) . "\r\n\r\n"; + $general_note_for_error_email .= __( 'If you need further help on this matter, please feel free to contact us using our website:', 'stripe-payments' ) . "\r\n"; + $general_note_for_error_email .= 'https://s-plugins.com/contact-us/' . "\r\n"; + + $body = $body . $general_note_for_error_email; + + $schedule_result = ASP_Utils::mail( $to, $subj, $body, $headers, true ); + ASP_Debug_Logger::log( 'Daily transaction rate limit email sent to ' . $to . ', from email address used: ' . $from ); + } + + public static function get_small_product_thumb( $prod_id, $force_regen = false ) { + $ret = ''; + //check if we have a thumbnail + $curr_thumb = get_post_meta( $prod_id, 'asp_product_thumbnail', true ); + if ( empty( $curr_thumb ) ) { + return $ret; + } + $ret = $curr_thumb; + //check if we have 100x100 preview generated + $thumb_thumb = get_post_meta( $prod_id, 'asp_product_thumbnail_thumb', true ); + if ( empty( $thumb_thumb ) || $force_regen ) { + //looks like we don't have one. Let's generate it + $thumb_thumb = ''; + $image = wp_get_image_editor( $curr_thumb ); + if ( ! is_wp_error( $image ) ) { + $image->resize( 100, 100, true ); + $upload_dir = wp_upload_dir(); + $ext = pathinfo( $curr_thumb, PATHINFO_EXTENSION ); + $file_name = 'asp_product_' . $prod_id . '_thumb_' . md5( $curr_thumb ) . '.' . $ext; + $res = $image->save( $upload_dir['path'] . '/' . $file_name ); + if ( ! is_wp_error( $res ) ) { + $thumb_thumb = $upload_dir['url'] . '/' . $file_name; + } else { + //error saving thumb image + return $ret; + } + } else { + //error occurred during image load + return $ret; + } + update_post_meta( $prod_id, 'asp_product_thumbnail_thumb', $thumb_thumb ); + $ret = $thumb_thumb; + } else { + // we have one. Let's return it + $ret = $thumb_thumb; + } + if ( is_ssl() ) { + $ret = self::url_to_https( $ret ); + } + return $ret; + } + + public static function formatted_price( $price, $curr = '', $price_is_cents = false ) { + if ( empty( $price ) ) { + $price = 0; + } + + $opts = get_option( 'AcceptStripePayments-settings' ); + + if ( false === $curr ) { + //if curr set to false, we format price without currency symbol or code + $curr_sym = ''; + } else { + + if ( '' === $curr ) { + //if currency not specified, let's use default currency set in options + $curr = $opts['currency_code']; + } + + $curr = strtoupper( $curr ); + + $currencies = self::get_currencies(); + if ( isset( $currencies[ $curr ] ) ) { + $curr_sym = sanitize_text_field( $currencies[ $curr ][1] ); + } else { + //no currency code found, let's just use currency code instead of symbol + $curr_sym = $curr; + } + } + + //check if price is in cents + if ( $price_is_cents && ! AcceptStripePayments::is_zero_cents( $curr ) ) { + $price = intval( $price ) / 100; + } + + $out = number_format( $price, $opts['price_decimals_num'], $opts['price_decimal_sep'], $opts['price_thousand_sep'] ); + + switch ( $opts['price_currency_pos'] ) { + case 'left': + $out = $curr_sym . '' . $out; + break; + case 'right': + $out .= '' . $curr_sym; + break; + case 'left-with-space': + $out = $curr_sym . ' ' . $out; + break; + case 'right-with-space': + $out .= ' ' . $curr_sym; + break; + default: + $out .= '' . $curr_sym; + break; + } + + return $out; + } + + public static function get_visitor_preferred_lang() { + $langs = array(); + preg_match_all( '~([\w-]+)(?:[^,\d]+([\d.]+))?~', strtolower( $_SERVER['HTTP_ACCEPT_LANGUAGE'] ), $matches, PREG_SET_ORDER ); + foreach ( $matches as $match ) { + + list($a, $b) = explode( '-', $match[1] ) + array( '', '' ); + $value = isset( $match[2] ) ? (float) $match[2] : 1.0; + + $langs[ $match[1] ] = $value; + + $langs[ $a ] = $value - 0.1; + } + arsort( $langs ); + + if ( empty( $langs ) ) { + return ''; + } + + reset( $langs ); + $lang = key( $langs ); + + if ( strlen( $lang ) < 2 && strlen( $lang ) > 6 ) { + return ''; + } + + if ( strlen( $lang ) >= 5 ) { + $lang_parts = explode( '-', $lang ); + if ( 2 === count( $lang_parts ) ) { + $lang = $lang_parts[0] . '_' . strtoupper( $lang_parts[1] ); + } + } + + return $lang; + } + + public static function load_custom_lang( $lang ) { + global $l10n; + $textdomain = 'stripe-payments'; + + if ( isset( $l10n[ $textdomain ] ) ) { + self::$textdomain_backup = $l10n[ $textdomain ]; + } + + $mo_file = ''; + + foreach ( self::$textdomain_paths as $path ) { + if ( file_exists( $path . $textdomain . '-' . $lang . '.mo' ) ) { + $mo_file = $path . $textdomain . '-' . $lang . '.mo'; + break; + } + } + + if ( empty( $mo_file ) ) { + return; + } + + load_textdomain( $textdomain, $mo_file ); + } + + public static function set_custom_lang_if_needed() { + $asp_class = AcceptStripePayments::get_instance(); + $lang = $asp_class->get_setting( 'checkout_lang' ); + + if ( empty( $lang ) ) { + $lang = self::get_visitor_preferred_lang(); + } else { + if ( isset( self::$lang_code_locale[ $lang ] ) ) { + $lang = self::$lang_code_locale[ $lang ]; + } + } + + self::load_custom_lang( $lang ); + } + + public static function use_internal_api() { + $asp_class = AcceptStripePayments::get_instance(); + $dont_use_stripe_php_sdk = $asp_class->get_setting( 'dont_use_stripe_php_sdk' ); + + if ( $dont_use_stripe_php_sdk ) { + return true; + } + return false; + } + + public static function load_stripe_lib() { + if ( ! class_exists( '\Stripe\Stripe' ) ) { + require_once WP_ASP_PLUGIN_PATH . 'includes/stripe/init.php'; + \Stripe\Stripe::setAppInfo( 'Stripe Payments', WP_ASP_PLUGIN_VERSION, 'https://wordpress.org/plugins/stripe-payments/', 'pp_partner_Fvas9OJ0jQ2oNQ' ); + \Stripe\Stripe::setApiVersion( ASPMain::$stripe_api_ver ); + } else { + $declared = new \ReflectionClass( '\Stripe\Stripe' ); + $path = $declared->getFileName(); + $own_path = WP_ASP_PLUGIN_PATH . 'includes/stripe/lib/Stripe.php'; + if ( strtolower( $path ) !== strtolower( $own_path ) ) { + // Stripe library is loaded from other location + // Let's only log one warning per 6 hours in order to not flood the log + $lib_warning_last_logged_time = get_option( 'asp_lib_warning_last_logged_time' ); + $time = time(); + if ( $time - ( 60 * 60 * 6 ) > $lib_warning_last_logged_time ) { + $opts = get_option( 'AcceptStripePayments-settings' ); + if ( $opts['debug_log_enable'] ) { + ASP_Debug_Logger::log( sprintf( "WARNING: Stripe PHP library conflict! Another Stripe PHP SDK library is being used. Please disable plugin or theme that provides it as it can cause issues during payment process.\r\nLibrary path: %s", $path ) ); + update_option( 'asp_lib_warning_last_logged_time', $time ); + } + } + } + } + } + + //Fix for incomplete_class when unserializing the charge object saved in order_data + //If dont_use_stripe_php_sdk (Advance -> Experimental section) checkbox is unchecked. + public static function load_stripe_php_sdk_if_enabled() { + try { + if ( ! self::use_internal_api() ) { + //The 'dont_use_stripe_php_sdk' is unchecked. Load the stripe PHP SDK. + //So the retrieved order object can read the "Stripe" classes correctly. + ASP_Utils::load_stripe_lib(); + } + } catch ( \Throwable $e ) { + // handle error if needed + } + } + + public static function gen_help_popup( $contents ) { + return '
' . $contents . '
'; + } + + private static function generate_ckey() { + return md5( uniqid() ); + } + + public static function get_ckey( $regen = false ) { + $ckey = get_option( 'asp_cache_key' ); + + if ( empty( $ckey ) || $regen ) { + $ckey = self::generate_ckey(); + update_option( 'asp_cache_key', $ckey ); + } + return $ckey; + + } + + public static function url_to_https( $url ) { + return preg_replace( '/^http:\/\//i', 'https://', $url ); + } + + public static function get_visitor_token( $str = '' ) { + $ua = ! empty( $_SERVER['HTTP_USER_AGENT'] ) ? sanitize_text_field( $_SERVER['HTTP_USER_AGENT'] ) : ''; + + return md5( $ua . $str ); + } + + public static function clear_external_caches() { + //WP Rocket + if ( function_exists( 'rocket_clean_domain' ) ) { + rocket_clean_domain(); + } + + // wp-super-cache + if ( function_exists( 'wp_cache_clear_cache' ) ) { + wp_cache_clear_cache(); + } + + // WPEngine + if ( class_exists( 'WpeCommon' ) ) { + WpeCommon::purge_memcached(); + WpeCommon::clear_maxcdn_cache(); + WpeCommon::purge_varnish_cache(); + } + + // W3 Total Cache + if ( function_exists( 'w3tc_pgcache_flush' ) ) { + w3tc_pgcache_flush(); + } + + // SG Optimizer + if ( function_exists( 'sg_cachepress_purge_cache' ) ) { + sg_cachepress_purge_cache(); + } + + do_action( 'asp_clear_external_caches' ); + } + + public static function get_base_pp_url() { + $base_url = ''; + $structure = get_option( 'permalink_structure' ); + if ( empty( $structure ) ) { + $home_url = get_home_url( null, '/' ); + $base_url = add_query_arg( + array( + 'asp_action' => 'show_pp', + ), + $home_url + ); + } else { + $base_url = get_home_url( null, AcceptStripePayments::$pp_slug . '/' ); + } + return $base_url; + } + + /** + * Returns Stripe account info + * + * Since 2.0.47 + * @return mixed + */ + public static function get_stripe_acc_info() { + $acc_info = false; + + $asp_main = AcceptStripePayments::get_instance(); + + $key = $asp_main->is_live ? $asp_main->APISecKey : $asp_main->APISecKeyTest; + + try { + + if ( self::use_internal_api() ) { + $api = ASP_Stripe_API::get_instance(); + $api->set_api_key( $key ); + $api->set_param( 'throw_exception', true ); + + $acc_info = $api->get( 'account' ); + } else { + + ASP_Utils::load_stripe_lib(); + \Stripe\Stripe::setApiKey( $key ); + + $acc_info = \Stripe\Account::retrieve(); + } + } catch ( \Throwable $e ) { + // handle error if needed + } + + return $acc_info; + } + + public static function get_tax_variations_tax( $tax_var, $country, $state, $city ) { + $tax = 0; + if ( empty( $tax_var ) ) { + return false; + } + + foreach ( $tax_var as $v ) { + switch ( $v['type'] ) { + case '0': + if ( $country === $v['loc'] ) { + $tax = $tax + $v['amount']; + } + break; + case '1': + if ( $state === $v['loc'] ) { + $tax = $tax + $v['amount']; + } + break; + case '2': + if ( $city === $v['loc'] ) { + $tax = $tax + $v['amount']; + } + break; + default: + break; + + } + } + + return ! empty( $tax ) ? $tax : false; + } + + /* + * Useful for using with wp_kses() function. + * See also ASP_Utils::asp_allowed_tags_expanded() + */ + public static function asp_allowed_tags() { + $my_allowed = wp_kses_allowed_html( 'post' ); + + // form fields - input + $my_allowed['input'] = array( + 'class' => array(), + 'id' => array(), + 'name' => array(), + 'value' => array(), + 'type' => array(), + 'step' => array(), + 'min' => array(), + 'checked' => array(), + 'size' => array(), + 'readonly' => array(), + 'style' => array(), + 'placeholder' => array(), + 'required' => array(), + 'data-asp-variations-group-id' => array(), + 'data-asp-custom-mandatory' => array(), + ); + // select + $my_allowed['select'] = array( + 'class' => array(), + 'id' => array(), + 'name' => array(), + 'value' => array(), + 'type' => array(), + 'placeholder' => array(), + 'required' => array(), + 'data-asp-variations-group-id' => array(), + 'data-asp-custom-mandatory' => array(), + ); + // select options + $my_allowed['option'] = array( + 'selected' => array(), + 'value' => array(), + 'data-asp-curr-sym' => array(), + ); + // button + $my_allowed['button'] = array( + 'type' => array(), + 'class' => array(), + 'id' => array(), + 'style' => array(), + ); + // style + $my_allowed['style'] = array( + 'types' => array(), + ); + + return $my_allowed; + } + + /* + * Useful for using with wp_kses() function. + */ + public static function asp_allowed_tags_expanded() { + $my_allowed = ASP_Utils::asp_allowed_tags(); + + //Expanded allowed button tags + if( isset( $my_allowed['button'] ) && is_array( $my_allowed['button'] ) ){ + $button_extra = array( + 'data-hook-mode' => array(), + ); + $my_allowed['button'] = array_merge( $my_allowed['button'] , $button_extra); + } + + // iframe + $my_allowed['iframe'] = array( + 'src' => array(), + 'height' => array(), + 'width' => array(), + 'frameborder' => array(), + 'allowfullscreen' => array(), + ); + + // allow for some inline jquery + $my_allowed['script'] = array(); + + return $my_allowed; + } + + public static function asp_allowed_tags_for_svg() { + $kses_defaults = wp_kses_allowed_html( 'post' ); + + $svg_args = array( + 'svg' => array( + 'id' => true, + 'class' => true, + 'aria-hidden' => true, + 'aria-labelledby' => true, + 'role' => true, + 'xmlns' => true, + 'xmlns:xlink' => true, + 'width' => true, + 'height' => true, + 'viewbox' => true, + 'fill' => true, + 'stroke' => true, + 'stroke-linecap' => true, + 'stroke-linejoin' => true, + 'stroke-width' => true, + ), + 'g' => array( 'fill' => true ), + 'title' => array( 'title' => true ), + 'path' => array( + 'd' => true, + 'fill' => true, + ), + ); + return array_merge( $kses_defaults, $svg_args ); + } + + public static function get_user_ip_address() { + $user_ip = ''; + if ( isset( $_SERVER['HTTP_X_FORWARDED_FOR'] ) && ! empty( $_SERVER['HTTP_X_FORWARDED_FOR'] ) ) { + $user_ip = sanitize_text_field( $_SERVER['HTTP_X_FORWARDED_FOR'] ); + } else { + $user_ip = sanitize_text_field( $_SERVER['REMOTE_ADDR'] ); + } + + if ( strstr( $user_ip, ',' ) ) { + $ip_values = explode( ',', $user_ip ); + $user_ip = $ip_values['0']; + } + + return apply_filters( 'asp_get_user_ip_address', $user_ip ); + } + + /** + * Get the currently logged in user/member basic info. + * First it checks if WP user is logged in. + * Otherwise take the info of SWPM or WP eMember plugins (if logged-in). + * + * @return array Returns user info if available, empty array otherwise. + */ + public static function get_logged_in_user_info(){ + $user_info = array(); + + // Check if logged in as a WP user. + if( is_user_logged_in() ){ + $wp_user = wp_get_current_user(); + if( $wp_user->exists() ){ + $user_info = array( + 'id' => $wp_user->get('ID'), + 'username' => $wp_user->get('user_login'), + 'type' => 'wp-user' + ); + } + } else if (class_exists('SwpmAuth')) { + // Check if logged in as SWPM member + $swpm_auth = SwpmAuth::get_instance(); + if ( $swpm_auth->is_logged_in() ) { + $user_info = array( + 'id' => $swpm_auth->get( 'member_id' ), + 'username' => $swpm_auth->get( 'user_name' ), + 'type' => 'simple-membership' + ); + } + } else if (class_exists('Emember_Auth') ) { + // Check if logged in as WP eMember member + $emember_auth = Emember_Auth::getInstance(); + if ( $emember_auth->isLoggedIn() ) { + $user_info = array( + 'id' => $emember_auth->getUserInfo('member_id'), + 'username' => $emember_auth->getUserInfo('user_name'), + 'type' => 'wp-emember' + ); + } + } + + $user_info = apply_filters( 'asp_get_logged_in_user_info', $user_info ); + return $user_info; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/class-asp.php b/wp-content/plugins/stripe-payments/includes/class-asp.php new file mode 100644 index 0000000..d13530b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/class-asp.php @@ -0,0 +1,678 @@ + 50, + 'AUD' => 50, + 'BGN' => 100, + 'BRL' => 50, + 'CAD' => 50, + 'CHF' => 50, + 'COP' => 2000, + 'DKK' => 250, + 'EUR' => 50, + 'GBP' => 30, + 'HKD' => 400, + 'INR' => 50, + 'JPY' => 50, + 'MXN' => 1000, + 'MYR' => 200, + 'NOK' => 300, + 'NZD' => 50, + 'PLN' => 200, + 'RON' => 200, + 'SEK' => 300, + 'SGD' => 50, + 'AED' => 200, + ); + public $APISecKey = ''; + public $APIPubKey = ''; + public $APIPubKeyTest = ''; + public $APIPubKeyLive = ''; + public $APISecKeyTest = ''; + public $APISecKeyLive = ''; + public $is_live = false; + + public static $pp_slug = 'asp-payment-box'; + + /** + * Plugin version, used for cache-busting of style and script file references. + * + * @since 1.0.0 + * + * @var string + */ + const VERSION = '1.0.0'; + + /** + * + * Unique identifier for your plugin. + * + * The variable name is used as the text domain when internationalizing strings + * of text. Its value should match the Text Domain file header in the main + * plugin file. + * + * @since 1.0.0 + * + * @var string + */ + protected $plugin_slug = 'accept_stripe_payment'; //Do not change this value. + + /** + * Instance of this class. + * + * @since 1.0.0 + * + * @var object + */ + protected static $instance = null; + private $settings = null; + + /** + * Initialize the plugin by setting localization and loading public scripts + * and styles. + * + * @since 1.0.0 + */ + private function __construct() { + + self::$instance = $this; + + add_action( 'asp_send_scheduled_email', array( $this, 'send_scheduled_email' ), 10, 4 ); + + if ( is_admin() ) { + if ( ! function_exists( 'is_plugin_active' ) ) { + require_once ABSPATH . '/wp-admin/includes/plugin.php'; + } + if ( is_plugin_active( 'stripe-payments-recaptcha/asp-recaptcha-main.php' ) ) { + deactivate_plugins( 'stripe-payments-recaptcha/asp-recaptcha-main.php' ); + } + } + if ( ! class_exists( 'ASP_RECAPTCHA_Main' ) ) { + require_once WP_ASP_PLUGIN_PATH . 'includes/recaptcha/asp-recaptcha-main.php'; + } + + require_once WP_ASP_PLUGIN_PATH . 'includes/eprecaptcha/asp-eprecaptcha-main.php'; + + require_once WP_ASP_PLUGIN_PATH . 'includes/hcaptcha/asp-hcaptcha-main.php'; + + $this->settings = (array) get_option( 'AcceptStripePayments-settings' ); + + if ( $this->get_setting( 'is_live' ) == 0 ) { + //use test keys + $this->is_live = false; + $this->APIPubKey = $this->get_setting( 'api_publishable_key_test' ); + $this->APISecKey = $this->get_setting( 'api_secret_key_test' ); + } else { + //use live keys + $this->is_live = true; + $this->APIPubKey = $this->get_setting( 'api_publishable_key' ); + $this->APISecKey = $this->get_setting( 'api_secret_key' ); + } + $this->APIPubKeyTest = $this->get_setting( 'api_publishable_key_test' ); + $this->APIPubKeyLive = $this->get_setting( 'api_publishable_key' ); + $this->APISecKeyTest = $this->get_setting( 'api_secret_key_test' ); + $this->APISecKeyLive = $this->get_setting( 'api_secret_key' ); + + // Load plugin text domain + add_action( 'init', array( $this, 'load_asp_plugin_textdomain' ) ); + + add_action( 'plugins_loaded', array( $this, 'plugins_loaded' ) ); + + //Can be used to override some of the safe styles allowed in wp_kses function. + add_filter( 'safe_style_css', array( $this, 'customize_safe_style_css' ) ); + + //handle self hooks + require_once WP_ASP_PLUGIN_PATH . 'includes/class-asp-self-hooks-handler.php'; + + //handle IPN stuff if needed + require_once WP_ASP_PLUGIN_PATH . 'includes/process_ipn.php'; + require_once WP_ASP_PLUGIN_PATH . 'includes/class-asp-process-ipn-ng.php'; + + //handle payment popup display if needed + require_once WP_ASP_PLUGIN_PATH . 'includes/class-asp-pp-display.php'; + + //handle payment popup ajax + require_once WP_ASP_PLUGIN_PATH . 'includes/class-asp-pp-ajax.php'; + + // SWPM integration + require_once WP_ASP_PLUGIN_PATH . 'includes/integrations/class-asp-swpm-integrations.php'; + + // Activate plugin when new blog is added + add_action( 'wpmu_new_blog', array( $this, 'activate_new_site' ) ); + + // Load public-facing style sheet and JavaScript. + // add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_styles' ) ); + add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_frontend_scripts_styles' ) ); + add_action( 'after_switch_theme', array( $this, 'rewrite_flush' ) ); + } + + public function plugins_loaded() { + //check if we have view_log request with token + $action = isset( $_GET['asp_action'] ) ? sanitize_text_field( stripslashes ( $_GET['asp_action'] ) ) : ''; + $token = isset( $_GET['token'] ) ? sanitize_text_field( stripslashes ( $_GET['token'] ) ) : ''; + if ( isset( $action ) && 'view_log' === $action && isset( $token ) ) { + //let's check token + if ( $this->get_setting( 'debug_log_link_enable', false ) && $this->get_setting( 'debug_log_access_token' ) === $token ) { + ASP_Debug_Logger::view_log(); + } + } + + if ( ! is_admin() ) { + add_action( 'wp_print_footer_scripts', array( $this, 'frontend_print_footer_scripts' ) ); + } + } + + public function customize_safe_style_css( $styles ) { + $styles[] = 'display'; + return $styles; + } + + public function send_scheduled_email( $to, $subj, $body, $headers ) { + ASP_Debug_Logger::log( sprintf( 'Sending scheduled email to %s.', $to ) ); + wp_mail( $to, $subj, $body, $headers ); + } + + public function get_setting( $field, $default = false ) { + $this->settings = (array) get_option( 'AcceptStripePayments-settings' ); + return isset( $this->settings[ $field ] ) ? $this->settings[ $field ] : $default; + } + + /** + * Return the plugin slug. + * + * @since 1.0.0 + * + * @return Plugin slug variable. + */ + public function get_plugin_slug() { + return $this->plugin_slug; + } + + /** + * Return an instance of this class. + * + * @since 1.0.0 + * + * @return object A single instance of this class. + */ + public static function get_instance() { + // If the single instance hasn't been set, set it now. + if ( null === self::$instance ) { + self::$instance = new self(); + } + + return self::$instance; + } + + /** + * Fired when the plugin is activated. + * + * @since 1.0.0 + * + * @param boolean $network_wide True if WPMU superadmin uses + * "Network Activate" action, false if + * WPMU is disabled or plugin is + * activated on an individual blog. + */ + public static function activate( $network_wide ) { + + if ( function_exists( 'is_multisite' ) && is_multisite() ) { + + if ( $network_wide ) { + + // Get all blog ids + $blog_ids = self::get_blog_ids(); + + foreach ( $blog_ids as $blog_id ) { + switch_to_blog( $blog_id ); + self::single_activate(); + } + + restore_current_blog(); + } else { + self::single_activate(); + } + } else { + self::single_activate(); + } + } + + /** + * Fired when the plugin is deactivated. + * + * @since 1.0.0 + * + * @param boolean $network_wide True if WPMU superadmin uses + * "Network Deactivate" action, false if + * WPMU is disabled or plugin is + * deactivated on an individual blog. + */ + public static function deactivate( $network_wide ) { + + if ( function_exists( 'is_multisite' ) && is_multisite() ) { + + if ( $network_wide ) { + + // Get all blog ids + $blog_ids = self::get_blog_ids(); + + foreach ( $blog_ids as $blog_id ) { + + switch_to_blog( $blog_id ); + self::single_deactivate(); + } + + restore_current_blog(); + } else { + self::single_deactivate(); + } + } else { + self::single_deactivate(); + } + } + + /** + * Fired when a new site is activated with a WPMU environment. + * + * @since 1.0.0 + * + * @param int $blog_id ID of the new blog. + */ + public function activate_new_site( $blog_id ) { + + if ( 1 !== did_action( 'wpmu_new_blog' ) ) { + return; + } + + switch_to_blog( $blog_id ); + self::single_activate(); + restore_current_blog(); + } + + /** + * Get all blog ids of blogs in the current network that are: + * - not archived + * - not spam + * - not deleted + * + * @since 1.0.0 + * + * @return array|false The blog ids, false if no matches. + */ + private static function get_blog_ids() { + global $wpdb; + + return $wpdb->get_col( + "SELECT blog_id FROM $wpdb->blogs + WHERE archived = '0' AND spam = '0' + AND deleted = '0'" + ); + } + + /** + * Fired for each blog when the plugin is activated. + * + * @since 1.0.0 + */ + private static function single_activate() { + $admin_email = get_option( 'admin_email' ); + if ( ! $admin_email ) { + $admin_email = ''; + } + + //Generate (if one doesn't exist) and save a private key for hashing purpose + $hp_key = get_option( 'asp_hash_private_key_one' ); + if ( empty( $hp_key ) ) { + $hp_key = uniqid( '', true ); + update_option( 'asp_hash_private_key_one', $hp_key ); + } + + //Default settings values + $default = array( + 'is_live' => 0, + 'debug_log_enable' => 0, + 'dont_save_card' => 0, + 'currency_code' => 'USD', + 'button_text' => __( 'Buy Now', 'stripe-payments' ), + // translators: %s is not a placeholder + 'popup_button_text' => __( 'Pay %s', 'stripe-payments' ), + 'use_new_button_method' => 0, + 'checkout_url' => site_url( 'checkout' ), + 'from_email_address' => get_bloginfo( 'name' ) . ' ', + 'buyer_email_subject' => __( 'Thank you for the purchase', 'stripe-payments' ), + 'buyer_email_body' => __( 'Hello', 'stripe-payments' ) . "\r\n\r\n" + . __( 'Thank you for your purchase! You ordered the following item(s):', 'stripe-payments' ) . "\r\n\r\n" + . '{product_details}', + 'seller_notification_email' => get_bloginfo( 'admin_email' ), + 'seller_email_subject' => __( 'Notification of product sale', 'stripe-payments' ), + 'seller_email_body' => __( 'Dear Seller', 'stripe-payments' ) . "\r\n\r\n" + . __( 'This mail is to notify you of a product sale.', 'stripe-payments' ) . "\r\n\r\n" + . "{product_details}\r\n\r\n" + . __( 'The sale was made to', 'stripe-payments' ) . " {payer_email}\r\n\r\n" + . __( 'Thanks', 'stripe-payments' ), + 'price_currency_pos' => 'left', + 'price_decimal_sep' => '.', + 'price_thousand_sep' => ',', + 'price_decimals_num' => '2', + 'api_keys_separated' => true, + 'stripe_receipt_email' => 0, + 'custom_field_enabled' => 0, + 'custom_field_name' => '', + 'custom_field_descr' => '', + 'custom_field_type' => 'text', + 'custom_field_mandatory' => 0, + 'send_email_on_error' => 0, + 'send_email_on_error_to' => $admin_email, + 'send_email_on_daily_txn_rate_limit' => 1, + 'send_email_on_daily_txn_rate_limit_to' => $admin_email, + 'use_old_checkout_api1' => 0, + 'disable_buttons_before_js_loads' => 0, + 'tos_text' => __( 'I accept the Terms and Conditions', 'stripe-payments' ), + 'daily_txn_limit_without_captcha' => 25, + 'daily_txn_limit_with_captcha' => 100 + ); + $opt = get_option( 'AcceptStripePayments-settings' ); + // Check if its a first install + $first_install = false; + if ( ! is_array( $opt ) ) { + //this is first install + $first_install = true; + $opt = $default; + } + $opt = array_merge( $default, $opt ); + //force remove PHP warning dismissal + delete_option( 'wp_asp_php_warning_dismissed' ); + update_option( 'AcceptStripePayments-settings', $opt ); + + //lets add default values for some settings that were added after plugin update + //let's separate Test and Live API keys (introduced in version 1.6.6) + if ( $opt['is_live'] == 0 && ! isset( $opt['api_keys_separated'] ) ) { + //current keys are test keys. Let's set them and clear the old values + if ( isset( $opt['api_secret_key'] ) ) { + $opt['api_secret_key_test'] = $opt['api_secret_key']; + $opt['api_secret_key'] = ''; + } + if ( isset( $opt['api_publishable_key'] ) ) { + $opt['api_publishable_key_test'] = $opt['api_publishable_key']; + $opt['api_publishable_key'] = ''; + } + //let's also set an indicator value in order for the plugin to not do that anymore + $opt['api_keys_separated'] = true; + } + + //Enabled "Hide State Field" for existing installs, but only if wasn't set before + if ( ! $first_install && ! isset( $opt['hide_state_field'] ) ) { + $opt['hide_state_field'] = 1; + } + + // 2.0.53: convert old `recaptcha_enabled` option to `captcha_type` if needed + if ( ! empty( $opt['recaptcha_enabled'] ) ) { + $opt['captcha_type'] = 'recaptcha'; + $opt['recaptcha_enabled'] = 0; + } + + $opt_diff = array_diff_key( $default, $opt ); + if ( ! empty( $opt_diff ) ) { + foreach ( $opt_diff as $key => $value ) { + $opt[ $key ] = $default[ $key ]; + } + } + + update_option( 'AcceptStripePayments-settings', $opt ); + + //create checkout page + $args = array( + 'post_type' => 'page', + ); + $pages = get_pages( $args ); + $checkout_page_id = ''; + foreach ( $pages as $page ) { + if ( strpos( $page->post_content, 'accept_stripe_payment_checkout' ) !== false ) { + $checkout_page_id = $page->ID; + } + } + if ( '' === $checkout_page_id ) { + $checkout_page_id = self::create_post( 'page', 'Checkout-Result', 'Stripe-Checkout-Result', '[accept_stripe_payment_checkout]' ); + $checkout_page = get_post( $checkout_page_id ); + $checkout_page_url = $checkout_page->guid; + $asp_settings = get_option( 'AcceptStripePayments-settings' ); + if ( ! empty( $asp_settings ) ) { + $asp_settings['checkout_url'] = $checkout_page_url; + $asp_settings['checkout_page_id'] = $checkout_page_id; + update_option( 'AcceptStripePayments-settings', $asp_settings ); + } + } + + //Create all products/shop page + $args = array( + 'post_type' => 'page', + ); + $pages = get_pages( $args ); + $products_page_id = ''; + foreach ( $pages as $page ) { + if ( strpos( $page->post_content, '[asp_show_all_products' ) !== false ) { + $products_page_id = $page->ID; + } + } + if ( '' === $products_page_id ) { + $products_page_id = self::create_post( 'page', 'Products', 'Products', '[asp_show_all_products]' ); + + //Save the newly created products page ID so it can be used later. + $asp_settings = get_option( 'AcceptStripePayments-settings' ); + if ( ! empty( $asp_settings ) ) { + $asp_settings['products_page_id'] = $products_page_id; + update_option( 'AcceptStripePayments-settings', $asp_settings ); + } + } + //Flush rewrite rules so new pages and slugs are properly handled + $asp_products = ASP_Admin_Products::get_instance(); + $asp_products->register_post_type(); + $asp_order = ASPOrder::get_instance(); + $asp_order->register_post_type(); + flush_rewrite_rules(); + } + + public static function create_post( $post_type, $title, $name, $content, $parent_id = null ) { + $post = array( + 'post_title' => $title, + 'post_name' => $name, + 'comment_status' => 'closed', + 'ping_status' => 'closed', + 'post_content' => $content, + 'post_status' => 'publish', + 'post_type' => $post_type, + ); + + if ( null !== $parent_id ) { + $post['post_parent'] = $parent_id; + } + $post_id = wp_insert_post( $post ); + return $post_id; + } + + /** + * Fired for each blog when the plugin is deactivated. + */ + private static function single_deactivate() { + // @TODO: Define deactivation functionality here + } + + /** + * Load the plugin text domain for translation. + */ + public function load_asp_plugin_textdomain() { + load_plugin_textdomain( 'stripe-payments', false, dirname( plugin_basename( ASPMain::$file ) ) . '/languages/' ); + } + + /** + * @since 1.0.0 + */ + public function rewrite_flush() { + flush_rewrite_rules(); + } + + public static function get_currencies() { + $currencies = ASP_Utils::get_currencies(); + return $currencies; + } + + /** + * Use ASP_Utils::formatted_price() instead. + */ + public static function formatted_price( $price, $curr = '', $price_is_cents = false ) { + return ASP_Utils::formatted_price( $price, $curr, $price_is_cents ); + } + + public static function apply_tax( $price, $tax, $is_zero_cents = false ) { + if ( ! empty( $tax ) ) { + $prec = 2; + if ( $is_zero_cents ) { + $prec = 0; + } + $tax_amount = round( ( $price * $tax / 100 ), $prec ); + $price += $tax_amount; + } + return $price; + } + + public static function apply_shipping( $price, $shipping, $is_zero_cents = false ) { + if ( ! empty( $shipping ) ) { + $prec = 2; + if ( $is_zero_cents ) { + $prec = 0; + } + $price += floatval( $shipping ); + $price = round( $price, $prec ); + } + return $price; + } + + public static function get_tax_amount( $price, $tax, $is_zero_cents = false ) { + if ( ! empty( $tax ) ) { + $prec = 2; + if ( $is_zero_cents ) { + $prec = 0; + } + $tax_amount = round( ( $price * $tax / 100 ), $prec ); + return $tax_amount; + } else { + return 0; + } + } + + public static function is_zero_cents( $curr ) { + $zero_cents = array( 'JPY', 'MGA', 'VND', 'KRW' ); + return in_array( strtoupper( $curr ), $zero_cents, true ); + } + + public static function from_cents( $amount, $currency ) { + $prec = 2; + if ( self::is_zero_cents( $currency ) ) { + $prec = 0; + } + $res = round( $amount / 100, $prec ); + return $res; + } + + /* + * Generates additional items string for the email body. + * It can be used to display variation data, shipping, tax etc. + */ + public static function gen_additional_items( $data, $sep = "\n" ) { + $out = ''; + //Debug logging purposes only. + //ASP_Debug_Logger::log_array_data($data['additional_items'], true); + /* + Example of $data['additional_items'] array: + Array + ( + [Size - Medium] => 5 + [Download Link - High Res] => 0 + [Gift Wrapping - Yes] => 5 + [Tax] => 3 + [Shipping] => 15 + ) + */ + if ( ! empty( $data['additional_items'] ) ) { + foreach ( $data['additional_items'] as $item => $price ) { + if ( $price < 0 ) { + $amnt_str = '-' . self::formatted_price( abs( $price ), $data['currency_code'] ); + } else { + $amnt_str = self::formatted_price( $price, $data['currency_code'] ); + } + //Debug logging purposes only + //ASP_Debug_Logger::log( sprintf( 'Additional item: %s, amount: %s', $item, $amnt_str ) ); + //Example output: Additional item: Size - Medium, amount: $5.00 + + //Apply filter to allow changing the additional items data line. + $additional_items_data_line = apply_filters( 'asp_additional_items_individual_item', $item) . ': ' . $amnt_str . $sep; + $filtered_additional_items_data_line = apply_filters( 'asp_additional_items_data_line', $additional_items_data_line, $data ); + $out .= $filtered_additional_items_data_line; + } + } + return $out; + } + + public static function tofloat( $num ) { + $dot_pos = strrpos( $num, '.' ); + $comma_pos = strrpos( $num, ',' ); + $sep = ( ( $dot_pos > $comma_pos ) && $dot_pos ) ? $dot_pos : ( ( ( $comma_pos > $dot_pos ) && $comma_pos ) ? $comma_pos : false ); + + if ( ! $sep ) { + return floatval( preg_replace( '/[^0-9]/', '', $num ) ); + } + + return floatval( + preg_replace( '/[^0-9]/', '', substr( $num, 0, $sep ) ) . '.' . + preg_replace( '/[^0-9]/', '', substr( $num, $sep + 1, strlen( $num ) ) ) + ); + } + + public function enqueue_frontend_scripts_styles() { + wp_register_script( 'stripe-handler-ng', WP_ASP_PLUGIN_URL . '/public/assets/js/stripe-handler-ng.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + + $iframe_url = ASP_Utils::get_base_pp_url(); + + $prefetch = $this->get_setting( 'frontend_prefetch_scripts' ); + + $asp_dev_mode = ( defined( 'WP_ASP_DEV_MODE' ) ) ? '1' : ''; + + wp_localize_script( + 'stripe-handler-ng', + 'wpASPNG', + array( + 'iframeUrl' => $iframe_url, + 'ppSlug' => self::$pp_slug, + 'prefetch' => $prefetch, + 'ckey' => ASP_Utils::get_ckey(), + 'aspDevMode' => $asp_dev_mode, + ) + ); + + wp_enqueue_script( 'stripe-handler-ng' ); + wp_register_style( 'stripe-handler-ng-style', WP_ASP_PLUGIN_URL . '/public/assets/css/public.css', array(), WP_ASP_PLUGIN_VERSION ); + wp_enqueue_style( 'stripe-handler-ng-style' ); + } + + public function frontend_print_footer_scripts() { + if ( ! empty( $this->footer_scripts ) ) { + $allowed_tags = array( + 'a' => array( + 'href' => array(), + 'title' => array() + ), + 'link' => array( + 'href' => array(), + 'rel' => array(), + 'as' => array(), + ), + ); + echo wp_kses( $this->footer_scripts, $allowed_tags ); + } + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/eprecaptcha/admin/asp-eprecaptcha-admin-menu.php b/wp-content/plugins/stripe-payments/includes/eprecaptcha/admin/asp-eprecaptcha-admin-menu.php new file mode 100644 index 0000000..1e4eb8c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/eprecaptcha/admin/asp-eprecaptcha-admin-menu.php @@ -0,0 +1,104 @@ +asp_admin = AcceptStripePayments_Admin::get_instance(); + $this->plugin_slug = $this->asp_admin->plugin_slug; + + add_action( 'admin_init', array( $this, 'register_settings' ) ); + add_filter( 'asp-admin-settings-addon-field-display', array( $this, 'field_display' ), 10, 2 ); + add_filter( 'apm-admin-settings-sanitize-field', array( $this, 'sanitize_settings' ), 10, 2 ); + } + + public function sanitize_settings( $output, $input ) { + + $output['eprecaptcha_site_key'] = sanitize_text_field( $input['eprecaptcha_site_key'] ); + + $output['eprecaptcha_api_key'] = sanitize_text_field( $input['eprecaptcha_api_key'] ); + + $output['eprecaptcha_project_id'] = sanitize_text_field( $input['eprecaptcha_project_id'] ); + + if ( $output['captcha_type'] === 'eprecaptcha' ) { + if ( empty( $output['eprecaptcha_site_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter Enterprise reCaptcha Site Key.', 'stripe-payments' ) ); + } + if ( empty( $output['eprecaptcha_api_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter Enterprise reCaptcha Api Key.', 'stripe-payments' ) ); + } + if ( empty( $output['eprecaptcha_project_id'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter Enterprise reCaptcha Project Id.', 'stripe-payments' ) ); + } + } + return $output; + } + + public function field_display( $field, $field_value ) { + $ret = array(); + + switch ( $field ) { + case 'recaptcha_invisible': + $ret['field'] = 'checkbox'; + $ret['field_name'] = $field; + break; + default: + break; + } + if ( ! empty( $ret ) ) { + return $ret; + } else { + return $field; + } + } + + public function register_settings() { + add_settings_section( 'AcceptStripePayments-eprecaptcha-section', __( 'Enterprise reCAPTCHA Settings', 'stripe-payments' ), array( $this, 'show_settings_description' ), $this->plugin_slug . '-eprecaptcha' ); + + add_settings_field( + 'eprecaptcha_site_key', + __( 'Site Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-eprecaptcha', + 'AcceptStripePayments-eprecaptcha-section', + array( + 'field' => 'eprecaptcha_site_key', + 'size' => 63, + 'desc' => __( 'Your Enterprise reCaptcha Site Key.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'eprecaptcha_api_key', + __( 'API Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-eprecaptcha', + 'AcceptStripePayments-eprecaptcha-section', + array( + 'field' => 'eprecaptcha_api_key', + 'size' => 63, + 'desc' => __( 'Your Enterprise reCaptcha API Key.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'eprecaptcha_project_id', + __( 'Project Id', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-eprecaptcha', + 'AcceptStripePayments-eprecaptcha-section', + array( + 'field' => 'eprecaptcha_project_id', + 'size' => 30, + 'desc' => __( 'Your Enterprise reCaptcha Project Id.', 'stripe-payments' ), + ) + ); + } + + public function show_settings_description() { + echo __( 'Click here to read the documentation to learn how to configure this and get API keys for your website.', 'stripe-payments' ); + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/eprecaptcha/asp-eprecaptcha-main.php b/wp-content/plugins/stripe-payments/includes/eprecaptcha/asp-eprecaptcha-main.php new file mode 100644 index 0000000..6e043ce --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/eprecaptcha/asp-eprecaptcha-main.php @@ -0,0 +1,346 @@ +asp_main = AcceptStripePayments::get_instance(); + + $this->enabled = $this->asp_main->get_setting( 'captcha_type' ) === 'eprecaptcha'; + + if ( ! empty( $this->asp_main->get_setting( 'eprecaptcha_project_id' ) ) && + ! empty( $this->asp_main->get_setting( 'eprecaptcha_site_key' ) ) && + ! empty( $this->asp_main->get_setting( 'eprecaptcha_api_key' ) ) + ) { + $this->keys_entered = true; + } + + add_action( 'wp_ajax_asp_eprecaptcha_check', array( $this, 'ajax_eprecaptcha_check' ) ); + add_action( 'wp_ajax_nopriv_asp_eprecaptcha_check', array( $this, 'ajax_eprecaptcha_check' ) ); + + if ( is_admin() ) { + include_once WP_ASP_PLUGIN_PATH . 'includes/eprecaptcha/admin/asp-eprecaptcha-admin-menu.php'; + new ASP_EPRECAPTCHA_Admin_Menu(); + } + + if ( $this->enabled ) { + add_action( 'asp_ng_before_token_request', array( $this, 'ng_before_token_request' ) ); + add_action( 'asp_ng_before_payment_processing', array( $this, 'ng_before_payment_processing' ) ); + add_action( 'asp_ng_do_additional_captcha_response_check', array( $this, 'ng_do_additional_captcha_response_check' ), 10, 2 ); + + if ( ! is_admin() ) { + add_filter( 'asp-button-output-data-ready', array( $this, 'data_ready' ), 10, 2 ); + add_filter( 'asp-button-output-additional-styles', array( $this, 'output_styles' ) ); + add_action( 'asp-button-output-register-script', array( $this, 'register_script' ) ); + add_action( 'asp-button-output-enqueue-script', array( $this, 'enqueue_script' ) ); + add_filter( 'asp-button-output-after-button', array( $this, 'after_button' ), 10, 3 ); + add_filter( 'asp_before_payment_processing', array( $this, 'before_payment_processing' ), 10, 2 ); + + add_filter( 'asp_ng_pp_data_ready', array( $this, 'ng_data_ready' ), 10, 2 ); + add_filter( 'asp_ng_pp_output_before_buttons', array( $this, 'ng_before_buttons' ), 10, 2 ); + add_action( 'asp_ng_pp_output_add_scripts', array( $this, 'ng_add_scripts' ) ); + add_filter( 'asp_ng_button_output_after_button', array( $this, 'ng_button_output_after_button' ), 10, 3 ); + } + } + } + + private function check_eprecatpcha( $token ) { + $ret = array(); + $projectId = $this->asp_main->get_setting( 'eprecaptcha_project_id' ); + $apiKey = $this->asp_main->get_setting( 'eprecaptcha_api_key' ); + $obj = new stdClass(); + $obj->event = new stdClass(); + + $obj->event->siteKey = $this->asp_main->get_setting( 'eprecaptcha_site_key' ); + $obj->event->token=$token; + $body = json_encode($obj); + + $res = wp_remote_post( + 'https://recaptchaenterprise.googleapis.com/v1/projects/'.$projectId.'/assessments?key='.$apiKey, + array( + 'headers' => array('Content-Type' => 'application/json; charset=utf-8'), + 'data_format' => 'body', + 'body' => $body, + ) + ); + + if ( is_wp_error( $res ) ) { + $ret['error'] = __( 'Enterprice reCaptcha: error occurred during API request.', 'stripe-payments' ) . ' ' . $res->get_error_message(); + return $ret; + } + + if ( $res['response']['code'] !== 200 ) { + $ret['error'] = __( 'Enterprise reCaptcha: error occurred during API request. HTTP Error code:', 'stripe-payments' ) . ' ' . $res['response']['code']; + return $ret; + } + + $response = json_decode( $res['body'], true ); + + if ( is_null( $response ) ) { + $ret['error'] = __( 'Enterprise reCaptcha: error occured parsing API response, invalid JSON data.', 'stripe-payments' ); + return $ret; + } + + if ( $response["tokenProperties"]['valid'] !== true ) { + $err_codes_str = __($response["tokenProperties"]['invalidReason'] , 'stripe-payments' ); + $ret['error'] = __( 'Enterprise reCaptcha: check failed. Following error(s) occurred:', 'stripe-payments' ) . ' ' . $err_codes_str; + return $ret; + } + return $ret; + } + + public function ajax_eprecaptcha_check() { + $out = array(); + $payload = isset( $_POST['eprecaptcha_response'] ) ? sanitize_text_field( stripslashes ( $_POST['eprecaptcha_response'] ) ) : ''; + if ( empty( $payload ) ) { + $out['error'] = __( 'Empty Enterprise reCaptcha response received.', 'stripe-payments' ); + wp_send_json( $out ); + } + + $out = $this->check_eprecatpcha( $payload ); + + $sess = ASP_Session::get_instance(); + + if ( isset( $out['error'] ) ) { + $sess->set_transient_data( 'epreCaptcha_checked', false ); + $sess->set_transient_data( 'epreCaptcha_error', $out['error'] ); + } else { + ASP_Utils_Bot_Mitigation::record_captcha_solve_ip_time_data(); + + $sess->set_transient_data( 'epreCaptcha_checked', true ); + $sess->set_transient_data( 'epreCaptcha_tokens', $this->max_tokens ); + } + + wp_send_json( $out ); + } + + public function ng_do_additional_captcha_response_check( $item, $params ) { + + if ( !ASP_Utils_Bot_Mitigation::is_captcha_solve_ip_data_time_valid() ){ + ASP_Debug_Logger::log( 'Enterprise reCAPTCHA - Additional captcha response check failed!', false ); + //Exit out silently. Do not go ahead with the request processing. + //If some sites want more relaxed option, we can add an option to extend the expiry timer maybe. + exit; + } + + ASP_Debug_Logger::log( 'Enterprise reCAPTCHA - Additional captcha response check done.', true ); + return true; + } + + public function ng_before_token_request( $item ) { + + $sess = ASP_Session::get_instance(); + + $checked = $sess->get_transient_data( 'epreCaptcha_checked' ); + + if ( ! $checked ) { + $err = $sess->get_transient_data( 'epreCaptcha_error' ); + if ( empty( $err ) ) { + $err = __( 'Enterprise reCaptcha check failed.', 'stripe-payments' ); + } + wp_send_json( + array( + 'success' => false, + 'err' => $err, + ) + ); + } + + $tokens = $sess->get_transient_data( 'epreCaptcha_tokens', 0 ); + + if ( $tokens <= 0 ) { + wp_send_json( + array( + 'success' => false, + 'err' => __( 'epreCaptcha tokens expired. Please refresh the page and try again.', 'stripe-payments' ), + ) + ); + } + + $tokens--; + $sess->set_transient_data( 'epreCaptcha_tokens', $tokens ); + + return true; + } + + public function ng_before_payment_processing( $post_data ) { + $sess = ASP_Session::get_instance(); + $sess->set_transient_data( 'epreCaptcha_checked', false ); + $sess->set_transient_data( 'epreCaptcha_error', false ); + } + + public function ng_before_buttons( $out, $data ) { + ob_start(); + ?> + +
+ + asp_main->get_setting( 'eprecaptcha_site_key' ); + return $data; + } + + public function ng_data_ready( $data, $atts ) { + if ( $this->enabled && ! $this->keys_entered ) { + $data['fatal_error'] = __( 'Please enter Enterprise reCaptcha keys.', 'stripe-payments' ); + } + $addon = array( + 'name' => 'epreCaptcha', + 'handler' => 'epreCaptchaHandlerNG', + ); + $data['addons'][] = $addon; + $data['eprecaptchaSiteKey'] = $this->asp_main->get_setting( 'eprecaptcha_site_key' ); + return $data; + } + + public function ng_add_scripts( $scripts ) { + $scripts[] = array( + 'footer' => true, + 'src' => 'https://www.google.com/recaptcha/enterprise.js?onload=onloadCallback&render=explicit', + ); + $scripts[] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/includes/eprecaptcha/public/js/asp-eprecaptcha-ng.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + return $scripts; + } + + public function ng_button_output_after_button( $output, $data, $class ) { + $prefetch = $this->asp_main->get_setting( 'frontend_prefetch_scripts' ); + if ( $prefetch ) { + if ( empty( $this->asp_main->sc_scripts_prefetched ) ) { + if ( ! isset( $this->asp_main->footer_scripts ) ) { + $this->asp_main->footer_scripts = ''; + } + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + } + } + return $output; + } + + public function before_payment_processing( $ret, $post ) { + if ( ! isset( $post['eprecaptchaKey'] ) || empty( $post['eprecaptchaKey'] ) ) { + $ret['error'] = __( 'Enterprise reCaptcha: missing user response data.', 'stripe-payments' ); + return $ret; + } + $payload = sanitize_text_field( $post['eprecaptchaKey'] ); + + $ret = $this->check_eprecatpcha( $payload ); + + return $ret; + } + + public function output_styles( $output ) { + ob_start(); + ?> + + +
+
+
+ div{height:2px;width:100%}.iziModal .iziModal-header{background:#88a0b9;padding:14px 18px 15px;box-shadow:inset 0 -10px 15px -12px rgba(0,0,0,.3),0 0 0 #555;overflow:hidden;position:relative;z-index:10}.iziModal .iziModal-header-icon{font-size:40px;color:rgba(255,255,255,.5);padding:0 15px 0 0;margin:0;float:left}.iziModal .iziModal-header-title{color:#fff;font-size:18px;font-weight:600;line-height:1.3}.iziModal .iziModal-header-subtitle{color:rgba(255,255,255,.6);font-size:12px;line-height:1.45}.iziModal .iziModal-header-subtitle,.iziModal .iziModal-header-title{display:block;margin:0;padding:0;font-family:'Lato',Arial;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;text-align:left}.iziModal .iziModal-header-buttons{position:absolute;top:50%;right:10px;margin:-17px 0 0}.iziModal .iziModal-button{display:block;float:right;z-index:2;outline:0;height:34px;width:34px;border:0;padding:0;margin:0;opacity:.3;border-radius:50%;transition:transform .5s cubic-bezier(.16,.81,.32,1),opacity .5s ease;background-size:67%!important;-webkit-tap-highlight-color:transparent}.iziModal .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6ODZCQkIzQ0I0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6ODZCQkIzQ0M0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDo4NkJCQjNDOTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDo4NkJCQjNDQTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PsgTJLcAAALJSURBVHja3JnLS1VBHMfvQ7g9dBXRRrwEFRciAhMi1JRW1aIHVEIYEkW0iVpUhOD/ICK6cFMgSbUpC6VFkQa9NtpjkauriRY9Noa3pHT8/mIODMM5Or85o87pC5/NPf5mvmc8M7+Z36SFEKkY2gj2gUawF2wHW8A6+fwv+A6KYAQMg+dg2rbDtKXhGnAaHJIms4zYz9J4HxgAf1g9k2EGteAhWBBuNApaQNrUg6nRTaAbzIuV0RCocWW4DoyJlVcJXI5ruFk2tJqi/2TWxvA5sXbqA2Ucw01i7dVjargazAo/dE33p6/DlAheg50pP0SJpwG8CH7IaH/Q5pFZUhnoArkwwwVwJeWfdoMLYYZvqG+yTGo9CerAoIWBT+A4qAdPDWOugwo1NVcxJtpFZRLkwH3GJCqCghJfxVjnz1JMMMKnwAbGRAg0B5rAA4O4CblZ+qj8tkBjZthvSzDCtFIMM0ZpQhslk5Eej4jpZ/T7G+ygwG1ghrk+jjNMFy1eMPJzpOAzlou6iWmXZkm91EBHjEwUZXoQTDk2SxqhRh7HTJ9hpstB3rFZ0ldq6J2DnB9m2rXZfxOPlrX1DrJRXiaBXSHPaMHvB0cd9JPLpBImMvzLQTuUFA6A9yHPfoIjhsllOc1l5N4grtmDWgYrl5+JTUZcSjNkeMyxWdpA3ZN72IJj01OJTByJS82J2/wQVxmB5y1HK8x0JWMf/kzdD98FJcY5S51gdwyTQl6eUAraspo27PeWXgy8afim0+CELAwOWHyH9EkdkyWwJ4Yxk6BCP+bTm48anutWW5dAp34IpbW03UOzb0FPVEHbx0LKfvAyqpAyKw97JU8Mt6pml6rAJ6oY6Eu5NfvfF7QTeWWQyEsZr6694lwsNoPD8mKRo29gCNwGj7gXi7aGA1EBcY+8vq0GW8FmJb3Pgx9gEnwAr8Ab8MW2w0UBBgAVyyyaohV7ewAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6RTBBOUI4RUM0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6RTBBOUI4RUQ0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpFMEE5QjhFQTRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDpFMEE5QjhFQjRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PrQO6gAAAANmSURBVHjazJlbSBRRGMd3x92i0ForRRMiKiUoX4ouiFlJkRVBDxW9GJERwUasvdRT9FD00osRQtAFqegGBUHRBY0uaCVKEkSRpVR0tSwrQtp1+p/4Bk7D7M45M/Ot/uGHu+Psmf+c+eY753wnbJpmyIfGgvmgiv6WgkKQBwzwE3wBr0AnuAta6ZgnhT0aFuY2ghoyGdH4bS+4Dc6CZjCkdWVhWIPF4JoZnB6CDToeVE8sBidNPt0E5UEZrgG9Jr8GwHa/huMgaWZXDSDsxfBuc/jUBAwdw3Fz+NWoang5SJkjQwm7P3seLqQEX2LLfgfBdZcMORMcBqNDwekPqASP0uXhpjR3Ok0x/fUw9HIHGGVdw5DuRtzJpgxDsJui2qOWmuaAOuuLbHivz4YLwLgQj/aAXNmwuItlHhtbA7pAG5jEZHgKWCcbrhUTIY+NPQVjqFFObbYMi/hc6aOhl2AJ9TKnFoIyYXgemKEzJQXVVkyR3oFVzKZFuqw2qHdyFPKhrHPgMoWC3fRjRtNVVg+7SR5IiqmXxUt60cG0CK/vTIZniZVCmcKJF0C3ZNjKBqvJ9Hrwm46tsN1EkCoRQ/M3fBjvs6GrYAvdwHEfGcd1qBaGkwoxrKI+xjz83yJ0iLFHApd46X4xX+M+WECh4lepCNUIcpnMijrEWtAvTRHrbOd8FZNG8uA2Nf0hpmwtjBPwpQ5T0GPS/+tBAZhIq+b3Lu09EyHRwRgO+0C+7dhWcII+PwCf6Sk/Aa9d2vtn+A7nyASugJiD6YSDQcOlvVbxiCaAN8xrs3sgprBiac/QhlhnzjUo6JuZM0UlDS5FPtoQIdNlPYJTWUihFaDex+9Pg6T1KHJAJ2NI7ASllA28hEQ/KJIXoSlwgKlnh+jFe+GjLtwIPtjfyktUt+UaUZWqvw7H3oJD1peI7eQdoF1xWa+zQikHH13OmwqmOxxP0EiZtgK/DRwNuIcHwSeXc2K01WAPhbhKBb5hBNTVbskVH7fqpZGhbJUNtYF83fqwQSXPbOsGjb6etwx2gcEsmT3iFAZeNmUqaMeHSz2qu0k6W15Rqsx3B2i0D+xXGAHTFrRVlEeFuVoqH+ku6VNUbDkPzlAtg30nVK66i8rRIjAbTKaSQVQyN0DD6nOqcLZQld9TLfmvAAMAeMcvp3eCFqQAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MkFFRTU5NDA0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MkFFRTU5NDE0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDoyQUVFNTkzRTRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyQUVFNTkzRjRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuDFfX8AAANASURBVHjazJlZSBVRGMfHcWlB0xZM68GKukQLYaGkmEUR2EsvRfQS+BSJPUQE+lTR8hqIZY8hFS0ERVCRoW3gpUApghYpszLTVnCB3O70/+K7MAwzc78Z58z4hx8XzpzvzJ+Zc+d85ztphmFoU9BsUAoq+XcFyAc5QAfD4BfoBp3gCWjnNl9K82mYzO0FVWwyw0NsD3gIroBWkPB0ZzLsgc3grhGcnoE9XjxIOxaCC4Y6tYC1QRmuAj2Geg2CA1M1XAsmjHDVANL8GK4zolMz0L0YrjWiV5PU8HYw6TBIf8imD6UynA96HYKPg3mgMUTDY6DUzXCzQ+AxSz+r6QEQZz4HbLoDZNkZrnAIoOlRZjN1Gk3XS0zty/gTFaRq7Ay3uAR8BcU2ps/z9QJTWw74HrDhTyDbbHg9SKQI+sb9rKa3mV8ZmAt+KJjP1TS+zinFPkqEUqQdBeAOKLa0UwIzpqlXtcYpIKWIO4RBZPoRKNfC10YQI8MlYLkwaAB8ABsiMDwDbKU8dgtIFwRMgJ3guRadKpNPWBMa7tOi1WoyHJPuTsC4oN+IQsOLM3gPJlEWqOE/neMGBqwDeYoMz6G8c0I4h6eFyHBC8A2eVoaH8JutaPwuUA/+uvSht1sHKgTjTWZwjUCVYdrK3xT0iwkND+lc5FClUQ9fINHCRYY7FBrWPSz5Er2lAR9H9P+hpfYGl64OCmPadQ7ojcDwOJetysBMQX/6mrWS4d+cIoYtMnAEnBT2fwVeJufYxZBMFoKFlrajQtOX/uczvEtIB50Kdgn1lt3JGdANltjsXE64jPMnuQ1LPuFJcFrBE11gzQXAUnAPFNk86esO4zSBfmu5lVa9toCf8DC4Ba6C22DEdO01KDLdP5fLr1Z94X2ibV1ilWVQ1XrDpvPAU4c+u1KVqvaHXI7q43ltp3PSYmDDNCgGPrCUD1wN6y5lqzAUN89baX1Y55Jn2LrPRUffRwaHwWhIZs/aTQM/hzLlDp+coPRReprk5cgrkyvz7wM0+hOcAvOlPvwcLNIp526ux1H5aJbHeFpVX4Br4LLXWoffk9CkVnLlaBNYAxaBXJBpMjfIy+o7EAdtfIyb8HPDfwIMAM1WPs8F9tcxAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-button-close:hover{transform:rotate(180deg)}.iziModal .iziModal-button:hover{opacity:.8}.iziModal .iziModal-header.iziModal-noSubtitle{height:auto;padding:10px 15px 12px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{font-size:23px;padding-right:13px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-title{font-size:15px;margin:3px 0 0;font-weight:400}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-buttons{right:6px;margin:-16px 0 0}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-button{height:30px;width:30px}.iziModal-rtl{direction:rtl}.iziModal-rtl .iziModal-header{padding:14px 18px 15px 40px}.iziModal-rtl .iziModal-header-icon{float:right;padding:0 0 0 15px}.iziModal-rtl .iziModal-header-buttons{right:initial;left:10px}.iziModal-rtl .iziModal-button{float:left}.iziModal-rtl .iziModal-header-subtitle,.iziModal-rtl .iziModal-header-title{text-align:right;font-family:Tahoma,'Lato',Arial;font-weight:500}.iziModal-rtl .iziModal-header.iziModal-noSubtitle{padding:10px 15px 12px 40px}.iziModal-rtl .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{padding:0 0 0 13px}.iziModal.iziModal-light .iziModal-header-icon{color:rgba(0,0,0,.5)}.iziModal.iziModal-light .iziModal-header-title{color:#000}.iziModal.iziModal-light .iziModal-header-subtitle{color:rgba(0,0,0,.6)}.iziModal.iziModal-light .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyQTU1RUZDNzRFODQxMUU2ODAxOEUwQzg0QjBDQjI3OSIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo1NEM4MTU1MEI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENDMkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjZjYzMwMmE1LWFlMjEtNDI3ZS1hMmE4LTJlYjhlMmZlY2E3NSIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjdmYmU3NGE3LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Po24QssAAANtSURBVHja3JlJaBRBFIa7ZxyTSXADHUkikuAawZNLEOOGGrwJQYko8R4RBQ+OICoqghJQUVwPYjzFY0QUBQU1kogoKO6CG0pcIwbiNibj/8JraNvu6Xo9NTOtP3xzSKe6/65+Ve9VlWlkp2IwGUwFE0E5GA4G8/U+0APegWfgHrgPuq0bpNNp0QPNgEYngHlgGpuMCNp2s+kr4BYM/8ql4WqwHEzP4mXteg7awOW0YlerPnQIaARLNBl1ikLlBDw/1WF4ClgHKozc6idogekz2RheANbaBlE+dB4chfF+qeHF3LOF0FWwF6b7nBe8RvecApolzQVr3C64GR4H1huFV51pmvV+hikRbABFRji0GqarMxluAGON8CgKmmA65mZ4DFhqhE9VPP//ZXgZiCmm1t1gI6XWAAY+gF0gCe4qtqlHL8fthkeBWsXGreA6eMgPviEw+x5sBZ3gAdjPCcNPI8Fsu+FawUCzz40psEfRNJndBl7b/pZmVLTQMkzJo0bQSys43iWm3cxS+DUJOmoSwqKCRmEZWKkYv6RSMBPc5lqXRGm0A1Q6XiaT2aSwo8jrK/qZwZlFIlXTusxa6iXDddTdARpnMj2ek9AWjWYH7h/lubcs4A28THdyAdOl0ezAmKNBNyLLiT0Btjti9zuHg06zpJKIprohwXNypcu1OIdGjYbnxCLGPyYy/EPDfejzbwYvXK59AzuFGdFLKTL8WYNZ59RVzGESJCNm0teI40E6zNIA2wSaA2REP32iaW0omKXRbJKTUVyYEVV0J8oxvEiQmiUZrFSz6XNkuJe3nBKCelaSbjOZrhLsd1BInYxweSeJq9YA6dYtuZCBI4JZ6jGW/W+sebhd0DAaMIO5mTYFW1+X6GeQ7TO3W0WyQj3cw0ulBg4nSUbcAY7zPVYp7ip95FXOH29Hb35AOPjypWMIh7PORSjFZVsIzdKW7AWvfYnTVNWHyCytHw+jd1Nehqks3KepvtChUzD7yGvE2/cduqxldQF1EWZb/PbWLF3jAVgo0WrlkN+c6hSd+rzlaSuaR7O0oX0wyIa2pVAdGaj0HCUVOqIq4dVwrg5lmmG2w+8f/9tjL6foYHE+Gy8Xtv3CPUpf7WauDxadKuIwoeNbOmoYDYbZ0ns/1wxUC7ykigs8sS/LpEe3vwUYALiKDDDSgEiSAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDpEQTg1NTA2NTRFODQxMUU2OTQ0N0VERjY2Q0M5ODYwRCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCQkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCQUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjFlNTQwYzczLTVhZmEtNDJlYi04YzJlLWMwMzFlYmFiYmIyNiIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOmVkYmRiMzM1LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PvIicdUAAAOvSURBVHjaxJlZbA1hFMe/qaItUUsspakg1laJ7UUisQuRvvTFA15sQSRCLBFrQryhHqxNHxEPtaQ8CCUkIrVVRbVBJdZYSrXVonr9/3pGxnTunZk78/X+k1+aO+1899/vnnvO+c4YKpi6ghEgW34OBD1BKjBAM6gH78Fz8BhUyrW/ikQivt7QiNMozU0DE8RkJx/3fgCPwA1QHvHp2K/hHJAPJqpwVA2K4flW2IZ7gyVgptKjh6AQxl+GYZi7uRr0U3rVBIpg+nIQwwvACpCkOk4XwYlosR3LMGN1qUqMroGDTqaNGDu7SiVWl+D3iP2i00c9HqxUidd8wzDy3HY4HRwCfWzXz4L7Lm+QKfHeOUTTLWAzdro6muH1YIbDjculWrmpUEM2YYXcCNMt9pAYE8WsWYLdlAxaNYTGMDDHKYYXBVy4B0jTFM/5iOcUc1fM/2JcnItNAYtBNzGtQ33BVHDV3OHpARqhV6CLLKpTs8yQYHxOCrDQO7AV1Gg2PBJhMYiGh4MMnx1eLkixXKsFuzSbZrrMpeGxHnqFFtvrTWCbhILd9AuNpnPMHXaTtZD0kl1mRdwSxXSjJsNZfONjcmqIJR5p3lp6Y+sXrAzsBz/lNXvmtZYMFKbqafi0pKQgKpOSPhmsC5BxXEs1Fz4fUr/7TWMe/q9bC2s3tJs1Df/Q/B5PwAZwJYS1WpPlo0zRZJZziL2gQU7I1GyHL7QSD26taVOytI26DpinxKypApvpk+C6dHlMnXskbUbT1yTpN3WJHWB327UCS3hUoc+tA/VyxP/ost5rGq7QWZnAdoe0eZgnYweDbgmgkoafgk8aTfNgsMNmmqfhC+Czj3V4T3mSBH255kxB0ztd4tNNDJkas2CUdkAKHQ3yAtxfijj/bdb7Cumyhmoyexzcs6Qwv2qUbPKvJDOtnNFklrF3R5qneA2XYHe/2A+ht1Xb3FZXRY1XTAjFTgtxJ45qKtWDpZK1g6dhIQuvBzjcy8FgQ6y8Nw+sCdnwL1Dn8jdMe6m2a+3ma9ESNUdOC1VixSH3bnPiYyraswnO0fqDIQkyW8WmCWab7b+I9TCF3+x0j2e+MPUA7LPGrVfD1F3VNsrPVR0zhS8BB5x21muzYa1Sy1Tb4y4d4qOwIi9Pk/wcj1gV50p5zQjJKAsJH8KcY4vpdYrjV0w9HMxxHjfKNpfwdMyRNuAmyy2M1vq5OegBNFMmR9lSHDizSLPMJGjuO2BZfSOtLKvpMylUvh/d/hFgAOH4+ibxGTZuAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA3BpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCRkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCRUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjgzM2MwOWZiLWJjOTEtNGVlZS05MDM1LTRkMmU2ZmE1ZjBmMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Pv1Q9Z8AAAOXSURBVHjaxJlLbA1RGMfPjIs+EvoIRYt4FVUl2EkkRTxKUqQbG0SEho2FjUQ8YtEICbEgTdFYeK1KaGvVeoUltyStt0UlNE17aWhV2+v/9X5XJpMzc8/0zpn5kl+aO3Nm7r/fnPu9xhDp2URQDJbw3xkgB2QCAwyAPvANfARvQDsfG7V4PO7pC40xCiVxa8AKFjnOw7VdoA08BtG4R8VeBZeCKrBS+GPvQAM0P/NbcB7YBdYJPfYKXIXwL34IJm8eBFOFXusH9RDdnI7gLWA/MEVwdh/UOe1tN8G0V3eLcKwFXJCJNl08G5ZYsrWgWnZCJng5OOBwo1iAoisMw6hMJXgyOOywVW7xj+9BgKL3QHSxm+C9IF9y4U2GMlStRPQP8Jbp9lFwhJwE0RHrgaSV8N6xG238l7Zjtfx3K58/Bd7zsWngIqdnP2we2ACa7B7e6RL6joK5EtHNfL7b5u1Bn7dGFbycYRVM/8WyFJnuJK+z2iVwzFrMcF1h+Cx4ClhtFVyu8CW54ITE01EwFMAPcH1SMJWIqxQvItE1YHEIsXkhtkUhCV4ApiteFOPadn4IgseDMooSSxVrhWFwmkvCsKw06WGhKLhHhGuzSHChh9pZ5cc1oFFwfoTTsWrWqQCvXdZQEpkDsjUJziSv3Qu43k3LTA1BXqvRY/4DMjTd/yu4niJVm9wslCjcb4QE/9Qo+Al44baAmgpKCIqC+01OBLrsr8/de8zkiYwuUxWSq7iuM8JhantIqfYItkOepKBysnbycIfPXYKqURL6DhaBCQrrKcZHTa5loyEIJgHXwG3F9TQV+pxMGK0BiaTHn2OLEjcURbdi7XBSMO3jTxoEjtg+7wDnhG3spSD6F3hk7Tjoxnc0CJ5k+5wFCrhplYl2mmI24nyvvWumAE9z2zIfBW8WifnxIHc2yb6xiHtEoms0/hlGtpAPHCkgNDjFyZngPN88COvkPpEe+XGHbFcD7z53C+ybwKEAo0UPZ8QCybkmiL3sNvkheygSI08RYOSQiaUhd52sUpIZLWwJsYqkkdcZeHfIS66nc9XcZQRpNBY7C7F9Yy1OtonErDgSgNhGcEXmWa/VFA1O9onE6y4dRqGtXuVtkpf2iDy8EVR6GLykMnrsNFC867QF0hH8v3MVicFcuYdKy56uqQx4SukWQj3NOtJtQIt4ckSvbmdziMqy7HcS9xv0cn/Xwdn0A1drnl/d/hNgAGQa6Lgarp6BAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-loader{background:#fff url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%;position:absolute;left:0;right:0;top:0;bottom:0;z-index:9}.iziModal .iziModal-content-loader{background:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%}.iziModal .iziModal-content:after,.iziModal .iziModal-content:before{content:'';display:table}.iziModal .iziModal-content:after{clear:both}.iziModal .iziModal-content{zoom:1;width:100%;-webkit-overflow-scrolling:touch}.iziModal .iziModal-wrap{width:100%;position:relative;-webkit-overflow-scrolling:touch;overflow-scrolling:touch}.iziModal .iziModal-iframe{border:0;margin:0 0 -6px;width:100%;transition:height .3s ease}.iziModal-overlay{display:block;position:fixed;top:0;left:0;height:100%;width:100%}.iziModal-navigate{position:fixed;left:0;right:0;top:0;bottom:0;pointer-events:none}.iziModal-navigate-caption{position:absolute;left:10px;top:10px;color:#fff;line-height:16px;font-size:9px;font-family:'Lato',Arial;letter-spacing:.1em;text-indent:0;text-align:center;width:70px;padding:5px 0;text-transform:uppercase;display:none}.iziModal-navigate-caption::after,.iziModal-navigate-caption::before{position:absolute;top:2px;width:20px;height:20px;text-align:center;line-height:14px;font-size:12px;content:'';background-size:100%!important}.iziModal-navigate-caption:before{left:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4ZpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyNmFjNjAyMy04OWU0LWE0NDAtYmMxMy1kOTA5MTQ3MmYzYjAiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6NDREQ0YwRjA1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6NDREQ0YwRUY1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpmNmM0Nzk3Ni1mNzE3LTk5NDAtYTgyYS1mNTdjNmNiYmU0NWMiIHN0UmVmOmRvY3VtZW50SUQ9ImFkb2JlOmRvY2lkOnBob3Rvc2hvcDowZGVmYTEyZC01MzM0LTExZTYtYWRkYi04Y2NmYjI5ZTAxNjYiLz4gPC9yZGY6RGVzY3JpcHRpb24+IDwvcmRmOlJERj4gPC94OnhtcG1ldGE+IDw/eHBhY2tldCBlbmQ9InIiPz7oo0ptAAACWklEQVR42uyZTWsTYRSFZybxo4kWk5g2NC5qTAU3Kq30A9udi1oXolV/hWuhv6R/Q6utioi4LbbVFHemamlRU0OCEk0wZjwXzwtDoBDopHMHcuFJMplZnLm5ue+589qu61qeOApyYAjEgG0FEyLqN/gKiqBuTtgewWlwCZw056xgwwirgU3wxSv4NJgCUV5YBRXQDEhsBJwCSSauBVZFdJRlIJk9Av7wbj577jDIOENtRmPVwcsw6KfAAvikRKzEDlhnhuU/lRPBWaa9wsxqC6ndPX7OiOA4D8qW3vjO9z7H0w3+KhZstNmOFbLoCQ6DYGmL+bAInmGfLFC4asFXwRJIgB+goVmw+I7HXO+/gevGnGgUPEGxktkSmAMbWmt4HDwBKS6XN1jDKrvEFYoVK7oLroE3h93Woh1eNwqWafJ/gQV65vM+ail34mc6EZwBK2CAx8fAIjjeBYMzDT4cVHCEXtRbRvEu/Nr9HCIOnGGp15vgEec9KYn74B0nAT/CZnv86FcNvwK3wENwAjwAs2Bbs5d4CW5zir0AXvv8p+tKH34B5lkW4h2egRHtbu05uMMHHWfB0zC4NRF5l09kzvE4rd2tyUJyjy4tz7akZqXbL8QETbJ/FsMgWOJtb6brCQ5YsBsC8Uab63DVkkgqFpzie93h8OhScFah2LTHi5ccWroaLd5l6//+hpYQoWP05LKqFs2WQYbTsNxAi+5fxpWmdfh7HS7XhwSzG+H3a2JnvZsyktmLbdOFhpDMvrf4sN1u2/aK0cwMcmYLcturweceW+CnOfFPgAEA8uWFFylBJYoAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal-navigate-caption:after{right:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAZdEVYdFNvZnR3YXJlAEFkb2JlIEltYWdlUmVhZHlxyWU8AAADhmlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4gPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPiA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPiA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIgeG1wTU06T3JpZ2luYWxEb2N1bWVudElEPSJ4bXAuZGlkOjI2YWM2MDIzLTg5ZTQtYTQ0MC1iYzEzLWQ5MDkxNDcyZjNiMCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0NERDRjBGMDUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0NERDRjBFRjUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOmY2YzQ3OTc2LWY3MTctOTk0MC1hODJhLWY1N2M2Y2JiZTQ1YyIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjBkZWZhMTJkLTUzMzQtMTFlNi1hZGRiLThjY2ZiMjllMDE2NiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuijSm0AAAKbSURBVFhH7ZnJj0xRGEerzFoIMTaCZmOIedhaiJj55yz8DaYdNhIJEUMQbCTG3rQ02hDSiEY553XdTpHS3nv96taV9ElO6lVt6peb7933fffVG41GrYW5uBaX4EysYzcw1Fd8hc/wM2a0Bl6Nm3BW9i0dDPsQX/olBF6FO72AH/gG3+N3jL3KBpqGC3ERTsGfeAsHDTyHi71oCXzBe/gaU2A5bscZOIxXTb8OLQNX9i6mElYsg/voqruwfQb2BhODWgqpMYDv0NLsNXC4yd42P1PEwNJj4HBTWdipErLVDfxfMRm408QMvBu3jV6WJ1Zg9/rbeBOP+UNZYgX+iE/Rp+lpPIKliBXYB9IhtPNy3z/T/F6YmDXsChvyBc7Gs3gACxEzsDzBg9iPPXgO92NuYgeWx2h3+AhtaM7jPsyF7aV37XR8gNZYO/pwKY51+xPkG27Fk2joT3gCr2A7NuJ6HMkTeAPadlp3VeMChF7G0P6X3dmfjAXOUxIj6LZkv1ylNuStDZejkL+PS96ScFzRqnDAtI5PoTefvbg7iNNOOwqVRCfYghdxBbpHH8Y7+DcKlUTV7MLLaNghPIrjhf2N2IF34AVcjE44hrXHyE3MwE6/loEzpEcIlqKjeyFiBe7FS+he/gENewMLEyuwXdo8dGWP43UsRazA9g7uDNbwNX8oS8watlsz+ISIGbgSJgN3GgOHlnFq8zNFQraGgT1iFc9iUyU0XsMGHhy9zh6XbvCp4ZuBBWglDBj4OdqLeu0+uRJTwMZ+Dbp/e21P3m97yWe2snsw1LTHmz5C/9lQdwhfGbiq89GwvrrwUT4UAouhN6MzloTRpVuEYI5O9urZYXtrYPGQw2OlZegM163QhrJMfWVgyTq0Qq32C/N7uPz9OknWAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal-navigate>button{position:fixed;bottom:0;top:0;border:0;height:100%;width:84px;background-size:100%!important;cursor:pointer;padding:0;opacity:.2;transition:opacity .3s ease;pointer-events:all;margin:0;outline:0}.iziModal-navigate>button:hover{opacity:1}.iziModal-navigate-prev{left:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5sGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiCiAgICAgICAgICAgIHhtbG5zOnN0RXZ0PSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VFdmVudCMiCiAgICAgICAgICAgIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+eG1wLmRpZDo2NDkyYzcxMy05ZDM0LTZlNGQtYmUwNi1hMDMyY2Q4NDVjNGU8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkRvY3VtZW50SUQ+eG1wLmRpZDo1QjIzMUMxODU3RjcxMUU2ODUzRkRBRjE5RDhDQjZBRDwveG1wTU06RG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDpjZmMwNzVmNC1kODA3LWI0NDMtYWIwYS02YWVhZjRjMDgxZWE8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEZXJpdmVkRnJvbSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgIDxzdFJlZjppbnN0YW5jZUlEPnhtcC5paWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RSZWY6ZG9jdW1lbnRJRD4KICAgICAgICAgPC94bXBNTTpEZXJpdmVkRnJvbT4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmNmYzA3NWY0LWQ4MDctYjQ0My1hYjBhLTZhZWFmNGMwODFlYTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDo1Ni0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjA0LTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFhEaW1lbnNpb24+CiAgICAgICAgIDxleGlmOlBpeGVsWURpbWVuc2lvbj4xODg8L2V4aWY6UGl4ZWxZRGltZW5zaW9uPgogICAgICA8L3JkZjpEZXNjcmlwdGlvbj4KICAgPC9yZGY6UkRGPgo8L3g6eG1wbWV0YT4KICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAKPD94cGFja2V0IGVuZD0idyI/PvAvv7QAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAAmdJREFUeNrs1LsJQkEQhtH/mtmBgQ8QA7tQK1e7MBBBMbADwzUZEyuQveeDCXbD4TBDay3SWJpYgYCXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXv/WJskpyQJ4jQH7Mcmu0C+BV+/Y5/VeF/oV8Ood+7dpDfDqHvsrySHJBXjBDrxgB16wAy/YgRfswAt24AU78IIdeMEOPOywAw+7gIcdeMEOvGAHXrADL9iBF+zAC3bgBTvwsMMOPOwCHnYBD7uAhx14wQ68YAdesAMv2IEX7MDDDjvwsAt42AU87AIedgEPu4CHXcDDDrxgB16wAw877MDDDjvwsAt42AU87AIedgEPu4CHXcDDLuBhB16wAw877MDDLuBhF/CwC3jYBTzsAh52AQ+7gIddwEtjB3+tS/78+Z/V5d9iATz0Ah56AQ+9gIdewEMv4KEX8NALeOgFPPQCHnoBDz3wgh54QQ889NADDz30wEMv4KEX8NALeOgFPPQCHnoBD72Ahx54QQ+8oAde0AMv6IEX9MBDDz3w0EMPPPQCHnoBD72Ah17AQw+8FUAPvKAHXtADL+iBF/TAC3rgBT3wgh546KEHHnrogYdewEMv4KEHXtADL+iBF/TAC3rgBT3wgh54QQ+8oAde0AMv6IGHHnrgoU/yrgFe3aO/JdknuQOv3tGfC/tjjEsYWmsoyIWXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXvqnPgAAAP//AwCEcoCBRabYzAAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal-navigate-next{right:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAB3SAAAd0gEUasEwAAA7pGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmRjPSJodHRwOi8vcHVybC5vcmcvZGMvZWxlbWVudHMvMS4xLyIKICAgICAgICAgICAgeG1sbnM6cGhvdG9zaG9wPSJodHRwOi8vbnMuYWRvYmUuY29tL3Bob3Rvc2hvcC8xLjAvIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6dGlmZj0iaHR0cDovL25zLmFkb2JlLmNvbS90aWZmLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmV4aWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vZXhpZi8xLjAvIj4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjEyLTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDphZjljN2Q2MC00MTg2LWE3NGQtYTBiMS1mMGU5ODUwYzg2ZGY8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+CiAgICAgICAgIDx4bXBNTTpIaXN0b3J5PgogICAgICAgICAgICA8cmRmOlNlcT4KICAgICAgICAgICAgICAgPHJkZjpsaSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDphY3Rpb24+Y3JlYXRlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjAxNjJjMmE3LWZmMjYtYzE0ZC05Yjg4LTc2MGM2NzAxYjYzNzwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1MTowNy0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmFmOWM3ZDYwLTQxODYtYTc0ZC1hMGIxLWYwZTk4NTBjODZkZjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpYUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6WVJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpZUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6UmVzb2x1dGlvblVuaXQ+MjwvdGlmZjpSZXNvbHV0aW9uVW5pdD4KICAgICAgICAgPGV4aWY6Q29sb3JTcGFjZT42NTUzNTwvZXhpZjpDb2xvclNwYWNlPgogICAgICAgICA8ZXhpZjpQaXhlbFhEaW1lbnNpb24+MTg4PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFlEaW1lbnNpb24+CiAgICAgIDwvcmRmOkRlc2NyaXB0aW9uPgogICA8L3JkZjpSREY+CjwveDp4bXBtZXRhPgogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgIAo8P3hwYWNrZXQgZW5kPSJ3Ij8+nbt1mgAAACBjSFJNAAB6JQAAgIMAAPn/AACA6QAAdTAAAOpgAAA6mAAAF2+SX8VGAAACQklEQVR42uzSsQ3CQAAEQTdiOyGg/wrciJ0QUMYSECEKAP3PSdvAaZZqkWbJCQJeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXsBLwEvAS8BLwEvAS8BLwEvAS8BLwEvAC3gJeAl4CXgJ+D9vrY7qBgLwo7dVZ+89oAd+5Pbq6nPQAz9s9+rZ96AHHnoBD72Ah17AQy/goRfw0At46AU89AIeegEPvYCHHnhBD7ygBx566IGHHnrgoRfw0At46AU89AIeegEPvYCHXsBDL+ChB17QAy/ogRf0wAt64KGHHnjooQceegEPvYCHXsBDL+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADDz30wEPvI+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADL+iBF/TAC3rgoZ8ePRDAAy/YgRfswAt24AU78IIdeMEOvGAHXrADL9iBhx124GEX8LADL9iBF+zAC3bgBTvwgh14wQ68YAcedtiBh13Awy7gYRfwsAMv2IEX7MALduAFO/CCHXjYYQcedgEPu4CHXcDDLuBhF/CwA+8E2IEX7MALduAFO/Cwww487AIedgEPu4CHXcDDLuBhF/CwC3jYgRfswMMOO/CwC3jYBTzsAh52AQ+7gIddwMMu4GEX8LBravB7dcEO/Ext1Qk78DO1VgfswEvAS8BLwEvAS8BLwEvAS8BLwEvAS8ALeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXgBLwEvAS8BLwEvAS/9shcAAAD//wMAtAygvJrkwJUAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isAttachedTop .iziModal-header{border-top-left-radius:0;border-top-right-radius:0}.iziModal.isAttachedTop{margin-top:0!important;margin-bottom:auto!important;border-top-left-radius:0!important;border-top-right-radius:0!important}.iziModal.isAttachedBottom{margin-top:auto!important;margin-bottom:0!important;border-bottom-left-radius:0!important;border-bottom-right-radius:0!important}.iziModal.isFullscreen{max-width:100%!important;margin:0!important;height:100%!important}.iziModal.isAttached,.iziModal.isFullscreen{border-radius:0!important}.iziModal.hasScroll .iziModal-wrap{overflow-y:auto;overflow-x:hidden}html.iziModal-isAttached,html.iziModal-isOverflow{overflow:hidden}html.iziModal-isAttached body,html.iziModal-isOverflow body{overflow-y:scroll;position:relative}.iziModal ::-webkit-scrollbar{overflow:visible;height:7px;width:7px}.iziModal ::-webkit-scrollbar-thumb{background-color:rgba(0,0,0,.2);background-clip:padding-box;border:solid transparent;border-width:0;min-height:28px;padding:100px 0 0;box-shadow:inset 1px 1px 0 rgba(0,0,0,.1),inset 0 -1px 0 rgba(0,0,0,.07)}.iziModal ::-webkit-scrollbar-thumb:active{background-color:rgba(0,0,0,.4)}.iziModal ::-webkit-scrollbar-button{height:0;width:0}.iziModal ::-webkit-scrollbar-track{background-clip:padding-box;border:solid transparent;border-width:0 0 0 2px}.iziModal.transitionIn .iziModal-header{-webkit-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-header .iziModal-header-icon{-webkit-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-button{-webkit-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-iframe,.iziModal.transitionIn .iziModal-wrap{-webkit-animation:iziM-fadeIn 1.3s;-moz-animation:iziM-fadeIn 1.3s;animation:iziM-fadeIn 1.3s}.iziModal.transitionIn .iziModal-header{-webkit-animation-delay:0s;-moz-animation:0s;animation-delay:0s}.iziModal.transitionIn .iziModal-header .iziModal-header-icon,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation-delay:.4s;-moz-animation:.4s;animation-delay:.4s}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle{-webkit-animation-delay:.5s;-moz-animation:.5s;animation-delay:.5s}.iziModal.transitionOut .iziModal-header,.iziModal.transitionOut .iziModal-header *{transition:none!important}.iziModal .fadeOut,.iziModal-navigate.fadeOut,.iziModal-overlay.fadeOut,.iziModal.fadeOut{-webkit-animation:iziM-fadeOut .5s;-moz-animation:iziM-fadeOut .5s;animation:iziM-fadeOut .5s;animation-fill-mode:forwards}.iziModal .fadeIn,.iziModal-navigate.fadeIn,.iziModal-overlay.fadeIn,.iziModal.fadeIn{-webkit-animation:iziM-fadeIn .5s;-moz-animation:iziM-fadeIn .5s;animation:iziM-fadeIn .5s}.iziModal-overlay.comingIn,.iziModal.comingIn{-webkit-animation:iziM-comingIn .5s ease;-moz-animation:iziM-comingIn .5s ease;animation:iziM-comingIn .5s ease}.iziModal-overlay.comingOut,.iziModal.comingOut{-webkit-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);-moz-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation-fill-mode:forwards}.iziModal-overlay.bounceInDown,.iziModal.bounceInDown{-webkit-animation:iziM-bounceInDown .7s ease;animation:iziM-bounceInDown .7s ease}.iziModal-overlay.bounceOutDown,.iziModal.bounceOutDown{-webkit-animation:iziM-bounceOutDown .7s ease;animation:iziM-bounceOutDown .7s ease}.iziModal-overlay.bounceInUp,.iziModal.bounceInUp{-webkit-animation:iziM-bounceInUp .7s ease;animation:iziM-bounceInUp .7s ease}.iziModal-overlay.bounceOutUp,.iziModal.bounceOutUp{-webkit-animation:iziM-bounceOutUp .7s ease;animation:iziM-bounceOutUp .7s ease}.iziModal-overlay.fadeInDown,.iziModal.fadeInDown{-webkit-animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutDown,.iziModal.fadeOutDown{-webkit-animation:iziM-fadeOutDown .5s ease;animation:iziM-fadeOutDown .5s ease}.iziModal-overlay.fadeInUp,.iziModal.fadeInUp{-webkit-animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutUp,.iziModal.fadeOutUp{-webkit-animation:iziM-fadeOutUp .5s ease;animation:iziM-fadeOutUp .5s ease}.iziModal-overlay.fadeInLeft,.iziModal.fadeInLeft{-webkit-animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutLeft,.iziModal.fadeOutLeft{-webkit-animation:iziM-fadeOutLeft .5s ease;animation:iziM-fadeOutLeft .5s ease}.iziModal-overlay.fadeInRight,.iziModal.fadeInRight{-webkit-animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutRight,.iziModal.fadeOutRight{-webkit-animation:iziM-fadeOutRight .5s ease;animation:iziM-fadeOutRight .5s ease}.iziModal-overlay.flipInX,.iziModal.flipInX{-webkit-animation:iziM-flipInX .7s ease;animation:iziM-flipInX .7s ease}.iziModal-overlay.flipOutX,.iziModal.flipOutX{-webkit-animation:iziM-flipOutX .7s ease;animation:iziM-flipOutX .7s ease}@-webkit-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-moz-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-webkit-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-moz-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-webkit-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-moz-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-webkit-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-moz-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-webkit-keyframes iziM-slideIn{0%{opacity:0;-webkit-transform:translateX(50px)}to{opacity:1;-webkit-transform:translateX(0)}}@-moz-keyframes iziM-slideIn{0%{opacity:0;-moz-transform:translateX(50px)}to{opacity:1;-moz-transform:translateX(0)}}@keyframes iziM-slideIn{0%{opacity:0;transform:translateX(50px)}to{opacity:1;transform:translateX(0)}}@-webkit-keyframes iziM-slideDown{0%{opacity:0;-webkit-transform:scale(1,0) translateY(-40px);-webkit-transform-origin:center top}}@-moz-keyframes iziM-slideDown{0%{opacity:0;-moz-transform:scale(1,0) translateY(-40px);-moz-transform-origin:center top}}@keyframes iziM-slideDown{0%{opacity:0;transform:scale(1,0) translateY(-40px);transform-origin:center top}}@-webkit-keyframes iziM-revealIn{0%{opacity:0;-webkit-transform:scale3d(.3,.3,1)}}@-moz-keyframes iziM-revealIn{0%{opacity:0;-moz-transform:scale3d(.3,.3,1)}}@keyframes iziM-revealIn{0%{opacity:0;transform:scale3d(.3,.3,1)}}@-webkit-keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@-webkit-keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@-webkit-keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-2000px,0);transform:translate3d(0,-2000px,0)}}@keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}}@-webkit-keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@-webkit-keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@-webkit-keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@-webkit-keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@-webkit-keyframes iziM-flipInX{0%{-webkit-transform:perspective(400px) rotateX(60deg);opacity:0}40%{-webkit-transform:perspective(400px) rotateX(-10deg)}70%{-webkit-transform:perspective(400px) rotateX(10deg)}to{-webkit-transform:perspective(400px) rotateX(0deg);opacity:1}}@keyframes iziM-flipInX{0%{transform:perspective(400px) rotateX(60deg);opacity:0}40%{transform:perspective(400px) rotateX(-10deg)}70%{transform:perspective(400px) rotateX(10deg)}to{transform:perspective(400px) rotateX(0deg);opacity:1}}@-webkit-keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}}@keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-ng.js b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-ng.js new file mode 100644 index 0000000..cb72da3 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-ng.js @@ -0,0 +1,109 @@ +var epreCaptchaLoaded = false; + +var epreCaptchaHandlerNG = function (data) { + var parent = this; + parent.data = data; + parent.data.eprecaptchaChecked = false; + parent.errCont = jQuery('#eprecaptcha-error'); + + parent.init = function () { + if (epreCaptchaLoaded) { + parent.epreCaptchaRender(); + } + } + + parent.epreCaptchaRender = function () { + + if (typeof (parent.eprecaptchaID) === "undefined") { + parent.eprecaptchaID = grecaptcha.enterprise.render('asp-eprecaptcha-container', { + 'sitekey': vars.data.eprecaptchaSiteKey, + 'badge': 'inline', + 'callback': function (resp) { + if (resp !== '' && !parent.data.eprecaptchaChecked) { + smokeScreen(true); + parent.errCont.hide(); + console.log('Enterprise reCaptcha doing backend check'); + var ajaxData = 'action=asp_eprecaptcha_check&eprecaptcha_response=' + resp; + new ajaxRequest(vars.ajaxURL, ajaxData, + function (res) { + var resp = JSON.parse(res.responseText); + if (resp.error) { + console.log('fail'); + smokeScreen(false); + parent.data.eprecaptchaChecked = false; + parent.errCont.html(resp.error).hide().fadeIn(); + grecaptcha.enterprise.reset(); + } else { + console.log('success'); + parent.errCont.hide(); + parent.data.eprecaptchaChecked = true; + smokeScreen(false); + } + }, + function (res, errMsg) { + smokeScreen(false); + parent.errCont.html(resp.err).hide().fadeIn(); + grecaptcha.enterprise.reset(); + } + ); + } + }, + 'expired-callback': function () { + parent.data.eprecaptchaChecked = false; + parent.data.eprecaptchaKey = ''; + if (!vars.data.recaptchaInvisible) { + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + }, + }); + } + } + + parent.csBeforeRegen = function () { + if (vars.data.eprecaptchaInvisible && !parent.data.eprecaptchaChecked) { + smokeScreen(true); + vars.data.doNotProceed = true; + vars.data.reConfirmToken = true; + grecaptcha.enterprise.execute(); + } + } + + parent.confirmToken = function () { + if (vars.data.eprecaptchaInvisible && !parent.data.eprecaptchaChecked) { + smokeScreen(true); + vars.data.canProceed = false; + vars.data.reConfirmToken = true; + grecaptcha.enterprise.execute(); + } + } + + parent.submitCanProceed = function () { + if (parent.data.eprecaptchaChecked === false) { + vars.data.canProceed = false; + if (vars.data.isEvent && vars.data.eprecaptchaInvisible) { + vars.data.canProceed = true; + return; + } + if (vars.data.eprecaptchaInvisible) { + smokeScreen(true); + grecaptcha.enterprise.execute(); + } else { + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + } + } +} + +function onloadCallback() { + epreCaptchaLoaded = true; + console.log(vars.data.addons); + vars.data.addons.forEach(function (addon) { + if (addon.name === 'epreCaptcha') { + if (addon.obj !== 'undefined') { + addon.obj.epreCaptchaRender(); + } else { + epreCaptchaLoaded = true; + } + } + }); +} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-script.js b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-script.js new file mode 100644 index 0000000..7fd7dba --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/asp-eprecaptcha-script.js @@ -0,0 +1,42 @@ +function wp_asp_button_clicked_recaptcha(data) { + if (typeof (data.eprecaptchaChecked) === "undefined" || !data.eprecaptchaChecked) { + data.canProceed = false; + jQuery('#asp-recaptcha-modal-' + data.uniq_id).iziModal({ + title: 'Enterprise reCaptcha', + transitionIn: 'fadeInUp', + transitionOut: 'fadeOutDown', + closeOnEscape: false, + overlayClose: false, + fullscreen: false, + restoreDefaultContent: false, + }); + + jQuery('#asp-eprecaptcha-modal-' + data.uniq_id).iziModal('open'); + + if (typeof (data.eprecaptchaID) === "undefined") { + data.eprecaptchaID = grecaptcha.enterprise.render('asp-eprecaptcha-container-' + data.uniq_id, { + 'sitekey': data.eprecaptchaSiteKey, + 'callback': function (key) { + if (key !== '') { + data.eprecaptchaChecked = true; + data.canProceed = true; + + jQuery('form#stripe_form_' + data.uniq_id).append(''); + + grecaptcha.enterprise.reset(data.eprecaptchaID); + jQuery('#asp-eprecaptcha-modal-' + data.uniq_id).iziModal('close'); + jQuery('#asp-eprecaptcha-container-' + data.uniq_id).html(''); + if (typeof data.buttonClicked !== "undefined") { + if (typeof data.buttonClicked.click === 'function') { + data.buttonClicked.click(); + } + } else { + jQuery('#stripe_button_' + data.uniq_id).click(); + } + } + }, + }); + } + } + return data; +} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/iziModal.min.js b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/iziModal.min.js new file mode 100644 index 0000000..ce1f3ea --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/eprecaptcha/public/js/iziModal.min.js @@ -0,0 +1,6 @@ +/* +* iziModal | v1.6.0 +* http://izimodal.marcelodolce.com +* by Marcelo Dolce. +*/ +!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):"object"==typeof module&&module.exports?module.exports=function(e,i){return void 0===i&&(i="undefined"!=typeof window?require("jquery"):require("jquery")(e)),t(i),i}:t(jQuery)}(function(t){function e(){var t,e=document.createElement("fakeelement"),i={animation:"animationend",OAnimation:"oAnimationEnd",MozAnimation:"animationend",WebkitAnimation:"webkitAnimationEnd"};for(t in i)if(void 0!==e.style[t])return i[t]}function i(t){return 9===t?navigator.appVersion.indexOf("MSIE 9.")!==-1:(userAgent=navigator.userAgent,userAgent.indexOf("MSIE ")>-1||userAgent.indexOf("Trident/")>-1)}function n(t){var e=/%|px|em|cm|vh|vw/;return parseInt(String(t).split(e)[0])}function o(e){var i=e.replace(/^.*#/,""),n=t(e);n.attr("id",i+"-tmp"),window.location.hash=e,n.attr("id",i)}var s=t(window),a=t(document),r="iziModal",l={CLOSING:"closing",CLOSED:"closed",OPENING:"opening",OPENED:"opened",DESTROYED:"destroyed"},d=e(),h=!!/Mobi/.test(navigator.userAgent);window.$iziModal={},window.$iziModal.autoOpen=0,window.$iziModal.history=!1;var c=function(t,e){this.init(t,e)};return c.prototype={constructor:c,init:function(e,i){var n=this;this.$element=t(e),void 0!==this.$element[0].id&&""!==this.$element[0].id?this.id=this.$element[0].id:(this.id=r+Math.floor(1e7*Math.random()+1),this.$element.attr("id",this.id)),this.classes=void 0!==this.$element.attr("class")?this.$element.attr("class"):"",this.content=this.$element.html(),this.state=l.CLOSED,this.options=i,this.width=0,this.timer=null,this.timerTimeout=null,this.progressBar=null,this.isPaused=!1,this.isFullscreen=!1,this.headerHeight=0,this.modalHeight=0,this.$overlay=t('
'),this.$navigate=t('
Use
'),this.group={name:this.$element.attr("data-"+r+"-group"),index:null,ids:[]},this.$element.attr("aria-hidden","true"),this.$element.attr("aria-labelledby",this.id),this.$element.attr("role","dialog"),this.$element.hasClass("iziModal")||this.$element.addClass("iziModal"),void 0===this.group.name&&""!==i.group&&(this.group.name=i.group,this.$element.attr("data-"+r+"-group",i.group)),this.options.loop===!0&&this.$element.attr("data-"+r+"-loop",!0),t.each(this.options,function(t,e){var o=n.$element.attr("data-"+r+"-"+t);try{"undefined"!=typeof o&&(""===o||"true"==o?i[t]=!0:"false"==o?i[t]=!1:"function"==typeof e?i[t]=new Function(o):i[t]=o)}catch(s){}}),i.appendTo!==!1&&this.$element.appendTo(i.appendTo),i.iframe===!0?(this.$element.html('
'+this.content+"
"),null!==i.iframeHeight&&this.$element.find("."+r+"-iframe").css("height",i.iframeHeight)):this.$element.html('
'+this.content+"
"),null!==this.options.background&&this.$element.css("background",this.options.background),this.$wrap=this.$element.find("."+r+"-wrap"),null===i.zindex||isNaN(parseInt(i.zindex))||(this.$element.css("z-index",i.zindex),this.$navigate.css("z-index",i.zindex-1),this.$overlay.css("z-index",i.zindex-2)),""!==i.radius&&this.$element.css("border-radius",i.radius),""!==i.padding&&this.$element.find("."+r+"-content").css("padding",i.padding),""!==i.theme&&("light"===i.theme?this.$element.addClass(r+"-light"):this.$element.addClass(i.theme)),i.rtl===!0&&this.$element.addClass(r+"-rtl"),i.openFullscreen===!0&&(this.isFullscreen=!0,this.$element.addClass("isFullscreen")),this.createHeader(),this.recalcWidth(),this.recalcVerticalPos(),!n.options.afterRender||"function"!=typeof n.options.afterRender&&"object"!=typeof n.options.afterRender||n.options.afterRender(n)},createHeader:function(){this.$header=t('

'+this.options.title+'

'+this.options.subtitle+'

'),this.options.closeButton===!0&&this.$header.find("."+r+"-header-buttons").append('"),this.options.fullscreen===!0&&this.$header.find("."+r+"-header-buttons").append('"),this.options.timeoutProgressbar===!0&&this.$header.prepend('
'),""===this.options.subtitle&&this.$header.addClass(r+"-noSubtitle"),""!==this.options.title&&(null!==this.options.headerColor&&(this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+this.options.headerColor),this.$header.css("background",this.options.headerColor)),null===this.options.icon&&null===this.options.iconText||(this.$header.prepend(''),null!==this.options.icon&&this.$header.find("."+r+"-header-icon").addClass(this.options.icon).css("color",this.options.iconColor),null!==this.options.iconText&&this.$header.find("."+r+"-header-icon").html(this.options.iconText)),this.$element.css("overflow","hidden").prepend(this.$header))},setGroup:function(e){var i=this,n=this.group.name||e;if(this.group.ids=[],void 0!==e&&e!==this.group.name&&(n=e,this.group.name=n,this.$element.attr("data-"+r+"-group",n)),void 0!==n&&""!==n){var o=0;t.each(t("."+r+"[data-"+r+"-group="+n+"]"),function(e,n){i.group.ids.push(t(this)[0].id),i.id==t(this)[0].id&&(i.group.index=o),o++})}},toggle:function(){this.state==l.OPENED&&this.close(),this.state==l.CLOSED&&this.open()},startProgress:function(t){var e=this;this.isPaused=!1,clearTimeout(this.timerTimeout),this.options.timeoutProgressbar===!0?(this.progressBar={hideEta:null,maxHideTime:null,currentTime:(new Date).getTime(),el:this.$element.find("."+r+"-progressbar > div"),updateProgress:function(){if(!e.isPaused){e.progressBar.currentTime=e.progressBar.currentTime+10;var t=(e.progressBar.hideEta-e.progressBar.currentTime)/e.progressBar.maxHideTime*100;e.progressBar.el.width(t+"%"),t<0&&e.close()}}},t>0&&(this.progressBar.maxHideTime=parseFloat(t),this.progressBar.hideEta=(new Date).getTime()+this.progressBar.maxHideTime,this.timerTimeout=setInterval(this.progressBar.updateProgress,10))):this.timerTimeout=setTimeout(function(){e.close()},e.options.timeout)},pauseProgress:function(){this.isPaused=!0},resumeProgress:function(){this.isPaused=!1},resetProgress:function(t){clearTimeout(this.timerTimeout),this.progressBar={},this.$element.find("."+r+"-progressbar > div").width("100%")},open:function(e){function i(){s.state=l.OPENED,s.$element.trigger(l.OPENED),!s.options.onOpened||"function"!=typeof s.options.onOpened&&"object"!=typeof s.options.onOpened||s.options.onOpened(s)}function n(){s.$element.off("click","[data-"+r+"-close]").on("click","[data-"+r+"-close]",function(e){e.preventDefault();var i=t(e.currentTarget).attr("data-"+r+"-transitionOut");void 0!==i?s.close({transition:i}):s.close()}),s.$element.off("click","[data-"+r+"-fullscreen]").on("click","[data-"+r+"-fullscreen]",function(t){t.preventDefault(),s.isFullscreen===!0?(s.isFullscreen=!1,s.$element.removeClass("isFullscreen")):(s.isFullscreen=!0,s.$element.addClass("isFullscreen")),s.options.onFullscreen&&"function"==typeof s.options.onFullscreen&&s.options.onFullscreen(s),s.$element.trigger("fullscreen",s)}),s.$navigate.off("click","."+r+"-navigate-next").on("click","."+r+"-navigate-next",function(t){s.next(t)}),s.$element.off("click","[data-"+r+"-next]").on("click","[data-"+r+"-next]",function(t){s.next(t)}),s.$navigate.off("click","."+r+"-navigate-prev").on("click","."+r+"-navigate-prev",function(t){s.prev(t)}),s.$element.off("click","[data-"+r+"-prev]").on("click","[data-"+r+"-prev]",function(t){s.prev(t)})}var s=this;try{void 0!==e&&e.preventClose===!1&&t.each(t("."+r),function(e,i){if(void 0!==t(i).data().iziModal){var n=t(i).iziModal("getState");"opened"!=n&&"opening"!=n||t(i).iziModal("close")}})}catch(c){}if(function(){if(s.options.history){var t=document.title;document.title=t+" - "+s.options.title,o("#"+s.id),document.title=t,window.$iziModal.history=!0}else window.$iziModal.history=!1}(),this.state==l.CLOSED){if(n(),this.setGroup(),this.state=l.OPENING,this.$element.trigger(l.OPENING),this.$element.attr("aria-hidden","false"),this.options.timeoutProgressbar===!0&&this.$element.find("."+r+"-progressbar > div").width("100%"),this.options.iframe===!0){this.$element.find("."+r+"-content").addClass(r+"-content-loader"),this.$element.find("."+r+"-iframe").on("load",function(){t(this).parent().removeClass(r+"-content-loader")});var u=null;try{u=""!==t(e.currentTarget).attr("href")?t(e.currentTarget).attr("href"):null}catch(c){}if(null===this.options.iframeURL||null!==u&&void 0!==u||(u=this.options.iframeURL),null===u||void 0===u)throw new Error("Failed to find iframe URL");this.$element.find("."+r+"-iframe").attr("src",u)}(this.options.bodyOverflow||h)&&(t("html").addClass(r+"-isOverflow"),h&&t("body").css("overflow","hidden")),this.options.onOpening&&"function"==typeof this.options.onOpening&&this.options.onOpening(this),function(){if(s.group.ids.length>1){s.$navigate.appendTo("body"),s.$navigate.addClass("fadeIn"),s.options.navigateCaption===!0&&s.$navigate.find("."+r+"-navigate-caption").show();var n=s.$element.outerWidth();s.options.navigateArrows!==!1?"closeScreenEdge"===s.options.navigateArrows?(s.$navigate.find("."+r+"-navigate-prev").css("left",0).show(),s.$navigate.find("."+r+"-navigate-next").css("right",0).show()):(s.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(n/2+84)).show(),s.$navigate.find("."+r+"-navigate-next").css("margin-right",-(n/2+84)).show()):(s.$navigate.find("."+r+"-navigate-prev").hide(),s.$navigate.find("."+r+"-navigate-next").hide());var o;0===s.group.index&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-prev").hide()),s.group.index+1===s.group.ids.length&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-next").hide())}s.options.overlay===!0&&(s.options.appendToOverlay===!1?s.$overlay.appendTo("body"):s.$overlay.appendTo(s.options.appendToOverlay)),s.options.transitionInOverlay&&s.$overlay.addClass(s.options.transitionInOverlay);var a=s.options.transitionIn;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionIn||(a=e.transition||e.transitionIn),void 0!==e.zindex&&s.setZindex(e.zindex)),""!==a&&void 0!==d?(s.$element.addClass("transitionIn "+a).show(),s.$wrap.one(d,function(){s.$element.removeClass(a+" transitionIn"),s.$overlay.removeClass(s.options.transitionInOverlay),s.$navigate.removeClass("fadeIn"),i()})):(s.$element.show(),i()),s.options.pauseOnHover!==!0||s.options.pauseOnHover!==!0||s.options.timeout===!1||isNaN(parseInt(s.options.timeout))||s.options.timeout===!1||0===s.options.timeout||(s.$element.off("mouseenter").on("mouseenter",function(t){t.preventDefault(),s.isPaused=!0}),s.$element.off("mouseleave").on("mouseleave",function(t){t.preventDefault(),s.isPaused=!1}))}(),this.options.timeout===!1||isNaN(parseInt(this.options.timeout))||this.options.timeout===!1||0===this.options.timeout||s.startProgress(this.options.timeout),this.options.overlayClose&&!this.$element.hasClass(this.options.transitionOut)&&this.$overlay.click(function(){s.close()}),this.options.focusInput&&this.$element.find(":input:not(button):enabled:visible:first").focus(),function p(){s.recalcLayout(),s.timer=setTimeout(p,300)}(),a.on("keydown."+r,function(t){s.options.closeOnEscape&&27===t.keyCode&&s.close()})}},close:function(e){function i(){n.state=l.CLOSED,n.$element.trigger(l.CLOSED),n.options.iframe===!0&&n.$element.find("."+r+"-iframe").attr("src",""),(n.options.bodyOverflow||h)&&(t("html").removeClass(r+"-isOverflow"),h&&t("body").css("overflow","auto")),n.options.onClosed&&"function"==typeof n.options.onClosed&&n.options.onClosed(n),n.options.restoreDefaultContent===!0&&n.$element.find("."+r+"-content").html(n.content),0===t("."+r+":visible").length&&t("html").removeClass(r+"-isAttached")}var n=this;if(this.state==l.OPENED||this.state==l.OPENING){a.off("keydown."+r),this.state=l.CLOSING,this.$element.trigger(l.CLOSING),this.$element.attr("aria-hidden","true"),clearTimeout(this.timer),clearTimeout(this.timerTimeout),n.options.onClosing&&"function"==typeof n.options.onClosing&&n.options.onClosing(this);var o=this.options.transitionOut;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionOut||(o=e.transition||e.transitionOut)),o===!1||""===o||void 0===d?(this.$element.hide(),this.$overlay.remove(),this.$navigate.remove(),i()):(this.$element.attr("class",[this.classes,r,o,"light"==this.options.theme?r+"-light":this.options.theme,this.isFullscreen===!0?"isFullscreen":"",this.options.rtl?r+"-rtl":""].join(" ")),this.$overlay.attr("class",r+"-overlay "+this.options.transitionOutOverlay),n.options.navigateArrows===!1||h||this.$navigate.attr("class",r+"-navigate fadeOut"),this.$element.one(d,function(){n.$element.hasClass(o)&&n.$element.removeClass(o+" transitionOut").hide(),n.$overlay.removeClass(n.options.transitionOutOverlay).remove(),n.$navigate.removeClass("fadeOut").remove(),i()}))}},next:function(e){var i=this,n="fadeInRight",o="fadeOutLeft",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index+1;o<=i.group.ids.length;o++){try{a["in"]=t("#"+i.group.ids[o]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o]).iziModal("open",{transition:n});break}if(o==i.group.ids.length&&e>0||i.options.loop===!0)for(var l=0;l<=i.group.ids.length;l++)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},prev:function(e){var i=this,n="fadeInLeft",o="fadeOutRight",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index;o>=0;o--){try{a["in"]=t("#"+i.group.ids[o-1]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o-1]).iziModal("open",{transition:n});break}if(0===o&&e>0||i.options.loop===!0)for(var l=i.group.ids.length-1;l>=0;l--)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},destroy:function(){var e=t.Event("destroy");this.$element.trigger(e),a.off("keydown."+r),clearTimeout(this.timer),clearTimeout(this.timerTimeout),this.options.iframe===!0&&this.$element.find("."+r+"-iframe").remove(),this.$element.html(this.$element.find("."+r+"-content").html()),this.$element.off("click","[data-"+r+"-close]"),this.$element.off("click","[data-"+r+"-fullscreen]"),this.$element.off("."+r).removeData(r).attr("style",""),this.$overlay.remove(),this.$navigate.remove(),this.$element.trigger(l.DESTROYED),this.$element=null},getState:function(){return this.state},getGroup:function(){return this.group},setWidth:function(t){this.options.width=t,this.recalcWidth();var e=this.$element.outerWidth();this.options.navigateArrows!==!0&&"closeToModal"!=this.options.navigateArrows||(this.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(e/2+84)).show(),this.$navigate.find("."+r+"-navigate-next").css("margin-right",-(e/2+84)).show())},setTop:function(t){this.options.top=t,this.recalcVerticalPos(!1)},setBottom:function(t){this.options.bottom=t,this.recalcVerticalPos(!1)},setHeader:function(t){t?this.$element.find("."+r+"-header").show():(this.headerHeight=0,this.$element.find("."+r+"-header").hide())},setTitle:function(t){this.options.title=t,0===this.headerHeight&&this.createHeader(),0===this.$header.find("."+r+"-header-title").length&&this.$header.append('

'),this.$header.find("."+r+"-header-title").html(t)},setSubtitle:function(t){""===t?(this.$header.find("."+r+"-header-subtitle").remove(),this.$header.addClass(r+"-noSubtitle")):(0===this.$header.find("."+r+"-header-subtitle").length&&this.$header.append('

'),this.$header.removeClass(r+"-noSubtitle")),this.$header.find("."+r+"-header-subtitle").html(t),this.options.subtitle=t},setIcon:function(t){0===this.$header.find("."+r+"-header-icon").length&&this.$header.prepend(''),this.$header.find("."+r+"-header-icon").attr("class",r+"-header-icon "+t),this.options.icon=t},setIconText:function(t){this.$header.find("."+r+"-header-icon").html(t),this.options.iconText=t},setHeaderColor:function(t){this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+t),this.$header.css("background",t),this.options.headerColor=t},setBackground:function(t){t===!1?(this.options.background=null,this.$element.css("background","")):(this.$element.css("background",t),this.options.background=t)},setZindex:function(t){isNaN(parseInt(this.options.zindex))||(this.options.zindex=t,this.$element.css("z-index",t),this.$navigate.css("z-index",t-1),this.$overlay.css("z-index",t-2))},setFullscreen:function(t){t?(this.isFullscreen=!0,this.$element.addClass("isFullscreen")):(this.isFullscreen=!1,this.$element.removeClass("isFullscreen"))},setContent:function(t){if("object"==typeof t){var e=t["default"]||!1;e===!0&&(this.content=t.content),t=t.content}this.options.iframe===!1&&this.$element.find("."+r+"-content").html(t)},setTransitionIn:function(t){this.options.transitionIn=t},setTransitionOut:function(t){this.options.transitionOut=t},setTimeout:function(t){this.options.timeout=t},resetContent:function(){this.$element.find("."+r+"-content").html(this.content)},startLoading:function(){this.$element.find("."+r+"-loader").length||this.$element.append('
'),this.$element.find("."+r+"-loader").css({top:this.headerHeight,borderRadius:this.options.radius})},stopLoading:function(){var t=this.$element.find("."+r+"-loader");t.length||(this.$element.prepend('
'),t=this.$element.find("."+r+"-loader").css("border-radius",this.options.radius)),t.removeClass("fadeIn").addClass("fadeOut"),setTimeout(function(){t.remove()},600)},recalcWidth:function(){var t=this;if(this.$element.css("max-width",this.options.width),i()){var e=t.options.width;e.toString().split("%").length>1&&(e=t.$element.outerWidth()),t.$element.css({left:"50%",marginLeft:-(e/2)})}},recalcVerticalPos:function(t){null!==this.options.top&&this.options.top!==!1?(this.$element.css("margin-top",this.options.top),0===this.options.top&&this.$element.css({borderTopRightRadius:0,borderTopLeftRadius:0})):t===!1&&this.$element.css({marginTop:"",borderRadius:this.options.radius}),null!==this.options.bottom&&this.options.bottom!==!1?(this.$element.css("margin-bottom",this.options.bottom),0===this.options.bottom&&this.$element.css({borderBottomRightRadius:0,borderBottomLeftRadius:0})):t===!1&&this.$element.css({marginBottom:"",borderRadius:this.options.radius})},recalcLayout:function(){var e=this,o=s.height(),a=this.$element.outerHeight(),d=this.$element.outerWidth(),h=this.$element.find("."+r+"-content")[0].scrollHeight,c=h+this.headerHeight,u=this.$element.innerHeight()-this.headerHeight,p=(parseInt(-((this.$element.innerHeight()+1)/2))+"px",this.$wrap.scrollTop()),f=0;i()&&(d>=s.width()||this.isFullscreen===!0?this.$element.css({left:"0",marginLeft:""}):this.$element.css({left:"50%",marginLeft:-(d/2)})),this.options.borderBottom===!0&&""!==this.options.title&&(f=3),this.$element.find("."+r+"-header").length&&this.$element.find("."+r+"-header").is(":visible")?(this.headerHeight=parseInt(this.$element.find("."+r+"-header").innerHeight()),this.$element.css("overflow","hidden")):(this.headerHeight=0,this.$element.css("overflow","")),this.$element.find("."+r+"-loader").length&&this.$element.find("."+r+"-loader").css("top",this.headerHeight),a!==this.modalHeight&&(this.modalHeight=a,this.options.onResize&&"function"==typeof this.options.onResize&&this.options.onResize(this)),this.state!=l.OPENED&&this.state!=l.OPENING||(this.options.iframe===!0&&(o=s.width()?this.$element.find("."+r+"-button-fullscreen").hide():this.$element.find("."+r+"-button-fullscreen").show(),this.recalcButtons(),this.isFullscreen===!1&&(o=o-(n(this.options.top)||0)-(n(this.options.bottom)||0)),c>o?(this.options.top>0&&null===this.options.bottom&&h0&&null===this.options.top&&hu&&c>o?(e.$element.addClass("hasScroll"),e.$wrap.css("height",a-(e.headerHeight+f))):(e.$element.removeClass("hasScroll"),e.$wrap.css("height","auto"))}(),function(){u+p1){try{n.$el=document.createElement(id[0])}catch(o){}n.$el.id=this.selector.split("#")[1].trim()}else if(n["class"].length>1){try{n.$el=document.createElement(n["class"][0])}catch(o){}for(var s=1;sasp_admin = AcceptStripePayments_Admin::get_instance(); + $this->plugin_slug = $this->asp_admin->plugin_slug; + + add_action( 'admin_init', array( $this, 'register_settings' ) ); + add_filter( 'asp-admin-settings-addon-field-display', array( $this, 'field_display' ), 10, 2 ); + add_filter( 'asp_admin_settings_sanitize_field_end', array( $this, 'sanitize_settings' ), 10, 2 ); + } + + public function sanitize_settings( $output, $input ) { + $output['hcaptcha_invisible'] = isset( $input['hcaptcha_invisible'] ) ? 1 : 0; + + $output['hcaptcha_site_key'] = sanitize_text_field( $input['hcaptcha_site_key'] ); + + $output['hcaptcha_secret_key'] = sanitize_text_field( $input['hcaptcha_secret_key'] ); + + if ( $output['captcha_type'] === 'hcaptcha' ) { + if ( empty( $output['hcaptcha_site_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter hCaptcha Site Key.', 'stripe-payments' ) ); + } + if ( empty( $output['hcaptcha_secret_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter hCaptcha Secret Key.', 'stripe-payments' ) ); + } + } + return $output; + } + + public function field_display( $field, $field_value ) { + $ret = array(); + switch ( $field ) { + case 'hcaptcha_invisible': + $ret['field'] = 'checkbox'; + $ret['field_name'] = $field; + break; + default: + break; + } + if ( ! empty( $ret ) ) { + return $ret; + } else { + return $field; + } + } + + public function register_settings() { + add_settings_section( 'AcceptStripePayments-hcaptcha-section', __( 'hCaptcha Settings', 'stripe-payments' ), array( $this, 'show_settings_description' ), $this->plugin_slug . '-hcaptcha' ); + + add_settings_field( + 'hcaptcha_invisible', + __( 'Use Invisible hCaptcha Badge', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-hcaptcha', + 'AcceptStripePayments-hcaptcha-section', + array( + 'field' => 'hcaptcha_invisible', + 'size' => 10, + 'desc' => __( 'When enabled, hCaptcha client/server interactions occur in the background, and the user will only be presented with a hCaptcha challenge if that user meets challenge criteria.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'hcaptcha_site_key', + __( 'Site Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-hcaptcha', + 'AcceptStripePayments-hcaptcha-section', + array( + 'field' => 'hcaptcha_site_key', + 'size' => 50, + 'desc' => __( 'Your hCaptcha Site Key.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'hcaptcha_secret_key', + __( 'Secret Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-hcaptcha', + 'AcceptStripePayments-hcaptcha-section', + array( + 'field' => 'hcaptcha_secret_key', + 'size' => 50, + 'desc' => __( 'Your hCaptcha Secret Key.', 'stripe-payments' ), + ) + ); + } + + public function show_settings_description() { + echo __( 'Click here to read the documentation to learn how to configure this and get API keys for your website.', 'stripe-payments' ); + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/hcaptcha/asp-hcaptcha-main.php b/wp-content/plugins/stripe-payments/includes/hcaptcha/asp-hcaptcha-main.php new file mode 100644 index 0000000..3b1a6df --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/hcaptcha/asp-hcaptcha-main.php @@ -0,0 +1,272 @@ +asp_main = AcceptStripePayments::get_instance(); + + $this->enabled = $this->asp_main->get_setting( 'captcha_type' ) === 'hcaptcha'; + + if ( ! empty( $this->asp_main->get_setting( 'hcaptcha_secret_key' ) ) && + ! empty( $this->asp_main->get_setting( 'hcaptcha_site_key' ) ) ) { + $this->keys_entered = true; + } + + add_action( 'wp_ajax_asp_hcaptcha_check', array( $this, 'ajax_hcaptcha_check' ) ); + add_action( 'wp_ajax_nopriv_asp_hcaptcha_check', array( $this, 'ajax_hcaptcha_check' ) ); + + if ( is_admin() ) { + require_once WP_ASP_PLUGIN_PATH . 'includes/hcaptcha/admin/asp-hcaptcha-admin-menu.php'; + new ASP_HCAPTCHA_Admin_Menu(); + } + + if ( $this->enabled ) { + add_action( 'asp_ng_before_token_request', array( $this, 'ng_before_token_request' ) ); + add_action( 'asp_ng_before_payment_processing', array( $this, 'ng_before_payment_processing' ) ); + add_action( 'asp_ng_do_additional_captcha_response_check', array( $this, 'ng_do_additional_captcha_response_check' ), 10, 2 ); + + if ( ! is_admin() ) { + add_filter( 'asp_ng_pp_data_ready', array( $this, 'ng_data_ready' ), 10, 2 ); + add_filter( 'asp_ng_pp_output_before_buttons', array( $this, 'ng_before_buttons' ), 10, 2 ); + add_action( 'asp_ng_pp_output_add_scripts', array( $this, 'ng_add_scripts' ) ); + add_filter( 'asp_ng_button_output_after_button', array( $this, 'ng_button_output_after_button' ), 10, 3 ); + } + } + } + + private function check_hcaptcha( $response ) { + $ret = array(); + $res = wp_remote_post( + 'https://hcaptcha.com/siteverify', + array( + 'body' => array( + 'secret' => $this->asp_main->get_setting( 'hcaptcha_secret_key' ), + 'response' => $response, + ), + ) + ); + if ( is_wp_error( $res ) ) { + $ret['error'] = __( 'hCaptcha: error occurred during API request.', 'stripe-payments' ) . ' ' . $res->get_error_message(); + return $ret; + } + + if ( $res['response']['code'] !== 200 ) { + $ret['error'] = __( 'hCaptcha: error occurred during API request. HTTP Error code:', 'stripe-payments' ) . ' ' . $res['response']['code']; + return $ret; + } + + $response = json_decode( $res['body'], true ); + + if ( is_null( $response ) ) { + $ret['error'] = __( 'hCaptcha: error occured parsing API response, invalid JSON data.', 'stripe-payments' ); + return $ret; + } + + if ( $response['success'] !== true ) { + $err_codes_str = ''; + if ( is_array( $response['error-codes'] ) ) { + foreach ( $response['error-codes'] as $error_code ) { + switch ( $error_code ) { + case 'invalid-input-response': + $err_codes_str .= __( 'The response parameter is invalid or malformed.', 'stripe-payments' ); + break; + case 'missing-input-secret': + $err_codes_str .= __( 'Secret key is missing.', 'stripe-payments' ); + break; + case 'invalid-input-secret': + $err_codes_str .= __( 'Secret key is invalid or malformed.', 'stripe-payments' ); + break; + case 'missing-input-response': + $err_codes_str .= __( 'The response parameter is missing.', 'stripe-payments' ); + break; + default: + $err_codes_str .= $error_code; + break; + } + } + } + $ret['error'] = __( 'hCaptcha: check failed. Following error(s) occurred:', 'stripe-payments' ) . ' ' . $err_codes_str; + return $ret; + } + return $ret; + } + + public function ajax_hcaptcha_check() { + $out = array(); + $payload = isset( $_POST['hcaptcha_response'] ) ? sanitize_text_field( stripslashes ( $_POST['hcaptcha_response'] ) ) : ''; + if ( empty( $payload ) ) { + $out['error'] = __( 'Empty hCaptcha response received.', 'stripe-payments' ); + wp_send_json( $out ); + } + + $out = $this->check_hcaptcha( $payload ); + + $sess = ASP_Session::get_instance(); + + if ( isset( $out['error'] ) ) { + $sess->set_transient_data( 'hCaptcha_checked', false ); + $sess->set_transient_data( 'hCaptcha_error', $out['error'] ); + } else { + ASP_Utils_Bot_Mitigation::record_captcha_solve_ip_time_data(); + + $sess->set_transient_data( 'hCaptcha_checked', true ); + $sess->set_transient_data( 'hCaptcha_tokens', $this->max_tokens ); + } + + wp_send_json( $out ); + } + + public function ng_do_additional_captcha_response_check( $item, $params ) { + + if ( !ASP_Utils_Bot_Mitigation::is_captcha_solve_ip_data_time_valid() ){ + ASP_Debug_Logger::log( 'hCaptcha - Additional captcha response check failed!', false ); + //Exit out to be safe. If some sites want more relaxed option, we can add an option to extend the timer. + exit; + } + + ASP_Debug_Logger::log( 'hCaptcha - Additional captcha response check done.', true ); + return true; + } + + public function ng_before_token_request( $item ) { + + $sess = ASP_Session::get_instance(); + + $checked = $sess->get_transient_data( 'hCaptcha_checked' ); + + if ( ! $checked ) { + $err = $sess->get_transient_data( 'hCaptcha_error' ); + if ( empty( $err ) ) { + $err = __( 'hCaptcha check failed.', 'stripe-payments' ); + } + wp_send_json( + array( + 'success' => false, + 'err' => $err, + ) + ); + } + + $tokens = $sess->get_transient_data( 'hCaptcha_tokens', 0 ); + + if ( $tokens <= 0 ) { + wp_send_json( + array( + 'success' => false, + 'err' => __( 'hCaptcha tokens expired. Please refresh the page and try again.', 'stripe-payments' ), + ) + ); + } + + $tokens--; + $sess->set_transient_data( 'hCaptcha_tokens', $tokens ); + + return true; + } + + public function ng_before_payment_processing( $post_data ) { + $sess = ASP_Session::get_instance(); + $sess->set_transient_data( 'hCaptcha_checked', false ); + $sess->set_transient_data( 'hCaptcha_error', false ); + } + + public function ng_before_buttons( $out, $data ) { + $invisible = $this->asp_main->get_setting( 'hcaptcha_invisible' ); + ob_start(); + ?> + +
+ +
This site is protected by hCaptcha and its +Privacy Policy and +Terms of Service apply.
+ + + enabled && ! $this->keys_entered ) { + $data['fatal_error'] = __( 'Please enter hCaptcha keys.', 'stripe-payments' ); + } + $addon = array( + 'name' => 'hCaptcha', + 'handler' => 'hCaptchaHandlerNG', + ); + $data['addons'][] = $addon; + $data['hcaptchaSiteKey'] = $this->asp_main->get_setting( 'hcaptcha_site_key' ); + $data['hcaptchaInvisible'] = $this->asp_main->get_setting( 'hcaptcha_invisible' ); + return $data; + } + + public function ng_add_scripts( $scripts ) { + $scripts[] = array( + 'footer' => true, + 'src' => 'https://js.hcaptcha.com/1/api.js?onload=onloadCallback&render=explicit', + ); + $scripts[] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/includes/hcaptcha/public/js/asp-hcaptcha-ng.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + return $scripts; + } + + public function ng_button_output_after_button( $output, $data, $class ) { + $prefetch = $this->asp_main->get_setting( 'frontend_prefetch_scripts' ); + if ( $prefetch ) { + if ( empty( $this->asp_main->sc_scripts_prefetched ) ) { + if ( ! isset( $this->asp_main->footer_scripts ) ) { + $this->asp_main->footer_scripts = ''; + } + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + } + } + return $output; + } + +} + +new ASP_HCAPTCHA_Main(); diff --git a/wp-content/plugins/stripe-payments/includes/hcaptcha/public/js/asp-hcaptcha-ng.js b/wp-content/plugins/stripe-payments/includes/hcaptcha/public/js/asp-hcaptcha-ng.js new file mode 100644 index 0000000..a792def --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/hcaptcha/public/js/asp-hcaptcha-ng.js @@ -0,0 +1,120 @@ +var hCaptchaLoaded = false; + +var hCaptchaHandlerNG = function (data) { + var parent = this; + parent.data = data; + parent.data.hcaptchaChecked = false; + parent.errCont = jQuery('#hcaptcha-error'); + + parent.init = function () { + if (hCaptchaLoaded) { + parent.hCaptchaRender(); + } + } + + parent.hCaptchaRender = function () { + if (typeof (parent.hcaptchaID) !== "undefined") { + return; + } + parent.hcaptchaID = hcaptcha.render('asp-hcaptcha-container', { + 'sitekey': vars.data.hcaptchaSiteKey, + 'badge': 'inline', + 'size': (vars.data.hcaptchaInvisible) ? 'invisible' : null, + 'callback': function (resp) { + if (resp !== '' && !parent.data.hcaptchaChecked) { + smokeScreen(true); + parent.errCont.hide(); + console.log('hCaptcha doing backend check'); + var ajaxData = 'action=asp_hcaptcha_check&hcaptcha_response=' + resp; + new ajaxRequest(vars.ajaxURL, ajaxData, + function (res) { + var resp = JSON.parse(res.responseText); + if (resp.error) { + console.log('fail'); + smokeScreen(false); + parent.data.hcaptchaChecked = false; + parent.errCont.html(resp.error).hide().fadeIn(); + hcaptcha.reset(); + } else { + console.log('success'); + parent.errCont.hide(); + parent.data.hcaptchaChecked = true; + if (vars.data.hcaptchaInvisible) { + if (vars.data.reConfirmToken) { + vars.data.reConfirmToken = false; + vars.data.canProceed = true; + handlePayment(); + return; + } + smokeScreen(false); + triggerEvent(form, 'submit'); + return; + } + smokeScreen(false); + } + }, + function (res, errMsg) { + smokeScreen(false); + parent.errCont.html(resp.err).hide().fadeIn(); + hcaptcha.reset(); + } + ); + } + }, + 'expired-callback': function () { + parent.data.hcaptchaChecked = false; + parent.data.hcaptchaKey = ''; + if (!vars.data.hcaptchaInvisible) { + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + }, + }); + } + + parent.csBeforeRegen = function () { + if (vars.data.hcaptchaInvisible && !parent.data.hcaptchaChecked) { + smokeScreen(true); + vars.data.doNotProceed = true; + vars.data.reConfirmToken = true; + hcaptcha.execute(); + } + } + + parent.confirmToken = function () { + if (vars.data.hcaptchaInvisible && !parent.data.hcaptchaChecked) { + smokeScreen(true); + vars.data.canProceed = false; + vars.data.reConfirmToken = true; + hcaptcha.execute(); + } + } + + parent.submitCanProceed = function () { + if (parent.data.hcaptchaChecked === false) { + vars.data.canProceed = false; + if (vars.data.isEvent && vars.data.hcaptchaInvisible) { + vars.data.canProceed = true; + return; + } + if (vars.data.hcaptchaInvisible) { + smokeScreen(true); + hcaptcha.execute(); + } else { + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + } + } +} + +function onloadCallback() { + console.log('hCaptcha onload'); + vars.data.addons.forEach(function (addon) { + if (addon.name === 'hCaptcha') { + if (addon.obj !== 'undefined') { + addon.obj.hCaptchaRender(); + } else { + hCaptchaLoaded = true; + } + } + }); +} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/index.html b/wp-content/plugins/stripe-payments/includes/index.html new file mode 100644 index 0000000..e69de29 diff --git a/wp-content/plugins/stripe-payments/includes/index.php b/wp-content/plugins/stripe-payments/includes/index.php new file mode 100644 index 0000000..e71af0e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/index.php @@ -0,0 +1 @@ +source->address_line1)) { + $addr_street = $charge->source->address_line1; + } + + if (empty($addr_zip) && ! empty($charge->source->address_zip)) { + $addr_zip = $charge->source->address_zip; + } + + if (empty($addr_city) && ! empty($charge->source->address_city)) { + $addr_city = $charge->source->address_city; + } + + if (empty($addr_state) && ! empty($charge->source->address_state)) { + $addr_state = $charge->source->address_state; + } + + if (empty($addr_country) && ! empty($charge->source->address_country)) { + $addr_country = $charge->source->address_country; + } + + //get address from new API payment data + $ipn = ASP_Process_IPN_NG::get_instance(); + + if (isset($ipn->p_data)) { + $addr = $ipn->p_data->get_billing_details(); + if ($addr) { + if (empty($addr_street) && ! empty($addr->line1)) { + $addr_street = $addr->line1; + } + if (empty($addr_zip) && ! empty($addr->postal_code)) { + $addr_zip = $addr->postal_code; + } + + if (empty($addr_city) && ! empty($addr->city)) { + $addr_city = $addr->city; + } + + if (empty($addr_state) && ! empty($addr->state)) { + $addr_state = $addr->state; + } + + if (empty($addr_country) && ! empty($addr->country)) { + $addr_country = $addr->country; + } + } + } + + if (! empty($addr_country)) { + //convert country code to country name + $countries = ASP_Utils::get_countries_untranslated(); + if (isset($countries[$addr_country])) { + $addr_country = $countries[$addr_country]; + } + } + + $ipn_data = array( + 'payer_email' => $data['stripeEmail'], + 'first_name' => $first_name, + 'last_name' => $last_name, + 'txn_id' => $data['txn_id'], + 'address_street' => $addr_street, + 'address_city' => $addr_city, + 'address_state' => $addr_state, + 'address_zip' => $addr_zip, + 'address_country' => $addr_country, + ); + + ASP_Debug_Logger::log('Calling swpm_handle_subsc_signup_stand_alone'); + + $swpm_id = ''; + if (SwpmMemberUtils::is_member_logged_in()) { + $swpm_id = SwpmMemberUtils::get_logged_in_members_id(); + } + + if (defined('SIMPLE_WP_MEMBERSHIP_PATH')) { + if (!function_exists('swpm_handle_subsc_signup_stand_alone')) { + require_once(SIMPLE_WP_MEMBERSHIP_PATH . 'ipn/swpm_handle_subsc_ipn.php'); + } + + swpm_handle_subsc_signup_stand_alone($ipn_data, $level_id, $data['txn_id'], $swpm_id); + } + } + + public function handle_swpm_account_connection($data, $charge) { + if (empty($data['product_id'])) { + return; + } + + $order_post_id = $data['order_post_id']; + + // Check if user is logged in + if (!SwpmMemberUtils::is_member_logged_in()) { + return; + } + + $member_id = SwpmMemberUtils::get_logged_in_members_id(); + if (!is_numeric($member_id)) { + return; + } + + // Valid swpm member ID found, let's save it to order meta; + update_post_meta($order_post_id, 'asp_product_swpm_member_id', $member_id); + + ASP_Debug_Logger::log('Connected SWPM member ID ' . $member_id . ' to order ID ' . $order_post_id); + } + + public function show_asp_swpm_purchase_history($atts) { + $is_logged_in = SwpmMemberUtils::is_member_logged_in(); + $member_id = SwpmMemberUtils::get_logged_in_members_id(); + + if (empty($is_logged_in) || !is_numeric($member_id)) { + return '

' . esc_html__('You need to be logged in to view your purchase history.', 'stripe-payments') . '

'; + } + + $atts = shortcode_atts(array( + 'show_downloads' => 0, + ), $atts); + + $show_downloads = boolval($atts['show_downloads']); + + // Get all order cpt (stripe_order) for this SWPM member by member ID by the 'asp_product_swpm_member_id' post meta. + $orders = get_posts(array( + 'post_type' => 'stripe_order', + 'posts_per_page' => -1, + 'field' => 'ids', + 'meta_query' => array( + array( + 'key' => 'asp_product_swpm_member_id', + 'value' => $member_id, + ), + ), + )); + + if (empty($orders)) { + return '

' . esc_html__('No purchase history found.', 'stripe-payments') . '

'; + } + + $transactions_data = array(); + + foreach ($orders as $order) { + $product_id = get_post_meta($order->ID, 'asp_product_id', true); + + if (empty($product_id)) { + continue; + } + + // $product_name = get_the_title($product_id); + $order_data = get_post_meta($order->ID, 'order_data', true); + + // Format the date using the saved wp date format string; + // $date_format = get_option('date_format') . ' ' . get_option('time_format'); + $date_format = get_option('date_format'); + $formatted_date = date($date_format, strtotime($order->post_date)); + + $product_name = isset($order_data['item_name']) ? sanitize_text_field($order_data['item_name']) : '-'; + $txn_id = isset($order_data['txn_id']) ? sanitize_text_field($order_data['txn_id']) : '-'; + $item_url = isset($order_data['item_url']) ? sanitize_url($order_data['item_url']) : ''; + $quantity = isset($order_data['item_quantity']) ? intval($order_data['item_quantity']) : 0; + $paid_amount = isset($order_data['paid_amount']) ? $order_data['paid_amount'] : 0; + $currency_code = isset($order_data['currency_code']) ? strtoupper($order_data['currency_code']) : 'USD'; + // Get the formatted amount with currency symbol + $paid_amount = ASP_Utils::formatted_price($paid_amount, $currency_code); + + $transactions_data[] = array( + 'product_name' => $product_name, + 'quantity' => $quantity, + 'txn_id' => $txn_id, + 'item_url' => $item_url, + 'purchase_date' => $formatted_date, + 'paid_amount' => $paid_amount, + ); + } + + $output = ''; + ob_start(); + ?> + +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ 1) { + echo ' x' . esc_html($txn['quantity']); + } + ?> + + + + + + + + + + +
+
+ sess = ASP_Session::get_instance(); + $this->process_ipn(); + } else { + //Legacy API is disabled, but request was made to it + ASP_Debug_Logger::log( 'Legacy API backend accessed while it is disabled.', false ); + wp_die( 'Access denied.' ); + } + } + } + } + + function ipn_completed( $errMsg = '' ) { + if ( ! empty( $errMsg ) ) { + $aspData = array( 'error_msg' => $errMsg ); + ASP_Debug_Logger::log( $errMsg, false ); //Log the error + + $msg_before_process = __( 'Error occurred before user interacted with payment popup. This might be caused by JavaScript errors on page.', 'stripe-payments' ); + $msg_after_process = __( 'Error occurred after user interacted with popup.', 'stripe-payments' ); + + if ( isset( $_POST['clickProcessed'] ) ) { + $additional_msg = $msg_after_process; + } else { + $additional_msg = $msg_before_process; + } + + ASP_Debug_Logger::log( $additional_msg, false ); + + $this->sess->set_transient_data( 'asp_data', $aspData ); + + //send email to notify site admin (if option enabled) + $opt = get_option( 'AcceptStripePayments-settings' ); + if ( isset( $opt['send_email_on_error'] ) && $opt['send_email_on_error'] ) { + $to = $opt['send_email_on_error_to']; + $from = get_option( 'admin_email' ); + $headers = 'From: ' . $from . "\r\n"; + $subj = __( 'Stripe Payments Error Details', 'stripe-payments' ); + $body = __( 'Following error occurred during payment processing:', 'stripe-payments' ) . "\r\n\r\n"; + $body .= $errMsg . "\r\n\r\n"; + $body .= $additional_msg . "\r\n"; + $body .= __( 'Debug data:', 'stripe-payments' ) . "\r\n"; + foreach ( $_POST as $key => $value ) { + $value = is_array( $value ) ? json_encode( $value ) : $value; + $body .= $key . ': ' . $value . "\r\n"; + } + wp_mail( $to, $subj, $body, $headers ); + } + } else { + ASP_Debug_Logger::log( 'Payment has been processed successfully.' ); + } + ASP_Debug_Logger::log( sprintf( 'Redirecting to results page "%s"', $this->aspRedirectURL ) . "\r\n" ); + wp_redirect( $this->aspRedirectURL ); + exit; + } + + function process_ipn() { + $asp_class = AcceptStripePayments::get_instance(); + + ASP_Debug_Logger::log( 'Payment processing started.' ); + + $post_thankyou_page_url = isset( $_POST['thankyou_page_url'] ) ? sanitize_text_field( $_POST['thankyou_page_url'] ) : false; + + $this->aspRedirectURL = empty( $post_thankyou_page_url ) ? $asp_class->get_setting( 'checkout_url' ) : base64_decode( $post_thankyou_page_url ); + + ASP_Debug_Logger::log( 'Triggering hook for addons to process posted data if needed.' ); + $process_result = apply_filters( 'asp_before_payment_processing', array(), $_POST ); + + if ( isset( $process_result ) && ! empty( $process_result ) ) { + if ( isset( $process_result['error'] ) && ! empty( $process_result['error'] ) ) { + $this->ipn_completed( $process_result['error'] ); + } + } + + //Check nonce + ASP_Debug_Logger::log( 'Checking received data.' ); + + if ( ! isset( $_POST['stripeToken'] ) || empty( $_POST['stripeToken'] ) ) { + $this->ipn_completed( 'Invalid Stripe Token' ); + } + if ( ! isset( $_POST['stripeTokenType'] ) || empty( $_POST['stripeTokenType'] ) ) { + $this->ipn_completed( 'Invalid Stripe Token Type' ); + } + + if ( ! isset( $_POST['stripeEmail'] ) || empty( $_POST['stripeEmail'] ) ) { + $this->ipn_completed( 'Invalid Request' ); + } + + $got_product_data_from_db = false; + + if ( isset( $_POST['stripeProductId'] ) && ! empty( $_POST['stripeProductId'] ) ) { + //got product ID. Let's try to get required data from database instead of $_POST data + $prod_id = intval( $_POST['stripeProductId'] ); + ASP_Debug_Logger::log( 'Got product ID: ' . $prod_id . '. Trying to get info from database.' ); + $post = get_post( $prod_id ); + if ( ! $post || get_post_type( $prod_id ) != ASPMain::$products_slug ) { + //this is not Stripe Payments product + $this->ipn_completed( 'Invalid product ID: ' . $prod_id ); + } + $item_name = $post->post_title; + + $currency_code = get_post_meta( $prod_id, 'asp_product_currency', true ); + + $currency_variable = get_post_meta( $prod_id, 'asp_product_currency_variable', true ); + + if ( $currency_variable ) { + $currency_code = sanitize_text_field( $_POST['stripeCurrency'] ); + } + + if ( ! $currency_code ) { + $currency_code = $asp_class->get_setting( 'currency_code' ); + } + + $item_quantity = get_post_meta( $prod_id, 'asp_product_quantity', true ); + + $item_custom_quantity = get_post_meta( $prod_id, 'asp_product_custom_quantity', true ); + + if ( $item_custom_quantity ) { + //custom quantity. Let's get the value from $_POST data + $item_custom_quantity = intval( $_POST['stripeCustomQuantity'] ); + } else { + $item_custom_quantity = false; + } + + $variable = false; + + $item_price = get_post_meta( $prod_id, 'asp_product_price', true ); + + if ( empty( $item_price ) ) { + //this is probably custom price + $variable = true; + $item_price = floatval( $_POST['stripeAmount'] ); + } + + //get tax and shipping amounts if applicable + + $tax = get_post_meta( $prod_id, 'asp_product_tax', true ); + + $shipping = floatval( get_post_meta( $prod_id, 'asp_product_shipping', true ) ); + + //let's apply filter so addons can change price, currency and shipping if needed + $price_arr = array( + 'price' => $item_price, + 'currency' => $currency_code, + 'shipping' => empty( $shipping ) ? false : $shipping, + 'variable' => $variable, + ); + $price_arr = apply_filters( 'asp_modify_price_currency_shipping', $price_arr ); + extract( $price_arr, EXTR_OVERWRITE ); + $item_price = $price; + $currency_code = $currency; + + //handle item url + $item_url = get_post_meta( $prod_id, 'asp_product_upload', true ); + + if ( ! empty( $item_url ) ) { + $item_url = base64_encode( $item_url ); + } else { + $item_url = ''; + } + + $post_item_url = isset( $_POST['item_url'] ) ? sanitize_text_field( $_POST['item_url'] ) : false; + + $button_key = isset( $_POST['stripeButtonKey'] ) ? sanitize_text_field( $_POST['stripeButtonKey'] ) : false; + + if ( empty( $button_key ) ) { + //let's generate our own button key + $price = AcceptStripePayments::apply_tax( $item_price, $tax, AcceptStripePayments::is_zero_cents( $currency_code ) ); + $price = AcceptStripePayments::apply_shipping( $price, $shipping, AcceptStripePayments::is_zero_cents( $currency_code ) ); + $price_in_cents = $price; + if ( ! AcceptStripePayments::is_zero_cents( $currency_code ) ) { + $price_in_cents = $price_in_cents * 100; + } + $button_key = md5( htmlspecialchars_decode( $item_name ) . $price_in_cents ); + } + + if ( ! empty( $post_item_url ) ) { + if ( $item_url !== $post_item_url ) { + $item_url = $post_item_url; + } + } + + $got_product_data_from_db = true; + + ASP_Debug_Logger::log( 'Got required product info from database.' ); + } + + if ( ! $got_product_data_from_db ) { + //couldn't get data from database by product ID for some reason. Getting data from $_POST instead + + if ( ! isset( $_POST['item_name'] ) || empty( $_POST['item_name'] ) ) { + $this->ipn_completed( 'Invalid Item name' ); + } + + if ( ! isset( $_POST['currency_code'] ) || empty( $_POST['currency_code'] ) ) { + $this->ipn_completed( 'Invalid Currency Code' ); + } + + $item_name = stripslashes( sanitize_text_field( $_POST['item_name'] ) ); + $item_quantity = sanitize_text_field( $_POST['item_quantity'] ); + $item_custom_quantity = isset( $_POST['stripeCustomQuantity'] ) ? intval( $_POST['stripeCustomQuantity'] ) : false; + $item_url = sanitize_text_field( $_POST['item_url'] ); + $button_key = sanitize_text_field( $_POST['stripeButtonKey'] ); + $reported_price = sanitize_text_field( $_POST['stripeItemPrice'] ); + + ASP_Debug_Logger::log( 'Checking price consistency.' ); + $calculated_button_key = md5( htmlspecialchars_decode( $item_name ) . $reported_price ); + + if ( $button_key !== $calculated_button_key ) { + $this->ipn_completed( 'Button Key mismatch. Expected ' . $button_key . ', calculated: ' . $calculated_button_key ); + } + $trans_name = 'stripe-payments-' . $button_key; + $trans = get_transient( $trans_name ); //Read the price for this item from the system. + + if ( empty( $trans ) ) { + $this->ipn_completed( "Can't check payment validity. Aborting." ); + } + + $item_price = $trans['price']; + + $tax = isset( $trans['tax'] ) ? $trans['tax'] : 0; + + $shipping = isset( $trans['shipping'] ) ? $trans['shipping'] : 0; + + $currency_code = strtoupper( sanitize_text_field( $_POST['currency_code'] ) ); + + if ( ! AcceptStripePayments::is_zero_cents( $currency_code ) ) { + $shipping = $shipping / 100; + } + } + + if ( empty( $item_price ) ) { //Custom amount + $item_price = floatval( $_POST['stripeAmount'] ); + } + + if ( ! is_numeric( $item_price ) ) { + $this->ipn_completed( 'Invalid item price: ' . $item_price ); + } + + $currencyCodeType = strtolower( $currency_code ); + + $stripeToken = sanitize_text_field( $_POST['stripeToken'] ); + $stripeTokenType = sanitize_text_field( $_POST['stripeTokenType'] ); + $stripeEmail = sanitize_email( $_POST['stripeEmail'] ); + $charge_description = sanitize_text_field( $_POST['charge_description'] ); + + $orig_item_price = $item_price; + + //check if we have variatons selected for the product + $variations = array(); + $varApplied = array(); + if ( $got_product_data_from_db && isset( $_POST['stripeVariations'] ) ) { + // we got variations posted. Let's get variations from product + $v = new ASPVariations( $prod_id ); + if ( ! empty( $v->variations ) ) { + //there are variations configured for the product + $posted_v = filter_var( $_POST['stripeVariations'], FILTER_UNSAFE_RAW, FILTER_REQUIRE_ARRAY ); + foreach ( $posted_v as $grp_id => $var_id ) { + $grp_id = sanitize_text_field( stripslashes( $grp_id )); + $var_id = sanitize_text_field( stripslashes( $var_id )); + + $var = $v->get_variation( $grp_id, $var_id[0] ); + if ( ! empty( $var ) ) { + $item_price = $item_price + $var['price']; + $variations[] = array( $var['group_name'] . ' - ' . $var['name'], $var['price'] ); + $varApplied[] = $var; + } + } + } else { + //no variations configured for the product + } + } + + //check if we we need to apply coupon + if ( isset( $prod_id ) && ! empty( $_POST['stripeCoupon'] ) ) { + $coupon_code = strtoupper( $_POST['stripeCoupon'] ); + ASP_Debug_Logger::log( sprintf( 'Coupon provided "%s"', $coupon_code ) ); + $coupon = AcceptStripePayments_CouponsAdmin::get_coupon( $coupon_code ); + if ( $coupon['valid'] ) { + if ( ! AcceptStripePayments_CouponsAdmin::is_coupon_allowed_for_product( $coupon['id'], $prod_id ) ) { + //coupon not allowed for this product + ASP_Debug_Logger::log( 'Coupon is not allowed for this product' ); + unset( $coupon ); + } else { + if ( $coupon['discountType'] === 'perc' ) { + $perc = AcceptStripePayments::is_zero_cents( $currency_code ) ? 0 : 2; + $discount_amount = round( $item_price * ( $coupon['discount'] / 100 ), $perc ); + } else { + $discount_amount = $coupon['discount']; + } + ASP_Debug_Logger::log( sprintf( 'Coupon is valid. Discount amount: %s', $discount_amount ) ); + $coupon['discountAmount'] = $discount_amount; + $item_price = $item_price - $discount_amount; + } + } else { + ASP_Debug_Logger::log( sprintf( 'Invalid coupon "%s", reason: %s', $coupon_code, $coupon['err_msg'] ) ); + unset( $coupon ); + } + } + + $amount = $item_price; + + //apply tax if needed + $tax_amt = AcceptStripePayments::get_tax_amount( $amount, $tax, AcceptStripePayments::is_zero_cents( $currency_code ) ); + + $amount = AcceptStripePayments::apply_tax( $amount, $tax, AcceptStripePayments::is_zero_cents( $currency_code ) ); + + if ( $item_custom_quantity !== false ) { //custom quantity + $item_quantity = $item_custom_quantity; + } + + if ( empty( $item_quantity ) ) { + $item_quantity = 1; + } + + $amount = ( $item_quantity !== 'NA' ? ( $amount * $item_quantity ) : $amount ); + + //add shipping cost + $amount = AcceptStripePayments::apply_shipping( $amount, $shipping, AcceptStripePayments::is_zero_cents( $currency_code ) ); + + $amount_in_cents = $amount; + + if ( ! AcceptStripePayments::is_zero_cents( $currency_code ) ) { + $amount_in_cents = $amount_in_cents * 100; + } + + $opt = get_option( 'AcceptStripePayments-settings' ); + + $data = array(); + $data['product_id'] = isset( $_POST['stripeProductId'] ) && ! empty( $_POST['stripeProductId'] ) ? intval( $_POST['stripeProductId'] ) : ''; + $data['is_live'] = $asp_class->get_setting( 'is_live' ); + $data['item_name'] = $item_name; + $data['stripeToken'] = $stripeToken; + $data['stripeTokenType'] = $stripeTokenType; + $data['stripeEmail'] = $stripeEmail; + $data['item_quantity'] = $item_quantity; + $data['item_price'] = $orig_item_price; + $data['discount_item_price'] = $item_price; + $data['paid_amount'] = $amount; + $data['amount_in_cents'] = $amount_in_cents; + $data['currency_code'] = $currency_code; + $data['charge_description'] = $charge_description; + $data['addonName'] = isset( $_POST['stripeAddonName'] ) ? sanitize_text_field( $_POST['stripeAddonName'] ) : ''; + $data['button_key'] = isset( $button_key ) ? $button_key : ''; + + //Coupon + if ( isset( $coupon ) ) { + $data['coupon'] = $coupon; + } + + //Custom Field + $data['custom_fields'] = array(); + if ( isset( $_POST['stripeCustomField'] ) ) { + $data['custom_fields'][] = array( + 'name' => sanitize_text_field( $_POST['stripeCustomFieldName'] ), + 'value' => sanitize_text_field( $_POST['stripeCustomField'] ), + ); + } + $data['custom_fields'] = apply_filters( 'asp_process_custom_fields', $data['custom_fields'], $data ); + + //Filter so addons can modify applied variations if needed + $variations = apply_filters( 'asp_filter_variations_display', $variations, $data ); + + ob_start(); + + ASP_Debug_Logger::log( 'Getting API keys and trying to create a charge.' ); + + ASP_Utils::load_stripe_lib(); + + if ( $data['is_live'] ) { + $sec_key = $asp_class->APISecKeyLive; + } else { + $sec_key = $asp_class->APISecKeyTest; + } + + \Stripe\Stripe::setApiKey( $sec_key ); + + //let addons process payment if needed + ASP_Debug_Logger::log( 'Firing pre-payment hook.' ); + $data = apply_filters( 'asp_process_charge', $data ); + + if ( empty( $data['charge'] ) && $amount_in_cents == 0 ) { + //looks like we have zero amount. We won't be really processing the charge as it would result in error, + //so we just make it look like it was actually processed. + $data['charge'] = new stdClass(); + $data['charge']->id = 0; + $data['charge']->created = time(); + } + + if ( empty( $data['charge'] ) ) { + ASP_Debug_Logger::log( 'Processing payment.' ); + + try { + + $charge_opts = array( + 'amount' => $amount_in_cents, + 'currency' => $currencyCodeType, + 'description' => $charge_description, + ); + + //Check if we need to add Receipt Email parameter + if ( isset( $opt['stripe_receipt_email'] ) && $opt['stripe_receipt_email'] == 1 ) { + $charge_opts['receipt_email'] = $stripeEmail; + } + + //Check if we need to add Don't Save Card parameter + if ( $opt['dont_save_card'] == 1 ) { + $charge_opts['source'] = $stripeToken; + } else { + + $customer_data = array( + 'email' => $stripeEmail, + 'card' => $stripeToken, + ); + + $customer_data = apply_filters( 'asp_customer_data_before_create', $customer_data ); + + $customer = \Stripe\Customer::create( $customer_data ); + + $charge_opts['customer'] = $customer->id; + } + + $charge_opts['metadata'] = array(); + + //Check if we need to include custom field in metadata + if ( ! empty( $data['custom_fields'] ) ) { + $cfStr = ''; + foreach ( $data['custom_fields'] as $cf ) { + $cfStr .= $cf['name'] . ': ' . $cf['value'] . ' | '; + } + $cfStr = rtrim( $cfStr, ' | ' ); + //trim the string as metadata value cannot exceed 500 chars + $cfStr = substr( $cfStr, 0, 499 ); + $charge_opts['metadata']['Custom Fields'] = $cfStr; + } + + //Check if we need to include variations data into metadata + if ( ! empty( $variations ) ) { + $varStr = ''; + foreach ( $variations as $variation ) { + $varStr .= '[' . $variation[0] . '], '; + } + $varStr = rtrim( $varStr, ', ' ); + //trim the string as metadata value cannot exceed 500 chars + $varStr = substr( $varStr, 0, 499 ); + $charge_opts['metadata']['Variations'] = $varStr; + } + + //Shipping address data (if any) + $shipping_address = ''; + $shipping_address .= isset( $_POST['stripeShippingName'] ) ? sanitize_text_field( $_POST['stripeShippingName'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressLine1'] ) ? sanitize_text_field( $_POST['stripeShippingAddressLine1'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressApt'] ) ? sanitize_text_field( $_POST['stripeShippingAddressApt'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressZip'] ) ? sanitize_text_field( $_POST['stripeShippingAddressZip'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressCity'] ) ? sanitize_text_field( $_POST['stripeShippingAddressCity'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressState'] ) ? sanitize_text_field( $_POST['stripeShippingAddressState'] ) . "\n" : ''; + $shipping_address .= isset( $_POST['stripeShippingAddressCountry'] ) ? sanitize_text_field( $_POST['stripeShippingAddressCountry'] ) . "\n" : ''; + $data['shipping_address'] = $shipping_address; + + if ( ! empty( $shipping_address ) ) { + //add shipping address to metadata + $shipping_address = str_replace( "\n", ', ', $shipping_address ); + $shipping_address = rtrim( $shipping_address, ', ' ); + $charge_opts['metadata']['Shipping Address'] = $shipping_address; + } + + $data['charge'] = \Stripe\Charge::create( $charge_opts ); + } catch ( Exception $e ) { + //If the charge fails (payment unsuccessful), this code will get triggered. + if ( ! empty( $data['charge']->failure_code ) ) { + $err_msg = $data['charge']->failure_code . ': ' . $data['charge']->failure_message; + } else { + $err_msg = $e->getMessage(); + } + $this->ipn_completed( $err_msg ); + } + } + + //Grab the charge ID and set it as the transaction ID. + $txn_id = $data['charge']->id; //$charge->balance_transaction; + //Core transaction data + $data['txn_id'] = $txn_id; //The Stripe charge ID + + $post_data = $data; + + //Billing address data (if any) + $billing_address = ''; + $billing_address .= isset( $_POST['stripeBillingName'] ) ? sanitize_text_field( $_POST['stripeBillingName'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressLine1'] ) ? sanitize_text_field( $_POST['stripeBillingAddressLine1'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressApt'] ) ? sanitize_text_field( $_POST['stripeBillingAddressApt'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressZip'] ) ? sanitize_text_field( $_POST['stripeBillingAddressZip'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressCity'] ) ? sanitize_text_field( $_POST['stripeBillingAddressCity'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressState'] ) ? sanitize_text_field( $_POST['stripeBillingAddressState'] ) . "\n" : ''; + $billing_address .= isset( $_POST['stripeBillingAddressCountry'] ) ? sanitize_text_field( $_POST['stripeBillingAddressCountry'] ) . "\n" : ''; + + if ( empty( $billing_address ) && ( isset( $data['product_id'] ) && get_post_meta( $data['product_id'], 'asp_product_collect_billing_addr', true ) ) ) { + //let's try to fetch billing address from payment data + $billing_address .= ! empty( $data['charge']->source->name ) ? $data['charge']->source->name . "\n" : ''; + $_POST['stripeBillingName'] = ! empty( $billing_address ) ? $billing_address : null; + $billing_address .= ! empty( $data['charge']->source->address_line1 ) ? $data['charge']->source->address_line1 . "\n" : ''; + $billing_address .= ! empty( $data['charge']->source->address_line2 ) ? $data['charge']->source->address_line2 . "\n" : ''; + $billing_address .= ! empty( $data['charge']->source->address_zip ) ? $data['charge']->source->address_zip . "\n" : ''; + $billing_address .= ! empty( $data['charge']->source->address_city ) ? $data['charge']->source->address_city . "\n" : ''; + $billing_address .= ! empty( $data['charge']->source->address_state ) ? $data['charge']->source->address_state . "\n" : ''; + $billing_address .= ! empty( $data['charge']->source->address_country ) ? $data['charge']->source->address_country . "\n" : ''; + } + + $post_data['billing_address'] = $billing_address; + + //get customer name + $name = isset( $_POST['stripeBillingName'] ) ? sanitize_text_field( $_POST['stripeBillingName'] ) : ''; + if ( empty( $name ) && ! empty( $data['charge']->source->name ) ) { + $name = $data['charge']->source->name; + } + $post_data['customer_name'] = $name; + + $purchase_date = date( 'Y-m-d H:i:s', $data['charge']->created ); + $purchase_date = get_date_from_gmt( $purchase_date, get_option( 'date_format' ) . ', ' . get_option( 'time_format' ) ); + + $post_data['purchase_date'] = $purchase_date; + + $post_data['additional_items'] = array(); + + //check if we need to add variations + if ( ! empty( $variations ) ) { + foreach ( $variations as $variation ) { + $post_data['additional_items'][ $variation[0] ] = $variation[1]; + } + } + + //check if we need to increase redeem coupon count + if ( isset( $coupon ) && $coupon['valid'] ) { + $curr_redeem_cnt = get_post_meta( $coupon['id'], 'asp_coupon_red_count', true ); + $curr_redeem_cnt++; + update_post_meta( $coupon['id'], 'asp_coupon_red_count', $curr_redeem_cnt ); + if ( isset( $data['is_trial'] ) ) { + //trial Subscription + $coupon['discountAmount'] = 0; + $data['discount_item_price'] = 0; + } + $post_data['coupon'] = $coupon; + $post_data['additional_items'][ sprintf( __( 'Coupon "%s"', 'stripe-payments' ), $coupon['code'] ) ] = floatval( '-' . $coupon['discountAmount'] ); + $post_data['additional_items'][ __( 'Subtotal', 'stripe-payments' ) ] = $data['discount_item_price']; + } + + if ( isset( $tax ) && ! empty( $tax ) ) { + $taxStr = apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ); + $post_data['additional_items'][ ucfirst( $taxStr ) ] = $tax_amt; + $post_data['tax_perc'] = $tax; + $post_data['tax'] = $tax_amt; + } + + if ( isset( $shipping ) && ! empty( $shipping ) ) { + $shipStr = apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ); + $post_data['additional_items'][ ucfirst( $shipStr ) ] = $shipping; + $post_data['shipping'] = $shipping; + } + + //Insert the order data to the custom post + $dont_create_order = $asp_class->get_setting( 'dont_create_order' ); + if ( ! $dont_create_order ) { + $order = new ASP_Order_Item(); + $order->create( empty( $data['product_id'] ) ? 0 : $data['product_id'] ); + $order_post_id = $order->update_legacy( $post_data, $data['charge'] ); + $order->change_status( 'paid' ); + $post_data['order_post_id'] = $order_post_id; + } + + // handle download item url + $item_url = apply_filters( 'asp_item_url_process', $item_url, $post_data ); + $item_url = base64_decode( $item_url ); + $post_data['item_url'] = $item_url; + + if ( ! empty( $varApplied ) ) { + //process variations URLs if needed + foreach ( $varApplied as $key => $var ) { + if ( ! empty( $var['url'] ) ) { + $var = apply_filters( 'asp_variation_url_process', $var, $post_data ); + $varApplied[ $key ] = $var; + } + } + } + + //add variations to the resulting array + $post_data['var_applied'] = $varApplied; + + ASP_Debug_Logger::log( 'Firing post-payment hooks.' ); + + //Action hook with the checkout post data parameters. + do_action( 'asp_stripe_payment_completed', $post_data, $data['charge'] ); + + //insert payment data into order info + if ( isset( $order_post_id ) ) { + update_post_meta( $order_post_id, 'order_data', $post_data ); + update_post_meta( $order_post_id, 'charge_data', $data['charge'] ); + } + + //Action hook with the order object. + if ( ! $dont_create_order ) { + do_action( 'AcceptStripePayments_payment_completed', $order, $data['charge'] ); + } + + if ( ! empty( $data['product_id'] ) ) { + //check if we need to deal with stock + if ( get_post_meta( $data['product_id'], 'asp_product_enable_stock', true ) ) { + $stock_items = intval( get_post_meta( $data['product_id'], 'asp_product_stock_items', true ) ); + $stock_items = $stock_items - $data['item_quantity']; + if ( $stock_items < 0 ) { + $stock_items = 0; + } + update_post_meta( $data['product_id'], 'asp_product_stock_items', $stock_items ); + $data['stock_items'] = $stock_items; + } + } + + //Let's handle email sending stuff + if ( isset( $opt['send_emails_to_buyer'] ) ) { + if ( $opt['send_emails_to_buyer'] ) { + $from = $opt['from_email_address']; + $to = $post_data['stripeEmail']; + $subj = $opt['buyer_email_subject']; + $body = asp_apply_dynamic_tags_on_email_body( $opt['buyer_email_body'], $post_data ); + + $subj = apply_filters( 'asp_buyer_email_subject', $subj, $post_data ); + $body = apply_filters( 'asp_buyer_email_body', $body, $post_data ); + $from = apply_filters( 'asp_buyer_email_from', $from, $post_data ); + + $headers = array(); + if ( ! empty( $opt['buyer_email_type'] ) && $opt['buyer_email_type'] === 'html' ) { + $headers[] = 'Content-Type: text/html; charset=UTF-8'; + $body = nl2br( $body ); + } + $headers[] = 'From: ' . $from; + + wp_mail( $to, $subj, $body, $headers ); + ASP_Debug_Logger::log( 'Notification email sent to buyer: ' . $to . ', From email address used: ' . $from ); + } + } + if ( isset( $opt['send_emails_to_seller'] ) ) { + if ( $opt['send_emails_to_seller'] ) { + $from = $opt['from_email_address']; + $to = $opt['seller_notification_email']; + $subj = $opt['seller_email_subject']; + $body = asp_apply_dynamic_tags_on_email_body( $opt['seller_email_body'], $post_data, true ); + + $subj = apply_filters( 'asp_seller_email_subject', $subj, $post_data ); + $body = apply_filters( 'asp_seller_email_body', $body, $post_data ); + $from = apply_filters( 'asp_seller_email_from', $from, $post_data ); + + $headers = array(); + if ( ! empty( $opt['seller_email_type'] ) && $opt['seller_email_type'] === 'html' ) { + $headers[] = 'Content-Type: text/html; charset=UTF-8'; + $body = nl2br( $body ); + } + $headers[] = 'From: ' . $from; + + wp_mail( $to, $subj, $body, $headers ); + ASP_Debug_Logger::log( 'Notification email sent to seller: ' . $to . ', From email address used: ' . $from ); + } + } + + $post_data['charge_date_raw'] = $data['charge']->created; + + $charge_date = date( 'Y-m-d H:i:s', $data['charge']->created ); + $charge_date = get_date_from_gmt( $charge_date, get_option( 'date_format' ) . ', ' . get_option( 'time_format' ) ); + + $post_data['charge_date'] = $charge_date; + + $this->sess->set_transient_data( 'asp_data', $post_data ); + + $this->ipn_completed(); + } +} + +AcceptStripePayments_Process_IPN::get_instance(); + +function asp_apply_dynamic_tags_on_email_body( $body, $post, $seller_email = false ) { + $product_details = __( 'Product Name', 'stripe-payments' ) . ': {item_name}' . "\n"; + $product_details .= __( 'Quantity', 'stripe-payments' ) . ': {item_quantity}' . "\n"; + $product_details .= __( 'Item Price', 'stripe-payments' ) . ': {item_price_curr}' . "\n"; + //check if there are any additional items available like tax and shipping cost + $product_details .= AcceptStripePayments::gen_additional_items( $post ); + $product_details .= '--------------------------------' . "\n"; + $product_details .= __( 'Total Amount', 'stripe-payments' ) . ': {purchase_amt_curr}' . "\n"; + + $varUrls = array(); + // check if we have variations applied with download links + if ( ! empty( $post['var_applied'] ) ) { + foreach ( $post['var_applied'] as $var ) { + if ( ! empty( $var['url'] ) ) { + $varUrls[] = $var['url']; + } + } + } + $download_str = ''; + if ( ! empty( $post['item_url'] ) ) { + $download_str = "\n\n" . __( 'Download link', 'stripe-payments' ) . ': ' . $post['item_url']; + } + if ( ! empty( $varUrls ) ) { + //show variations download link(s) + //those links will replace the one set for the product + if ( count( $varUrls ) === 1 ) { + $download_str = __( 'Download link', 'stripe-payments' ) . ': '; + } else { + $download_str = __( 'Download links', 'stripe-payments' ) . ":\n"; + } + foreach ( $varUrls as $url ) { + $download_str .= $url . "\n"; + } + } + + $product_details .= rtrim( $download_str, "\n" ); + + //Add link to order info if this is email to the seller + if ( $seller_email && isset( $post['order_post_id'] ) ) { + $product_details .= "\n\n" . __( 'Order Info: ', 'stripe-payments' ) . admin_url( 'post.php?post=' . $post['order_post_id'] . '&action=edit' ); + } + + $post['product_details'] = $product_details; + + //Get the product variations (if any) + $product_variations = AcceptStripePayments::gen_additional_items( $post ); + + $custom_field = ''; + if ( isset( $post['custom_fields'] ) ) { + foreach ( $post['custom_fields'] as $cf ) { + $custom_field .= $cf['name'] . ': ' . $cf['value'] . "\r\n"; + } + $custom_field = rtrim( $custom_field, "\r\n" ); + } + + $curr = $post['currency_code']; + + $currencies = AcceptStripePayments::get_currencies(); + if ( isset( $currencies[ $curr ] ) ) { + $curr_sym = $currencies[ $curr ][1]; + } else { + $curr_sym = ''; + } + + $item_price = AcceptStripePayments::formatted_price( $post['item_price'], false ); + + $item_price_curr = AcceptStripePayments::formatted_price( $post['item_price'], $post['currency_code'] ); + $post['item_price_curr'] = $item_price_curr; + + $purchase_amt = AcceptStripePayments::formatted_price( $post['paid_amount'], false ); + + $purchase_amt_curr = AcceptStripePayments::formatted_price( $post['paid_amount'], $post['currency_code'] ); + $post['purchase_amt_curr'] = $purchase_amt_curr; + + $tax = 0; + $tax_amt = 0; + $shipping = 0; + + if ( isset( $post['tax_perc'] ) && ! empty( $post['tax_perc'] ) ) { + $tax = $post['tax_perc'] . '%'; + } + if ( isset( $post['tax'] ) && ! empty( $post['tax'] ) ) { + $tax_amt = AcceptStripePayments::formatted_price( $post['tax'], $post['currency_code'] ); + } + if ( isset( $post['shipping'] ) && ! empty( $post['shipping'] ) ) { + $shipping = AcceptStripePayments::formatted_price( $post['shipping'], $post['currency_code'] ); + } + + if ( isset( $post['charge']->object ) && 'charge' !== $post['charge']->object ) { + //this is most likely subs product + $ipn = ASP_Process_IPN_NG::get_instance(); + if ( isset( $ipn->p_data ) ) { + $obj = $ipn->p_data->get_obj(); + + if ( isset( $obj->latest_invoice ) + && isset( $obj->latest_invoice->charge ) + && is_object( $obj->latest_invoice->charge ) ) { + $post['charge'] = $obj->latest_invoice->charge; + } + } + } + + $pm_type = ''; + $card_brand = ''; + $card_last4 = ''; + + if ( isset( $post['charge']->object ) && 'charge' === $post['charge']->object ) { + + $pm_type = $post['charge']->payment_method_details->type; + + if ( isset( $post['charge']->payment_method_details->card ) ) { + $card_brand = $post['charge']->payment_method_details->card->brand; + $card_last4 = $post['charge']->payment_method_details->card->last4; + } + } + + $first_name = isset($post['customer_first_name']) && !empty($post['customer_first_name']) ? $post['customer_first_name'] : ''; + $last_name = isset($post['customer_last_name']) && !empty($post['customer_last_name']) ? $post['customer_last_name'] : ''; + + if (empty($first_name) && empty($last_name)){ + // First name, last name explicitly not set. Try to get them from full name. + if ( ! empty( $post['customer_name'] ) ) { + $parts = explode( ' ', $post['customer_name'], 2 ); + $first_name = ! empty( $parts[0] ) ? $parts[0] : ''; + $last_name = ! empty( $parts[1] ) ? $parts[1] : ''; + } + } + + $logged_in_user_id = isset($post['logged_in_user_id']) && ! empty( $post['logged_in_user_id'] ) ? $post['logged_in_user_id'] : ''; + $logged_in_user_name = isset($post['logged_in_user_name']) && ! empty( $post['logged_in_user_name'] ) ? $post['logged_in_user_name'] : ''; + + $item_description = ''; + $product_url = ''; + $surcharge_total_amt = ''; + $surcharge_label = ''; + if ( isset( $post['product_id'] ) ){ + // Retrieve product item from product id. + $product_item = new ASP_Product_Item( $post['product_id'] ); + $product_type = $product_item->get_type(); + if ( in_array($product_type, array('one_time', 'donation')) ) { + $surcharge_label = $product_item->get_surcharge_label(); + if (isset($post['additional_items'][$surcharge_label])) { + $surcharge_total_amt = AcceptStripePayments::formatted_price($post['additional_items'][$surcharge_label], $post['currency_code']); + } + } + + $item_description = get_post_field('post_content', $post['product_id']); + $product_url = get_permalink( $post['product_id'] ); + } + + $tags = array( + '{item_name}', + '{item_short_desc}', + '{item_description}', + '{item_quantity}', + '{item_url}', + '{download_url}', + '{payer_email}', + '{customer_name}', + '{first_name}', + '{last_name}', + '{transaction_id}', + '{item_price}', + '{item_price_curr}', + '{purchase_amt}', + '{purchase_amt_curr}', + '{tax}', + '{tax_amt}', + '{shipping_amt}', + '{currency}', + '{currency_code}', + '{purchase_date}', + '{shipping_address}', + '{billing_address}', + '{custom_field}', + '{coupon_code}', + '{card_brand}', + '{card_last_4}', + '{payment_method}', + '{product_variations}', + '{product_url}', + '{logged_in_user_name}', + '{logged_in_user_id}', + '{surcharge_total_amt}', + '{surcharge_label}', + ); + $vals = array( + $post['item_name'], + $post['charge_description'], + $item_description, + $post['item_quantity'], + ! empty( $post['item_url'] ) ? $post['item_url'] : '', + ! empty( $post['item_url'] ) ? $post['item_url'] : '', + $post['stripeEmail'], + $post['customer_name'], + $first_name, + $last_name, + $post['txn_id'], + $item_price, + $post['item_price_curr'], + $purchase_amt, + $post['purchase_amt_curr'], + $tax, + $tax_amt, + $shipping, + $curr_sym, + $curr, + $post['purchase_date'], + isset( $post['shipping_address'] ) ? $post['shipping_address'] : '', + isset( $post['billing_address'] ) ? $post['billing_address'] : '', + $custom_field, + ! empty( $post['coupon_code'] ) ? $post['coupon_code'] : '', + $card_brand, + $card_last4, + $pm_type, + $product_variations, + $product_url, + $logged_in_user_name, + $logged_in_user_id, + $surcharge_total_amt, + $surcharge_label, + ); + + //let's combine tags and vals into one array so we can apply filters on it + $tags_vals = array( + 'tags' => $tags, + 'vals' => $vals, + ); + $tags_vals = apply_filters( 'asp_email_body_tags_vals_before_replace', $tags_vals, $post ); + $tags = $tags_vals['tags']; + $vals = $tags_vals['vals']; + + $product_details = str_replace( $tags, $vals, $product_details ); + $tags[] = '{product_details}'; + $vals[] = $product_details; + + $body = stripslashes( str_replace( $tags, $vals, $body ) ); + + //let's apply a filter for the email body. + $body = apply_filters( 'asp_email_body_after_replace', $body ); + + //make tags and vals available for checkout results page by storing those in inner session + if ( ! $seller_email ) { + $sess = ASP_Session::get_instance(); + $sess->set_transient_data( 'asp_checkout_data_tags', $tags ); + $sess->set_transient_data( 'asp_checkout_data_vals', $vals ); + } + + return $body; +} diff --git a/wp-content/plugins/stripe-payments/includes/recaptcha/admin/asp-recaptcha-admin-menu.php b/wp-content/plugins/stripe-payments/includes/recaptcha/admin/asp-recaptcha-admin-menu.php new file mode 100644 index 0000000..c22f9a0 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/recaptcha/admin/asp-recaptcha-admin-menu.php @@ -0,0 +1,110 @@ +asp_admin = AcceptStripePayments_Admin::get_instance(); + $this->plugin_slug = $this->asp_admin->plugin_slug; + + if ( file_exists( WP_PLUGIN_DIR . '/stripe-payments-recaptcha/asp-recaptcha-main.php' ) ) { + AcceptStripePayments_Admin::add_admin_notice( + 'warning', + 'Stripe Payments: ' . + __( 'reCaptcha add-on is a part of core plugin now. Please delete "Stripe Payments reCapthca Addon" plugin to prevent potential issues.', 'stripe-payments' ) . + '

' . esc_html( __( 'Click here to see the plugin on Plugins page.', 'stripe-payments' ) ) . '', + false + ); + } + + add_action( 'admin_init', array( $this, 'register_settings' ) ); + add_filter( 'asp-admin-settings-addon-field-display', array( $this, 'field_display' ), 10, 2 ); + add_filter( 'apm-admin-settings-sanitize-field', array( $this, 'sanitize_settings' ), 10, 2 ); + } + + public function sanitize_settings( $output, $input ) { + //$output['recaptcha_invisible'] = isset( $input['recaptcha_invisible'] ) ? 1 : 0; + $output['recaptcha_invisible'] = 0; + + $output['recaptcha_site_key'] = sanitize_text_field( $input['recaptcha_site_key'] ); + + $output['recaptcha_secret_key'] = sanitize_text_field( $input['recaptcha_secret_key'] ); + + if ( $output['captcha_type'] === 'recaptcha' ) { + if ( empty( $output['recaptcha_site_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter reCaptcha Site Key.', 'stripe-payments' ) ); + } + if ( empty( $output['recaptcha_secret_key'] ) ) { + add_settings_error( 'AcceptStripePayments-settings', 'invalid-credentials', __( 'Please enter reCaptcha Secret Key.', 'stripe-payments' ) ); + } + } + return $output; + } + + public function field_display( $field, $field_value ) { + $ret = array(); + switch ( $field ) { + case 'recaptcha_invisible': + $ret['field'] = 'checkbox'; + $ret['field_name'] = $field; + break; + default: + break; + } + if ( ! empty( $ret ) ) { + return $ret; + } else { + return $field; + } + } + + public function register_settings() { + add_settings_section( 'AcceptStripePayments-recaptcha-section', __( 'reCAPTCHA Settings', 'stripe-payments' ), array( $this, 'show_settings_description' ), $this->plugin_slug . '-recaptcha' ); + + // add_settings_field( + // 'recaptcha_invisible', + // __( 'Use Invisible reCAPTCHA Badge', 'stripe-payments' ), + // array( $this->asp_admin, 'settings_field_callback' ), + // $this->plugin_slug . '-recaptcha', + // 'AcceptStripePayments-recaptcha-section', + // array( + // 'field' => 'recaptcha_invisible', + // 'size' => 10, + // 'desc' => __( 'It is recommended to use the "I am not a robot" checkbox captcha option for better payment button protection. However, if you want to enable this option then you must enter reCAPTCHA v2 Invisible badge API Keys below.', 'stripe-payments' ), + // ) + // ); + + add_settings_field( + 'recaptcha_site_key', + __( 'Site Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-recaptcha', + 'AcceptStripePayments-recaptcha-section', + array( + 'field' => 'recaptcha_site_key', + 'size' => 50, + 'desc' => __( 'Your reCaptcha Site Key.', 'stripe-payments' ), + ) + ); + + add_settings_field( + 'recaptcha_secret_key', + __( 'Secret Key', 'stripe-payments' ), + array( $this->asp_admin, 'settings_field_callback' ), + $this->plugin_slug . '-recaptcha', + 'AcceptStripePayments-recaptcha-section', + array( + 'field' => 'recaptcha_secret_key', + 'size' => 50, + 'desc' => __( 'Your reCaptcha Secret Key.', 'stripe-payments' ), + ) + ); + } + + public function show_settings_description() { + echo __( 'Click here to read the documentation to learn how to configure this and get API keys for your website.', 'stripe-payments' ); + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/recaptcha/asp-recaptcha-main.php b/wp-content/plugins/stripe-payments/includes/recaptcha/asp-recaptcha-main.php new file mode 100644 index 0000000..5cdb35a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/recaptcha/asp-recaptcha-main.php @@ -0,0 +1,351 @@ +asp_main = AcceptStripePayments::get_instance(); + + $this->enabled = $this->asp_main->get_setting( 'captcha_type' ) === 'recaptcha'; + + if ( ! empty( $this->asp_main->get_setting( 'recaptcha_secret_key' ) ) && + ! empty( $this->asp_main->get_setting( 'recaptcha_site_key' ) ) ) { + $this->keys_entered = true; + } + + add_action( 'wp_ajax_asp_recaptcha_check', array( $this, 'ajax_recaptcha_check' ) ); + add_action( 'wp_ajax_nopriv_asp_recaptcha_check', array( $this, 'ajax_recaptcha_check' ) ); + + if ( is_admin() ) { + include_once WP_ASP_PLUGIN_PATH . 'includes/recaptcha/admin/asp-recaptcha-admin-menu.php'; + new ASP_RECAPTCHA_Admin_Menu(); + } + + if ( $this->enabled ) { + add_action( 'asp_ng_before_token_request', array( $this, 'ng_before_token_request' ) ); + add_action( 'asp_ng_before_payment_processing', array( $this, 'ng_before_payment_processing' ) ); + add_action( 'asp_ng_do_additional_captcha_response_check', array( $this, 'ng_do_additional_captcha_response_check' ), 10, 2 ); + + if ( ! is_admin() ) { + add_filter( 'asp-button-output-data-ready', array( $this, 'data_ready' ), 10, 2 ); + add_filter( 'asp-button-output-additional-styles', array( $this, 'output_styles' ) ); + add_action( 'asp-button-output-register-script', array( $this, 'register_script' ) ); + add_action( 'asp-button-output-enqueue-script', array( $this, 'enqueue_script' ) ); + add_filter( 'asp-button-output-after-button', array( $this, 'after_button' ), 10, 3 ); + add_filter( 'asp_before_payment_processing', array( $this, 'before_payment_processing' ), 10, 2 ); + + add_filter( 'asp_ng_pp_data_ready', array( $this, 'ng_data_ready' ), 10, 2 ); + add_filter( 'asp_ng_pp_output_before_buttons', array( $this, 'ng_before_buttons' ), 10, 2 ); + add_action( 'asp_ng_pp_output_add_scripts', array( $this, 'ng_add_scripts' ) ); + add_filter( 'asp_ng_button_output_after_button', array( $this, 'ng_button_output_after_button' ), 10, 3 ); + } + } + } + + private function check_recatpcha( $response ) { + $ret = array(); + $res = wp_remote_post( + 'https://www.google.com/recaptcha/api/siteverify', + array( + 'body' => array( + 'secret' => $this->asp_main->get_setting( 'recaptcha_secret_key' ), + 'response' => $response, + ), + ) + ); + if ( is_wp_error( $res ) ) { + $ret['error'] = __( 'reCaptcha: error occurred during API request.', 'stripe-payments' ) . ' ' . $res->get_error_message(); + return $ret; + } + + if ( $res['response']['code'] !== 200 ) { + $ret['error'] = __( 'reCaptcha: error occurred during API request. HTTP Error code:', 'stripe-payments' ) . ' ' . $res['response']['code']; + return $ret; + } + + $response = json_decode( $res['body'], true ); + + if ( is_null( $response ) ) { + $ret['error'] = __( 'reCaptcha: error occured parsing API response, invalid JSON data.', 'stripe-payments' ); + return $ret; + } + + if ( $response['success'] !== true ) { + $err_codes_str = ''; + if ( is_array( $response['error-codes'] ) ) { + foreach ( $response['error-codes'] as $error_code ) { + switch ( $error_code ) { + case 'invalid-input-response': + $err_codes_str .= __( 'The response parameter is invalid or malformed.', 'stripe-payments' ); + break; + case 'missing-input-secret': + $err_codes_str .= __( 'Secret key is missing.', 'stripe-payments' ); + break; + case 'invalid-input-secret': + $err_codes_str .= __( 'Secret key is invalid or malformed.', 'stripe-payments' ); + break; + case 'missing-input-response': + $err_codes_str .= __( 'The response parameter is missing.', 'stripe-payments' ); + break; + default: + $err_codes_str .= $error_code; + break; + } + } + } + $ret['error'] = __( 'reCaptcha: check failed. Following error(s) occurred:', 'stripe-payments' ) . ' ' . $err_codes_str; + return $ret; + } + return $ret; + } + + public function ajax_recaptcha_check() { + $out = array(); + $payload = isset( $_POST['recaptcha_response'] ) ? sanitize_text_field( stripslashes ( $_POST['recaptcha_response'] ) ) : ''; + if ( empty( $payload ) ) { + $out['error'] = __( 'Empty reCaptcha response received.', 'stripe-payments' ); + wp_send_json( $out ); + } + + $out = $this->check_recatpcha( $payload ); + + $sess = ASP_Session::get_instance(); + + if ( isset( $out['error'] ) ) { + $sess->set_transient_data( 'reCaptcha_checked', false ); + $sess->set_transient_data( 'reCaptcha_error', $out['error'] ); + } else { + ASP_Utils_Bot_Mitigation::record_captcha_solve_ip_time_data(); + + $sess->set_transient_data( 'reCaptcha_checked', true ); + $sess->set_transient_data( 'reCaptcha_tokens', $this->max_tokens ); + } + + wp_send_json( $out ); + } + + public function ng_do_additional_captcha_response_check( $item, $params ) { + + if ( !ASP_Utils_Bot_Mitigation::is_captcha_solve_ip_data_time_valid() ){ + ASP_Debug_Logger::log( 'Additional captcha response check failed!', false ); + //Exit out silently. Do not go ahead with the request processing. + //If some sites want more relaxed option, we can add an option to extend the expiry timer maybe. + exit; + } + + ASP_Debug_Logger::log( 'Additional captcha response check done.', true ); + return true; + } + + public function ng_before_token_request( $item ) { + + $sess = ASP_Session::get_instance(); + + $checked = $sess->get_transient_data( 'reCaptcha_checked' ); + + if ( ! $checked ) { + $err = $sess->get_transient_data( 'reCaptcha_error' ); + if ( empty( $err ) ) { + $err = __( 'reCaptcha check failed.', 'stripe-payments' ); + } + wp_send_json( + array( + 'success' => false, + 'err' => $err, + ) + ); + } + + $tokens = $sess->get_transient_data( 'reCaptcha_tokens', 0 ); + + if ( $tokens <= 0 ) { + wp_send_json( + array( + 'success' => false, + 'err' => __( 'reCaptcha tokens expired. Please refresh the page and try again.', 'stripe-payments' ), + ) + ); + } + + $tokens--; + $sess->set_transient_data( 'reCaptcha_tokens', $tokens ); + + return true; + } + + public function ng_before_payment_processing( $post_data ) { + $sess = ASP_Session::get_instance(); + $sess->set_transient_data( 'reCaptcha_checked', false ); + $sess->set_transient_data( 'reCaptcha_error', false ); + } + + public function ng_before_buttons( $out, $data ) { + //$invisible = $this->asp_main->get_setting( 'recaptcha_invisible' ); + $invisible = false; + ob_start(); + ?> + +
+ + asp_main->get_setting( 'recaptcha_site_key' ); + //$data['recaptchaInvisible'] = $this->asp_main->get_setting( 'recaptcha_invisible' ); + return $data; + } + + public function ng_data_ready( $data, $atts ) { + if ( $this->enabled && ! $this->keys_entered ) { + $data['fatal_error'] = __( 'Please enter reCaptcha keys.', 'stripe-payments' ); + } + $addon = array( + 'name' => 'reCaptcha', + 'handler' => 'reCaptchaHandlerNG', + ); + $data['addons'][] = $addon; + $data['recaptchaSiteKey'] = $this->asp_main->get_setting( 'recaptcha_site_key' ); + return $data; + } + + public function ng_add_scripts( $scripts ) { + $scripts[] = array( + 'footer' => true, + 'src' => 'https://www.google.com/recaptcha/api.js?onload=onloadCallback&render=explicit', + ); + $scripts[] = array( + 'footer' => true, + 'src' => WP_ASP_PLUGIN_URL . '/includes/recaptcha/public/js/asp-recaptcha-ng.js?ver=' . WP_ASP_PLUGIN_VERSION, + ); + return $scripts; + } + + public function ng_button_output_after_button( $output, $data, $class ) { + $prefetch = $this->asp_main->get_setting( 'frontend_prefetch_scripts' ); + if ( $prefetch ) { + if ( empty( $this->asp_main->sc_scripts_prefetched ) ) { + if ( ! isset( $this->asp_main->footer_scripts ) ) { + $this->asp_main->footer_scripts = ''; + } + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + } + } + return $output; + } + + public function before_payment_processing( $ret, $post ) { + if ( ! isset( $post['recaptchaKey'] ) || empty( $post['recaptchaKey'] ) ) { + $ret['error'] = __( 'reCaptcha: missing user response data.', 'stripe-payments' ); + return $ret; + } + $payload = sanitize_text_field( $post['recaptchaKey'] ); + + $ret = $this->check_recatpcha( $payload ); + + return $ret; + } + + public function output_styles( $output ) { + ob_start(); + ?> + + +
+
+
+ div{height:2px;width:100%}.iziModal .iziModal-header{background:#88a0b9;padding:14px 18px 15px;box-shadow:inset 0 -10px 15px -12px rgba(0,0,0,.3),0 0 0 #555;overflow:hidden;position:relative;z-index:10}.iziModal .iziModal-header-icon{font-size:40px;color:rgba(255,255,255,.5);padding:0 15px 0 0;margin:0;float:left}.iziModal .iziModal-header-title{color:#fff;font-size:18px;font-weight:600;line-height:1.3}.iziModal .iziModal-header-subtitle{color:rgba(255,255,255,.6);font-size:12px;line-height:1.45}.iziModal .iziModal-header-subtitle,.iziModal .iziModal-header-title{display:block;margin:0;padding:0;font-family:'Lato',Arial;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;text-align:left}.iziModal .iziModal-header-buttons{position:absolute;top:50%;right:10px;margin:-17px 0 0}.iziModal .iziModal-button{display:block;float:right;z-index:2;outline:0;height:34px;width:34px;border:0;padding:0;margin:0;opacity:.3;border-radius:50%;transition:transform .5s cubic-bezier(.16,.81,.32,1),opacity .5s ease;background-size:67%!important;-webkit-tap-highlight-color:transparent}.iziModal .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6ODZCQkIzQ0I0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6ODZCQkIzQ0M0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDo4NkJCQjNDOTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDo4NkJCQjNDQTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PsgTJLcAAALJSURBVHja3JnLS1VBHMfvQ7g9dBXRRrwEFRciAhMi1JRW1aIHVEIYEkW0iVpUhOD/ICK6cFMgSbUpC6VFkQa9NtpjkauriRY9Noa3pHT8/mIODMM5Or85o87pC5/NPf5mvmc8M7+Z36SFEKkY2gj2gUawF2wHW8A6+fwv+A6KYAQMg+dg2rbDtKXhGnAaHJIms4zYz9J4HxgAf1g9k2EGteAhWBBuNApaQNrUg6nRTaAbzIuV0RCocWW4DoyJlVcJXI5ruFk2tJqi/2TWxvA5sXbqA2Ucw01i7dVjargazAo/dE33p6/DlAheg50pP0SJpwG8CH7IaH/Q5pFZUhnoArkwwwVwJeWfdoMLYYZvqG+yTGo9CerAoIWBT+A4qAdPDWOugwo1NVcxJtpFZRLkwH3GJCqCghJfxVjnz1JMMMKnwAbGRAg0B5rAA4O4CblZ+qj8tkBjZthvSzDCtFIMM0ZpQhslk5Eej4jpZ/T7G+ygwG1ghrk+jjNMFy1eMPJzpOAzlou6iWmXZkm91EBHjEwUZXoQTDk2SxqhRh7HTJ9hpstB3rFZ0ldq6J2DnB9m2rXZfxOPlrX1DrJRXiaBXSHPaMHvB0cd9JPLpBImMvzLQTuUFA6A9yHPfoIjhsllOc1l5N4grtmDWgYrl5+JTUZcSjNkeMyxWdpA3ZN72IJj01OJTByJS82J2/wQVxmB5y1HK8x0JWMf/kzdD98FJcY5S51gdwyTQl6eUAraspo27PeWXgy8afim0+CELAwOWHyH9EkdkyWwJ4Yxk6BCP+bTm48anutWW5dAp34IpbW03UOzb0FPVEHbx0LKfvAyqpAyKw97JU8Mt6pml6rAJ6oY6Eu5NfvfF7QTeWWQyEsZr6694lwsNoPD8mKRo29gCNwGj7gXi7aGA1EBcY+8vq0GW8FmJb3Pgx9gEnwAr8Ab8MW2w0UBBgAVyyyaohV7ewAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6RTBBOUI4RUM0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6RTBBOUI4RUQ0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpFMEE5QjhFQTRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDpFMEE5QjhFQjRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PrQO6gAAAANmSURBVHjazJlbSBRRGMd3x92i0ForRRMiKiUoX4ouiFlJkRVBDxW9GJERwUasvdRT9FD00osRQtAFqegGBUHRBY0uaCVKEkSRpVR0tSwrQtp1+p/4Bk7D7M45M/Ot/uGHu+Psmf+c+eY753wnbJpmyIfGgvmgiv6WgkKQBwzwE3wBr0AnuAta6ZgnhT0aFuY2ghoyGdH4bS+4Dc6CZjCkdWVhWIPF4JoZnB6CDToeVE8sBidNPt0E5UEZrgG9Jr8GwHa/huMgaWZXDSDsxfBuc/jUBAwdw3Fz+NWoang5SJkjQwm7P3seLqQEX2LLfgfBdZcMORMcBqNDwekPqASP0uXhpjR3Ok0x/fUw9HIHGGVdw5DuRtzJpgxDsJui2qOWmuaAOuuLbHivz4YLwLgQj/aAXNmwuItlHhtbA7pAG5jEZHgKWCcbrhUTIY+NPQVjqFFObbYMi/hc6aOhl2AJ9TKnFoIyYXgemKEzJQXVVkyR3oFVzKZFuqw2qHdyFPKhrHPgMoWC3fRjRtNVVg+7SR5IiqmXxUt60cG0CK/vTIZniZVCmcKJF0C3ZNjKBqvJ9Hrwm46tsN1EkCoRQ/M3fBjvs6GrYAvdwHEfGcd1qBaGkwoxrKI+xjz83yJ0iLFHApd46X4xX+M+WECh4lepCNUIcpnMijrEWtAvTRHrbOd8FZNG8uA2Nf0hpmwtjBPwpQ5T0GPS/+tBAZhIq+b3Lu09EyHRwRgO+0C+7dhWcII+PwCf6Sk/Aa9d2vtn+A7nyASugJiD6YSDQcOlvVbxiCaAN8xrs3sgprBiac/QhlhnzjUo6JuZM0UlDS5FPtoQIdNlPYJTWUihFaDex+9Pg6T1KHJAJ2NI7ASllA28hEQ/KJIXoSlwgKlnh+jFe+GjLtwIPtjfyktUt+UaUZWqvw7H3oJD1peI7eQdoF1xWa+zQikHH13OmwqmOxxP0EiZtgK/DRwNuIcHwSeXc2K01WAPhbhKBb5hBNTVbskVH7fqpZGhbJUNtYF83fqwQSXPbOsGjb6etwx2gcEsmT3iFAZeNmUqaMeHSz2qu0k6W15Rqsx3B2i0D+xXGAHTFrRVlEeFuVoqH+ku6VNUbDkPzlAtg30nVK66i8rRIjAbTKaSQVQyN0DD6nOqcLZQld9TLfmvAAMAeMcvp3eCFqQAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MkFFRTU5NDA0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MkFFRTU5NDE0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDoyQUVFNTkzRTRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyQUVFNTkzRjRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuDFfX8AAANASURBVHjazJlZSBVRGMfHcWlB0xZM68GKukQLYaGkmEUR2EsvRfQS+BSJPUQE+lTR8hqIZY8hFS0ERVCRoW3gpUApghYpszLTVnCB3O70/+K7MAwzc78Z58z4hx8XzpzvzJ+Zc+d85ztphmFoU9BsUAoq+XcFyAc5QAfD4BfoBp3gCWjnNl9K82mYzO0FVWwyw0NsD3gIroBWkPB0ZzLsgc3grhGcnoE9XjxIOxaCC4Y6tYC1QRmuAj2Geg2CA1M1XAsmjHDVANL8GK4zolMz0L0YrjWiV5PU8HYw6TBIf8imD6UynA96HYKPg3mgMUTDY6DUzXCzQ+AxSz+r6QEQZz4HbLoDZNkZrnAIoOlRZjN1Gk3XS0zty/gTFaRq7Ay3uAR8BcU2ps/z9QJTWw74HrDhTyDbbHg9SKQI+sb9rKa3mV8ZmAt+KJjP1TS+zinFPkqEUqQdBeAOKLa0UwIzpqlXtcYpIKWIO4RBZPoRKNfC10YQI8MlYLkwaAB8ABsiMDwDbKU8dgtIFwRMgJ3guRadKpNPWBMa7tOi1WoyHJPuTsC4oN+IQsOLM3gPJlEWqOE/neMGBqwDeYoMz6G8c0I4h6eFyHBC8A2eVoaH8JutaPwuUA/+uvSht1sHKgTjTWZwjUCVYdrK3xT0iwkND+lc5FClUQ9fINHCRYY7FBrWPSz5Er2lAR9H9P+hpfYGl64OCmPadQ7ojcDwOJetysBMQX/6mrWS4d+cIoYtMnAEnBT2fwVeJufYxZBMFoKFlrajQtOX/uczvEtIB50Kdgn1lt3JGdANltjsXE64jPMnuQ1LPuFJcFrBE11gzQXAUnAPFNk86esO4zSBfmu5lVa9toCf8DC4Ba6C22DEdO01KDLdP5fLr1Z94X2ibV1ilWVQ1XrDpvPAU4c+u1KVqvaHXI7q43ltp3PSYmDDNCgGPrCUD1wN6y5lqzAUN89baX1Y55Jn2LrPRUffRwaHwWhIZs/aTQM/hzLlDp+coPRReprk5cgrkyvz7wM0+hOcAvOlPvwcLNIp526ux1H5aJbHeFpVX4Br4LLXWoffk9CkVnLlaBNYAxaBXJBpMjfIy+o7EAdtfIyb8HPDfwIMAM1WPs8F9tcxAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-button-close:hover{transform:rotate(180deg)}.iziModal .iziModal-button:hover{opacity:.8}.iziModal .iziModal-header.iziModal-noSubtitle{height:auto;padding:10px 15px 12px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{font-size:23px;padding-right:13px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-title{font-size:15px;margin:3px 0 0;font-weight:400}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-buttons{right:6px;margin:-16px 0 0}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-button{height:30px;width:30px}.iziModal-rtl{direction:rtl}.iziModal-rtl .iziModal-header{padding:14px 18px 15px 40px}.iziModal-rtl .iziModal-header-icon{float:right;padding:0 0 0 15px}.iziModal-rtl .iziModal-header-buttons{right:initial;left:10px}.iziModal-rtl .iziModal-button{float:left}.iziModal-rtl .iziModal-header-subtitle,.iziModal-rtl .iziModal-header-title{text-align:right;font-family:Tahoma,'Lato',Arial;font-weight:500}.iziModal-rtl .iziModal-header.iziModal-noSubtitle{padding:10px 15px 12px 40px}.iziModal-rtl .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{padding:0 0 0 13px}.iziModal.iziModal-light .iziModal-header-icon{color:rgba(0,0,0,.5)}.iziModal.iziModal-light .iziModal-header-title{color:#000}.iziModal.iziModal-light .iziModal-header-subtitle{color:rgba(0,0,0,.6)}.iziModal.iziModal-light .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyQTU1RUZDNzRFODQxMUU2ODAxOEUwQzg0QjBDQjI3OSIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo1NEM4MTU1MEI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENDMkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjZjYzMwMmE1LWFlMjEtNDI3ZS1hMmE4LTJlYjhlMmZlY2E3NSIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjdmYmU3NGE3LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Po24QssAAANtSURBVHja3JlJaBRBFIa7ZxyTSXADHUkikuAawZNLEOOGGrwJQYko8R4RBQ+OICoqghJQUVwPYjzFY0QUBQU1kogoKO6CG0pcIwbiNibj/8JraNvu6Xo9NTOtP3xzSKe6/65+Ve9VlWlkp2IwGUwFE0E5GA4G8/U+0APegWfgHrgPuq0bpNNp0QPNgEYngHlgGpuMCNp2s+kr4BYM/8ql4WqwHEzP4mXteg7awOW0YlerPnQIaARLNBl1ikLlBDw/1WF4ClgHKozc6idogekz2RheANbaBlE+dB4chfF+qeHF3LOF0FWwF6b7nBe8RvecApolzQVr3C64GR4H1huFV51pmvV+hikRbABFRji0GqarMxluAGON8CgKmmA65mZ4DFhqhE9VPP//ZXgZiCmm1t1gI6XWAAY+gF0gCe4qtqlHL8fthkeBWsXGreA6eMgPviEw+x5sBZ3gAdjPCcNPI8Fsu+FawUCzz40psEfRNJndBl7b/pZmVLTQMkzJo0bQSys43iWm3cxS+DUJOmoSwqKCRmEZWKkYv6RSMBPc5lqXRGm0A1Q6XiaT2aSwo8jrK/qZwZlFIlXTusxa6iXDddTdARpnMj2ek9AWjWYH7h/lubcs4A28THdyAdOl0ezAmKNBNyLLiT0Btjti9zuHg06zpJKIprohwXNypcu1OIdGjYbnxCLGPyYy/EPDfejzbwYvXK59AzuFGdFLKTL8WYNZ59RVzGESJCNm0teI40E6zNIA2wSaA2REP32iaW0omKXRbJKTUVyYEVV0J8oxvEiQmiUZrFSz6XNkuJe3nBKCelaSbjOZrhLsd1BInYxweSeJq9YA6dYtuZCBI4JZ6jGW/W+sebhd0DAaMIO5mTYFW1+X6GeQ7TO3W0WyQj3cw0ulBg4nSUbcAY7zPVYp7ip95FXOH29Hb35AOPjypWMIh7PORSjFZVsIzdKW7AWvfYnTVNWHyCytHw+jd1Nehqks3KepvtChUzD7yGvE2/cduqxldQF1EWZb/PbWLF3jAVgo0WrlkN+c6hSd+rzlaSuaR7O0oX0wyIa2pVAdGaj0HCUVOqIq4dVwrg5lmmG2w+8f/9tjL6foYHE+Gy8Xtv3CPUpf7WauDxadKuIwoeNbOmoYDYbZ0ns/1wxUC7ykigs8sS/LpEe3vwUYALiKDDDSgEiSAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDpEQTg1NTA2NTRFODQxMUU2OTQ0N0VERjY2Q0M5ODYwRCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCQkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCQUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjFlNTQwYzczLTVhZmEtNDJlYi04YzJlLWMwMzFlYmFiYmIyNiIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOmVkYmRiMzM1LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PvIicdUAAAOvSURBVHjaxJlZbA1hFMe/qaItUUsspakg1laJ7UUisQuRvvTFA15sQSRCLBFrQryhHqxNHxEPtaQ8CCUkIrVVRbVBJdZYSrXVonr9/3pGxnTunZk78/X+k1+aO+1899/vnnvO+c4YKpi6ghEgW34OBD1BKjBAM6gH78Fz8BhUyrW/ikQivt7QiNMozU0DE8RkJx/3fgCPwA1QHvHp2K/hHJAPJqpwVA2K4flW2IZ7gyVgptKjh6AQxl+GYZi7uRr0U3rVBIpg+nIQwwvACpCkOk4XwYlosR3LMGN1qUqMroGDTqaNGDu7SiVWl+D3iP2i00c9HqxUidd8wzDy3HY4HRwCfWzXz4L7Lm+QKfHeOUTTLWAzdro6muH1YIbDjculWrmpUEM2YYXcCNMt9pAYE8WsWYLdlAxaNYTGMDDHKYYXBVy4B0jTFM/5iOcUc1fM/2JcnItNAYtBNzGtQ33BVHDV3OHpARqhV6CLLKpTs8yQYHxOCrDQO7AV1Gg2PBJhMYiGh4MMnx1eLkixXKsFuzSbZrrMpeGxHnqFFtvrTWCbhILd9AuNpnPMHXaTtZD0kl1mRdwSxXSjJsNZfONjcmqIJR5p3lp6Y+sXrAzsBz/lNXvmtZYMFKbqafi0pKQgKpOSPhmsC5BxXEs1Fz4fUr/7TWMe/q9bC2s3tJs1Df/Q/B5PwAZwJYS1WpPlo0zRZJZziL2gQU7I1GyHL7QSD26taVOytI26DpinxKypApvpk+C6dHlMnXskbUbT1yTpN3WJHWB327UCS3hUoc+tA/VyxP/ost5rGq7QWZnAdoe0eZgnYweDbgmgkoafgk8aTfNgsMNmmqfhC+Czj3V4T3mSBH255kxB0ztd4tNNDJkas2CUdkAKHQ3yAtxfijj/bdb7Cumyhmoyexzcs6Qwv2qUbPKvJDOtnNFklrF3R5qneA2XYHe/2A+ht1Xb3FZXRY1XTAjFTgtxJ45qKtWDpZK1g6dhIQuvBzjcy8FgQ6y8Nw+sCdnwL1Dn8jdMe6m2a+3ma9ESNUdOC1VixSH3bnPiYyraswnO0fqDIQkyW8WmCWab7b+I9TCF3+x0j2e+MPUA7LPGrVfD1F3VNsrPVR0zhS8BB5x21muzYa1Sy1Tb4y4d4qOwIi9Pk/wcj1gV50p5zQjJKAsJH8KcY4vpdYrjV0w9HMxxHjfKNpfwdMyRNuAmyy2M1vq5OegBNFMmR9lSHDizSLPMJGjuO2BZfSOtLKvpMylUvh/d/hFgAOH4+ibxGTZuAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA3BpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCRkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCRUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjgzM2MwOWZiLWJjOTEtNGVlZS05MDM1LTRkMmU2ZmE1ZjBmMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Pv1Q9Z8AAAOXSURBVHjaxJlLbA1RGMfPjIs+EvoIRYt4FVUl2EkkRTxKUqQbG0SEho2FjUQ8YtEICbEgTdFYeK1KaGvVeoUltyStt0UlNE17aWhV2+v/9X5XJpMzc8/0zpn5kl+aO3Nm7r/fnPu9xhDp2URQDJbw3xkgB2QCAwyAPvANfARvQDsfG7V4PO7pC40xCiVxa8AKFjnOw7VdoA08BtG4R8VeBZeCKrBS+GPvQAM0P/NbcB7YBdYJPfYKXIXwL34IJm8eBFOFXusH9RDdnI7gLWA/MEVwdh/UOe1tN8G0V3eLcKwFXJCJNl08G5ZYsrWgWnZCJng5OOBwo1iAoisMw6hMJXgyOOywVW7xj+9BgKL3QHSxm+C9IF9y4U2GMlStRPQP8Jbp9lFwhJwE0RHrgaSV8N6xG238l7Zjtfx3K58/Bd7zsWngIqdnP2we2ACa7B7e6RL6joK5EtHNfL7b5u1Bn7dGFbycYRVM/8WyFJnuJK+z2iVwzFrMcF1h+Cx4ClhtFVyu8CW54ITE01EwFMAPcH1SMJWIqxQvItE1YHEIsXkhtkUhCV4ApiteFOPadn4IgseDMooSSxVrhWFwmkvCsKw06WGhKLhHhGuzSHChh9pZ5cc1oFFwfoTTsWrWqQCvXdZQEpkDsjUJziSv3Qu43k3LTA1BXqvRY/4DMjTd/yu4niJVm9wslCjcb4QE/9Qo+Al44baAmgpKCIqC+01OBLrsr8/de8zkiYwuUxWSq7iuM8JhantIqfYItkOepKBysnbycIfPXYKqURL6DhaBCQrrKcZHTa5loyEIJgHXwG3F9TQV+pxMGK0BiaTHn2OLEjcURbdi7XBSMO3jTxoEjtg+7wDnhG3spSD6F3hk7Tjoxnc0CJ5k+5wFCrhplYl2mmI24nyvvWumAE9z2zIfBW8WifnxIHc2yb6xiHtEoms0/hlGtpAPHCkgNDjFyZngPN88COvkPpEe+XGHbFcD7z53C+ybwKEAo0UPZ8QCybkmiL3sNvkheygSI08RYOSQiaUhd52sUpIZLWwJsYqkkdcZeHfIS66nc9XcZQRpNBY7C7F9Yy1OtonErDgSgNhGcEXmWa/VFA1O9onE6y4dRqGtXuVtkpf2iDy8EVR6GLykMnrsNFC867QF0hH8v3MVicFcuYdKy56uqQx4SukWQj3NOtJtQIt4ckSvbmdziMqy7HcS9xv0cn/Xwdn0A1drnl/d/hNgAGQa6Lgarp6BAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-loader{background:#fff url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%;position:absolute;left:0;right:0;top:0;bottom:0;z-index:9}.iziModal .iziModal-content-loader{background:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%}.iziModal .iziModal-content:after,.iziModal .iziModal-content:before{content:'';display:table}.iziModal .iziModal-content:after{clear:both}.iziModal .iziModal-content{zoom:1;width:100%;-webkit-overflow-scrolling:touch}.iziModal .iziModal-wrap{width:100%;position:relative;-webkit-overflow-scrolling:touch;overflow-scrolling:touch}.iziModal .iziModal-iframe{border:0;margin:0 0 -6px;width:100%;transition:height .3s ease}.iziModal-overlay{display:block;position:fixed;top:0;left:0;height:100%;width:100%}.iziModal-navigate{position:fixed;left:0;right:0;top:0;bottom:0;pointer-events:none}.iziModal-navigate-caption{position:absolute;left:10px;top:10px;color:#fff;line-height:16px;font-size:9px;font-family:'Lato',Arial;letter-spacing:.1em;text-indent:0;text-align:center;width:70px;padding:5px 0;text-transform:uppercase;display:none}.iziModal-navigate-caption::after,.iziModal-navigate-caption::before{position:absolute;top:2px;width:20px;height:20px;text-align:center;line-height:14px;font-size:12px;content:'';background-size:100%!important}.iziModal-navigate-caption:before{left:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4ZpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyNmFjNjAyMy04OWU0LWE0NDAtYmMxMy1kOTA5MTQ3MmYzYjAiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6NDREQ0YwRjA1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6NDREQ0YwRUY1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpmNmM0Nzk3Ni1mNzE3LTk5NDAtYTgyYS1mNTdjNmNiYmU0NWMiIHN0UmVmOmRvY3VtZW50SUQ9ImFkb2JlOmRvY2lkOnBob3Rvc2hvcDowZGVmYTEyZC01MzM0LTExZTYtYWRkYi04Y2NmYjI5ZTAxNjYiLz4gPC9yZGY6RGVzY3JpcHRpb24+IDwvcmRmOlJERj4gPC94OnhtcG1ldGE+IDw/eHBhY2tldCBlbmQ9InIiPz7oo0ptAAACWklEQVR42uyZTWsTYRSFZybxo4kWk5g2NC5qTAU3Kq30A9udi1oXolV/hWuhv6R/Q6utioi4LbbVFHemamlRU0OCEk0wZjwXzwtDoBDopHMHcuFJMplZnLm5ue+589qu61qeOApyYAjEgG0FEyLqN/gKiqBuTtgewWlwCZw056xgwwirgU3wxSv4NJgCUV5YBRXQDEhsBJwCSSauBVZFdJRlIJk9Av7wbj577jDIOENtRmPVwcsw6KfAAvikRKzEDlhnhuU/lRPBWaa9wsxqC6ndPX7OiOA4D8qW3vjO9z7H0w3+KhZstNmOFbLoCQ6DYGmL+bAInmGfLFC4asFXwRJIgB+goVmw+I7HXO+/gevGnGgUPEGxktkSmAMbWmt4HDwBKS6XN1jDKrvEFYoVK7oLroE3h93Woh1eNwqWafJ/gQV65vM+ail34mc6EZwBK2CAx8fAIjjeBYMzDT4cVHCEXtRbRvEu/Nr9HCIOnGGp15vgEec9KYn74B0nAT/CZnv86FcNvwK3wENwAjwAs2Bbs5d4CW5zir0AXvv8p+tKH34B5lkW4h2egRHtbu05uMMHHWfB0zC4NRF5l09kzvE4rd2tyUJyjy4tz7akZqXbL8QETbJ/FsMgWOJtb6brCQ5YsBsC8Uab63DVkkgqFpzie93h8OhScFah2LTHi5ccWroaLd5l6//+hpYQoWP05LKqFs2WQYbTsNxAi+5fxpWmdfh7HS7XhwSzG+H3a2JnvZsyktmLbdOFhpDMvrf4sN1u2/aK0cwMcmYLcturweceW+CnOfFPgAEA8uWFFylBJYoAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal-navigate-caption:after{right:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAZdEVYdFNvZnR3YXJlAEFkb2JlIEltYWdlUmVhZHlxyWU8AAADhmlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4gPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPiA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPiA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIgeG1wTU06T3JpZ2luYWxEb2N1bWVudElEPSJ4bXAuZGlkOjI2YWM2MDIzLTg5ZTQtYTQ0MC1iYzEzLWQ5MDkxNDcyZjNiMCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0NERDRjBGMDUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0NERDRjBFRjUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOmY2YzQ3OTc2LWY3MTctOTk0MC1hODJhLWY1N2M2Y2JiZTQ1YyIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjBkZWZhMTJkLTUzMzQtMTFlNi1hZGRiLThjY2ZiMjllMDE2NiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuijSm0AAAKbSURBVFhH7ZnJj0xRGEerzFoIMTaCZmOIedhaiJj55yz8DaYdNhIJEUMQbCTG3rQ02hDSiEY553XdTpHS3nv96taV9ElO6lVt6peb7933fffVG41GrYW5uBaX4EysYzcw1Fd8hc/wM2a0Bl6Nm3BW9i0dDPsQX/olBF6FO72AH/gG3+N3jL3KBpqGC3ERTsGfeAsHDTyHi71oCXzBe/gaU2A5bscZOIxXTb8OLQNX9i6mElYsg/voqruwfQb2BhODWgqpMYDv0NLsNXC4yd42P1PEwNJj4HBTWdipErLVDfxfMRm408QMvBu3jV6WJ1Zg9/rbeBOP+UNZYgX+iE/Rp+lpPIKliBXYB9IhtPNy3z/T/F6YmDXsChvyBc7Gs3gACxEzsDzBg9iPPXgO92NuYgeWx2h3+AhtaM7jPsyF7aV37XR8gNZYO/pwKY51+xPkG27Fk2joT3gCr2A7NuJ6HMkTeAPadlp3VeMChF7G0P6X3dmfjAXOUxIj6LZkv1ylNuStDZejkL+PS96ScFzRqnDAtI5PoTefvbg7iNNOOwqVRCfYghdxBbpHH8Y7+DcKlUTV7MLLaNghPIrjhf2N2IF34AVcjE44hrXHyE3MwE6/loEzpEcIlqKjeyFiBe7FS+he/gENewMLEyuwXdo8dGWP43UsRazA9g7uDNbwNX8oS8watlsz+ISIGbgSJgN3GgOHlnFq8zNFQraGgT1iFc9iUyU0XsMGHhy9zh6XbvCp4ZuBBWglDBj4OdqLeu0+uRJTwMZ+Dbp/e21P3m97yWe2snsw1LTHmz5C/9lQdwhfGbiq89GwvrrwUT4UAouhN6MzloTRpVuEYI5O9urZYXtrYPGQw2OlZegM163QhrJMfWVgyTq0Qq32C/N7uPz9OknWAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal-navigate>button{position:fixed;bottom:0;top:0;border:0;height:100%;width:84px;background-size:100%!important;cursor:pointer;padding:0;opacity:.2;transition:opacity .3s ease;pointer-events:all;margin:0;outline:0}.iziModal-navigate>button:hover{opacity:1}.iziModal-navigate-prev{left:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5sGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiCiAgICAgICAgICAgIHhtbG5zOnN0RXZ0PSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VFdmVudCMiCiAgICAgICAgICAgIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+eG1wLmRpZDo2NDkyYzcxMy05ZDM0LTZlNGQtYmUwNi1hMDMyY2Q4NDVjNGU8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkRvY3VtZW50SUQ+eG1wLmRpZDo1QjIzMUMxODU3RjcxMUU2ODUzRkRBRjE5RDhDQjZBRDwveG1wTU06RG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDpjZmMwNzVmNC1kODA3LWI0NDMtYWIwYS02YWVhZjRjMDgxZWE8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEZXJpdmVkRnJvbSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgIDxzdFJlZjppbnN0YW5jZUlEPnhtcC5paWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RSZWY6ZG9jdW1lbnRJRD4KICAgICAgICAgPC94bXBNTTpEZXJpdmVkRnJvbT4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmNmYzA3NWY0LWQ4MDctYjQ0My1hYjBhLTZhZWFmNGMwODFlYTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDo1Ni0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjA0LTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFhEaW1lbnNpb24+CiAgICAgICAgIDxleGlmOlBpeGVsWURpbWVuc2lvbj4xODg8L2V4aWY6UGl4ZWxZRGltZW5zaW9uPgogICAgICA8L3JkZjpEZXNjcmlwdGlvbj4KICAgPC9yZGY6UkRGPgo8L3g6eG1wbWV0YT4KICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAKPD94cGFja2V0IGVuZD0idyI/PvAvv7QAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAAmdJREFUeNrs1LsJQkEQhtH/mtmBgQ8QA7tQK1e7MBBBMbADwzUZEyuQveeDCXbD4TBDay3SWJpYgYCXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXv/WJskpyQJ4jQH7Mcmu0C+BV+/Y5/VeF/oV8Ood+7dpDfDqHvsrySHJBXjBDrxgB16wAy/YgRfswAt24AU78IIdeMEOPOywAw+7gIcdeMEOvGAHXrADL9iBF+zAC3bgBTvwsMMOPOwCHnYBD7uAhx14wQ68YAdesAMv2IEX7MDDDjvwsAt42AU87AIedgEPu4CHXcDDDrxgB16wAw877MDDDjvwsAt42AU87AIedgEPu4CHXcDDLuBhB16wAw877MDDLuBhF/CwC3jYBTzsAh52AQ+7gIddwEtjB3+tS/78+Z/V5d9iATz0Ah56AQ+9gIdewEMv4KEX8NALeOgFPPQCHnoBDz3wgh54QQ889NADDz30wEMv4KEX8NALeOgFPPQCHnoBD72Ahx54QQ+8oAde0AMv6IEX9MBDDz3w0EMPPPQCHnoBD72Ah17AQw+8FUAPvKAHXtADL+iBF/TAC3rgBT3wgh546KEHHnrogYdewEMv4KEHXtADL+iBF/TAC3rgBT3wgh54QQ+8oAde0AMv6IGHHnrgoU/yrgFe3aO/JdknuQOv3tGfC/tjjEsYWmsoyIWXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXvqnPgAAAP//AwCEcoCBRabYzAAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal-navigate-next{right:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAB3SAAAd0gEUasEwAAA7pGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmRjPSJodHRwOi8vcHVybC5vcmcvZGMvZWxlbWVudHMvMS4xLyIKICAgICAgICAgICAgeG1sbnM6cGhvdG9zaG9wPSJodHRwOi8vbnMuYWRvYmUuY29tL3Bob3Rvc2hvcC8xLjAvIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6dGlmZj0iaHR0cDovL25zLmFkb2JlLmNvbS90aWZmLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmV4aWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vZXhpZi8xLjAvIj4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjEyLTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDphZjljN2Q2MC00MTg2LWE3NGQtYTBiMS1mMGU5ODUwYzg2ZGY8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+CiAgICAgICAgIDx4bXBNTTpIaXN0b3J5PgogICAgICAgICAgICA8cmRmOlNlcT4KICAgICAgICAgICAgICAgPHJkZjpsaSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDphY3Rpb24+Y3JlYXRlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjAxNjJjMmE3LWZmMjYtYzE0ZC05Yjg4LTc2MGM2NzAxYjYzNzwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1MTowNy0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmFmOWM3ZDYwLTQxODYtYTc0ZC1hMGIxLWYwZTk4NTBjODZkZjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpYUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6WVJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpZUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6UmVzb2x1dGlvblVuaXQ+MjwvdGlmZjpSZXNvbHV0aW9uVW5pdD4KICAgICAgICAgPGV4aWY6Q29sb3JTcGFjZT42NTUzNTwvZXhpZjpDb2xvclNwYWNlPgogICAgICAgICA8ZXhpZjpQaXhlbFhEaW1lbnNpb24+MTg4PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFlEaW1lbnNpb24+CiAgICAgIDwvcmRmOkRlc2NyaXB0aW9uPgogICA8L3JkZjpSREY+CjwveDp4bXBtZXRhPgogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgIAo8P3hwYWNrZXQgZW5kPSJ3Ij8+nbt1mgAAACBjSFJNAAB6JQAAgIMAAPn/AACA6QAAdTAAAOpgAAA6mAAAF2+SX8VGAAACQklEQVR42uzSsQ3CQAAEQTdiOyGg/wrciJ0QUMYSECEKAP3PSdvAaZZqkWbJCQJeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXsBLwEvAS8BLwEvAS8BLwEvAS8BLwEvAC3gJeAl4CXgJ+D9vrY7qBgLwo7dVZ+89oAd+5Pbq6nPQAz9s9+rZ96AHHnoBD72Ah17AQy/goRfw0At46AU89AIeegEPvYCHHnhBD7ygBx566IGHHnrgoRfw0At46AU89AIeegEPvYCHXsBDL+ChB17QAy/ogRf0wAt64KGHHnjooQceegEPvYCHXsBDL+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADDz30wEPvI+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADL+iBF/TAC3rgoZ8ePRDAAy/YgRfswAt24AU78IIdeMEOvGAHXrADL9iBhx124GEX8LADL9iBF+zAC3bgBTvwgh14wQ68YAcedtiBh13Awy7gYRfwsAMv2IEX7MALduAFO/CCHXjYYQcedgEPu4CHXcDDLuBhF/CwA+8E2IEX7MALduAFO/Cwww487AIedgEPu4CHXcDDLuBhF/CwC3jYgRfswMMOO/CwC3jYBTzsAh52AQ+7gIddwMMu4GEX8LBravB7dcEO/Ext1Qk78DO1VgfswEvAS8BLwEvAS8BLwEvAS8BLwEvAS8ALeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXgBLwEvAS8BLwEvAS/9shcAAAD//wMAtAygvJrkwJUAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isAttachedTop .iziModal-header{border-top-left-radius:0;border-top-right-radius:0}.iziModal.isAttachedTop{margin-top:0!important;margin-bottom:auto!important;border-top-left-radius:0!important;border-top-right-radius:0!important}.iziModal.isAttachedBottom{margin-top:auto!important;margin-bottom:0!important;border-bottom-left-radius:0!important;border-bottom-right-radius:0!important}.iziModal.isFullscreen{max-width:100%!important;margin:0!important;height:100%!important}.iziModal.isAttached,.iziModal.isFullscreen{border-radius:0!important}.iziModal.hasScroll .iziModal-wrap{overflow-y:auto;overflow-x:hidden}html.iziModal-isAttached,html.iziModal-isOverflow{overflow:hidden}html.iziModal-isAttached body,html.iziModal-isOverflow body{overflow-y:scroll;position:relative}.iziModal ::-webkit-scrollbar{overflow:visible;height:7px;width:7px}.iziModal ::-webkit-scrollbar-thumb{background-color:rgba(0,0,0,.2);background-clip:padding-box;border:solid transparent;border-width:0;min-height:28px;padding:100px 0 0;box-shadow:inset 1px 1px 0 rgba(0,0,0,.1),inset 0 -1px 0 rgba(0,0,0,.07)}.iziModal ::-webkit-scrollbar-thumb:active{background-color:rgba(0,0,0,.4)}.iziModal ::-webkit-scrollbar-button{height:0;width:0}.iziModal ::-webkit-scrollbar-track{background-clip:padding-box;border:solid transparent;border-width:0 0 0 2px}.iziModal.transitionIn .iziModal-header{-webkit-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-header .iziModal-header-icon{-webkit-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-button{-webkit-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-iframe,.iziModal.transitionIn .iziModal-wrap{-webkit-animation:iziM-fadeIn 1.3s;-moz-animation:iziM-fadeIn 1.3s;animation:iziM-fadeIn 1.3s}.iziModal.transitionIn .iziModal-header{-webkit-animation-delay:0s;-moz-animation:0s;animation-delay:0s}.iziModal.transitionIn .iziModal-header .iziModal-header-icon,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation-delay:.4s;-moz-animation:.4s;animation-delay:.4s}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle{-webkit-animation-delay:.5s;-moz-animation:.5s;animation-delay:.5s}.iziModal.transitionOut .iziModal-header,.iziModal.transitionOut .iziModal-header *{transition:none!important}.iziModal .fadeOut,.iziModal-navigate.fadeOut,.iziModal-overlay.fadeOut,.iziModal.fadeOut{-webkit-animation:iziM-fadeOut .5s;-moz-animation:iziM-fadeOut .5s;animation:iziM-fadeOut .5s;animation-fill-mode:forwards}.iziModal .fadeIn,.iziModal-navigate.fadeIn,.iziModal-overlay.fadeIn,.iziModal.fadeIn{-webkit-animation:iziM-fadeIn .5s;-moz-animation:iziM-fadeIn .5s;animation:iziM-fadeIn .5s}.iziModal-overlay.comingIn,.iziModal.comingIn{-webkit-animation:iziM-comingIn .5s ease;-moz-animation:iziM-comingIn .5s ease;animation:iziM-comingIn .5s ease}.iziModal-overlay.comingOut,.iziModal.comingOut{-webkit-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);-moz-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation-fill-mode:forwards}.iziModal-overlay.bounceInDown,.iziModal.bounceInDown{-webkit-animation:iziM-bounceInDown .7s ease;animation:iziM-bounceInDown .7s ease}.iziModal-overlay.bounceOutDown,.iziModal.bounceOutDown{-webkit-animation:iziM-bounceOutDown .7s ease;animation:iziM-bounceOutDown .7s ease}.iziModal-overlay.bounceInUp,.iziModal.bounceInUp{-webkit-animation:iziM-bounceInUp .7s ease;animation:iziM-bounceInUp .7s ease}.iziModal-overlay.bounceOutUp,.iziModal.bounceOutUp{-webkit-animation:iziM-bounceOutUp .7s ease;animation:iziM-bounceOutUp .7s ease}.iziModal-overlay.fadeInDown,.iziModal.fadeInDown{-webkit-animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutDown,.iziModal.fadeOutDown{-webkit-animation:iziM-fadeOutDown .5s ease;animation:iziM-fadeOutDown .5s ease}.iziModal-overlay.fadeInUp,.iziModal.fadeInUp{-webkit-animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutUp,.iziModal.fadeOutUp{-webkit-animation:iziM-fadeOutUp .5s ease;animation:iziM-fadeOutUp .5s ease}.iziModal-overlay.fadeInLeft,.iziModal.fadeInLeft{-webkit-animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutLeft,.iziModal.fadeOutLeft{-webkit-animation:iziM-fadeOutLeft .5s ease;animation:iziM-fadeOutLeft .5s ease}.iziModal-overlay.fadeInRight,.iziModal.fadeInRight{-webkit-animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutRight,.iziModal.fadeOutRight{-webkit-animation:iziM-fadeOutRight .5s ease;animation:iziM-fadeOutRight .5s ease}.iziModal-overlay.flipInX,.iziModal.flipInX{-webkit-animation:iziM-flipInX .7s ease;animation:iziM-flipInX .7s ease}.iziModal-overlay.flipOutX,.iziModal.flipOutX{-webkit-animation:iziM-flipOutX .7s ease;animation:iziM-flipOutX .7s ease}@-webkit-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-moz-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-webkit-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-moz-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-webkit-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-moz-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-webkit-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-moz-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-webkit-keyframes iziM-slideIn{0%{opacity:0;-webkit-transform:translateX(50px)}to{opacity:1;-webkit-transform:translateX(0)}}@-moz-keyframes iziM-slideIn{0%{opacity:0;-moz-transform:translateX(50px)}to{opacity:1;-moz-transform:translateX(0)}}@keyframes iziM-slideIn{0%{opacity:0;transform:translateX(50px)}to{opacity:1;transform:translateX(0)}}@-webkit-keyframes iziM-slideDown{0%{opacity:0;-webkit-transform:scale(1,0) translateY(-40px);-webkit-transform-origin:center top}}@-moz-keyframes iziM-slideDown{0%{opacity:0;-moz-transform:scale(1,0) translateY(-40px);-moz-transform-origin:center top}}@keyframes iziM-slideDown{0%{opacity:0;transform:scale(1,0) translateY(-40px);transform-origin:center top}}@-webkit-keyframes iziM-revealIn{0%{opacity:0;-webkit-transform:scale3d(.3,.3,1)}}@-moz-keyframes iziM-revealIn{0%{opacity:0;-moz-transform:scale3d(.3,.3,1)}}@keyframes iziM-revealIn{0%{opacity:0;transform:scale3d(.3,.3,1)}}@-webkit-keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@-webkit-keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@-webkit-keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-2000px,0);transform:translate3d(0,-2000px,0)}}@keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}}@-webkit-keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@-webkit-keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@-webkit-keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@-webkit-keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@-webkit-keyframes iziM-flipInX{0%{-webkit-transform:perspective(400px) rotateX(60deg);opacity:0}40%{-webkit-transform:perspective(400px) rotateX(-10deg)}70%{-webkit-transform:perspective(400px) rotateX(10deg)}to{-webkit-transform:perspective(400px) rotateX(0deg);opacity:1}}@keyframes iziM-flipInX{0%{transform:perspective(400px) rotateX(60deg);opacity:0}40%{transform:perspective(400px) rotateX(-10deg)}70%{transform:perspective(400px) rotateX(10deg)}to{transform:perspective(400px) rotateX(0deg);opacity:1}}@-webkit-keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}}@keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-ng.js b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-ng.js new file mode 100644 index 0000000..9e0e9eb --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-ng.js @@ -0,0 +1,123 @@ +var reCaptchaLoaded = false; + +var reCaptchaHandlerNG = function (data) { + var parent = this; + parent.data = data; + parent.data.recaptchaChecked = false; + parent.errCont = jQuery('#recaptcha-error'); + + parent.init = function () { + if (reCaptchaLoaded) { + parent.reCaptchaRender(); + } + } + + parent.reCaptchaRender = function () { + if (typeof (parent.recaptchaID) === "undefined") { + parent.recaptchaID = grecaptcha.render('asp-recaptcha-container', { + 'sitekey': vars.data.recaptchaSiteKey, + 'badge': 'inline', + //'size': (vars.data.recaptchaInvisible) ? 'invisible' : null, + 'size': null, + 'callback': function (resp) { + if (resp !== '' && !parent.data.recaptchaChecked) { + smokeScreen(true); + parent.errCont.hide(); + console.log('reCaptcha doing backend check'); + var ajaxData = 'action=asp_recaptcha_check&recaptcha_response=' + resp; + new ajaxRequest(vars.ajaxURL, ajaxData, + function (res) { + var resp = JSON.parse(res.responseText); + if (resp.error) { + console.log('fail'); + smokeScreen(false); + parent.data.recaptchaChecked = false; + parent.errCont.html(resp.error).hide().fadeIn(); + grecaptcha.reset(); + } else { + console.log('success'); + parent.errCont.hide(); + parent.data.recaptchaChecked = true; + // if (vars.data.recaptchaInvisible) { + // if (vars.data.reConfirmToken) { + // vars.data.reConfirmToken = false; + // vars.data.canProceed = true; + // handlePayment(); + // return; + // } + // smokeScreen(false); + // triggerEvent(form, 'submit'); + // return; + // } + smokeScreen(false); + } + }, + function (res, errMsg) { + smokeScreen(false); + parent.errCont.html(resp.err).hide().fadeIn(); + grecaptcha.reset(); + } + ); + } + }, + 'expired-callback': function () { + parent.data.recaptchaChecked = false; + parent.data.recaptchaKey = ''; + if (!vars.data.recaptchaInvisible) { + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + }, + }); + } + } + + parent.csBeforeRegen = function () { + if (vars.data.recaptchaInvisible && !parent.data.recaptchaChecked) { + smokeScreen(true); + vars.data.doNotProceed = true; + vars.data.reConfirmToken = true; + grecaptcha.execute(); + } + } + + parent.confirmToken = function () { + if (vars.data.recaptchaInvisible && !parent.data.recaptchaChecked) { + smokeScreen(true); + vars.data.canProceed = false; + vars.data.reConfirmToken = true; + grecaptcha.execute(); + } + } + + parent.submitCanProceed = function () { + if (parent.data.recaptchaChecked === false) { + vars.data.canProceed = false; + if (vars.data.isEvent && vars.data.recaptchaInvisible) { + //vars.data.canProceed = true; + vars.data.canProceed =false; + return; + } + // if (vars.data.recaptchaInvisible) { + // smokeScreen(true); + // grecaptcha.execute(); + // } else { + // parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + // } + + parent.errCont.html(vars.str.strPleaseCheckCheckbox).hide().fadeIn(); + } + } +} + +function onloadCallback() { + console.log('reCaptcha onload'); + vars.data.addons.forEach(function (addon) { + if (addon.name === 'reCaptcha') { + if (addon.obj !== 'undefined') { + addon.obj.reCaptchaRender(); + } else { + reCaptchaLoaded = true; + } + } + }); +} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-script.js b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-script.js new file mode 100644 index 0000000..0ca0d2c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/asp-recaptcha-script.js @@ -0,0 +1,38 @@ +function wp_asp_button_clicked_recaptcha(data) { + if (typeof (data.recaptchaChecked) === "undefined" || !data.recaptchaChecked) { + data.canProceed = false; + jQuery('#asp-recaptcha-modal-' + data.uniq_id).iziModal({ + title: 'reCaptcha', + transitionIn: 'fadeInUp', + transitionOut: 'fadeOutDown', + closeOnEscape: false, + overlayClose: false, + fullscreen: false, + restoreDefaultContent: false, + }); + jQuery('#asp-recaptcha-modal-' + data.uniq_id).iziModal('open'); + if (typeof (data.recaptchaID) === "undefined") { + data.recaptchaID = grecaptcha.render('asp-recaptcha-container-' + data.uniq_id, { + 'sitekey': data.recaptchaSiteKey, + 'callback': function (key) { + if (key !== '') { + data.recaptchaChecked = true; + data.canProceed = true; + jQuery('form#stripe_form_' + data.uniq_id).append(''); + grecaptcha.reset(data.recaptchaID); + jQuery('#asp-recaptcha-modal-' + data.uniq_id).iziModal('close'); + jQuery('#asp-recaptcha-container-' + data.uniq_id).html(''); + if (typeof data.buttonClicked !== "undefined") { + if (typeof data.buttonClicked.click === 'function') { + data.buttonClicked.click(); + } + } else { + jQuery('#stripe_button_' + data.uniq_id).click(); + } + } + }, + }); + } + } + return data; +} \ No newline at end of file diff --git a/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/iziModal.min.js b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/iziModal.min.js new file mode 100644 index 0000000..ce1f3ea --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/recaptcha/public/js/iziModal.min.js @@ -0,0 +1,6 @@ +/* +* iziModal | v1.6.0 +* http://izimodal.marcelodolce.com +* by Marcelo Dolce. +*/ +!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):"object"==typeof module&&module.exports?module.exports=function(e,i){return void 0===i&&(i="undefined"!=typeof window?require("jquery"):require("jquery")(e)),t(i),i}:t(jQuery)}(function(t){function e(){var t,e=document.createElement("fakeelement"),i={animation:"animationend",OAnimation:"oAnimationEnd",MozAnimation:"animationend",WebkitAnimation:"webkitAnimationEnd"};for(t in i)if(void 0!==e.style[t])return i[t]}function i(t){return 9===t?navigator.appVersion.indexOf("MSIE 9.")!==-1:(userAgent=navigator.userAgent,userAgent.indexOf("MSIE ")>-1||userAgent.indexOf("Trident/")>-1)}function n(t){var e=/%|px|em|cm|vh|vw/;return parseInt(String(t).split(e)[0])}function o(e){var i=e.replace(/^.*#/,""),n=t(e);n.attr("id",i+"-tmp"),window.location.hash=e,n.attr("id",i)}var s=t(window),a=t(document),r="iziModal",l={CLOSING:"closing",CLOSED:"closed",OPENING:"opening",OPENED:"opened",DESTROYED:"destroyed"},d=e(),h=!!/Mobi/.test(navigator.userAgent);window.$iziModal={},window.$iziModal.autoOpen=0,window.$iziModal.history=!1;var c=function(t,e){this.init(t,e)};return c.prototype={constructor:c,init:function(e,i){var n=this;this.$element=t(e),void 0!==this.$element[0].id&&""!==this.$element[0].id?this.id=this.$element[0].id:(this.id=r+Math.floor(1e7*Math.random()+1),this.$element.attr("id",this.id)),this.classes=void 0!==this.$element.attr("class")?this.$element.attr("class"):"",this.content=this.$element.html(),this.state=l.CLOSED,this.options=i,this.width=0,this.timer=null,this.timerTimeout=null,this.progressBar=null,this.isPaused=!1,this.isFullscreen=!1,this.headerHeight=0,this.modalHeight=0,this.$overlay=t('
'),this.$navigate=t('
Use
'),this.group={name:this.$element.attr("data-"+r+"-group"),index:null,ids:[]},this.$element.attr("aria-hidden","true"),this.$element.attr("aria-labelledby",this.id),this.$element.attr("role","dialog"),this.$element.hasClass("iziModal")||this.$element.addClass("iziModal"),void 0===this.group.name&&""!==i.group&&(this.group.name=i.group,this.$element.attr("data-"+r+"-group",i.group)),this.options.loop===!0&&this.$element.attr("data-"+r+"-loop",!0),t.each(this.options,function(t,e){var o=n.$element.attr("data-"+r+"-"+t);try{"undefined"!=typeof o&&(""===o||"true"==o?i[t]=!0:"false"==o?i[t]=!1:"function"==typeof e?i[t]=new Function(o):i[t]=o)}catch(s){}}),i.appendTo!==!1&&this.$element.appendTo(i.appendTo),i.iframe===!0?(this.$element.html('
'+this.content+"
"),null!==i.iframeHeight&&this.$element.find("."+r+"-iframe").css("height",i.iframeHeight)):this.$element.html('
'+this.content+"
"),null!==this.options.background&&this.$element.css("background",this.options.background),this.$wrap=this.$element.find("."+r+"-wrap"),null===i.zindex||isNaN(parseInt(i.zindex))||(this.$element.css("z-index",i.zindex),this.$navigate.css("z-index",i.zindex-1),this.$overlay.css("z-index",i.zindex-2)),""!==i.radius&&this.$element.css("border-radius",i.radius),""!==i.padding&&this.$element.find("."+r+"-content").css("padding",i.padding),""!==i.theme&&("light"===i.theme?this.$element.addClass(r+"-light"):this.$element.addClass(i.theme)),i.rtl===!0&&this.$element.addClass(r+"-rtl"),i.openFullscreen===!0&&(this.isFullscreen=!0,this.$element.addClass("isFullscreen")),this.createHeader(),this.recalcWidth(),this.recalcVerticalPos(),!n.options.afterRender||"function"!=typeof n.options.afterRender&&"object"!=typeof n.options.afterRender||n.options.afterRender(n)},createHeader:function(){this.$header=t('

'+this.options.title+'

'+this.options.subtitle+'

'),this.options.closeButton===!0&&this.$header.find("."+r+"-header-buttons").append('"),this.options.fullscreen===!0&&this.$header.find("."+r+"-header-buttons").append('"),this.options.timeoutProgressbar===!0&&this.$header.prepend('
'),""===this.options.subtitle&&this.$header.addClass(r+"-noSubtitle"),""!==this.options.title&&(null!==this.options.headerColor&&(this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+this.options.headerColor),this.$header.css("background",this.options.headerColor)),null===this.options.icon&&null===this.options.iconText||(this.$header.prepend(''),null!==this.options.icon&&this.$header.find("."+r+"-header-icon").addClass(this.options.icon).css("color",this.options.iconColor),null!==this.options.iconText&&this.$header.find("."+r+"-header-icon").html(this.options.iconText)),this.$element.css("overflow","hidden").prepend(this.$header))},setGroup:function(e){var i=this,n=this.group.name||e;if(this.group.ids=[],void 0!==e&&e!==this.group.name&&(n=e,this.group.name=n,this.$element.attr("data-"+r+"-group",n)),void 0!==n&&""!==n){var o=0;t.each(t("."+r+"[data-"+r+"-group="+n+"]"),function(e,n){i.group.ids.push(t(this)[0].id),i.id==t(this)[0].id&&(i.group.index=o),o++})}},toggle:function(){this.state==l.OPENED&&this.close(),this.state==l.CLOSED&&this.open()},startProgress:function(t){var e=this;this.isPaused=!1,clearTimeout(this.timerTimeout),this.options.timeoutProgressbar===!0?(this.progressBar={hideEta:null,maxHideTime:null,currentTime:(new Date).getTime(),el:this.$element.find("."+r+"-progressbar > div"),updateProgress:function(){if(!e.isPaused){e.progressBar.currentTime=e.progressBar.currentTime+10;var t=(e.progressBar.hideEta-e.progressBar.currentTime)/e.progressBar.maxHideTime*100;e.progressBar.el.width(t+"%"),t<0&&e.close()}}},t>0&&(this.progressBar.maxHideTime=parseFloat(t),this.progressBar.hideEta=(new Date).getTime()+this.progressBar.maxHideTime,this.timerTimeout=setInterval(this.progressBar.updateProgress,10))):this.timerTimeout=setTimeout(function(){e.close()},e.options.timeout)},pauseProgress:function(){this.isPaused=!0},resumeProgress:function(){this.isPaused=!1},resetProgress:function(t){clearTimeout(this.timerTimeout),this.progressBar={},this.$element.find("."+r+"-progressbar > div").width("100%")},open:function(e){function i(){s.state=l.OPENED,s.$element.trigger(l.OPENED),!s.options.onOpened||"function"!=typeof s.options.onOpened&&"object"!=typeof s.options.onOpened||s.options.onOpened(s)}function n(){s.$element.off("click","[data-"+r+"-close]").on("click","[data-"+r+"-close]",function(e){e.preventDefault();var i=t(e.currentTarget).attr("data-"+r+"-transitionOut");void 0!==i?s.close({transition:i}):s.close()}),s.$element.off("click","[data-"+r+"-fullscreen]").on("click","[data-"+r+"-fullscreen]",function(t){t.preventDefault(),s.isFullscreen===!0?(s.isFullscreen=!1,s.$element.removeClass("isFullscreen")):(s.isFullscreen=!0,s.$element.addClass("isFullscreen")),s.options.onFullscreen&&"function"==typeof s.options.onFullscreen&&s.options.onFullscreen(s),s.$element.trigger("fullscreen",s)}),s.$navigate.off("click","."+r+"-navigate-next").on("click","."+r+"-navigate-next",function(t){s.next(t)}),s.$element.off("click","[data-"+r+"-next]").on("click","[data-"+r+"-next]",function(t){s.next(t)}),s.$navigate.off("click","."+r+"-navigate-prev").on("click","."+r+"-navigate-prev",function(t){s.prev(t)}),s.$element.off("click","[data-"+r+"-prev]").on("click","[data-"+r+"-prev]",function(t){s.prev(t)})}var s=this;try{void 0!==e&&e.preventClose===!1&&t.each(t("."+r),function(e,i){if(void 0!==t(i).data().iziModal){var n=t(i).iziModal("getState");"opened"!=n&&"opening"!=n||t(i).iziModal("close")}})}catch(c){}if(function(){if(s.options.history){var t=document.title;document.title=t+" - "+s.options.title,o("#"+s.id),document.title=t,window.$iziModal.history=!0}else window.$iziModal.history=!1}(),this.state==l.CLOSED){if(n(),this.setGroup(),this.state=l.OPENING,this.$element.trigger(l.OPENING),this.$element.attr("aria-hidden","false"),this.options.timeoutProgressbar===!0&&this.$element.find("."+r+"-progressbar > div").width("100%"),this.options.iframe===!0){this.$element.find("."+r+"-content").addClass(r+"-content-loader"),this.$element.find("."+r+"-iframe").on("load",function(){t(this).parent().removeClass(r+"-content-loader")});var u=null;try{u=""!==t(e.currentTarget).attr("href")?t(e.currentTarget).attr("href"):null}catch(c){}if(null===this.options.iframeURL||null!==u&&void 0!==u||(u=this.options.iframeURL),null===u||void 0===u)throw new Error("Failed to find iframe URL");this.$element.find("."+r+"-iframe").attr("src",u)}(this.options.bodyOverflow||h)&&(t("html").addClass(r+"-isOverflow"),h&&t("body").css("overflow","hidden")),this.options.onOpening&&"function"==typeof this.options.onOpening&&this.options.onOpening(this),function(){if(s.group.ids.length>1){s.$navigate.appendTo("body"),s.$navigate.addClass("fadeIn"),s.options.navigateCaption===!0&&s.$navigate.find("."+r+"-navigate-caption").show();var n=s.$element.outerWidth();s.options.navigateArrows!==!1?"closeScreenEdge"===s.options.navigateArrows?(s.$navigate.find("."+r+"-navigate-prev").css("left",0).show(),s.$navigate.find("."+r+"-navigate-next").css("right",0).show()):(s.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(n/2+84)).show(),s.$navigate.find("."+r+"-navigate-next").css("margin-right",-(n/2+84)).show()):(s.$navigate.find("."+r+"-navigate-prev").hide(),s.$navigate.find("."+r+"-navigate-next").hide());var o;0===s.group.index&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-prev").hide()),s.group.index+1===s.group.ids.length&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-next").hide())}s.options.overlay===!0&&(s.options.appendToOverlay===!1?s.$overlay.appendTo("body"):s.$overlay.appendTo(s.options.appendToOverlay)),s.options.transitionInOverlay&&s.$overlay.addClass(s.options.transitionInOverlay);var a=s.options.transitionIn;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionIn||(a=e.transition||e.transitionIn),void 0!==e.zindex&&s.setZindex(e.zindex)),""!==a&&void 0!==d?(s.$element.addClass("transitionIn "+a).show(),s.$wrap.one(d,function(){s.$element.removeClass(a+" transitionIn"),s.$overlay.removeClass(s.options.transitionInOverlay),s.$navigate.removeClass("fadeIn"),i()})):(s.$element.show(),i()),s.options.pauseOnHover!==!0||s.options.pauseOnHover!==!0||s.options.timeout===!1||isNaN(parseInt(s.options.timeout))||s.options.timeout===!1||0===s.options.timeout||(s.$element.off("mouseenter").on("mouseenter",function(t){t.preventDefault(),s.isPaused=!0}),s.$element.off("mouseleave").on("mouseleave",function(t){t.preventDefault(),s.isPaused=!1}))}(),this.options.timeout===!1||isNaN(parseInt(this.options.timeout))||this.options.timeout===!1||0===this.options.timeout||s.startProgress(this.options.timeout),this.options.overlayClose&&!this.$element.hasClass(this.options.transitionOut)&&this.$overlay.click(function(){s.close()}),this.options.focusInput&&this.$element.find(":input:not(button):enabled:visible:first").focus(),function p(){s.recalcLayout(),s.timer=setTimeout(p,300)}(),a.on("keydown."+r,function(t){s.options.closeOnEscape&&27===t.keyCode&&s.close()})}},close:function(e){function i(){n.state=l.CLOSED,n.$element.trigger(l.CLOSED),n.options.iframe===!0&&n.$element.find("."+r+"-iframe").attr("src",""),(n.options.bodyOverflow||h)&&(t("html").removeClass(r+"-isOverflow"),h&&t("body").css("overflow","auto")),n.options.onClosed&&"function"==typeof n.options.onClosed&&n.options.onClosed(n),n.options.restoreDefaultContent===!0&&n.$element.find("."+r+"-content").html(n.content),0===t("."+r+":visible").length&&t("html").removeClass(r+"-isAttached")}var n=this;if(this.state==l.OPENED||this.state==l.OPENING){a.off("keydown."+r),this.state=l.CLOSING,this.$element.trigger(l.CLOSING),this.$element.attr("aria-hidden","true"),clearTimeout(this.timer),clearTimeout(this.timerTimeout),n.options.onClosing&&"function"==typeof n.options.onClosing&&n.options.onClosing(this);var o=this.options.transitionOut;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionOut||(o=e.transition||e.transitionOut)),o===!1||""===o||void 0===d?(this.$element.hide(),this.$overlay.remove(),this.$navigate.remove(),i()):(this.$element.attr("class",[this.classes,r,o,"light"==this.options.theme?r+"-light":this.options.theme,this.isFullscreen===!0?"isFullscreen":"",this.options.rtl?r+"-rtl":""].join(" ")),this.$overlay.attr("class",r+"-overlay "+this.options.transitionOutOverlay),n.options.navigateArrows===!1||h||this.$navigate.attr("class",r+"-navigate fadeOut"),this.$element.one(d,function(){n.$element.hasClass(o)&&n.$element.removeClass(o+" transitionOut").hide(),n.$overlay.removeClass(n.options.transitionOutOverlay).remove(),n.$navigate.removeClass("fadeOut").remove(),i()}))}},next:function(e){var i=this,n="fadeInRight",o="fadeOutLeft",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index+1;o<=i.group.ids.length;o++){try{a["in"]=t("#"+i.group.ids[o]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o]).iziModal("open",{transition:n});break}if(o==i.group.ids.length&&e>0||i.options.loop===!0)for(var l=0;l<=i.group.ids.length;l++)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},prev:function(e){var i=this,n="fadeInLeft",o="fadeOutRight",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index;o>=0;o--){try{a["in"]=t("#"+i.group.ids[o-1]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o-1]).iziModal("open",{transition:n});break}if(0===o&&e>0||i.options.loop===!0)for(var l=i.group.ids.length-1;l>=0;l--)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},destroy:function(){var e=t.Event("destroy");this.$element.trigger(e),a.off("keydown."+r),clearTimeout(this.timer),clearTimeout(this.timerTimeout),this.options.iframe===!0&&this.$element.find("."+r+"-iframe").remove(),this.$element.html(this.$element.find("."+r+"-content").html()),this.$element.off("click","[data-"+r+"-close]"),this.$element.off("click","[data-"+r+"-fullscreen]"),this.$element.off("."+r).removeData(r).attr("style",""),this.$overlay.remove(),this.$navigate.remove(),this.$element.trigger(l.DESTROYED),this.$element=null},getState:function(){return this.state},getGroup:function(){return this.group},setWidth:function(t){this.options.width=t,this.recalcWidth();var e=this.$element.outerWidth();this.options.navigateArrows!==!0&&"closeToModal"!=this.options.navigateArrows||(this.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(e/2+84)).show(),this.$navigate.find("."+r+"-navigate-next").css("margin-right",-(e/2+84)).show())},setTop:function(t){this.options.top=t,this.recalcVerticalPos(!1)},setBottom:function(t){this.options.bottom=t,this.recalcVerticalPos(!1)},setHeader:function(t){t?this.$element.find("."+r+"-header").show():(this.headerHeight=0,this.$element.find("."+r+"-header").hide())},setTitle:function(t){this.options.title=t,0===this.headerHeight&&this.createHeader(),0===this.$header.find("."+r+"-header-title").length&&this.$header.append('

'),this.$header.find("."+r+"-header-title").html(t)},setSubtitle:function(t){""===t?(this.$header.find("."+r+"-header-subtitle").remove(),this.$header.addClass(r+"-noSubtitle")):(0===this.$header.find("."+r+"-header-subtitle").length&&this.$header.append('

'),this.$header.removeClass(r+"-noSubtitle")),this.$header.find("."+r+"-header-subtitle").html(t),this.options.subtitle=t},setIcon:function(t){0===this.$header.find("."+r+"-header-icon").length&&this.$header.prepend(''),this.$header.find("."+r+"-header-icon").attr("class",r+"-header-icon "+t),this.options.icon=t},setIconText:function(t){this.$header.find("."+r+"-header-icon").html(t),this.options.iconText=t},setHeaderColor:function(t){this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+t),this.$header.css("background",t),this.options.headerColor=t},setBackground:function(t){t===!1?(this.options.background=null,this.$element.css("background","")):(this.$element.css("background",t),this.options.background=t)},setZindex:function(t){isNaN(parseInt(this.options.zindex))||(this.options.zindex=t,this.$element.css("z-index",t),this.$navigate.css("z-index",t-1),this.$overlay.css("z-index",t-2))},setFullscreen:function(t){t?(this.isFullscreen=!0,this.$element.addClass("isFullscreen")):(this.isFullscreen=!1,this.$element.removeClass("isFullscreen"))},setContent:function(t){if("object"==typeof t){var e=t["default"]||!1;e===!0&&(this.content=t.content),t=t.content}this.options.iframe===!1&&this.$element.find("."+r+"-content").html(t)},setTransitionIn:function(t){this.options.transitionIn=t},setTransitionOut:function(t){this.options.transitionOut=t},setTimeout:function(t){this.options.timeout=t},resetContent:function(){this.$element.find("."+r+"-content").html(this.content)},startLoading:function(){this.$element.find("."+r+"-loader").length||this.$element.append('
'),this.$element.find("."+r+"-loader").css({top:this.headerHeight,borderRadius:this.options.radius})},stopLoading:function(){var t=this.$element.find("."+r+"-loader");t.length||(this.$element.prepend('
'),t=this.$element.find("."+r+"-loader").css("border-radius",this.options.radius)),t.removeClass("fadeIn").addClass("fadeOut"),setTimeout(function(){t.remove()},600)},recalcWidth:function(){var t=this;if(this.$element.css("max-width",this.options.width),i()){var e=t.options.width;e.toString().split("%").length>1&&(e=t.$element.outerWidth()),t.$element.css({left:"50%",marginLeft:-(e/2)})}},recalcVerticalPos:function(t){null!==this.options.top&&this.options.top!==!1?(this.$element.css("margin-top",this.options.top),0===this.options.top&&this.$element.css({borderTopRightRadius:0,borderTopLeftRadius:0})):t===!1&&this.$element.css({marginTop:"",borderRadius:this.options.radius}),null!==this.options.bottom&&this.options.bottom!==!1?(this.$element.css("margin-bottom",this.options.bottom),0===this.options.bottom&&this.$element.css({borderBottomRightRadius:0,borderBottomLeftRadius:0})):t===!1&&this.$element.css({marginBottom:"",borderRadius:this.options.radius})},recalcLayout:function(){var e=this,o=s.height(),a=this.$element.outerHeight(),d=this.$element.outerWidth(),h=this.$element.find("."+r+"-content")[0].scrollHeight,c=h+this.headerHeight,u=this.$element.innerHeight()-this.headerHeight,p=(parseInt(-((this.$element.innerHeight()+1)/2))+"px",this.$wrap.scrollTop()),f=0;i()&&(d>=s.width()||this.isFullscreen===!0?this.$element.css({left:"0",marginLeft:""}):this.$element.css({left:"50%",marginLeft:-(d/2)})),this.options.borderBottom===!0&&""!==this.options.title&&(f=3),this.$element.find("."+r+"-header").length&&this.$element.find("."+r+"-header").is(":visible")?(this.headerHeight=parseInt(this.$element.find("."+r+"-header").innerHeight()),this.$element.css("overflow","hidden")):(this.headerHeight=0,this.$element.css("overflow","")),this.$element.find("."+r+"-loader").length&&this.$element.find("."+r+"-loader").css("top",this.headerHeight),a!==this.modalHeight&&(this.modalHeight=a,this.options.onResize&&"function"==typeof this.options.onResize&&this.options.onResize(this)),this.state!=l.OPENED&&this.state!=l.OPENING||(this.options.iframe===!0&&(o=s.width()?this.$element.find("."+r+"-button-fullscreen").hide():this.$element.find("."+r+"-button-fullscreen").show(),this.recalcButtons(),this.isFullscreen===!1&&(o=o-(n(this.options.top)||0)-(n(this.options.bottom)||0)),c>o?(this.options.top>0&&null===this.options.bottom&&h0&&null===this.options.top&&hu&&c>o?(e.$element.addClass("hasScroll"),e.$wrap.css("height",a-(e.headerHeight+f))):(e.$element.removeClass("hasScroll"),e.$wrap.css("height","auto"))}(),function(){u+p1){try{n.$el=document.createElement(id[0])}catch(o){}n.$el.id=this.selector.split("#")[1].trim()}else if(n["class"].length>1){try{n.$el=document.createElement(n["class"][0])}catch(o){}for(var s=1;sinit(); + } + + public static function get_instance() { + if ( null === self::$instance ) { + self::$instance = new self(); + } + return self::$instance; + } + + private function get_transient_id() { + if ( empty( $this->transient_id ) ) { + $this->transient_id = md5( uniqid( 'asp', true ) ); + } + return $this->transient_id; + } + + public function set_transient_data( $name, $data ) { + $curr_data = get_transient( $this->trans_name ); + if ( empty( $curr_data ) ) { + $curr_data = array(); + } + $curr_data[ $name ] = wp_json_encode( $data ); + delete_transient( $this->trans_name ); + set_transient( $this->trans_name, $curr_data, 3600 ); + } + + public function get_transient_data( $name, $default = false ) { + $curr_data = get_transient( $this->trans_name ); + if ( empty( $curr_data ) ) { + return $default; + } + if ( ! isset( $curr_data[ $name ] ) ) { + return $default; + } + return json_decode( $curr_data[ $name ], true ); + } + + public function init() { + $asp_class = AcceptStripePayments::get_instance(); + $dont_use_cookie = $asp_class->get_setting( 'dont_use_cookie' ); + if ( $dont_use_cookie ) { + //Don't use cookie option is enabled. + return; + } + + $cookie_transient_id = isset( $_COOKIE['asp_transient_id'] ) ? sanitize_text_field( stripslashes ( $_COOKIE['asp_transient_id'] ) ) : ''; + if ( empty( $cookie_transient_id ) ) { + if ( ! headers_sent() ) { + $cookiepath = ! defined( 'COOKIEPATH' ) ? '/' : COOKIEPATH; + $cookie_domain = ! defined( 'COOKIE_DOMAIN' ) ? false : COOKIE_DOMAIN; + setcookie( 'asp_transient_id', $this->get_transient_id(), time() + 604800, $cookiepath, $cookie_domain ); + } + } else { + $this->transient_id = $cookie_transient_id; + } + $this->trans_name = 'asp_session_data_' . $this->get_transient_id(); + } + +} + +ASP_Session::get_instance(); diff --git a/wp-content/plugins/stripe-payments/includes/shortcodes/class-asp-shortcode-ng.php b/wp-content/plugins/stripe-payments/includes/shortcodes/class-asp-shortcode-ng.php new file mode 100644 index 0000000..b124293 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/shortcodes/class-asp-shortcode-ng.php @@ -0,0 +1,780 @@ +asp_main = AcceptStripePayments::get_instance(); + + //Enqueue scripts and styles + add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_scripts' ) ); + + if ( ! is_admin() ) { + //Frontend only. + + //The standard shortcode for product + add_shortcode( 'asp_product', array( $this, 'shortcode_asp_product' ) ); + add_shortcode( 'asp_product_ng', array( $this, 'shortcode_asp_product' ) ); + + //The dynamic shortcode for accepting payments (we have deprecated this shortcode). + add_shortcode( 'accept_stripe_payment', array( $this, 'shortcode_accept_stripe_payment' ) ); + add_shortcode( 'accept_stripe_payment_ng', array( $this, 'shortcode_accept_stripe_payment' ) ); + + add_filter( 'the_content', array( $this, 'filter_post_type_content' ) ); + } + + } + + public function enqueue_scripts() { + wp_register_style( 'asp-default-style', WP_ASP_PLUGIN_URL . '/public/views/templates/default/style.css', array(), WP_ASP_PLUGIN_VERSION ); + + wp_register_style( 'asp-stripe-button-css', 'https://checkout.stripe.com/v3/checkout/button.css' ); + } + + public static function filter_post_type_content( $content ) { + global $post; + if ( isset( $post ) ) { + if ( ASPMain::$products_slug === $post->post_type ) { //Handle the content for product type post + return do_shortcode( '[asp_product id="' . $post->ID . '" is_post_tpl="1" in_the_loop="' . + in_the_loop() . '"]' ); + } + } + return $content; + } + + /** + * Return an instance of this class. + * + * @since 1.0.0 + * + * @return object A single instance of this class. + */ + public static function get_instance() { + // If the single instance hasn't been set, set it now. + if ( null === self::$instance ) { + self::$instance = new self(); + } + + return self::$instance; + } + + private function gen_fatal_error_box( $msg ) { + $error_msg = '
'; + $error_msg .= $msg; + $error_msg .= '
'; + return $error_msg; + } + + public function shortcode_asp_product( $atts ) { + if ( ! isset( $atts['id'] ) || ! is_numeric( $atts['id'] ) ) { + $msg = __( 'Error: product ID is invalid.', 'stripe-payments' ); + $error_msg = $this->gen_fatal_error_box( $msg ); + return $error_msg; + } + + $id = $atts['id']; + $item = new ASP_Product_Item( $id ); + + $last_error = $item->get_last_error(); + + if ( $last_error ) { + $error_msg = $this->gen_fatal_error_box( $last_error ); + return $error_msg; + } + + $plan_id = get_post_meta( $id, 'asp_sub_plan_id', true ); + + if ( ! empty( $plan_id ) && ! class_exists( 'ASPSUB_main' ) ) { + //Subs addon not installed or disabled. Show corresponding error message + $error_msg = $this->gen_fatal_error_box( __( 'This product requires Stripe Payments Subscription addon.' ) ); + return $error_msg; + } + + if ( ! empty( $plan_id ) && class_exists( 'ASPSUB_main' ) && version_compare( ASPSUB_main::ADDON_VER, '2.0.0t1' ) < 0 ) { + $error_msg = $this->gen_fatal_error_box( 'Stripe Subscriptions addon version 2.0.0 or newer is required.' ); + return $error_msg; + } + + $currency = $item->get_currency(); + + $button_text = $item->get_button_text(); + + //check if we have button_text shortcode parameter. If it's not empty, this should be our button text + if ( isset( $atts['button_text'] ) && ! empty( $atts['button_text'] ) ) { + $button_text = esc_attr( $atts['button_text'] ); + } + + $thumb_img = ''; + $thumb_url = get_post_meta( $id, 'asp_product_thumbnail', true ); + + if ( $thumb_url ) { + if ( is_ssl() ) { + $thumb_url = ASP_Utils::url_to_https( $thumb_url ); + } + $thumb_img = ''; + } + + $url = get_post_meta( $id, 'asp_product_upload', true ); + + if ( ! $url ) { + $url = ''; + } + + $template_name = 'default'; //this could be made configurable + $button_color = 'blue'; //this could be made configurable + + $price = $item->get_price(); + $shipping = $item->get_shipping(); + + $surcharge_label = $item->get_surcharge_label(); + $surcharge_total = $item->calculate_total_surcharge(); + //Trigger filter so addons can modify surcharge total + $surcharge_total = apply_filters('asp_ng_modify_surcharge_total', $surcharge_total, $currency); + + //let's apply filter so addons can change price, currency and shipping if needed + $price_arr = array( + 'price' => $price, + 'currency' => $currency, + 'shipping' => empty( $shipping ) ? false : $shipping, + ); + $price_arr = apply_filters( 'asp_ng_modify_price_currency_shipping', $price_arr ); + extract( $price_arr, EXTR_OVERWRITE ); + + $buy_btn = ''; + + $button_class = $item->get_button_class(); + + $class = ! empty( $button_class ) ? $button_class : 'asp_product_buy_btn ' . $button_color; + + $class = isset( $atts['class'] ) ? $atts['class'] : $class; + + $custom_field = get_post_meta( $id, 'asp_product_custom_field', true ); + $cf_enabled = $this->asp_main->get_setting( 'custom_field_enabled' ); + + if ( ( '' === $custom_field ) || '2' === $custom_field ) { + $custom_field = $cf_enabled; + } else { + $custom_field = intval( $custom_field ); + } + + if ( ! $cf_enabled ) { + $custom_field = $cf_enabled; + } + + $thankyou_page = empty( $atts['thankyou_page_url'] ) ? get_post_meta( $id, 'asp_product_thankyou_page', true ) : $atts['thankyou_page_url']; + + if ( ! $shipping ) { + $shipping = 0; + } + + $tax = isset( $atts['tax'] ) ? $atts['tax'] : $item->get_tax(); + + if ( ! $tax || $tax < 0 ) { + $tax = 0; + } + + if ( isset( $atts['tax'] ) ) { + //save tax overidden data to session + $uniq_id = uniqid( 'asp_button', true ); + $sess = ASP_Session::get_instance(); + $sess->set_transient_data( 'overriden_data_' . $uniq_id, array( 'tax' => $tax ) ); + } + + $quantity = $item->get_quantity(); + + $under_price_line = ''; + $tot_price = ! empty( $quantity ) ? $price * $quantity : $price; + + if ( 0 !== $tax ) { + $tax_str = apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ); + if ( ! empty( $price ) ) { + $tax_amount = AcceptStripePayments::get_tax_amount( $tot_price, $tax, AcceptStripePayments::is_zero_cents( $currency ) ); + $tot_price += $tax_amount; + $under_price_line = '' . AcceptStripePayments::formatted_price( $tax_amount, $currency ) . ' (' . strtolower( $tax_str ) . ')'; + } else { + $under_price_line = '' . $tax . '% ' . lcfirst( $tax_str ) . ''; + } + } + if ( 0 !== $shipping ) { + $ship_str = apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ); + $tot_price += $shipping; + $shipping_line = AcceptStripePayments::formatted_price( $shipping, $currency ) . ' (' . strtolower( $ship_str ) . ')'; + if ( ! empty( $under_price_line ) ) { + $under_price_line .= ' + ' . $shipping_line . ''; + } else { + $under_price_line = '' . $shipping_line . ''; + } + } + + if ( !empty( $surcharge_total ) ){ + $tot_price += $surcharge_total; + + $surcharge_line = '
'. $surcharge_label . ': '; + $surcharge_line .= '' . AcceptStripePayments::formatted_price( $surcharge_total, $currency ) . ''; + $surcharge_line .= '
'; + + $under_price_line .= $surcharge_line; + } + + if ( ! empty( $price ) && ! empty( $under_price_line ) ) { + $under_price_line .= '
' . __( 'Total:', 'stripe-payments' ) . ' ' . AcceptStripePayments::formatted_price( $tot_price, $currency ) . '
'; + } + + if ( get_post_meta( $id, 'asp_product_no_popup_thumbnail', true ) !== 1 ) { + $item_logo = ASP_Utils::get_small_product_thumb( $id ); + } else { + $item_logo = ''; + } + + $compat_mode = isset( $atts['compat_mode'] ) ? 1 : 0; + + $this->compat_mode = ( $compat_mode ) ? true : false; + + $billing_address = get_post_meta( $id, 'asp_product_collect_billing_addr', true ); + $shipping_address = get_post_meta( $id, 'asp_product_collect_shipping_addr', true ); + + if ( ! $billing_address ) { + $shipping_address = false; + } + + $currency_variable = $item->is_currency_variable(); + + //Let's only output buy button if we're in the loop. Since the_content hook could be called several times (for example, by a plugin like Yoast SEO for its purposes), we should only output the button only when it's actually needed. + if ( ! isset( $atts['in_the_loop'] ) || '1' === $atts['in_the_loop'] ) { + $sc_params = array( + 'product_id' => $id, + 'name' => $item->get_name(), + 'price' => $price, + 'currency' => $currency, + 'currency_variable' => $currency_variable, + 'shipping' => $shipping, + 'tax' => $tax, + 'class' => $class, + 'quantity' => get_post_meta( $id, 'asp_product_quantity', true ), + 'custom_quantity' => get_post_meta( $id, 'asp_product_custom_quantity', true ), + 'button_text' => $button_text, + 'description' => get_post_meta( $id, 'asp_product_description', true ), + 'thankyou_page_url' => $thankyou_page, + 'item_logo' => $item_logo, + 'billing_address' => $billing_address, + 'shipping_address' => $shipping_address, + 'custom_field' => $custom_field, + 'compat_mode' => $compat_mode, + 'button_only' => isset( $atts['button_only'] ) ? intval( $atts['button_only'] ) : null, + 'btn_uniq_id' => isset( $uniq_id ) ? $uniq_id : '', + ); + //this would pass additional shortcode parameters from asp_product shortcode + $sc_params = array_merge( $atts, $sc_params ); + $buy_btn = $this->shortcode_accept_stripe_payment( $sc_params ); + } + + if ( ! isset( $sc_params['button_only'] ) ) { + $button_only = get_post_meta( $id, 'asp_product_button_only', true ); + } else { + $button_only = $sc_params['button_only']; + } + + if ( ( isset( $atts['fancy'] ) && empty( $atts['fancy'] ) ) || $button_only ) { + //Just show the stripe payment button (no fancy template) + $tpl = '
' . $buy_btn . '
'; + wp_enqueue_style( 'asp-default-style' ); + if ( ! $this->compat_mode ) { + $this->product_css_inserted = true; + } + return $tpl; + } + + //Show the stripe payment button with fancy style template. + require_once WP_ASP_PLUGIN_PATH . 'public/views/templates/' . $template_name . '/template.php'; + if ( isset( $atts['is_post_tpl'] ) ) { + $tpl = asp_get_post_template( $this->product_css_inserted ); + } else { + $tpl = asp_get_template( $this->product_css_inserted ); + } + if ( ! $this->compat_mode ) { + $this->product_css_inserted = true; + } + + $price_line = empty( $price ) ? '' : AcceptStripePayments::formatted_price( $price, $currency ); + + $qnt_str = ''; + if ( $quantity && 1 > $quantity ) { + $qnt_str = 'x ' . $quantity; + } + + remove_filter( 'the_content', array( $this, 'filter_post_type_content' ) ); + $post = get_post( $id ); + setup_postdata( $post ); + $GLOBALS['post'] = $post; + $descr = $post->post_content; + global $wp_embed; + if ( isset( $wp_embed ) && is_object( $wp_embed ) ) { + if ( method_exists( $wp_embed, 'autoembed' ) ) { + $descr = $wp_embed->autoembed( $descr ); + } + if ( method_exists( $wp_embed, 'run_shortcode' ) ) { + $descr = $wp_embed->run_shortcode( $descr ); + } + } + $descr = wpautop( do_shortcode( $descr ) ); + wp_reset_postdata(); + add_filter( 'the_content', array( $this, 'filter_post_type_content' ) ); + + $product_tags = array( + 'thumb_img' => $thumb_img, + 'quantity' => esc_attr( $qnt_str ), + 'name' => $post->post_title, + 'description' => $descr, + 'price' => esc_attr( $price_line ), + 'under_price_line' => wp_kses( $under_price_line, ASP_Utils::asp_allowed_tags() ), + 'buy_btn' => $buy_btn, + ); + + $product_tags = apply_filters( 'asp_product_tpl_tags_arr', $product_tags, $id ); + + foreach ( $product_tags as $tag => $repl ) { + $tpl = str_replace( '%_' . $tag . '_%', $repl, $tpl ); + } + + return $tpl; + } + + public function shortcode_accept_stripe_payment( $atts ) { + //Note: It will create a product dynamically using the (ASPMain::$temp_prod_slug) custom post type. + + $sc_attrs = shortcode_atts( + array( + 'product_id' => 0, + 'name' => '', + 'class' => 'stripe-button-el', //default Stripe button class + 'price' => '0', + 'shipping' => 0, + 'tax' => 0, + 'quantity' => '', + 'custom_quantity' => false, + 'description' => '', + 'url' => '', + 'thankyou_page_url' => '', + 'item_logo' => '', + 'billing_address' => '', + 'shipping_address' => '', + 'customer_email' => '', + 'customer_name' => '', + 'currency' => $this->asp_main->get_setting( 'currency_code' ), + 'currency_variable' => false, + 'checkout_lang' => $this->asp_main->get_setting( 'checkout_lang' ), + 'button_text' => $this->asp_main->get_setting( 'button_text' ), + 'compat_mode' => 0, + ), + $atts, + 'asp_accept_stripe_payment_atts', /* Provided for context to enable filtering */ + ); + + $product_id = absint(sanitize_text_field( $sc_attrs['product_id'] )); + $name = sanitize_text_field( $sc_attrs['name'] ); + $class = sanitize_text_field( $sc_attrs['class'] ); + $price = floatval(sanitize_text_field( $sc_attrs['price'] )); + $shipping = floatval(sanitize_text_field( $sc_attrs['shipping'] )); + $tax = floatval(sanitize_text_field( $sc_attrs['tax'] )); + $quantity = absint(sanitize_text_field( $sc_attrs['quantity'] )); + $custom_quantity = sanitize_text_field( $sc_attrs['custom_quantity'] ); + $description = sanitize_text_field( $sc_attrs['description'] ); + $url = sanitize_url( $sc_attrs['url'] ); + $thankyou_page_url = sanitize_url( $sc_attrs['thankyou_page_url'] ); + $item_logo = sanitize_url( $sc_attrs['item_logo'] ); + $billing_address = sanitize_text_field( $sc_attrs['billing_address'] ); + $shipping_address = sanitize_text_field( $sc_attrs['shipping_address'] ); + $customer_email = sanitize_email( $sc_attrs['customer_email'] ); + $customer_name = sanitize_text_field( $sc_attrs['customer_name'] ); + $currency = sanitize_text_field( $sc_attrs['currency'] ); + $currency_variable = sanitize_text_field( $sc_attrs['currency_variable'] ); + $checkout_lang = sanitize_text_field( $sc_attrs['checkout_lang'] ); + $button_text = sanitize_text_field( $sc_attrs['button_text'] ); + $compat_mode = sanitize_text_field( $sc_attrs['compat_mode'] ); + + $this->compat_mode = ( $compat_mode ) ? true : false; + + if ( empty( $name ) ) { + $error_msg = '
'; + $error_msg .= 'There is an error in your Stripe Payments shortcode. It is missing the "name" field. '; + $error_msg .= 'You must specify an item name value using the "name" parameter. This value should be unique so this item can be identified uniquely on the page.'; + $error_msg .= '
'; + return $error_msg; + } + + if ( ! empty( $url ) ) { + $url = base64_encode( $url ); + } else { + $url = ''; + } + + if ( ! empty( $thankyou_page_url ) ) { + $thankyou_page_url = base64_encode( $thankyou_page_url ); + } else { + $thankyou_page_url = ''; + } + + if ( ! is_numeric( $quantity ) ) { + $quantity = absint( $quantity ); + } + + if ( empty( $quantity ) && '1' !== $custom_quantity ) { + $quantity = 1; + } + + $price = floatval( $price ); + $uniq_id = count( self::$payment_buttons ) . uniqid(); + $button_id = 'asp_ng_button_' . $uniq_id; + self::$payment_buttons[] = $button_id; + + $item_price = $price; + $payment_amount = $custom_quantity ? $price : floatval( $price ) * $quantity; + if ( AcceptStripePayments::is_zero_cents( $currency ) ) { + //this is zero-cents currency, amount shouldn't be multiplied by 100 + $price_in_cents = $payment_amount; + } else { + $price_in_cents = $payment_amount * 100; + $item_price = $price * 100; + } + + if ( ! empty( $shipping ) ) { + $shipping_filt = round( $shipping, 2 ); + if ( ! AcceptStripePayments::is_zero_cents( $currency ) ) { + $shipping = $shipping_filt * 100; + } else { + $shipping = $shipping_filt; + } + } + + if ( ! empty( $price ) ) { + //let's apply tax if needed + if ( ! empty( $tax ) ) { + $tax_amount = round( ( $price_in_cents * $tax / 100 ) ); + $price_in_cents = $price_in_cents + $tax_amount; + } + + //let's apply shipping cost if needed + if ( ! empty( $shipping ) ) { + $price_in_cents = $price_in_cents + $shipping; + } + } + + if ( empty( $product_id ) ) { + $hash = md5( wp_json_encode( $atts ) ) . '5'; + //find temp product + $temp_post = get_posts( + array( + 'meta_key' => 'asp_shortcode_hash', + 'meta_value' => $hash, + 'posts_per_page' => 1, + 'offset' => 0, + 'post_type' => ASPMain::$temp_prod_slug, + ) + ); + wp_reset_postdata(); + if ( empty( $temp_post ) ) { + // no temp post found. Let's create one + $new_post = array(); + $new_post['post_type'] = ASPMain::$temp_prod_slug; + $new_post['post_title'] = $atts['name']; + $new_post['post_status'] = 'publish'; + $new_post['meta_input'] = array( + 'asp_shortcode_hash' => $hash, + 'asp_product_quantity' => $quantity, + 'asp_product_custom_quantity' => $custom_quantity, + 'asp_product_price' => $price, + 'asp_product_tax' => $tax, + 'asp_product_shipping' => $shipping, + 'asp_product_currency_variable' => $currency_variable, + 'asp_product_currency' => $currency, + 'asp_product_description' => $description, + 'asp_product_button_text' => $button_text, + 'asp_product_collect_billing_addr' => $billing_address, + 'asp_product_collect_shipping_addr' => $shipping_address, + 'asp_product_button_class' => $class, + 'asp_product_upload' => base64_decode( $url ), + 'asp_product_thumbnail' => $item_logo, + 'asp_product_thankyou_page' => empty( $thankyou_page_url ) ? '' : base64_decode( $thankyou_page_url ), + 'asp_product_button_only' => 1, + 'asp_product_custom_field' => 2, + 'asp_product_customer_email_hardcoded' => $customer_email, + 'asp_product_customer_name_hardcoded' => $customer_name, + ); + $post_id = wp_insert_post( $new_post ); + $temp_post = get_post( $post_id ); + } else { + $temp_post = $temp_post[0]; + } + $atts['id'] = $temp_post->ID; + $ret = $this->shortcode_asp_product( $atts ); + return $ret; + } + + $button_key = md5( htmlspecialchars_decode( $name ) . $price_in_cents ); + + //Charge description + //We only generate it if it's empty and if custom qunatity and price is not used + //If custom quantity and\or price are used, description will be generated by javascript + $descr_generated = false; + if ( empty( $description ) && '1' !== $custom_quantity && ( ! empty( $price ) && 0 !== $price ) ) { + //Create a description using quantity, payment amount and currency + if ( ! empty( $tax ) || ! empty( $shipping ) ) { + $formatted_amount = AcceptStripePayments::formatted_price( AcceptStripePayments::is_zero_cents( $currency ) ? $price_in_cents : $price_in_cents / 100, $currency ); + } else { + $formatted_amount = AcceptStripePayments::formatted_price( $payment_amount, $currency ); + } + $description = "{$quantity} X " . $formatted_amount; + $descr_generated = true; + } + + // Check if "Disable Buttons Before Javascript Loads" option is set + $is_disabled = ''; + if ( $this->asp_main->get_setting( 'disable_buttons_before_js_loads' ) ) { + $is_disabled = ' disabled'; + } + + $button = '
'; + $button .= ''; + $button .= '
'; + + $out_of_stock = false; + $stock_control_enabled = false; + $stock_items = 0; + //check if stock enabled + if ( isset( $product_id ) && get_post_meta( $product_id, 'asp_product_enable_stock', true ) ) { + //check if product is not out of stock + $stock_items = get_post_meta( $product_id, 'asp_product_stock_items', true ); + if ( empty( $stock_items ) ) { + $button = '
' . __( 'Out of stock', 'stripe-payments' ) . '
'; + $out_of_stock = true; + } else { + $stock_control_enabled = true; + $stock_items = $stock_items; + } + } + + //add message if no javascript is enabled + $button .= ''; + + $checkout_lang = empty( $checkout_lang ) ? $this->asp_main->get_setting( 'checkout_lang' ) : $checkout_lang; + + //Currency Display settings + $display_settings = array(); + $display_settings['c'] = $this->asp_main->get_setting( 'price_decimals_num', 2 ); + $display_settings['d'] = $this->asp_main->get_setting( 'price_decimal_sep' ); + $display_settings['t'] = $this->asp_main->get_setting( 'price_thousand_sep' ); + + $currencies = AcceptStripePayments::get_currencies(); + if ( isset( $currencies[ $currency ] ) ) { + $curr_sym = $currencies[ $currency ][1]; + } else { + //no currency code found, let's just use currency code instead of symbol + $curr_sym = $currencies; + } + + $curr_pos = $this->asp_main->get_setting( 'price_currency_pos' ); + + $display_settings['s'] = $curr_sym; + $display_settings['pos'] = $curr_pos; + + $display_str = array(); + $tax_str = apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ); + $ship_str = apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ); + + $display_str['tax'] = '%s (' . strtolower( $tax_str ) . ')'; + $display_str['ship'] = '%s (' . strtolower( $ship_str ) . ')'; + + $base_url = ASP_Utils::get_base_pp_url(); + + $url_params = array( + 'product_id' => $product_id, + ); + + if ( ! empty( $atts['btn_uniq_id'] ) ) { + $url_params['btn_uniq_id'] = $atts['btn_uniq_id']; + } + + $prefetch = $this->asp_main->get_setting( 'frontend_prefetch_scripts' ); + + if ( $prefetch ) { + $url_params['ckey'] = ASP_Utils::get_ckey(); + } + + $iframe_url = add_query_arg( $url_params, $base_url ); + + $data = array( + 'is_live' => $this->asp_main->is_live, + 'product_id' => $product_id, + 'iframe_url' => $iframe_url, + 'button_key' => $button_key, + 'item_price' => isset( $item_price ) ? $item_price : 0, + 'quantity' => $quantity, + 'custom_quantity' => $custom_quantity, + 'description' => $description, + 'descrGenerated' => $descr_generated, + 'shipping' => $shipping, + 'tax' => $tax, + 'image' => $item_logo, + 'currency' => $currency, + 'currency_variable' => $currency_variable, + 'locale' => ( empty( $checkout_lang ) ? 'auto' : $checkout_lang ), + 'name' => htmlspecialchars_decode( $name ), + 'url' => $url, + 'amount' => $price_in_cents, + 'billingAddress' => ( empty( $billing_address ) ? false : true ), + 'shippingAddress' => ( empty( $shipping_address ) ? false : true ), + 'customer_email' => $customer_email, + 'uniq_id' => $uniq_id, + 'variable' => ( empty( $price ) ? true : false ), + 'zeroCents' => $this->asp_main->zeroCents, + 'addonHooks' => array(), + 'button_text' => esc_attr( $button_text ), + 'out_of_stock' => $out_of_stock, + 'stock_control_enabled' => $stock_control_enabled, + 'stock_items' => $stock_items, + 'currencyFormat' => $display_settings, + 'displayStr' => $display_str, + 'thankyou_page_url' => $thankyou_page_url, + 'show_custom_amount_input' => false, + ); + + $data = apply_filters( 'asp-button-output-data-ready', $data, $atts ); + + $output = ''; + + //Let's insert Stripe default stylesheet only when it's needed + if ( 'stripe-button-el' === $class && ! ( ! $this->compat_mode && $this->stripe_css_inserted ) ) { + wp_enqueue_style( 'asp-stripe-button-css' ); + $this->stripe_css_inserted = true; + } + + $output .= $this->get_styles(); + + $output .= '
'; + + $output .= $this->get_button_code_new_method( $data ); + + $output .= '
'; + + $trans_name = 'stripe-payments-' . $button_key; //Create key using the item name. + $trans['tax'] = $tax; + $trans['shipping'] = $shipping; + $trans['price'] = $price; + set_transient( $trans_name, $trans, 2 * 3600 ); //Save the price for this item for 2 hours. + $output .= '
'; + //before button filter + if ( ! $out_of_stock ) { + $output = apply_filters( 'asp_ng_button_output_before_button', $output, $data, $class ); + } + $output .= '
'; + $output .= $button; + //after button filter + if ( ! $out_of_stock ) { + $output = apply_filters( 'asp_ng_button_output_after_button', $output, $data, $class ); + } + $output .= '
'; + $output .= '
' + . '
' + . '
' + . '
' + . '
' + . '
' + . '
' + . '
'; + + $output .= ''; + + $prefetch = $this->asp_main->get_setting( 'frontend_prefetch_scripts' ); + if ( $prefetch ) { + $this->asp_main->footer_scripts .= ''; + + if ( empty( $this->asp_main->sc_scripts_prefetched ) ) { + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + if ( ! defined( 'WP_ASP_DEV_MODE' ) ) { + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + } else { + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + $this->asp_main->footer_scripts .= ''; + } + } + } + return $output; + } + + private function get_styles() { + $output = ''; + if ( ! $this->button_css_inserted || $this->compat_mode ) { + ob_start(); + ?> + + '; + } + } + + if ( $data['show_custom_amount_input'] ) { + + if ( $data['amount'] == 0 ) { //price not specified, let's add an input box for user to specify the amount + $str_enter_amount = apply_filters( 'asp_customize_text_msg', __( 'Enter amount', 'stripe-payments' ), 'enter_amount' ); + $output .= '
'; + $output .= ''; + if ( ! $data['currency_variable'] ) { + $output .= ''. $data[ 'currency' ] .''; + } + $output .= ''; + $output .= '
'; + } + // if ( $data['currency_variable'] ) { + // //let's add a box where user can select currency + // $output .= '
'; + // $output .= ''; + // $output .= '
'; + // } + + } + + return $output; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/shortcodes/class-shortcode-asp.php b/wp-content/plugins/stripe-payments/includes/shortcodes/class-shortcode-asp.php new file mode 100644 index 0000000..398f9dd --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/shortcodes/class-shortcode-asp.php @@ -0,0 +1,941 @@ +AcceptStripePayments = AcceptStripePayments::get_instance(); + + //register the scripts. + add_action( 'wp_enqueue_scripts', array( $this, 'register_stripe_script' ) ); + + if ( ! is_admin() ) { + //Frontend only code. + + //NOTE: more shortcodes are defined in the class 'ASP_Shortcode_NG'. + add_shortcode( 'asp_show_all_products', array( &$this, 'shortcode_show_all_products' ) ); + add_shortcode( 'accept_stripe_payment_checkout', array( &$this, 'shortcode_accept_stripe_payment_checkout' ) ); + add_shortcode( 'accept_stripe_payment_checkout_error', array( &$this, 'shortcode_accept_stripe_payment_checkout_error' ) ); + add_shortcode( 'asp_show_my_transactions', array( $this, 'show_user_transactions' ) ); + add_shortcode( 'asp_available_quantity', array( $this, 'show_available_quantity' ) ); + + add_filter( 'widget_text', 'do_shortcode' ); + } + } + + /** + * Return an instance of this class. + * + * @since 1.0.0 + * + * @return object A single instance of this class. + */ + public static function get_instance() { + + // If the single instance hasn't been set, set it now. + if ( null === self::$instance ) { + self::$instance = new self(); + } + + return self::$instance; + } + + function get_loc_data() { + //localization data, some settings and Stripe API key + $key = $this->AcceptStripePayments->APIPubKey; + $key_test = $this->AcceptStripePayments->APIPubKeyTest; + $minAmounts = $this->AcceptStripePayments->minAmounts; + $zeroCents = $this->AcceptStripePayments->zeroCents; + + $amountOpts = array( + 'applySepOpts' => $this->AcceptStripePayments->get_setting( 'price_apply_for_input' ), + 'decimalSep' => $this->AcceptStripePayments->get_setting( 'price_decimal_sep' ), + 'thousandSep' => $this->AcceptStripePayments->get_setting( 'price_thousand_sep' ), + ); + + $loc_data = array( + 'strEnterValidAmount' => apply_filters( 'asp_customize_text_msg', __( 'Please enter a valid amount', 'stripe-payments' ), 'enter_valid_amount' ), + 'strMinAmount' => apply_filters( 'asp_customize_text_msg', __( 'Minimum amount is', 'stripe-payments' ), 'min_amount_is' ), + 'strEnterQuantity' => apply_filters( 'asp_customize_text_msg', __( 'Please enter quantity.', 'stripe-payments' ), 'enter_quantity' ), + 'strQuantityIsZero' => apply_filters( 'asp_customize_text_msg', __( 'Quantity can\'t be zero.', 'stripe-payments' ), 'quantity_is_zero' ), + 'strQuantityIsFloat' => apply_filters( 'asp_customize_text_msg', __( 'Quantity should be integer value.', 'stripe-payments' ), 'quantity_is_float' ), + 'strStockNotAvailable' => apply_filters( 'asp_customize_text_msg', __( 'You cannot order more items than available: %d', 'stripe-payments' ), 'stock_not_available' ), + 'strTax' => apply_filters( 'asp_customize_text_msg', __( 'Tax', 'stripe-payments' ), 'tax_str' ), + 'strShipping' => apply_filters( 'asp_customize_text_msg', __( 'Shipping', 'stripe-payments' ), 'shipping_str' ), + 'strSurcharge' => apply_filters( 'asp_customize_text_msg', __( 'Surcharge', 'stripe-payments' ), 'surcharge_str' ), + 'strTotal' => __( 'Total:', 'stripe-payments' ), + 'strPleaseFillIn' => apply_filters( 'asp_customize_text_msg', __( 'Please fill in this field.', 'stripe-payments' ), 'fill_in_field' ), + 'strPleaseCheckCheckbox' => __( 'Please check this checkbox.', 'stripe-payments' ), + 'strMustAcceptTos' => apply_filters( 'asp_customize_text_msg', __( 'You must accept the terms before you can proceed.', 'stripe-payments' ), 'accept_terms' ), + 'strRemoveCoupon' => apply_filters( 'asp_customize_text_msg', __( 'Remove coupon', 'stripe-payments' ), 'remove_coupon' ), + 'strRemove' => apply_filters( 'asp_customize_text_msg', __( 'Remove', 'stripe-payments' ), 'remove' ), + 'strStartFreeTrial' => apply_filters( 'asp_customize_text_msg', __( 'Start Free Trial', 'stripe-payments' ), 'start_free_trial' ), + 'strInvalidCFValidationRegex' => __( 'Invalid validation RegEx: ', 'stripe-payments' ), + 'key' => $key, + 'key_test' => $key_test, + 'ajax_url' => admin_url( 'admin-ajax.php' ), + 'minAmounts' => $minAmounts, + 'zeroCents' => $zeroCents, + 'amountOpts' => $amountOpts, + ); + return $loc_data; + } + + function register_stripe_script() { + wp_register_script( 'stripe-script', 'https://checkout.stripe.com/checkout.js', array(), null, true ); + wp_register_script( 'stripe-handler', WP_ASP_PLUGIN_URL . '/public/assets/js/stripe-handler.js', array( 'jquery' ), WP_ASP_PLUGIN_VERSION, true ); + + wp_localize_script( 'stripe-handler', 'stripehandler', $this->get_loc_data() ); + + wp_register_style( 'asp-all-products-css', WP_ASP_PLUGIN_URL . '/public/views/all-products/default/style.css', array(), WP_ASP_PLUGIN_VERSION ); + + // addons can register their scripts if needed + do_action( 'asp-button-output-register-script' ); + } + + function after_button_add_tos_filter( $output, $data, $class ) { + $output = apply_filters( 'asp_button_output_before_tos', $output, $data ); + $output .= $this->tplTOS; + $this->tplTOS = ''; + return $output; + } + + function after_button_add_сf_filter( $output, $data, $class ) { + $output .= $this->tplCF; + $this->tplCF = ''; + return $output; + } + + function tpl_get_tos( $output, $data ) { + if ( $data['tos'] == 1 && empty( $this->tplTOS ) ) { + $tos_text = $this->AcceptStripePayments->get_setting( 'tos_text' ); + $tplTOS = ''; + $tplTOS .= '
'; + $tplTOS .= ''; + $tplTOS .= ""; + $tplTOS .= '
'; + $this->tplTOS = $tplTOS; + } + $tosPos = $this->AcceptStripePayments->get_setting( 'tos_position' ); + if ( $tosPos !== 'below' ) { + $output = apply_filters( 'asp_button_output_before_tos', $output, $data ); + $output .= $this->tplTOS; + $this->tplTOS = ''; + } else { + add_filter( 'asp_button_output_after_button', array( $this, 'after_button_add_tos_filter' ), 1000, 3 ); + } + return $output; + } + + function tpl_get_cf( $output, $data ) { + if ( $data['custom_field'] == 1 && empty( $this->tplCF ) ) { + $replaceCF = apply_filters( 'asp_button_output_replace_custom_field', '', $data ); + if ( ! empty( $replaceCF ) ) { + //we got custom field replaced + $this->tplCF = $replaceCF; + $output .= $this->tplCF; + $this->tplCF = ''; + return $output; + } + $field_type = $this->AcceptStripePayments->get_setting( 'custom_field_type' ); + $field_name = $this->AcceptStripePayments->get_setting( 'custom_field_name' ); + $field_name = empty( $field_name ) ? __( 'Custom Field', 'stripe-payments' ) : $field_name; + $field_descr = $this->AcceptStripePayments->get_setting( 'custom_field_descr' ); + $descr_loc = $this->AcceptStripePayments->get_setting( 'custom_field_descr_location' ); + $mandatory = $this->AcceptStripePayments->get_setting( 'custom_field_mandatory' ); + $tplCF = ''; + $tplCF .= "
"; + $tplCF .= ''; + switch ( $field_type ) { + case 'text': + if ( $descr_loc !== 'below' ) { + $tplCF .= ''; + } else { + $tplCF .= ''; + $tplCF .= '
' . $field_descr . '
'; + } + break; + case 'checkbox': + $tplCF .= ''; + break; + } + $tplCF .= "" . + '
'; + $this->tplCF = $tplCF; + } + + //This custom field position option is used only for the legacy API which has been deprecated. It's here for backwards compatibility. + $cfPos = $this->AcceptStripePayments->get_setting( 'custom_field_position' ); + if ( $cfPos !== 'below' ) { + $output .= $this->tplCF; + $this->tplCF = ''; + } else { + add_filter( 'asp_button_output_after_button', array( $this, 'after_button_add_сf_filter' ), 990, 3 ); + } + + return $output; + } + + function show_user_transactions( $atts ) { + $atts = shortcode_atts( + array( + 'items_per_page' => '20', + 'show_subscription_cancel' => 0, + 'show_download_link' => 1, + ), + $atts, + 'asp_show_my_transactions' + ); + + $atts = array_map('sanitize_text_field', $atts); + + require_once WP_ASP_PLUGIN_PATH . 'includes/shortcodes/show-user-transactions.php'; + $scClass = new AcceptStripePayments_scUserTransactions(); + return $scClass->process_shortcode( $atts ); + } + + /** + * Displays available stock quantity of a product. + * If stock control is turned of, It shows 'Unlimited'. + * + * @param Array $atts Shortcode attributes. + * @return String HTML + */ + function show_available_quantity( $atts ) { + if ( ! isset( $atts['id'] ) || ! is_numeric( $atts['id'] ) ) { + $error_msg = '
'; + $error_msg .= 'Error: product ID is invalid.'; + $error_msg .= '
'; + return $error_msg; + } + $id = $atts['id']; + $post = get_post( $id ); + if ( ! $post || get_post_type( $id ) != ASPMain::$products_slug ) { + $error_msg = '
'; + $error_msg .= "Error: invalid product ID " . $id; + $error_msg .= '
'; + return $error_msg; + } + + $available_quantity = esc_attr(get_post_meta( $id, 'asp_product_stock_items', true )); + $stock_enable = esc_attr(get_post_meta( $id, 'asp_product_enable_stock', true )); + + $output = ''; + $output .= $stock_enable ? $available_quantity : 'Unlimited'; + $output .= ''; + return $output; + } + + function get_styles() { + $output = ''; + if ( ! $this->ButtonCSSInserted || $this->CompatMode ) { + // $this->ButtonCSSInserted = true; + // we need to style custom inputs + $style = file_get_contents( WP_ASP_PLUGIN_PATH . 'public/assets/css/public.css' ); + $output .= ''; + //addons can output their styles if needed + $output = apply_filters( 'asp-button-output-additional-styles', $output ); + ob_start(); + ?> + + CompatMode ) { + ob_start(); + ?> + + + + + $data ) ); + //enqueue our script that handles the stuff + wp_enqueue_script( 'stripe-handler' ); + } + //addons can enqueue their scripts if needed + do_action( 'asp-button-output-enqueue-script' ); + return $output; + } + + function get_button_code_new_method( $data ) { + $output = ''; + + if ( ! $data['out_of_stock'] ) { + + if ( $data['amount'] == 0 ) { //price not specified, let's add an input box for user to specify the amount + $str_enter_amount = apply_filters( 'asp_customize_text_msg', __( 'Enter amount', 'stripe-payments' ), 'enter_amount' ); + $output .= "
" + . ""; + if ( ! $data['currency_variable'] ) { + $output .= " {$data[ 'currency' ]}"; + } + $output .= "" + . '
'; + } + if ( $data['currency_variable'] ) { + //let's add a box where user can select currency + $output .= '
'; + $output .= ''; + $output .= '
'; + } + if ( $data['custom_quantity'] === '1' ) { //we should output input for customer to input custom quantity + if ( empty( $data['quantity'] ) ) { + //If quantity option is enabled and the value is empty then set default quantity to 1 so the number field type can handle it better. + $data['quantity'] = 1; + } + $output .= "
" + . "" + . " " . __( 'X item(s)', 'stripe-payments' ) . '' + . "" + . '
'; + } + + $output = apply_filters( 'asp_button_output_before_custom_field', $output, $data ); + + //Output Custom Field if needed + $output = $this->tpl_get_cf( $output, $data ); + + //Get subscription plan ID for the product (if any) + $plan_id = get_post_meta( $data['product_id'], 'asp_sub_plan_id', true ); + + //Variations + if ( ! empty( $data['variations'] ) ) { + //we got variations for this product + $variations_str = ''; + foreach ( $data['variations']['groups'] as $grp_id => $group ) { + if ( ! empty( $data['variations']['names'] ) ) { + $variations_str .= '
'; + $variations_str .= ''; + if ( isset( $data['variations']['opts'][ $grp_id ] ) && $data['variations']['opts'][ $grp_id ] === '1' ) { + //radio buttons output + } else { + $variations_str .= sprintf( '%s %s'; + } else { + $tpl = ''; + } + $price_mod = $data['variations']['prices'][ $grp_id ][ $var_id ]; + if ( ! empty( $price_mod ) ) { + $fmt_price = AcceptStripePayments::formatted_price( abs( $price_mod ), $data['currency'] ); + $price_mod = $price_mod < 0 ? ' - ' . $fmt_price : ' + ' . $fmt_price; + $price_mod = '(' . $price_mod . ')'; + } else { + $price_mod = ''; + } + $variations_str .= sprintf( $tpl, $var_id, $name, $price_mod ); + } + if ( isset( $data['variations']['opts'][ $grp_id ] ) && $data['variations']['opts'][ $grp_id ] === '1' ) { + //radio buttons output + } else { + $variations_str .= ''; + } + $variations_str .= '
'; + } + } + $output .= $variations_str; + } + + //add TOS box if needed + $output = $this->tpl_get_tos( $output, $data ); + + //Coupons + if ( isset( $data['coupons_enabled'] ) && $data['coupons_enabled'] == '1' && ! $data['variable'] ) { + if ( isset( $data['product_id'] ) ) { + //check if this is subscription product. If it is, we will only display coupon field if subs addon version is >=1.3.3t1 + if ( ! $plan_id || ( $plan_id && class_exists( 'ASPSUB_main' ) && version_compare( ASPSUB_main::ADDON_VER, '1.3.3t1' ) >= 0 ) ) { + $str_coupon_label = __( 'Coupon Code', 'stripe-payments' ); + $output .= '
' + . '' + . '
' + . '
'; + } + } + } + } + if ( $data ) { + if ( $data['product_id'] !== 0 ) { + $output .= ""; + } + $output .= "" + . "" + . "" + . "" + . "" + . "" + . "" + . "" + . ""; + } + + return $output; + } + + function shortcode_accept_stripe_payment_checkout( $atts, $content = '' ) { + if ( ! defined( 'DONOTCACHEPAGE' ) ) { + define( 'DONOTCACHEPAGE', true ); + } + + $aspData = array(); + $sess = ASP_Session::get_instance(); + $aspData = $sess->get_transient_data( 'asp_data' ); + if ( empty( $aspData ) ) { + // no session data, let's display nothing for now + return; + } + + // Check if $content is empty or not. If $content is empty, it means that it is using the standard thank you page shortcode (no customization using the shortcode opening and ending tags). + if ( empty( $content ) ) { + // Let's display the default/standard thank you page output. + // This scenario is not using the shortcode opening and ending tags for customization. + + if ( isset( $aspData['error_msg'] ) && ! empty( $aspData['error_msg'] ) ) { + //some error occurred, let's display it + return __( 'System was not able to complete the payment.', 'stripe-payments' ) . ' ' . $aspData['error_msg']; + } + + //Create the default thank you page output template. Later we will replace the placeholders with actual data. + ob_start(); + ?> +
+

+
+
+
+
{purchase_date_only}
+
+ +
+
+
{transaction_id}
+
+
+ +

+ + + + + + + + + + + + + + + + + + + $price ) { + if ( $price < 0 ) { + $amnt_str = '-' . AcceptStripePayments::formatted_price( abs( $price ), $aspData['currency_code'] ); + } else { + $amnt_str = AcceptStripePayments::formatted_price( $price, $aspData['currency_code'] ); + } + echo ''; + } + } + ?> + + + + + + + + +
{item_name}{item_price_curr}
+ + x {item_quantity}
' . $item . '' . $amnt_str. '
{paid_amount_curr}
+ + +

+ + + + + + + + + + + + + + + + + + + + + + +
{item_name} +
+
+ + + +
+

+
{shipping_address}
+
+ + + +
+

+
{billing_address}
+
+ +
+ apply_content_tags( $output, $aspData ); + } + + // Fallback to the customized thank you page output (where the shortcode opening and ending tags are used for customization). + if ( isset( $aspData['error_msg'] ) && ! empty( $aspData['error_msg'] ) ) { + //some error occurred. Let's check if we have [accept_stripe_payment_checkout_error] shortcode on page + $page_content = get_the_content(); + if ( ! empty( $page_content ) && ! has_shortcode( $page_content, 'accept_stripe_payment_checkout_error' ) ) { + //no error output shortcode found. Let's output default error message + return __( 'System was not able to complete the payment.', 'stripe-payments' ) . ' ' . $aspData['error_msg']; + } + return; + } + + $content = apply_filters( 'asp_stripe_payments_checkout_page_result', $content, $aspData ); + + $content = $this->apply_content_tags( do_shortcode( $content ), $aspData ); + return $content; + } + + function shortcode_accept_stripe_payment_checkout_error( $atts, $content = '' ) { + $aspData = array(); + $sess = ASP_Session::get_instance(); + $aspData = $sess->get_transient_data( 'asp_data' ); + if ( empty( $aspData ) ) { + // no session data, let's display nothing for now + return; + } + if ( isset( $aspData['error_msg'] ) && ! empty( $aspData['error_msg'] ) ) { + //some error occurred. Let's display error message + $content = $this->apply_content_tags( do_shortcode( $content ), $aspData ); + return $content; + } + // no error occurred - we don't display anything + return; + } + + function shortcode_show_all_products( $params ) { + + $params = shortcode_atts( + array( + 'items_per_page' => '30', + 'sort_by' => 'none', + 'sort_order' => 'desc', + 'template' => '', + 'search_box' => '1', + ), + $params, + 'asp_show_all_products' + ); + + //Handle the 'sort by' and 'sort order' options. + //Check if the user has changed/selected a 'sort by' option from the UI. + $sort_by = isset( $_GET['asp-sortby'] ) ? sanitize_text_field( stripslashes ( $_GET['asp-sortby'] ) ) : ''; + //Value of 'sort_by' from the shortcode parameters. + $sc_sort_by = isset( $params['sort_by'] ) ? $params['sort_by'] : 'id'; + //Value of 'sort_order' from the shortcode parameters. + $sc_sort_direction = isset( $params['sort_order'] ) ? strtoupper( $params['sort_order'] ) : 'desc'; + + if( !empty($sort_by) ) { + //User has selected a 'sort by' option from the UI. + $order_by = explode("-",$sort_by)[0]; + $sort_direction = isset(explode("-",$sort_by)[1]) ? explode("-",$sort_by)[1] : "asc"; + } + else{ + //Set default sorting option on page load. + //If shortcode has sorting parameters specified then it will use those otherwise, it will use the default value of 'id'. + $order_by = $sc_sort_by; + $sort_direction = $sc_sort_direction; + } + + //Include the template file for displaying all products. + $tpl = array(); + include_once WP_ASP_PLUGIN_PATH . 'public/views/all-products/default/template.php'; + + //Pagination related variables. + $page = filter_input( INPUT_GET, 'asp_page', FILTER_SANITIZE_NUMBER_INT ); + $page = empty( $page ) ? 1 : $page; + + //Query arguments for fetching products. + $q = array( + 'post_type' => ASPMain::$products_slug, + 'post_status' => 'publish', + 'posts_per_page' => isset( $params['items_per_page'] ) ? $params['items_per_page'] : 30, + 'paged' => $page, + 'orderby' => $order_by, + 'order' => $sort_direction, + ); + + //Handle search + $search = isset( $_GET['asp_search'] ) ? sanitize_text_field( stripslashes ( $_GET['asp_search'] ) ) : ''; + $search = empty( $search ) ? false : $search; + if ( $search !== false ) { + $q['s'] = $search; + } + + if( $q["orderby"] == "price" ) { + add_filter( 'posts_orderby', array(__CLASS__,'asp_orderby_price_callback' )); + } + + $products = new WP_Query( $q ); + + if( $q["orderby"] == "price" ) { + remove_filter( 'posts_orderby',array(__CLASS__,'asp_orderby_price_callback') ); + } + + if ( ! $products->have_posts() ) { + //query returned no results. Let's see if that was a search query + if ( $search === false ) { + //that wasn't search query. That means there is no products configured + wp_reset_postdata(); + return __( 'No products have been configured yet', 'stripe-payments' ); + } + } + + $search_box = ! empty( $params['search_box'] ) ? $params['search_box'] : false; + + if ( $search_box ) { + if ( $search !== false ) { + $tpl['clear_search_url'] = esc_url( remove_query_arg( array( 'asp_search', 'asp_page' ) ) ); + $tpl['search_result_text'] = $products->found_posts === 0 ? __( 'Nothing found for', 'stripe-payments' ) . ' "%s".' : __( 'Search results for', 'stripe-payments' ) . ' "%s".'; + $tpl['search_result_text'] = sprintf( $tpl['search_result_text'], htmlentities( $search ) ); + $tpl['search_term'] = htmlentities( $search ); + } else { + $tpl['search_result_text'] = ''; + $tpl['clear_search_button'] = ''; + $tpl['search_term'] = ''; + } + } else { + $tpl['search_box'] = ''; + } + + if (!isset($tpl['products_list'])){ + $tpl['products_list'] = ''; + } + $tpl['products_list'] .= isset($tpl['products_row_start']) ? $tpl['products_row_start'] : ''; + $i = isset($tpl['products_per_row']) ? $tpl['products_per_row'] : 3; //items per row + + while ( $products->have_posts() ) { + $products->the_post(); + $i --; + if ( $i < 0 ) { //new row + $tpl['products_list'] .= isset($tpl['products_row_end']) ? $tpl['products_row_end'] : ''; + $tpl['products_list'] .= isset($tpl['products_row_start']) ? $tpl['products_row_start'] : ''; + $i = (isset($tpl['products_per_row']) ? $tpl['products_per_row'] : 3) - 1; + } + + $id = get_the_ID(); + + $thumb_url = get_post_meta( $id, 'asp_product_thumbnail', true ); + if ( ! $thumb_url ) { + $thumb_url = WP_ASP_PLUGIN_URL . '/assets/product-thumb-placeholder.png'; + } + + $view_btn = str_replace( '%[product_url]%', get_permalink(), (isset($tpl['view_product_btn']) ? $tpl['view_product_btn'] : '') ); + + $price = get_post_meta( $id, 'asp_product_price', true ); + $curr = get_post_meta( $id, 'asp_product_currency', true ); + + if ( empty( $plan_id ) ) { + //let's apply filter so addons can change price, currency and shipping if needed + $price_arr = array( + 'price' => $price, + 'currency' => $curr, + 'shipping' => empty( $shipping ) ? false : $shipping, + ); + $price_arr = apply_filters( 'asp_modify_price_currency_shipping', $price_arr ); + extract( $price_arr, EXTR_OVERWRITE ); + $curr = $currency; + } + + $price_orig = $price; + + $price = AcceptStripePayments::formatted_price( $price, $curr ); + if ( empty( $price ) ) { + $price = ' '; + } + + $constr_price_var = get_post_meta( $id, 'asp_product_hide_amount_input', true ); + + if ( empty( $price_orig ) && ! empty( $constr_price_var ) ) { + $price = __( 'Variable', 'stripe-payments' ); + } + + $item_tags = array( 'price' => $price ); + + $item_tags = apply_filters( 'asp_product_tpl_tags_arr', $item_tags, $id ); + + $price = $item_tags['price']; + + $item = str_replace( + array( + '%[product_id]%', + '%[product_name]%', + '%[product_thumb]%', + '%[view_product_btn]%', + '%[product_price]%', + ), + array( + $id, + get_the_title(), + $thumb_url, + $view_btn, + $price, + ), + ( isset($tpl['products_item']) ? $tpl['products_item'] : '') + ); + + $tpl['products_list'] .= $item; + } + + $tpl['products_list'] .= isset($tpl['products_row_end']) ? $tpl['products_row_end'] : ''; + + //pagination + + $tpl['pagination_items'] = ''; + + $pages = $products->max_num_pages; + + if ( $pages > 1 ) { + $i = 1; + + while ( $i <= $pages ) { + if ( $i != $page ) { + $url = esc_url( add_query_arg( 'asp_page', $i ) ); + $str = str_replace( array( '%[url]%', '%[page_num]%' ), array( $url, $i ), $tpl['pagination_item'] ); + } else { + $str = str_replace( '%[page_num]%', $i, $tpl['pagination_item_current'] ); + } + $tpl['pagination_items'] .= $str; + $i ++; + } + } + + if ( empty( $tpl['pagination_items'] ) ) { + $tpl['pagination'] = ''; + } + + wp_reset_postdata(); + + //Build template + foreach ( $tpl as $key => $value ) { + $tpl['page'] = str_replace( '_%' . $key . '%_', $value, ( isset( $tpl['page'] ) ? $tpl['page'] : '') ); + } + + $output = '
'.$tpl['page'].'
'; + return $output; + } + + + public static function asp_orderby_price_callback( $orderby ) { + global $wpdb; + $order = ""; + if(stripos( $orderby, "desc" ) !== false) { + $order="desc"; + } + else{ + $order="asc"; + } + + $orderby = " + CASE + WHEN (select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_type' and wp.post_id=wp_posts.ID limit 1) ='one_time' THEN cast((select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_price' and wp.post_id=wp_posts.ID limit 1) as decimal) + WHEN ((select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_price' and wp.post_id=wp_posts.ID limit 1) is not null and (select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_price' and wp.post_id=wp_posts.ID limit 1)>0) THEN cast((select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_price' and wp.post_id=wp_posts.ID limit 1) as decimal) + WHEN (select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_type' and wp.post_id=wp_posts.ID limit 1) ='donation' THEN cast(0 as decimal) + WHEN (select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_product_min_amount' and wp.post_id=wp_posts.ID limit 1) is not null THEN cast(0 as decimal) + WHEN (select wp.meta_value from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_sub_plan_id' and wp.post_id=wp_posts.ID limit 1) is not null THEN cast((select (select plan.meta_value from ".$wpdb->prefix."postmeta plan where plan.post_id=wp.meta_value and plan.meta_key='asp_sub_plan_price' limit 1) from ".$wpdb->prefix."postmeta wp where wp.meta_key='asp_sub_plan_id' and wp.post_id=wp_posts.ID limit 1) as decimal) + else 0 + END ".$order." + "; + + return $orderby; + } + + function apply_content_tags( $content, $data ) { + + $tags = array(); + $vals = array(); + + if ( isset( $data['custom_fields'] ) && ! empty( $data['custom_fields'] ) ) { + $data['custom_field'] = ''; + foreach ( $data['custom_fields'] as $field ) { + $data['custom_field'] .= $field['name'] . ': ' . $field['value'] . "\r\n"; + } + $data['custom_field'] = rtrim( $data['custom_field'], "\r\n" ); + $data['custom_field'] = nl2br( $data['custom_field'] ); + $first_item = reset( $data['custom_fields'] ); + $data['custom_field_name'] = $first_item; + $data['custom_field_value'] = $first_item; + } else { + $data['custom_field'] = null; + $data['custom_field_name'] = null; + $data['custom_field_value'] = null; + } + + if ( isset( $data['paid_amount'] ) ) { + $data['paid_amount_curr'] = AcceptStripePayments::formatted_price( $data['paid_amount'], $data['currency_code'] ); + } else { + $data['paid_amount'] = 0; + $data['paid_amount_curr'] = 0; + } + $data['purchase_amt'] = $data['paid_amount']; + $data['purchase_amt_curr'] = $data['paid_amount_curr']; + + $curr = isset( $data['currency_code'] ) ? $data['currency_code'] : ''; + $currencies = AcceptStripePayments::get_currencies(); + if ( isset( $currencies[ $curr ] ) ) { + $curr_sym = $currencies[ $curr ][1]; + } else { + $curr_sym = ''; + } + $data['currency'] = $curr_sym; + + if ( isset( $data['item_price'] ) ) { + $data['item_price_curr'] = AcceptStripePayments::formatted_price( $data['item_price'], $data['currency_code'] ); + } else { + $data['item_price'] = 0; + } + + if ( isset( $data['tax_perc'] ) && ! empty( $data['tax_perc'] ) ) { + $data['tax_perc_fmt'] = $data['tax_perc'] . '%'; + } + if ( isset( $data['tax'] ) && ! empty( $data['tax'] ) ) { + $data['tax_amt'] = AcceptStripePayments::formatted_price( $data['tax'], $data['currency_code'] ); + } + if ( isset( $data['shipping'] ) && ! empty( $data['shipping'] ) ) { + $data['shipping_amt'] = AcceptStripePayments::formatted_price( $data['shipping'], $data['currency_code'] ); + } + + if (isset($data['charge']['created'])){ + $data['purchase_date_only'] = get_date_from_gmt( date( 'Y-m-d H:i:s', $data['charge']['created'] ), get_option( 'date_format' )); + } + + // we should unset as it's not a string and it would produce following fatal error if not unset: + // Object of class __PHP_Incomplete_Class could not be converted to string + unset( $data['charge'] ); + + foreach ( $data as $key => $value ) { + if ( $key == 'stripeEmail' ) { + $key = 'payer_email'; + } + if ( $key == 'txn_id' ) { + $key = 'transaction_id'; + } + if ( $key == 'tax' ) { //we don't set 'tax' key so it won't replace our new 'tax' key which we set below + continue; + } + if ( $key == 'tax_perc_fmt' ) { + $key = 'tax'; + } + $tags[] = '{' . $key . '}'; + $vals[] = is_array( $value ) ? '' : $value; + } + + //add email merge tags to the available merge tags + $sess = ASP_Session::get_instance(); + $sess_tags = $sess->get_transient_data( 'asp_checkout_data_tags', array() ); + $sess_vals = $sess->get_transient_data( 'asp_checkout_data_vals', array() ); + + foreach ( $sess_tags as $key => $value ) { + if ( empty( $tags[ $value ] ) ) { + if ( $value === '{product_details}' ) { + //replace new lines to
to display product details properly + $sess_vals[ $key ] = nl2br( $sess_vals[ $key ] ); + } + $tags[] = $value; + $vals[] = $sess_vals[ $key ]; + } + } + + $content = str_replace( $tags, $vals, $content ); + return $content; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/shortcodes/show-user-transactions.php b/wp-content/plugins/stripe-payments/includes/shortcodes/show-user-transactions.php new file mode 100644 index 0000000..c2c5c50 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/shortcodes/show-user-transactions.php @@ -0,0 +1,81 @@ +user_id = get_current_user_id(); + } + + public function process_shortcode( $atts ) { + $out = ''; + if ( ! $this->user_id ) { + //user not logged in + $redirect = get_permalink(); + $login_url = wp_login_url( $redirect ); + // translators: %s is login URL + $out .= sprintf( __( 'Please login to see your transactions history.', 'stripe-payments' ), $login_url ); + return $out; + } + //let's find all user transactions + $curr_page = filter_input( INPUT_GET, 'asp_page', FILTER_SANITIZE_NUMBER_INT ); + if ( ! $curr_page ) { + $curr_page = 1; + } + $args = array( + 'posts_per_page' => $atts['items_per_page'], + 'offset' => ( $curr_page - 1 ) * $atts['items_per_page'], + 'post_type' => 'stripe_order', + 'meta_key' => 'asp_user_id', + 'meta_value' => $this->user_id, + ); + $res = new WP_Query( $args ); + $transactions = $res->posts; + wp_reset_postdata(); + if ( ! $transactions ) { + //no transactions found + $out .= __( 'No transactions found.', 'stripe-payments' ); + return $out; + } + + $atts['curr_page'] = $curr_page; + $atts['total_pages'] = ceil( $res->found_posts / $atts['items_per_page'] ); + + require_once( WP_ASP_PLUGIN_PATH . 'public/views/templates/default/tpl-show-user-transactions.php' ); + $tpl = new AcceptStripePayments_tplUserTransactions( $atts ); + + $items = array(); + foreach ( $transactions as $trans ) { + $additional_data = array(); + $order_data = get_post_meta( $trans->ID, 'order_data', true ); + if ( $order_data ) { + $product_id = $order_data['product_id']; + + $additional_data = apply_filters( 'asp_sc_show_user_transactions_additional_data', $additional_data, $order_data, $atts ); + + $amount = AcceptStripePayments::formatted_price( $order_data['paid_amount'], $order_data['currency_code'] ); + $product_name = $order_data['item_name']; + if ( $atts['show_download_link'] && ! empty( $order_data['item_url'] ) ) { + $additional_data[] = array( __( 'Download link:', 'stripe-payments' ) => sprintf( '' . __( 'Click here to download', 'stripe-payments' ) . '', $order_data['item_url'] ) ); + } + } else { + $product_id = '-'; + $amount = '-'; + $product_name = $trans->post_title; + } + + $item = array( + 'product_name' => $product_name, + 'product_id' => $product_id, + 'date' => $trans->post_date, + 'amount' => $amount, + 'additional_data' => $additional_data, + ); + $items[] = $item; + } + $out .= $tpl->build_tpl( $items ); + return $out; + } + +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/.coveralls.github-actions.yml b/wp-content/plugins/stripe-payments/includes/stripe/.coveralls.github-actions.yml new file mode 100644 index 0000000..40ff9a7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/.coveralls.github-actions.yml @@ -0,0 +1,3 @@ +service_name: github-actions +coverage_clover: clover.xml +json_path: coveralls-upload.json diff --git a/wp-content/plugins/stripe-payments/includes/stripe/.editorconfig b/wp-content/plugins/stripe-payments/includes/stripe/.editorconfig new file mode 100644 index 0000000..174e912 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/.editorconfig @@ -0,0 +1,20 @@ +; https://editorconfig.org/ + +root = true + +[*] +indent_style = space +indent_size = 4 +insert_final_newline = true +trim_trailing_whitespace = true +end_of_line = lf +charset = utf-8 + +[*.{json,yml}] +indent_size = 2 + +[*.neon] +indent_style = tab + +[Makefile] +indent_style = tab diff --git a/wp-content/plugins/stripe-payments/includes/stripe/.gitignore b/wp-content/plugins/stripe-payments/includes/stripe/.gitignore new file mode 100644 index 0000000..880465a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/.gitignore @@ -0,0 +1,35 @@ +# Ignore build files +build/* + +# Mac OS X dumps these all over the place. +.DS_Store + +# Ignore the SimpleTest library if it is installed to /test/. +/test/simpletest/ + +# Ignore the /vendor/ directory for people using composer +/vendor/ + +# If the vendor directory isn't being commited the composer.lock file should also be ignored +composer.lock + +# Ignore PHPUnit coverage file +clover.xml + +# Ignore IDE's configuration files +.idea + +# Ignore PHP CS Fixer local config and cache +.php_cs +.php_cs.cache +.php-cs-fixer.cache + +# Ignore PHPStan local config +.phpstan.neon + +# Ignore phpDocumentor's local config and artifacts +.phpdoc/* +phpdoc.xml + +# Ignore cached PHPUnit results. +.phpunit.result.cache diff --git a/wp-content/plugins/stripe-payments/includes/stripe/.php-cs-fixer.php b/wp-content/plugins/stripe-payments/includes/stripe/.php-cs-fixer.php new file mode 100644 index 0000000..d833758 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/.php-cs-fixer.php @@ -0,0 +1,61 @@ +notPath('tests/TestCase.php'); + +$config = new PhpCsFixer\Config(); +$config->setRiskyAllowed(true); +$config->setRules([ + // Rulesets + '@PSR2' => true, + '@PhpCsFixer' => true, + '@PhpCsFixer:risky' => true, + '@PHP56Migration:risky' => true, + '@PHPUnit57Migration:risky' => true, + + // Additional rules + 'fopen_flags' => true, + 'linebreak_after_opening_tag' => true, + // This one is non-deterministic based on what environment you are running it in and what `get_defined_constants` returns. + 'native_constant_invocation' => false, + 'native_function_invocation' => [ + "strict" => false, + ], + + // --- Diffs from @PhpCsFixer / @PhpCsFixer:risky --- + + // This is the same as the default for the @PhpCsFixer ruleset, minus + // the following values: ['include', 'include_once', 'require', + // 'require_once']. We could enable them and remove this line after + // updating codegen for the `init.php` file to be compliant. + 'blank_line_before_statement' => ['statements' => ['break', 'case', 'continue', 'declare', 'default', 'exit', 'goto', 'return', 'switch', 'throw', 'try']], + + // This is just prettier / easier to read. + 'concat_space' => ['spacing' => 'one'], + + // This causes strange ordering with codegen'd classes. We might be + // able to enable this if we update codegen to output class elements + // in the correct order. + 'ordered_class_elements' => false, + + // Keep this disabled to avoid unnecessary diffs in PHPDoc comments of + // codegen'd classes. + 'phpdoc_align' => false, + + // This is a "risky" rule that causes a bug in our codebase. + // Specifically, in `StripeObject.updateAttributes` we construct new + // `StripeObject`s for metadata. We can't use `self` there because it + // needs to be a raw `StripeObject`. + 'self_accessor' => false, + + // Visibility annotations are not supported by php5.6 + 'visibility_required' => false, + + // Apparently "uninitialized" is distinct from "null" in some versions of PHP + // so I am defensively disabling this rule so as to not cause breaking changes + // but we can feel free to remove it in a major version (or maybe in a minor if + // we devote some effort into determining that it is safe) + 'no_null_property_initialization' => false, +]); +$config->setFinder($finder); +return $config; diff --git a/wp-content/plugins/stripe-payments/includes/stripe/.php_cs.dist b/wp-content/plugins/stripe-payments/includes/stripe/.php_cs.dist new file mode 100644 index 0000000..83660ff --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/.php_cs.dist @@ -0,0 +1,38 @@ +setRiskyAllowed(true) + ->setRules([ + // Rulesets + '@PSR2' => true, + '@PhpCsFixer' => true, + '@PhpCsFixer:risky' => true, + '@PHP56Migration:risky' => true, + '@PHPUnit57Migration:risky' => true, + + // Additional rules + 'fopen_flags' => true, + 'linebreak_after_opening_tag' => true, + 'native_function_invocation' => true, + + // --- Diffs from @PhpCsFixer / @PhpCsFixer:risky --- + + // This is just prettier / easier to read. + 'concat_space' => ['spacing' => 'one'], + + // This causes strange ordering with codegen'd classes. We might be + // able to enable this if we update codegen to output class elements + // in the correct order. + 'ordered_class_elements' => false, + + // Keep this disabled to avoid unnecessary diffs in PHPDoc comments of + // codegen'd classes. + 'phpdoc_align' => false, + + // This is a "risky" rule that causes a bug in our codebase. + // Specifically, in `StripeObject.updateAttributes` we construct new + // `StripeObject`s for metadata. We can't use `self` there because it + // needs to be a raw `StripeObject`. + 'self_accessor' => false, + ]) +; diff --git a/wp-content/plugins/stripe-payments/includes/stripe/CHANGELOG.md b/wp-content/plugins/stripe-payments/includes/stripe/CHANGELOG.md new file mode 100644 index 0000000..d24c5d7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/CHANGELOG.md @@ -0,0 +1,1531 @@ +# Changelog + +## 7.110.0 - 2022-01-13 +* [#1232](https://github.com/stripe/stripe-php/pull/1232) API Updates + * Add support for `paid_out_of_band` on `Invoice` + +## 7.109.0 - 2022-01-12 +* [#1231](https://github.com/stripe/stripe-php/pull/1231) API Updates + * Add support for `customer_creation` on `Checkout.Session` +* [#1227](https://github.com/stripe/stripe-php/pull/1227) Update docs URLs + +## 7.108.0 - 2021-12-22 +* [#1226](https://github.com/stripe/stripe-php/pull/1226) Upgrade php-cs-fixer to 3.4.0. +* [#1222](https://github.com/stripe/stripe-php/pull/1222) API Updates + * Add support for `processing` on `PaymentIntent` +* [#1220](https://github.com/stripe/stripe-php/pull/1220) API Updates + +## 7.107.0 - 2021-12-09 +* [#1219](https://github.com/stripe/stripe-php/pull/1219) API Updates + * Add support for `metadata` on `BillingPortal.Configuration` + * Add support for `wallets` on `Issuing.Card` + +## 7.106.0 - 2021-12-09 +* [#1218](https://github.com/stripe/stripe-php/pull/1218) API Updates + * Add support for new values `ge_vat` and `ua_vat` on enum `TaxId.type` +* [#1216](https://github.com/stripe/stripe-php/pull/1216) Fix namespaced classes in @return PHPDoc. +* [#1214](https://github.com/stripe/stripe-php/pull/1214) Announce PHP8 support in CHANGELOG.md + +## 7.105.0 - 2021-12-06 +* [#1213](https://github.com/stripe/stripe-php/pull/1213) PHP 8.1 missing ReturnTypeWillChange annotations. +* As of this version, PHP 8.1 is officially supported. + +## 7.104.0 - 2021-12-01 +* [#1211](https://github.com/stripe/stripe-php/pull/1211) PHPStan compatibility with PHP8.x +* [#1209](https://github.com/stripe/stripe-php/pull/1209) PHPUnit compatibility with PHP 8.x + +## 7.103.0 - 2021-11-19 +* [#1206](https://github.com/stripe/stripe-php/pull/1206) API Updates + * Add support for new value `jct` on enum `TaxRate.tax_type` + +## 7.102.0 - 2021-11-17 +* [#1205](https://github.com/stripe/stripe-php/pull/1205) API Updates + * Add support for `automatic_payment_methods` on `PaymentIntent` + +## 7.101.0 - 2021-11-16 +* [#1203](https://github.com/stripe/stripe-php/pull/1203) API Updates + * Add support for new resource `ShippingRate` + * Add support for `shipping_options` and `shipping_rate` on `Checkout.Session` + * Add support for `expire` method on resource `Checkout.Session` + * Add support for `status` on `Checkout.Session` + +## 7.100.0 - 2021-10-11 +* [#1190](https://github.com/stripe/stripe-php/pull/1190) API Updates + * Add support for `klarna` on `PaymentMethod`. + +## 7.99.0 - 2021-10-11 +* [#1188](https://github.com/stripe/stripe-php/pull/1188) API Updates + * Add support for `list_payment_methods` method on resource `Customer` + +## 7.98.0 - 2021-10-07 +* [#1187](https://github.com/stripe/stripe-php/pull/1187) API Updates + * Add support for `phone_number_collection` on `Checkout.Session` + * Add support for new value `customer_id` on enum `Radar.ValueList.item_type` + * Add support for new value `bbpos_wisepos_e` on enum `Terminal.Reader.device_type` + +## 7.97.0 - 2021-09-16 +* [#1181](https://github.com/stripe/stripe-php/pull/1181) API Updates + * Add support for `full_name_aliases` on `Person` + +## 7.96.0 - 2021-09-15 +* [#1178](https://github.com/stripe/stripe-php/pull/1178) API Updates + * Add support for livemode on Reporting.ReportType + * Add support for new value `rst` on enum `TaxRate.tax_type` + +## 7.95.0 - 2021-09-01 +* [#1177](https://github.com/stripe/stripe-php/pull/1177) API Updates + * Add support for `future_requirements` on `Account`, `Capability`, and `Person` + * Add support for `after_expiration`, `consent`, `consent_collection`, `expires_at`, and `recovered_from` on `Checkout.Session` + +## 7.94.0 - 2021-08-19 +* [#1173](https://github.com/stripe/stripe-php/pull/1173) API Updates + * Add support for new value `fil` on enum `Checkout.Session.locale` + * Add support for new value `au_arn` on enum `TaxId.type` + +## 7.93.0 - 2021-08-11 +* [#1172](https://github.com/stripe/stripe-php/pull/1172) API Updates + * Add support for `locale` on `BillingPortal.Session` + +* [#1171](https://github.com/stripe/stripe-php/pull/1171) Fix typo in docblock `CurlClient::executeStreamingRequestWithRetries` + +## 7.92.0 - 2021-07-28 +* [#1167](https://github.com/stripe/stripe-php/pull/1167) API Updates + * Add support for `account_type` on `BankAccount` + * Add support for new value `redacted` on enum `Review.closed_reason` + +## 7.91.0 - 2021-07-22 +* [#1164](https://github.com/stripe/stripe-php/pull/1164) API Updates + * Add support for new values `hr`, `ko`, and `vi` on enum `Checkout.Session.locale` + * Add support for `payment_settings` on `Subscription` + +## 7.90.0 - 2021-07-20 +* [#1163](https://github.com/stripe/stripe-php/pull/1163) API Updates + * Add support for `wallet` on `Issuing.Transaction` +* [#1160](https://github.com/stripe/stripe-php/pull/1160) Remove unused API error types from docs. + +## 7.89.0 - 2021-07-14 +* [#1158](https://github.com/stripe/stripe-php/pull/1158) API Updates + * Add support for `list_computed_upfront_line_items` method on resource `Quote` +* [#1157](https://github.com/stripe/stripe-php/pull/1157) Improve readme for old PHP versions + +## 7.88.0 - 2021-07-09 +* [#1152](https://github.com/stripe/stripe-php/pull/1152) API Updates + * Add support for new resource `Quote` + * Add support for `quote` on `Invoice` + * Add support for new value `quote_accept` on enum `Invoice.billing_reason` +* [#1155](https://github.com/stripe/stripe-php/pull/1155) Add streaming methods to Service infra + * Add support for `setStreamingHttpClient` and `streamingHttpClient` to `ApiRequestor` + * Add support for `getStreamingClient` and `requestStream` to `AbstractService` + * Add support for `requestStream` to `BaseStripeClient` + * `\Stripe\RequestOptions::parse` now clones its input if it is already a `RequestOptions` object, to prevent accidental mutation. +* [#1151](https://github.com/stripe/stripe-php/pull/1151) Add `mode` constants into Checkout\Session + +## 7.87.0 - 2021-06-30 +* [#1149](https://github.com/stripe/stripe-php/pull/1149) API Updates + * Add support for `wechat_pay` on `PaymentMethod` +* [#1143](https://github.com/stripe/stripe-php/pull/1143) Streaming requests +* [#1138](https://github.com/stripe/stripe-php/pull/1138) Deprecate travis + +## 7.86.0 - 2021-06-25 +* [#1145](https://github.com/stripe/stripe-php/pull/1145) API Updates + * Add support for `boleto` on `PaymentMethod`. + * Add support for `il_vat` as a member of the `TaxID.Type` enum. + +## 7.85.0 - 2021-06-18 +* [#1142](https://github.com/stripe/stripe-php/pull/1142) API Updates + * Add support for new TaxId types: `ca_pst_mb`, `ca_pst_bc`, `ca_gst_hst`, and `ca_pst_sk`. + +## 7.84.0 - 2021-06-16 +* [#1141](https://github.com/stripe/stripe-php/pull/1141) Update PHPDocs + * Add support for `url` on `Checkout\Session` + + +## 7.83.0 - 2021-06-07 +* [#1140](https://github.com/stripe/stripe-php/pull/1140) API Updates + * Added support for `tax_id_collection` on `Checkout\Session` and `Checkout\Session#create` + * Update `Location` to be expandable on `Terminal\Reader` + +## 7.82.0 - 2021-06-04 +* [#1136](https://github.com/stripe/stripe-php/pull/1136) Update PHPDocs + * Add support for `controller` on `Account`. + +## 7.81.0 - 2021-06-04 +* [#1135](https://github.com/stripe/stripe-php/pull/1135) API Updates + * Add support for new resource `TaxCode` + * Add support for `automatic_tax` `Invoice` and`Checkout.Session`. + * Add support for `tax_behavior` on `Price` + * Add support for `tax_code` on `Product` + * Add support for `tax` on `Customer` + * Add support for `tax_type` enum on `TaxRate` + +## 7.80.0 - 2021-05-26 +* [#1130](https://github.com/stripe/stripe-php/pull/1130) Update PHPDocs + +## 7.79.0 - 2021-05-19 +* [#1126](https://github.com/stripe/stripe-php/pull/1126) API Updates + * Added support for new resource `Identity.VerificationReport` + * Added support for new resource `Identity.VerificationSession` + * `File#list.purpose` and `File.purpose` added new enum members: `identity_document_downloadable` and `selfie`. + +## 7.78.0 - 2021-05-05 +* [#1120](https://github.com/stripe/stripe-php/pull/1120) Update PHPDocs + * Add support for `Radar.EarlyFraudWarning.payment_intent` + +## 7.77.0 - 2021-04-12 +* [#1110](https://github.com/stripe/stripe-php/pull/1110) Update PHPDocs + * Add support for `acss_debit` on `PaymentMethod` + * Add support for `payment_method_options` on `Checkout\Session` +* [#1107](https://github.com/stripe/stripe-php/pull/1107) Remove duplicate object phpdoc + +## 7.76.0 - 2021-03-22 +* [#1100](https://github.com/stripe/stripe-php/pull/1100) Update PHPDocs + * Added support for `amount_shipping` on `Checkout.Session.total_details` +* [#1088](https://github.com/stripe/stripe-php/pull/1088) Make possibility to extend CurlClient + +## 7.75.0 - 2021-02-22 +* [#1094](https://github.com/stripe/stripe-php/pull/1094) Add support for Billing Portal Configuration API + +## 7.74.0 - 2021-02-17 +* [#1093](https://github.com/stripe/stripe-php/pull/1093) Update PHPDocs + * Add support for on_behalf_of to Invoice + +## 7.73.0 - 2021-02-16 +* [#1091](https://github.com/stripe/stripe-php/pull/1091) Update PHPDocs + * Add support for `afterpay_clearpay` on `PaymentMethod`. + +## 7.72.0 - 2021-02-08 +* [#1089](https://github.com/stripe/stripe-php/pull/1089) Update PHPDocs + * Add support for `afterpay_clearpay_payments` on `Account.capabilities` + * Add support for `payment_settings` on `Invoice` + +## 7.71.0 - 2021-02-05 +* [#1087](https://github.com/stripe/stripe-php/pull/1087) Update PHPDocs +* [#1086](https://github.com/stripe/stripe-php/pull/1086) Update CA cert bundle URL + +## 7.70.0 - 2021-02-03 +* [#1085](https://github.com/stripe/stripe-php/pull/1085) Update PHPDocs + * Add support for `nationality` on `Person` + * Add member `gb_vat` of `TaxID` enum + + +## 7.69.0 - 2021-01-21 +* [#1079](https://github.com/stripe/stripe-php/pull/1079) Update PHPDocs + +## 7.68.0 - 2021-01-14 +* [#1063](https://github.com/stripe/stripe-php/pull/1063) Multiple API changes +* [#1061](https://github.com/stripe/stripe-php/pull/1061) Bump phpDocumentor to 3.0.0 + +## 7.67.0 - 2020-12-09 +* [#1060](https://github.com/stripe/stripe-php/pull/1060) Improve PHPDocs for `Discount` +* [#1059](https://github.com/stripe/stripe-php/pull/1059) Upgrade PHPStan to 0.12.59 +* [#1057](https://github.com/stripe/stripe-php/pull/1057) Bump PHP-CS-Fixer and update code + +## 7.66.1 - 2020-12-01 +* [#1054](https://github.com/stripe/stripe-php/pull/1054) Improve error message for invalid keys in StripeClient + +## 7.66.0 - 2020-11-24 +* [#1053](https://github.com/stripe/stripe-php/pull/1053) Update PHPDocs + +## 7.65.0 - 2020-11-19 +* [#1050](https://github.com/stripe/stripe-php/pull/1050) Added constants for `proration_behavior` on `Subscription` + +## 7.64.0 - 2020-11-18 +* [#1049](https://github.com/stripe/stripe-php/pull/1049) Update PHPDocs + +## 7.63.0 - 2020-11-17 +* [#1048](https://github.com/stripe/stripe-php/pull/1048) Update PHPDocs +* [#1046](https://github.com/stripe/stripe-php/pull/1046) Force IPv4 resolving + +## 7.62.0 - 2020-11-09 +* [#1041](https://github.com/stripe/stripe-php/pull/1041) Add missing constants on `Event` +* [#1038](https://github.com/stripe/stripe-php/pull/1038) Update PHPDocs + +## 7.61.0 - 2020-10-20 +* [#1030](https://github.com/stripe/stripe-php/pull/1030) Add support for `jp_rn` and `ru_kpp` as a `type` on `TaxId` + +## 7.60.0 - 2020-10-15 +* [#1027](https://github.com/stripe/stripe-php/pull/1027) Warn if opts are in params + +## 7.58.0 - 2020-10-14 +* [#1026](https://github.com/stripe/stripe-php/pull/1026) Add support for the Payout Reverse API + +## 7.57.0 - 2020-09-29 +* [#1020](https://github.com/stripe/stripe-php/pull/1020) Add support for the `SetupAttempt` resource and List API + +## 7.56.0 - 2020-09-25 +* [#1019](https://github.com/stripe/stripe-php/pull/1019) Update PHPDocs + +## 7.55.0 - 2020-09-24 +* [#1018](https://github.com/stripe/stripe-php/pull/1018) Multiple API changes + * Updated PHPDocs + * Added `TYPE_CONTRIBUTION` as a constant on `BalanceTransaction` + +## 7.54.0 - 2020-09-23 +* [#1017](https://github.com/stripe/stripe-php/pull/1017) Updated PHPDoc + +## 7.53.1 - 2020-09-22 +* [#1015](https://github.com/stripe/stripe-php/pull/1015) Bugfix: don't error on systems with php_uname in disablefunctions with whitespace + +## 7.53.0 - 2020-09-21 +* [#1016](https://github.com/stripe/stripe-php/pull/1016) Updated PHPDocs + +## 7.52.0 - 2020-09-08 +* [#1010](https://github.com/stripe/stripe-php/pull/1010) Update PHPDocs + +## 7.51.0 - 2020-09-02 +* [#1007](https://github.com/stripe/stripe-php/pull/1007) Multiple API changes + * Add support for the Issuing Dispute Submit API + * Add constants for `payment_status` on Checkout `Session` +* [#1003](https://github.com/stripe/stripe-php/pull/1003) Add trim to getSignatures to allow for leading whitespace. + +## 7.50.0 - 2020-08-28 +* [#1005](https://github.com/stripe/stripe-php/pull/1005) Updated PHPDocs + +## 7.49.0 - 2020-08-19 +* [#998](https://github.com/stripe/stripe-php/pull/998) PHPDocs updated + +## 7.48.0 - 2020-08-17 +* [#997](https://github.com/stripe/stripe-php/pull/997) PHPDocs updated +* [#996](https://github.com/stripe/stripe-php/pull/996) Fixing telemetry + +## 7.47.0 - 2020-08-13 +* [#994](https://github.com/stripe/stripe-php/pull/994) Nullable balance_transactions on issuing disputes +* [#991](https://github.com/stripe/stripe-php/pull/991) Fix invalid return types in OAuthService + +## 7.46.1 - 2020-08-07 +* [#990](https://github.com/stripe/stripe-php/pull/990) PHPdoc changes + +## 7.46.0 - 2020-08-05 +* [#989](https://github.com/stripe/stripe-php/pull/989) Add support for the `PromotionCode` resource and APIs + +## 7.45.0 - 2020-07-28 +* [#981](https://github.com/stripe/stripe-php/pull/981) PHPdoc updates + +## 7.44.0 - 2020-07-20 +* [#948](https://github.com/stripe/stripe-php/pull/948) Add `first()` and `last()` functions to `Collection` + +## 7.43.0 - 2020-07-17 +* [#975](https://github.com/stripe/stripe-php/pull/975) Add support for `political_exposure` on `Person` + +## 7.42.0 - 2020-07-15 +* [#974](https://github.com/stripe/stripe-php/pull/974) Add new constants for `purpose` on `File` + +## 7.41.1 - 2020-07-15 +* [#973](https://github.com/stripe/stripe-php/pull/973) Multiple PHPDoc fixes + +## 7.41.0 - 2020-07-14 +* [#971](https://github.com/stripe/stripe-php/pull/971) Adds enum values for `billing_address_collection` on Checkout `Session` + +## 7.40.0 - 2020-07-06 +* [#964](https://github.com/stripe/stripe-php/pull/964) Add OAuthService + +## 7.39.0 - 2020-06-25 +* [#960](https://github.com/stripe/stripe-php/pull/960) Add constants for `payment_behavior` on `Subscription` + +## 7.38.0 - 2020-06-24 +* [#959](https://github.com/stripe/stripe-php/pull/959) Add multiple constants missing for `Event` + +## 7.37.2 - 2020-06-23 +* [#957](https://github.com/stripe/stripe-php/pull/957) Updated PHPDocs + +## 7.37.1 - 2020-06-11 +* [#952](https://github.com/stripe/stripe-php/pull/952) Improve PHPDoc + +## 7.37.0 - 2020-06-09 +* [#950](https://github.com/stripe/stripe-php/pull/950) Add support for `id_npwp` and `my_frp` as `type` on `TaxId` + +## 7.36.2 - 2020-06-03 +* [#946](https://github.com/stripe/stripe-php/pull/946) Update PHPDoc + +## 7.36.1 - 2020-05-28 +* [#938](https://github.com/stripe/stripe-php/pull/938) Remove extra array_keys() call. +* [#942](https://github.com/stripe/stripe-php/pull/942) fix autopagination for service methods + +## 7.36.0 - 2020-05-21 +* [#937](https://github.com/stripe/stripe-php/pull/937) Add support for `ae_trn`, `cl_tin` and `sa_vat` as `type` on `TaxId` + +## 7.35.0 - 2020-05-20 +* [#936](https://github.com/stripe/stripe-php/pull/936) Add `anticipation_repayment` as a `type` on `BalanceTransaction` + +## 7.34.0 - 2020-05-18 +* [#934](https://github.com/stripe/stripe-php/pull/934) Add support for `issuing_dispute` as a `type` on `BalanceTransaction` + +## 7.33.1 - 2020-05-15 +* [#933](https://github.com/stripe/stripe-php/pull/933) Services bugfix: convert nested null params to empty strings + +## 7.33.0 - 2020-05-14 +* [#771](https://github.com/stripe/stripe-php/pull/771) Introduce client/services API. The [migration guide](https://github.com/stripe/stripe-php/wiki/Migration-to-StripeClient-and-services-in-7.33.0) contains before & after examples of the backwards-compatible changes. + +## 7.32.1 - 2020-05-13 +* [#932](https://github.com/stripe/stripe-php/pull/932) Fix multiple PHPDoc + +## 7.32.0 - 2020-05-11 +* [#931](https://github.com/stripe/stripe-php/pull/931) Add support for the `LineItem` resource and APIs + +## 7.31.0 - 2020-05-01 +* [#927](https://github.com/stripe/stripe-php/pull/927) Add support for new tax IDs + +## 7.30.0 - 2020-04-29 +* [#924](https://github.com/stripe/stripe-php/pull/924) Add support for the `Price` resource and APIs + +## 7.29.0 - 2020-04-22 +* [#920](https://github.com/stripe/stripe-php/pull/920) Add support for the `Session` resource and APIs on the `BillingPortal` namespace + +## 7.28.1 - 2020-04-10 +* [#915](https://github.com/stripe/stripe-php/pull/915) Improve PHPdocs for many classes + +## 7.28.0 - 2020-04-03 +* [#912](https://github.com/stripe/stripe-php/pull/912) Preserve backwards compatibility for typoed `TYPE_ADJUSTEMENT` enum. +* [#911](https://github.com/stripe/stripe-php/pull/911) Codegenerated PHPDoc for nested resources +* [#902](https://github.com/stripe/stripe-php/pull/902) Update docstrings for nested resources + +## 7.27.3 - 2020-03-18 +* [#899](https://github.com/stripe/stripe-php/pull/899) Convert keys to strings in `StripeObject::toArray()` + +## 7.27.2 - 2020-03-13 +* [#894](https://github.com/stripe/stripe-php/pull/894) Multiple PHPDocs changes + +## 7.27.1 - 2020-03-03 +* [#890](https://github.com/stripe/stripe-php/pull/890) Update PHPdoc + +## 7.27.0 - 2020-02-28 +* [#889](https://github.com/stripe/stripe-php/pull/889) Add new constants for `type` on `TaxId` + +## 7.26.0 - 2020-02-26 +* [#886](https://github.com/stripe/stripe-php/pull/886) Add support for listing Checkout `Session` +* [#883](https://github.com/stripe/stripe-php/pull/883) Add PHPDoc class descriptions + +## 7.25.0 - 2020-02-14 +* [#879](https://github.com/stripe/stripe-php/pull/879) Make `\Stripe\Collection` implement `\Countable` +* [#875](https://github.com/stripe/stripe-php/pull/875) Last set of PHP-CS-Fixer updates +* [#874](https://github.com/stripe/stripe-php/pull/874) Enable php_unit_internal_class rule +* [#873](https://github.com/stripe/stripe-php/pull/873) Add support for phpDocumentor in Makefile +* [#872](https://github.com/stripe/stripe-php/pull/872) Another batch of PHP-CS-Fixer rule updates +* [#871](https://github.com/stripe/stripe-php/pull/871) Fix a few PHPDoc comments +* [#870](https://github.com/stripe/stripe-php/pull/870) More PHP-CS-Fixer tweaks + +## 7.24.0 - 2020-02-10 +* [#862](https://github.com/stripe/stripe-php/pull/862) Better PHPDoc +* [#865](https://github.com/stripe/stripe-php/pull/865) Get closer to `@PhpCsFixer` standard ruleset + +## 7.23.0 - 2020-02-05 +* [#860](https://github.com/stripe/stripe-php/pull/860) Add PHPDoc types for expandable fields +* [#858](https://github.com/stripe/stripe-php/pull/858) Use `native_function_invocation` PHPStan rule +* [#857](https://github.com/stripe/stripe-php/pull/857) Update PHPDoc on nested resources +* [#855](https://github.com/stripe/stripe-php/pull/855) PHPDoc: `StripeObject` -> `ErrorObject` where appropriate +* [#837](https://github.com/stripe/stripe-php/pull/837) Autogen diff +* [#854](https://github.com/stripe/stripe-php/pull/854) Upgrade PHPStan and fix settings +* [#850](https://github.com/stripe/stripe-php/pull/850) Yet more PHPDoc updates + +## 7.22.0 - 2020-01-31 +* [#849](https://github.com/stripe/stripe-php/pull/849) Add new constants for `type` on `TaxId` +* [#843](https://github.com/stripe/stripe-php/pull/843) Even more PHPDoc fixes +* [#841](https://github.com/stripe/stripe-php/pull/841) More PHPDoc fixes + +## 7.21.1 - 2020-01-29 +* [#840](https://github.com/stripe/stripe-php/pull/840) Update phpdocs across multiple resources. + +## 7.21.0 - 2020-01-28 +* [#839](https://github.com/stripe/stripe-php/pull/839) Add support for `TYPE_ES_CIF` on `TaxId` + +## 7.20.0 - 2020-01-23 +* [#836](https://github.com/stripe/stripe-php/pull/836) Add new type values for `TaxId` + +## 7.19.1 - 2020-01-14 +* [#831](https://github.com/stripe/stripe-php/pull/831) Fix incorrect `UnexpectedValueException` instantiation + +## 7.19.0 - 2020-01-14 +* [#830](https://github.com/stripe/stripe-php/pull/830) Add support for `CreditNoteLineItem` + +## 7.18.0 - 2020-01-13 +* [#829](https://github.com/stripe/stripe-php/pull/829) Don't call php_uname function if disabled by php.ini + +## 7.17.0 - 2020-01-08 +* [#821](https://github.com/stripe/stripe-php/pull/821) Improve PHPDoc types for `ApiErrorException.get/setJsonBody()` methods + +## 7.16.0 - 2020-01-06 +* [#826](https://github.com/stripe/stripe-php/pull/826) Rename remaining `$options` to `$opts` +* [#825](https://github.com/stripe/stripe-php/pull/825) Update PHPDoc + +## 7.15.0 - 2020-01-06 +* [#824](https://github.com/stripe/stripe-php/pull/824) Add constant `TYPE_SG_UEN` to `TaxId` + +## 7.14.2 - 2019-12-04 +* [#816](https://github.com/stripe/stripe-php/pull/816) Disable autoloader when checking for `Throwable` + +## 7.14.1 - 2019-11-26 +* [#812](https://github.com/stripe/stripe-php/pull/812) Fix invalid PHPdoc on `Subscription` + +## 7.14.0 - 2019-11-26 +* [#811](https://github.com/stripe/stripe-php/pull/811) Add support for `CreditNote` preview. + +## 7.13.0 - 2019-11-19 +* [#808](https://github.com/stripe/stripe-php/pull/808) Add support for listing lines on an Invoice directly via `Invoice::allLines()` + +## 7.12.0 - 2019-11-08 + +- [#805](https://github.com/stripe/stripe-php/pull/805) Add Source::allSourceTransactions and SubscriptionItem::allUsageRecordSummaries +- [#798](https://github.com/stripe/stripe-php/pull/798) The argument of `array_key_exists` cannot be `null` +- [#803](https://github.com/stripe/stripe-php/pull/803) Removed unwanted got + +## 7.11.0 - 2019-11-06 + +- [#797](https://github.com/stripe/stripe-php/pull/797) Add support for reverse pagination + +## 7.10.0 - 2019-11-05 + +- [#795](https://github.com/stripe/stripe-php/pull/795) Add support for `Mandate` + +## 7.9.0 - 2019-11-05 + +- [#794](https://github.com/stripe/stripe-php/pull/794) Add PHPDoc to `ApiResponse` +- [#792](https://github.com/stripe/stripe-php/pull/792) Use single quotes for `OBJECT_NAME` constants + +## 7.8.0 - 2019-11-05 + +- [#790](https://github.com/stripe/stripe-php/pull/790) Mark nullable fields in PHPDoc +- [#788](https://github.com/stripe/stripe-php/pull/788) Early codegen fixes +- [#787](https://github.com/stripe/stripe-php/pull/787) Use PHPStan in Travis CI + +## 7.7.1 - 2019-10-25 + +- [#781](https://github.com/stripe/stripe-php/pull/781) Fix telemetry header +- [#780](https://github.com/stripe/stripe-php/pull/780) Contributor Convenant + +## 7.7.0 - 2019-10-23 + +- [#776](https://github.com/stripe/stripe-php/pull/776) Add `CAPABILITY_TRANSFERS` to `Account` +- [#778](https://github.com/stripe/stripe-php/pull/778) Add support for `TYPE_MX_RFC` type on `TaxId` + +## 7.6.0 - 2019-10-22 + +- [#770](https://github.com/stripe/stripe-php/pull/770) Add missing constants for Customer's `TaxId` + +## 7.5.0 - 2019-10-18 + +- [#768](https://github.com/stripe/stripe-php/pull/768) Redact API key in `RequestOptions` debug info + +## 7.4.0 - 2019-10-15 + +- [#764](https://github.com/stripe/stripe-php/pull/764) Add support for HTTP request monitoring callback + +## 7.3.1 - 2019-10-07 + +- [#755](https://github.com/stripe/stripe-php/pull/755) Respect Stripe-Should-Retry and Retry-After headers + +## 7.3.0 - 2019-10-02 + +- [#752](https://github.com/stripe/stripe-php/pull/752) Add `payment_intent.canceled` and `setup_intent.canceled` events +- [#749](https://github.com/stripe/stripe-php/pull/749) Call `toArray()` on objects only + +## 7.2.2 - 2019-09-24 + +- [#746](https://github.com/stripe/stripe-php/pull/746) Add missing decline codes + +## 7.2.1 - 2019-09-23 + +- [#744](https://github.com/stripe/stripe-php/pull/744) Added new PHPDoc + +## 7.2.0 - 2019-09-17 + +- [#738](https://github.com/stripe/stripe-php/pull/738) Added missing constants for `SetupIntent` events + +## 7.1.1 - 2019-09-16 + +- [#737](https://github.com/stripe/stripe-php/pull/737) Added new PHPDoc + +## 7.1.0 - 2019-09-13 + +- [#736](https://github.com/stripe/stripe-php/pull/736) Make `CaseInsensitiveArray` countable and traversable + +## 7.0.2 - 2019-09-06 + +- [#729](https://github.com/stripe/stripe-php/pull/729) Fix usage of `SignatureVerificationException` in PHPDoc blocks + +## 7.0.1 - 2019-09-05 + +- [#728](https://github.com/stripe/stripe-php/pull/728) Clean up Collection + +## 7.0.0 - 2019-09-03 + +Major version release. The [migration guide](https://github.com/stripe/stripe-php/wiki/Migration-guide-for-v7) contains a detailed list of backwards-incompatible changes with upgrade instructions. + +Pull requests included in this release (cf. [#552](https://github.com/stripe/stripe-php/pull/552)) (⚠️ = breaking changes): + +- ⚠️ Drop support for PHP 5.4 ([#551](https://github.com/stripe/stripe-php/pull/551)) +- ⚠️ Drop support for PHP 5.5 ([#554](https://github.com/stripe/stripe-php/pull/554)) +- Bump dependencies ([#553](https://github.com/stripe/stripe-php/pull/553)) +- Remove `CURLFile` check ([#555](https://github.com/stripe/stripe-php/pull/555)) +- Update constant definitions for PHP >= 5.6 ([#556](https://github.com/stripe/stripe-php/pull/556)) +- ⚠️ Remove `FileUpload` alias ([#557](https://github.com/stripe/stripe-php/pull/557)) +- Remove `curl_reset` check ([#570](https://github.com/stripe/stripe-php/pull/570)) +- Use `\Stripe\::class` constant instead of strings ([#643](https://github.com/stripe/stripe-php/pull/643)) +- Use `array_column` to flatten params ([#686](https://github.com/stripe/stripe-php/pull/686)) +- ⚠️ Remove deprecated methods ([#692](https://github.com/stripe/stripe-php/pull/692)) +- ⚠️ Remove `IssuerFraudRecord` ([#696](https://github.com/stripe/stripe-php/pull/696)) +- Update constructors of Stripe exception classes ([#559](https://github.com/stripe/stripe-php/pull/559)) +- Fix remaining TODOs ([#700](https://github.com/stripe/stripe-php/pull/700)) +- Use yield for autopagination ([#703](https://github.com/stripe/stripe-php/pull/703)) +- ⚠️ Rename fake magic methods and rewrite array conversion ([#704](https://github.com/stripe/stripe-php/pull/704)) +- Add `ErrorObject` to Stripe exceptions ([#705](https://github.com/stripe/stripe-php/pull/705)) +- Start using PHP CS Fixer ([#706](https://github.com/stripe/stripe-php/pull/706)) +- Update error messages for nested resource operations ([#708](https://github.com/stripe/stripe-php/pull/708)) +- Upgrade retry logic ([#707](https://github.com/stripe/stripe-php/pull/707)) +- ⚠️ `Collection` improvements / fixes ([#715](https://github.com/stripe/stripe-php/pull/715)) +- ⚠️ Modernize exceptions ([#709](https://github.com/stripe/stripe-php/pull/709)) +- Add constants for error codes ([#716](https://github.com/stripe/stripe-php/pull/716)) +- Update certificate bundle ([#717](https://github.com/stripe/stripe-php/pull/717)) +- Retry requests on a 429 that's a lock timeout ([#718](https://github.com/stripe/stripe-php/pull/718)) +- Fix `toArray()` calls ([#719](https://github.com/stripe/stripe-php/pull/719)) +- Couple of fixes for PHP 7.4 ([#725](https://github.com/stripe/stripe-php/pull/725)) + +## 6.43.1 - 2019-08-29 + +- [#722](https://github.com/stripe/stripe-php/pull/722) Make `LoggerInterface::error` compatible with its PSR-3 counterpart +- [#714](https://github.com/stripe/stripe-php/pull/714) Add `pending_setup_intent` property in `Subscription` +- [#713](https://github.com/stripe/stripe-php/pull/713) Add typehint to `ApiResponse` +- [#712](https://github.com/stripe/stripe-php/pull/712) Fix comment +- [#701](https://github.com/stripe/stripe-php/pull/701) Start testing PHP 7.3 + +## 6.43.0 - 2019-08-09 + +- [#694](https://github.com/stripe/stripe-php/pull/694) Add `SubscriptionItem::createUsageRecord` method + +## 6.42.0 - 2019-08-09 + +- [#688](https://github.com/stripe/stripe-php/pull/688) Remove `SubscriptionScheduleRevision` + - Note that this is technically a breaking change, however we've chosen to release it as a minor version in light of the fact that this resource and its API methods were virtually unused. + +## 6.41.0 - 2019-07-31 + +- [#683](https://github.com/stripe/stripe-php/pull/683) Move the List Balance History API to `/v1/balance_transactions` + +## 6.40.0 - 2019-06-27 + +- [#675](https://github.com/stripe/stripe-php/pull/675) Add support for `SetupIntent` resource and APIs + +## 6.39.2 - 2019-06-26 + +- [#676](https://github.com/stripe/stripe-php/pull/676) Fix exception message in `CustomerBalanceTransaction::update()` + +## 6.39.1 - 2019-06-25 + +- [#674](https://github.com/stripe/stripe-php/pull/674) Add new constants for `collection_method` on `Invoice` + +## 6.39.0 - 2019-06-24 + +- [#673](https://github.com/stripe/stripe-php/pull/673) Enable request latency telemetry by default + +## 6.38.0 - 2019-06-17 + +- [#649](https://github.com/stripe/stripe-php/pull/649) Add support for `CustomerBalanceTransaction` resource and APIs + +## 6.37.2 - 2019-06-17 + +- [#671](https://github.com/stripe/stripe-php/pull/671) Add new PHPDoc +- [#672](https://github.com/stripe/stripe-php/pull/672) Add constants for `submit_type` on Checkout `Session` + +## 6.37.1 - 2019-06-14 + +- [#670](https://github.com/stripe/stripe-php/pull/670) Add new PHPDoc + +## 6.37.0 - 2019-05-23 + +- [#663](https://github.com/stripe/stripe-php/pull/663) Add support for `radar.early_fraud_warning` resource + +## 6.36.0 - 2019-05-22 + +- [#661](https://github.com/stripe/stripe-php/pull/661) Add constants for new TaxId types +- [#662](https://github.com/stripe/stripe-php/pull/662) Add constants for BalanceTransaction types + +## 6.35.2 - 2019-05-20 + +- [#655](https://github.com/stripe/stripe-php/pull/655) Add constants for payment intent statuses +- [#659](https://github.com/stripe/stripe-php/pull/659) Fix PHPDoc for various nested Account actions +- [#660](https://github.com/stripe/stripe-php/pull/660) Fix various PHPDoc + +## 6.35.1 - 2019-05-20 + +- [#658](https://github.com/stripe/stripe-php/pull/658) Use absolute value when checking timestamp tolerance + +## 6.35.0 - 2019-05-14 + +- [#651](https://github.com/stripe/stripe-php/pull/651) Add support for the Capability resource and APIs + +## 6.34.6 - 2019-05-13 + +- [#654](https://github.com/stripe/stripe-php/pull/654) Fix typo in definition of `Event::PAYMENT_METHOD_ATTACHED` constant + +## 6.34.5 - 2019-05-06 + +- [#647](https://github.com/stripe/stripe-php/pull/647) Set the return type to static for more operations + +## 6.34.4 - 2019-05-06 + +- [#650](https://github.com/stripe/stripe-php/pull/650) Add missing constants for Event types + +## 6.34.3 - 2019-05-01 + +- [#644](https://github.com/stripe/stripe-php/pull/644) Update return type to `static` to improve static analysis +- [#645](https://github.com/stripe/stripe-php/pull/645) Fix constant for `payment_intent.payment_failed` + +## 6.34.2 - 2019-04-26 + +- [#642](https://github.com/stripe/stripe-php/pull/642) Fix an issue where existing idempotency keys would be overwritten when using automatic retries + +## 6.34.1 - 2019-04-25 + +- [#640](https://github.com/stripe/stripe-php/pull/640) Add missing phpdocs + +## 6.34.0 - 2019-04-24 + +- [#626](https://github.com/stripe/stripe-php/pull/626) Add support for the `TaxRate` resource and APIs +- [#639](https://github.com/stripe/stripe-php/pull/639) Fix multiple phpdoc issues + +## 6.33.0 - 2019-04-22 + +- [#630](https://github.com/stripe/stripe-php/pull/630) Add support for the `TaxId` resource and APIs + +## 6.32.1 - 2019-04-19 + +- [#636](https://github.com/stripe/stripe-php/pull/636) Correct type of `$personId` in PHPDoc + +## 6.32.0 - 2019-04-18 + +- [#621](https://github.com/stripe/stripe-php/pull/621) Add support for `CreditNote` + +## 6.31.5 - 2019-04-12 + +- [#628](https://github.com/stripe/stripe-php/pull/628) Add constants for `person.*` event types +- [#628](https://github.com/stripe/stripe-php/pull/628) Add missing constants for `Account` and `Person` + +## 6.31.4 - 2019-04-05 + +- [#624](https://github.com/stripe/stripe-php/pull/624) Fix encoding of nested parameters in multipart requests + +## 6.31.3 - 2019-04-02 + +- [#623](https://github.com/stripe/stripe-php/pull/623) Only use HTTP/2 with curl >= 7.60.0 + +## 6.31.2 - 2019-03-25 + +- [#619](https://github.com/stripe/stripe-php/pull/619) Fix PHPDoc return types for list methods for nested resources + +## 6.31.1 - 2019-03-22 + +- [#612](https://github.com/stripe/stripe-php/pull/612) Add a lot of constants +- [#614](https://github.com/stripe/stripe-php/pull/614) Add missing subscription status constants + +## 6.31.0 - 2019-03-18 + +- [#600](https://github.com/stripe/stripe-php/pull/600) Add support for the `PaymentMethod` resource and APIs +- [#606](https://github.com/stripe/stripe-php/pull/606) Add support for retrieving a Checkout `Session` +- [#611](https://github.com/stripe/stripe-php/pull/611) Add support for deleting a Terminal `Location` and `Reader` + +## 6.30.5 - 2019-03-11 + +- [#607](https://github.com/stripe/stripe-php/pull/607) Correctly handle case where a metadata key is called `metadata` + +## 6.30.4 - 2019-02-27 + +- [#602](https://github.com/stripe/stripe-php/pull/602) Add `subscription_schedule` to `Subscription` for PHPDoc. + +## 6.30.3 - 2019-02-26 + +- [#603](https://github.com/stripe/stripe-php/pull/603) Improve PHPDoc on the `Source` object to cover all types of Sources currently supported. + +## 6.30.2 - 2019-02-25 + +- [#601](https://github.com/stripe/stripe-php/pull/601) Fix PHPDoc across multiple resources and add support for new events. + +## 6.30.1 - 2019-02-16 + +- [#599](https://github.com/stripe/stripe-php/pull/599) Fix PHPDoc for `SubscriptionSchedule` and `SubscriptionScheduleRevision` + +## 6.30.0 - 2019-02-12 + +- [#590](https://github.com/stripe/stripe-php/pull/590) Add support for `SubscriptionSchedule` and `SubscriptionScheduleRevision` + +## 6.29.3 - 2019-01-31 + +- [#592](https://github.com/stripe/stripe-php/pull/592) Some more PHPDoc fixes + +## 6.29.2 - 2019-01-31 + +- [#591](https://github.com/stripe/stripe-php/pull/591) Fix PHPDoc for nested resources + +## 6.29.1 - 2019-01-25 + +- [#566](https://github.com/stripe/stripe-php/pull/566) Fix dangling message contents +- [#586](https://github.com/stripe/stripe-php/pull/586) Don't overwrite `CURLOPT_HTTP_VERSION` option + +## 6.29.0 - 2019-01-23 + +- [#579](https://github.com/stripe/stripe-php/pull/579) Rename `CheckoutSession` to `Session` and move it under the `Checkout` namespace. This is a breaking change, but we've reached out to affected merchants and all new merchants would use the new approach. + +## 6.28.1 - 2019-01-21 + +- [#580](https://github.com/stripe/stripe-php/pull/580) Properly serialize `individual` on `Account` objects + +## 6.28.0 - 2019-01-03 + +- [#576](https://github.com/stripe/stripe-php/pull/576) Add support for iterating directly over `Collection` instances + +## 6.27.0 - 2018-12-21 + +- [#571](https://github.com/stripe/stripe-php/pull/571) Add support for the `CheckoutSession` resource + +## 6.26.0 - 2018-12-11 + +- [#568](https://github.com/stripe/stripe-php/pull/568) Enable persistent connections + +## 6.25.0 - 2018-12-10 + +- [#567](https://github.com/stripe/stripe-php/pull/567) Add support for account links + +## 6.24.0 - 2018-11-28 + +- [#562](https://github.com/stripe/stripe-php/pull/562) Add support for the Review resource +- [#564](https://github.com/stripe/stripe-php/pull/564) Add event name constants for subscription schedule aborted/expiring + +## 6.23.0 - 2018-11-27 + +- [#542](https://github.com/stripe/stripe-php/pull/542) Add support for `ValueList` and `ValueListItem` for Radar + +## 6.22.1 - 2018-11-20 + +- [#561](https://github.com/stripe/stripe-php/pull/561) Add cast and some docs to telemetry introduced in 6.22.0/549 + +## 6.22.0 - 2018-11-15 + +- [#549](https://github.com/stripe/stripe-php/pull/549) Add support for client telemetry + +## 6.21.1 - 2018-11-12 + +- [#548](https://github.com/stripe/stripe-php/pull/548) Don't mutate `Exception` class properties from `OAuthBase` error + +## 6.21.0 - 2018-11-08 + +- [#537](https://github.com/stripe/stripe-php/pull/537) Add new API endpoints for the `Invoice` resource. + +## 6.20.1 - 2018-11-07 + +- [#546](https://github.com/stripe/stripe-php/pull/546) Drop files from the Composer package that aren't needed in the release + +## 6.20.0 - 2018-10-30 + +- [#536](https://github.com/stripe/stripe-php/pull/536) Add support for the `Person` resource +- [#541](https://github.com/stripe/stripe-php/pull/541) Add support for the `WebhookEndpoint` resource + +## 6.19.5 - 2018-10-17 + +- [#539](https://github.com/stripe/stripe-php/pull/539) Fix methods on `\Stripe\PaymentIntent` to properly pass arguments to the API. + +## 6.19.4 - 2018-10-11 + +- [#534](https://github.com/stripe/stripe-php/pull/534) Fix PSR-4 autoloading for `\Stripe\FileUpload` class alias + +## 6.19.3 - 2018-10-09 + +- [#530](https://github.com/stripe/stripe-php/pull/530) Add constants for `flow` (`FLOW_*`), `status` (`STATUS_*`) and `usage` (`USAGE_*`) on `\Stripe\Source` + +## 6.19.2 - 2018-10-08 + +- [#531](https://github.com/stripe/stripe-php/pull/531) Store HTTP response headers in case-insensitive array + +## 6.19.1 - 2018-09-25 + +- [#526](https://github.com/stripe/stripe-php/pull/526) Ignore null values in request parameters + +## 6.19.0 - 2018-09-24 + +- [#523](https://github.com/stripe/stripe-php/pull/523) Add support for Stripe Terminal + +## 6.18.0 - 2018-09-24 + +- [#520](https://github.com/stripe/stripe-php/pull/520) Rename `\Stripe\FileUpload` to `\Stripe\File` + +## 6.17.2 - 2018-09-18 + +- [#522](https://github.com/stripe/stripe-php/pull/522) Fix warning when adding a new additional owner to an existing array + +## 6.17.1 - 2018-09-14 + +- [#517](https://github.com/stripe/stripe-php/pull/517) Integer-index encode all sequential arrays + +## 6.17.0 - 2018-09-05 + +- [#514](https://github.com/stripe/stripe-php/pull/514) Add support for reporting resources + +## 6.16.0 - 2018-08-23 + +- [#509](https://github.com/stripe/stripe-php/pull/509) Add support for usage record summaries + +## 6.15.0 - 2018-08-03 + +- [#504](https://github.com/stripe/stripe-php/pull/504) Add cancel support for topups + +## 6.14.0 - 2018-08-02 + +- [#505](https://github.com/stripe/stripe-php/pull/505) Add support for file links + +## 6.13.0 - 2018-07-31 + +- [#502](https://github.com/stripe/stripe-php/pull/502) Add `isDeleted()` method to `\Stripe\StripeObject` + +## 6.12.0 - 2018-07-28 + +- [#501](https://github.com/stripe/stripe-php/pull/501) Add support for scheduled query runs (`\Stripe\Sigma\ScheduledQueryRun`) for Sigma + +## 6.11.0 - 2018-07-26 + +- [#500](https://github.com/stripe/stripe-php/pull/500) Add support for Stripe Issuing + +## 6.10.4 - 2018-07-19 + +- [#498](https://github.com/stripe/stripe-php/pull/498) Internal improvements to the `\Stripe\ApiResource.classUrl()` method + +## 6.10.3 - 2018-07-16 + +- [#497](https://github.com/stripe/stripe-php/pull/497) Use HTTP/2 only for HTTPS requests + +## 6.10.2 - 2018-07-11 + +- [#494](https://github.com/stripe/stripe-php/pull/494) Enable HTTP/2 support + +## 6.10.1 - 2018-07-10 + +- [#493](https://github.com/stripe/stripe-php/pull/493) Add PHPDoc for `auto_advance` on `\Stripe\Invoice` + +## 6.10.0 - 2018-06-28 + +- [#488](https://github.com/stripe/stripe-php/pull/488) Add support for `$appPartnerId` to `Stripe::setAppInfo()` + +## 6.9.0 - 2018-06-28 + +- [#487](https://github.com/stripe/stripe-php/pull/487) Add support for payment intents + +## 6.8.2 - 2018-06-24 + +- [#486](https://github.com/stripe/stripe-php/pull/486) Make `Account.deauthorize()` return the `StripeObject` from the API + +## 6.8.1 - 2018-06-13 + +- [#472](https://github.com/stripe/stripe-php/pull/472) Added phpDoc for `ApiRequestor` and others, especially regarding thrown errors + +## 6.8.0 - 2018-06-13 + +- [#481](https://github.com/stripe/stripe-php/pull/481) Add new `\Stripe\Discount` and `\Stripe\OrderItem` classes, add more PHPDoc describing object attributes + +## 6.7.4 - 2018-05-29 + +- [#480](https://github.com/stripe/stripe-php/pull/480) PHPDoc changes for API version 2018-05-21 and the addition of the new `CHARGE_EXPIRED` event type + +## 6.7.3 - 2018-05-28 + +- [#479](https://github.com/stripe/stripe-php/pull/479) Fix unnecessary traits on `\Stripe\InvoiceLineItem` + +## 6.7.2 - 2018-05-28 + +- [#471](https://github.com/stripe/stripe-php/pull/471) Add `OBJECT_NAME` constant to all API resource classes, add `\Stripe\InvoiceLineItem` class + +## 6.7.1 - 2018-05-13 + +- [#468](https://github.com/stripe/stripe-php/pull/468) Update fields in PHP docs for accuracy + +## 6.7.0 - 2018-05-09 + +- [#466](https://github.com/stripe/stripe-php/pull/466) Add support for issuer fraud records + +## 6.6.0 - 2018-04-11 + +- [#460](https://github.com/stripe/stripe-php/pull/460) Add support for flexible billing primitives + +## 6.5.0 - 2018-04-05 + +- [#461](https://github.com/stripe/stripe-php/pull/461) Don't zero keys on non-`metadata` subobjects + +## 6.4.2 - 2018-03-17 + +- [#458](https://github.com/stripe/stripe-php/pull/458) Add PHPDoc for `account` on `\Stripe\Event` + +## 6.4.1 - 2018-03-02 + +- [#455](https://github.com/stripe/stripe-php/pull/455) Fix namespaces in PHPDoc +- [#456](https://github.com/stripe/stripe-php/pull/456) Fix namespaces for some exceptions + +## 6.4.0 - 2018-02-28 + +- [#453](https://github.com/stripe/stripe-php/pull/453) Add constants for `reason` (`REASON_*`) and `status` (`STATUS_*`) on `\Stripe\Dispute` + +## 6.3.2 - 2018-02-27 + +- [#452](https://github.com/stripe/stripe-php/pull/452) Add PHPDoc for `amount_paid` and `amount_remaining` on `\Stripe\Invoice` + +## 6.3.1 - 2018-02-26 + +- [#443](https://github.com/stripe/stripe-php/pull/443) Add event types as constants to `\Stripe\Event` class + +## 6.3.0 - 2018-02-23 + +- [#450](https://github.com/stripe/stripe-php/pull/450) Add support for `code` attribute on all Stripe exceptions + +## 6.2.0 - 2018-02-21 + +- [#440](https://github.com/stripe/stripe-php/pull/440) Add support for topups +- [#442](https://github.com/stripe/stripe-php/pull/442) Fix PHPDoc for `\Stripe\Error\SignatureVerification` + +## 6.1.0 - 2018-02-12 + +- [#435](https://github.com/stripe/stripe-php/pull/435) Fix header persistence on `Collection` objects +- [#436](https://github.com/stripe/stripe-php/pull/436) Introduce new `Idempotency` error class + +## 6.0.0 - 2018-02-07 + +Major version release. List of backwards incompatible changes to watch out for: + +- The minimum PHP version is now 5.4.0. If you're using PHP 5.3 or older, consider upgrading to a more recent version. + +* `\Stripe\AttachedObject` no longer exists. Attributes that used to be instances of `\Stripe\AttachedObject` (such as `metadata`) are now instances of `\Stripe\StripeObject`. + +- Attributes that used to be PHP arrays (such as `legal_entity->additional_owners` on `\Stripe\Account` instances) are now instances of `\Stripe\StripeObject`, except when they are empty. `\Stripe\StripeObject` has array semantics so this should not be an issue unless you are actively checking types. + +* `\Stripe\Collection` now derives from `\Stripe\StripeObject` rather than from `\Stripe\ApiResource`. + +Pull requests included in this release: + +- [#410](https://github.com/stripe/stripe-php/pull/410) Drop support for PHP 5.3 +- [#411](https://github.com/stripe/stripe-php/pull/411) Use traits for common API operations +- [#414](https://github.com/stripe/stripe-php/pull/414) Use short array syntax +- [#404](https://github.com/stripe/stripe-php/pull/404) Fix serialization logic +- [#417](https://github.com/stripe/stripe-php/pull/417) Remove `ExternalAccount` class +- [#418](https://github.com/stripe/stripe-php/pull/418) Increase test coverage +- [#421](https://github.com/stripe/stripe-php/pull/421) Update CA bundle and add script for future updates +- [#422](https://github.com/stripe/stripe-php/pull/422) Use vendored CA bundle for all requests +- [#428](https://github.com/stripe/stripe-php/pull/428) Support for automatic request retries + +## 5.9.2 - 2018-02-07 + +- [#431](https://github.com/stripe/stripe-php/pull/431) Update PHPDoc @property tags for latest API version + +## 5.9.1 - 2018-02-06 + +- [#427](https://github.com/stripe/stripe-php/pull/427) Add and update PHPDoc @property tags on all API resources + +## 5.9.0 - 2018-01-17 + +- [#421](https://github.com/stripe/stripe-php/pull/421) Updated bundled CA certificates +- [#423](https://github.com/stripe/stripe-php/pull/423) Escape unsanitized input in OAuth example + +## 5.8.0 - 2017-12-20 + +- [#403](https://github.com/stripe/stripe-php/pull/403) Add `__debugInfo()` magic method to `StripeObject` + +## 5.7.0 - 2017-11-28 + +- [#390](https://github.com/stripe/stripe-php/pull/390) Remove some unsupported API methods +- [#391](https://github.com/stripe/stripe-php/pull/391) Alphabetize the list of API resources in `Util::convertToStripeObject()` and add missing resources +- [#393](https://github.com/stripe/stripe-php/pull/393) Fix expiry date update for card sources + +## 5.6.0 - 2017-10-31 + +- [#386](https://github.com/stripe/stripe-php/pull/386) Support for exchange rates APIs + +## 5.5.1 - 2017-10-30 + +- [#387](https://github.com/stripe/stripe-php/pull/387) Allow `personal_address_kana` and `personal_address_kanji` to be updated on an account + +## 5.5.0 - 2017-10-27 + +- [#385](https://github.com/stripe/stripe-php/pull/385) Support for listing source transactions + +## 5.4.0 - 2017-10-24 + +- [#383](https://github.com/stripe/stripe-php/pull/383) Add static methods to manipulate resources from parent + - `Account` gains methods for external accounts and login links (e.g. `createExternalAccount`, `createLoginLink`) + - `ApplicationFee` gains methods for refunds + - `Customer` gains methods for sources + - `Transfer` gains methods for reversals + +## 5.3.0 - 2017-10-11 + +- [#378](https://github.com/stripe/stripe-php/pull/378) Rename source `delete` to `detach` (and deprecate the former) + +## 5.2.3 - 2017-09-27 + +- Add PHPDoc for `Card` + +## 5.2.2 - 2017-09-20 + +- Fix deserialization mapping of `FileUpload` objects + +## 5.2.1 - 2017-09-14 + +- Serialized `shipping` nested attribute + +## 5.2.0 - 2017-08-29 + +- Add support for `InvalidClient` OAuth error + +## 5.1.3 - 2017-08-14 + +- Allow `address_kana` and `address_kanji` to be updated for custom accounts + +## 5.1.2 - 2017-08-01 + +- Fix documented return type of `autoPagingIterator()` (was missing namespace) + +## 5.1.1 - 2017-07-03 + +- Fix order returns to use the right URL `/v1/order_returns` + +## 5.1.0 - 2017-06-30 + +- Add support for OAuth + +## 5.0.0 - 2017-06-27 + +- `pay` on invoice now takes params as well as opts + +## 4.13.0 - 2017-06-19 + +- Add support for ephemeral keys + +## 4.12.0 - 2017-06-05 + +- Clients can implement `getUserAgentInfo()` to add additional user agent information + +## 4.11.0 - 2017-06-05 + +- Implement `Countable` for `AttachedObject` (`metadata` and `additional_owners`) + +## 4.10.0 - 2017-05-25 + +- Add support for login links + +## 4.9.1 - 2017-05-10 + +- Fix docs to include arrays on `$id` parameter for retrieve methods + +## 4.9.0 - 2017-04-28 + +- Support for checking webhook signatures + +## 4.8.1 - 2017-04-24 + +- Allow nested field `payout_schedule` to be updated + +## 4.8.0 - 2017-04-20 + +- Add `\Stripe\Stripe::setLogger()` to support an external PSR-3 compatible logger + +## 4.7.0 - 2017-04-10 + +- Add support for payouts and recipient transfers + +## 4.6.0 - 2017-04-06 + +- Please see 4.7.0 instead (no-op release) + +## 4.5.1 - 2017-03-22 + +- Remove hard dependency on cURL + +## 4.5.0 - 2017-03-20 + +- Support for detaching sources from customers + +## 4.4.2 - 2017-02-27 + +- Correct handling of `owner` parameter when updating sources + +## 4.4.1 - 2017-02-24 + +- Correct the error check on a bad JSON decoding + +## 4.4.0 - 2017-01-18 + +- Add support for updating sources + +## 4.3.0 - 2016-11-30 + +- Add support for verifying sources + +## 4.2.0 - 2016-11-21 + +- Add retrieve method for 3-D Secure resources + +## 4.1.1 - 2016-10-21 + +- Add docblock with model properties for `Plan` + +## 4.1.0 - 2016-10-18 + +- Support for 403 status codes (permission denied) + +## 4.0.1 - 2016-10-17 + +- Fix transfer reversal materialization +- Fixes for some property definitions in docblocks + +## 4.0.0 - 2016-09-28 + +- Support for subscription items +- Drop attempt to force TLS 1.2: please note that this could be breaking if you're using old OS distributions or packages and upgraded recently (so please make sure to test your integration!) + +## 3.23.0 - 2016-09-15 + +- Add support for Apple Pay domains + +## 3.22.0 - 2016-09-13 + +- Add `Stripe::setAppInfo` to allow plugins to register user agent information + +## 3.21.0 - 2016-08-25 + +- Add `Source` model for generic payment sources + +## 3.20.0 - 2016-08-08 + +- Add `getDeclineCode` to card errors + +## 3.19.0 - 2016-07-29 + +- Opt requests directly into TLS 1.2 where OpenSSL >= 1.0.1 (see #277 for context) + +## 3.18.0 - 2016-07-28 + +- Add new `STATUS_` constants for subscriptions + +## 3.17.1 - 2016-07-28 + +- Fix auto-paging iterator so that it plays nicely with `iterator_to_array` + +## 3.17.0 - 2016-07-14 + +- Add field annotations to model classes for better editor hinting + +## 3.16.0 - 2016-07-12 + +- Add `ThreeDSecure` model for 3-D secure payments + +## 3.15.0 - 2016-06-29 + +- Add static `update` method to all resources that can be changed. + +## 3.14.3 - 2016-06-20 + +- Make sure that cURL never sends `Expects: 100-continue`, even on large request bodies + +## 3.14.2 - 2016-06-03 + +- Add `inventory` under `SKU` to list of keys that have nested data and can be updated + +## 3.14.1 - 2016-05-27 + +- Fix some inconsistencies in PHPDoc + +## 3.14.0 - 2016-05-25 + +- Add support for returning Relay orders + +## 3.13.0 - 2016-05-04 + +- Add `list`, `create`, `update`, `retrieve`, and `delete` methods to the Subscription class + +## 3.12.1 - 2016-04-07 + +- Additional check on value arrays for some extra safety + +## 3.12.0 - 2016-03-31 + +- Fix bug `refreshFrom` on `StripeObject` would not take an `$opts` array +- Fix bug where `$opts` not passed to parent `save` method in `Account` +- Fix bug where non-existent variable was referenced in `reverse` in `Transfer` +- Update CA cert bundle for compatibility with OpenSSL versions below 1.0.1 + +## 3.11.0 - 2016-03-22 + +- Allow `CurlClient` to be initialized with default `CURLOPT_*` options + +## 3.10.1 - 2016-03-22 + +- Fix bug where request params and options were ignored in `ApplicationFee`'s `refund.` + +## 3.10.0 - 2016-03-15 + +- Add `reject` on `Account` to support the new API feature + +## 3.9.2 - 2016-03-04 + +- Fix error when an object's metadata is set more than once + +## 3.9.1 - 2016-02-24 + +- Fix encoding behavior of nested arrays for requests (see #227) + +## 3.9.0 - 2016-02-09 + +- Add automatic pagination mechanism with `autoPagingIterator()` +- Allow global account ID to be set with `Stripe::setAccountId()` + +## 3.8.0 - 2016-02-08 + +- Add `CountrySpec` model for looking up country payment information + +## 3.7.1 - 2016-02-01 + +- Update bundled CA certs + +## 3.7.0 - 2016-01-27 + +- Support deleting Relay products and SKUs + +## 3.6.0 - 2016-01-05 + +- Allow configuration of HTTP client timeouts + +## 3.5.0 - 2015-12-01 + +- Add a verification routine for external accounts + +## 3.4.0 - 2015-09-14 + +- Products, SKUs, and Orders -- https://stripe.com/relay + +## 3.3.0 - 2015-09-11 + +- Add support for 429 Rate Limit response + +## 3.2.0 - 2015-08-17 + +- Add refund listing and retrieval without an associated charge + +## 3.1.0 - 2015-08-03 + +- Add dispute listing and retrieval +- Add support for manage account deletion + +## 3.0.0 - 2015-07-28 + +- Rename `\Stripe\Object` to `\Stripe\StripeObject` (PHP 7 compatibility) +- Rename `getCode` and `getParam` in exceptions to `getStripeCode` and `getStripeParam` +- Add support for calling `json_encode` on Stripe objects in PHP 5.4+ +- Start supporting/testing PHP 7 + +## 2.3.0 - 2015-07-06 + +- Add request ID to all Stripe exceptions + +## 2.2.0 - 2015-06-01 + +- Add support for Alipay accounts as sources +- Add support for bank accounts as sources (private beta) +- Add support for bank accounts and cards as external_accounts on Account objects + +## 2.1.4 - 2015-05-13 + +- Fix CA certificate file path (thanks @lphilps & @matthewarkin) + +## 2.1.3 - 2015-05-12 + +- Fix to account updating to permit `tos_acceptance` and `personal_address` to be set properly +- Fix to Transfer reversal creation (thanks @neatness!) +- Network requests are now done through a swappable class for easier mocking + +## 2.1.2 - 2015-04-10 + +- Remove SSL cert revokation checking (all pre-Heartbleed certs have expired) +- Bug fixes to account updating + +## 2.1.1 - 2015-02-27 + +- Support transfer reversals + +## 2.1.0 - 2015-02-19 + +- Support new API version (2015-02-18) +- Added Bitcoin Receiever update and delete actions +- Edited tests to prefer "source" over "card" as per new API version + +## 2.0.1 - 2015-02-16 + +- Fix to fetching endpoints that use a non-default baseUrl (`FileUpload`) + +## 2.0.0 - 2015-02-14 + +- Bumped minimum version to 5.3.3 +- Switched to Stripe namespace instead of Stripe\_ class name prefiexes (thanks @chadicus!) +- Switched tests to PHPUnit (thanks @chadicus!) +- Switched style guide to PSR2 (thanks @chadicus!) +- Added \$opts hash to the end of most methods: this permits passing 'idempotency_key', 'stripe_account', or 'stripe_version'. The last 2 will persist across multiple object loads. +- Added support for retrieving Account by ID + +## 1.18.0 - 2015-01-21 + +- Support making bitcoin charges through BitcoinReceiver source object + +## 1.17.5 - 2014-12-23 + +- Adding support for creating file uploads. + +## 1.17.4 - 2014-12-15 + +- Saving objects fetched with a custom key now works (thanks @JustinHook & @jpasilan) +- Added methods for reporting charges as safe or fraudulent and for specifying the reason for refunds + +## 1.17.3 - 2014-11-06 + +- Better handling of HHVM support for SSL certificate blacklist checking. + +## 1.17.2 - 2014-09-23 + +- Coupons now are backed by a `Stripe_Coupon` instead of `Stripe_Object`, and support updating metadata +- Running operations (`create`, `retrieve`, `all`) on upcoming invoice items now works + +## 1.17.1 - 2014-07-31 + +- Requests now send Content-Type header + +## 1.17.0 - 2014-07-29 + +- Application Fee refunds now a list instead of array +- HHVM now works +- Small bug fixes (thanks @bencromwell & @fastest963) +- `__toString` now returns the name of the object in addition to its JSON representation + +## 1.16.0 - 2014-06-17 + +- Add metadata for refunds and disputes + +## 1.15.0 - 2014-05-28 + +- Support canceling transfers + +## 1.14.1 - 2014-05-21 + +- Support cards for recipients. + +## 1.13.1 - 2014-05-15 + +- Fix bug in account resource where `id` wasn't in the result + +## 1.13.0 - 2014-04-10 + +- Add support for certificate blacklisting +- Update ca bundle +- Drop support for HHVM (Temporarily) + +## 1.12.0 - 2014-04-01 + +- Add Stripe_RateLimitError for catching rate limit errors. +- Update to Zend coding style (thanks, @jpiasetz) + +## 1.11.0 - 2014-01-29 + +- Add support for multiple subscriptions per customer + +## 1.10.1 - 2013-12-02 + +- Add new ApplicationFee + +## 1.9.1 - 2013-11-08 + +- Fix a bug where a null nestable object causes warnings to fire. + +## 1.9.0 - 2013-10-16 + +- Add support for metadata API. + +## 1.8.4 - 2013-09-18 + +- Add support for closing disputes. + +## 1.8.3 - 2013-08-13 + +- Add new Balance and BalanceTransaction + +## 1.8.2 - 2013-08-12 + +- Add support for unsetting attributes by updating to NULL. Setting properties to a blank string is now an error. + +## 1.8.1 - 2013-07-12 + +- Add support for multiple cards API (Stripe API version 2013-07-12: https://stripe.com/docs/upgrades#2013-07-05) + +## 1.8.0 - 2013-04-11 + +- Allow Transfers to be creatable +- Add new Recipient resource + +## 1.7.15 - 2013-02-21 + +- Add 'id' to the list of permanent object attributes + +## 1.7.14 - 2013-02-20 + +- Don't re-encode strings that are already encoded in UTF-8. If you were previously using plan or coupon objects with UTF-8 IDs, they may have been treated as ISO-8859-1 (Latin-1) and encoded to UTF-8 a 2nd time. You may now need to pass the IDs to utf8_encode before passing them to Stripe_Plan::retrieve or Stripe_Coupon::retrieve. +- Ensure that all input is encoded in UTF-8 before submitting it to Stripe's servers. (github issue #27) + +## 1.7.13 - 2013-02-01 + +- Add support for passing options when retrieving Stripe objects e.g., Stripe_Charge::retrieve(array("id"=>"foo", "expand" => array("customer"))); Stripe_Charge::retrieve("foo") will continue to work + +## 1.7.12 - 2013-01-15 + +- Add support for setting a Stripe API version override + +## 1.7.11 - 2012-12-30 + +- Version bump to cleanup constants and such (fix issue #26) + +## 1.7.10 - 2012-11-08 + +- Add support for updating charge disputes. +- Fix bug preventing retrieval of null attributes + +## 1.7.9 - 2012-11-08 + +- Fix usage under autoloaders such as the one generated by composer (fix issue #22) + +## 1.7.8 - 2012-10-30 + +- Add support for creating invoices. +- Add support for new invoice lines return format +- Add support for new list objects + +## 1.7.7 - 2012-09-14 + +- Get all of the various version numbers in the repo in sync (no other changes) + +## 1.7.6 - 2012-08-31 + +- Add update and pay methods to Invoice resource + +## 1.7.5 - 2012-08-23 + +- Change internal function names so that Stripe_SingletonApiRequest is E_STRICT-clean (github issue #16) + +## 1.7.4 - 2012-08-21 + +- Bugfix so that Stripe objects (e.g. Customer, Charge objects) used in API calls are transparently converted to their object IDs + +## 1.7.3 - 2012-08-15 + +- Add new Account resource + +## 1.7.2 - 2012-06-26 + +- Make clearer that you should be including lib/Stripe.php, not test/Stripe.php (github issue #14) + +## 1.7.1 - 2012-05-24 + +- Add missing argument to Stripe_InvalidRequestError constructor in Stripe_ApiResource::instanceUrl. Fixes a warning when Stripe_ApiResource::instanceUrl is called on a resource with no ID (fix issue #12) + +## 1.7.0 - 2012-05-17 + +- Support Composer and Packagist (github issue #9) +- Add new deleteDiscount method to Stripe_Customer +- Add new Transfer resource +- Switch from using HTTP Basic auth to Bearer auth. (Note: Stripe will support Basic auth for the indefinite future, but recommends Bearer auth when possible going forward) +- Numerous test suite improvements diff --git a/wp-content/plugins/stripe-payments/includes/stripe/CODE_OF_CONDUCT.md b/wp-content/plugins/stripe-payments/includes/stripe/CODE_OF_CONDUCT.md new file mode 100644 index 0000000..349f5a0 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/CODE_OF_CONDUCT.md @@ -0,0 +1,77 @@ +# Contributor Covenant Code of Conduct + +## Our Pledge + +In the interest of fostering an open and welcoming environment, we as +contributors and maintainers pledge to make participation in our project and +our community a harassment-free experience for everyone, regardless of age, body +size, disability, ethnicity, sex characteristics, gender identity and expression, +level of experience, education, socio-economic status, nationality, personal +appearance, race, religion, or sexual identity and orientation. + +## Our Standards + +Examples of behavior that contributes to creating a positive environment +include: + +* Using welcoming and inclusive language +* Being respectful of differing viewpoints and experiences +* Gracefully accepting constructive criticism +* Focusing on what is best for the community +* Showing empathy towards other community members + +Examples of unacceptable behavior by participants include: + +* The use of sexualized language or imagery and unwelcome sexual attention or + advances +* Trolling, insulting/derogatory comments, and personal or political attacks +* Public or private harassment +* Publishing others' private information, such as a physical or electronic + address, without explicit permission +* Other conduct which could reasonably be considered inappropriate in a + professional setting + +## Our Responsibilities + +Project maintainers are responsible for clarifying the standards of acceptable +behavior and are expected to take appropriate and fair corrective action in +response to any instances of unacceptable behavior. + +Project maintainers have the right and responsibility to remove, edit, or +reject comments, commits, code, wiki edits, issues, and other contributions +that are not aligned to this Code of Conduct, or to ban temporarily or +permanently any contributor for other behaviors that they deem inappropriate, +threatening, offensive, or harmful. + +## Scope + +This Code of Conduct applies within all project spaces, and it also applies when +an individual is representing the project or its community in public spaces. +Examples of representing a project or community include using an official +project e-mail address, posting via an official social media account, or acting +as an appointed representative at an online or offline event. Representation of +a project may be further defined and clarified by project maintainers. + +## Enforcement + +Instances of abusive, harassing, or otherwise unacceptable behavior may be +reported by contacting the project team at conduct@stripe.com. All +complaints will be reviewed and investigated and will result in a response that +is deemed necessary and appropriate to the circumstances. The project team is +obligated to maintain confidentiality with regard to the reporter of an incident. +Further details of specific enforcement policies may be posted separately. + +Project maintainers who do not follow or enforce the Code of Conduct in good +faith may face temporary or permanent repercussions as determined by other +members of the project's leadership. + +## Attribution + +This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, +available at https://www.contributor-covenant.org/version/1/4/code-of-conduct.html + +[homepage]: https://www.contributor-covenant.org + +For answers to common questions about this code of conduct, see +https://www.contributor-covenant.org/faq + diff --git a/wp-content/plugins/stripe-payments/includes/stripe/LICENSE b/wp-content/plugins/stripe-payments/includes/stripe/LICENSE new file mode 100644 index 0000000..847c705 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/LICENSE @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2010-2019 Stripe, Inc. (https://stripe.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/wp-content/plugins/stripe-payments/includes/stripe/Makefile b/wp-content/plugins/stripe-payments/includes/stripe/Makefile new file mode 100644 index 0000000..f9c5975 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/Makefile @@ -0,0 +1,31 @@ +export PHPDOCUMENTOR_VERSION := v3.0.0 + +vendor: composer.json + composer install + +vendor/bin/phpdoc: vendor + curl -sfL https://github.com/phpDocumentor/phpDocumentor/releases/download/$(PHPDOCUMENTOR_VERSION)/phpDocumentor.phar -o vendor/bin/phpdoc + chmod +x vendor/bin/phpdoc + +test: vendor + vendor/bin/phpunit +.PHONY: test + +fmt: vendor + vendor/bin/php-cs-fixer fix -v --using-cache=no . +.PHONY: fmt + +fmtcheck: vendor + vendor/bin/php-cs-fixer fix -v --dry-run --using-cache=no . +.PHONY: fmtcheck + +phpdoc: vendor/bin/phpdoc + vendor/bin/phpdoc + +phpstan: vendor + php -d memory_limit=512M vendor/bin/phpstan analyse lib tests +.PHONY: phpstan + +phpstan-baseline: vendor/bin/phpstan + php -d memory_limit=512M vendor/bin/phpstan analyse lib tests --generate-baseline +.PHONY: phpstan-baseline diff --git a/wp-content/plugins/stripe-payments/includes/stripe/README.md b/wp-content/plugins/stripe-payments/includes/stripe/README.md new file mode 100644 index 0000000..e9d25ad --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/README.md @@ -0,0 +1,270 @@ +# Stripe PHP bindings + +[![Build Status](https://travis-ci.org/stripe/stripe-php.svg?branch=master)](https://travis-ci.org/stripe/stripe-php) +[![Latest Stable Version](https://poser.pugx.org/stripe/stripe-php/v/stable.svg)](https://packagist.org/packages/stripe/stripe-php) +[![Total Downloads](https://poser.pugx.org/stripe/stripe-php/downloads.svg)](https://packagist.org/packages/stripe/stripe-php) +[![License](https://poser.pugx.org/stripe/stripe-php/license.svg)](https://packagist.org/packages/stripe/stripe-php) + +The Stripe PHP library provides convenient access to the Stripe API from +applications written in the PHP language. It includes a pre-defined set of +classes for API resources that initialize themselves dynamically from API +responses which makes it compatible with a wide range of versions of the Stripe +API. + +## Requirements + +PHP 5.6.0 and later. + +## Composer + +You can install the bindings via [Composer](http://getcomposer.org/). Run the following command: + +```bash +composer require stripe/stripe-php +``` + +To use the bindings, use Composer's [autoload](https://getcomposer.org/doc/01-basic-usage.md#autoloading): + +```php +require_once('vendor/autoload.php'); +``` + +## Manual Installation + +If you do not wish to use Composer, you can download the [latest release](https://github.com/stripe/stripe-php/releases). Then, to use the bindings, include the `init.php` file. + +```php +require_once('/path/to/stripe-php/init.php'); +``` + +## Dependencies + +The bindings require the following extensions in order to work properly: + +- [`curl`](https://secure.php.net/manual/en/book.curl.php), although you can use your own non-cURL client if you prefer +- [`json`](https://secure.php.net/manual/en/book.json.php) +- [`mbstring`](https://secure.php.net/manual/en/book.mbstring.php) (Multibyte String) + +If you use Composer, these dependencies should be handled automatically. If you install manually, you'll want to make sure that these extensions are available. + +## Getting Started + +Simple usage looks like: + +```php +$stripe = new \Stripe\StripeClient('sk_test_BQokikJOvBiI2HlWgH4olfQ2'); +$customer = $stripe->customers->create([ + 'description' => 'example customer', + 'email' => 'email@example.com', + 'payment_method' => 'pm_card_visa', +]); +echo $customer; +``` + +### Client/service patterns vs legacy patterns + +You can continue to use the legacy integration patterns used prior to version [7.33.0](https://github.com/stripe/stripe-php/blob/master/CHANGELOG.md#7330---2020-05-14). Review the [migration guide](https://github.com/stripe/stripe-php/wiki/Migration-to-StripeClient-and-services-in-7.33.0) for the backwards-compatible client/services pattern changes. + +## Documentation + +See the [PHP API docs](https://stripe.com/docs/api/?lang=php#intro). + +See [video demonstrations][youtube-playlist] covering how to use the library. + +## Legacy Version Support + +### PHP 5.4 & 5.5 + +If you are using PHP 5.4 or 5.5, you should consider upgrading your environment as those versions have been past end of life since September 2015 and July 2016 respectively. +Otherwise, you can still use Stripe by downloading stripe-php v6.43.1 ([zip](https://github.com/stripe/stripe-php/archive/v6.43.1.zip), [tar.gz](https://github.com/stripe/stripe-php/archive/6.43.1.tar.gz)) from our [releases page](https://github.com/stripe/stripe-php/releases). This version will work but might not support recent features we added since the version was released and upgrading PHP is the best course of action. + +### PHP 5.3 + +If you are using PHP 5.3, you should upgrade your environment as this version has been past end of life since August 2014. +Otherwise, you can download v5.9.2 ([zip](https://github.com/stripe/stripe-php/archive/v5.9.2.zip), [tar.gz](https://github.com/stripe/stripe-php/archive/v5.9.2.tar.gz)) from our [releases page](https://github.com/stripe/stripe-php/releases). This version will continue to work with new versions of the Stripe API for all common uses. + +## Custom Request Timeouts + +_NOTE:_ We do not recommend decreasing the timeout for non-read-only calls (e.g. charge creation), since even if you locally timeout, the request on Stripe's side can still complete. If you are decreasing timeouts on these calls, make sure to use [idempotency tokens](https://stripe.com/docs/api/?lang=php#idempotent_requests) to avoid executing the same transaction twice as a result of timeout retry logic. + +To modify request timeouts (connect or total, in seconds) you'll need to tell the API client to use a CurlClient other than its default. You'll set the timeouts in that CurlClient. + +```php +// set up your tweaked Curl client +$curl = new \Stripe\HttpClient\CurlClient(); +$curl->setTimeout(10); // default is \Stripe\HttpClient\CurlClient::DEFAULT_TIMEOUT +$curl->setConnectTimeout(5); // default is \Stripe\HttpClient\CurlClient::DEFAULT_CONNECT_TIMEOUT + +echo $curl->getTimeout(); // 10 +echo $curl->getConnectTimeout(); // 5 + +// tell Stripe to use the tweaked client +\Stripe\ApiRequestor::setHttpClient($curl); + +// use the Stripe API client as you normally would +``` + +## Custom cURL Options (e.g. proxies) + +Need to set a proxy for your requests? Pass in the requisite `CURLOPT_*` array to the CurlClient constructor, using the same syntax as `curl_stopt_array()`. This will set the default cURL options for each HTTP request made by the SDK, though many more common options (e.g. timeouts; see above on how to set those) will be overridden by the client even if set here. + +```php +// set up your tweaked Curl client +$curl = new \Stripe\HttpClient\CurlClient([CURLOPT_PROXY => 'proxy.local:80']); +// tell Stripe to use the tweaked client +\Stripe\ApiRequestor::setHttpClient($curl); +``` + +Alternately, a callable can be passed to the CurlClient constructor that returns the above array based on request inputs. See `testDefaultOptions()` in `tests/CurlClientTest.php` for an example of this behavior. Note that the callable is called at the beginning of every API request, before the request is sent. + +### Configuring a Logger + +The library does minimal logging, but it can be configured +with a [`PSR-3` compatible logger][psr3] so that messages +end up there instead of `error_log`: + +```php +\Stripe\Stripe::setLogger($logger); +``` + +### Accessing response data + +You can access the data from the last API response on any object via `getLastResponse()`. + +```php +$customer = $stripe->customers->create([ + 'description' => 'example customer', +]); +echo $customer->getLastResponse()->headers['Request-Id']; +``` + +### SSL / TLS compatibility issues + +Stripe's API now requires that [all connections use TLS 1.2](https://stripe.com/blog/upgrading-tls). Some systems (most notably some older CentOS and RHEL versions) are capable of using TLS 1.2 but will use TLS 1.0 or 1.1 by default. In this case, you'd get an `invalid_request_error` with the following error message: "Stripe no longer supports API requests made with TLS 1.0. Please initiate HTTPS connections with TLS 1.2 or later. You can learn more about this at [https://stripe.com/blog/upgrading-tls](https://stripe.com/blog/upgrading-tls).". + +The recommended course of action is to [upgrade your cURL and OpenSSL packages](https://support.stripe.com/questions/how-do-i-upgrade-my-stripe-integration-from-tls-1-0-to-tls-1-2#php) so that TLS 1.2 is used by default, but if that is not possible, you might be able to solve the issue by setting the `CURLOPT_SSLVERSION` option to either `CURL_SSLVERSION_TLSv1` or `CURL_SSLVERSION_TLSv1_2`: + +```php +$curl = new \Stripe\HttpClient\CurlClient([CURLOPT_SSLVERSION => CURL_SSLVERSION_TLSv1]); +\Stripe\ApiRequestor::setHttpClient($curl); +``` + +### Per-request Configuration + +For apps that need to use multiple keys during the lifetime of a process, like +one that uses [Stripe Connect][connect], it's also possible to set a +per-request key and/or account: + +```php +$customers = $stripe->customers->all([],[ + 'api_key' => 'sk_test_...', + 'stripe_account' => 'acct_...' +]); + +$stripe->customers->retrieve('cus_123456789', [], [ + 'api_key' => 'sk_test_...', + 'stripe_account' => 'acct_...' +]); +``` + +### Configuring CA Bundles + +By default, the library will use its own internal bundle of known CA +certificates, but it's possible to configure your own: + +```php +\Stripe\Stripe::setCABundlePath("path/to/ca/bundle"); +``` + +### Configuring Automatic Retries + +The library can be configured to automatically retry requests that fail due to +an intermittent network problem: + +```php +\Stripe\Stripe::setMaxNetworkRetries(2); +``` + +[Idempotency keys][idempotency-keys] are added to requests to guarantee that +retries are safe. + +### Request latency telemetry + +By default, the library sends request latency telemetry to Stripe. These +numbers help Stripe improve the overall latency of its API for all users. + +You can disable this behavior if you prefer: + +```php +\Stripe\Stripe::setEnableTelemetry(false); +``` + +## Development + +Get [Composer][composer]. For example, on Mac OS: + +```bash +brew install composer +``` + +Install dependencies: + +```bash +composer install +``` + +The test suite depends on [stripe-mock], so make sure to fetch and run it from a +background terminal ([stripe-mock's README][stripe-mock] also contains +instructions for installing via Homebrew and other methods): + +```bash +go get -u github.com/stripe/stripe-mock +stripe-mock +``` + +Install dependencies as mentioned above (which will resolve [PHPUnit](http://packagist.org/packages/phpunit/phpunit)), then you can run the test suite: + +```bash +./vendor/bin/phpunit +``` + +Or to run an individual test file: + +```bash +./vendor/bin/phpunit tests/Stripe/UtilTest.php +``` + +Update bundled CA certificates from the [Mozilla cURL release][curl]: + +```bash +./update_certs.php +``` + +The library uses [PHP CS Fixer][php-cs-fixer] for code formatting. Code must be formatted before PRs are submitted, otherwise CI will fail. Run the formatter with: + +```bash +./vendor/bin/php-cs-fixer fix -v . +``` + +## Attention plugin developers + +Are you writing a plugin that integrates Stripe and embeds our library? Then please use the `setAppInfo` function to identify your plugin. For example: + +```php +\Stripe\Stripe::setAppInfo("MyAwesomePlugin", "1.2.34", "https://myawesomeplugin.info"); +``` + +The method should be called once, before any request is sent to the API. The second and third parameters are optional. + +### SSL / TLS configuration option + +See the "SSL / TLS compatibility issues" paragraph above for full context. If you want to ensure that your plugin can be used on all systems, you should add a configuration option to let your users choose between different values for `CURLOPT_SSLVERSION`: none (default), `CURL_SSLVERSION_TLSv1` and `CURL_SSLVERSION_TLSv1_2`. + +[composer]: https://getcomposer.org/ +[connect]: https://stripe.com/connect +[curl]: http://curl.haxx.se/docs/caextract.html +[idempotency-keys]: https://stripe.com/docs/api/?lang=php#idempotent_requests +[php-cs-fixer]: https://github.com/FriendsOfPHP/PHP-CS-Fixer +[psr3]: http://www.php-fig.org/psr/psr-3/ +[stripe-mock]: https://github.com/stripe/stripe-mock +[youtube-playlist]: https://www.youtube.com/playlist?list=PLy1nL-pvL2M6cUbiHrfMkXxZ9j9SGBxFE diff --git a/wp-content/plugins/stripe-payments/includes/stripe/VERSION b/wp-content/plugins/stripe-payments/includes/stripe/VERSION new file mode 100644 index 0000000..ca04796 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/VERSION @@ -0,0 +1 @@ +7.110.0 diff --git a/wp-content/plugins/stripe-payments/includes/stripe/build.php b/wp-content/plugins/stripe-payments/includes/stripe/build.php new file mode 100644 index 0000000..37360ff --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/build.php @@ -0,0 +1,25 @@ +#!/usr/bin/env php +=5.6.0", + "ext-curl": "*", + "ext-json": "*", + "ext-mbstring": "*" + }, + "require-dev": { + "phpunit/phpunit": "^5.7 || ^9.0", + "squizlabs/php_codesniffer": "^3.3", + "friendsofphp/php-cs-fixer": "3.4.0", + "phpstan/phpstan": "^1.2" + }, + "autoload": { + "psr-4": { + "Stripe\\": "lib/" + } + }, + "autoload-dev": { + "psr-4": { + "Stripe\\": [ + "tests/", + "tests/Stripe/" + ] + } + }, + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/data/ca-certificates.crt b/wp-content/plugins/stripe-payments/includes/stripe/data/ca-certificates.crt new file mode 100644 index 0000000..65be218 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/data/ca-certificates.crt @@ -0,0 +1,3476 @@ +## +## Bundle of CA Root Certificates +## +## Certificate data from Mozilla as of: Wed Aug 28 03:12:10 2019 GMT +## +## This is a bundle of X.509 certificates of public Certificate Authorities +## (CA). These were automatically extracted from Mozilla's root certificates +## file (certdata.txt). This file can be found in the mozilla source tree: +## https://hg.mozilla.org/releases/mozilla-release/raw-file/default/security/nss/lib/ckfw/builtins/certdata.txt +## +## It contains the certificates in PEM format and therefore +## can be directly used with curl / libcurl / php_curl, or with +## an Apache+mod_ssl webserver for SSL client authentication. +## Just configure this file as the SSLCACertificateFile. +## +## Conversion done with mk-ca-bundle.pl version 1.27. +## SHA256: fffa309937c3be940649293f749b8207fabc6eb224e50e4bb3f2c5e44e0d6a6b +## + + +GlobalSign Root CA +================== +-----BEGIN CERTIFICATE----- +MIIDdTCCAl2gAwIBAgILBAAAAAABFUtaw5QwDQYJKoZIhvcNAQEFBQAwVzELMAkGA1UEBhMCQkUx +GTAXBgNVBAoTEEdsb2JhbFNpZ24gbnYtc2ExEDAOBgNVBAsTB1Jvb3QgQ0ExGzAZBgNVBAMTEkds +b2JhbFNpZ24gUm9vdCBDQTAeFw05ODA5MDExMjAwMDBaFw0yODAxMjgxMjAwMDBaMFcxCzAJBgNV +BAYTAkJFMRkwFwYDVQQKExBHbG9iYWxTaWduIG52LXNhMRAwDgYDVQQLEwdSb290IENBMRswGQYD +VQQDExJHbG9iYWxTaWduIFJvb3QgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDa +DuaZjc6j40+Kfvvxi4Mla+pIH/EqsLmVEQS98GPR4mdmzxzdzxtIK+6NiY6arymAZavpxy0Sy6sc +THAHoT0KMM0VjU/43dSMUBUc71DuxC73/OlS8pF94G3VNTCOXkNz8kHp1Wrjsok6Vjk4bwY8iGlb +Kk3Fp1S4bInMm/k8yuX9ifUSPJJ4ltbcdG6TRGHRjcdGsnUOhugZitVtbNV4FpWi6cgKOOvyJBNP +c1STE4U6G7weNLWLBYy5d4ux2x8gkasJU26Qzns3dLlwR5EiUWMWea6xrkEmCMgZK9FGqkjWZCrX +gzT/LCrBbBlDSgeF59N89iFo7+ryUp9/k5DPAgMBAAGjQjBAMA4GA1UdDwEB/wQEAwIBBjAPBgNV +HRMBAf8EBTADAQH/MB0GA1UdDgQWBBRge2YaRQ2XyolQL30EzTSo//z9SzANBgkqhkiG9w0BAQUF +AAOCAQEA1nPnfE920I2/7LqivjTFKDK1fPxsnCwrvQmeU79rXqoRSLblCKOzyj1hTdNGCbM+w6Dj +Y1Ub8rrvrTnhQ7k4o+YviiY776BQVvnGCv04zcQLcFGUl5gE38NflNUVyRRBnMRddWQVDf9VMOyG +j/8N7yy5Y0b2qvzfvGn9LhJIZJrglfCm7ymPAbEVtQwdpf5pLGkkeB6zpxxxYu7KyJesF12KwvhH +hm4qxFYxldBniYUr+WymXUadDKqC5JlR3XC321Y9YeRq4VzW9v493kHMB65jUr9TU/Qr6cf9tveC +X4XSQRjbgbMEHMUfpIBvFSDJ3gyICh3WZlXi/EjJKSZp4A== +-----END CERTIFICATE----- + +GlobalSign Root CA - R2 +======================= +-----BEGIN CERTIFICATE----- +MIIDujCCAqKgAwIBAgILBAAAAAABD4Ym5g0wDQYJKoZIhvcNAQEFBQAwTDEgMB4GA1UECxMXR2xv +YmFsU2lnbiBSb290IENBIC0gUjIxEzARBgNVBAoTCkdsb2JhbFNpZ24xEzARBgNVBAMTCkdsb2Jh +bFNpZ24wHhcNMDYxMjE1MDgwMDAwWhcNMjExMjE1MDgwMDAwWjBMMSAwHgYDVQQLExdHbG9iYWxT +aWduIFJvb3QgQ0EgLSBSMjETMBEGA1UEChMKR2xvYmFsU2lnbjETMBEGA1UEAxMKR2xvYmFsU2ln +bjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKbPJA6+Lm8omUVCxKs+IVSbC9N/hHD6 +ErPLv4dfxn+G07IwXNb9rfF73OX4YJYJkhD10FPe+3t+c4isUoh7SqbKSaZeqKeMWhG8eoLrvozp +s6yWJQeXSpkqBy+0Hne/ig+1AnwblrjFuTosvNYSuetZfeLQBoZfXklqtTleiDTsvHgMCJiEbKjN +S7SgfQx5TfC4LcshytVsW33hoCmEofnTlEnLJGKRILzdC9XZzPnqJworc5HGnRusyMvo4KD0L5CL +TfuwNhv2GXqF4G3yYROIXJ/gkwpRl4pazq+r1feqCapgvdzZX99yqWATXgAByUr6P6TqBwMhAo6C +ygPCm48CAwEAAaOBnDCBmTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4E +FgQUm+IHV2ccHsBqBt5ZtJot39wZhi4wNgYDVR0fBC8wLTAroCmgJ4YlaHR0cDovL2NybC5nbG9i +YWxzaWduLm5ldC9yb290LXIyLmNybDAfBgNVHSMEGDAWgBSb4gdXZxwewGoG3lm0mi3f3BmGLjAN +BgkqhkiG9w0BAQUFAAOCAQEAmYFThxxol4aR7OBKuEQLq4GsJ0/WwbgcQ3izDJr86iw8bmEbTUsp +9Z8FHSbBuOmDAGJFtqkIk7mpM0sYmsL4h4hO291xNBrBVNpGP+DTKqttVCL1OmLNIG+6KYnX3ZHu +01yiPqFbQfXf5WRDLenVOavSot+3i9DAgBkcRcAtjOj4LaR0VknFBbVPFd5uRHg5h6h+u/N5GJG7 +9G+dwfCMNYxdAfvDbbnvRG15RjF+Cv6pgsH/76tuIMRQyV+dTZsXjAzlAcmgQWpzU/qlULRuJQ/7 +TBj0/VLZjmmx6BEP3ojY+x1J96relc8geMJgEtslQIxq/H5COEBkEveegeGTLg== +-----END CERTIFICATE----- + +Verisign Class 3 Public Primary Certification Authority - G3 +============================================================ +-----BEGIN CERTIFICATE----- +MIIEGjCCAwICEQCbfgZJoz5iudXukEhxKe9XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV +UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv +cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl +IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh +dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw +CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy +dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv +cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkg +Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC +ggEBAMu6nFL8eB8aHm8bN3O9+MlrlBIwT/A2R/XQkQr1F8ilYcEWQE37imGQ5XYgwREGfassbqb1 +EUGO+i2tKmFZpGcmTNDovFJbcCAEWNF6yaRpvIMXZK0Fi7zQWM6NjPXr8EJJC52XJ2cybuGukxUc +cLwgTS8Y3pKI6GyFVxEa6X7jJhFUokWWVYPKMIno3Nij7SqAP395ZVc+FSBmCC+Vk7+qRy+oRpfw +EuL+wgorUeZ25rdGt+INpsyow0xZVYnm6FNcHOqd8GIWC6fJXwzw3sJ2zq/3avL6QaaiMxTJ5Xpj +055iN9WFZZ4O5lMkdBteHRJTW8cs54NJOxWuimi5V5cCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA +ERSWwauSCPc/L8my/uRan2Te2yFPhpk0djZX3dAVL8WtfxUfN2JzPtTnX84XA9s1+ivbrmAJXx5f +j267Cz3qWhMeDGBvtcC1IyIuBwvLqXTLR7sdwdela8wv0kL9Sd2nic9TutoAWii/gt/4uhMdUIaC +/Y4wjylGsB49Ndo4YhYYSq3mtlFs3q9i6wHQHiT+eo8SGhJouPtmmRQURVyu565pF4ErWjfJXir0 +xuKhXFSbplQAz/DxwceYMBo7Nhbbo27q/a2ywtrvAkcTisDxszGtTxzhT5yvDwyd93gN2PQ1VoDa +t20Xj50egWTh/sVFuq1ruQp6Tk9LhO5L8X3dEQ== +-----END CERTIFICATE----- + +Entrust.net Premium 2048 Secure Server CA +========================================= +-----BEGIN CERTIFICATE----- +MIIEKjCCAxKgAwIBAgIEOGPe+DANBgkqhkiG9w0BAQUFADCBtDEUMBIGA1UEChMLRW50cnVzdC5u +ZXQxQDA+BgNVBAsUN3d3dy5lbnRydXN0Lm5ldC9DUFNfMjA0OCBpbmNvcnAuIGJ5IHJlZi4gKGxp +bWl0cyBsaWFiLikxJTAjBgNVBAsTHChjKSAxOTk5IEVudHJ1c3QubmV0IExpbWl0ZWQxMzAxBgNV +BAMTKkVudHJ1c3QubmV0IENlcnRpZmljYXRpb24gQXV0aG9yaXR5ICgyMDQ4KTAeFw05OTEyMjQx +NzUwNTFaFw0yOTA3MjQxNDE1MTJaMIG0MRQwEgYDVQQKEwtFbnRydXN0Lm5ldDFAMD4GA1UECxQ3 +d3d3LmVudHJ1c3QubmV0L0NQU18yMDQ4IGluY29ycC4gYnkgcmVmLiAobGltaXRzIGxpYWIuKTEl +MCMGA1UECxMcKGMpIDE5OTkgRW50cnVzdC5uZXQgTGltaXRlZDEzMDEGA1UEAxMqRW50cnVzdC5u +ZXQgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgKDIwNDgpMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8A +MIIBCgKCAQEArU1LqRKGsuqjIAcVFmQqK0vRvwtKTY7tgHalZ7d4QMBzQshowNtTK91euHaYNZOL +Gp18EzoOH1u3Hs/lJBQesYGpjX24zGtLA/ECDNyrpUAkAH90lKGdCCmziAv1h3edVc3kw37XamSr +hRSGlVuXMlBvPci6Zgzj/L24ScF2iUkZ/cCovYmjZy/Gn7xxGWC4LeksyZB2ZnuU4q941mVTXTzW +nLLPKQP5L6RQstRIzgUyVYr9smRMDuSYB3Xbf9+5CFVghTAp+XtIpGmG4zU/HoZdenoVve8AjhUi +VBcAkCaTvA5JaJG/+EfTnZVCwQ5N328mz8MYIWJmQ3DW1cAH4QIDAQABo0IwQDAOBgNVHQ8BAf8E +BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUVeSB0RGAvtiJuQijMfmhJAkWuXAwDQYJ +KoZIhvcNAQEFBQADggEBADubj1abMOdTmXx6eadNl9cZlZD7Bh/KM3xGY4+WZiT6QBshJ8rmcnPy +T/4xmf3IDExoU8aAghOY+rat2l098c5u9hURlIIM7j+VrxGrD9cv3h8Dj1csHsm7mhpElesYT6Yf +zX1XEC+bBAlahLVu2B064dae0Wx5XnkcFMXj0EyTO2U87d89vqbllRrDtRnDvV5bu/8j72gZyxKT +J1wDLW8w0B62GqzeWvfRqqgnpv55gcR5mTNXuhKwqeBCbJPKVt7+bYQLCIt+jerXmCHG8+c8eS9e +nNFMFY3h7CI3zJpDC5fcgJCNs2ebb0gIFVbPv/ErfF6adulZkMV8gzURZVE= +-----END CERTIFICATE----- + +Baltimore CyberTrust Root +========================= +-----BEGIN CERTIFICATE----- +MIIDdzCCAl+gAwIBAgIEAgAAuTANBgkqhkiG9w0BAQUFADBaMQswCQYDVQQGEwJJRTESMBAGA1UE +ChMJQmFsdGltb3JlMRMwEQYDVQQLEwpDeWJlclRydXN0MSIwIAYDVQQDExlCYWx0aW1vcmUgQ3li +ZXJUcnVzdCBSb290MB4XDTAwMDUxMjE4NDYwMFoXDTI1MDUxMjIzNTkwMFowWjELMAkGA1UEBhMC +SUUxEjAQBgNVBAoTCUJhbHRpbW9yZTETMBEGA1UECxMKQ3liZXJUcnVzdDEiMCAGA1UEAxMZQmFs +dGltb3JlIEN5YmVyVHJ1c3QgUm9vdDCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKME +uyKrmD1X6CZymrV51Cni4eiVgLGw41uOKymaZN+hXe2wCQVt2yguzmKiYv60iNoS6zjrIZ3AQSsB +UnuId9Mcj8e6uYi1agnnc+gRQKfRzMpijS3ljwumUNKoUMMo6vWrJYeKmpYcqWe4PwzV9/lSEy/C +G9VwcPCPwBLKBsua4dnKM3p31vjsufFoREJIE9LAwqSuXmD+tqYF/LTdB1kC1FkYmGP1pWPgkAx9 +XbIGevOF6uvUA65ehD5f/xXtabz5OTZydc93Uk3zyZAsuT3lySNTPx8kmCFcB5kpvcY67Oduhjpr +l3RjM71oGDHweI12v/yejl0qhqdNkNwnGjkCAwEAAaNFMEMwHQYDVR0OBBYEFOWdWTCCR1jMrPoI +VDaGezq1BE3wMBIGA1UdEwEB/wQIMAYBAf8CAQMwDgYDVR0PAQH/BAQDAgEGMA0GCSqGSIb3DQEB +BQUAA4IBAQCFDF2O5G9RaEIFoN27TyclhAO992T9Ldcw46QQF+vaKSm2eT929hkTI7gQCvlYpNRh +cL0EYWoSihfVCr3FvDB81ukMJY2GQE/szKN+OMY3EU/t3WgxjkzSswF07r51XgdIGn9w/xZchMB5 +hbgF/X++ZRGjD8ACtPhSNzkE1akxehi/oCr0Epn3o0WC4zxe9Z2etciefC7IpJ5OCBRLbf1wbWsa +Y71k5h+3zvDyny67G7fyUIhzksLi4xaNmjICq44Y3ekQEe5+NauQrz4wlHrQMz2nZQ/1/I6eYs9H +RCwBXbsdtTLSR9I4LtD+gdwyah617jzV/OeBHRnDJELqYzmp +-----END CERTIFICATE----- + +AddTrust External Root +====================== +-----BEGIN CERTIFICATE----- +MIIENjCCAx6gAwIBAgIBATANBgkqhkiG9w0BAQUFADBvMQswCQYDVQQGEwJTRTEUMBIGA1UEChML +QWRkVHJ1c3QgQUIxJjAkBgNVBAsTHUFkZFRydXN0IEV4dGVybmFsIFRUUCBOZXR3b3JrMSIwIAYD +VQQDExlBZGRUcnVzdCBFeHRlcm5hbCBDQSBSb290MB4XDTAwMDUzMDEwNDgzOFoXDTIwMDUzMDEw +NDgzOFowbzELMAkGA1UEBhMCU0UxFDASBgNVBAoTC0FkZFRydXN0IEFCMSYwJAYDVQQLEx1BZGRU +cnVzdCBFeHRlcm5hbCBUVFAgTmV0d29yazEiMCAGA1UEAxMZQWRkVHJ1c3QgRXh0ZXJuYWwgQ0Eg +Um9vdDCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALf3GjPm8gAELTngTlvtH7xsD821 ++iO2zt6bETOXpClMfZOfvUq8k+0DGuOPz+VtUFrWlymUWoCwSXrbLpX9uMq/NzgtHj6RQa1wVsfw +Tz/oMp50ysiQVOnGXw94nZpAPA6sYapeFI+eh6FqUNzXmk6vBbOmcZSccbNQYArHE504B4YCqOmo +aSYYkKtMsE8jqzpPhNjfzp/haW+710LXa0Tkx63ubUFfclpxCDezeWWkWaCUN/cALw3CknLa0Dhy +2xSoRcRdKn23tNbE7qzNE0S3ySvdQwAl+mG5aWpYIxG3pzOPVnVZ9c0p10a3CitlttNCbxWyuHv7 +7+ldU9U0WicCAwEAAaOB3DCB2TAdBgNVHQ4EFgQUrb2YejS0Jvf6xCZU7wO94CTLVBowCwYDVR0P +BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wgZkGA1UdIwSBkTCBjoAUrb2YejS0Jvf6xCZU7wO94CTL +VBqhc6RxMG8xCzAJBgNVBAYTAlNFMRQwEgYDVQQKEwtBZGRUcnVzdCBBQjEmMCQGA1UECxMdQWRk +VHJ1c3QgRXh0ZXJuYWwgVFRQIE5ldHdvcmsxIjAgBgNVBAMTGUFkZFRydXN0IEV4dGVybmFsIENB +IFJvb3SCAQEwDQYJKoZIhvcNAQEFBQADggEBALCb4IUlwtYj4g+WBpKdQZic2YR5gdkeWxQHIzZl +j7DYd7usQWxHYINRsPkyPef89iYTx4AWpb9a/IfPeHmJIZriTAcKhjW88t5RxNKWt9x+Tu5w/Rw5 +6wwCURQtjr0W4MHfRnXnJK3s9EK0hZNwEGe6nQY1ShjTK3rMUUKhemPR5ruhxSvCNr4TDea9Y355 +e6cJDUCrat2PisP29owaQgVR1EX1n6diIWgVIEM8med8vSTYqZEXc4g/VhsxOBi0cQ+azcgOno4u +G+GMmIPLHzHxREzGBHNJdmAPx/i9F4BrLunMTA5amnkPIAou1Z5jJh5VkpTYghdae9C8x49OhgQ= +-----END CERTIFICATE----- + +Entrust Root Certification Authority +==================================== +-----BEGIN CERTIFICATE----- +MIIEkTCCA3mgAwIBAgIERWtQVDANBgkqhkiG9w0BAQUFADCBsDELMAkGA1UEBhMCVVMxFjAUBgNV +BAoTDUVudHJ1c3QsIEluYy4xOTA3BgNVBAsTMHd3dy5lbnRydXN0Lm5ldC9DUFMgaXMgaW5jb3Jw +b3JhdGVkIGJ5IHJlZmVyZW5jZTEfMB0GA1UECxMWKGMpIDIwMDYgRW50cnVzdCwgSW5jLjEtMCsG +A1UEAxMkRW50cnVzdCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTA2MTEyNzIwMjM0 +MloXDTI2MTEyNzIwNTM0MlowgbAxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1FbnRydXN0LCBJbmMu +MTkwNwYDVQQLEzB3d3cuZW50cnVzdC5uZXQvQ1BTIGlzIGluY29ycG9yYXRlZCBieSByZWZlcmVu +Y2UxHzAdBgNVBAsTFihjKSAyMDA2IEVudHJ1c3QsIEluYy4xLTArBgNVBAMTJEVudHJ1c3QgUm9v +dCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB +ALaVtkNC+sZtKm9I35RMOVcF7sN5EUFoNu3s/poBj6E4KPz3EEZmLk0eGrEaTsbRwJWIsMn/MYsz +A9u3g3s+IIRe7bJWKKf44LlAcTfFy0cOlypowCKVYhXbR9n10Cv/gkvJrT7eTNuQgFA/CYqEAOww +Cj0Yzfv9KlmaI5UXLEWeH25DeW0MXJj+SKfFI0dcXv1u5x609mhF0YaDW6KKjbHjKYD+JXGIrb68 +j6xSlkuqUY3kEzEZ6E5Nn9uss2rVvDlUccp6en+Q3X0dgNmBu1kmwhH+5pPi94DkZfs0Nw4pgHBN +rziGLp5/V6+eF67rHMsoIV+2HNjnogQi+dPa2MsCAwEAAaOBsDCBrTAOBgNVHQ8BAf8EBAMCAQYw +DwYDVR0TAQH/BAUwAwEB/zArBgNVHRAEJDAigA8yMDA2MTEyNzIwMjM0MlqBDzIwMjYxMTI3MjA1 +MzQyWjAfBgNVHSMEGDAWgBRokORnpKZTgMeGZqTx90tD+4S9bTAdBgNVHQ4EFgQUaJDkZ6SmU4DH +hmak8fdLQ/uEvW0wHQYJKoZIhvZ9B0EABBAwDhsIVjcuMTo0LjADAgSQMA0GCSqGSIb3DQEBBQUA +A4IBAQCT1DCw1wMgKtD5Y+iRDAUgqV8ZyntyTtSx29CW+1RaGSwMCPeyvIWonX9tO1KzKtvn1ISM +Y/YPyyYBkVBs9F8U4pN0wBOeMDpQ47RgxRzwIkSNcUesyBrJ6ZuaAGAT/3B+XxFNSRuzFVJ7yVTa +v52Vr2ua2J7p8eRDjeIRRDq/r72DQnNSi6q7pynP9WQcCk3RvKqsnyrQ/39/2n3qse0wJcGE2jTS +W3iDVuycNsMm4hH2Z0kdkquM++v/eu6FSqdQgPCnXEqULl8FmTxSQeDNtGPPAUO6nIPcj2A781q0 +tHuu2guQOHXvgR1m0vdXcDazv/wor3ElhVsT/h5/WrQ8 +-----END CERTIFICATE----- + +GeoTrust Global CA +================== +-----BEGIN CERTIFICATE----- +MIIDVDCCAjygAwIBAgIDAjRWMA0GCSqGSIb3DQEBBQUAMEIxCzAJBgNVBAYTAlVTMRYwFAYDVQQK +Ew1HZW9UcnVzdCBJbmMuMRswGQYDVQQDExJHZW9UcnVzdCBHbG9iYWwgQ0EwHhcNMDIwNTIxMDQw +MDAwWhcNMjIwNTIxMDQwMDAwWjBCMQswCQYDVQQGEwJVUzEWMBQGA1UEChMNR2VvVHJ1c3QgSW5j +LjEbMBkGA1UEAxMSR2VvVHJ1c3QgR2xvYmFsIENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB +CgKCAQEA2swYYzD99BcjGlZ+W988bDjkcbd4kdS8odhM+KhDtgPpTSEHCIjaWC9mOSm9BXiLnTjo +BbdqfnGk5sRgprDvgOSJKA+eJdbtg/OtppHHmMlCGDUUna2YRpIuT8rxh0PBFpVXLVDviS2Aelet +8u5fa9IAjbkU+BQVNdnARqN7csiRv8lVK83Qlz6cJmTM386DGXHKTubU1XupGc1V3sjs0l44U+Vc +T4wt/lAjNvxm5suOpDkZALeVAjmRCw7+OC7RHQWa9k0+bw8HHa8sHo9gOeL6NlMTOdReJivbPagU +vTLrGAMoUgRx5aszPeE4uwc2hGKceeoWMPRfwCvocWvk+QIDAQABo1MwUTAPBgNVHRMBAf8EBTAD +AQH/MB0GA1UdDgQWBBTAephojYn7qwVkDBF9qn1luMrMTjAfBgNVHSMEGDAWgBTAephojYn7qwVk +DBF9qn1luMrMTjANBgkqhkiG9w0BAQUFAAOCAQEANeMpauUvXVSOKVCUn5kaFOSPeCpilKInZ57Q +zxpeR+nBsqTP3UEaBU6bS+5Kb1VSsyShNwrrZHYqLizz/Tt1kL/6cdjHPTfStQWVYrmm3ok9Nns4 +d0iXrKYgjy6myQzCsplFAMfOEVEiIuCl6rYVSAlk6l5PdPcFPseKUgzbFbS9bZvlxrFUaKnjaZC2 +mqUPuLk/IH2uSrW4nOQdtqvmlKXBx4Ot2/Unhw4EbNX/3aBd7YdStysVAq45pmp06drE57xNNB6p +XE0zX5IJL4hmXXeXxx12E6nV5fEWCRE11azbJHFwLJhWC9kXtNHjUStedejV0NxPNO3CBWaAocvm +Mw== +-----END CERTIFICATE----- + +GeoTrust Universal CA +===================== +-----BEGIN CERTIFICATE----- +MIIFaDCCA1CgAwIBAgIBATANBgkqhkiG9w0BAQUFADBFMQswCQYDVQQGEwJVUzEWMBQGA1UEChMN +R2VvVHJ1c3QgSW5jLjEeMBwGA1UEAxMVR2VvVHJ1c3QgVW5pdmVyc2FsIENBMB4XDTA0MDMwNDA1 +MDAwMFoXDTI5MDMwNDA1MDAwMFowRTELMAkGA1UEBhMCVVMxFjAUBgNVBAoTDUdlb1RydXN0IElu +Yy4xHjAcBgNVBAMTFUdlb1RydXN0IFVuaXZlcnNhbCBDQTCCAiIwDQYJKoZIhvcNAQEBBQADggIP +ADCCAgoCggIBAKYVVaCjxuAfjJ0hUNfBvitbtaSeodlyWL0AG0y/YckUHUWCq8YdgNY96xCcOq9t +JPi8cQGeBvV8Xx7BDlXKg5pZMK4ZyzBIle0iN430SppyZj6tlcDgFgDgEB8rMQ7XlFTTQjOgNB0e +RXbdT8oYN+yFFXoZCPzVx5zw8qkuEKmS5j1YPakWaDwvdSEYfyh3peFhF7em6fgemdtzbvQKoiFs +7tqqhZJmr/Z6a4LauiIINQ/PQvE1+mrufislzDoR5G2vc7J2Ha3QsnhnGqQ5HFELZ1aD/ThdDc7d +8Lsrlh/eezJS/R27tQahsiFepdaVaH/wmZ7cRQg+59IJDTWU3YBOU5fXtQlEIGQWFwMCTFMNaN7V +qnJNk22CDtucvc+081xdVHppCZbW2xHBjXWotM85yM48vCR85mLK4b19p71XZQvk/iXttmkQ3Cga +Rr0BHdCXteGYO8A3ZNY9lO4L4fUorgtWv3GLIylBjobFS1J72HGrH4oVpjuDWtdYAVHGTEHZf9hB +Z3KiKN9gg6meyHv8U3NyWfWTehd2Ds735VzZC1U0oqpbtWpU5xPKV+yXbfReBi9Fi1jUIxaS5BZu +KGNZMN9QAZxjiRqf2xeUgnA3wySemkfWWspOqGmJch+RbNt+nhutxx9z3SxPGWX9f5NAEC7S8O08 +ni4oPmkmM8V7AgMBAAGjYzBhMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFNq7LqqwDLiIJlF0 +XG0D08DYj3rWMB8GA1UdIwQYMBaAFNq7LqqwDLiIJlF0XG0D08DYj3rWMA4GA1UdDwEB/wQEAwIB +hjANBgkqhkiG9w0BAQUFAAOCAgEAMXjmx7XfuJRAyXHEqDXsRh3ChfMoWIawC/yOsjmPRFWrZIRc +aanQmjg8+uUfNeVE44B5lGiku8SfPeE0zTBGi1QrlaXv9z+ZhP015s8xxtxqv6fXIwjhmF7DWgh2 +qaavdy+3YL1ERmrvl/9zlcGO6JP7/TG37FcREUWbMPEaiDnBTzynANXH/KttgCJwpQzgXQQpAvvL +oJHRfNbDflDVnVi+QTjruXU8FdmbyUqDWcDaU/0zuzYYm4UPFd3uLax2k7nZAY1IEKj79TiG8dsK +xr2EoyNB3tZ3b4XUhRxQ4K5RirqNPnbiucon8l+f725ZDQbYKxek0nxru18UGkiPGkzns0ccjkxF +KyDuSN/n3QmOGKjaQI2SJhFTYXNd673nxE0pN2HrrDktZy4W1vUAg4WhzH92xH3kt0tm7wNFYGm2 +DFKWkoRepqO1pD4r2czYG0eq8kTaT/kD6PAUyz/zg97QwVTjt+gKN02LIFkDMBmhLMi9ER/frslK +xfMnZmaGrGiR/9nmUxwPi1xpZQomyB40w11Re9epnAahNt3ViZS82eQtDF4JbAiXfKM9fJP/P6EU +p8+1Xevb2xzEdt+Iub1FBZUbrvxGakyvSOPOrg/SfuvmbJxPgWp6ZKy7PtXny3YuxadIwVyQD8vI +P/rmMuGNG2+k5o7Y+SlIis5z/iw= +-----END CERTIFICATE----- + +GeoTrust Universal CA 2 +======================= +-----BEGIN CERTIFICATE----- +MIIFbDCCA1SgAwIBAgIBATANBgkqhkiG9w0BAQUFADBHMQswCQYDVQQGEwJVUzEWMBQGA1UEChMN +R2VvVHJ1c3QgSW5jLjEgMB4GA1UEAxMXR2VvVHJ1c3QgVW5pdmVyc2FsIENBIDIwHhcNMDQwMzA0 +MDUwMDAwWhcNMjkwMzA0MDUwMDAwWjBHMQswCQYDVQQGEwJVUzEWMBQGA1UEChMNR2VvVHJ1c3Qg +SW5jLjEgMB4GA1UEAxMXR2VvVHJ1c3QgVW5pdmVyc2FsIENBIDIwggIiMA0GCSqGSIb3DQEBAQUA +A4ICDwAwggIKAoICAQCzVFLByT7y2dyxUxpZKeexw0Uo5dfR7cXFS6GqdHtXr0om/Nj1XqduGdt0 +DE81WzILAePb63p3NeqqWuDW6KFXlPCQo3RWlEQwAx5cTiuFJnSCegx2oG9NzkEtoBUGFF+3Qs17 +j1hhNNwqCPkuwwGmIkQcTAeC5lvO0Ep8BNMZcyfwqph/Lq9O64ceJHdqXbboW0W63MOhBW9Wjo8Q +JqVJwy7XQYci4E+GymC16qFjwAGXEHm9ADwSbSsVsaxLse4YuU6W3Nx2/zu+z18DwPw76L5GG//a +QMJS9/7jOvdqdzXQ2o3rXhhqMcceujwbKNZrVMaqW9eiLBsZzKIC9ptZvTdrhrVtgrrY6slWvKk2 +WP0+GfPtDCapkzj4T8FdIgbQl+rhrcZV4IErKIM6+vR7IVEAvlI4zs1meaj0gVbi0IMJR1FbUGrP +20gaXT73y/Zl92zxlfgCOzJWgjl6W70viRu/obTo/3+NjN8D8WBOWBFM66M/ECuDmgFz2ZRthAAn +ZqzwcEAJQpKtT5MNYQlRJNiS1QuUYbKHsu3/mjX/hVTK7URDrBs8FmtISgocQIgfksILAAX/8sgC +SqSqqcyZlpwvWOB94b67B9xfBHJcMTTD7F8t4D1kkCLm0ey4Lt1ZrtmhN79UNdxzMk+MBB4zsslG +8dhcyFVQyWi9qLo2CQIDAQABo2MwYTAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBR281Xh+qQ2 ++/CfXGJx7Tz0RzgQKzAfBgNVHSMEGDAWgBR281Xh+qQ2+/CfXGJx7Tz0RzgQKzAOBgNVHQ8BAf8E +BAMCAYYwDQYJKoZIhvcNAQEFBQADggIBAGbBxiPz2eAubl/oz66wsCVNK/g7WJtAJDday6sWSf+z +dXkzoS9tcBc0kf5nfo/sm+VegqlVHy/c1FEHEv6sFj4sNcZj/NwQ6w2jqtB8zNHQL1EuxBRa3ugZ +4T7GzKQp5y6EqgYweHZUcyiYWTjgAA1i00J9IZ+uPTqM1fp3DRgrFg5fNuH8KrUwJM/gYwx7WBr+ +mbpCErGR9Hxo4sjoryzqyX6uuyo9DRXcNJW2GHSoag/HtPQTxORb7QrSpJdMKu0vbBKJPfEncKpq +A1Ihn0CoZ1Dy81of398j9tx4TuaYT1U6U+Pv8vSfx3zYWK8pIpe44L2RLrB27FcRz+8pRPPphXpg +Y+RdM4kX2TGq2tbzGDVyz4crL2MjhF2EjD9XoIj8mZEoJmmZ1I+XRL6O1UixpCgp8RW04eWe3fiP +pm8m1wk8OhwRDqZsN/etRIcsKMfYdIKz0G9KV7s1KSegi+ghp4dkNl3M2Basx7InQJJVOCiNUW7d +FGdTbHFcJoRNdVq2fmBWqU2t+5sel/MN2dKXVHfaPRK34B7vCAas+YWH6aLcr34YEoP9VhdBLtUp +gn2Z9DH2canPLAEnpQW5qrJITirvn5NSUZU8UnOOVkwXQMAJKOSLakhT2+zNVVXxxvjpoixMptEm +X36vWkzaH6byHCx+rgIW0lbQL1dTR+iS +-----END CERTIFICATE----- + +Comodo AAA Services root +======================== +-----BEGIN CERTIFICATE----- +MIIEMjCCAxqgAwIBAgIBATANBgkqhkiG9w0BAQUFADB7MQswCQYDVQQGEwJHQjEbMBkGA1UECAwS +R3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHDAdTYWxmb3JkMRowGAYDVQQKDBFDb21vZG8gQ0Eg +TGltaXRlZDEhMB8GA1UEAwwYQUFBIENlcnRpZmljYXRlIFNlcnZpY2VzMB4XDTA0MDEwMTAwMDAw +MFoXDTI4MTIzMTIzNTk1OVowezELMAkGA1UEBhMCR0IxGzAZBgNVBAgMEkdyZWF0ZXIgTWFuY2hl +c3RlcjEQMA4GA1UEBwwHU2FsZm9yZDEaMBgGA1UECgwRQ29tb2RvIENBIExpbWl0ZWQxITAfBgNV +BAMMGEFBQSBDZXJ0aWZpY2F0ZSBTZXJ2aWNlczCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC +ggEBAL5AnfRu4ep2hxxNRUSOvkbIgwadwSr+GB+O5AL686tdUIoWMQuaBtDFcCLNSS1UY8y2bmhG +C1Pqy0wkwLxyTurxFa70VJoSCsN6sjNg4tqJVfMiWPPe3M/vg4aijJRPn2jymJBGhCfHdr/jzDUs +i14HZGWCwEiwqJH5YZ92IFCokcdmtet4YgNW8IoaE+oxox6gmf049vYnMlhvB/VruPsUK6+3qszW +Y19zjNoFmag4qMsXeDZRrOme9Hg6jc8P2ULimAyrL58OAd7vn5lJ8S3frHRNG5i1R8XlKdH5kBjH +Ypy+g8cmez6KJcfA3Z3mNWgQIJ2P2N7Sw4ScDV7oL8kCAwEAAaOBwDCBvTAdBgNVHQ4EFgQUoBEK +Iz6W8Qfs4q8p74Klf9AwpLQwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wewYDVR0f +BHQwcjA4oDagNIYyaHR0cDovL2NybC5jb21vZG9jYS5jb20vQUFBQ2VydGlmaWNhdGVTZXJ2aWNl +cy5jcmwwNqA0oDKGMGh0dHA6Ly9jcmwuY29tb2RvLm5ldC9BQUFDZXJ0aWZpY2F0ZVNlcnZpY2Vz +LmNybDANBgkqhkiG9w0BAQUFAAOCAQEACFb8AvCb6P+k+tZ7xkSAzk/ExfYAWMymtrwUSWgEdujm +7l3sAg9g1o1QGE8mTgHj5rCl7r+8dFRBv/38ErjHT1r0iWAFf2C3BUrz9vHCv8S5dIa2LX1rzNLz +Rt0vxuBqw8M0Ayx9lt1awg6nCpnBBYurDC/zXDrPbDdVCYfeU0BsWO/8tqtlbgT2G9w84FoVxp7Z +8VlIMCFlA2zs6SFz7JsDoeA3raAVGI/6ugLOpyypEBMs1OUIJqsil2D4kF501KKaU73yqWjgom7C +12yxow+ev+to51byrvLjKzg6CYG1a4XXvi3tPxq3smPi9WIsgtRqAEFQ8TmDn5XpNpaYbg== +-----END CERTIFICATE----- + +QuoVadis Root CA +================ +-----BEGIN CERTIFICATE----- +MIIF0DCCBLigAwIBAgIEOrZQizANBgkqhkiG9w0BAQUFADB/MQswCQYDVQQGEwJCTTEZMBcGA1UE +ChMQUXVvVmFkaXMgTGltaXRlZDElMCMGA1UECxMcUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0 +eTEuMCwGA1UEAxMlUXVvVmFkaXMgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wMTAz +MTkxODMzMzNaFw0yMTAzMTcxODMzMzNaMH8xCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRp +cyBMaW1pdGVkMSUwIwYDVQQLExxSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MS4wLAYDVQQD +EyVRdW9WYWRpcyBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEF +AAOCAQ8AMIIBCgKCAQEAv2G1lVO6V/z68mcLOhrfEYBklbTRvM16z/Ypli4kVEAkOPcahdxYTMuk +J0KX0J+DisPkBgNbAKVRHnAEdOLB1Dqr1607BxgFjv2DrOpm2RgbaIr1VxqYuvXtdj182d6UajtL +F8HVj71lODqV0D1VNk7feVcxKh7YWWVJWCCYfqtffp/p1k3sg3Spx2zY7ilKhSoGFPlU5tPaZQeL +YzcS19Dsw3sgQUSj7cugF+FxZc4dZjH3dgEZyH0DWLaVSR2mEiboxgx24ONmy+pdpibu5cxfvWen +AScOospUxbF6lR1xHkopigPcakXBpBlebzbNw6Kwt/5cOOJSvPhEQ+aQuwIDAQABo4ICUjCCAk4w +PQYIKwYBBQUHAQEEMTAvMC0GCCsGAQUFBzABhiFodHRwczovL29jc3AucXVvdmFkaXNvZmZzaG9y +ZS5jb20wDwYDVR0TAQH/BAUwAwEB/zCCARoGA1UdIASCAREwggENMIIBCQYJKwYBBAG+WAABMIH7 +MIHUBggrBgEFBQcCAjCBxxqBxFJlbGlhbmNlIG9uIHRoZSBRdW9WYWRpcyBSb290IENlcnRpZmlj +YXRlIGJ5IGFueSBwYXJ0eSBhc3N1bWVzIGFjY2VwdGFuY2Ugb2YgdGhlIHRoZW4gYXBwbGljYWJs +ZSBzdGFuZGFyZCB0ZXJtcyBhbmQgY29uZGl0aW9ucyBvZiB1c2UsIGNlcnRpZmljYXRpb24gcHJh +Y3RpY2VzLCBhbmQgdGhlIFF1b1ZhZGlzIENlcnRpZmljYXRlIFBvbGljeS4wIgYIKwYBBQUHAgEW +Fmh0dHA6Ly93d3cucXVvdmFkaXMuYm0wHQYDVR0OBBYEFItLbe3TKbkGGew5Oanwl4Rqy+/fMIGu +BgNVHSMEgaYwgaOAFItLbe3TKbkGGew5Oanwl4Rqy+/foYGEpIGBMH8xCzAJBgNVBAYTAkJNMRkw +FwYDVQQKExBRdW9WYWRpcyBMaW1pdGVkMSUwIwYDVQQLExxSb290IENlcnRpZmljYXRpb24gQXV0 +aG9yaXR5MS4wLAYDVQQDEyVRdW9WYWRpcyBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggQ6 +tlCLMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQUFAAOCAQEAitQUtf70mpKnGdSkfnIYj9lo +fFIk3WdvOXrEql494liwTXCYhGHoG+NpGA7O+0dQoE7/8CQfvbLO9Sf87C9TqnN7Az10buYWnuul +LsS/VidQK2K6vkscPFVcQR0kvoIgR13VRH56FmjffU1RcHhXHTMe/QKZnAzNCgVPx7uOpHX6Sm2x +gI4JVrmcGmD+XcHXetwReNDWXcG31a0ymQM6isxUJTkxgXsTIlG6Rmyhu576BGxJJnSP0nPrzDCi +5upZIof4l/UO/erMkqQWxFIY6iHOsfHmhIHluqmGKPJDWl0Snawe2ajlCmqnf6CHKc/yiU3U7MXi +5nrQNiOKSnQ2+Q== +-----END CERTIFICATE----- + +QuoVadis Root CA 2 +================== +-----BEGIN CERTIFICATE----- +MIIFtzCCA5+gAwIBAgICBQkwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoT +EFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMTElF1b1ZhZGlzIFJvb3QgQ0EgMjAeFw0wNjExMjQx +ODI3MDBaFw0zMTExMjQxODIzMzNaMEUxCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRpcyBM +aW1pdGVkMRswGQYDVQQDExJRdW9WYWRpcyBSb290IENBIDIwggIiMA0GCSqGSIb3DQEBAQUAA4IC +DwAwggIKAoICAQCaGMpLlA0ALa8DKYrwD4HIrkwZhR0In6spRIXzL4GtMh6QRr+jhiYaHv5+HBg6 +XJxgFyo6dIMzMH1hVBHL7avg5tKifvVrbxi3Cgst/ek+7wrGsxDp3MJGF/hd/aTa/55JWpzmM+Yk +lvc/ulsrHHo1wtZn/qtmUIttKGAr79dgw8eTvI02kfN/+NsRE8Scd3bBrrcCaoF6qUWD4gXmuVbB +lDePSHFjIuwXZQeVikvfj8ZaCuWw419eaxGrDPmF60Tp+ARz8un+XJiM9XOva7R+zdRcAitMOeGy +lZUtQofX1bOQQ7dsE/He3fbE+Ik/0XX1ksOR1YqI0JDs3G3eicJlcZaLDQP9nL9bFqyS2+r+eXyt +66/3FsvbzSUr5R/7mp/iUcw6UwxI5g69ybR2BlLmEROFcmMDBOAENisgGQLodKcftslWZvB1Jdxn +wQ5hYIizPtGo/KPaHbDRsSNU30R2be1B2MGyIrZTHN81Hdyhdyox5C315eXbyOD/5YDXC2Og/zOh +D7osFRXql7PSorW+8oyWHhqPHWykYTe5hnMz15eWniN9gqRMgeKh0bpnX5UHoycR7hYQe7xFSkyy +BNKr79X9DFHOUGoIMfmR2gyPZFwDwzqLID9ujWc9Otb+fVuIyV77zGHcizN300QyNQliBJIWENie +J0f7OyHj+OsdWwIDAQABo4GwMIGtMA8GA1UdEwEB/wQFMAMBAf8wCwYDVR0PBAQDAgEGMB0GA1Ud +DgQWBBQahGK8SEwzJQTU7tD2A8QZRtGUazBuBgNVHSMEZzBlgBQahGK8SEwzJQTU7tD2A8QZRtGU +a6FJpEcwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoTEFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMT +ElF1b1ZhZGlzIFJvb3QgQ0EgMoICBQkwDQYJKoZIhvcNAQEFBQADggIBAD4KFk2fBluornFdLwUv +Z+YTRYPENvbzwCYMDbVHZF34tHLJRqUDGCdViXh9duqWNIAXINzng/iN/Ae42l9NLmeyhP3ZRPx3 +UIHmfLTJDQtyU/h2BwdBR5YM++CCJpNVjP4iH2BlfF/nJrP3MpCYUNQ3cVX2kiF495V5+vgtJodm +VjB3pjd4M1IQWK4/YY7yarHvGH5KWWPKjaJW1acvvFYfzznB4vsKqBUsfU16Y8Zsl0Q80m/DShcK ++JDSV6IZUaUtl0HaB0+pUNqQjZRG4T7wlP0QADj1O+hA4bRuVhogzG9Yje0uRY/W6ZM/57Es3zrW +IozchLsib9D45MY56QSIPMO661V6bYCZJPVsAfv4l7CUW+v90m/xd2gNNWQjrLhVoQPRTUIZ3Ph1 +WVaj+ahJefivDrkRoHy3au000LYmYjgahwz46P0u05B/B5EqHdZ+XIWDmbA4CD/pXvk1B+TJYm5X +f6dQlfe6yJvmjqIBxdZmv3lh8zwc4bmCXF2gw+nYSL0ZohEUGW6yhhtoPkg3Goi3XZZenMfvJ2II +4pEZXNLxId26F0KCl3GBUzGpn/Z9Yr9y4aOTHcyKJloJONDO1w2AFrR4pTqHTI2KpdVGl/IsELm8 +VCLAAVBpQ570su9t+Oza8eOx79+Rj1QqCyXBJhnEUhAFZdWCEOrCMc0u +-----END CERTIFICATE----- + +QuoVadis Root CA 3 +================== +-----BEGIN CERTIFICATE----- +MIIGnTCCBIWgAwIBAgICBcYwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoT +EFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMTElF1b1ZhZGlzIFJvb3QgQ0EgMzAeFw0wNjExMjQx +OTExMjNaFw0zMTExMjQxOTA2NDRaMEUxCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRpcyBM +aW1pdGVkMRswGQYDVQQDExJRdW9WYWRpcyBSb290IENBIDMwggIiMA0GCSqGSIb3DQEBAQUAA4IC +DwAwggIKAoICAQDMV0IWVJzmmNPTTe7+7cefQzlKZbPoFog02w1ZkXTPkrgEQK0CSzGrvI2RaNgg +DhoB4hp7Thdd4oq3P5kazethq8Jlph+3t723j/z9cI8LoGe+AaJZz3HmDyl2/7FWeUUrH556VOij +KTVopAFPD6QuN+8bv+OPEKhyq1hX51SGyMnzW9os2l2ObjyjPtr7guXd8lyyBTNvijbO0BNO/79K +DDRMpsMhvVAEVeuxu537RR5kFd5VAYwCdrXLoT9CabwvvWhDFlaJKjdhkf2mrk7AyxRllDdLkgbv +BNDInIjbC3uBr7E9KsRlOni27tyAsdLTmZw67mtaa7ONt9XOnMK+pUsvFrGeaDsGb659n/je7Mwp +p5ijJUMv7/FfJuGITfhebtfZFG4ZM2mnO4SJk8RTVROhUXhA+LjJou57ulJCg54U7QVSWllWp5f8 +nT8KKdjcT5EOE7zelaTfi5m+rJsziO+1ga8bxiJTyPbH7pcUsMV8eFLI8M5ud2CEpukqdiDtWAEX +MJPpGovgc2PZapKUSU60rUqFxKMiMPwJ7Wgic6aIDFUhWMXhOp8q3crhkODZc6tsgLjoC2SToJyM +Gf+z0gzskSaHirOi4XCPLArlzW1oUevaPwV/izLmE1xr/l9A4iLItLRkT9a6fUg+qGkM17uGcclz +uD87nSVL2v9A6wIDAQABo4IBlTCCAZEwDwYDVR0TAQH/BAUwAwEB/zCB4QYDVR0gBIHZMIHWMIHT +BgkrBgEEAb5YAAMwgcUwgZMGCCsGAQUFBwICMIGGGoGDQW55IHVzZSBvZiB0aGlzIENlcnRpZmlj +YXRlIGNvbnN0aXR1dGVzIGFjY2VwdGFuY2Ugb2YgdGhlIFF1b1ZhZGlzIFJvb3QgQ0EgMyBDZXJ0 +aWZpY2F0ZSBQb2xpY3kgLyBDZXJ0aWZpY2F0aW9uIFByYWN0aWNlIFN0YXRlbWVudC4wLQYIKwYB +BQUHAgEWIWh0dHA6Ly93d3cucXVvdmFkaXNnbG9iYWwuY29tL2NwczALBgNVHQ8EBAMCAQYwHQYD +VR0OBBYEFPLAE+CCQz777i9nMpY1XNu4ywLQMG4GA1UdIwRnMGWAFPLAE+CCQz777i9nMpY1XNu4 +ywLQoUmkRzBFMQswCQYDVQQGEwJCTTEZMBcGA1UEChMQUXVvVmFkaXMgTGltaXRlZDEbMBkGA1UE +AxMSUXVvVmFkaXMgUm9vdCBDQSAzggIFxjANBgkqhkiG9w0BAQUFAAOCAgEAT62gLEz6wPJv92ZV +qyM07ucp2sNbtrCD2dDQ4iH782CnO11gUyeim/YIIirnv6By5ZwkajGxkHon24QRiSemd1o417+s +hvzuXYO8BsbRd2sPbSQvS3pspweWyuOEn62Iix2rFo1bZhfZFvSLgNLd+LJ2w/w4E6oM3kJpK27z +POuAJ9v1pkQNn1pVWQvVDVJIxa6f8i+AxeoyUDUSly7B4f/xI4hROJ/yZlZ25w9Rl6VSDE1JUZU2 +Pb+iSwwQHYaZTKrzchGT5Or2m9qoXadNt54CrnMAyNojA+j56hl0YgCUyyIgvpSnWbWCar6ZeXqp +8kokUvd0/bpO5qgdAm6xDYBEwa7TIzdfu4V8K5Iu6H6li92Z4b8nby1dqnuH/grdS/yO9SbkbnBC +bjPsMZ57k8HkyWkaPcBrTiJt7qtYTcbQQcEr6k8Sh17rRdhs9ZgC06DYVYoGmRmioHfRMJ6szHXu +g/WwYjnPbFfiTNKRCw51KBuav/0aQ/HKd/s7j2G4aSgWQgRecCocIdiP4b0jWy10QJLZYxkNc91p +vGJHvOB0K7Lrfb5BG7XARsWhIstfTsEokt4YutUqKLsRixeTmJlglFwjz1onl14LBQaTNx47aTbr +qZ5hHY8y2o4M1nQ+ewkk2gF3R8Q7zTSMmfXK4SVhM7JZG+Ju1zdXtg2pEto= +-----END CERTIFICATE----- + +Security Communication Root CA +============================== +-----BEGIN CERTIFICATE----- +MIIDWjCCAkKgAwIBAgIBADANBgkqhkiG9w0BAQUFADBQMQswCQYDVQQGEwJKUDEYMBYGA1UEChMP +U0VDT00gVHJ1c3QubmV0MScwJQYDVQQLEx5TZWN1cml0eSBDb21tdW5pY2F0aW9uIFJvb3RDQTEw +HhcNMDMwOTMwMDQyMDQ5WhcNMjMwOTMwMDQyMDQ5WjBQMQswCQYDVQQGEwJKUDEYMBYGA1UEChMP +U0VDT00gVHJ1c3QubmV0MScwJQYDVQQLEx5TZWN1cml0eSBDb21tdW5pY2F0aW9uIFJvb3RDQTEw +ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCzs/5/022x7xZ8V6UMbXaKL0u/ZPtM7orw +8yl89f/uKuDp6bpbZCKamm8sOiZpUQWZJtzVHGpxxpp9Hp3dfGzGjGdnSj74cbAZJ6kJDKaVv0uM +DPpVmDvY6CKhS3E4eayXkmmziX7qIWgGmBSWh9JhNrxtJ1aeV+7AwFb9Ms+k2Y7CI9eNqPPYJayX +5HA49LY6tJ07lyZDo6G8SVlyTCMwhwFY9k6+HGhWZq/NQV3Is00qVUarH9oe4kA92819uZKAnDfd +DJZkndwi92SL32HeFZRSFaB9UslLqCHJxrHty8OVYNEP8Ktw+N/LTX7s1vqr2b1/VPKl6Xn62dZ2 +JChzAgMBAAGjPzA9MB0GA1UdDgQWBBSgc0mZaNyFW2XjmygvV5+9M7wHSDALBgNVHQ8EBAMCAQYw +DwYDVR0TAQH/BAUwAwEB/zANBgkqhkiG9w0BAQUFAAOCAQEAaECpqLvkT115swW1F7NgE+vGkl3g +0dNq/vu+m22/xwVtWSDEHPC32oRYAmP6SBbvT6UL90qY8j+eG61Ha2POCEfrUj94nK9NrvjVT8+a +mCoQQTlSxN3Zmw7vkwGusi7KaEIkQmywszo+zenaSMQVy+n5Bw+SUEmK3TGXX8npN6o7WWWXlDLJ +s58+OmJYxUmtYg5xpTKqL8aJdkNAExNnPaJUJRDL8Try2frbSVa7pv6nQTXD4IhhyYjH3zYQIphZ +6rBK+1YWc26sTfcioU+tHXotRSflMMFe8toTyyVCUZVHA4xsIcx0Qu1T/zOLjw9XARYvz6buyXAi +FL39vmwLAw== +-----END CERTIFICATE----- + +Sonera Class 2 Root CA +====================== +-----BEGIN CERTIFICATE----- +MIIDIDCCAgigAwIBAgIBHTANBgkqhkiG9w0BAQUFADA5MQswCQYDVQQGEwJGSTEPMA0GA1UEChMG +U29uZXJhMRkwFwYDVQQDExBTb25lcmEgQ2xhc3MyIENBMB4XDTAxMDQwNjA3Mjk0MFoXDTIxMDQw +NjA3Mjk0MFowOTELMAkGA1UEBhMCRkkxDzANBgNVBAoTBlNvbmVyYTEZMBcGA1UEAxMQU29uZXJh +IENsYXNzMiBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAJAXSjWdyvANlsdE+hY3 +/Ei9vX+ALTU74W+oZ6m/AxxNjG8yR9VBaKQTBME1DJqEQ/xcHf+Js+gXGM2RX/uJ4+q/Tl18GybT +dXnt5oTjV+WtKcT0OijnpXuENmmz/V52vaMtmdOQTiMofRhj8VQ7Jp12W5dCsv+u8E7s3TmVToMG +f+dJQMjFAbJUWmYdPfz56TwKnoG4cPABi+QjVHzIrviQHgCWctRUz2EjvOr7nQKV0ba5cTppCD8P +tOFCx4j1P5iop7oc4HFx71hXgVB6XGt0Rg6DA5jDjqhu8nYybieDwnPz3BjotJPqdURrBGAgcVeH +nfO+oJAjPYok4doh28MCAwEAAaMzMDEwDwYDVR0TAQH/BAUwAwEB/zARBgNVHQ4ECgQISqCqWITT +XjwwCwYDVR0PBAQDAgEGMA0GCSqGSIb3DQEBBQUAA4IBAQBazof5FnIVV0sd2ZvnoiYw7JNn39Yt +0jSv9zilzqsWuasvfDXLrNAPtEwr/IDva4yRXzZ299uzGxnq9LIR/WFxRL8oszodv7ND6J+/3DEI +cbCdjdY0RzKQxmUk96BKfARzjzlvF4xytb1LyHr4e4PDKE6cCepnP7JnBBvDFNr450kkkdAdavph +Oe9r5yF1BgfYErQhIHBCcYHaPJo2vqZbDWpsmh+Re/n570K6Tk6ezAyNlNzZRZxe7EJQY670XcSx +EtzKO6gunRRaBXW37Ndj4ro1tgQIkejanZz2ZrUYrAqmVCY0M9IbwdR/GjqOC6oybtv8TyWf2TLH +llpwrN9M +-----END CERTIFICATE----- + +XRamp Global CA Root +==================== +-----BEGIN CERTIFICATE----- +MIIEMDCCAxigAwIBAgIQUJRs7Bjq1ZxN1ZfvdY+grTANBgkqhkiG9w0BAQUFADCBgjELMAkGA1UE +BhMCVVMxHjAcBgNVBAsTFXd3dy54cmFtcHNlY3VyaXR5LmNvbTEkMCIGA1UEChMbWFJhbXAgU2Vj +dXJpdHkgU2VydmljZXMgSW5jMS0wKwYDVQQDEyRYUmFtcCBHbG9iYWwgQ2VydGlmaWNhdGlvbiBB +dXRob3JpdHkwHhcNMDQxMTAxMTcxNDA0WhcNMzUwMTAxMDUzNzE5WjCBgjELMAkGA1UEBhMCVVMx +HjAcBgNVBAsTFXd3dy54cmFtcHNlY3VyaXR5LmNvbTEkMCIGA1UEChMbWFJhbXAgU2VjdXJpdHkg +U2VydmljZXMgSW5jMS0wKwYDVQQDEyRYUmFtcCBHbG9iYWwgQ2VydGlmaWNhdGlvbiBBdXRob3Jp +dHkwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCYJB69FbS638eMpSe2OAtp87ZOqCwu +IR1cRN8hXX4jdP5efrRKt6atH67gBhbim1vZZ3RrXYCPKZ2GG9mcDZhtdhAoWORlsH9KmHmf4MMx +foArtYzAQDsRhtDLooY2YKTVMIJt2W7QDxIEM5dfT2Fa8OT5kavnHTu86M/0ay00fOJIYRyO82FE +zG+gSqmUsE3a56k0enI4qEHMPJQRfevIpoy3hsvKMzvZPTeL+3o+hiznc9cKV6xkmxnr9A8ECIqs +AxcZZPRaJSKNNCyy9mgdEm3Tih4U2sSPpuIjhdV6Db1q4Ons7Be7QhtnqiXtRYMh/MHJfNViPvry +xS3T/dRlAgMBAAGjgZ8wgZwwEwYJKwYBBAGCNxQCBAYeBABDAEEwCwYDVR0PBAQDAgGGMA8GA1Ud +EwEB/wQFMAMBAf8wHQYDVR0OBBYEFMZPoj0GY4QJnM5i5ASsjVy16bYbMDYGA1UdHwQvMC0wK6Ap +oCeGJWh0dHA6Ly9jcmwueHJhbXBzZWN1cml0eS5jb20vWEdDQS5jcmwwEAYJKwYBBAGCNxUBBAMC +AQEwDQYJKoZIhvcNAQEFBQADggEBAJEVOQMBG2f7Shz5CmBbodpNl2L5JFMn14JkTpAuw0kbK5rc +/Kh4ZzXxHfARvbdI4xD2Dd8/0sm2qlWkSLoC295ZLhVbO50WfUfXN+pfTXYSNrsf16GBBEYgoyxt +qZ4Bfj8pzgCT3/3JknOJiWSe5yvkHJEs0rnOfc5vMZnT5r7SHpDwCRR5XCOrTdLaIR9NmXmd4c8n +nxCbHIgNsIpkQTG4DmyQJKSbXHGPurt+HBvbaoAPIbzp26a3QPSyi6mx5O+aGtA9aZnuqCij4Tyz +8LIRnM98QObd50N9otg6tamN8jSZxNQQ4Qb9CYQQO+7ETPTsJ3xCwnR8gooJybQDJbw= +-----END CERTIFICATE----- + +Go Daddy Class 2 CA +=================== +-----BEGIN CERTIFICATE----- +MIIEADCCAuigAwIBAgIBADANBgkqhkiG9w0BAQUFADBjMQswCQYDVQQGEwJVUzEhMB8GA1UEChMY +VGhlIEdvIERhZGR5IEdyb3VwLCBJbmMuMTEwLwYDVQQLEyhHbyBEYWRkeSBDbGFzcyAyIENlcnRp +ZmljYXRpb24gQXV0aG9yaXR5MB4XDTA0MDYyOTE3MDYyMFoXDTM0MDYyOTE3MDYyMFowYzELMAkG +A1UEBhMCVVMxITAfBgNVBAoTGFRoZSBHbyBEYWRkeSBHcm91cCwgSW5jLjExMC8GA1UECxMoR28g +RGFkZHkgQ2xhc3MgMiBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCASAwDQYJKoZIhvcNAQEBBQAD +ggENADCCAQgCggEBAN6d1+pXGEmhW+vXX0iG6r7d/+TvZxz0ZWizV3GgXne77ZtJ6XCAPVYYYwhv +2vLM0D9/AlQiVBDYsoHUwHU9S3/Hd8M+eKsaA7Ugay9qK7HFiH7Eux6wwdhFJ2+qN1j3hybX2C32 +qRe3H3I2TqYXP2WYktsqbl2i/ojgC95/5Y0V4evLOtXiEqITLdiOr18SPaAIBQi2XKVlOARFmR6j +YGB0xUGlcmIbYsUfb18aQr4CUWWoriMYavx4A6lNf4DD+qta/KFApMoZFv6yyO9ecw3ud72a9nmY +vLEHZ6IVDd2gWMZEewo+YihfukEHU1jPEX44dMX4/7VpkI+EdOqXG68CAQOjgcAwgb0wHQYDVR0O +BBYEFNLEsNKR1EwRcbNhyz2h/t2oatTjMIGNBgNVHSMEgYUwgYKAFNLEsNKR1EwRcbNhyz2h/t2o +atTjoWekZTBjMQswCQYDVQQGEwJVUzEhMB8GA1UEChMYVGhlIEdvIERhZGR5IEdyb3VwLCBJbmMu +MTEwLwYDVQQLEyhHbyBEYWRkeSBDbGFzcyAyIENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggEAMAwG +A1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBADJL87LKPpH8EsahB4yOd6AzBhRckB4Y9wim +PQoZ+YeAEW5p5JYXMP80kWNyOO7MHAGjHZQopDH2esRU1/blMVgDoszOYtuURXO1v0XJJLXVggKt +I3lpjbi2Tc7PTMozI+gciKqdi0FuFskg5YmezTvacPd+mSYgFFQlq25zheabIZ0KbIIOqPjCDPoQ +HmyW74cNxA9hi63ugyuV+I6ShHI56yDqg+2DzZduCLzrTia2cyvk0/ZM/iZx4mERdEr/VxqHD3VI +Ls9RaRegAhJhldXRQLIQTO7ErBBDpqWeCtWVYpoNz4iCxTIM5CufReYNnyicsbkqWletNw+vHX/b +vZ8= +-----END CERTIFICATE----- + +Starfield Class 2 CA +==================== +-----BEGIN CERTIFICATE----- +MIIEDzCCAvegAwIBAgIBADANBgkqhkiG9w0BAQUFADBoMQswCQYDVQQGEwJVUzElMCMGA1UEChMc +U3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMpU3RhcmZpZWxkIENsYXNzIDIg +Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkwHhcNMDQwNjI5MTczOTE2WhcNMzQwNjI5MTczOTE2WjBo +MQswCQYDVQQGEwJVUzElMCMGA1UEChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAG +A1UECxMpU3RhcmZpZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEgMA0GCSqG +SIb3DQEBAQUAA4IBDQAwggEIAoIBAQC3Msj+6XGmBIWtDBFk385N78gDGIc/oav7PKaf8MOh2tTY +bitTkPskpD6E8J7oX+zlJ0T1KKY/e97gKvDIr1MvnsoFAZMej2YcOadN+lq2cwQlZut3f+dZxkqZ +JRRU6ybH838Z1TBwj6+wRir/resp7defqgSHo9T5iaU0X9tDkYI22WY8sbi5gv2cOj4QyDvvBmVm +epsZGD3/cVE8MC5fvj13c7JdBmzDI1aaK4UmkhynArPkPw2vCHmCuDY96pzTNbO8acr1zJ3o/WSN +F4Azbl5KXZnJHoe0nRrA1W4TNSNe35tfPe/W93bC6j67eA0cQmdrBNj41tpvi/JEoAGrAgEDo4HF +MIHCMB0GA1UdDgQWBBS/X7fRzt0fhvRbVazc1xDCDqmI5zCBkgYDVR0jBIGKMIGHgBS/X7fRzt0f +hvRbVazc1xDCDqmI56FspGowaDELMAkGA1UEBhMCVVMxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNo +bm9sb2dpZXMsIEluYy4xMjAwBgNVBAsTKVN0YXJmaWVsZCBDbGFzcyAyIENlcnRpZmljYXRpb24g +QXV0aG9yaXR5ggEAMAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAAWdP4id0ckaVaGs +afPzWdqbAYcaT1epoXkJKtv3L7IezMdeatiDh6GX70k1PncGQVhiv45YuApnP+yz3SFmH8lU+nLM +PUxA2IGvd56Deruix/U0F47ZEUD0/CwqTRV/p2JdLiXTAAsgGh1o+Re49L2L7ShZ3U0WixeDyLJl +xy16paq8U4Zt3VekyvggQQto8PT7dL5WXXp59fkdheMtlb71cZBDzI0fmgAKhynpVSJYACPq4xJD +KVtHCN2MQWplBqjlIapBtJUhlbl90TSrE9atvNziPTnNvT51cKEYWQPJIrSPnNVeKtelttQKbfi3 +QBFGmh95DmK/D5fs4C8fF5Q= +-----END CERTIFICATE----- + +Taiwan GRCA +=========== +-----BEGIN CERTIFICATE----- +MIIFcjCCA1qgAwIBAgIQH51ZWtcvwgZEpYAIaeNe9jANBgkqhkiG9w0BAQUFADA/MQswCQYDVQQG +EwJUVzEwMC4GA1UECgwnR292ZXJubWVudCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4X +DTAyMTIwNTEzMjMzM1oXDTMyMTIwNTEzMjMzM1owPzELMAkGA1UEBhMCVFcxMDAuBgNVBAoMJ0dv +dmVybm1lbnQgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCAiIwDQYJKoZIhvcNAQEBBQAD +ggIPADCCAgoCggIBAJoluOzMonWoe/fOW1mKydGGEghU7Jzy50b2iPN86aXfTEc2pBsBHH8eV4qN +w8XRIePaJD9IK/ufLqGU5ywck9G/GwGHU5nOp/UKIXZ3/6m3xnOUT0b3EEk3+qhZSV1qgQdW8or5 +BtD3cCJNtLdBuTK4sfCxw5w/cP1T3YGq2GN49thTbqGsaoQkclSGxtKyyhwOeYHWtXBiCAEuTk8O +1RGvqa/lmr/czIdtJuTJV6L7lvnM4T9TjGxMfptTCAtsF/tnyMKtsc2AtJfcdgEWFelq16TheEfO +htX7MfP6Mb40qij7cEwdScevLJ1tZqa2jWR+tSBqnTuBto9AAGdLiYa4zGX+FVPpBMHWXx1E1wov +J5pGfaENda1UhhXcSTvxls4Pm6Dso3pdvtUqdULle96ltqqvKKyskKw4t9VoNSZ63Pc78/1Fm9G7 +Q3hub/FCVGqY8A2tl+lSXunVanLeavcbYBT0peS2cWeqH+riTcFCQP5nRhc4L0c/cZyu5SHKYS1t +B6iEfC3uUSXxY5Ce/eFXiGvviiNtsea9P63RPZYLhY3Naye7twWb7LuRqQoHEgKXTiCQ8P8NHuJB +O9NAOueNXdpm5AKwB1KYXA6OM5zCppX7VRluTI6uSw+9wThNXo+EHWbNxWCWtFJaBYmOlXqYwZE8 +lSOyDvR5tMl8wUohAgMBAAGjajBoMB0GA1UdDgQWBBTMzO/MKWCkO7GStjz6MmKPrCUVOzAMBgNV +HRMEBTADAQH/MDkGBGcqBwAEMTAvMC0CAQAwCQYFKw4DAhoFADAHBgVnKgMAAAQUA5vwIhP/lSg2 +09yewDL7MTqKUWUwDQYJKoZIhvcNAQEFBQADggIBAECASvomyc5eMN1PhnR2WPWus4MzeKR6dBcZ +TulStbngCnRiqmjKeKBMmo4sIy7VahIkv9Ro04rQ2JyftB8M3jh+Vzj8jeJPXgyfqzvS/3WXy6Tj +Zwj/5cAWtUgBfen5Cv8b5Wppv3ghqMKnI6mGq3ZW6A4M9hPdKmaKZEk9GhiHkASfQlK3T8v+R0F2 +Ne//AHY2RTKbxkaFXeIksB7jSJaYV0eUVXoPQbFEJPPB/hprv4j9wabak2BegUqZIJxIZhm1AHlU +D7gsL0u8qV1bYH+Mh6XgUmMqvtg7hUAV/h62ZT/FS9p+tXo1KaMuephgIqP0fSdOLeq0dDzpD6Qz +DxARvBMB1uUO07+1EqLhRSPAzAhuYbeJq4PjJB7mXQfnHyA+z2fI56wwbSdLaG5LKlwCCDTb+Hbk +Z6MmnD+iMsJKxYEYMRBWqoTvLQr/uB930r+lWKBi5NdLkXWNiYCYfm3LU05er/ayl4WXudpVBrkk +7tfGOB5jGxI7leFYrPLfhNVfmS8NVVvmONsuP3LpSIXLuykTjx44VbnzssQwmSNOXfJIoRIM3BKQ +CZBUkQM8R+XVyWXgt0t97EfTsws+rZ7QdAAO671RrcDeLMDDav7v3Aun+kbfYNucpllQdSNpc5Oy ++fwC00fmcc4QAu4njIT/rEUNE1yDMuAlpYYsfPQS +-----END CERTIFICATE----- + +DigiCert Assured ID Root CA +=========================== +-----BEGIN CERTIFICATE----- +MIIDtzCCAp+gAwIBAgIQDOfg5RfYRv6P5WD8G/AwOTANBgkqhkiG9w0BAQUFADBlMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSQw +IgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgQ0EwHhcNMDYxMTEwMDAwMDAwWhcNMzEx +MTEwMDAwMDAwWjBlMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQL +ExB3d3cuZGlnaWNlcnQuY29tMSQwIgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgQ0Ew +ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCtDhXO5EOAXLGH87dg+XESpa7cJpSIqvTO +9SA5KFhgDPiA2qkVlTJhPLWxKISKityfCgyDF3qPkKyK53lTXDGEKvYPmDI2dsze3Tyoou9q+yHy +UmHfnyDXH+Kx2f4YZNISW1/5WBg1vEfNoTb5a3/UsDg+wRvDjDPZ2C8Y/igPs6eD1sNuRMBhNZYW +/lmci3Zt1/GiSw0r/wty2p5g0I6QNcZ4VYcgoc/lbQrISXwxmDNsIumH0DJaoroTghHtORedmTpy +oeb6pNnVFzF1roV9Iq4/AUaG9ih5yLHa5FcXxH4cDrC0kqZWs72yl+2qp/C3xag/lRbQ/6GW6whf +GHdPAgMBAAGjYzBhMA4GA1UdDwEB/wQEAwIBhjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRF +66Kv9JLLgjEtUYunpyGd823IDzAfBgNVHSMEGDAWgBRF66Kv9JLLgjEtUYunpyGd823IDzANBgkq +hkiG9w0BAQUFAAOCAQEAog683+Lt8ONyc3pklL/3cmbYMuRCdWKuh+vy1dneVrOfzM4UKLkNl2Bc +EkxY5NM9g0lFWJc1aRqoR+pWxnmrEthngYTffwk8lOa4JiwgvT2zKIn3X/8i4peEH+ll74fg38Fn +SbNd67IJKusm7Xi+fT8r87cmNW1fiQG2SVufAQWbqz0lwcy2f8Lxb4bG+mRo64EtlOtCt/qMHt1i +8b5QZ7dsvfPxH2sMNgcWfzd8qVttevESRmCD1ycEvkvOl77DZypoEd+A5wwzZr8TDRRu838fYxAe ++o0bJW1sj6W3YQGx0qMmoRBxna3iw/nDmVG3KwcIzi7mULKn+gpFL6Lw8g== +-----END CERTIFICATE----- + +DigiCert Global Root CA +======================= +-----BEGIN CERTIFICATE----- +MIIDrzCCApegAwIBAgIQCDvgVpBCRrGhdWrJWZHHSjANBgkqhkiG9w0BAQUFADBhMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSAw +HgYDVQQDExdEaWdpQ2VydCBHbG9iYWwgUm9vdCBDQTAeFw0wNjExMTAwMDAwMDBaFw0zMTExMTAw +MDAwMDBaMGExCzAJBgNVBAYTAlVTMRUwEwYDVQQKEwxEaWdpQ2VydCBJbmMxGTAXBgNVBAsTEHd3 +dy5kaWdpY2VydC5jb20xIDAeBgNVBAMTF0RpZ2lDZXJ0IEdsb2JhbCBSb290IENBMIIBIjANBgkq +hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA4jvhEXLeqKTTo1eqUKKPC3eQyaKl7hLOllsBCSDMAZOn +TjC3U/dDxGkAV53ijSLdhwZAAIEJzs4bg7/fzTtxRuLWZscFs3YnFo97nh6Vfe63SKMI2tavegw5 +BmV/Sl0fvBf4q77uKNd0f3p4mVmFaG5cIzJLv07A6Fpt43C/dxC//AH2hdmoRBBYMql1GNXRor5H +4idq9Joz+EkIYIvUX7Q6hL+hqkpMfT7PT19sdl6gSzeRntwi5m3OFBqOasv+zbMUZBfHWymeMr/y +7vrTC0LUq7dBMtoM1O/4gdW7jVg/tRvoSSiicNoxBN33shbyTApOB6jtSj1etX+jkMOvJwIDAQAB +o2MwYTAOBgNVHQ8BAf8EBAMCAYYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUA95QNVbRTLtm +8KPiGxvDl7I90VUwHwYDVR0jBBgwFoAUA95QNVbRTLtm8KPiGxvDl7I90VUwDQYJKoZIhvcNAQEF +BQADggEBAMucN6pIExIK+t1EnE9SsPTfrgT1eXkIoyQY/EsrhMAtudXH/vTBH1jLuG2cenTnmCmr +EbXjcKChzUyImZOMkXDiqw8cvpOp/2PV5Adg06O/nVsJ8dWO41P0jmP6P6fbtGbfYmbW0W5BjfIt +tep3Sp+dWOIrWcBAI+0tKIJFPnlUkiaY4IBIqDfv8NZ5YBberOgOzW6sRBc4L0na4UU+Krk2U886 +UAb3LujEV0lsYSEY1QSteDwsOoBrp+uvFRTp2InBuThs4pFsiv9kuXclVzDAGySj4dzp30d8tbQk +CAUw7C29C79Fv1C5qfPrmAESrciIxpg0X40KPMbp1ZWVbd4= +-----END CERTIFICATE----- + +DigiCert High Assurance EV Root CA +================================== +-----BEGIN CERTIFICATE----- +MIIDxTCCAq2gAwIBAgIQAqxcJmoLQJuPC3nyrkYldzANBgkqhkiG9w0BAQUFADBsMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSsw +KQYDVQQDEyJEaWdpQ2VydCBIaWdoIEFzc3VyYW5jZSBFViBSb290IENBMB4XDTA2MTExMDAwMDAw +MFoXDTMxMTExMDAwMDAwMFowbDELMAkGA1UEBhMCVVMxFTATBgNVBAoTDERpZ2lDZXJ0IEluYzEZ +MBcGA1UECxMQd3d3LmRpZ2ljZXJ0LmNvbTErMCkGA1UEAxMiRGlnaUNlcnQgSGlnaCBBc3N1cmFu +Y2UgRVYgUm9vdCBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAMbM5XPm+9S75S0t +Mqbf5YE/yc0lSbZxKsPVlDRnogocsF9ppkCxxLeyj9CYpKlBWTrT3JTWPNt0OKRKzE0lgvdKpVMS +OO7zSW1xkX5jtqumX8OkhPhPYlG++MXs2ziS4wblCJEMxChBVfvLWokVfnHoNb9Ncgk9vjo4UFt3 +MRuNs8ckRZqnrG0AFFoEt7oT61EKmEFBIk5lYYeBQVCmeVyJ3hlKV9Uu5l0cUyx+mM0aBhakaHPQ +NAQTXKFx01p8VdteZOE3hzBWBOURtCmAEvF5OYiiAhF8J2a3iLd48soKqDirCmTCv2ZdlYTBoSUe +h10aUAsgEsxBu24LUTi4S8sCAwEAAaNjMGEwDgYDVR0PAQH/BAQDAgGGMA8GA1UdEwEB/wQFMAMB +Af8wHQYDVR0OBBYEFLE+w2kD+L9HAdSYJhoIAu9jZCvDMB8GA1UdIwQYMBaAFLE+w2kD+L9HAdSY +JhoIAu9jZCvDMA0GCSqGSIb3DQEBBQUAA4IBAQAcGgaX3NecnzyIZgYIVyHbIUf4KmeqvxgydkAQ +V8GK83rZEWWONfqe/EW1ntlMMUu4kehDLI6zeM7b41N5cdblIZQB2lWHmiRk9opmzN6cN82oNLFp +myPInngiK3BD41VHMWEZ71jFhS9OMPagMRYjyOfiZRYzy78aG6A9+MpeizGLYAiJLQwGXFK3xPkK +mNEVX58Svnw2Yzi9RKR/5CYrCsSXaQ3pjOLAEFe4yHYSkVXySGnYvCoCWw9E1CAx2/S6cCZdkGCe +vEsXCS+0yx5DaMkHJ8HSXPfqIbloEpw8nL+e/IBcm2PN7EeqJSdnoDfzAIJ9VNep+OkuE6N36B9K +-----END CERTIFICATE----- + +Certplus Class 2 Primary CA +=========================== +-----BEGIN CERTIFICATE----- +MIIDkjCCAnqgAwIBAgIRAIW9S/PY2uNp9pTXX8OlRCMwDQYJKoZIhvcNAQEFBQAwPTELMAkGA1UE +BhMCRlIxETAPBgNVBAoTCENlcnRwbHVzMRswGQYDVQQDExJDbGFzcyAyIFByaW1hcnkgQ0EwHhcN +OTkwNzA3MTcwNTAwWhcNMTkwNzA2MjM1OTU5WjA9MQswCQYDVQQGEwJGUjERMA8GA1UEChMIQ2Vy +dHBsdXMxGzAZBgNVBAMTEkNsYXNzIDIgUHJpbWFyeSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP +ADCCAQoCggEBANxQltAS+DXSCHh6tlJw/W/uz7kRy1134ezpfgSN1sxvc0NXYKwzCkTsA18cgCSR +5aiRVhKC9+Ar9NuuYS6JEI1rbLqzAr3VNsVINyPi8Fo3UjMXEuLRYE2+L0ER4/YXJQyLkcAbmXuZ +Vg2v7tK8R1fjeUl7NIknJITesezpWE7+Tt9avkGtrAjFGA7v0lPubNCdEgETjdyAYveVqUSISnFO +YFWe2yMZeVYHDD9jC1yw4r5+FfyUM1hBOHTE4Y+L3yasH7WLO7dDWWuwJKZtkIvEcupdM5i3y95e +e++U8Rs+yskhwcWYAqqi9lt3m/V+llU0HGdpwPFC40es/CgcZlUCAwEAAaOBjDCBiTAPBgNVHRME +CDAGAQH/AgEKMAsGA1UdDwQEAwIBBjAdBgNVHQ4EFgQU43Mt38sOKAze3bOkynm4jrvoMIkwEQYJ +YIZIAYb4QgEBBAQDAgEGMDcGA1UdHwQwMC4wLKAqoCiGJmh0dHA6Ly93d3cuY2VydHBsdXMuY29t +L0NSTC9jbGFzczIuY3JsMA0GCSqGSIb3DQEBBQUAA4IBAQCnVM+IRBnL39R/AN9WM2K191EBkOvD +P9GIROkkXe/nFL0gt5o8AP5tn9uQ3Nf0YtaLcF3n5QRIqWh8yfFC82x/xXp8HVGIutIKPidd3i1R +TtMTZGnkLuPT55sJmabglZvOGtd/vjzOUrMRFcEPF80Du5wlFbqidon8BvEY0JNLDnyCt6X09l/+ +7UCmnYR0ObncHoUW2ikbhiMAybuJfm6AiB4vFLQDJKgybwOaRywwvlbGp0ICcBvqQNi6BQNwB6SW +//1IMwrh3KWBkJtN3X3n57LNXMhqlfil9o3EXXgIvnsG1knPGTZQIy4I5p4FTUcY1Rbpsda2ENW7 +l7+ijrRU +-----END CERTIFICATE----- + +DST Root CA X3 +============== +-----BEGIN CERTIFICATE----- +MIIDSjCCAjKgAwIBAgIQRK+wgNajJ7qJMDmGLvhAazANBgkqhkiG9w0BAQUFADA/MSQwIgYDVQQK +ExtEaWdpdGFsIFNpZ25hdHVyZSBUcnVzdCBDby4xFzAVBgNVBAMTDkRTVCBSb290IENBIFgzMB4X +DTAwMDkzMDIxMTIxOVoXDTIxMDkzMDE0MDExNVowPzEkMCIGA1UEChMbRGlnaXRhbCBTaWduYXR1 +cmUgVHJ1c3QgQ28uMRcwFQYDVQQDEw5EU1QgUm9vdCBDQSBYMzCCASIwDQYJKoZIhvcNAQEBBQAD +ggEPADCCAQoCggEBAN+v6ZdQCINXtMxiZfaQguzH0yxrMMpb7NnDfcdAwRgUi+DoM3ZJKuM/IUmT +rE4Orz5Iy2Xu/NMhD2XSKtkyj4zl93ewEnu1lcCJo6m67XMuegwGMoOifooUMM0RoOEqOLl5CjH9 +UL2AZd+3UWODyOKIYepLYYHsUmu5ouJLGiifSKOeDNoJjj4XLh7dIN9bxiqKqy69cK3FCxolkHRy +xXtqqzTWMIn/5WgTe1QLyNau7Fqckh49ZLOMxt+/yUFw7BZy1SbsOFU5Q9D8/RhcQPGX69Wam40d +utolucbY38EVAjqr2m7xPi71XAicPNaDaeQQmxkqtilX4+U9m5/wAl0CAwEAAaNCMEAwDwYDVR0T +AQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFMSnsaR7LHH62+FLkHX/xBVghYkQ +MA0GCSqGSIb3DQEBBQUAA4IBAQCjGiybFwBcqR7uKGY3Or+Dxz9LwwmglSBd49lZRNI+DT69ikug +dB/OEIKcdBodfpga3csTS7MgROSR6cz8faXbauX+5v3gTt23ADq1cEmv8uXrAvHRAosZy5Q6XkjE +GB5YGV8eAlrwDPGxrancWYaLbumR9YbK+rlmM6pZW87ipxZzR8srzJmwN0jP41ZL9c8PDHIyh8bw +RLtTcm1D9SZImlJnt1ir/md2cXjbDaJWFBM5JDGFoqgCWjBH4d1QB7wCCZAA62RjYJsWvIjJEubS +fZGL+T0yjWW06XyxV3bqxbYoOb8VZRzI9neWagqNdwvYkQsEjgfbKbYK7p2CNTUQ +-----END CERTIFICATE----- + +SwissSign Gold CA - G2 +====================== +-----BEGIN CERTIFICATE----- +MIIFujCCA6KgAwIBAgIJALtAHEP1Xk+wMA0GCSqGSIb3DQEBBQUAMEUxCzAJBgNVBAYTAkNIMRUw +EwYDVQQKEwxTd2lzc1NpZ24gQUcxHzAdBgNVBAMTFlN3aXNzU2lnbiBHb2xkIENBIC0gRzIwHhcN +MDYxMDI1MDgzMDM1WhcNMzYxMDI1MDgzMDM1WjBFMQswCQYDVQQGEwJDSDEVMBMGA1UEChMMU3dp +c3NTaWduIEFHMR8wHQYDVQQDExZTd2lzc1NpZ24gR29sZCBDQSAtIEcyMIICIjANBgkqhkiG9w0B +AQEFAAOCAg8AMIICCgKCAgEAr+TufoskDhJuqVAtFkQ7kpJcyrhdhJJCEyq8ZVeCQD5XJM1QiyUq +t2/876LQwB8CJEoTlo8jE+YoWACjR8cGp4QjK7u9lit/VcyLwVcfDmJlD909Vopz2q5+bbqBHH5C +jCA12UNNhPqE21Is8w4ndwtrvxEvcnifLtg+5hg3Wipy+dpikJKVyh+c6bM8K8vzARO/Ws/BtQpg +vd21mWRTuKCWs2/iJneRjOBiEAKfNA+k1ZIzUd6+jbqEemA8atufK+ze3gE/bk3lUIbLtK/tREDF +ylqM2tIrfKjuvqblCqoOpd8FUrdVxyJdMmqXl2MT28nbeTZ7hTpKxVKJ+STnnXepgv9VHKVxaSvR +AiTysybUa9oEVeXBCsdtMDeQKuSeFDNeFhdVxVu1yzSJkvGdJo+hB9TGsnhQ2wwMC3wLjEHXuend +jIj3o02yMszYF9rNt85mndT9Xv+9lz4pded+p2JYryU0pUHHPbwNUMoDAw8IWh+Vc3hiv69yFGkO +peUDDniOJihC8AcLYiAQZzlG+qkDzAQ4embvIIO1jEpWjpEA/I5cgt6IoMPiaG59je883WX0XaxR +7ySArqpWl2/5rX3aYT+YdzylkbYcjCbaZaIJbcHiVOO5ykxMgI93e2CaHt+28kgeDrpOVG2Y4OGi +GqJ3UM/EY5LsRxmd6+ZrzsECAwEAAaOBrDCBqTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUw +AwEB/zAdBgNVHQ4EFgQUWyV7lqRlUX64OfPAeGZe6Drn8O4wHwYDVR0jBBgwFoAUWyV7lqRlUX64 +OfPAeGZe6Drn8O4wRgYDVR0gBD8wPTA7BglghXQBWQECAQEwLjAsBggrBgEFBQcCARYgaHR0cDov +L3JlcG9zaXRvcnkuc3dpc3NzaWduLmNvbS8wDQYJKoZIhvcNAQEFBQADggIBACe645R88a7A3hfm +5djV9VSwg/S7zV4Fe0+fdWavPOhWfvxyeDgD2StiGwC5+OlgzczOUYrHUDFu4Up+GC9pWbY9ZIEr +44OE5iKHjn3g7gKZYbge9LgriBIWhMIxkziWMaa5O1M/wySTVltpkuzFwbs4AOPsF6m43Md8AYOf +Mke6UiI0HTJ6CVanfCU2qT1L2sCCbwq7EsiHSycR+R4tx5M/nttfJmtS2S6K8RTGRI0Vqbe/vd6m +Gu6uLftIdxf+u+yvGPUqUfA5hJeVbG4bwyvEdGB5JbAKJ9/fXtI5z0V9QkvfsywexcZdylU6oJxp +mo/a77KwPJ+HbBIrZXAVUjEaJM9vMSNQH4xPjyPDdEFjHFWoFN0+4FFQz/EbMFYOkrCChdiDyyJk +vC24JdVUorgG6q2SpCSgwYa1ShNqR88uC1aVVMvOmttqtKay20EIhid392qgQmwLOM7XdVAyksLf +KzAiSNDVQTglXaTpXZ/GlHXQRf0wl0OPkKsKx4ZzYEppLd6leNcG2mqeSz53OiATIgHQv2ieY2Br +NU0LbbqhPcCT4H8js1WtciVORvnSFu+wZMEBnunKoGqYDs/YYPIvSbjkQuE4NRb0yG5P94FW6Lqj +viOvrv1vA+ACOzB2+httQc8Bsem4yWb02ybzOqR08kkkW8mw0FfB+j564ZfJ +-----END CERTIFICATE----- + +SwissSign Silver CA - G2 +======================== +-----BEGIN CERTIFICATE----- +MIIFvTCCA6WgAwIBAgIITxvUL1S7L0swDQYJKoZIhvcNAQEFBQAwRzELMAkGA1UEBhMCQ0gxFTAT +BgNVBAoTDFN3aXNzU2lnbiBBRzEhMB8GA1UEAxMYU3dpc3NTaWduIFNpbHZlciBDQSAtIEcyMB4X +DTA2MTAyNTA4MzI0NloXDTM2MTAyNTA4MzI0NlowRzELMAkGA1UEBhMCQ0gxFTATBgNVBAoTDFN3 +aXNzU2lnbiBBRzEhMB8GA1UEAxMYU3dpc3NTaWduIFNpbHZlciBDQSAtIEcyMIICIjANBgkqhkiG +9w0BAQEFAAOCAg8AMIICCgKCAgEAxPGHf9N4Mfc4yfjDmUO8x/e8N+dOcbpLj6VzHVxumK4DV644 +N0MvFz0fyM5oEMF4rhkDKxD6LHmD9ui5aLlV8gREpzn5/ASLHvGiTSf5YXu6t+WiE7brYT7QbNHm ++/pe7R20nqA1W6GSy/BJkv6FCgU+5tkL4k+73JU3/JHpMjUi0R86TieFnbAVlDLaYQ1HTWBCrpJH +6INaUFjpiou5XaHc3ZlKHzZnu0jkg7Y360g6rw9njxcH6ATK72oxh9TAtvmUcXtnZLi2kUpCe2Uu +MGoM9ZDulebyzYLs2aFK7PayS+VFheZteJMELpyCbTapxDFkH4aDCyr0NQp4yVXPQbBH6TCfmb5h +qAaEuSh6XzjZG6k4sIN/c8HDO0gqgg8hm7jMqDXDhBuDsz6+pJVpATqJAHgE2cn0mRmrVn5bi4Y5 +FZGkECwJMoBgs5PAKrYYC51+jUnyEEp/+dVGLxmSo5mnJqy7jDzmDrxHB9xzUfFwZC8I+bRHHTBs +ROopN4WSaGa8gzj+ezku01DwH/teYLappvonQfGbGHLy9YR0SslnxFSuSGTfjNFusB3hB48IHpmc +celM2KX3RxIfdNFRnobzwqIjQAtz20um53MGjMGg6cFZrEb65i/4z3GcRm25xBWNOHkDRUjvxF3X +CO6HOSKGsg0PWEP3calILv3q1h8CAwEAAaOBrDCBqTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/ +BAUwAwEB/zAdBgNVHQ4EFgQUF6DNweRBtjpbO8tFnb0cwpj6hlgwHwYDVR0jBBgwFoAUF6DNweRB +tjpbO8tFnb0cwpj6hlgwRgYDVR0gBD8wPTA7BglghXQBWQEDAQEwLjAsBggrBgEFBQcCARYgaHR0 +cDovL3JlcG9zaXRvcnkuc3dpc3NzaWduLmNvbS8wDQYJKoZIhvcNAQEFBQADggIBAHPGgeAn0i0P +4JUw4ppBf1AsX19iYamGamkYDHRJ1l2E6kFSGG9YrVBWIGrGvShpWJHckRE1qTodvBqlYJ7YH39F +kWnZfrt4csEGDyrOj4VwYaygzQu4OSlWhDJOhrs9xCrZ1x9y7v5RoSJBsXECYxqCsGKrXlcSH9/L +3XWgwF15kIwb4FDm3jH+mHtwX6WQ2K34ArZv02DdQEsixT2tOnqfGhpHkXkzuoLcMmkDlm4fS/Bx +/uNncqCxv1yL5PqZIseEuRuNI5c/7SXgz2W79WEE790eslpBIlqhn10s6FvJbakMDHiqYMZWjwFa +DGi8aRl5xB9+lwW/xekkUV7U1UtT7dkjWjYDZaPBA61BMPNGG4WQr2W11bHkFlt4dR2Xem1ZqSqP +e97Dh4kQmUlzeMg9vVE1dCrV8X5pGyq7O70luJpaPXJhkGaH7gzWTdQRdAtq/gsD/KNVV4n+Ssuu +WxcFyPKNIzFTONItaj+CuY0IavdeQXRuwxF+B6wpYJE/OMpXEA29MC/HpeZBoNquBYeaoKRlbEwJ +DIm6uNO5wJOKMPqN5ZprFQFOZ6raYlY+hAhm0sQ2fac+EPyI4NSA5QC9qvNOBqN6avlicuMJT+ub +DgEj8Z+7fNzcbBGXJbLytGMU0gYqZ4yD9c7qB9iaah7s5Aq7KkzrCWA5zspi2C5u +-----END CERTIFICATE----- + +GeoTrust Primary Certification Authority +======================================== +-----BEGIN CERTIFICATE----- +MIIDfDCCAmSgAwIBAgIQGKy1av1pthU6Y2yv2vrEoTANBgkqhkiG9w0BAQUFADBYMQswCQYDVQQG +EwJVUzEWMBQGA1UEChMNR2VvVHJ1c3QgSW5jLjExMC8GA1UEAxMoR2VvVHJ1c3QgUHJpbWFyeSBD +ZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wNjExMjcwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMFgx +CzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTEwLwYDVQQDEyhHZW9UcnVzdCBQ +cmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB +CgKCAQEAvrgVe//UfH1nrYNke8hCUy3f9oQIIGHWAVlqnEQRr+92/ZV+zmEwu3qDXwK9AWbK7hWN +b6EwnL2hhZ6UOvNWiAAxz9juapYC2e0DjPt1befquFUWBRaa9OBesYjAZIVcFU2Ix7e64HXprQU9 +nceJSOC7KMgD4TCTZF5SwFlwIjVXiIrxlQqD17wxcwE07e9GceBrAqg1cmuXm2bgyxx5X9gaBGge +RwLmnWDiNpcB3841kt++Z8dtd1k7j53WkBWUvEI0EME5+bEnPn7WinXFsq+W06Lem+SYvn3h6YGt +tm/81w7a4DSwDRp35+MImO9Y+pyEtzavwt+s0vQQBnBxNQIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQULNVQQZcVi/CPNmFbSvtr2ZnJM5IwDQYJKoZI +hvcNAQEFBQADggEBAFpwfyzdtzRP9YZRqSa+S7iq8XEN3GHHoOo0Hnp3DwQ16CePbJC/kRYkRj5K +Ts4rFtULUh38H2eiAkUxT87z+gOneZ1TatnaYzr4gNfTmeGl4b7UVXGYNTq+k+qurUKykG/g/CFN +NWMziUnWm07Kx+dOCQD32sfvmWKZd7aVIl6KoKv0uHiYyjgZmclynnjNS6yvGaBzEi38wkG6gZHa +Floxt/m0cYASSJlyc1pZU8FjUjPtp8nSOQJw+uCxQmYpqptR7TBUIhRf2asdweSU8Pj1K/fqynhG +1riR/aYNKxoUAT6A8EKglQdebc3MS6RFjasS6LPeWuWgfOgPIh1a6Vk= +-----END CERTIFICATE----- + +thawte Primary Root CA +====================== +-----BEGIN CERTIFICATE----- +MIIEIDCCAwigAwIBAgIQNE7VVyDV7exJ9C/ON9srbTANBgkqhkiG9w0BAQUFADCBqTELMAkGA1UE +BhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2 +aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMvKGMpIDIwMDYgdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhv +cml6ZWQgdXNlIG9ubHkxHzAdBgNVBAMTFnRoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EwHhcNMDYxMTE3 +MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCBqTELMAkGA1UEBhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwg +SW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMv +KGMpIDIwMDYgdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxHzAdBgNVBAMT +FnRoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCs +oPD7gFnUnMekz52hWXMJEEUMDSxuaPFsW0hoSVk3/AszGcJ3f8wQLZU0HObrTQmnHNK4yZc2AreJ +1CRfBsDMRJSUjQJib+ta3RGNKJpchJAQeg29dGYvajig4tVUROsdB58Hum/u6f1OCyn1PoSgAfGc +q/gcfomk6KHYcWUNo1F77rzSImANuVud37r8UVsLr5iy6S7pBOhih94ryNdOwUxkHt3Ph1i6Sk/K +aAcdHJ1KxtUvkcx8cXIcxcBn6zL9yZJclNqFwJu/U30rCfSMnZEfl2pSy94JNqR32HuHUETVPm4p +afs5SSYeCaWAe0At6+gnhcn+Yf1+5nyXHdWdAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYD +VR0PAQH/BAQDAgEGMB0GA1UdDgQWBBR7W0XPr87Lev0xkhpqtvNG61dIUDANBgkqhkiG9w0BAQUF +AAOCAQEAeRHAS7ORtvzw6WfUDW5FvlXok9LOAz/t2iWwHVfLHjp2oEzsUHboZHIMpKnxuIvW1oeE +uzLlQRHAd9mzYJ3rG9XRbkREqaYB7FViHXe4XI5ISXycO1cRrK1zN44veFyQaEfZYGDm/Ac9IiAX +xPcW6cTYcvnIc3zfFi8VqT79aie2oetaupgf1eNNZAqdE8hhuvU5HIe6uL17In/2/qxAeeWsEG89 +jxt5dovEN7MhGITlNgDrYyCZuen+MwS7QcjBAvlEYyCegc5C09Y/LHbTY5xZ3Y+m4Q6gLkH3LpVH +z7z9M/P2C2F+fpErgUfCJzDupxBdN49cOSvkBPB7jVaMaA== +-----END CERTIFICATE----- + +VeriSign Class 3 Public Primary Certification Authority - G5 +============================================================ +-----BEGIN CERTIFICATE----- +MIIE0zCCA7ugAwIBAgIQGNrRniZ96LtKIVjNzGs7SjANBgkqhkiG9w0BAQUFADCByjELMAkGA1UE +BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO +ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk +IHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRp +ZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwHhcNMDYxMTA4MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCB +yjELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2ln +biBUcnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBh +dXRob3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmlt +YXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw +ggEKAoIBAQCvJAgIKXo1nmAMqudLO07cfLw8RRy7K+D+KQL5VwijZIUVJ/XxrcgxiV0i6CqqpkKz +j/i5Vbext0uz/o9+B1fs70PbZmIVYc9gDaTY3vjgw2IIPVQT60nKWVSFJuUrjxuf6/WhkcIzSdhD +Y2pSS9KP6HBRTdGJaXvHcPaz3BJ023tdS1bTlr8Vd6Gw9KIl8q8ckmcY5fQGBO+QueQA5N06tRn/ +Arr0PO7gi+s3i+z016zy9vA9r911kTMZHRxAy3QkGSGT2RT+rCpSx4/VBEnkjWNHiDxpg8v+R70r +fk/Fla4OndTRQ8Bnc+MUCH7lP59zuDMKz10/NIeWiu5T6CUVAgMBAAGjgbIwga8wDwYDVR0TAQH/ +BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2Uv +Z2lmMCEwHzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVy +aXNpZ24uY29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFH/TZafC3ey78DAJ80M5+gKvMzEzMA0GCSqG +SIb3DQEBBQUAA4IBAQCTJEowX2LP2BqYLz3q3JktvXf2pXkiOOzEp6B4Eq1iDkVwZMXnl2YtmAl+ +X6/WzChl8gGqCBpH3vn5fJJaCGkgDdk+bW48DW7Y5gaRQBi5+MHt39tBquCWIMnNZBU4gcmU7qKE +KQsTb47bDN0lAtukixlE0kF6BWlKWE9gyn6CagsCqiUXObXbf+eEZSqVir2G3l6BFoMtEMze/aiC +Km0oHw0LxOXnGiYZ4fQRbxC1lfznQgUy286dUV4otp6F01vvpX1FQHKOtw5rDgb7MzVIcbidJ4vE +ZV8NhnacRHr2lVz2XTIIM6RUthg/aFzyQkqFOFSDX9HoLPKsEdao7WNq +-----END CERTIFICATE----- + +SecureTrust CA +============== +-----BEGIN CERTIFICATE----- +MIIDuDCCAqCgAwIBAgIQDPCOXAgWpa1Cf/DrJxhZ0DANBgkqhkiG9w0BAQUFADBIMQswCQYDVQQG +EwJVUzEgMB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xFzAVBgNVBAMTDlNlY3VyZVRy +dXN0IENBMB4XDTA2MTEwNzE5MzExOFoXDTI5MTIzMTE5NDA1NVowSDELMAkGA1UEBhMCVVMxIDAe +BgNVBAoTF1NlY3VyZVRydXN0IENvcnBvcmF0aW9uMRcwFQYDVQQDEw5TZWN1cmVUcnVzdCBDQTCC +ASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKukgeWVzfX2FI7CT8rU4niVWJxB4Q2ZQCQX +OZEzZum+4YOvYlyJ0fwkW2Gz4BERQRwdbvC4u/jep4G6pkjGnx29vo6pQT64lO0pGtSO0gMdA+9t +DWccV9cGrcrI9f4Or2YlSASWC12juhbDCE/RRvgUXPLIXgGZbf2IzIaowW8xQmxSPmjL8xk037uH +GFaAJsTQ3MBv396gwpEWoGQRS0S8Hvbn+mPeZqx2pHGj7DaUaHp3pLHnDi+BeuK1cobvomuL8A/b +01k/unK8RCSc43Oz969XL0Imnal0ugBS8kvNU3xHCzaFDmapCJcWNFfBZveA4+1wVMeT4C4oFVmH +ursCAwEAAaOBnTCBmjATBgkrBgEEAYI3FAIEBh4EAEMAQTALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/ +BAUwAwEB/zAdBgNVHQ4EFgQUQjK2FvoE/f5dS3rD/fdMQB1aQ68wNAYDVR0fBC0wKzApoCegJYYj +aHR0cDovL2NybC5zZWN1cmV0cnVzdC5jb20vU1RDQS5jcmwwEAYJKwYBBAGCNxUBBAMCAQAwDQYJ +KoZIhvcNAQEFBQADggEBADDtT0rhWDpSclu1pqNlGKa7UTt36Z3q059c4EVlew3KW+JwULKUBRSu +SceNQQcSc5R+DCMh/bwQf2AQWnL1mA6s7Ll/3XpvXdMc9P+IBWlCqQVxyLesJugutIxq/3HcuLHf +mbx8IVQr5Fiiu1cprp6poxkmD5kuCLDv/WnPmRoJjeOnnyvJNjR7JLN4TJUXpAYmHrZkUjZfYGfZ +nMUFdAvnZyPSCPyI6a6Lf+Ew9Dd+/cYy2i2eRDAwbO4H3tI0/NL/QPZL9GZGBlSm8jIKYyYwa5vR +3ItHuuG51WLQoqD0ZwV4KWMabwTW+MZMo5qxN7SN5ShLHZ4swrhovO0C7jE= +-----END CERTIFICATE----- + +Secure Global CA +================ +-----BEGIN CERTIFICATE----- +MIIDvDCCAqSgAwIBAgIQB1YipOjUiolN9BPI8PjqpTANBgkqhkiG9w0BAQUFADBKMQswCQYDVQQG +EwJVUzEgMB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xGTAXBgNVBAMTEFNlY3VyZSBH +bG9iYWwgQ0EwHhcNMDYxMTA3MTk0MjI4WhcNMjkxMjMxMTk1MjA2WjBKMQswCQYDVQQGEwJVUzEg +MB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xGTAXBgNVBAMTEFNlY3VyZSBHbG9iYWwg +Q0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCvNS7YrGxVaQZx5RNoJLNP2MwhR/jx +YDiJiQPpvepeRlMJ3Fz1Wuj3RSoC6zFh1ykzTM7HfAo3fg+6MpjhHZevj8fcyTiW89sa/FHtaMbQ +bqR8JNGuQsiWUGMu4P51/pinX0kuleM5M2SOHqRfkNJnPLLZ/kG5VacJjnIFHovdRIWCQtBJwB1g +8NEXLJXr9qXBkqPFwqcIYA1gBBCWeZ4WNOaptvolRTnIHmX5k/Wq8VLcmZg9pYYaDDUz+kulBAYV +HDGA76oYa8J719rO+TMg1fW9ajMtgQT7sFzUnKPiXB3jqUJ1XnvUd+85VLrJChgbEplJL4hL/VBi +0XPnj3pDAgMBAAGjgZ0wgZowEwYJKwYBBAGCNxQCBAYeBABDAEEwCwYDVR0PBAQDAgGGMA8GA1Ud +EwEB/wQFMAMBAf8wHQYDVR0OBBYEFK9EBMJBfkiD2045AuzshHrmzsmkMDQGA1UdHwQtMCswKaAn +oCWGI2h0dHA6Ly9jcmwuc2VjdXJldHJ1c3QuY29tL1NHQ0EuY3JsMBAGCSsGAQQBgjcVAQQDAgEA +MA0GCSqGSIb3DQEBBQUAA4IBAQBjGghAfaReUw132HquHw0LURYD7xh8yOOvaliTFGCRsoTciE6+ +OYo68+aCiV0BN7OrJKQVDpI1WkpEXk5X+nXOH0jOZvQ8QCaSmGwb7iRGDBezUqXbpZGRzzfTb+cn +CDpOGR86p1hcF895P4vkp9MmI50mD1hp/Ed+stCNi5O/KU9DaXR2Z0vPB4zmAve14bRDtUstFJ/5 +3CYNv6ZHdAbYiNE6KTCEztI5gGIbqMdXSbxqVVFnFUq+NQfk1XWYN3kwFNspnWzFacxHVaIw98xc +f8LDmBxrThaA63p4ZUWiABqvDA1VZDRIuJK58bRQKfJPIx/abKwfROHdI3hRW8cW +-----END CERTIFICATE----- + +COMODO Certification Authority +============================== +-----BEGIN CERTIFICATE----- +MIIEHTCCAwWgAwIBAgIQToEtioJl4AsC7j41AkblPTANBgkqhkiG9w0BAQUFADCBgTELMAkGA1UE +BhMCR0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgG +A1UEChMRQ09NT0RPIENBIExpbWl0ZWQxJzAlBgNVBAMTHkNPTU9ETyBDZXJ0aWZpY2F0aW9uIEF1 +dGhvcml0eTAeFw0wNjEyMDEwMDAwMDBaFw0yOTEyMzEyMzU5NTlaMIGBMQswCQYDVQQGEwJHQjEb +MBkGA1UECBMSR3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHEwdTYWxmb3JkMRowGAYDVQQKExFD +T01PRE8gQ0EgTGltaXRlZDEnMCUGA1UEAxMeQ09NT0RPIENlcnRpZmljYXRpb24gQXV0aG9yaXR5 +MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA0ECLi3LjkRv3UcEbVASY06m/weaKXTuH ++7uIzg3jLz8GlvCiKVCZrts7oVewdFFxze1CkU1B/qnI2GqGd0S7WWaXUF601CxwRM/aN5VCaTww +xHGzUvAhTaHYujl8HJ6jJJ3ygxaYqhZ8Q5sVW7euNJH+1GImGEaaP+vB+fGQV+useg2L23IwambV +4EajcNxo2f8ESIl33rXp+2dtQem8Ob0y2WIC8bGoPW43nOIv4tOiJovGuFVDiOEjPqXSJDlqR6sA +1KGzqSX+DT+nHbrTUcELpNqsOO9VUCQFZUaTNE8tja3G1CEZ0o7KBWFxB3NH5YoZEr0ETc5OnKVI +rLsm9wIDAQABo4GOMIGLMB0GA1UdDgQWBBQLWOWLxkwVN6RAqTCpIb5HNlpW/zAOBgNVHQ8BAf8E +BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zBJBgNVHR8EQjBAMD6gPKA6hjhodHRwOi8vY3JsLmNvbW9k +b2NhLmNvbS9DT01PRE9DZXJ0aWZpY2F0aW9uQXV0aG9yaXR5LmNybDANBgkqhkiG9w0BAQUFAAOC +AQEAPpiem/Yb6dc5t3iuHXIYSdOH5EOC6z/JqvWote9VfCFSZfnVDeFs9D6Mk3ORLgLETgdxb8CP +OGEIqB6BCsAvIC9Bi5HcSEW88cbeunZrM8gALTFGTO3nnc+IlP8zwFboJIYmuNg4ON8qa90SzMc/ +RxdMosIGlgnW2/4/PEZB31jiVg88O8EckzXZOFKs7sjsLjBOlDW0JB9LeGna8gI4zJVSk/BwJVmc +IGfE7vmLV2H0knZ9P4SNVbfo5azV8fUZVqZa+5Acr5Pr5RzUZ5ddBA6+C4OmF4O5MBKgxTMVBbkN ++8cFduPYSo38NBejxiEovjBFMR7HeL5YYTisO+IBZQ== +-----END CERTIFICATE----- + +Network Solutions Certificate Authority +======================================= +-----BEGIN CERTIFICATE----- +MIID5jCCAs6gAwIBAgIQV8szb8JcFuZHFhfjkDFo4DANBgkqhkiG9w0BAQUFADBiMQswCQYDVQQG +EwJVUzEhMB8GA1UEChMYTmV0d29yayBTb2x1dGlvbnMgTC5MLkMuMTAwLgYDVQQDEydOZXR3b3Jr +IFNvbHV0aW9ucyBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwHhcNMDYxMjAxMDAwMDAwWhcNMjkxMjMx +MjM1OTU5WjBiMQswCQYDVQQGEwJVUzEhMB8GA1UEChMYTmV0d29yayBTb2x1dGlvbnMgTC5MLkMu +MTAwLgYDVQQDEydOZXR3b3JrIFNvbHV0aW9ucyBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwggEiMA0G +CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDkvH6SMG3G2I4rC7xGzuAnlt7e+foS0zwzc7MEL7xx +jOWftiJgPl9dzgn/ggwbmlFQGiaJ3dVhXRncEg8tCqJDXRfQNJIg6nPPOCwGJgl6cvf6UDL4wpPT +aaIjzkGxzOTVHzbRijr4jGPiFFlp7Q3Tf2vouAPlT2rlmGNpSAW+Lv8ztumXWWn4Zxmuk2GWRBXT +crA/vGp97Eh/jcOrqnErU2lBUzS1sLnFBgrEsEX1QV1uiUV7PTsmjHTC5dLRfbIR1PtYMiKagMnc +/Qzpf14Dl847ABSHJ3A4qY5usyd2mFHgBeMhqxrVhSI8KbWaFsWAqPS7azCPL0YCorEMIuDTAgMB +AAGjgZcwgZQwHQYDVR0OBBYEFCEwyfsA106Y2oeqKtCnLrFAMadMMA4GA1UdDwEB/wQEAwIBBjAP +BgNVHRMBAf8EBTADAQH/MFIGA1UdHwRLMEkwR6BFoEOGQWh0dHA6Ly9jcmwubmV0c29sc3NsLmNv +bS9OZXR3b3JrU29sdXRpb25zQ2VydGlmaWNhdGVBdXRob3JpdHkuY3JsMA0GCSqGSIb3DQEBBQUA +A4IBAQC7rkvnt1frf6ott3NHhWrB5KUd5Oc86fRZZXe1eltajSU24HqXLjjAV2CDmAaDn7l2em5Q +4LqILPxFzBiwmZVRDuwduIj/h1AcgsLj4DKAv6ALR8jDMe+ZZzKATxcheQxpXN5eNK4CtSbqUN9/ +GGUsyfJj4akH/nxxH2szJGoeBfcFaMBqEssuXmHLrijTfsK0ZpEmXzwuJF/LWA/rKOyvEZbz3Htv +wKeI8lN3s2Berq4o2jUsbzRF0ybh3uxbTydrFny9RAQYgrOJeRcQcT16ohZO9QHNpGxlaKFJdlxD +ydi8NmdspZS11My5vWo1ViHe2MPr+8ukYEywVaCge1ey +-----END CERTIFICATE----- + +COMODO ECC Certification Authority +================================== +-----BEGIN CERTIFICATE----- +MIICiTCCAg+gAwIBAgIQH0evqmIAcFBUTAGem2OZKjAKBggqhkjOPQQDAzCBhTELMAkGA1UEBhMC +R0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgGA1UE +ChMRQ09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBFQ0MgQ2VydGlmaWNhdGlvbiBB +dXRob3JpdHkwHhcNMDgwMzA2MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCBhTELMAkGA1UEBhMCR0Ix +GzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgGA1UEChMR +Q09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBFQ0MgQ2VydGlmaWNhdGlvbiBBdXRo +b3JpdHkwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQDR3svdcmCFYX7deSRFtSrYpn1PlILBs5BAH+X +4QokPB0BBO490o0JlwzgdeT6+3eKKvUDYEs2ixYjFq0JcfRK9ChQtP6IHG4/bC8vCVlbpVsLM5ni +wz2J+Wos77LTBumjQjBAMB0GA1UdDgQWBBR1cacZSBm8nZ3qQUfflMRId5nTeTAOBgNVHQ8BAf8E +BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAKBggqhkjOPQQDAwNoADBlAjEA7wNbeqy3eApyt4jf/7VG +FAkK+qDmfQjGGoe9GKhzvSbKYAydzpmfz1wPMOG+FDHqAjAU9JM8SaczepBGR7NjfRObTrdvGDeA +U/7dIOA1mjbRxwG55tzd8/8dLDoWV9mSOdY= +-----END CERTIFICATE----- + +OISTE WISeKey Global Root GA CA +=============================== +-----BEGIN CERTIFICATE----- +MIID8TCCAtmgAwIBAgIQQT1yx/RrH4FDffHSKFTfmjANBgkqhkiG9w0BAQUFADCBijELMAkGA1UE +BhMCQ0gxEDAOBgNVBAoTB1dJU2VLZXkxGzAZBgNVBAsTEkNvcHlyaWdodCAoYykgMjAwNTEiMCAG +A1UECxMZT0lTVEUgRm91bmRhdGlvbiBFbmRvcnNlZDEoMCYGA1UEAxMfT0lTVEUgV0lTZUtleSBH +bG9iYWwgUm9vdCBHQSBDQTAeFw0wNTEyMTExNjAzNDRaFw0zNzEyMTExNjA5NTFaMIGKMQswCQYD +VQQGEwJDSDEQMA4GA1UEChMHV0lTZUtleTEbMBkGA1UECxMSQ29weXJpZ2h0IChjKSAyMDA1MSIw +IAYDVQQLExlPSVNURSBGb3VuZGF0aW9uIEVuZG9yc2VkMSgwJgYDVQQDEx9PSVNURSBXSVNlS2V5 +IEdsb2JhbCBSb290IEdBIENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAy0+zAJs9 +Nt350UlqaxBJH+zYK7LG+DKBKUOVTJoZIyEVRd7jyBxRVVuuk+g3/ytr6dTqvirdqFEr12bDYVxg +Asj1znJ7O7jyTmUIms2kahnBAbtzptf2w93NvKSLtZlhuAGio9RN1AU9ka34tAhxZK9w8RxrfvbD +d50kc3vkDIzh2TbhmYsFmQvtRTEJysIA2/dyoJaqlYfQjse2YXMNdmaM3Bu0Y6Kff5MTMPGhJ9vZ +/yxViJGg4E8HsChWjBgbl0SOid3gF27nKu+POQoxhILYQBRJLnpB5Kf+42TMwVlxSywhp1t94B3R +LoGbw9ho972WG6xwsRYUC9tguSYBBQIDAQABo1EwTzALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/BAUw +AwEB/zAdBgNVHQ4EFgQUswN+rja8sHnR3JQmthG+IbJphpQwEAYJKwYBBAGCNxUBBAMCAQAwDQYJ +KoZIhvcNAQEFBQADggEBAEuh/wuHbrP5wUOxSPMowB0uyQlB+pQAHKSkq0lPjz0e701vvbyk9vIm +MMkQyh2I+3QZH4VFvbBsUfk2ftv1TDI6QU9bR8/oCy22xBmddMVHxjtqD6wU2zz0c5ypBd8A3HR4 ++vg1YFkCExh8vPtNsCBtQ7tgMHpnM1zFmdH4LTlSc/uMqpclXHLZCB6rTjzjgTGfA6b7wP4piFXa +hNVQA7bihKOmNqoROgHhGEvWRGizPflTdISzRpFGlgC3gCy24eMQ4tui5yiPAZZiFj4A4xylNoEY +okxSdsARo27mHbrjWr42U8U+dY+GaSlYU7Wcu2+fXMUY7N0v4ZjJ/L7fCg0= +-----END CERTIFICATE----- + +Certigna +======== +-----BEGIN CERTIFICATE----- +MIIDqDCCApCgAwIBAgIJAP7c4wEPyUj/MA0GCSqGSIb3DQEBBQUAMDQxCzAJBgNVBAYTAkZSMRIw +EAYDVQQKDAlEaGlteW90aXMxETAPBgNVBAMMCENlcnRpZ25hMB4XDTA3MDYyOTE1MTMwNVoXDTI3 +MDYyOTE1MTMwNVowNDELMAkGA1UEBhMCRlIxEjAQBgNVBAoMCURoaW15b3RpczERMA8GA1UEAwwI +Q2VydGlnbmEwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDIaPHJ1tazNHUmgh7stL7q +XOEm7RFHYeGifBZ4QCHkYJ5ayGPhxLGWkv8YbWkj4Sti993iNi+RB7lIzw7sebYs5zRLcAglozyH +GxnygQcPOJAZ0xH+hrTy0V4eHpbNgGzOOzGTtvKg0KmVEn2lmsxryIRWijOp5yIVUxbwzBfsV1/p +ogqYCd7jX5xv3EjjhQsVWqa6n6xI4wmy9/Qy3l40vhx4XUJbzg4ij02Q130yGLMLLGq/jj8UEYkg +DncUtT2UCIf3JR7VsmAA7G8qKCVuKj4YYxclPz5EIBb2JsglrgVKtOdjLPOMFlN+XPsRGgjBRmKf +Irjxwo1p3Po6WAbfAgMBAAGjgbwwgbkwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUGu3+QTmQ +tCRZvgHyUtVF9lo53BEwZAYDVR0jBF0wW4AUGu3+QTmQtCRZvgHyUtVF9lo53BGhOKQ2MDQxCzAJ +BgNVBAYTAkZSMRIwEAYDVQQKDAlEaGlteW90aXMxETAPBgNVBAMMCENlcnRpZ25hggkA/tzjAQ/J +SP8wDgYDVR0PAQH/BAQDAgEGMBEGCWCGSAGG+EIBAQQEAwIABzANBgkqhkiG9w0BAQUFAAOCAQEA +hQMeknH2Qq/ho2Ge6/PAD/Kl1NqV5ta+aDY9fm4fTIrv0Q8hbV6lUmPOEvjvKtpv6zf+EwLHyzs+ +ImvaYS5/1HI93TDhHkxAGYwP15zRgzB7mFncfca5DClMoTOi62c6ZYTTluLtdkVwj7Ur3vkj1klu +PBS1xp81HlDQwY9qcEQCYsuuHWhBp6pX6FOqB9IG9tUUBguRA3UsbHK1YZWaDYu5Def131TN3ubY +1gkIl2PlwS6wt0QmwCbAr1UwnjvVNioZBPRcHv/PLLf/0P2HQBHVESO7SMAhqaQoLf0V+LBOK/Qw +WyH8EZE0vkHve52Xdf+XlcCWWC/qu0bXu+TZLg== +-----END CERTIFICATE----- + +Deutsche Telekom Root CA 2 +========================== +-----BEGIN CERTIFICATE----- +MIIDnzCCAoegAwIBAgIBJjANBgkqhkiG9w0BAQUFADBxMQswCQYDVQQGEwJERTEcMBoGA1UEChMT +RGV1dHNjaGUgVGVsZWtvbSBBRzEfMB0GA1UECxMWVC1UZWxlU2VjIFRydXN0IENlbnRlcjEjMCEG +A1UEAxMaRGV1dHNjaGUgVGVsZWtvbSBSb290IENBIDIwHhcNOTkwNzA5MTIxMTAwWhcNMTkwNzA5 +MjM1OTAwWjBxMQswCQYDVQQGEwJERTEcMBoGA1UEChMTRGV1dHNjaGUgVGVsZWtvbSBBRzEfMB0G +A1UECxMWVC1UZWxlU2VjIFRydXN0IENlbnRlcjEjMCEGA1UEAxMaRGV1dHNjaGUgVGVsZWtvbSBS +b290IENBIDIwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCrC6M14IspFLEUha88EOQ5 +bzVdSq7d6mGNlUn0b2SjGmBmpKlAIoTZ1KXleJMOaAGtuU1cOs7TuKhCQN/Po7qCWWqSG6wcmtoI +KyUn+WkjR/Hg6yx6m/UTAtB+NHzCnjwAWav12gz1MjwrrFDa1sPeg5TKqAyZMg4ISFZbavva4VhY +AUlfckE8FQYBjl2tqriTtM2e66foai1SNNs671x1Udrb8zH57nGYMsRUFUQM+ZtV7a3fGAigo4aK +Se5TBY8ZTNXeWHmb0mocQqvF1afPaA+W5OFhmHZhyJF81j4A4pFQh+GdCuatl9Idxjp9y7zaAzTV +jlsB9WoHtxa2bkp/AgMBAAGjQjBAMB0GA1UdDgQWBBQxw3kbuvVT1xfgiXotF2wKsyudMzAPBgNV +HRMECDAGAQH/AgEFMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQUFAAOCAQEAlGRZrTlk5ynr +E/5aw4sTV8gEJPB0d8Bg42f76Ymmg7+Wgnxu1MM9756AbrsptJh6sTtU6zkXR34ajgv8HzFZMQSy +zhfzLMdiNlXiItiJVbSYSKpk+tYcNthEeFpaIzpXl/V6ME+un2pMSyuOoAPjPuCp1NJ70rOo4nI8 +rZ7/gFnkm0W09juwzTkZmDLl6iFhkOQxIY40sfcvNUqFENrnijchvllj4PKFiDFT1FQUhXB59C4G +dyd1Lx+4ivn+xbrYNuSD7Odlt79jWvNGr4GUN9RBjNYj1h7P9WgbRGOiWrqnNVmh5XAFmw4jV5mU +Cm26OWMohpLzGITY+9HPBVZkVw== +-----END CERTIFICATE----- + +Cybertrust Global Root +====================== +-----BEGIN CERTIFICATE----- +MIIDoTCCAomgAwIBAgILBAAAAAABD4WqLUgwDQYJKoZIhvcNAQEFBQAwOzEYMBYGA1UEChMPQ3li +ZXJ0cnVzdCwgSW5jMR8wHQYDVQQDExZDeWJlcnRydXN0IEdsb2JhbCBSb290MB4XDTA2MTIxNTA4 +MDAwMFoXDTIxMTIxNTA4MDAwMFowOzEYMBYGA1UEChMPQ3liZXJ0cnVzdCwgSW5jMR8wHQYDVQQD +ExZDeWJlcnRydXN0IEdsb2JhbCBSb290MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA ++Mi8vRRQZhP/8NN57CPytxrHjoXxEnOmGaoQ25yiZXRadz5RfVb23CO21O1fWLE3TdVJDm71aofW +0ozSJ8bi/zafmGWgE07GKmSb1ZASzxQG9Dvj1Ci+6A74q05IlG2OlTEQXO2iLb3VOm2yHLtgwEZL +AfVJrn5GitB0jaEMAs7u/OePuGtm839EAL9mJRQr3RAwHQeWP032a7iPt3sMpTjr3kfb1V05/Iin +89cqdPHoWqI7n1C6poxFNcJQZZXcY4Lv3b93TZxiyWNzFtApD0mpSPCzqrdsxacwOUBdrsTiXSZT +8M4cIwhhqJQZugRiQOwfOHB3EgZxpzAYXSUnpQIDAQABo4GlMIGiMA4GA1UdDwEB/wQEAwIBBjAP +BgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBS2CHsNesysIEyGVjJez6tuhS1wVzA/BgNVHR8EODA2 +MDSgMqAwhi5odHRwOi8vd3d3Mi5wdWJsaWMtdHJ1c3QuY29tL2NybC9jdC9jdHJvb3QuY3JsMB8G +A1UdIwQYMBaAFLYIew16zKwgTIZWMl7Pq26FLXBXMA0GCSqGSIb3DQEBBQUAA4IBAQBW7wojoFRO +lZfJ+InaRcHUowAl9B8Tq7ejhVhpwjCt2BWKLePJzYFa+HMjWqd8BfP9IjsO0QbE2zZMcwSO5bAi +5MXzLqXZI+O4Tkogp24CJJ8iYGd7ix1yCcUxXOl5n4BHPa2hCwcUPUf/A2kaDAtE52Mlp3+yybh2 +hO0j9n0Hq0V+09+zv+mKts2oomcrUtW3ZfA5TGOgkXmTUg9U3YO7n9GPp1Nzw8v/MOx8BLjYRB+T +X3EJIrduPuocA06dGiBh+4E37F78CkWr1+cXVdCg6mCbpvbjjFspwgZgFJ0tl0ypkxWdYcQBX0jW +WL1WMRJOEcgh4LMRkWXbtKaIOM5V +-----END CERTIFICATE----- + +ePKI Root Certification Authority +================================= +-----BEGIN CERTIFICATE----- +MIIFsDCCA5igAwIBAgIQFci9ZUdcr7iXAF7kBtK8nTANBgkqhkiG9w0BAQUFADBeMQswCQYDVQQG +EwJUVzEjMCEGA1UECgwaQ2h1bmdod2EgVGVsZWNvbSBDby4sIEx0ZC4xKjAoBgNVBAsMIWVQS0kg +Um9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wNDEyMjAwMjMxMjdaFw0zNDEyMjAwMjMx +MjdaMF4xCzAJBgNVBAYTAlRXMSMwIQYDVQQKDBpDaHVuZ2h3YSBUZWxlY29tIENvLiwgTHRkLjEq +MCgGA1UECwwhZVBLSSBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIICIjANBgkqhkiG9w0B +AQEFAAOCAg8AMIICCgKCAgEA4SUP7o3biDN1Z82tH306Tm2d0y8U82N0ywEhajfqhFAHSyZbCUNs +IZ5qyNUD9WBpj8zwIuQf5/dqIjG3LBXy4P4AakP/h2XGtRrBp0xtInAhijHyl3SJCRImHJ7K2RKi +lTza6We/CKBk49ZCt0Xvl/T29de1ShUCWH2YWEtgvM3XDZoTM1PRYfl61dd4s5oz9wCGzh1NlDiv +qOx4UXCKXBCDUSH3ET00hl7lSM2XgYI1TBnsZfZrxQWh7kcT1rMhJ5QQCtkkO7q+RBNGMD+XPNjX +12ruOzjjK9SXDrkb5wdJfzcq+Xd4z1TtW0ado4AOkUPB1ltfFLqfpo0kR0BZv3I4sjZsN/+Z0V0O +WQqraffAsgRFelQArr5T9rXn4fg8ozHSqf4hUmTFpmfwdQcGlBSBVcYn5AGPF8Fqcde+S/uUWH1+ +ETOxQvdibBjWzwloPn9s9h6PYq2lY9sJpx8iQkEeb5mKPtf5P0B6ebClAZLSnT0IFaUQAS2zMnao +lQ2zepr7BxB4EW/hj8e6DyUadCrlHJhBmd8hh+iVBmoKs2pHdmX2Os+PYhcZewoozRrSgx4hxyy/ +vv9haLdnG7t4TY3OZ+XkwY63I2binZB1NJipNiuKmpS5nezMirH4JYlcWrYvjB9teSSnUmjDhDXi +Zo1jDiVN1Rmy5nk3pyKdVDECAwEAAaNqMGgwHQYDVR0OBBYEFB4M97Zn8uGSJglFwFU5Lnc/Qkqi +MAwGA1UdEwQFMAMBAf8wOQYEZyoHAAQxMC8wLQIBADAJBgUrDgMCGgUAMAcGBWcqAwAABBRFsMLH +ClZ87lt4DJX5GFPBphzYEDANBgkqhkiG9w0BAQUFAAOCAgEACbODU1kBPpVJufGBuvl2ICO1J2B0 +1GqZNF5sAFPZn/KmsSQHRGoqxqWOeBLoR9lYGxMqXnmbnwoqZ6YlPwZpVnPDimZI+ymBV3QGypzq +KOg4ZyYr8dW1P2WT+DZdjo2NQCCHGervJ8A9tDkPJXtoUHRVnAxZfVo9QZQlUgjgRywVMRnVvwdV +xrsStZf0X4OFunHB2WyBEXYKCrC/gpf36j36+uwtqSiUO1bd0lEursC9CBWMd1I0ltabrNMdjmEP +NXubrjlpC2JgQCA2j6/7Nu4tCEoduL+bXPjqpRugc6bY+G7gMwRfaKonh+3ZwZCc7b3jajWvY9+r +GNm65ulK6lCKD2GTHuItGeIwlDWSXQ62B68ZgI9HkFFLLk3dheLSClIKF5r8GrBQAuUBo2M3IUxE +xJtRmREOc5wGj1QupyheRDmHVi03vYVElOEMSyycw5KFNGHLD7ibSkNS/jQ6fbjpKdx2qcgw+BRx +gMYeNkh0IkFch4LoGHGLQYlE535YW6i4jRPpp2zDR+2zGp1iro2C6pSe3VkQw63d4k3jMdXH7Ojy +sP6SHhYKGvzZ8/gntsm+HbRsZJB/9OTEW9c3rkIO3aQab3yIVMUWbuF6aC74Or8NpDyJO3inTmOD +BCEIZ43ygknQW/2xzQ+DhNQ+IIX3Sj0rnP0qCglN6oH4EZw= +-----END CERTIFICATE----- + +certSIGN ROOT CA +================ +-----BEGIN CERTIFICATE----- +MIIDODCCAiCgAwIBAgIGIAYFFnACMA0GCSqGSIb3DQEBBQUAMDsxCzAJBgNVBAYTAlJPMREwDwYD +VQQKEwhjZXJ0U0lHTjEZMBcGA1UECxMQY2VydFNJR04gUk9PVCBDQTAeFw0wNjA3MDQxNzIwMDRa +Fw0zMTA3MDQxNzIwMDRaMDsxCzAJBgNVBAYTAlJPMREwDwYDVQQKEwhjZXJ0U0lHTjEZMBcGA1UE +CxMQY2VydFNJR04gUk9PVCBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALczuX7I +JUqOtdu0KBuqV5Do0SLTZLrTk+jUrIZhQGpgV2hUhE28alQCBf/fm5oqrl0Hj0rDKH/v+yv6efHH +rfAQUySQi2bJqIirr1qjAOm+ukbuW3N7LBeCgV5iLKECZbO9xSsAfsT8AzNXDe3i+s5dRdY4zTW2 +ssHQnIFKquSyAVwdj1+ZxLGt24gh65AIgoDzMKND5pCCrlUoSe1b16kQOA7+j0xbm0bqQfWwCHTD +0IgztnzXdN/chNFDDnU5oSVAKOp4yw4sLjmdjItuFhwvJoIQ4uNllAoEwF73XVv4EOLQunpL+943 +AAAaWyjj0pxzPjKHmKHJUS/X3qwzs08CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8B +Af8EBAMCAcYwHQYDVR0OBBYEFOCMm9slSbPxfIbWskKHC9BroNnkMA0GCSqGSIb3DQEBBQUAA4IB +AQA+0hyJLjX8+HXd5n9liPRyTMks1zJO890ZeUe9jjtbkw9QSSQTaxQGcu8J06Gh40CEyecYMnQ8 +SG4Pn0vU9x7Tk4ZkVJdjclDVVc/6IJMCopvDI5NOFlV2oHB5bc0hH88vLbwZ44gx+FkagQnIl6Z0 +x2DEW8xXjrJ1/RsCCdtZb3KTafcxQdaIOL+Hsr0Wefmq5L6IJd1hJyMctTEHBDa0GpC9oHRxUIlt +vBTjD4au8as+x6AJzKNI0eDbZOeStc+vckNwi/nDhDwTqn6Sm1dTk/pwwpEOMfmbZ13pljheX7Nz +TogVZ96edhBiIL5VaZVDADlN9u6wWk5JRFRYX0KD +-----END CERTIFICATE----- + +GeoTrust Primary Certification Authority - G3 +============================================= +-----BEGIN CERTIFICATE----- +MIID/jCCAuagAwIBAgIQFaxulBmyeUtB9iepwxgPHzANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UE +BhMCVVMxFjAUBgNVBAoTDUdlb1RydXN0IEluYy4xOTA3BgNVBAsTMChjKSAyMDA4IEdlb1RydXN0 +IEluYy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTE2MDQGA1UEAxMtR2VvVHJ1c3QgUHJpbWFy +eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEczMB4XDTA4MDQwMjAwMDAwMFoXDTM3MTIwMTIz +NTk1OVowgZgxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTkwNwYDVQQLEzAo +YykgMjAwOCBHZW9UcnVzdCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxNjA0BgNVBAMT +LUdlb1RydXN0IFByaW1hcnkgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZI +hvcNAQEBBQADggEPADCCAQoCggEBANziXmJYHTNXOTIz+uvLh4yn1ErdBojqZI4xmKU4kB6Yzy5j +K/BGvESyiaHAKAxJcCGVn2TAppMSAmUmhsalifD614SgcK9PGpc/BkTVyetyEH3kMSj7HGHmKAdE +c5IiaacDiGydY8hS2pgn5whMcD60yRLBxWeDXTPzAxHsatBT4tG6NmCUgLthY2xbF37fQJQeqw3C +IShwiP/WJmxsYAQlTlV+fe+/lEjetx3dcI0FX4ilm/LC7urRQEFtYjgdVgbFA0dRIBn8exALDmKu +dlW/X3e+PkkBUz2YJQN2JFodtNuJ6nnltrM7P7pMKEF/BqxqjsHQ9gUdfeZChuOl1UcCAwEAAaNC +MEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFMR5yo6hTgMdHNxr +2zFblD4/MH8tMA0GCSqGSIb3DQEBCwUAA4IBAQAtxRPPVoB7eni9n64smefv2t+UXglpp+duaIy9 +cr5HqQ6XErhK8WTTOd8lNNTBzU6B8A8ExCSzNJbGpqow32hhc9f5joWJ7w5elShKKiePEI4ufIbE +Ap7aDHdlDkQNkv39sxY2+hENHYwOB4lqKVb3cvTdFZx3NWZXqxNT2I7BQMXXExZacse3aQHEerGD +AWh9jUGhlBjBJVz88P6DAod8DQ3PLghcSkANPuyBYeYk28rgDi0Hsj5W3I31QYUHSJsMC8tJP33s +t/3LjWeJGqvtux6jAAgIFyqCXDFdRootD4abdNlF+9RAsXqqaC2Gspki4cErx5z481+oghLrGREt +-----END CERTIFICATE----- + +thawte Primary Root CA - G2 +=========================== +-----BEGIN CERTIFICATE----- +MIICiDCCAg2gAwIBAgIQNfwmXNmET8k9Jj1Xm67XVjAKBggqhkjOPQQDAzCBhDELMAkGA1UEBhMC +VVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjE4MDYGA1UECxMvKGMpIDIwMDcgdGhhd3RlLCBJbmMu +IC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxJDAiBgNVBAMTG3RoYXd0ZSBQcmltYXJ5IFJvb3Qg +Q0EgLSBHMjAeFw0wNzExMDUwMDAwMDBaFw0zODAxMTgyMzU5NTlaMIGEMQswCQYDVQQGEwJVUzEV +MBMGA1UEChMMdGhhd3RlLCBJbmMuMTgwNgYDVQQLEy8oYykgMjAwNyB0aGF3dGUsIEluYy4gLSBG +b3IgYXV0aG9yaXplZCB1c2Ugb25seTEkMCIGA1UEAxMbdGhhd3RlIFByaW1hcnkgUm9vdCBDQSAt +IEcyMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEotWcgnuVnfFSeIf+iha/BebfowJPDQfGAFG6DAJS +LSKkQjnE/o/qycG+1E3/n3qe4rF8mq2nhglzh9HnmuN6papu+7qzcMBniKI11KOasf2twu8x+qi5 +8/sIxpHR+ymVo0IwQDAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQU +mtgAMADna3+FGO6Lts6KDPgR4bswCgYIKoZIzj0EAwMDaQAwZgIxAN344FdHW6fmCsO99YCKlzUN +G4k8VIZ3KMqh9HneteY4sPBlcIx/AlTCv//YoT7ZzwIxAMSNlPzcU9LcnXgWHxUzI1NS41oxXZ3K +rr0TKUQNJ1uo52icEvdYPy5yAlejj6EULg== +-----END CERTIFICATE----- + +thawte Primary Root CA - G3 +=========================== +-----BEGIN CERTIFICATE----- +MIIEKjCCAxKgAwIBAgIQYAGXt0an6rS0mtZLL/eQ+zANBgkqhkiG9w0BAQsFADCBrjELMAkGA1UE +BhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2 +aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMvKGMpIDIwMDggdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhv +cml6ZWQgdXNlIG9ubHkxJDAiBgNVBAMTG3RoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EgLSBHMzAeFw0w +ODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIGuMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMdGhh +d3RlLCBJbmMuMSgwJgYDVQQLEx9DZXJ0aWZpY2F0aW9uIFNlcnZpY2VzIERpdmlzaW9uMTgwNgYD +VQQLEy8oYykgMjAwOCB0aGF3dGUsIEluYy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTEkMCIG +A1UEAxMbdGhhd3RlIFByaW1hcnkgUm9vdCBDQSAtIEczMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8A +MIIBCgKCAQEAsr8nLPvb2FvdeHsbnndmgcs+vHyu86YnmjSjaDFxODNi5PNxZnmxqWWjpYvVj2At +P0LMqmsywCPLLEHd5N/8YZzic7IilRFDGF/Eth9XbAoFWCLINkw6fKXRz4aviKdEAhN0cXMKQlkC ++BsUa0Lfb1+6a4KinVvnSr0eAXLbS3ToO39/fR8EtCab4LRarEc9VbjXsCZSKAExQGbY2SS99irY +7CFJXJv2eul/VTV+lmuNk5Mny5K76qxAwJ/C+IDPXfRa3M50hqY+bAtTyr2SzhkGcuYMXDhpxwTW +vGzOW/b3aJzcJRVIiKHpqfiYnODz1TEoYRFsZ5aNOZnLwkUkOQIDAQABo0IwQDAPBgNVHRMBAf8E +BTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUrWyqlGCc7eT/+j4KdCtjA/e2Wb8wDQYJ +KoZIhvcNAQELBQADggEBABpA2JVlrAmSicY59BDlqQ5mU1143vokkbvnRFHfxhY0Cu9qRFHqKweK +A3rD6z8KLFIWoCtDuSWQP3CpMyVtRRooOyfPqsMpQhvfO0zAMzRbQYi/aytlryjvsvXDqmbOe1bu +t8jLZ8HJnBoYuMTDSQPxYA5QzUbF83d597YV4Djbxy8ooAw/dyZ02SUS2jHaGh7cKUGRIjxpp7sC +8rZcJwOJ9Abqm+RyguOhCcHpABnTPtRwa7pxpqpYrvS76Wy274fMm7v/OeZWYdMKp8RcTGB7BXcm +er/YB1IsYvdwY9k5vG8cwnncdimvzsUsZAReiDZuMdRAGmI0Nj81Aa6sY6A= +-----END CERTIFICATE----- + +GeoTrust Primary Certification Authority - G2 +============================================= +-----BEGIN CERTIFICATE----- +MIICrjCCAjWgAwIBAgIQPLL0SAoA4v7rJDteYD7DazAKBggqhkjOPQQDAzCBmDELMAkGA1UEBhMC +VVMxFjAUBgNVBAoTDUdlb1RydXN0IEluYy4xOTA3BgNVBAsTMChjKSAyMDA3IEdlb1RydXN0IElu +Yy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTE2MDQGA1UEAxMtR2VvVHJ1c3QgUHJpbWFyeSBD +ZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMB4XDTA3MTEwNTAwMDAwMFoXDTM4MDExODIzNTk1 +OVowgZgxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTkwNwYDVQQLEzAoYykg +MjAwNyBHZW9UcnVzdCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxNjA0BgNVBAMTLUdl +b1RydXN0IFByaW1hcnkgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMjB2MBAGByqGSM49AgEG +BSuBBAAiA2IABBWx6P0DFUPlrOuHNxFi79KDNlJ9RVcLSo17VDs6bl8VAsBQps8lL33KSLjHUGMc +KiEIfJo22Av+0SbFWDEwKCXzXV2juLaltJLtbCyf691DiaI8S0iRHVDsJt/WYC69IaNCMEAwDwYD +VR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFBVfNVdRVfslsq0DafwBo/q+ +EVXVMAoGCCqGSM49BAMDA2cAMGQCMGSWWaboCd6LuvpaiIjwH5HTRqjySkwCY/tsXzjbLkGTqQ7m +ndwxHLKgpxgceeHHNgIwOlavmnRs9vuD4DPTCF+hnMJbn0bWtsuRBmOiBuczrD6ogRLQy7rQkgu2 +npaqBA+K +-----END CERTIFICATE----- + +VeriSign Universal Root Certification Authority +=============================================== +-----BEGIN CERTIFICATE----- +MIIEuTCCA6GgAwIBAgIQQBrEZCGzEyEDDrvkEhrFHTANBgkqhkiG9w0BAQsFADCBvTELMAkGA1UE +BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO +ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwOCBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk +IHVzZSBvbmx5MTgwNgYDVQQDEy9WZXJpU2lnbiBVbml2ZXJzYWwgUm9vdCBDZXJ0aWZpY2F0aW9u +IEF1dGhvcml0eTAeFw0wODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIG9MQswCQYDVQQGEwJV +UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv +cmsxOjA4BgNVBAsTMShjKSAyMDA4IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl +IG9ubHkxODA2BgNVBAMTL1ZlcmlTaWduIFVuaXZlcnNhbCBSb290IENlcnRpZmljYXRpb24gQXV0 +aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAx2E3XrEBNNti1xWb/1hajCMj +1mCOkdeQmIN65lgZOIzF9uVkhbSicfvtvbnazU0AtMgtc6XHaXGVHzk8skQHnOgO+k1KxCHfKWGP +MiJhgsWHH26MfF8WIFFE0XBPV+rjHOPMee5Y2A7Cs0WTwCznmhcrewA3ekEzeOEz4vMQGn+HLL72 +9fdC4uW/h2KJXwBL38Xd5HVEMkE6HnFuacsLdUYI0crSK5XQz/u5QGtkjFdN/BMReYTtXlT2NJ8I +AfMQJQYXStrxHXpma5hgZqTZ79IugvHw7wnqRMkVauIDbjPTrJ9VAMf2CGqUuV/c4DPxhGD5WycR +tPwW8rtWaoAljQIDAQABo4GyMIGvMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMG0G +CCsGAQUFBwEMBGEwX6FdoFswWTBXMFUWCWltYWdlL2dpZjAhMB8wBwYFKw4DAhoEFI/l0xqGrI2O +a8PPgGrUSBgsexkuMCUWI2h0dHA6Ly9sb2dvLnZlcmlzaWduLmNvbS92c2xvZ28uZ2lmMB0GA1Ud +DgQWBBS2d/ppSEefUxLVwuoHMnYH0ZcHGTANBgkqhkiG9w0BAQsFAAOCAQEASvj4sAPmLGd75JR3 +Y8xuTPl9Dg3cyLk1uXBPY/ok+myDjEedO2Pzmvl2MpWRsXe8rJq+seQxIcaBlVZaDrHC1LGmWazx +Y8u4TB1ZkErvkBYoH1quEPuBUDgMbMzxPcP1Y+Oz4yHJJDnp/RVmRvQbEdBNc6N9Rvk97ahfYtTx +P/jgdFcrGJ2BtMQo2pSXpXDrrB2+BxHw1dvd5Yzw1TKwg+ZX4o+/vqGqvz0dtdQ46tewXDpPaj+P +wGZsY6rp2aQW9IHRlRQOfc2VNNnSj3BzgXucfr2YYdhFh5iQxeuGMMY1v/D/w1WIg0vvBZIGcfK4 +mJO37M2CYfE45k+XmCpajQ== +-----END CERTIFICATE----- + +VeriSign Class 3 Public Primary Certification Authority - G4 +============================================================ +-----BEGIN CERTIFICATE----- +MIIDhDCCAwqgAwIBAgIQL4D+I4wOIg9IZxIokYesszAKBggqhkjOPQQDAzCByjELMAkGA1UEBhMC +VVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBOZXR3 +b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVz +ZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRpZmlj +YXRpb24gQXV0aG9yaXR5IC0gRzQwHhcNMDcxMTA1MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCByjEL +MAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBU +cnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRo +b3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5 +IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzQwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAASnVnp8 +Utpkmw4tXNherJI9/gHmGUo9FANL+mAnINmDiWn6VMaaGF5VKmTeBvaNSjutEDxlPZCIBIngMGGz +rl0Bp3vefLK+ymVhAIau2o970ImtTR1ZmkGxvEeA3J5iw/mjgbIwga8wDwYDVR0TAQH/BAUwAwEB +/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2UvZ2lmMCEw +HzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVyaXNpZ24u +Y29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFLMWkf3upm7ktS5Jj4d4gYDs5bG1MAoGCCqGSM49BAMD +A2gAMGUCMGYhDBgmYFo4e1ZC4Kf8NoRRkSAsdk1DPcQdhCPQrNZ8NQbOzWm9kA3bbEhCHQ6qQgIx +AJw9SDkjOVgaFRJZap7v1VmyHVIsmXHNxynfGyphe3HR3vPA5Q06Sqotp9iGKt0uEA== +-----END CERTIFICATE----- + +NetLock Arany (Class Gold) Főtanúsítvány +======================================== +-----BEGIN CERTIFICATE----- +MIIEFTCCAv2gAwIBAgIGSUEs5AAQMA0GCSqGSIb3DQEBCwUAMIGnMQswCQYDVQQGEwJIVTERMA8G +A1UEBwwIQnVkYXBlc3QxFTATBgNVBAoMDE5ldExvY2sgS2Z0LjE3MDUGA1UECwwuVGFuw7pzw610 +dsOhbnlraWFkw7NrIChDZXJ0aWZpY2F0aW9uIFNlcnZpY2VzKTE1MDMGA1UEAwwsTmV0TG9jayBB +cmFueSAoQ2xhc3MgR29sZCkgRsWRdGFuw7pzw610dsOhbnkwHhcNMDgxMjExMTUwODIxWhcNMjgx +MjA2MTUwODIxWjCBpzELMAkGA1UEBhMCSFUxETAPBgNVBAcMCEJ1ZGFwZXN0MRUwEwYDVQQKDAxO +ZXRMb2NrIEtmdC4xNzA1BgNVBAsMLlRhbsO6c8OtdHbDoW55a2lhZMOzayAoQ2VydGlmaWNhdGlv +biBTZXJ2aWNlcykxNTAzBgNVBAMMLE5ldExvY2sgQXJhbnkgKENsYXNzIEdvbGQpIEbFkXRhbsO6 +c8OtdHbDoW55MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAxCRec75LbRTDofTjl5Bu +0jBFHjzuZ9lk4BqKf8owyoPjIMHj9DrTlF8afFttvzBPhCf2nx9JvMaZCpDyD/V/Q4Q3Y1GLeqVw +/HpYzY6b7cNGbIRwXdrzAZAj/E4wqX7hJ2Pn7WQ8oLjJM2P+FpD/sLj916jAwJRDC7bVWaaeVtAk +H3B5r9s5VA1lddkVQZQBr17s9o3x/61k/iCa11zr/qYfCGSji3ZVrR47KGAuhyXoqq8fxmRGILdw +fzzeSNuWU7c5d+Qa4scWhHaXWy+7GRWF+GmF9ZmnqfI0p6m2pgP8b4Y9VHx2BJtr+UBdADTHLpl1 +neWIA6pN+APSQnbAGwIDAKiLo0UwQzASBgNVHRMBAf8ECDAGAQH/AgEEMA4GA1UdDwEB/wQEAwIB +BjAdBgNVHQ4EFgQUzPpnk/C2uNClwB7zU/2MU9+D15YwDQYJKoZIhvcNAQELBQADggEBAKt/7hwW +qZw8UQCgwBEIBaeZ5m8BiFRhbvG5GK1Krf6BQCOUL/t1fC8oS2IkgYIL9WHxHG64YTjrgfpioTta +YtOUZcTh5m2C+C8lcLIhJsFyUR+MLMOEkMNaj7rP9KdlpeuY0fsFskZ1FSNqb4VjMIDw1Z4fKRzC +bLBQWV2QWzuoDTDPv31/zvGdg73JRm4gpvlhUbohL3u+pRVjodSVh/GeufOJ8z2FuLjbvrW5Kfna +NwUASZQDhETnv0Mxz3WLJdH0pmT1kvarBes96aULNmLazAZfNou2XjG4Kvte9nHfRCaexOYNkbQu +dZWAUWpLMKawYqGT8ZvYzsRjdT9ZR7E= +-----END CERTIFICATE----- + +Staat der Nederlanden Root CA - G2 +================================== +-----BEGIN CERTIFICATE----- +MIIFyjCCA7KgAwIBAgIEAJiWjDANBgkqhkiG9w0BAQsFADBaMQswCQYDVQQGEwJOTDEeMBwGA1UE +CgwVU3RhYXQgZGVyIE5lZGVybGFuZGVuMSswKQYDVQQDDCJTdGFhdCBkZXIgTmVkZXJsYW5kZW4g +Um9vdCBDQSAtIEcyMB4XDTA4MDMyNjExMTgxN1oXDTIwMDMyNTExMDMxMFowWjELMAkGA1UEBhMC +TkwxHjAcBgNVBAoMFVN0YWF0IGRlciBOZWRlcmxhbmRlbjErMCkGA1UEAwwiU3RhYXQgZGVyIE5l +ZGVybGFuZGVuIFJvb3QgQ0EgLSBHMjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMVZ +5291qj5LnLW4rJ4L5PnZyqtdj7U5EILXr1HgO+EASGrP2uEGQxGZqhQlEq0i6ABtQ8SpuOUfiUtn +vWFI7/3S4GCI5bkYYCjDdyutsDeqN95kWSpGV+RLufg3fNU254DBtvPUZ5uW6M7XxgpT0GtJlvOj +CwV3SPcl5XCsMBQgJeN/dVrlSPhOewMHBPqCYYdu8DvEpMfQ9XQ+pV0aCPKbJdL2rAQmPlU6Yiil +e7Iwr/g3wtG61jj99O9JMDeZJiFIhQGp5Rbn3JBV3w/oOM2ZNyFPXfUib2rFEhZgF1XyZWampzCR +OME4HYYEhLoaJXhena/MUGDWE4dS7WMfbWV9whUYdMrhfmQpjHLYFhN9C0lK8SgbIHRrxT3dsKpI +CT0ugpTNGmXZK4iambwYfp/ufWZ8Pr2UuIHOzZgweMFvZ9C+X+Bo7d7iscksWXiSqt8rYGPy5V65 +48r6f1CGPqI0GAwJaCgRHOThuVw+R7oyPxjMW4T182t0xHJ04eOLoEq9jWYv6q012iDTiIJh8BIi +trzQ1aTsr1SIJSQ8p22xcik/Plemf1WvbibG/ufMQFxRRIEKeN5KzlW/HdXZt1bv8Hb/C3m1r737 +qWmRRpdogBQ2HbN/uymYNqUg+oJgYjOk7Na6B6duxc8UpufWkjTYgfX8HV2qXB72o007uPc5AgMB +AAGjgZcwgZQwDwYDVR0TAQH/BAUwAwEB/zBSBgNVHSAESzBJMEcGBFUdIAAwPzA9BggrBgEFBQcC +ARYxaHR0cDovL3d3dy5wa2lvdmVyaGVpZC5ubC9wb2xpY2llcy9yb290LXBvbGljeS1HMjAOBgNV +HQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJFoMocVHYnitfGsNig0jQt8YojrMA0GCSqGSIb3DQEBCwUA +A4ICAQCoQUpnKpKBglBu4dfYszk78wIVCVBR7y29JHuIhjv5tLySCZa59sCrI2AGeYwRTlHSeYAz ++51IvuxBQ4EffkdAHOV6CMqqi3WtFMTC6GY8ggen5ieCWxjmD27ZUD6KQhgpxrRW/FYQoAUXvQwj +f/ST7ZwaUb7dRUG/kSS0H4zpX897IZmflZ85OkYcbPnNe5yQzSipx6lVu6xiNGI1E0sUOlWDuYaN +kqbG9AclVMwWVxJKgnjIFNkXgiYtXSAfea7+1HAWFpWD2DU5/1JddRwWxRNVz0fMdWVSSt7wsKfk +CpYL+63C4iWEst3kvX5ZbJvw8NjnyvLplzh+ib7M+zkXYT9y2zqR2GUBGR2tUKRXCnxLvJxxcypF +URmFzI79R6d0lR2o0a9OF7FpJsKqeFdbxU2n5Z4FF5TKsl+gSRiNNOkmbEgeqmiSBeGCc1qb3Adb +CG19ndeNIdn8FCCqwkXfP+cAslHkwvgFuXkajDTznlvkN1trSt8sV4pAWja63XVECDdCcAz+3F4h +oKOKwJCcaNpQ5kUQR3i2TtJlycM33+FCY7BXN0Ute4qcvwXqZVUz9zkQxSgqIXobisQk+T8VyJoV +IPVVYpbtbZNQvOSqeK3Zywplh6ZmwcSBo3c6WB4L7oOLnR7SUqTMHW+wmG2UMbX4cQrcufx9MmDm +66+KAQ== +-----END CERTIFICATE----- + +Hongkong Post Root CA 1 +======================= +-----BEGIN CERTIFICATE----- +MIIDMDCCAhigAwIBAgICA+gwDQYJKoZIhvcNAQEFBQAwRzELMAkGA1UEBhMCSEsxFjAUBgNVBAoT +DUhvbmdrb25nIFBvc3QxIDAeBgNVBAMTF0hvbmdrb25nIFBvc3QgUm9vdCBDQSAxMB4XDTAzMDUx +NTA1MTMxNFoXDTIzMDUxNTA0NTIyOVowRzELMAkGA1UEBhMCSEsxFjAUBgNVBAoTDUhvbmdrb25n +IFBvc3QxIDAeBgNVBAMTF0hvbmdrb25nIFBvc3QgUm9vdCBDQSAxMIIBIjANBgkqhkiG9w0BAQEF +AAOCAQ8AMIIBCgKCAQEArP84tulmAknjorThkPlAj3n54r15/gK97iSSHSL22oVyaf7XPwnU3ZG1 +ApzQjVrhVcNQhrkpJsLj2aDxaQMoIIBFIi1WpztUlVYiWR8o3x8gPW2iNr4joLFutbEnPzlTCeqr +auh0ssJlXI6/fMN4hM2eFvz1Lk8gKgifd/PFHsSaUmYeSF7jEAaPIpjhZY4bXSNmO7ilMlHIhqqh +qZ5/dpTCpmy3QfDVyAY45tQM4vM7TG1QjMSDJ8EThFk9nnV0ttgCXjqQesBCNnLsak3c78QA3xMY +V18meMjWCnl3v/evt3a5pQuEF10Q6m/hq5URX208o1xNg1vysxmKgIsLhwIDAQABoyYwJDASBgNV +HRMBAf8ECDAGAQH/AgEDMA4GA1UdDwEB/wQEAwIBxjANBgkqhkiG9w0BAQUFAAOCAQEADkbVPK7i +h9legYsCmEEIjEy82tvuJxuC52pF7BaLT4Wg87JwvVqWuspube5Gi27nKi6Wsxkz67SfqLI37pio +l7Yutmcn1KZJ/RyTZXaeQi/cImyaT/JaFTmxcdcrUehtHJjA2Sr0oYJ71clBoiMBdDhViw+5Lmei +IAQ32pwL0xch4I+XeTRvhEgCIDMb5jREn5Fw9IBehEPCKdJsEhTkYY2sEJCehFC78JZvRZ+K88ps +T/oROhUVRsPNH4NbLUES7VBnQRM9IauUiqpOfMGx+6fWtScvl6tu4B3i0RwsH0Ti/L6RoZz71ilT +c4afU9hDDl3WY4JxHYB0yvbiAmvZWg== +-----END CERTIFICATE----- + +SecureSign RootCA11 +=================== +-----BEGIN CERTIFICATE----- +MIIDbTCCAlWgAwIBAgIBATANBgkqhkiG9w0BAQUFADBYMQswCQYDVQQGEwJKUDErMCkGA1UEChMi +SmFwYW4gQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcywgSW5jLjEcMBoGA1UEAxMTU2VjdXJlU2lnbiBS +b290Q0ExMTAeFw0wOTA0MDgwNDU2NDdaFw0yOTA0MDgwNDU2NDdaMFgxCzAJBgNVBAYTAkpQMSsw +KQYDVQQKEyJKYXBhbiBDZXJ0aWZpY2F0aW9uIFNlcnZpY2VzLCBJbmMuMRwwGgYDVQQDExNTZWN1 +cmVTaWduIFJvb3RDQTExMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA/XeqpRyQBTvL +TJszi1oURaTnkBbR31fSIRCkF/3frNYfp+TbfPfs37gD2pRY/V1yfIw/XwFndBWW4wI8h9uuywGO +wvNmxoVF9ALGOrVisq/6nL+k5tSAMJjzDbaTj6nU2DbysPyKyiyhFTOVMdrAG/LuYpmGYz+/3ZMq +g6h2uRMft85OQoWPIucuGvKVCbIFtUROd6EgvanyTgp9UK31BQ1FT0Zx/Sg+U/sE2C3XZR1KG/rP +O7AxmjVuyIsG0wCR8pQIZUyxNAYAeoni8McDWc/V1uinMrPmmECGxc0nEovMe863ETxiYAcjPitA +bpSACW22s293bzUIUPsCh8U+iQIDAQABo0IwQDAdBgNVHQ4EFgQUW/hNT7KlhtQ60vFjmqC+CfZX +t94wDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAKCh +OBZmLqdWHyGcBvod7bkixTgm2E5P7KN/ed5GIaGHd48HCJqypMWvDzKYC3xmKbabfSVSSUOrTC4r +bnpwrxYO4wJs+0LmGJ1F2FXI6Dvd5+H0LgscNFxsWEr7jIhQX5Ucv+2rIrVls4W6ng+4reV6G4pQ +Oh29Dbx7VFALuUKvVaAYga1lme++5Jy/xIWrQbJUb9wlze144o4MjQlJ3WN7WmmWAiGovVJZ6X01 +y8hSyn+B/tlr0/cR7SXf+Of5pPpyl4RTDaXQMhhRdlkUbA/r7F+AjHVDg8OFmP9Mni0N5HeDk061 +lgeLKBObjBmNQSdJQO7e5iNEOdyhIta6A/I= +-----END CERTIFICATE----- + +Microsec e-Szigno Root CA 2009 +============================== +-----BEGIN CERTIFICATE----- +MIIECjCCAvKgAwIBAgIJAMJ+QwRORz8ZMA0GCSqGSIb3DQEBCwUAMIGCMQswCQYDVQQGEwJIVTER +MA8GA1UEBwwIQnVkYXBlc3QxFjAUBgNVBAoMDU1pY3Jvc2VjIEx0ZC4xJzAlBgNVBAMMHk1pY3Jv +c2VjIGUtU3ppZ25vIFJvb3QgQ0EgMjAwOTEfMB0GCSqGSIb3DQEJARYQaW5mb0BlLXN6aWduby5o +dTAeFw0wOTA2MTYxMTMwMThaFw0yOTEyMzAxMTMwMThaMIGCMQswCQYDVQQGEwJIVTERMA8GA1UE +BwwIQnVkYXBlc3QxFjAUBgNVBAoMDU1pY3Jvc2VjIEx0ZC4xJzAlBgNVBAMMHk1pY3Jvc2VjIGUt +U3ppZ25vIFJvb3QgQ0EgMjAwOTEfMB0GCSqGSIb3DQEJARYQaW5mb0BlLXN6aWduby5odTCCASIw +DQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAOn4j/NjrdqG2KfgQvvPkd6mJviZpWNwrZuuyjNA +fW2WbqEORO7hE52UQlKavXWFdCyoDh2Tthi3jCyoz/tccbna7P7ofo/kLx2yqHWH2Leh5TvPmUpG +0IMZfcChEhyVbUr02MelTTMuhTlAdX4UfIASmFDHQWe4oIBhVKZsTh/gnQ4H6cm6M+f+wFUoLAKA +pxn1ntxVUwOXewdI/5n7N4okxFnMUBBjjqqpGrCEGob5X7uxUG6k0QrM1XF+H6cbfPVTbiJfyyvm +1HxdrtbCxkzlBQHZ7Vf8wSN5/PrIJIOV87VqUQHQd9bpEqH5GoP7ghu5sJf0dgYzQ0mg/wu1+rUC +AwEAAaOBgDB+MA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBTLD8bf +QkPMPcu1SCOhGnqmKrs0aDAfBgNVHSMEGDAWgBTLD8bfQkPMPcu1SCOhGnqmKrs0aDAbBgNVHREE +FDASgRBpbmZvQGUtc3ppZ25vLmh1MA0GCSqGSIb3DQEBCwUAA4IBAQDJ0Q5eLtXMs3w+y/w9/w0o +lZMEyL/azXm4Q5DwpL7v8u8hmLzU1F0G9u5C7DBsoKqpyvGvivo/C3NqPuouQH4frlRheesuCDfX +I/OMn74dseGkddug4lQUsbocKaQY9hK6ohQU4zE1yED/t+AFdlfBHFny+L/k7SViXITwfn4fs775 +tyERzAMBVnCnEJIeGzSBHq2cGsMEPO0CYdYeBvNfOofyK/FFh+U9rNHHV4S9a67c2Pm2G2JwCz02 +yULyMtd6YebS2z3PyKnJm9zbWETXbzivf3jTo60adbocwTZ8jx5tHMN1Rq41Bab2XD0h7lbwyYIi +LXpUq3DDfSJlgnCW +-----END CERTIFICATE----- + +GlobalSign Root CA - R3 +======================= +-----BEGIN CERTIFICATE----- +MIIDXzCCAkegAwIBAgILBAAAAAABIVhTCKIwDQYJKoZIhvcNAQELBQAwTDEgMB4GA1UECxMXR2xv +YmFsU2lnbiBSb290IENBIC0gUjMxEzARBgNVBAoTCkdsb2JhbFNpZ24xEzARBgNVBAMTCkdsb2Jh +bFNpZ24wHhcNMDkwMzE4MTAwMDAwWhcNMjkwMzE4MTAwMDAwWjBMMSAwHgYDVQQLExdHbG9iYWxT +aWduIFJvb3QgQ0EgLSBSMzETMBEGA1UEChMKR2xvYmFsU2lnbjETMBEGA1UEAxMKR2xvYmFsU2ln +bjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAMwldpB5BngiFvXAg7aEyiie/QV2EcWt +iHL8RgJDx7KKnQRfJMsuS+FggkbhUqsMgUdwbN1k0ev1LKMPgj0MK66X17YUhhB5uzsTgHeMCOFJ +0mpiLx9e+pZo34knlTifBtc+ycsmWQ1z3rDI6SYOgxXG71uL0gRgykmmKPZpO/bLyCiR5Z2KYVc3 +rHQU3HTgOu5yLy6c+9C7v/U9AOEGM+iCK65TpjoWc4zdQQ4gOsC0p6Hpsk+QLjJg6VfLuQSSaGjl +OCZgdbKfd/+RFO+uIEn8rUAVSNECMWEZXriX7613t2Saer9fwRPvm2L7DWzgVGkWqQPabumDk3F2 +xmmFghcCAwEAAaNCMEAwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE +FI/wS3+oLkUkrk1Q+mOai97i3Ru8MA0GCSqGSIb3DQEBCwUAA4IBAQBLQNvAUKr+yAzv95ZURUm7 +lgAJQayzE4aGKAczymvmdLm6AC2upArT9fHxD4q/c2dKg8dEe3jgr25sbwMpjjM5RcOO5LlXbKr8 +EpbsU8Yt5CRsuZRj+9xTaGdWPoO4zzUhw8lo/s7awlOqzJCK6fBdRoyV3XpYKBovHd7NADdBj+1E +bddTKJd+82cEHhXXipa0095MJ6RMG3NzdvQXmcIfeg7jLQitChws/zyrVQ4PkX4268NXSb7hLi18 +YIvDQVETI53O9zJrlAGomecsMx86OyXShkDOOyyGeMlhLxS67ttVb9+E7gUJTb0o2HLO02JQZR7r +kpeDMdmztcpHWD9f +-----END CERTIFICATE----- + +Autoridad de Certificacion Firmaprofesional CIF A62634068 +========================================================= +-----BEGIN CERTIFICATE----- +MIIGFDCCA/ygAwIBAgIIU+w77vuySF8wDQYJKoZIhvcNAQEFBQAwUTELMAkGA1UEBhMCRVMxQjBA +BgNVBAMMOUF1dG9yaWRhZCBkZSBDZXJ0aWZpY2FjaW9uIEZpcm1hcHJvZmVzaW9uYWwgQ0lGIEE2 +MjYzNDA2ODAeFw0wOTA1MjAwODM4MTVaFw0zMDEyMzEwODM4MTVaMFExCzAJBgNVBAYTAkVTMUIw +QAYDVQQDDDlBdXRvcmlkYWQgZGUgQ2VydGlmaWNhY2lvbiBGaXJtYXByb2Zlc2lvbmFsIENJRiBB +NjI2MzQwNjgwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDKlmuO6vj78aI14H9M2uDD +Utd9thDIAl6zQyrET2qyyhxdKJp4ERppWVevtSBC5IsP5t9bpgOSL/UR5GLXMnE42QQMcas9UX4P +B99jBVzpv5RvwSmCwLTaUbDBPLutN0pcyvFLNg4kq7/DhHf9qFD0sefGL9ItWY16Ck6WaVICqjaY +7Pz6FIMMNx/Jkjd/14Et5cS54D40/mf0PmbR0/RAz15iNA9wBj4gGFrO93IbJWyTdBSTo3OxDqqH +ECNZXyAFGUftaI6SEspd/NYrspI8IM/hX68gvqB2f3bl7BqGYTM+53u0P6APjqK5am+5hyZvQWyI +plD9amML9ZMWGxmPsu2bm8mQ9QEM3xk9Dz44I8kvjwzRAv4bVdZO0I08r0+k8/6vKtMFnXkIoctX +MbScyJCyZ/QYFpM6/EfY0XiWMR+6KwxfXZmtY4laJCB22N/9q06mIqqdXuYnin1oKaPnirjaEbsX +LZmdEyRG98Xi2J+Of8ePdG1asuhy9azuJBCtLxTa/y2aRnFHvkLfuwHb9H/TKI8xWVvTyQKmtFLK +bpf7Q8UIJm+K9Lv9nyiqDdVF8xM6HdjAeI9BZzwelGSuewvF6NkBiDkal4ZkQdU7hwxu+g/GvUgU +vzlN1J5Bto+WHWOWk9mVBngxaJ43BjuAiUVhOSPHG0SjFeUc+JIwuwIDAQABo4HvMIHsMBIGA1Ud +EwEB/wQIMAYBAf8CAQEwDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBRlzeurNR4APn7VdMActHNH +DhpkLzCBpgYDVR0gBIGeMIGbMIGYBgRVHSAAMIGPMC8GCCsGAQUFBwIBFiNodHRwOi8vd3d3LmZp +cm1hcHJvZmVzaW9uYWwuY29tL2NwczBcBggrBgEFBQcCAjBQHk4AUABhAHMAZQBvACAAZABlACAA +bABhACAAQgBvAG4AYQBuAG8AdgBhACAANAA3ACAAQgBhAHIAYwBlAGwAbwBuAGEAIAAwADgAMAAx +ADcwDQYJKoZIhvcNAQEFBQADggIBABd9oPm03cXF661LJLWhAqvdpYhKsg9VSytXjDvlMd3+xDLx +51tkljYyGOylMnfX40S2wBEqgLk9am58m9Ot/MPWo+ZkKXzR4Tgegiv/J2Wv+xYVxC5xhOW1//qk +R71kMrv2JYSiJ0L1ILDCExARzRAVukKQKtJE4ZYm6zFIEv0q2skGz3QeqUvVhyj5eTSSPi5E6PaP +T481PyWzOdxjKpBrIF/EUhJOlywqrJ2X3kjyo2bbwtKDlaZmp54lD+kLM5FlClrD2VQS3a/DTg4f +Jl4N3LON7NWBcN7STyQF82xO9UxJZo3R/9ILJUFI/lGExkKvgATP0H5kSeTy36LssUzAKh3ntLFl +osS88Zj0qnAHY7S42jtM+kAiMFsRpvAFDsYCA0irhpuF3dvd6qJ2gHN99ZwExEWN57kci57q13XR +crHedUTnQn3iV2t93Jm8PYMo6oCTjcVMZcFwgbg4/EMxsvYDNEeyrPsiBsse3RdHHF9mudMaotoR +saS8I8nkvof/uZS2+F0gStRf571oe2XyFR7SOqkt6dhrJKyXWERHrVkY8SFlcN7ONGCoQPHzPKTD +KCOM/iczQ0CgFzzr6juwcqajuUpLXhZI9LK8yIySxZ2frHI2vDSANGupi5LAuBft7HZT9SQBjLMi +6Et8Vcad+qMUu2WFbm5PEn4KPJ2V +-----END CERTIFICATE----- + +Izenpe.com +========== +-----BEGIN CERTIFICATE----- +MIIF8TCCA9mgAwIBAgIQALC3WhZIX7/hy/WL1xnmfTANBgkqhkiG9w0BAQsFADA4MQswCQYDVQQG +EwJFUzEUMBIGA1UECgwLSVpFTlBFIFMuQS4xEzARBgNVBAMMCkl6ZW5wZS5jb20wHhcNMDcxMjEz +MTMwODI4WhcNMzcxMjEzMDgyNzI1WjA4MQswCQYDVQQGEwJFUzEUMBIGA1UECgwLSVpFTlBFIFMu +QS4xEzARBgNVBAMMCkl6ZW5wZS5jb20wggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDJ +03rKDx6sp4boFmVqscIbRTJxldn+EFvMr+eleQGPicPK8lVx93e+d5TzcqQsRNiekpsUOqHnJJAK +ClaOxdgmlOHZSOEtPtoKct2jmRXagaKH9HtuJneJWK3W6wyyQXpzbm3benhB6QiIEn6HLmYRY2xU ++zydcsC8Lv/Ct90NduM61/e0aL6i9eOBbsFGb12N4E3GVFWJGjMxCrFXuaOKmMPsOzTFlUFpfnXC +PCDFYbpRR6AgkJOhkEvzTnyFRVSa0QUmQbC1TR0zvsQDyCV8wXDbO/QJLVQnSKwv4cSsPsjLkkxT +OTcj7NMB+eAJRE1NZMDhDVqHIrytG6P+JrUV86f8hBnp7KGItERphIPzidF0BqnMC9bC3ieFUCbK +F7jJeodWLBoBHmy+E60QrLUk9TiRodZL2vG70t5HtfG8gfZZa88ZU+mNFctKy6lvROUbQc/hhqfK +0GqfvEyNBjNaooXlkDWgYlwWTvDjovoDGrQscbNYLN57C9saD+veIR8GdwYDsMnvmfzAuU8Lhij+ +0rnq49qlw0dpEuDb8PYZi+17cNcC1u2HGCgsBCRMd+RIihrGO5rUD8r6ddIBQFqNeb+Lz0vPqhbB +leStTIo+F5HUsWLlguWABKQDfo2/2n+iD5dPDNMN+9fR5XJ+HMh3/1uaD7euBUbl8agW7EekFwID +AQABo4H2MIHzMIGwBgNVHREEgagwgaWBD2luZm9AaXplbnBlLmNvbaSBkTCBjjFHMEUGA1UECgw+ +SVpFTlBFIFMuQS4gLSBDSUYgQTAxMzM3MjYwLVJNZXJjLlZpdG9yaWEtR2FzdGVpeiBUMTA1NSBG +NjIgUzgxQzBBBgNVBAkMOkF2ZGEgZGVsIE1lZGl0ZXJyYW5lbyBFdG9yYmlkZWEgMTQgLSAwMTAx +MCBWaXRvcmlhLUdhc3RlaXowDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0O +BBYEFB0cZQ6o8iV7tJHP5LGx5r1VdGwFMA0GCSqGSIb3DQEBCwUAA4ICAQB4pgwWSp9MiDrAyw6l +Fn2fuUhfGI8NYjb2zRlrrKvV9pF9rnHzP7MOeIWblaQnIUdCSnxIOvVFfLMMjlF4rJUT3sb9fbga +kEyrkgPH7UIBzg/YsfqikuFgba56awmqxinuaElnMIAkejEWOVt+8Rwu3WwJrfIxwYJOubv5vr8q +hT/AQKM6WfxZSzwoJNu0FXWuDYi6LnPAvViH5ULy617uHjAimcs30cQhbIHsvm0m5hzkQiCeR7Cs +g1lwLDXWrzY0tM07+DKo7+N4ifuNRSzanLh+QBxh5z6ikixL8s36mLYp//Pye6kfLqCTVyvehQP5 +aTfLnnhqBbTFMXiJ7HqnheG5ezzevh55hM6fcA5ZwjUukCox2eRFekGkLhObNA5me0mrZJfQRsN5 +nXJQY6aYWwa9SG3YOYNw6DXwBdGqvOPbyALqfP2C2sJbUjWumDqtujWTI6cfSN01RpiyEGjkpTHC +ClguGYEQyVB1/OpaFs4R1+7vUIgtYf8/QnMFlEPVjjxOAToZpR9GTnfQXeWBIiGH/pR9hNiTrdZo +Q0iy2+tzJOeRf1SktoA+naM8THLCV8Sg1Mw4J87VBp6iSNnpn86CcDaTmjvfliHjWbcM2pE38P1Z +WrOZyGlsQyYBNWNgVYkDOnXYukrZVP/u3oDYLdE41V4tC5h9Pmzb/CaIxw== +-----END CERTIFICATE----- + +Chambers of Commerce Root - 2008 +================================ +-----BEGIN CERTIFICATE----- +MIIHTzCCBTegAwIBAgIJAKPaQn6ksa7aMA0GCSqGSIb3DQEBBQUAMIGuMQswCQYDVQQGEwJFVTFD +MEEGA1UEBxM6TWFkcmlkIChzZWUgY3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNv +bS9hZGRyZXNzKTESMBAGA1UEBRMJQTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMu +QS4xKTAnBgNVBAMTIENoYW1iZXJzIG9mIENvbW1lcmNlIFJvb3QgLSAyMDA4MB4XDTA4MDgwMTEy +Mjk1MFoXDTM4MDczMTEyMjk1MFowga4xCzAJBgNVBAYTAkVVMUMwQQYDVQQHEzpNYWRyaWQgKHNl +ZSBjdXJyZW50IGFkZHJlc3MgYXQgd3d3LmNhbWVyZmlybWEuY29tL2FkZHJlc3MpMRIwEAYDVQQF +EwlBODI3NDMyODcxGzAZBgNVBAoTEkFDIENhbWVyZmlybWEgUy5BLjEpMCcGA1UEAxMgQ2hhbWJl +cnMgb2YgQ29tbWVyY2UgUm9vdCAtIDIwMDgwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoIC +AQCvAMtwNyuAWko6bHiUfaN/Gh/2NdW928sNRHI+JrKQUrpjOyhYb6WzbZSm891kDFX29ufyIiKA +XuFixrYp4YFs8r/lfTJqVKAyGVn+H4vXPWCGhSRv4xGzdz4gljUha7MI2XAuZPeEklPWDrCQiorj +h40G072QDuKZoRuGDtqaCrsLYVAGUvGef3bsyw/QHg3PmTA9HMRFEFis1tPo1+XqxQEHd9ZR5gN/ +ikilTWh1uem8nk4ZcfUyS5xtYBkL+8ydddy/Js2Pk3g5eXNeJQ7KXOt3EgfLZEFHcpOrUMPrCXZk +NNI5t3YRCQ12RcSprj1qr7V9ZS+UWBDsXHyvfuK2GNnQm05aSd+pZgvMPMZ4fKecHePOjlO+Bd5g +D2vlGts/4+EhySnB8esHnFIbAURRPHsl18TlUlRdJQfKFiC4reRB7noI/plvg6aRArBsNlVq5331 +lubKgdaX8ZSD6e2wsWsSaR6s+12pxZjptFtYer49okQ6Y1nUCyXeG0+95QGezdIp1Z8XGQpvvwyQ +0wlf2eOKNcx5Wk0ZN5K3xMGtr/R5JJqyAQuxr1yW84Ay+1w9mPGgP0revq+ULtlVmhduYJ1jbLhj +ya6BXBg14JC7vjxPNyK5fuvPnnchpj04gftI2jE9K+OJ9dC1vX7gUMQSibMjmhAxhduub+84Mxh2 +EQIDAQABo4IBbDCCAWgwEgYDVR0TAQH/BAgwBgEB/wIBDDAdBgNVHQ4EFgQU+SSsD7K1+HnA+mCI +G8TZTQKeFxkwgeMGA1UdIwSB2zCB2IAU+SSsD7K1+HnA+mCIG8TZTQKeFxmhgbSkgbEwga4xCzAJ +BgNVBAYTAkVVMUMwQQYDVQQHEzpNYWRyaWQgKHNlZSBjdXJyZW50IGFkZHJlc3MgYXQgd3d3LmNh +bWVyZmlybWEuY29tL2FkZHJlc3MpMRIwEAYDVQQFEwlBODI3NDMyODcxGzAZBgNVBAoTEkFDIENh +bWVyZmlybWEgUy5BLjEpMCcGA1UEAxMgQ2hhbWJlcnMgb2YgQ29tbWVyY2UgUm9vdCAtIDIwMDiC +CQCj2kJ+pLGu2jAOBgNVHQ8BAf8EBAMCAQYwPQYDVR0gBDYwNDAyBgRVHSAAMCowKAYIKwYBBQUH +AgEWHGh0dHA6Ly9wb2xpY3kuY2FtZXJmaXJtYS5jb20wDQYJKoZIhvcNAQEFBQADggIBAJASryI1 +wqM58C7e6bXpeHxIvj99RZJe6dqxGfwWPJ+0W2aeaufDuV2I6A+tzyMP3iU6XsxPpcG1Lawk0lgH +3qLPaYRgM+gQDROpI9CF5Y57pp49chNyM/WqfcZjHwj0/gF/JM8rLFQJ3uIrbZLGOU8W6jx+ekbU +RWpGqOt1glanq6B8aBMz9p0w8G8nOSQjKpD9kCk18pPfNKXG9/jvjA9iSnyu0/VU+I22mlaHFoI6 +M6taIgj3grrqLuBHmrS1RaMFO9ncLkVAO+rcf+g769HsJtg1pDDFOqxXnrN2pSB7+R5KBWIBpih1 +YJeSDW4+TTdDDZIVnBgizVGZoCkaPF+KMjNbMMeJL0eYD6MDxvbxrN8y8NmBGuScvfaAFPDRLLmF +9dijscilIeUcE5fuDr3fKanvNFNb0+RqE4QGtjICxFKuItLcsiFCGtpA8CnJ7AoMXOLQusxI0zcK +zBIKinmwPQN/aUv0NCB9szTqjktk9T79syNnFQ0EuPAtwQlRPLJsFfClI9eDdOTlLsn+mCdCxqvG +nrDQWzilm1DefhiYtUU79nm06PcaewaD+9CL2rvHvRirCG88gGtAPxkZumWK5r7VXNM21+9AUiRg +OGcEMeyP84LG3rlV8zsxkVrctQgVrXYlCg17LofiDKYGvCYQbTed7N14jHyAxfDZd0jQ +-----END CERTIFICATE----- + +Global Chambersign Root - 2008 +============================== +-----BEGIN CERTIFICATE----- +MIIHSTCCBTGgAwIBAgIJAMnN0+nVfSPOMA0GCSqGSIb3DQEBBQUAMIGsMQswCQYDVQQGEwJFVTFD +MEEGA1UEBxM6TWFkcmlkIChzZWUgY3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNv +bS9hZGRyZXNzKTESMBAGA1UEBRMJQTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMu +QS4xJzAlBgNVBAMTHkdsb2JhbCBDaGFtYmVyc2lnbiBSb290IC0gMjAwODAeFw0wODA4MDExMjMx +NDBaFw0zODA3MzExMjMxNDBaMIGsMQswCQYDVQQGEwJFVTFDMEEGA1UEBxM6TWFkcmlkIChzZWUg +Y3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNvbS9hZGRyZXNzKTESMBAGA1UEBRMJ +QTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMuQS4xJzAlBgNVBAMTHkdsb2JhbCBD +aGFtYmVyc2lnbiBSb290IC0gMjAwODCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMDf +VtPkOpt2RbQT2//BthmLN0EYlVJH6xedKYiONWwGMi5HYvNJBL99RDaxccy9Wglz1dmFRP+RVyXf +XjaOcNFccUMd2drvXNL7G706tcuto8xEpw2uIRU/uXpbknXYpBI4iRmKt4DS4jJvVpyR1ogQC7N0 +ZJJ0YPP2zxhPYLIj0Mc7zmFLmY/CDNBAspjcDahOo7kKrmCgrUVSY7pmvWjg+b4aqIG7HkF4ddPB +/gBVsIdU6CeQNR1MM62X/JcumIS/LMmjv9GYERTtY/jKmIhYF5ntRQOXfjyGHoiMvvKRhI9lNNgA +TH23MRdaKXoKGCQwoze1eqkBfSbW+Q6OWfH9GzO1KTsXO0G2Id3UwD2ln58fQ1DJu7xsepeY7s2M +H/ucUa6LcL0nn3HAa6x9kGbo1106DbDVwo3VyJ2dwW3Q0L9R5OP4wzg2rtandeavhENdk5IMagfe +Ox2YItaswTXbo6Al/3K1dh3ebeksZixShNBFks4c5eUzHdwHU1SjqoI7mjcv3N2gZOnm3b2u/GSF +HTynyQbehP9r6GsaPMWis0L7iwk+XwhSx2LE1AVxv8Rk5Pihg+g+EpuoHtQ2TS9x9o0o9oOpE9Jh +wZG7SMA0j0GMS0zbaRL/UJScIINZc+18ofLx/d33SdNDWKBWY8o9PeU1VlnpDsogzCtLkykPAgMB +AAGjggFqMIIBZjASBgNVHRMBAf8ECDAGAQH/AgEMMB0GA1UdDgQWBBS5CcqcHtvTbDprru1U8VuT +BjUuXjCB4QYDVR0jBIHZMIHWgBS5CcqcHtvTbDprru1U8VuTBjUuXqGBsqSBrzCBrDELMAkGA1UE +BhMCRVUxQzBBBgNVBAcTOk1hZHJpZCAoc2VlIGN1cnJlbnQgYWRkcmVzcyBhdCB3d3cuY2FtZXJm +aXJtYS5jb20vYWRkcmVzcykxEjAQBgNVBAUTCUE4Mjc0MzI4NzEbMBkGA1UEChMSQUMgQ2FtZXJm +aXJtYSBTLkEuMScwJQYDVQQDEx5HbG9iYWwgQ2hhbWJlcnNpZ24gUm9vdCAtIDIwMDiCCQDJzdPp +1X0jzjAOBgNVHQ8BAf8EBAMCAQYwPQYDVR0gBDYwNDAyBgRVHSAAMCowKAYIKwYBBQUHAgEWHGh0 +dHA6Ly9wb2xpY3kuY2FtZXJmaXJtYS5jb20wDQYJKoZIhvcNAQEFBQADggIBAICIf3DekijZBZRG +/5BXqfEv3xoNa/p8DhxJJHkn2EaqbylZUohwEurdPfWbU1Rv4WCiqAm57OtZfMY18dwY6fFn5a+6 +ReAJ3spED8IXDneRRXozX1+WLGiLwUePmJs9wOzL9dWCkoQ10b42OFZyMVtHLaoXpGNR6woBrX/s +dZ7LoR/xfxKxueRkf2fWIyr0uDldmOghp+G9PUIadJpwr2hsUF1Jz//7Dl3mLEfXgTpZALVza2Mg +9jFFCDkO9HB+QHBaP9BrQql0PSgvAm11cpUJjUhjxsYjV5KTXjXBjfkK9yydYhz2rXzdpjEetrHH +foUm+qRqtdpjMNHvkzeyZi99Bffnt0uYlDXA2TopwZ2yUDMdSqlapskD7+3056huirRXhOukP9Du +qqqHW2Pok+JrqNS4cnhrG+055F3Lm6qH1U9OAP7Zap88MQ8oAgF9mOinsKJknnn4SPIVqczmyETr +P3iZ8ntxPjzxmKfFGBI/5rsoM0LpRQp8bfKGeS/Fghl9CYl8slR2iK7ewfPM4W7bMdaTrpmg7yVq +c5iJWzouE4gev8CSlDQb4ye3ix5vQv/n6TebUB0tovkC7stYWDpxvGjjqsGvHCgfotwjZT+B6q6Z +09gwzxMNTxXJhLynSC34MCN32EZLeW32jO06f2ARePTpm67VVMB0gNELQp/B +-----END CERTIFICATE----- + +Go Daddy Root Certificate Authority - G2 +======================================== +-----BEGIN CERTIFICATE----- +MIIDxTCCAq2gAwIBAgIBADANBgkqhkiG9w0BAQsFADCBgzELMAkGA1UEBhMCVVMxEDAOBgNVBAgT +B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxGjAYBgNVBAoTEUdvRGFkZHkuY29tLCBJbmMu +MTEwLwYDVQQDEyhHbyBEYWRkeSBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5 +MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgYMxCzAJBgNVBAYTAlVTMRAwDgYDVQQIEwdBcml6 +b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMRowGAYDVQQKExFHb0RhZGR5LmNvbSwgSW5jLjExMC8G +A1UEAxMoR28gRGFkZHkgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZI +hvcNAQEBBQADggEPADCCAQoCggEBAL9xYgjx+lk09xvJGKP3gElY6SKDE6bFIEMBO4Tx5oVJnyfq +9oQbTqC023CYxzIBsQU+B07u9PpPL1kwIuerGVZr4oAH/PMWdYA5UXvl+TW2dE6pjYIT5LY/qQOD ++qK+ihVqf94Lw7YZFAXK6sOoBJQ7RnwyDfMAZiLIjWltNowRGLfTshxgtDj6AozO091GB94KPutd +fMh8+7ArU6SSYmlRJQVhGkSBjCypQ5Yj36w6gZoOKcUcqeldHraenjAKOc7xiID7S13MMuyFYkMl +NAJWJwGRtDtwKj9useiciAF9n9T521NtYJ2/LOdYq7hfRvzOxBsDPAnrSTFcaUaz4EcCAwEAAaNC +MEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFDqahQcQZyi27/a9 +BUFuIMGU2g/eMA0GCSqGSIb3DQEBCwUAA4IBAQCZ21151fmXWWcDYfF+OwYxdS2hII5PZYe096ac +vNjpL9DbWu7PdIxztDhC2gV7+AJ1uP2lsdeu9tfeE8tTEH6KRtGX+rcuKxGrkLAngPnon1rpN5+r +5N9ss4UXnT3ZJE95kTXWXwTrgIOrmgIttRD02JDHBHNA7XIloKmf7J6raBKZV8aPEjoJpL1E/QYV +N8Gb5DKj7Tjo2GTzLH4U/ALqn83/B2gX2yKQOC16jdFU8WnjXzPKej17CuPKf1855eJ1usV2GDPO +LPAvTK33sefOT6jEm0pUBsV/fdUID+Ic/n4XuKxe9tQWskMJDE32p2u0mYRlynqI4uJEvlz36hz1 +-----END CERTIFICATE----- + +Starfield Root Certificate Authority - G2 +========================================= +-----BEGIN CERTIFICATE----- +MIID3TCCAsWgAwIBAgIBADANBgkqhkiG9w0BAQsFADCBjzELMAkGA1UEBhMCVVMxEDAOBgNVBAgT +B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNobm9s +b2dpZXMsIEluYy4xMjAwBgNVBAMTKVN0YXJmaWVsZCBSb290IENlcnRpZmljYXRlIEF1dGhvcml0 +eSAtIEcyMB4XDTA5MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgY8xCzAJBgNVBAYTAlVTMRAw +DgYDVQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFyZmllbGQg +VGVjaG5vbG9naWVzLCBJbmMuMTIwMAYDVQQDEylTdGFyZmllbGQgUm9vdCBDZXJ0aWZpY2F0ZSBB +dXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAL3twQP89o/8ArFv +W59I2Z154qK3A2FWGMNHttfKPTUuiUP3oWmb3ooa/RMgnLRJdzIpVv257IzdIvpy3Cdhl+72WoTs +bhm5iSzchFvVdPtrX8WJpRBSiUZV9Lh1HOZ/5FSuS/hVclcCGfgXcVnrHigHdMWdSL5stPSksPNk +N3mSwOxGXn/hbVNMYq/NHwtjuzqd+/x5AJhhdM8mgkBj87JyahkNmcrUDnXMN/uLicFZ8WJ/X7Nf +ZTD4p7dNdloedl40wOiWVpmKs/B/pM293DIxfJHP4F8R+GuqSVzRmZTRouNjWwl2tVZi4Ut0HZbU +JtQIBFnQmA4O5t78w+wfkPECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC +AQYwHQYDVR0OBBYEFHwMMh+n2TB/xH1oo2Kooc6rB1snMA0GCSqGSIb3DQEBCwUAA4IBAQARWfol +TwNvlJk7mh+ChTnUdgWUXuEok21iXQnCoKjUsHU48TRqneSfioYmUeYs0cYtbpUgSpIB7LiKZ3sx +4mcujJUDJi5DnUox9g61DLu34jd/IroAow57UvtruzvE03lRTs2Q9GcHGcg8RnoNAX3FWOdt5oUw +F5okxBDgBPfg8n/Uqgr/Qh037ZTlZFkSIHc40zI+OIF1lnP6aI+xy84fxez6nH7PfrHxBy22/L/K +pL/QlwVKvOoYKAKQvVR4CSFx09F9HdkWsKlhPdAKACL8x3vLCWRFCztAgfd9fDL1mMpYjn0q7pBZ +c2T5NnReJaH1ZgUufzkVqSr7UIuOhWn0 +-----END CERTIFICATE----- + +Starfield Services Root Certificate Authority - G2 +================================================== +-----BEGIN CERTIFICATE----- +MIID7zCCAtegAwIBAgIBADANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UEBhMCVVMxEDAOBgNVBAgT +B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNobm9s +b2dpZXMsIEluYy4xOzA5BgNVBAMTMlN0YXJmaWVsZCBTZXJ2aWNlcyBSb290IENlcnRpZmljYXRl +IEF1dGhvcml0eSAtIEcyMB4XDTA5MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgZgxCzAJBgNV +BAYTAlVTMRAwDgYDVQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxT +dGFyZmllbGQgVGVjaG5vbG9naWVzLCBJbmMuMTswOQYDVQQDEzJTdGFyZmllbGQgU2VydmljZXMg +Um9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC +AQoCggEBANUMOsQq+U7i9b4Zl1+OiFOxHz/Lz58gE20pOsgPfTz3a3Y4Y9k2YKibXlwAgLIvWX/2 +h/klQ4bnaRtSmpDhcePYLQ1Ob/bISdm28xpWriu2dBTrz/sm4xq6HZYuajtYlIlHVv8loJNwU4Pa +hHQUw2eeBGg6345AWh1KTs9DkTvnVtYAcMtS7nt9rjrnvDH5RfbCYM8TWQIrgMw0R9+53pBlbQLP +LJGmpufehRhJfGZOozptqbXuNC66DQO4M99H67FrjSXZm86B0UVGMpZwh94CDklDhbZsc7tk6mFB +rMnUVN+HL8cisibMn1lUaJ/8viovxFUcdUBgF4UCVTmLfwUCAwEAAaNCMEAwDwYDVR0TAQH/BAUw +AwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJxfAN+qAdcwKziIorhtSpzyEZGDMA0GCSqG +SIb3DQEBCwUAA4IBAQBLNqaEd2ndOxmfZyMIbw5hyf2E3F/YNoHN2BtBLZ9g3ccaaNnRbobhiCPP +E95Dz+I0swSdHynVv/heyNXBve6SbzJ08pGCL72CQnqtKrcgfU28elUSwhXqvfdqlS5sdJ/PHLTy +xQGjhdByPq1zqwubdQxtRbeOlKyWN7Wg0I8VRw7j6IPdj/3vQQF3zCepYoUz8jcI73HPdwbeyBkd +iEDPfUYd/x7H4c7/I9vG+o1VTqkC50cRRj70/b17KSa7qWFiNyi2LSr2EIZkyXCn0q23KXB56jza +YyWf/Wi3MOxw+3WKt21gZ7IeyLnp2KhvAotnDU0mV3HaIPzBSlCNsSi6 +-----END CERTIFICATE----- + +AffirmTrust Commercial +====================== +-----BEGIN CERTIFICATE----- +MIIDTDCCAjSgAwIBAgIId3cGJyapsXwwDQYJKoZIhvcNAQELBQAwRDELMAkGA1UEBhMCVVMxFDAS +BgNVBAoMC0FmZmlybVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBDb21tZXJjaWFsMB4XDTEw +MDEyOTE0MDYwNloXDTMwMTIzMTE0MDYwNlowRDELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmly +bVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBDb21tZXJjaWFsMIIBIjANBgkqhkiG9w0BAQEF +AAOCAQ8AMIIBCgKCAQEA9htPZwcroRX1BiLLHwGy43NFBkRJLLtJJRTWzsO3qyxPxkEylFf6Eqdb +DuKPHx6GGaeqtS25Xw2Kwq+FNXkyLbscYjfysVtKPcrNcV/pQr6U6Mje+SJIZMblq8Yrba0F8PrV +C8+a5fBQpIs7R6UjW3p6+DM/uO+Zl+MgwdYoic+U+7lF7eNAFxHUdPALMeIrJmqbTFeurCA+ukV6 +BfO9m2kVrn1OIGPENXY6BwLJN/3HR+7o8XYdcxXyl6S1yHp52UKqK39c/s4mT6NmgTWvRLpUHhww +MmWd5jyTXlBOeuM61G7MGvv50jeuJCqrVwMiKA1JdX+3KNp1v47j3A55MQIDAQABo0IwQDAdBgNV +HQ4EFgQUnZPGU4teyq8/nx4P5ZmVvCT2lI8wDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC +AQYwDQYJKoZIhvcNAQELBQADggEBAFis9AQOzcAN/wr91LoWXym9e2iZWEnStB03TX8nfUYGXUPG +hi4+c7ImfU+TqbbEKpqrIZcUsd6M06uJFdhrJNTxFq7YpFzUf1GO7RgBsZNjvbz4YYCanrHOQnDi +qX0GJX0nof5v7LMeJNrjS1UaADs1tDvZ110w/YETifLCBivtZ8SOyUOyXGsViQK8YvxO8rUzqrJv +0wqiUOP2O+guRMLbZjipM1ZI8W0bM40NjD9gN53Tym1+NH4Nn3J2ixufcv1SNUFFApYvHLKac0kh +sUlHRUe072o0EclNmsxZt9YCnlpOZbWUrhvfKbAW8b8Angc6F2S1BLUjIZkKlTuXfO8= +-----END CERTIFICATE----- + +AffirmTrust Networking +====================== +-----BEGIN CERTIFICATE----- +MIIDTDCCAjSgAwIBAgIIfE8EORzUmS0wDQYJKoZIhvcNAQEFBQAwRDELMAkGA1UEBhMCVVMxFDAS +BgNVBAoMC0FmZmlybVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBOZXR3b3JraW5nMB4XDTEw +MDEyOTE0MDgyNFoXDTMwMTIzMTE0MDgyNFowRDELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmly +bVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBOZXR3b3JraW5nMIIBIjANBgkqhkiG9w0BAQEF +AAOCAQ8AMIIBCgKCAQEAtITMMxcua5Rsa2FSoOujz3mUTOWUgJnLVWREZY9nZOIG41w3SfYvm4SE +Hi3yYJ0wTsyEheIszx6e/jarM3c1RNg1lho9Nuh6DtjVR6FqaYvZ/Ls6rnla1fTWcbuakCNrmreI +dIcMHl+5ni36q1Mr3Lt2PpNMCAiMHqIjHNRqrSK6mQEubWXLviRmVSRLQESxG9fhwoXA3hA/Pe24 +/PHxI1Pcv2WXb9n5QHGNfb2V1M6+oF4nI979ptAmDgAp6zxG8D1gvz9Q0twmQVGeFDdCBKNwV6gb +h+0t+nvujArjqWaJGctB+d1ENmHP4ndGyH329JKBNv3bNPFyfvMMFr20FQIDAQABo0IwQDAdBgNV +HQ4EFgQUBx/S55zawm6iQLSwelAQUHTEyL0wDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC +AQYwDQYJKoZIhvcNAQEFBQADggEBAIlXshZ6qML91tmbmzTCnLQyFE2npN/svqe++EPbkTfOtDIu +UFUaNU52Q3Eg75N3ThVwLofDwR1t3Mu1J9QsVtFSUzpE0nPIxBsFZVpikpzuQY0x2+c06lkh1QF6 +12S4ZDnNye2v7UsDSKegmQGA3GWjNq5lWUhPgkvIZfFXHeVZLgo/bNjR9eUJtGxUAArgFU2HdW23 +WJZa3W3SAKD0m0i+wzekujbgfIeFlxoVot4uolu9rxj5kFDNcFn4J2dHy8egBzp90SxdbBk6ZrV9 +/ZFvgrG+CJPbFEfxojfHRZ48x3evZKiT3/Zpg4Jg8klCNO1aAFSFHBY2kgxc+qatv9s= +-----END CERTIFICATE----- + +AffirmTrust Premium +=================== +-----BEGIN CERTIFICATE----- +MIIFRjCCAy6gAwIBAgIIbYwURrGmCu4wDQYJKoZIhvcNAQEMBQAwQTELMAkGA1UEBhMCVVMxFDAS +BgNVBAoMC0FmZmlybVRydXN0MRwwGgYDVQQDDBNBZmZpcm1UcnVzdCBQcmVtaXVtMB4XDTEwMDEy +OTE0MTAzNloXDTQwMTIzMTE0MTAzNlowQTELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmlybVRy +dXN0MRwwGgYDVQQDDBNBZmZpcm1UcnVzdCBQcmVtaXVtMIICIjANBgkqhkiG9w0BAQEFAAOCAg8A +MIICCgKCAgEAxBLfqV/+Qd3d9Z+K4/as4Tx4mrzY8H96oDMq3I0gW64tb+eT2TZwamjPjlGjhVtn +BKAQJG9dKILBl1fYSCkTtuG+kU3fhQxTGJoeJKJPj/CihQvL9Cl/0qRY7iZNyaqoe5rZ+jjeRFcV +5fiMyNlI4g0WJx0eyIOFJbe6qlVBzAMiSy2RjYvmia9mx+n/K+k8rNrSs8PhaJyJ+HoAVt70VZVs ++7pk3WKL3wt3MutizCaam7uqYoNMtAZ6MMgpv+0GTZe5HMQxK9VfvFMSF5yZVylmd2EhMQcuJUmd +GPLu8ytxjLW6OQdJd/zvLpKQBY0tL3d770O/Nbua2Plzpyzy0FfuKE4mX4+QaAkvuPjcBukumj5R +p9EixAqnOEhss/n/fauGV+O61oV4d7pD6kh/9ti+I20ev9E2bFhc8e6kGVQa9QPSdubhjL08s9NI +S+LI+H+SqHZGnEJlPqQewQcDWkYtuJfzt9WyVSHvutxMAJf7FJUnM7/oQ0dG0giZFmA7mn7S5u04 +6uwBHjxIVkkJx0w3AJ6IDsBz4W9m6XJHMD4Q5QsDyZpCAGzFlH5hxIrff4IaC1nEWTJ3s7xgaVY5 +/bQGeyzWZDbZvUjthB9+pSKPKrhC9IK31FOQeE4tGv2Bb0TXOwF0lkLgAOIua+rF7nKsu7/+6qqo ++Nz2snmKtmcCAwEAAaNCMEAwHQYDVR0OBBYEFJ3AZ6YMItkm9UWrpmVSESfYRaxjMA8GA1UdEwEB +/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMA0GCSqGSIb3DQEBDAUAA4ICAQCzV00QYk465KzquByv +MiPIs0laUZx2KI15qldGF9X1Uva3ROgIRL8YhNILgM3FEv0AVQVhh0HctSSePMTYyPtwni94loMg +Nt58D2kTiKV1NpgIpsbfrM7jWNa3Pt668+s0QNiigfV4Py/VpfzZotReBA4Xrf5B8OWycvpEgjNC +6C1Y91aMYj+6QrCcDFx+LmUmXFNPALJ4fqENmS2NuB2OosSw/WDQMKSOyARiqcTtNd56l+0OOF6S +L5Nwpamcb6d9Ex1+xghIsV5n61EIJenmJWtSKZGc0jlzCFfemQa0W50QBuHCAKi4HEoCChTQwUHK ++4w1IX2COPKpVJEZNZOUbWo6xbLQu4mGk+ibyQ86p3q4ofB4Rvr8Ny/lioTz3/4E2aFooC8k4gmV +BtWVyuEklut89pMFu+1z6S3RdTnX5yTb2E5fQ4+e0BQ5v1VwSJlXMbSc7kqYA5YwH2AG7hsj/oFg +IxpHYoWlzBk0gG+zrBrjn/B7SK3VAdlntqlyk+otZrWyuOQ9PLLvTIzq6we/qzWaVYa8GKa1qF60 +g2xraUDTn9zxw2lrueFtCfTxqlB2Cnp9ehehVZZCmTEJ3WARjQUwfuaORtGdFNrHF+QFlozEJLUb +zxQHskD4o55BhrwE0GuWyCqANP2/7waj3VjFhT0+j/6eKeC2uAloGRwYQw== +-----END CERTIFICATE----- + +AffirmTrust Premium ECC +======================= +-----BEGIN CERTIFICATE----- +MIIB/jCCAYWgAwIBAgIIdJclisc/elQwCgYIKoZIzj0EAwMwRTELMAkGA1UEBhMCVVMxFDASBgNV +BAoMC0FmZmlybVRydXN0MSAwHgYDVQQDDBdBZmZpcm1UcnVzdCBQcmVtaXVtIEVDQzAeFw0xMDAx +MjkxNDIwMjRaFw00MDEyMzExNDIwMjRaMEUxCzAJBgNVBAYTAlVTMRQwEgYDVQQKDAtBZmZpcm1U +cnVzdDEgMB4GA1UEAwwXQWZmaXJtVHJ1c3QgUHJlbWl1bSBFQ0MwdjAQBgcqhkjOPQIBBgUrgQQA +IgNiAAQNMF4bFZ0D0KF5Nbc6PJJ6yhUczWLznCZcBz3lVPqj1swS6vQUX+iOGasvLkjmrBhDeKzQ +N8O9ss0s5kfiGuZjuD0uL3jET9v0D6RoTFVya5UdThhClXjMNzyR4ptlKymjQjBAMB0GA1UdDgQW +BBSaryl6wBE1NSZRMADDav5A1a7WPDAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAK +BggqhkjOPQQDAwNnADBkAjAXCfOHiFBar8jAQr9HX/VsaobgxCd05DhT1wV/GzTjxi+zygk8N53X +57hG8f2h4nECMEJZh0PUUd+60wkyWs6Iflc9nF9Ca/UHLbXwgpP5WW+uZPpY5Yse42O+tYHNbwKM +eQ== +-----END CERTIFICATE----- + +Certum Trusted Network CA +========================= +-----BEGIN CERTIFICATE----- +MIIDuzCCAqOgAwIBAgIDBETAMA0GCSqGSIb3DQEBBQUAMH4xCzAJBgNVBAYTAlBMMSIwIAYDVQQK +ExlVbml6ZXRvIFRlY2hub2xvZ2llcyBTLkEuMScwJQYDVQQLEx5DZXJ0dW0gQ2VydGlmaWNhdGlv +biBBdXRob3JpdHkxIjAgBgNVBAMTGUNlcnR1bSBUcnVzdGVkIE5ldHdvcmsgQ0EwHhcNMDgxMDIy +MTIwNzM3WhcNMjkxMjMxMTIwNzM3WjB+MQswCQYDVQQGEwJQTDEiMCAGA1UEChMZVW5pemV0byBU +ZWNobm9sb2dpZXMgUy5BLjEnMCUGA1UECxMeQ2VydHVtIENlcnRpZmljYXRpb24gQXV0aG9yaXR5 +MSIwIAYDVQQDExlDZXJ0dW0gVHJ1c3RlZCBOZXR3b3JrIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC +AQ8AMIIBCgKCAQEA4/t9o3K6wvDJFIf1awFO4W5AB7ptJ11/91sts1rHUV+rpDKmYYe2bg+G0jAC +l/jXaVehGDldamR5xgFZrDwxSjh80gTSSyjoIF87B6LMTXPb865Px1bVWqeWifrzq2jUI4ZZJ88J +J7ysbnKDHDBy3+Ci6dLhdHUZvSqeexVUBBvXQzmtVSjF4hq79MDkrjhJM8x2hZ85RdKknvISjFH4 +fOQtf/WsX+sWn7Et0brMkUJ3TCXJkDhv2/DM+44el1k+1WBO5gUo7Ul5E0u6SNsv+XLTOcr+H9g0 +cvW0QM8xAcPs3hEtF10fuFDRXhmnad4HMyjKUJX5p1TLVIZQRan5SQIDAQABo0IwQDAPBgNVHRMB +Af8EBTADAQH/MB0GA1UdDgQWBBQIds3LB/8k9sXN7buQvOKEN0Z19zAOBgNVHQ8BAf8EBAMCAQYw +DQYJKoZIhvcNAQEFBQADggEBAKaorSLOAT2mo/9i0Eidi15ysHhE49wcrwn9I0j6vSrEuVUEtRCj +jSfeC4Jj0O7eDDd5QVsisrCaQVymcODU0HfLI9MA4GxWL+FpDQ3Zqr8hgVDZBqWo/5U30Kr+4rP1 +mS1FhIrlQgnXdAIv94nYmem8J9RHjboNRhx3zxSkHLmkMcScKHQDNP8zGSal6Q10tz6XxnboJ5aj +Zt3hrvJBW8qYVoNzcOSGGtIxQbovvi0TWnZvTuhOgQ4/WwMioBK+ZlgRSssDxLQqKi2WF+A5VLxI +03YnnZotBqbJ7DnSq9ufmgsnAjUpsUCV5/nonFWIGUbWtzT1fs45mtk48VH3Tyw= +-----END CERTIFICATE----- + +TWCA Root Certification Authority +================================= +-----BEGIN CERTIFICATE----- +MIIDezCCAmOgAwIBAgIBATANBgkqhkiG9w0BAQUFADBfMQswCQYDVQQGEwJUVzESMBAGA1UECgwJ +VEFJV0FOLUNBMRAwDgYDVQQLDAdSb290IENBMSowKAYDVQQDDCFUV0NBIFJvb3QgQ2VydGlmaWNh +dGlvbiBBdXRob3JpdHkwHhcNMDgwODI4MDcyNDMzWhcNMzAxMjMxMTU1OTU5WjBfMQswCQYDVQQG +EwJUVzESMBAGA1UECgwJVEFJV0FOLUNBMRAwDgYDVQQLDAdSb290IENBMSowKAYDVQQDDCFUV0NB +IFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEK +AoIBAQCwfnK4pAOU5qfeCTiRShFAh6d8WWQUe7UREN3+v9XAu1bihSX0NXIP+FPQQeFEAcK0HMMx +QhZHhTMidrIKbw/lJVBPhYa+v5guEGcevhEFhgWQxFnQfHgQsIBct+HHK3XLfJ+utdGdIzdjp9xC +oi2SBBtQwXu4PhvJVgSLL1KbralW6cH/ralYhzC2gfeXRfwZVzsrb+RH9JlF/h3x+JejiB03HFyP +4HYlmlD4oFT/RJB2I9IyxsOrBr/8+7/zrX2SYgJbKdM1o5OaQ2RgXbL6Mv87BK9NQGr5x+PvI/1r +y+UPizgN7gr8/g+YnzAx3WxSZfmLgb4i4RxYA7qRG4kHAgMBAAGjQjBAMA4GA1UdDwEB/wQEAwIB +BjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRqOFsmjd6LWvJPelSDGRjjCDWmujANBgkqhkiG +9w0BAQUFAAOCAQEAPNV3PdrfibqHDAhUaiBQkr6wQT25JmSDCi/oQMCXKCeCMErJk/9q56YAf4lC +mtYR5VPOL8zy2gXE/uJQxDqGfczafhAJO5I1KlOy/usrBdlsXebQ79NqZp4VKIV66IIArB6nCWlW +QtNoURi+VJq/REG6Sb4gumlc7rh3zc5sH62Dlhh9DrUUOYTxKOkto557HnpyWoOzeW/vtPzQCqVY +T0bf+215WfKEIlKuD8z7fDvnaspHYcN6+NOSBB+4IIThNlQWx0DeO4pz3N/GCUzf7Nr/1FNCocny +Yh0igzyXxfkZYiesZSLX0zzG5Y6yU8xJzrww/nsOM5D77dIUkR8Hrw== +-----END CERTIFICATE----- + +Security Communication RootCA2 +============================== +-----BEGIN CERTIFICATE----- +MIIDdzCCAl+gAwIBAgIBADANBgkqhkiG9w0BAQsFADBdMQswCQYDVQQGEwJKUDElMCMGA1UEChMc +U0VDT00gVHJ1c3QgU3lzdGVtcyBDTy4sTFRELjEnMCUGA1UECxMeU2VjdXJpdHkgQ29tbXVuaWNh +dGlvbiBSb290Q0EyMB4XDTA5MDUyOTA1MDAzOVoXDTI5MDUyOTA1MDAzOVowXTELMAkGA1UEBhMC +SlAxJTAjBgNVBAoTHFNFQ09NIFRydXN0IFN5c3RlbXMgQ08uLExURC4xJzAlBgNVBAsTHlNlY3Vy +aXR5IENvbW11bmljYXRpb24gUm9vdENBMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB +ANAVOVKxUrO6xVmCxF1SrjpDZYBLx/KWvNs2l9amZIyoXvDjChz335c9S672XewhtUGrzbl+dp++ ++T42NKA7wfYxEUV0kz1XgMX5iZnK5atq1LXaQZAQwdbWQonCv/Q4EpVMVAX3NuRFg3sUZdbcDE3R +3n4MqzvEFb46VqZab3ZpUql6ucjrappdUtAtCms1FgkQhNBqyjoGADdH5H5XTz+L62e4iKrFvlNV +spHEfbmwhRkGeC7bYRr6hfVKkaHnFtWOojnflLhwHyg/i/xAXmODPIMqGplrz95Zajv8bxbXH/1K +EOtOghY6rCcMU/Gt1SSwawNQwS08Ft1ENCcadfsCAwEAAaNCMEAwHQYDVR0OBBYEFAqFqXdlBZh8 +QIH4D5csOPEK7DzPMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MA0GCSqGSIb3DQEB +CwUAA4IBAQBMOqNErLlFsceTfsgLCkLfZOoc7llsCLqJX2rKSpWeeo8HxdpFcoJxDjrSzG+ntKEj +u/Ykn8sX/oymzsLS28yN/HH8AynBbF0zX2S2ZTuJbxh2ePXcokgfGT+Ok+vx+hfuzU7jBBJV1uXk +3fs+BXziHV7Gp7yXT2g69ekuCkO2r1dcYmh8t/2jioSgrGK+KwmHNPBqAbubKVY8/gA3zyNs8U6q +tnRGEmyR7jTV7JqR50S+kDFy1UkC9gLl9B/rfNmWVan/7Ir5mUf/NVoCqgTLiluHcSmRvaS0eg29 +mvVXIwAHIRc/SjnRBUkLp7Y3gaVdjKozXoEofKd9J+sAro03 +-----END CERTIFICATE----- + +EC-ACC +====== +-----BEGIN CERTIFICATE----- +MIIFVjCCBD6gAwIBAgIQ7is969Qh3hSoYqwE893EATANBgkqhkiG9w0BAQUFADCB8zELMAkGA1UE +BhMCRVMxOzA5BgNVBAoTMkFnZW5jaWEgQ2F0YWxhbmEgZGUgQ2VydGlmaWNhY2lvIChOSUYgUS0w +ODAxMTc2LUkpMSgwJgYDVQQLEx9TZXJ2ZWlzIFB1YmxpY3MgZGUgQ2VydGlmaWNhY2lvMTUwMwYD +VQQLEyxWZWdldSBodHRwczovL3d3dy5jYXRjZXJ0Lm5ldC92ZXJhcnJlbCAoYykwMzE1MDMGA1UE +CxMsSmVyYXJxdWlhIEVudGl0YXRzIGRlIENlcnRpZmljYWNpbyBDYXRhbGFuZXMxDzANBgNVBAMT +BkVDLUFDQzAeFw0wMzAxMDcyMzAwMDBaFw0zMTAxMDcyMjU5NTlaMIHzMQswCQYDVQQGEwJFUzE7 +MDkGA1UEChMyQWdlbmNpYSBDYXRhbGFuYSBkZSBDZXJ0aWZpY2FjaW8gKE5JRiBRLTA4MDExNzYt +SSkxKDAmBgNVBAsTH1NlcnZlaXMgUHVibGljcyBkZSBDZXJ0aWZpY2FjaW8xNTAzBgNVBAsTLFZl +Z2V1IGh0dHBzOi8vd3d3LmNhdGNlcnQubmV0L3ZlcmFycmVsIChjKTAzMTUwMwYDVQQLEyxKZXJh +cnF1aWEgRW50aXRhdHMgZGUgQ2VydGlmaWNhY2lvIENhdGFsYW5lczEPMA0GA1UEAxMGRUMtQUND +MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAsyLHT+KXQpWIR4NA9h0X84NzJB5R85iK +w5K4/0CQBXCHYMkAqbWUZRkiFRfCQ2xmRJoNBD45b6VLeqpjt4pEndljkYRm4CgPukLjbo73FCeT +ae6RDqNfDrHrZqJyTxIThmV6PttPB/SnCWDaOkKZx7J/sxaVHMf5NLWUhdWZXqBIoH7nF2W4onW4 +HvPlQn2v7fOKSGRdghST2MDk/7NQcvJ29rNdQlB50JQ+awwAvthrDk4q7D7SzIKiGGUzE3eeml0a +E9jD2z3Il3rucO2n5nzbcc8tlGLfbdb1OL4/pYUKGbio2Al1QnDE6u/LDsg0qBIimAy4E5S2S+zw +0JDnJwIDAQABo4HjMIHgMB0GA1UdEQQWMBSBEmVjX2FjY0BjYXRjZXJ0Lm5ldDAPBgNVHRMBAf8E +BTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUoMOLRKo3pUW/l4Ba0fF4opvpXY0wfwYD +VR0gBHgwdjB0BgsrBgEEAfV4AQMBCjBlMCwGCCsGAQUFBwIBFiBodHRwczovL3d3dy5jYXRjZXJ0 +Lm5ldC92ZXJhcnJlbDA1BggrBgEFBQcCAjApGidWZWdldSBodHRwczovL3d3dy5jYXRjZXJ0Lm5l +dC92ZXJhcnJlbCAwDQYJKoZIhvcNAQEFBQADggEBAKBIW4IB9k1IuDlVNZyAelOZ1Vr/sXE7zDkJ +lF7W2u++AVtd0x7Y/X1PzaBB4DSTv8vihpw3kpBWHNzrKQXlxJ7HNd+KDM3FIUPpqojlNcAZQmNa +Al6kSBg6hW/cnbw/nZzBh7h6YQjpdwt/cKt63dmXLGQehb+8dJahw3oS7AwaboMMPOhyRp/7SNVe +l+axofjk70YllJyJ22k4vuxcDlbHZVHlUIiIv0LVKz3l+bqeLrPK9HOSAgu+TGbrIP65y7WZf+a2 +E/rKS03Z7lNGBjvGTq2TWoF+bCpLagVFjPIhpDGQh2xlnJ2lYJU6Un/10asIbvPuW/mIPX64b24D +5EI= +-----END CERTIFICATE----- + +Hellenic Academic and Research Institutions RootCA 2011 +======================================================= +-----BEGIN CERTIFICATE----- +MIIEMTCCAxmgAwIBAgIBADANBgkqhkiG9w0BAQUFADCBlTELMAkGA1UEBhMCR1IxRDBCBgNVBAoT +O0hlbGxlbmljIEFjYWRlbWljIGFuZCBSZXNlYXJjaCBJbnN0aXR1dGlvbnMgQ2VydC4gQXV0aG9y +aXR5MUAwPgYDVQQDEzdIZWxsZW5pYyBBY2FkZW1pYyBhbmQgUmVzZWFyY2ggSW5zdGl0dXRpb25z +IFJvb3RDQSAyMDExMB4XDTExMTIwNjEzNDk1MloXDTMxMTIwMTEzNDk1MlowgZUxCzAJBgNVBAYT +AkdSMUQwQgYDVQQKEztIZWxsZW5pYyBBY2FkZW1pYyBhbmQgUmVzZWFyY2ggSW5zdGl0dXRpb25z +IENlcnQuIEF1dGhvcml0eTFAMD4GA1UEAxM3SGVsbGVuaWMgQWNhZGVtaWMgYW5kIFJlc2VhcmNo +IEluc3RpdHV0aW9ucyBSb290Q0EgMjAxMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB +AKlTAOMupvaO+mDYLZU++CwqVE7NuYRhlFhPjz2L5EPzdYmNUeTDN9KKiE15HrcS3UN4SoqS5tdI +1Q+kOilENbgH9mgdVc04UfCMJDGFr4PJfel3r+0ae50X+bOdOFAPplp5kYCvN66m0zH7tSYJnTxa +71HFK9+WXesyHgLacEnsbgzImjeN9/E2YEsmLIKe0HjzDQ9jpFEw4fkrJxIH2Oq9GGKYsFk3fb7u +8yBRQlqD75O6aRXxYp2fmTmCobd0LovUxQt7L/DICto9eQqakxylKHJzkUOap9FNhYS5qXSPFEDH +3N6sQWRstBmbAmNtJGSPRLIl6s5ddAxjMlyNh+UCAwEAAaOBiTCBhjAPBgNVHRMBAf8EBTADAQH/ +MAsGA1UdDwQEAwIBBjAdBgNVHQ4EFgQUppFC/RNhSiOeCKQp5dgTBCPuQSUwRwYDVR0eBEAwPqA8 +MAWCAy5ncjAFggMuZXUwBoIELmVkdTAGggQub3JnMAWBAy5ncjAFgQMuZXUwBoEELmVkdTAGgQQu +b3JnMA0GCSqGSIb3DQEBBQUAA4IBAQAf73lB4XtuP7KMhjdCSk4cNx6NZrokgclPEg8hwAOXhiVt +XdMiKahsog2p6z0GW5k6x8zDmjR/qw7IThzh+uTczQ2+vyT+bOdrwg3IBp5OjWEopmr95fZi6hg8 +TqBTnbI6nOulnJEWtk2C4AwFSKls9cz4y51JtPACpf1wA+2KIaWuE4ZJwzNzvoc7dIsXRSZMFpGD +/md9zU1jZ/rzAxKWeAaNsWftjj++n08C9bMJL/NMh98qy5V8AcysNnq/onN694/BtZqhFLKPM58N +7yLcZnuEvUUXBj08yrl3NI/K6s8/MT7jiOOASSXIl7WdmplNsDz4SgCbZN2fOUvRJ9e4 +-----END CERTIFICATE----- + +Actalis Authentication Root CA +============================== +-----BEGIN CERTIFICATE----- +MIIFuzCCA6OgAwIBAgIIVwoRl0LE48wwDQYJKoZIhvcNAQELBQAwazELMAkGA1UEBhMCSVQxDjAM +BgNVBAcMBU1pbGFuMSMwIQYDVQQKDBpBY3RhbGlzIFMucC5BLi8wMzM1ODUyMDk2NzEnMCUGA1UE +AwweQWN0YWxpcyBBdXRoZW50aWNhdGlvbiBSb290IENBMB4XDTExMDkyMjExMjIwMloXDTMwMDky +MjExMjIwMlowazELMAkGA1UEBhMCSVQxDjAMBgNVBAcMBU1pbGFuMSMwIQYDVQQKDBpBY3RhbGlz +IFMucC5BLi8wMzM1ODUyMDk2NzEnMCUGA1UEAwweQWN0YWxpcyBBdXRoZW50aWNhdGlvbiBSb290 +IENBMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEAp8bEpSmkLO/lGMWwUKNvUTufClrJ +wkg4CsIcoBh/kbWHuUA/3R1oHwiD1S0eiKD4j1aPbZkCkpAW1V8IbInX4ay8IMKx4INRimlNAJZa +by/ARH6jDuSRzVju3PvHHkVH3Se5CAGfpiEd9UEtL0z9KK3giq0itFZljoZUj5NDKd45RnijMCO6 +zfB9E1fAXdKDa0hMxKufgFpbOr3JpyI/gCczWw63igxdBzcIy2zSekciRDXFzMwujt0q7bd9Zg1f +YVEiVRvjRuPjPdA1YprbrxTIW6HMiRvhMCb8oJsfgadHHwTrozmSBp+Z07/T6k9QnBn+locePGX2 +oxgkg4YQ51Q+qDp2JE+BIcXjDwL4k5RHILv+1A7TaLndxHqEguNTVHnd25zS8gebLra8Pu2Fbe8l +EfKXGkJh90qX6IuxEAf6ZYGyojnP9zz/GPvG8VqLWeICrHuS0E4UT1lF9gxeKF+w6D9Fz8+vm2/7 +hNN3WpVvrJSEnu68wEqPSpP4RCHiMUVhUE4Q2OM1fEwZtN4Fv6MGn8i1zeQf1xcGDXqVdFUNaBr8 +EBtiZJ1t4JWgw5QHVw0U5r0F+7if5t+L4sbnfpb2U8WANFAoWPASUHEXMLrmeGO89LKtmyuy/uE5 +jF66CyCU3nuDuP/jVo23Eek7jPKxwV2dpAtMK9myGPW1n0sCAwEAAaNjMGEwHQYDVR0OBBYEFFLY +iDrIn3hm7YnzezhwlMkCAjbQMA8GA1UdEwEB/wQFMAMBAf8wHwYDVR0jBBgwFoAUUtiIOsifeGbt +ifN7OHCUyQICNtAwDgYDVR0PAQH/BAQDAgEGMA0GCSqGSIb3DQEBCwUAA4ICAQALe3KHwGCmSUyI +WOYdiPcUZEim2FgKDk8TNd81HdTtBjHIgT5q1d07GjLukD0R0i70jsNjLiNmsGe+b7bAEzlgqqI0 +JZN1Ut6nna0Oh4lScWoWPBkdg/iaKWW+9D+a2fDzWochcYBNy+A4mz+7+uAwTc+G02UQGRjRlwKx +K3JCaKygvU5a2hi/a5iB0P2avl4VSM0RFbnAKVy06Ij3Pjaut2L9HmLecHgQHEhb2rykOLpn7VU+ +Xlff1ANATIGk0k9jpwlCCRT8AKnCgHNPLsBA2RF7SOp6AsDT6ygBJlh0wcBzIm2Tlf05fbsq4/aC +4yyXX04fkZT6/iyj2HYauE2yOE+b+h1IYHkm4vP9qdCa6HCPSXrW5b0KDtst842/6+OkfcvHlXHo +2qN8xcL4dJIEG4aspCJTQLas/kx2z/uUMsA1n3Y/buWQbqCmJqK4LL7RK4X9p2jIugErsWx0Hbhz +lefut8cl8ABMALJ+tguLHPPAUJ4lueAI3jZm/zel0btUZCzJJ7VLkn5l/9Mt4blOvH+kQSGQQXem +OR/qnuOf0GZvBeyqdn6/axag67XH/JJULysRJyU3eExRarDzzFhdFPFqSBX/wge2sY0PjlxQRrM9 +vwGYT7JZVEc+NHt4bVaTLnPqZih4zR0Uv6CPLy64Lo7yFIrM6bV8+2ydDKXhlg== +-----END CERTIFICATE----- + +Trustis FPS Root CA +=================== +-----BEGIN CERTIFICATE----- +MIIDZzCCAk+gAwIBAgIQGx+ttiD5JNM2a/fH8YygWTANBgkqhkiG9w0BAQUFADBFMQswCQYDVQQG +EwJHQjEYMBYGA1UEChMPVHJ1c3RpcyBMaW1pdGVkMRwwGgYDVQQLExNUcnVzdGlzIEZQUyBSb290 +IENBMB4XDTAzMTIyMzEyMTQwNloXDTI0MDEyMTExMzY1NFowRTELMAkGA1UEBhMCR0IxGDAWBgNV +BAoTD1RydXN0aXMgTGltaXRlZDEcMBoGA1UECxMTVHJ1c3RpcyBGUFMgUm9vdCBDQTCCASIwDQYJ +KoZIhvcNAQEBBQADggEPADCCAQoCggEBAMVQe547NdDfxIzNjpvto8A2mfRC6qc+gIMPpqdZh8mQ +RUN+AOqGeSoDvT03mYlmt+WKVoaTnGhLaASMk5MCPjDSNzoiYYkchU59j9WvezX2fihHiTHcDnlk +H5nSW7r+f2C/revnPDgpai/lkQtV/+xvWNUtyd5MZnGPDNcE2gfmHhjjvSkCqPoc4Vu5g6hBSLwa +cY3nYuUtsuvffM/bq1rKMfFMIvMFE/eC+XN5DL7XSxzA0RU8k0Fk0ea+IxciAIleH2ulrG6nS4zt +o3Lmr2NNL4XSFDWaLk6M6jKYKIahkQlBOrTh4/L68MkKokHdqeMDx4gVOxzUGpTXn2RZEm0CAwEA +AaNTMFEwDwYDVR0TAQH/BAUwAwEB/zAfBgNVHSMEGDAWgBS6+nEleYtXQSUhhgtx67JkDoshZzAd +BgNVHQ4EFgQUuvpxJXmLV0ElIYYLceuyZA6LIWcwDQYJKoZIhvcNAQEFBQADggEBAH5Y//01GX2c +GE+esCu8jowU/yyg2kdbw++BLa8F6nRIW/M+TgfHbcWzk88iNVy2P3UnXwmWzaD+vkAMXBJV+JOC +yinpXj9WV4s4NvdFGkwozZ5BuO1WTISkQMi4sKUraXAEasP41BIy+Q7DsdwyhEQsb8tGD+pmQQ9P +8Vilpg0ND2HepZ5dfWWhPBfnqFVO76DH7cZEf1T1o+CP8HxVIo8ptoGj4W1OLBuAZ+ytIJ8MYmHV +l/9D7S3B2l0pKoU/rGXuhg8FjZBf3+6f9L/uHfuY5H+QK4R4EA5sSVPvFVtlRkpdr7r7OnIdzfYl +iB6XzCGcKQENZetX2fNXlrtIzYE= +-----END CERTIFICATE----- + +Buypass Class 2 Root CA +======================= +-----BEGIN CERTIFICATE----- +MIIFWTCCA0GgAwIBAgIBAjANBgkqhkiG9w0BAQsFADBOMQswCQYDVQQGEwJOTzEdMBsGA1UECgwU +QnV5cGFzcyBBUy05ODMxNjMzMjcxIDAeBgNVBAMMF0J1eXBhc3MgQ2xhc3MgMiBSb290IENBMB4X +DTEwMTAyNjA4MzgwM1oXDTQwMTAyNjA4MzgwM1owTjELMAkGA1UEBhMCTk8xHTAbBgNVBAoMFEJ1 +eXBhc3MgQVMtOTgzMTYzMzI3MSAwHgYDVQQDDBdCdXlwYXNzIENsYXNzIDIgUm9vdCBDQTCCAiIw +DQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANfHXvfBB9R3+0Mh9PT1aeTuMgHbo4Yf5FkNuud1 +g1Lr6hxhFUi7HQfKjK6w3Jad6sNgkoaCKHOcVgb/S2TwDCo3SbXlzwx87vFKu3MwZfPVL4O2fuPn +9Z6rYPnT8Z2SdIrkHJasW4DptfQxh6NR/Md+oW+OU3fUl8FVM5I+GC911K2GScuVr1QGbNgGE41b +/+EmGVnAJLqBcXmQRFBoJJRfuLMR8SlBYaNByyM21cHxMlAQTn/0hpPshNOOvEu/XAFOBz3cFIqU +CqTqc/sLUegTBxj6DvEr0VQVfTzh97QZQmdiXnfgolXsttlpF9U6r0TtSsWe5HonfOV116rLJeff +awrbD02TTqigzXsu8lkBarcNuAeBfos4GzjmCleZPe4h6KP1DBbdi+w0jpwqHAAVF41og9JwnxgI +zRFo1clrUs3ERo/ctfPYV3Me6ZQ5BL/T3jjetFPsaRyifsSP5BtwrfKi+fv3FmRmaZ9JUaLiFRhn +Bkp/1Wy1TbMz4GHrXb7pmA8y1x1LPC5aAVKRCfLf6o3YBkBjqhHk/sM3nhRSP/TizPJhk9H9Z2vX +Uq6/aKtAQ6BXNVN48FP4YUIHZMbXb5tMOA1jrGKvNouicwoN9SG9dKpN6nIDSdvHXx1iY8f93ZHs +M+71bbRuMGjeyNYmsHVee7QHIJihdjK4TWxPAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD +VR0OBBYEFMmAd+BikoL1RpzzuvdMw964o605MA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQsF +AAOCAgEAU18h9bqwOlI5LJKwbADJ784g7wbylp7ppHR/ehb8t/W2+xUbP6umwHJdELFx7rxP462s +A20ucS6vxOOto70MEae0/0qyexAQH6dXQbLArvQsWdZHEIjzIVEpMMpghq9Gqx3tOluwlN5E40EI +osHsHdb9T7bWR9AUC8rmyrV7d35BH16Dx7aMOZawP5aBQW9gkOLo+fsicdl9sz1Gv7SEr5AcD48S +aq/v7h56rgJKihcrdv6sVIkkLE8/trKnToyokZf7KcZ7XC25y2a2t6hbElGFtQl+Ynhw/qlqYLYd +DnkM/crqJIByw5c/8nerQyIKx+u2DISCLIBrQYoIwOula9+ZEsuK1V6ADJHgJgg2SMX6OBE1/yWD +LfJ6v9r9jv6ly0UsH8SIU653DtmadsWOLB2jutXsMq7Aqqz30XpN69QH4kj3Io6wpJ9qzo6ysmD0 +oyLQI+uUWnpp3Q+/QFesa1lQ2aOZ4W7+jQF5JyMV3pKdewlNWudLSDBaGOYKbeaP4NK75t98biGC +wWg5TbSYWGZizEqQXsP6JwSxeRV0mcy+rSDeJmAc61ZRpqPq5KM/p/9h3PFaTWwyI0PurKju7koS +CTxdccK+efrCh2gdC/1cacwG0Jp9VJkqyTkaGa9LKkPzY11aWOIv4x3kqdbQCtCev9eBCfHJxyYN +rJgWVqA= +-----END CERTIFICATE----- + +Buypass Class 3 Root CA +======================= +-----BEGIN CERTIFICATE----- +MIIFWTCCA0GgAwIBAgIBAjANBgkqhkiG9w0BAQsFADBOMQswCQYDVQQGEwJOTzEdMBsGA1UECgwU +QnV5cGFzcyBBUy05ODMxNjMzMjcxIDAeBgNVBAMMF0J1eXBhc3MgQ2xhc3MgMyBSb290IENBMB4X +DTEwMTAyNjA4Mjg1OFoXDTQwMTAyNjA4Mjg1OFowTjELMAkGA1UEBhMCTk8xHTAbBgNVBAoMFEJ1 +eXBhc3MgQVMtOTgzMTYzMzI3MSAwHgYDVQQDDBdCdXlwYXNzIENsYXNzIDMgUm9vdCBDQTCCAiIw +DQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAKXaCpUWUOOV8l6ddjEGMnqb8RB2uACatVI2zSRH +sJ8YZLya9vrVediQYkwiL944PdbgqOkcLNt4EemOaFEVcsfzM4fkoF0LXOBXByow9c3EN3coTRiR +5r/VUv1xLXA+58bEiuPwKAv0dpihi4dVsjoT/Lc+JzeOIuOoTyrvYLs9tznDDgFHmV0ST9tD+leh +7fmdvhFHJlsTmKtdFoqwNxxXnUX/iJY2v7vKB3tvh2PX0DJq1l1sDPGzbjniazEuOQAnFN44wOwZ +ZoYS6J1yFhNkUsepNxz9gjDthBgd9K5c/3ATAOux9TN6S9ZV+AWNS2mw9bMoNlwUxFFzTWsL8TQH +2xc519woe2v1n/MuwU8XKhDzzMro6/1rqy6any2CbgTUUgGTLT2G/H783+9CHaZr77kgxve9oKeV +/afmiSTYzIw0bOIjL9kSGiG5VZFvC5F5GQytQIgLcOJ60g7YaEi7ghM5EFjp2CoHxhLbWNvSO1UQ +RwUVZ2J+GGOmRj8JDlQyXr8NYnon74Do29lLBlo3WiXQCBJ31G8JUJc9yB3D34xFMFbG02SrZvPA +Xpacw8Tvw3xrizp5f7NJzz3iiZ+gMEuFuZyUJHmPfWupRWgPK9Dx2hzLabjKSWJtyNBjYt1gD1iq +j6G8BaVmos8bdrKEZLFMOVLAMLrwjEsCsLa3AgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD +VR0OBBYEFEe4zf/lb+74suwvTg75JbCOPGvDMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQsF +AAOCAgEAACAjQTUEkMJAYmDv4jVM1z+s4jSQuKFvdvoWFqRINyzpkMLyPPgKn9iB5btb2iUspKdV +cSQy9sgL8rxq+JOssgfCX5/bzMiKqr5qb+FJEMwx14C7u8jYog5kV+qi9cKpMRXSIGrs/CIBKM+G +uIAeqcwRpTzyFrNHnfzSgCHEy9BHcEGhyoMZCCxt8l13nIoUE9Q2HJLw5QY33KbmkJs4j1xrG0aG +Q0JfPgEHU1RdZX33inOhmlRaHylDFCfChQ+1iHsaO5S3HWCntZznKWlXWpuTekMwGwPXYshApqr8 +ZORK15FTAaggiG6cX0S5y2CBNOxv033aSF/rtJC8LakcC6wc1aJoIIAE1vyxjy+7SjENSoYc6+I2 +KSb12tjE8nVhz36udmNKekBlk4f4HoCMhuWG1o8O/FMsYOgWYRqiPkN7zTlgVGr18okmAWiDSKIz +6MkEkbIRNBE+6tBDGR8Dk5AM/1E9V/RBbuHLoL7ryWPNbczk+DaqaJ3tvV2XcEQNtg413OEMXbug +UZTLfhbrES+jkkXITHHZvMmZUldGL1DPvTVp9D0VzgalLA8+9oG6lLvDu79leNKGef9JOxqDDPDe +eOzI8k1MGt6CKfjBWtrt7uYnXuhF0J0cUahoq0Tj0Itq4/g7u9xN12TyUb7mqqta6THuBrxzvxNi +Cp/HuZc= +-----END CERTIFICATE----- + +T-TeleSec GlobalRoot Class 3 +============================ +-----BEGIN CERTIFICATE----- +MIIDwzCCAqugAwIBAgIBATANBgkqhkiG9w0BAQsFADCBgjELMAkGA1UEBhMCREUxKzApBgNVBAoM +IlQtU3lzdGVtcyBFbnRlcnByaXNlIFNlcnZpY2VzIEdtYkgxHzAdBgNVBAsMFlQtU3lzdGVtcyBU +cnVzdCBDZW50ZXIxJTAjBgNVBAMMHFQtVGVsZVNlYyBHbG9iYWxSb290IENsYXNzIDMwHhcNMDgx +MDAxMTAyOTU2WhcNMzMxMDAxMjM1OTU5WjCBgjELMAkGA1UEBhMCREUxKzApBgNVBAoMIlQtU3lz +dGVtcyBFbnRlcnByaXNlIFNlcnZpY2VzIEdtYkgxHzAdBgNVBAsMFlQtU3lzdGVtcyBUcnVzdCBD +ZW50ZXIxJTAjBgNVBAMMHFQtVGVsZVNlYyBHbG9iYWxSb290IENsYXNzIDMwggEiMA0GCSqGSIb3 +DQEBAQUAA4IBDwAwggEKAoIBAQC9dZPwYiJvJK7genasfb3ZJNW4t/zN8ELg63iIVl6bmlQdTQyK +9tPPcPRStdiTBONGhnFBSivwKixVA9ZIw+A5OO3yXDw/RLyTPWGrTs0NvvAgJ1gORH8EGoel15YU +NpDQSXuhdfsaa3Ox+M6pCSzyU9XDFES4hqX2iys52qMzVNn6chr3IhUciJFrf2blw2qAsCTz34ZF +iP0Zf3WHHx+xGwpzJFu5ZeAsVMhg02YXP+HMVDNzkQI6pn97djmiH5a2OK61yJN0HZ65tOVgnS9W +0eDrXltMEnAMbEQgqxHY9Bn20pxSN+f6tsIxO0rUFJmtxxr1XV/6B7h8DR/Wgx6zAgMBAAGjQjBA +MA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBS1A/d2O2GCahKqGFPr +AyGUv/7OyjANBgkqhkiG9w0BAQsFAAOCAQEAVj3vlNW92nOyWL6ukK2YJ5f+AbGwUgC4TeQbIXQb +fsDuXmkqJa9c1h3a0nnJ85cp4IaH3gRZD/FZ1GSFS5mvJQQeyUapl96Cshtwn5z2r3Ex3XsFpSzT +ucpH9sry9uetuUg/vBa3wW306gmv7PO15wWeph6KU1HWk4HMdJP2udqmJQV0eVp+QD6CSyYRMG7h +P0HHRwA11fXT91Q+gT3aSWqas+8QPebrb9HIIkfLzM8BMZLZGOMivgkeGj5asuRrDFR6fUNOuIml +e9eiPZaGzPImNC1qkp2aGtAw4l1OBLBfiyB+d8E9lYLRRpo7PHi4b6HQDWSieB4pTpPDpFQUWw== +-----END CERTIFICATE----- + +EE Certification Centre Root CA +=============================== +-----BEGIN CERTIFICATE----- +MIIEAzCCAuugAwIBAgIQVID5oHPtPwBMyonY43HmSjANBgkqhkiG9w0BAQUFADB1MQswCQYDVQQG +EwJFRTEiMCAGA1UECgwZQVMgU2VydGlmaXRzZWVyaW1pc2tlc2t1czEoMCYGA1UEAwwfRUUgQ2Vy +dGlmaWNhdGlvbiBDZW50cmUgUm9vdCBDQTEYMBYGCSqGSIb3DQEJARYJcGtpQHNrLmVlMCIYDzIw +MTAxMDMwMTAxMDMwWhgPMjAzMDEyMTcyMzU5NTlaMHUxCzAJBgNVBAYTAkVFMSIwIAYDVQQKDBlB +UyBTZXJ0aWZpdHNlZXJpbWlza2Vza3VzMSgwJgYDVQQDDB9FRSBDZXJ0aWZpY2F0aW9uIENlbnRy +ZSBSb290IENBMRgwFgYJKoZIhvcNAQkBFglwa2lAc2suZWUwggEiMA0GCSqGSIb3DQEBAQUAA4IB +DwAwggEKAoIBAQDIIMDs4MVLqwd4lfNE7vsLDP90jmG7sWLqI9iroWUyeuuOF0+W2Ap7kaJjbMeM +TC55v6kF/GlclY1i+blw7cNRfdCT5mzrMEvhvH2/UpvObntl8jixwKIy72KyaOBhU8E2lf/slLo2 +rpwcpzIP5Xy0xm90/XsY6KxX7QYgSzIwWFv9zajmofxwvI6Sc9uXp3whrj3B9UiHbCe9nyV0gVWw +93X2PaRka9ZP585ArQ/dMtO8ihJTmMmJ+xAdTX7Nfh9WDSFwhfYggx/2uh8Ej+p3iDXE/+pOoYtN +P2MbRMNE1CV2yreN1x5KZmTNXMWcg+HCCIia7E6j8T4cLNlsHaFLAgMBAAGjgYowgYcwDwYDVR0T +AQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFBLyWj7qVhy/zQas8fElyalL1BSZ +MEUGA1UdJQQ+MDwGCCsGAQUFBwMCBggrBgEFBQcDAQYIKwYBBQUHAwMGCCsGAQUFBwMEBggrBgEF +BQcDCAYIKwYBBQUHAwkwDQYJKoZIhvcNAQEFBQADggEBAHv25MANqhlHt01Xo/6tu7Fq1Q+e2+Rj +xY6hUFaTlrg4wCQiZrxTFGGVv9DHKpY5P30osxBAIWrEr7BSdxjhlthWXePdNl4dp1BUoMUq5KqM +lIpPnTX/dqQGE5Gion0ARD9V04I8GtVbvFZMIi5GQ4okQC3zErg7cBqklrkar4dBGmoYDQZPxz5u +uSlNDUmJEYcyW+ZLBMjkXOZ0c5RdFpgTlf7727FE5TpwrDdr5rMzcijJs1eg9gIWiAYLtqZLICjU +3j2LrTcFU3T+bsy8QxdxXvnFzBqpYe73dgzzcvRyrc9yAjYHR8/vGVCJYMzpJJUPwssd8m92kMfM +dcGWxZ0= +-----END CERTIFICATE----- + +D-TRUST Root Class 3 CA 2 2009 +============================== +-----BEGIN CERTIFICATE----- +MIIEMzCCAxugAwIBAgIDCYPzMA0GCSqGSIb3DQEBCwUAME0xCzAJBgNVBAYTAkRFMRUwEwYDVQQK +DAxELVRydXN0IEdtYkgxJzAlBgNVBAMMHkQtVFJVU1QgUm9vdCBDbGFzcyAzIENBIDIgMjAwOTAe +Fw0wOTExMDUwODM1NThaFw0yOTExMDUwODM1NThaME0xCzAJBgNVBAYTAkRFMRUwEwYDVQQKDAxE +LVRydXN0IEdtYkgxJzAlBgNVBAMMHkQtVFJVU1QgUm9vdCBDbGFzcyAzIENBIDIgMjAwOTCCASIw +DQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBANOySs96R+91myP6Oi/WUEWJNTrGa9v+2wBoqOAD +ER03UAifTUpolDWzU9GUY6cgVq/eUXjsKj3zSEhQPgrfRlWLJ23DEE0NkVJD2IfgXU42tSHKXzlA +BF9bfsyjxiupQB7ZNoTWSPOSHjRGICTBpFGOShrvUD9pXRl/RcPHAY9RySPocq60vFYJfxLLHLGv +KZAKyVXMD9O0Gu1HNVpK7ZxzBCHQqr0ME7UAyiZsxGsMlFqVlNpQmvH/pStmMaTJOKDfHR+4CS7z +p+hnUquVH+BGPtikw8paxTGA6Eian5Rp/hnd2HN8gcqW3o7tszIFZYQ05ub9VxC1X3a/L7AQDcUC +AwEAAaOCARowggEWMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFP3aFMSfMN4hvR5COfyrYyNJ +4PGEMA4GA1UdDwEB/wQEAwIBBjCB0wYDVR0fBIHLMIHIMIGAoH6gfIZ6bGRhcDovL2RpcmVjdG9y +eS5kLXRydXN0Lm5ldC9DTj1ELVRSVVNUJTIwUm9vdCUyMENsYXNzJTIwMyUyMENBJTIwMiUyMDIw +MDksTz1ELVRydXN0JTIwR21iSCxDPURFP2NlcnRpZmljYXRlcmV2b2NhdGlvbmxpc3QwQ6BBoD+G +PWh0dHA6Ly93d3cuZC10cnVzdC5uZXQvY3JsL2QtdHJ1c3Rfcm9vdF9jbGFzc18zX2NhXzJfMjAw +OS5jcmwwDQYJKoZIhvcNAQELBQADggEBAH+X2zDI36ScfSF6gHDOFBJpiBSVYEQBrLLpME+bUMJm +2H6NMLVwMeniacfzcNsgFYbQDfC+rAF1hM5+n02/t2A7nPPKHeJeaNijnZflQGDSNiH+0LS4F9p0 +o3/U37CYAqxva2ssJSRyoWXuJVrl5jLn8t+rSfrzkGkj2wTZ51xY/GXUl77M/C4KzCUqNQT4YJEV +dT1B/yMfGchs64JTBKbkTCJNjYy6zltz7GRUUG3RnFX7acM2w4y8PIWmawomDeCTmGCufsYkl4ph +X5GOZpIJhzbNi5stPvZR1FDUWSi9g/LMKHtThm3YJohw1+qRzT65ysCQblrGXnRl11z+o+I= +-----END CERTIFICATE----- + +D-TRUST Root Class 3 CA 2 EV 2009 +================================= +-----BEGIN CERTIFICATE----- +MIIEQzCCAyugAwIBAgIDCYP0MA0GCSqGSIb3DQEBCwUAMFAxCzAJBgNVBAYTAkRFMRUwEwYDVQQK +DAxELVRydXN0IEdtYkgxKjAoBgNVBAMMIUQtVFJVU1QgUm9vdCBDbGFzcyAzIENBIDIgRVYgMjAw +OTAeFw0wOTExMDUwODUwNDZaFw0yOTExMDUwODUwNDZaMFAxCzAJBgNVBAYTAkRFMRUwEwYDVQQK +DAxELVRydXN0IEdtYkgxKjAoBgNVBAMMIUQtVFJVU1QgUm9vdCBDbGFzcyAzIENBIDIgRVYgMjAw +OTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAJnxhDRwui+3MKCOvXwEz75ivJn9gpfS +egpnljgJ9hBOlSJzmY3aFS3nBfwZcyK3jpgAvDw9rKFs+9Z5JUut8Mxk2og+KbgPCdM03TP1YtHh +zRnp7hhPTFiu4h7WDFsVWtg6uMQYZB7jM7K1iXdODL/ZlGsTl28So/6ZqQTMFexgaDbtCHu39b+T +7WYxg4zGcTSHThfqr4uRjRxWQa4iN1438h3Z0S0NL2lRp75mpoo6Kr3HGrHhFPC+Oh25z1uxav60 +sUYgovseO3Dvk5h9jHOW8sXvhXCtKSb8HgQ+HKDYD8tSg2J87otTlZCpV6LqYQXY+U3EJ/pure35 +11H3a6UCAwEAAaOCASQwggEgMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFNOUikxiEyoZLsyv +cop9NteaHNxnMA4GA1UdDwEB/wQEAwIBBjCB3QYDVR0fBIHVMIHSMIGHoIGEoIGBhn9sZGFwOi8v +ZGlyZWN0b3J5LmQtdHJ1c3QubmV0L0NOPUQtVFJVU1QlMjBSb290JTIwQ2xhc3MlMjAzJTIwQ0El +MjAyJTIwRVYlMjAyMDA5LE89RC1UcnVzdCUyMEdtYkgsQz1ERT9jZXJ0aWZpY2F0ZXJldm9jYXRp +b25saXN0MEagRKBChkBodHRwOi8vd3d3LmQtdHJ1c3QubmV0L2NybC9kLXRydXN0X3Jvb3RfY2xh +c3NfM19jYV8yX2V2XzIwMDkuY3JsMA0GCSqGSIb3DQEBCwUAA4IBAQA07XtaPKSUiO8aEXUHL7P+ +PPoeUSbrh/Yp3uDx1MYkCenBz1UbtDDZzhr+BlGmFaQt77JLvyAoJUnRpjZ3NOhk31KxEcdzes05 +nsKtjHEh8lprr988TlWvsoRlFIm5d8sqMb7Po23Pb0iUMkZv53GMoKaEGTcH8gNFCSuGdXzfX2lX +ANtu2KZyIktQ1HWYVt+3GP9DQ1CuekR78HlR10M9p9OB0/DJT7naxpeG0ILD5EJt/rDiZE4OJudA +NCa1CInXCGNjOCd1HjPqbqjdn5lPdE2BiYBL3ZqXKVwvvoFBuYz/6n1gBp7N1z3TLqMVvKjmJuVv +w9y4AyHqnxbxLFS1 +-----END CERTIFICATE----- + +CA Disig Root R2 +================ +-----BEGIN CERTIFICATE----- +MIIFaTCCA1GgAwIBAgIJAJK4iNuwisFjMA0GCSqGSIb3DQEBCwUAMFIxCzAJBgNVBAYTAlNLMRMw +EQYDVQQHEwpCcmF0aXNsYXZhMRMwEQYDVQQKEwpEaXNpZyBhLnMuMRkwFwYDVQQDExBDQSBEaXNp +ZyBSb290IFIyMB4XDTEyMDcxOTA5MTUzMFoXDTQyMDcxOTA5MTUzMFowUjELMAkGA1UEBhMCU0sx +EzARBgNVBAcTCkJyYXRpc2xhdmExEzARBgNVBAoTCkRpc2lnIGEucy4xGTAXBgNVBAMTEENBIERp +c2lnIFJvb3QgUjIwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCio8QACdaFXS1tFPbC +w3OeNcJxVX6B+6tGUODBfEl45qt5WDza/3wcn9iXAng+a0EE6UG9vgMsRfYvZNSrXaNHPWSb6Wia +xswbP7q+sos0Ai6YVRn8jG+qX9pMzk0DIaPY0jSTVpbLTAwAFjxfGs3Ix2ymrdMxp7zo5eFm1tL7 +A7RBZckQrg4FY8aAamkw/dLukO8NJ9+flXP04SXabBbeQTg06ov80egEFGEtQX6sx3dOy1FU+16S +GBsEWmjGycT6txOgmLcRK7fWV8x8nhfRyyX+hk4kLlYMeE2eARKmK6cBZW58Yh2EhN/qwGu1pSqV +g8NTEQxzHQuyRpDRQjrOQG6Vrf/GlK1ul4SOfW+eioANSW1z4nuSHsPzwfPrLgVv2RvPN3YEyLRa +5Beny912H9AZdugsBbPWnDTYltxhh5EF5EQIM8HauQhl1K6yNg3ruji6DOWbnuuNZt2Zz9aJQfYE +koopKW1rOhzndX0CcQ7zwOe9yxndnWCywmZgtrEE7snmhrmaZkCo5xHtgUUDi/ZnWejBBhG93c+A +Ak9lQHhcR1DIm+YfgXvkRKhbhZri3lrVx/k6RGZL5DJUfORsnLMOPReisjQS1n6yqEm70XooQL6i +Fh/f5DcfEXP7kAplQ6INfPgGAVUzfbANuPT1rqVCV3w2EYx7XsQDnYx5nQIDAQABo0IwQDAPBgNV +HRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUtZn4r7CU9eMg1gqtzk5WpC5u +Qu0wDQYJKoZIhvcNAQELBQADggIBACYGXnDnZTPIgm7ZnBc6G3pmsgH2eDtpXi/q/075KMOYKmFM +tCQSin1tERT3nLXK5ryeJ45MGcipvXrA1zYObYVybqjGom32+nNjf7xueQgcnYqfGopTpti72TVV +sRHFqQOzVju5hJMiXn7B9hJSi+osZ7z+Nkz1uM/Rs0mSO9MpDpkblvdhuDvEK7Z4bLQjb/D907Je +dR+Zlais9trhxTF7+9FGs9K8Z7RiVLoJ92Owk6Ka+elSLotgEqv89WBW7xBci8QaQtyDW2QOy7W8 +1k/BfDxujRNt+3vrMNDcTa/F1balTFtxyegxvug4BkihGuLq0t4SOVga/4AOgnXmt8kHbA7v/zjx +mHHEt38OFdAlab0inSvtBfZGR6ztwPDUO+Ls7pZbkBNOHlY667DvlruWIxG68kOGdGSVyCh13x01 +utI3gzhTODY7z2zp+WsO0PsE6E9312UBeIYMej4hYvF/Y3EMyZ9E26gnonW+boE+18DrG5gPcFw0 +sorMwIUY6256s/daoQe/qUKS82Ail+QUoQebTnbAjn39pCXHR+3/H3OszMOl6W8KjptlwlCFtaOg +UxLMVYdh84GuEEZhvUQhuMI9dM9+JDX6HAcOmz0iyu8xL4ysEr3vQCj8KWefshNPZiTEUxnpHikV +7+ZtsH8tZ/3zbBt1RqPlShfppNcL +-----END CERTIFICATE----- + +ACCVRAIZ1 +========= +-----BEGIN CERTIFICATE----- +MIIH0zCCBbugAwIBAgIIXsO3pkN/pOAwDQYJKoZIhvcNAQEFBQAwQjESMBAGA1UEAwwJQUNDVlJB +SVoxMRAwDgYDVQQLDAdQS0lBQ0NWMQ0wCwYDVQQKDARBQ0NWMQswCQYDVQQGEwJFUzAeFw0xMTA1 +MDUwOTM3MzdaFw0zMDEyMzEwOTM3MzdaMEIxEjAQBgNVBAMMCUFDQ1ZSQUlaMTEQMA4GA1UECwwH +UEtJQUNDVjENMAsGA1UECgwEQUNDVjELMAkGA1UEBhMCRVMwggIiMA0GCSqGSIb3DQEBAQUAA4IC +DwAwggIKAoICAQCbqau/YUqXry+XZpp0X9DZlv3P4uRm7x8fRzPCRKPfmt4ftVTdFXxpNRFvu8gM +jmoYHtiP2Ra8EEg2XPBjs5BaXCQ316PWywlxufEBcoSwfdtNgM3802/J+Nq2DoLSRYWoG2ioPej0 +RGy9ocLLA76MPhMAhN9KSMDjIgro6TenGEyxCQ0jVn8ETdkXhBilyNpAlHPrzg5XPAOBOp0KoVdD +aaxXbXmQeOW1tDvYvEyNKKGno6e6Ak4l0Squ7a4DIrhrIA8wKFSVf+DuzgpmndFALW4ir50awQUZ +0m/A8p/4e7MCQvtQqR0tkw8jq8bBD5L/0KIV9VMJcRz/RROE5iZe+OCIHAr8Fraocwa48GOEAqDG +WuzndN9wrqODJerWx5eHk6fGioozl2A3ED6XPm4pFdahD9GILBKfb6qkxkLrQaLjlUPTAYVtjrs7 +8yM2x/474KElB0iryYl0/wiPgL/AlmXz7uxLaL2diMMxs0Dx6M/2OLuc5NF/1OVYm3z61PMOm3WR +5LpSLhl+0fXNWhn8ugb2+1KoS5kE3fj5tItQo05iifCHJPqDQsGH+tUtKSpacXpkatcnYGMN285J +9Y0fkIkyF/hzQ7jSWpOGYdbhdQrqeWZ2iE9x6wQl1gpaepPluUsXQA+xtrn13k/c4LOsOxFwYIRK +Q26ZIMApcQrAZQIDAQABo4ICyzCCAscwfQYIKwYBBQUHAQEEcTBvMEwGCCsGAQUFBzAChkBodHRw +Oi8vd3d3LmFjY3YuZXMvZmlsZWFkbWluL0FyY2hpdm9zL2NlcnRpZmljYWRvcy9yYWl6YWNjdjEu +Y3J0MB8GCCsGAQUFBzABhhNodHRwOi8vb2NzcC5hY2N2LmVzMB0GA1UdDgQWBBTSh7Tj3zcnk1X2 +VuqB5TbMjB4/vTAPBgNVHRMBAf8EBTADAQH/MB8GA1UdIwQYMBaAFNKHtOPfNyeTVfZW6oHlNsyM +Hj+9MIIBcwYDVR0gBIIBajCCAWYwggFiBgRVHSAAMIIBWDCCASIGCCsGAQUFBwICMIIBFB6CARAA +QQB1AHQAbwByAGkAZABhAGQAIABkAGUAIABDAGUAcgB0AGkAZgBpAGMAYQBjAGkA8wBuACAAUgBh +AO0AegAgAGQAZQAgAGwAYQAgAEEAQwBDAFYAIAAoAEEAZwBlAG4AYwBpAGEAIABkAGUAIABUAGUA +YwBuAG8AbABvAGcA7QBhACAAeQAgAEMAZQByAHQAaQBmAGkAYwBhAGMAaQDzAG4AIABFAGwAZQBj +AHQAcgDzAG4AaQBjAGEALAAgAEMASQBGACAAUQA0ADYAMAAxADEANQA2AEUAKQAuACAAQwBQAFMA +IABlAG4AIABoAHQAdABwADoALwAvAHcAdwB3AC4AYQBjAGMAdgAuAGUAczAwBggrBgEFBQcCARYk +aHR0cDovL3d3dy5hY2N2LmVzL2xlZ2lzbGFjaW9uX2MuaHRtMFUGA1UdHwROMEwwSqBIoEaGRGh0 +dHA6Ly93d3cuYWNjdi5lcy9maWxlYWRtaW4vQXJjaGl2b3MvY2VydGlmaWNhZG9zL3JhaXphY2N2 +MV9kZXIuY3JsMA4GA1UdDwEB/wQEAwIBBjAXBgNVHREEEDAOgQxhY2N2QGFjY3YuZXMwDQYJKoZI +hvcNAQEFBQADggIBAJcxAp/n/UNnSEQU5CmH7UwoZtCPNdpNYbdKl02125DgBS4OxnnQ8pdpD70E +R9m+27Up2pvZrqmZ1dM8MJP1jaGo/AaNRPTKFpV8M9xii6g3+CfYCS0b78gUJyCpZET/LtZ1qmxN +YEAZSUNUY9rizLpm5U9EelvZaoErQNV/+QEnWCzI7UiRfD+mAM/EKXMRNt6GGT6d7hmKG9Ww7Y49 +nCrADdg9ZuM8Db3VlFzi4qc1GwQA9j9ajepDvV+JHanBsMyZ4k0ACtrJJ1vnE5Bc5PUzolVt3OAJ +TS+xJlsndQAJxGJ3KQhfnlmstn6tn1QwIgPBHnFk/vk4CpYY3QIUrCPLBhwepH2NDd4nQeit2hW3 +sCPdK6jT2iWH7ehVRE2I9DZ+hJp4rPcOVkkO1jMl1oRQQmwgEh0q1b688nCBpHBgvgW1m54ERL5h +I6zppSSMEYCUWqKiuUnSwdzRp+0xESyeGabu4VXhwOrPDYTkF7eifKXeVSUG7szAh1xA2syVP1Xg +Nce4hL60Xc16gwFy7ofmXx2utYXGJt/mwZrpHgJHnyqobalbz+xFd3+YJ5oyXSrjhO7FmGYvliAd +3djDJ9ew+f7Zfc3Qn48LFFhRny+Lwzgt3uiP1o2HpPVWQxaZLPSkVrQ0uGE3ycJYgBugl6H8WY3p +EfbRD0tVNEYqi4Y7 +-----END CERTIFICATE----- + +TWCA Global Root CA +=================== +-----BEGIN CERTIFICATE----- +MIIFQTCCAymgAwIBAgICDL4wDQYJKoZIhvcNAQELBQAwUTELMAkGA1UEBhMCVFcxEjAQBgNVBAoT +CVRBSVdBTi1DQTEQMA4GA1UECxMHUm9vdCBDQTEcMBoGA1UEAxMTVFdDQSBHbG9iYWwgUm9vdCBD +QTAeFw0xMjA2MjcwNjI4MzNaFw0zMDEyMzExNTU5NTlaMFExCzAJBgNVBAYTAlRXMRIwEAYDVQQK +EwlUQUlXQU4tQ0ExEDAOBgNVBAsTB1Jvb3QgQ0ExHDAaBgNVBAMTE1RXQ0EgR2xvYmFsIFJvb3Qg +Q0EwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCwBdvI64zEbooh745NnHEKH1Jw7W2C +nJfF10xORUnLQEK1EjRsGcJ0pDFfhQKX7EMzClPSnIyOt7h52yvVavKOZsTuKwEHktSz0ALfUPZV +r2YOy+BHYC8rMjk1Ujoog/h7FsYYuGLWRyWRzvAZEk2tY/XTP3VfKfChMBwqoJimFb3u/Rk28OKR +Q4/6ytYQJ0lM793B8YVwm8rqqFpD/G2Gb3PpN0Wp8DbHzIh1HrtsBv+baz4X7GGqcXzGHaL3SekV +tTzWoWH1EfcFbx39Eb7QMAfCKbAJTibc46KokWofwpFFiFzlmLhxpRUZyXx1EcxwdE8tmx2RRP1W +KKD+u4ZqyPpcC1jcxkt2yKsi2XMPpfRaAok/T54igu6idFMqPVMnaR1sjjIsZAAmY2E2TqNGtz99 +sy2sbZCilaLOz9qC5wc0GZbpuCGqKX6mOL6OKUohZnkfs8O1CWfe1tQHRvMq2uYiN2DLgbYPoA/p +yJV/v1WRBXrPPRXAb94JlAGD1zQbzECl8LibZ9WYkTunhHiVJqRaCPgrdLQABDzfuBSO6N+pjWxn +kjMdwLfS7JLIvgm/LCkFbwJrnu+8vyq8W8BQj0FwcYeyTbcEqYSjMq+u7msXi7Kx/mzhkIyIqJdI +zshNy/MGz19qCkKxHh53L46g5pIOBvwFItIm4TFRfTLcDwIDAQABoyMwITAOBgNVHQ8BAf8EBAMC +AQYwDwYDVR0TAQH/BAUwAwEB/zANBgkqhkiG9w0BAQsFAAOCAgEAXzSBdu+WHdXltdkCY4QWwa6g +cFGn90xHNcgL1yg9iXHZqjNB6hQbbCEAwGxCGX6faVsgQt+i0trEfJdLjbDorMjupWkEmQqSpqsn +LhpNgb+E1HAerUf+/UqdM+DyucRFCCEK2mlpc3INvjT+lIutwx4116KD7+U4x6WFH6vPNOw/KP4M +8VeGTslV9xzU2KV9Bnpv1d8Q34FOIWWxtuEXeZVFBs5fzNxGiWNoRI2T9GRwoD2dKAXDOXC4Ynsg +/eTb6QihuJ49CcdP+yz4k3ZB3lLg4VfSnQO8d57+nile98FRYB/e2guyLXW3Q0iT5/Z5xoRdgFlg +lPx4mI88k1HtQJAH32RjJMtOcQWh15QaiDLxInQirqWm2BJpTGCjAu4r7NRjkgtevi92a6O2JryP +A9gK8kxkRr05YuWW6zRjESjMlfGt7+/cgFhI6Uu46mWs6fyAtbXIRfmswZ/ZuepiiI7E8UuDEq3m +i4TWnsLrgxifarsbJGAzcMzs9zLzXNl5fe+epP7JI8Mk7hWSsT2RTyaGvWZzJBPqpK5jwa19hAM8 +EHiGG3njxPPyBJUgriOCxLM6AGK/5jYk4Ve6xx6QddVfP5VhK8E7zeWzaGHQRiapIVJpLesux+t3 +zqY6tQMzT3bR51xUAV3LePTJDL/PEo4XLSNolOer/qmyKwbQBM0= +-----END CERTIFICATE----- + +TeliaSonera Root CA v1 +====================== +-----BEGIN CERTIFICATE----- +MIIFODCCAyCgAwIBAgIRAJW+FqD3LkbxezmCcvqLzZYwDQYJKoZIhvcNAQEFBQAwNzEUMBIGA1UE +CgwLVGVsaWFTb25lcmExHzAdBgNVBAMMFlRlbGlhU29uZXJhIFJvb3QgQ0EgdjEwHhcNMDcxMDE4 +MTIwMDUwWhcNMzIxMDE4MTIwMDUwWjA3MRQwEgYDVQQKDAtUZWxpYVNvbmVyYTEfMB0GA1UEAwwW +VGVsaWFTb25lcmEgUm9vdCBDQSB2MTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMK+ +6yfwIaPzaSZVfp3FVRaRXP3vIb9TgHot0pGMYzHw7CTww6XScnwQbfQ3t+XmfHnqjLWCi65ItqwA +3GV17CpNX8GH9SBlK4GoRz6JI5UwFpB/6FcHSOcZrr9FZ7E3GwYq/t75rH2D+1665I+XZ75Ljo1k +B1c4VWk0Nj0TSO9P4tNmHqTPGrdeNjPUtAa9GAH9d4RQAEX1jF3oI7x+/jXh7VB7qTCNGdMJjmhn +Xb88lxhTuylixcpecsHHltTbLaC0H2kD7OriUPEMPPCs81Mt8Bz17Ww5OXOAFshSsCPN4D7c3TxH +oLs1iuKYaIu+5b9y7tL6pe0S7fyYGKkmdtwoSxAgHNN/Fnct7W+A90m7UwW7XWjH1Mh1Fj+JWov3 +F0fUTPHSiXk+TT2YqGHeOh7S+F4D4MHJHIzTjU3TlTazN19jY5szFPAtJmtTfImMMsJu7D0hADnJ +oWjiUIMusDor8zagrC/kb2HCUQk5PotTubtn2txTuXZZNp1D5SDgPTJghSJRt8czu90VL6R4pgd7 +gUY2BIbdeTXHlSw7sKMXNeVzH7RcWe/a6hBle3rQf5+ztCo3O3CLm1u5K7fsslESl1MpWtTwEhDc +TwK7EpIvYtQ/aUN8Ddb8WHUBiJ1YFkveupD/RwGJBmr2X7KQarMCpgKIv7NHfirZ1fpoeDVNAgMB +AAGjPzA9MA8GA1UdEwEB/wQFMAMBAf8wCwYDVR0PBAQDAgEGMB0GA1UdDgQWBBTwj1k4ALP1j5qW +DNXr+nuqF+gTEjANBgkqhkiG9w0BAQUFAAOCAgEAvuRcYk4k9AwI//DTDGjkk0kiP0Qnb7tt3oNm +zqjMDfz1mgbldxSR651Be5kqhOX//CHBXfDkH1e3damhXwIm/9fH907eT/j3HEbAek9ALCI18Bmx +0GtnLLCo4MBANzX2hFxc469CeP6nyQ1Q6g2EdvZR74NTxnr/DlZJLo961gzmJ1TjTQpgcmLNkQfW +pb/ImWvtxBnmq0wROMVvMeJuScg/doAmAyYp4Db29iBT4xdwNBedY2gea+zDTYa4EzAvXUYNR0PV +G6pZDrlcjQZIrXSHX8f8MVRBE+LHIQ6e4B4N4cB7Q4WQxYpYxmUKeFfyxiMPAdkgS94P+5KFdSpc +c41teyWRyu5FrgZLAMzTsVlQ2jqIOylDRl6XK1TOU2+NSueW+r9xDkKLfP0ooNBIytrEgUy7onOT +JsjrDNYmiLbAJM+7vVvrdX3pCI6GMyx5dwlppYn8s3CQh3aP0yK7Qs69cwsgJirQmz1wHiRszYd2 +qReWt88NkvuOGKmYSdGe/mBEciG5Ge3C9THxOUiIkCR1VBatzvT4aRRkOfujuLpwQMcnHL/EVlP6 +Y2XQ8xwOFvVrhlhNGNTkDY6lnVuR3HYkUD/GKvvZt5y11ubQ2egZixVxSK236thZiNSQvxaz2ems +WWFUyBy6ysHK4bkgTI86k4mloMy/0/Z1pHWWbVY= +-----END CERTIFICATE----- + +E-Tugra Certification Authority +=============================== +-----BEGIN CERTIFICATE----- +MIIGSzCCBDOgAwIBAgIIamg+nFGby1MwDQYJKoZIhvcNAQELBQAwgbIxCzAJBgNVBAYTAlRSMQ8w +DQYDVQQHDAZBbmthcmExQDA+BgNVBAoMN0UtVHXEn3JhIEVCRyBCaWxpxZ9pbSBUZWtub2xvamls +ZXJpIHZlIEhpem1ldGxlcmkgQS7Fni4xJjAkBgNVBAsMHUUtVHVncmEgU2VydGlmaWthc3lvbiBN +ZXJrZXppMSgwJgYDVQQDDB9FLVR1Z3JhIENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTEzMDMw +NTEyMDk0OFoXDTIzMDMwMzEyMDk0OFowgbIxCzAJBgNVBAYTAlRSMQ8wDQYDVQQHDAZBbmthcmEx +QDA+BgNVBAoMN0UtVHXEn3JhIEVCRyBCaWxpxZ9pbSBUZWtub2xvamlsZXJpIHZlIEhpem1ldGxl +cmkgQS7Fni4xJjAkBgNVBAsMHUUtVHVncmEgU2VydGlmaWthc3lvbiBNZXJrZXppMSgwJgYDVQQD +DB9FLVR1Z3JhIENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIICIjANBgkqhkiG9w0BAQEFAAOCAg8A +MIICCgKCAgEA4vU/kwVRHoViVF56C/UYB4Oufq9899SKa6VjQzm5S/fDxmSJPZQuVIBSOTkHS0vd +hQd2h8y/L5VMzH2nPbxHD5hw+IyFHnSOkm0bQNGZDbt1bsipa5rAhDGvykPL6ys06I+XawGb1Q5K +CKpbknSFQ9OArqGIW66z6l7LFpp3RMih9lRozt6Plyu6W0ACDGQXwLWTzeHxE2bODHnv0ZEoq1+g +ElIwcxmOj+GMB6LDu0rw6h8VqO4lzKRG+Bsi77MOQ7osJLjFLFzUHPhdZL3Dk14opz8n8Y4e0ypQ +BaNV2cvnOVPAmJ6MVGKLJrD3fY185MaeZkJVgkfnsliNZvcHfC425lAcP9tDJMW/hkd5s3kc91r0 +E+xs+D/iWR+V7kI+ua2oMoVJl0b+SzGPWsutdEcf6ZG33ygEIqDUD13ieU/qbIWGvaimzuT6w+Gz +rt48Ue7LE3wBf4QOXVGUnhMMti6lTPk5cDZvlsouDERVxcr6XQKj39ZkjFqzAQqptQpHF//vkUAq +jqFGOjGY5RH8zLtJVor8udBhmm9lbObDyz51Sf6Pp+KJxWfXnUYTTjF2OySznhFlhqt/7x3U+Lzn +rFpct1pHXFXOVbQicVtbC/DP3KBhZOqp12gKY6fgDT+gr9Oq0n7vUaDmUStVkhUXU8u3Zg5mTPj5 +dUyQ5xJwx0UCAwEAAaNjMGEwHQYDVR0OBBYEFC7j27JJ0JxUeVz6Jyr+zE7S6E5UMA8GA1UdEwEB +/wQFMAMBAf8wHwYDVR0jBBgwFoAULuPbsknQnFR5XPonKv7MTtLoTlQwDgYDVR0PAQH/BAQDAgEG +MA0GCSqGSIb3DQEBCwUAA4ICAQAFNzr0TbdF4kV1JI+2d1LoHNgQk2Xz8lkGpD4eKexd0dCrfOAK +kEh47U6YA5n+KGCRHTAduGN8qOY1tfrTYXbm1gdLymmasoR6d5NFFxWfJNCYExL/u6Au/U5Mh/jO +XKqYGwXgAEZKgoClM4so3O0409/lPun++1ndYYRP0lSWE2ETPo+Aab6TR7U1Q9Jauz1c77NCR807 +VRMGsAnb/WP2OogKmW9+4c4bU2pEZiNRCHu8W1Ki/QY3OEBhj0qWuJA3+GbHeJAAFS6LrVE1Uweo +a2iu+U48BybNCAVwzDk/dr2l02cmAYamU9JgO3xDf1WKvJUawSg5TB9D0pH0clmKuVb8P7Sd2nCc +dlqMQ1DujjByTd//SffGqWfZbawCEeI6FiWnWAjLb1NBnEg4R2gz0dfHj9R0IdTDBZB6/86WiLEV +KV0jq9BgoRJP3vQXzTLlyb/IQ639Lo7xr+L0mPoSHyDYwKcMhcWQ9DstliaxLL5Mq+ux0orJ23gT +Dx4JnW2PAJ8C2sH6H3p6CcRK5ogql5+Ji/03X186zjhZhkuvcQu02PJwT58yE+Owp1fl2tpDy4Q0 +8ijE6m30Ku/Ba3ba+367hTzSU8JNvnHhRdH9I2cNE3X7z2VnIp2usAnRCf8dNL/+I5c30jn6PQ0G +C7TbO6Orb1wdtn7os4I07QZcJA== +-----END CERTIFICATE----- + +T-TeleSec GlobalRoot Class 2 +============================ +-----BEGIN CERTIFICATE----- +MIIDwzCCAqugAwIBAgIBATANBgkqhkiG9w0BAQsFADCBgjELMAkGA1UEBhMCREUxKzApBgNVBAoM +IlQtU3lzdGVtcyBFbnRlcnByaXNlIFNlcnZpY2VzIEdtYkgxHzAdBgNVBAsMFlQtU3lzdGVtcyBU +cnVzdCBDZW50ZXIxJTAjBgNVBAMMHFQtVGVsZVNlYyBHbG9iYWxSb290IENsYXNzIDIwHhcNMDgx +MDAxMTA0MDE0WhcNMzMxMDAxMjM1OTU5WjCBgjELMAkGA1UEBhMCREUxKzApBgNVBAoMIlQtU3lz +dGVtcyBFbnRlcnByaXNlIFNlcnZpY2VzIEdtYkgxHzAdBgNVBAsMFlQtU3lzdGVtcyBUcnVzdCBD +ZW50ZXIxJTAjBgNVBAMMHFQtVGVsZVNlYyBHbG9iYWxSb290IENsYXNzIDIwggEiMA0GCSqGSIb3 +DQEBAQUAA4IBDwAwggEKAoIBAQCqX9obX+hzkeXaXPSi5kfl82hVYAUdAqSzm1nzHoqvNK38DcLZ +SBnuaY/JIPwhqgcZ7bBcrGXHX+0CfHt8LRvWurmAwhiCFoT6ZrAIxlQjgeTNuUk/9k9uN0goOA/F +vudocP05l03Sx5iRUKrERLMjfTlH6VJi1hKTXrcxlkIF+3anHqP1wvzpesVsqXFP6st4vGCvx970 +2cu+fjOlbpSD8DT6IavqjnKgP6TeMFvvhk1qlVtDRKgQFRzlAVfFmPHmBiiRqiDFt1MmUUOyCxGV +WOHAD3bZwI18gfNycJ5v/hqO2V81xrJvNHy+SE/iWjnX2J14np+GPgNeGYtEotXHAgMBAAGjQjBA +MA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBS/WSA2AHmgoCJrjNXy +YdK4LMuCSjANBgkqhkiG9w0BAQsFAAOCAQEAMQOiYQsfdOhyNsZt+U2e+iKo4YFWz827n+qrkRk4 +r6p8FU3ztqONpfSO9kSpp+ghla0+AGIWiPACuvxhI+YzmzB6azZie60EI4RYZeLbK4rnJVM3YlNf +vNoBYimipidx5joifsFvHZVwIEoHNN/q/xWA5brXethbdXwFeilHfkCoMRN3zUA7tFFHei4R40cR +3p1m0IvVVGb6g1XqfMIpiRvpb7PO4gWEyS8+eIVibslfwXhjdFjASBgMmTnrpMwatXlajRWc2BQN +9noHV8cigwUtPJslJj0Ys6lDfMjIq2SPDqO/nBudMNva0Bkuqjzx+zOAduTNrRlPBSeOE6Fuwg== +-----END CERTIFICATE----- + +Atos TrustedRoot 2011 +===================== +-----BEGIN CERTIFICATE----- +MIIDdzCCAl+gAwIBAgIIXDPLYixfszIwDQYJKoZIhvcNAQELBQAwPDEeMBwGA1UEAwwVQXRvcyBU +cnVzdGVkUm9vdCAyMDExMQ0wCwYDVQQKDARBdG9zMQswCQYDVQQGEwJERTAeFw0xMTA3MDcxNDU4 +MzBaFw0zMDEyMzEyMzU5NTlaMDwxHjAcBgNVBAMMFUF0b3MgVHJ1c3RlZFJvb3QgMjAxMTENMAsG +A1UECgwEQXRvczELMAkGA1UEBhMCREUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCV +hTuXbyo7LjvPpvMpNb7PGKw+qtn4TaA+Gke5vJrf8v7MPkfoepbCJI419KkM/IL9bcFyYie96mvr +54rMVD6QUM+A1JX76LWC1BTFtqlVJVfbsVD2sGBkWXppzwO3bw2+yj5vdHLqqjAqc2K+SZFhyBH+ +DgMq92og3AIVDV4VavzjgsG1xZ1kCWyjWZgHJ8cblithdHFsQ/H3NYkQ4J7sVaE3IqKHBAUsR320 +HLliKWYoyrfhk/WklAOZuXCFteZI6o1Q/NnezG8HDt0Lcp2AMBYHlT8oDv3FdU9T1nSatCQujgKR +z3bFmx5VdJx4IbHwLfELn8LVlhgf8FQieowHAgMBAAGjfTB7MB0GA1UdDgQWBBSnpQaxLKYJYO7R +l+lwrrw7GWzbITAPBgNVHRMBAf8EBTADAQH/MB8GA1UdIwQYMBaAFKelBrEspglg7tGX6XCuvDsZ +bNshMBgGA1UdIAQRMA8wDQYLKwYBBAGwLQMEAQEwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEB +CwUAA4IBAQAmdzTblEiGKkGdLD4GkGDEjKwLVLgfuXvTBznk+j57sj1O7Z8jvZfza1zv7v1Apt+h +k6EKhqzvINB5Ab149xnYJDE0BAGmuhWawyfc2E8PzBhj/5kPDpFrdRbhIfzYJsdHt6bPWHJxfrrh +TZVHO8mvbaG0weyJ9rQPOLXiZNwlz6bb65pcmaHFCN795trV1lpFDMS3wrUU77QR/w4VtfX128a9 +61qn8FYiqTxlVMYVqL2Gns2Dlmh6cYGJ4Qvh6hEbaAjMaZ7snkGeRDImeuKHCnE96+RapNLbxc3G +3mB/ufNPRJLvKrcYPqcZ2Qt9sTdBQrC6YB3y/gkRsPCHe6ed +-----END CERTIFICATE----- + +QuoVadis Root CA 1 G3 +===================== +-----BEGIN CERTIFICATE----- +MIIFYDCCA0igAwIBAgIUeFhfLq0sGUvjNwc1NBMotZbUZZMwDQYJKoZIhvcNAQELBQAwSDELMAkG +A1UEBhMCQk0xGTAXBgNVBAoTEFF1b1ZhZGlzIExpbWl0ZWQxHjAcBgNVBAMTFVF1b1ZhZGlzIFJv +b3QgQ0EgMSBHMzAeFw0xMjAxMTIxNzI3NDRaFw00MjAxMTIxNzI3NDRaMEgxCzAJBgNVBAYTAkJN +MRkwFwYDVQQKExBRdW9WYWRpcyBMaW1pdGVkMR4wHAYDVQQDExVRdW9WYWRpcyBSb290IENBIDEg +RzMwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCgvlAQjunybEC0BJyFuTHK3C3kEakE +PBtVwedYMB0ktMPvhd6MLOHBPd+C5k+tR4ds7FtJwUrVu4/sh6x/gpqG7D0DmVIB0jWerNrwU8lm +PNSsAgHaJNM7qAJGr6Qc4/hzWHa39g6QDbXwz8z6+cZM5cOGMAqNF34168Xfuw6cwI2H44g4hWf6 +Pser4BOcBRiYz5P1sZK0/CPTz9XEJ0ngnjybCKOLXSoh4Pw5qlPafX7PGglTvF0FBM+hSo+LdoIN +ofjSxxR3W5A2B4GbPgb6Ul5jxaYA/qXpUhtStZI5cgMJYr2wYBZupt0lwgNm3fME0UDiTouG9G/l +g6AnhF4EwfWQvTA9xO+oabw4m6SkltFi2mnAAZauy8RRNOoMqv8hjlmPSlzkYZqn0ukqeI1RPToV +7qJZjqlc3sX5kCLliEVx3ZGZbHqfPT2YfF72vhZooF6uCyP8Wg+qInYtyaEQHeTTRCOQiJ/GKubX +9ZqzWB4vMIkIG1SitZgj7Ah3HJVdYdHLiZxfokqRmu8hqkkWCKi9YSgxyXSthfbZxbGL0eUQMk1f +iyA6PEkfM4VZDdvLCXVDaXP7a3F98N/ETH3Goy7IlXnLc6KOTk0k+17kBL5yG6YnLUlamXrXXAkg +t3+UuU/xDRxeiEIbEbfnkduebPRq34wGmAOtzCjvpUfzUwIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUo5fW816iEOGrRZ88F2Q87gFwnMwwDQYJKoZI +hvcNAQELBQADggIBABj6W3X8PnrHX3fHyt/PX8MSxEBd1DKquGrX1RUVRpgjpeaQWxiZTOOtQqOC +MTaIzen7xASWSIsBx40Bz1szBpZGZnQdT+3Btrm0DWHMY37XLneMlhwqI2hrhVd2cDMT/uFPpiN3 +GPoajOi9ZcnPP/TJF9zrx7zABC4tRi9pZsMbj/7sPtPKlL92CiUNqXsCHKnQO18LwIE6PWThv6ct +Tr1NxNgpxiIY0MWscgKCP6o6ojoilzHdCGPDdRS5YCgtW2jgFqlmgiNR9etT2DGbe+m3nUvriBbP ++V04ikkwj+3x6xn0dxoxGE1nVGwvb2X52z3sIexe9PSLymBlVNFxZPT5pqOBMzYzcfCkeF9OrYMh +3jRJjehZrJ3ydlo28hP0r+AJx2EqbPfgna67hkooby7utHnNkDPDs3b69fBsnQGQ+p6Q9pxyz0fa +wx/kNSBT8lTR32GDpgLiJTjehTItXnOQUl1CxM49S+H5GYQd1aJQzEH7QRTDvdbJWqNjZgKAvQU6 +O0ec7AAmTPWIUb+oI38YB7AL7YsmoWTTYUrrXJ/es69nA7Mf3W1daWhpq1467HxpvMc7hU6eFbm0 +FU/DlXpY18ls6Wy58yljXrQs8C097Vpl4KlbQMJImYFtnh8GKjwStIsPm6Ik8KaN1nrgS7ZklmOV +hMJKzRwuJIczYOXD +-----END CERTIFICATE----- + +QuoVadis Root CA 2 G3 +===================== +-----BEGIN CERTIFICATE----- +MIIFYDCCA0igAwIBAgIURFc0JFuBiZs18s64KztbpybwdSgwDQYJKoZIhvcNAQELBQAwSDELMAkG +A1UEBhMCQk0xGTAXBgNVBAoTEFF1b1ZhZGlzIExpbWl0ZWQxHjAcBgNVBAMTFVF1b1ZhZGlzIFJv +b3QgQ0EgMiBHMzAeFw0xMjAxMTIxODU5MzJaFw00MjAxMTIxODU5MzJaMEgxCzAJBgNVBAYTAkJN +MRkwFwYDVQQKExBRdW9WYWRpcyBMaW1pdGVkMR4wHAYDVQQDExVRdW9WYWRpcyBSb290IENBIDIg +RzMwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQChriWyARjcV4g/Ruv5r+LrI3HimtFh +ZiFfqq8nUeVuGxbULX1QsFN3vXg6YOJkApt8hpvWGo6t/x8Vf9WVHhLL5hSEBMHfNrMWn4rjyduY +NM7YMxcoRvynyfDStNVNCXJJ+fKH46nafaF9a7I6JaltUkSs+L5u+9ymc5GQYaYDFCDy54ejiK2t +oIz/pgslUiXnFgHVy7g1gQyjO/Dh4fxaXc6AcW34Sas+O7q414AB+6XrW7PFXmAqMaCvN+ggOp+o +MiwMzAkd056OXbxMmO7FGmh77FOm6RQ1o9/NgJ8MSPsc9PG/Srj61YxxSscfrf5BmrODXfKEVu+l +V0POKa2Mq1W/xPtbAd0jIaFYAI7D0GoT7RPjEiuA3GfmlbLNHiJuKvhB1PLKFAeNilUSxmn1uIZo +L1NesNKqIcGY5jDjZ1XHm26sGahVpkUG0CM62+tlXSoREfA7T8pt9DTEceT/AFr2XK4jYIVz8eQQ +sSWu1ZK7E8EM4DnatDlXtas1qnIhO4M15zHfeiFuuDIIfR0ykRVKYnLP43ehvNURG3YBZwjgQQvD +6xVu+KQZ2aKrr+InUlYrAoosFCT5v0ICvybIxo/gbjh9Uy3l7ZizlWNof/k19N+IxWA1ksB8aRxh +lRbQ694Lrz4EEEVlWFA4r0jyWbYW8jwNkALGcC4BrTwV1wIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQU7edvdlq/YOxJW8ald7tyFnGbxD0wDQYJKoZI +hvcNAQELBQADggIBAJHfgD9DCX5xwvfrs4iP4VGyvD11+ShdyLyZm3tdquXK4Qr36LLTn91nMX66 +AarHakE7kNQIXLJgapDwyM4DYvmL7ftuKtwGTTwpD4kWilhMSA/ohGHqPHKmd+RCroijQ1h5fq7K +pVMNqT1wvSAZYaRsOPxDMuHBR//47PERIjKWnML2W2mWeyAMQ0GaW/ZZGYjeVYg3UQt4XAoeo0L9 +x52ID8DyeAIkVJOviYeIyUqAHerQbj5hLja7NQ4nlv1mNDthcnPxFlxHBlRJAHpYErAK74X9sbgz +dWqTHBLmYF5vHX/JHyPLhGGfHoJE+V+tYlUkmlKY7VHnoX6XOuYvHxHaU4AshZ6rNRDbIl9qxV6X +U/IyAgkwo1jwDQHVcsaxfGl7w/U2Rcxhbl5MlMVerugOXou/983g7aEOGzPuVBj+D77vfoRrQ+Nw +mNtddbINWQeFFSM51vHfqSYP1kjHs6Yi9TM3WpVHn3u6GBVv/9YUZINJ0gpnIdsPNWNgKCLjsZWD +zYWm3S8P52dSbrsvhXz1SnPnxT7AvSESBT/8twNJAlvIJebiVDj1eYeMHVOyToV7BjjHLPj4sHKN +JeV3UvQDHEimUF+IIDBu8oJDqz2XhOdT+yHBTw8imoa4WSr2Rz0ZiC3oheGe7IUIarFsNMkd7Egr +O3jtZsSOeWmD3n+M +-----END CERTIFICATE----- + +QuoVadis Root CA 3 G3 +===================== +-----BEGIN CERTIFICATE----- +MIIFYDCCA0igAwIBAgIULvWbAiin23r/1aOp7r0DoM8Sah0wDQYJKoZIhvcNAQELBQAwSDELMAkG +A1UEBhMCQk0xGTAXBgNVBAoTEFF1b1ZhZGlzIExpbWl0ZWQxHjAcBgNVBAMTFVF1b1ZhZGlzIFJv +b3QgQ0EgMyBHMzAeFw0xMjAxMTIyMDI2MzJaFw00MjAxMTIyMDI2MzJaMEgxCzAJBgNVBAYTAkJN +MRkwFwYDVQQKExBRdW9WYWRpcyBMaW1pdGVkMR4wHAYDVQQDExVRdW9WYWRpcyBSb290IENBIDMg +RzMwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCzyw4QZ47qFJenMioKVjZ/aEzHs286 +IxSR/xl/pcqs7rN2nXrpixurazHb+gtTTK/FpRp5PIpM/6zfJd5O2YIyC0TeytuMrKNuFoM7pmRL +Mon7FhY4futD4tN0SsJiCnMK3UmzV9KwCoWdcTzeo8vAMvMBOSBDGzXRU7Ox7sWTaYI+FrUoRqHe +6okJ7UO4BUaKhvVZR74bbwEhELn9qdIoyhA5CcoTNs+cra1AdHkrAj80//ogaX3T7mH1urPnMNA3 +I4ZyYUUpSFlob3emLoG+B01vr87ERRORFHAGjx+f+IdpsQ7vw4kZ6+ocYfx6bIrc1gMLnia6Et3U +VDmrJqMz6nWB2i3ND0/kA9HvFZcba5DFApCTZgIhsUfei5pKgLlVj7WiL8DWM2fafsSntARE60f7 +5li59wzweyuxwHApw0BiLTtIadwjPEjrewl5qW3aqDCYz4ByA4imW0aucnl8CAMhZa634RylsSqi +Md5mBPfAdOhx3v89WcyWJhKLhZVXGqtrdQtEPREoPHtht+KPZ0/l7DxMYIBpVzgeAVuNVejH38DM +dyM0SXV89pgR6y3e7UEuFAUCf+D+IOs15xGsIs5XPd7JMG0QA4XN8f+MFrXBsj6IbGB/kE+V9/Yt +rQE5BwT6dYB9v0lQ7e/JxHwc64B+27bQ3RP+ydOc17KXqQIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUxhfQvKjqAkPyGwaZXSuQILnXnOQwDQYJKoZI +hvcNAQELBQADggIBADRh2Va1EodVTd2jNTFGu6QHcrxfYWLopfsLN7E8trP6KZ1/AvWkyaiTt3px +KGmPc+FSkNrVvjrlt3ZqVoAh313m6Tqe5T72omnHKgqwGEfcIHB9UqM+WXzBusnIFUBhynLWcKzS +t/Ac5IYp8M7vaGPQtSCKFWGafoaYtMnCdvvMujAWzKNhxnQT5WvvoxXqA/4Ti2Tk08HS6IT7SdEQ +TXlm66r99I0xHnAUrdzeZxNMgRVhvLfZkXdxGYFgu/BYpbWcC/ePIlUnwEsBbTuZDdQdm2NnL9Du +DcpmvJRPpq3t/O5jrFc/ZSXPsoaP0Aj/uHYUbt7lJ+yreLVTubY/6CD50qi+YUbKh4yE8/nxoGib +Ih6BJpsQBJFxwAYf3KDTuVan45gtf4Od34wrnDKOMpTwATwiKp9Dwi7DmDkHOHv8XgBCH/MyJnmD +hPbl8MFREsALHgQjDFSlTC9JxUrRtm5gDWv8a4uFJGS3iQ6rJUdbPM9+Sb3H6QrG2vd+DhcI00iX +0HGS8A85PjRqHH3Y8iKuu2n0M7SmSFXRDw4m6Oy2Cy2nhTXN/VnIn9HNPlopNLk9hM6xZdRZkZFW +dSHBd575euFgndOtBBj0fOtek49TSiIp+EgrPk2GrFt/ywaZWWDYWGWVjUTR939+J399roD1B0y2 +PpxxVJkES/1Y+Zj0 +-----END CERTIFICATE----- + +DigiCert Assured ID Root G2 +=========================== +-----BEGIN CERTIFICATE----- +MIIDljCCAn6gAwIBAgIQC5McOtY5Z+pnI7/Dr5r0SzANBgkqhkiG9w0BAQsFADBlMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSQw +IgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgRzIwHhcNMTMwODAxMTIwMDAwWhcNMzgw +MTE1MTIwMDAwWjBlMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQL +ExB3d3cuZGlnaWNlcnQuY29tMSQwIgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgRzIw +ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDZ5ygvUj82ckmIkzTz+GoeMVSAn61UQbVH +35ao1K+ALbkKz3X9iaV9JPrjIgwrvJUXCzO/GU1BBpAAvQxNEP4HteccbiJVMWWXvdMX0h5i89vq +bFCMP4QMls+3ywPgym2hFEwbid3tALBSfK+RbLE4E9HpEgjAALAcKxHad3A2m67OeYfcgnDmCXRw +VWmvo2ifv922ebPynXApVfSr/5Vh88lAbx3RvpO704gqu52/clpWcTs/1PPRCv4o76Pu2ZmvA9OP +YLfykqGxvYmJHzDNw6YuYjOuFgJ3RFrngQo8p0Quebg/BLxcoIfhG69Rjs3sLPr4/m3wOnyqi+Rn +lTGNAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBTO +w0q5mVXyuNtgv6l+vVa1lzan1jANBgkqhkiG9w0BAQsFAAOCAQEAyqVVjOPIQW5pJ6d1Ee88hjZv +0p3GeDgdaZaikmkuOGybfQTUiaWxMTeKySHMq2zNixya1r9I0jJmwYrA8y8678Dj1JGG0VDjA9tz +d29KOVPt3ibHtX2vK0LRdWLjSisCx1BL4GnilmwORGYQRI+tBev4eaymG+g3NJ1TyWGqolKvSnAW +hsI6yLETcDbYz+70CjTVW0z9B5yiutkBclzzTcHdDrEcDcRjvq30FPuJ7KJBDkzMyFdA0G4Dqs0M +jomZmWzwPDCvON9vvKO+KSAnq3T/EyJ43pdSVR6DtVQgA+6uwE9W3jfMw3+qBCe703e4YtsXfJwo +IhNzbM8m9Yop5w== +-----END CERTIFICATE----- + +DigiCert Assured ID Root G3 +=========================== +-----BEGIN CERTIFICATE----- +MIICRjCCAc2gAwIBAgIQC6Fa+h3foLVJRK/NJKBs7DAKBggqhkjOPQQDAzBlMQswCQYDVQQGEwJV +UzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSQwIgYD +VQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgRzMwHhcNMTMwODAxMTIwMDAwWhcNMzgwMTE1 +MTIwMDAwWjBlMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3 +d3cuZGlnaWNlcnQuY29tMSQwIgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgRzMwdjAQ +BgcqhkjOPQIBBgUrgQQAIgNiAAQZ57ysRGXtzbg/WPuNsVepRC0FFfLvC/8QdJ+1YlJfZn4f5dwb +RXkLzMZTCp2NXQLZqVneAlr2lSoOjThKiknGvMYDOAdfVdp+CW7if17QRSAPWXYQ1qAk8C3eNvJs +KTmjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBTL0L2p4ZgF +UaFNN6KDec6NHSrkhDAKBggqhkjOPQQDAwNnADBkAjAlpIFFAmsSS3V0T8gj43DydXLefInwz5Fy +YZ5eEJJZVrmDxxDnOOlYJjZ91eQ0hjkCMHw2U/Aw5WJjOpnitqM7mzT6HtoQknFekROn3aRukswy +1vUhZscv6pZjamVFkpUBtA== +-----END CERTIFICATE----- + +DigiCert Global Root G2 +======================= +-----BEGIN CERTIFICATE----- +MIIDjjCCAnagAwIBAgIQAzrx5qcRqaC7KGSxHQn65TANBgkqhkiG9w0BAQsFADBhMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSAw +HgYDVQQDExdEaWdpQ2VydCBHbG9iYWwgUm9vdCBHMjAeFw0xMzA4MDExMjAwMDBaFw0zODAxMTUx +MjAwMDBaMGExCzAJBgNVBAYTAlVTMRUwEwYDVQQKEwxEaWdpQ2VydCBJbmMxGTAXBgNVBAsTEHd3 +dy5kaWdpY2VydC5jb20xIDAeBgNVBAMTF0RpZ2lDZXJ0IEdsb2JhbCBSb290IEcyMIIBIjANBgkq +hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAuzfNNNx7a8myaJCtSnX/RrohCgiN9RlUyfuI2/Ou8jqJ +kTx65qsGGmvPrC3oXgkkRLpimn7Wo6h+4FR1IAWsULecYxpsMNzaHxmx1x7e/dfgy5SDN67sH0NO +3Xss0r0upS/kqbitOtSZpLYl6ZtrAGCSYP9PIUkY92eQq2EGnI/yuum06ZIya7XzV+hdG82MHauV +BJVJ8zUtluNJbd134/tJS7SsVQepj5WztCO7TG1F8PapspUwtP1MVYwnSlcUfIKdzXOS0xZKBgyM +UNGPHgm+F6HmIcr9g+UQvIOlCsRnKPZzFBQ9RnbDhxSJITRNrw9FDKZJobq7nMWxM4MphQIDAQAB +o0IwQDAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBhjAdBgNVHQ4EFgQUTiJUIBiV5uNu +5g/6+rkS7QYXjzkwDQYJKoZIhvcNAQELBQADggEBAGBnKJRvDkhj6zHd6mcY1Yl9PMWLSn/pvtsr +F9+wX3N3KjITOYFnQoQj8kVnNeyIv/iPsGEMNKSuIEyExtv4NeF22d+mQrvHRAiGfzZ0JFrabA0U +WTW98kndth/Jsw1HKj2ZL7tcu7XUIOGZX1NGFdtom/DzMNU+MeKNhJ7jitralj41E6Vf8PlwUHBH +QRFXGU7Aj64GxJUTFy8bJZ918rGOmaFvE7FBcf6IKshPECBV1/MUReXgRPTqh5Uykw7+U0b6LJ3/ +iyK5S9kJRaTepLiaWN0bfVKfjllDiIGknibVb63dDcY3fe0Dkhvld1927jyNxF1WW6LZZm6zNTfl +MrY= +-----END CERTIFICATE----- + +DigiCert Global Root G3 +======================= +-----BEGIN CERTIFICATE----- +MIICPzCCAcWgAwIBAgIQBVVWvPJepDU1w6QP1atFcjAKBggqhkjOPQQDAzBhMQswCQYDVQQGEwJV +UzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSAwHgYD +VQQDExdEaWdpQ2VydCBHbG9iYWwgUm9vdCBHMzAeFw0xMzA4MDExMjAwMDBaFw0zODAxMTUxMjAw +MDBaMGExCzAJBgNVBAYTAlVTMRUwEwYDVQQKEwxEaWdpQ2VydCBJbmMxGTAXBgNVBAsTEHd3dy5k +aWdpY2VydC5jb20xIDAeBgNVBAMTF0RpZ2lDZXJ0IEdsb2JhbCBSb290IEczMHYwEAYHKoZIzj0C +AQYFK4EEACIDYgAE3afZu4q4C/sLfyHS8L6+c/MzXRq8NOrexpu80JX28MzQC7phW1FGfp4tn+6O +YwwX7Adw9c+ELkCDnOg/QW07rdOkFFk2eJ0DQ+4QE2xy3q6Ip6FrtUPOZ9wj/wMco+I+o0IwQDAP +BgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBhjAdBgNVHQ4EFgQUs9tIpPmhxdiuNkHMEWNp +Yim8S8YwCgYIKoZIzj0EAwMDaAAwZQIxAK288mw/EkrRLTnDCgmXc/SINoyIJ7vmiI1Qhadj+Z4y +3maTD/HMsQmP3Wyr+mt/oAIwOWZbwmSNuJ5Q3KjVSaLtx9zRSX8XAbjIho9OjIgrqJqpisXRAL34 +VOKa5Vt8sycX +-----END CERTIFICATE----- + +DigiCert Trusted Root G4 +======================== +-----BEGIN CERTIFICATE----- +MIIFkDCCA3igAwIBAgIQBZsbV56OITLiOQe9p3d1XDANBgkqhkiG9w0BAQwFADBiMQswCQYDVQQG +EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSEw +HwYDVQQDExhEaWdpQ2VydCBUcnVzdGVkIFJvb3QgRzQwHhcNMTMwODAxMTIwMDAwWhcNMzgwMTE1 +MTIwMDAwWjBiMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3 +d3cuZGlnaWNlcnQuY29tMSEwHwYDVQQDExhEaWdpQ2VydCBUcnVzdGVkIFJvb3QgRzQwggIiMA0G +CSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC/5pBzaN675F1KPDAiMGkz7MKnJS7JIT3yithZwuEp +pz1Yq3aaza57G4QNxDAf8xukOBbrVsaXbR2rsnnyyhHS5F/WBTxSD1Ifxp4VpX6+n6lXFllVcq9o +k3DCsrp1mWpzMpTREEQQLt+C8weE5nQ7bXHiLQwb7iDVySAdYyktzuxeTsiT+CFhmzTrBcZe7Fsa +vOvJz82sNEBfsXpm7nfISKhmV1efVFiODCu3T6cw2Vbuyntd463JT17lNecxy9qTXtyOj4DatpGY +QJB5w3jHtrHEtWoYOAMQjdjUN6QuBX2I9YI+EJFwq1WCQTLX2wRzKm6RAXwhTNS8rhsDdV14Ztk6 +MUSaM0C/CNdaSaTC5qmgZ92kJ7yhTzm1EVgX9yRcRo9k98FpiHaYdj1ZXUJ2h4mXaXpI8OCiEhtm +mnTK3kse5w5jrubU75KSOp493ADkRSWJtppEGSt+wJS00mFt6zPZxd9LBADMfRyVw4/3IbKyEbe7 +f/LVjHAsQWCqsWMYRJUadmJ+9oCw++hkpjPRiQfhvbfmQ6QYuKZ3AeEPlAwhHbJUKSWJbOUOUlFH +dL4mrLZBdd56rF+NP8m800ERElvlEFDrMcXKchYiCd98THU/Y+whX8QgUWtvsauGi0/C1kVfnSD8 +oR7FwI+isX4KJpn15GkvmB0t9dmpsh3lGwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MA4GA1Ud +DwEB/wQEAwIBhjAdBgNVHQ4EFgQU7NfjgtJxXWRM3y5nP+e6mK4cD08wDQYJKoZIhvcNAQEMBQAD +ggIBALth2X2pbL4XxJEbw6GiAI3jZGgPVs93rnD5/ZpKmbnJeFwMDF/k5hQpVgs2SV1EY+CtnJYY +ZhsjDT156W1r1lT40jzBQ0CuHVD1UvyQO7uYmWlrx8GnqGikJ9yd+SeuMIW59mdNOj6PWTkiU0Tr +yF0Dyu1Qen1iIQqAyHNm0aAFYF/opbSnr6j3bTWcfFqK1qI4mfN4i/RN0iAL3gTujJtHgXINwBQy +7zBZLq7gcfJW5GqXb5JQbZaNaHqasjYUegbyJLkJEVDXCLG4iXqEI2FCKeWjzaIgQdfRnGTZ6iah +ixTXTBmyUEFxPT9NcCOGDErcgdLMMpSEDQgJlxxPwO5rIHQw0uA5NBCFIRUBCOhVMt5xSdkoF1BN +5r5N0XWs0Mr7QbhDparTwwVETyw2m+L64kW4I1NsBm9nVX9GtUw/bihaeSbSpKhil9Ie4u1Ki7wb +/UdKDd9nZn6yW0HQO+T0O/QEY+nvwlQAUaCKKsnOeMzV6ocEGLPOr0mIr/OSmbaz5mEP0oUA51Aa +5BuVnRmhuZyxm7EAHu/QD09CbMkKvO5D+jpxpchNJqU1/YldvIViHTLSoCtU7ZpXwdv6EM8Zt4tK +G48BtieVU+i2iW1bvGjUI+iLUaJW+fCmgKDWHrO8Dw9TdSmq6hN35N6MgSGtBxBHEa2HPQfRdbzP +82Z+ +-----END CERTIFICATE----- + +COMODO RSA Certification Authority +================================== +-----BEGIN CERTIFICATE----- +MIIF2DCCA8CgAwIBAgIQTKr5yttjb+Af907YWwOGnTANBgkqhkiG9w0BAQwFADCBhTELMAkGA1UE +BhMCR0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgG +A1UEChMRQ09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBSU0EgQ2VydGlmaWNhdGlv +biBBdXRob3JpdHkwHhcNMTAwMTE5MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCBhTELMAkGA1UEBhMC +R0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgGA1UE +ChMRQ09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBSU0EgQ2VydGlmaWNhdGlvbiBB +dXRob3JpdHkwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCR6FSS0gpWsawNJN3Fz0Rn +dJkrN6N9I3AAcbxT38T6KhKPS38QVr2fcHK3YX/JSw8Xpz3jsARh7v8Rl8f0hj4K+j5c+ZPmNHrZ +FGvnnLOFoIJ6dq9xkNfs/Q36nGz637CC9BR++b7Epi9Pf5l/tfxnQ3K9DADWietrLNPtj5gcFKt+ +5eNu/Nio5JIk2kNrYrhV/erBvGy2i/MOjZrkm2xpmfh4SDBF1a3hDTxFYPwyllEnvGfDyi62a+pG +x8cgoLEfZd5ICLqkTqnyg0Y3hOvozIFIQ2dOciqbXL1MGyiKXCJ7tKuY2e7gUYPDCUZObT6Z+pUX +2nwzV0E8jVHtC7ZcryxjGt9XyD+86V3Em69FmeKjWiS0uqlWPc9vqv9JWL7wqP/0uK3pN/u6uPQL +OvnoQ0IeidiEyxPx2bvhiWC4jChWrBQdnArncevPDt09qZahSL0896+1DSJMwBGB7FY79tOi4lu3 +sgQiUpWAk2nojkxl8ZEDLXB0AuqLZxUpaVICu9ffUGpVRr+goyhhf3DQw6KqLCGqR84onAZFdr+C +GCe01a60y1Dma/RMhnEw6abfFobg2P9A3fvQQoh/ozM6LlweQRGBY84YcWsr7KaKtzFcOmpH4MN5 +WdYgGq/yapiqcrxXStJLnbsQ/LBMQeXtHT1eKJ2czL+zUdqnR+WEUwIDAQABo0IwQDAdBgNVHQ4E +FgQUu69+Aj36pvE8hI6t7jiY7NkyMtQwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8w +DQYJKoZIhvcNAQEMBQADggIBAArx1UaEt65Ru2yyTUEUAJNMnMvlwFTPoCWOAvn9sKIN9SCYPBMt +rFaisNZ+EZLpLrqeLppysb0ZRGxhNaKatBYSaVqM4dc+pBroLwP0rmEdEBsqpIt6xf4FpuHA1sj+ +nq6PK7o9mfjYcwlYRm6mnPTXJ9OV2jeDchzTc+CiR5kDOF3VSXkAKRzH7JsgHAckaVd4sjn8OoSg +tZx8jb8uk2IntznaFxiuvTwJaP+EmzzV1gsD41eeFPfR60/IvYcjt7ZJQ3mFXLrrkguhxuhoqEwW +sRqZCuhTLJK7oQkYdQxlqHvLI7cawiiFwxv/0Cti76R7CZGYZ4wUAc1oBmpjIXUDgIiKboHGhfKp +pC3n9KUkEEeDys30jXlYsQab5xoq2Z0B15R97QNKyvDb6KkBPvVWmckejkk9u+UJueBPSZI9FoJA +zMxZxuY67RIuaTxslbH9qh17f4a+Hg4yRvv7E491f0yLS0Zj/gA0QHDBw7mh3aZw4gSzQbzpgJHq +ZJx64SIDqZxubw5lT2yHh17zbqD5daWbQOhTsiedSrnAdyGN/4fy3ryM7xfft0kL0fJuMAsaDk52 +7RH89elWsn2/x20Kk4yl0MC2Hb46TpSi125sC8KKfPog88Tk5c0NqMuRkrF8hey1FGlmDoLnzc7I +LaZRfyHBNVOFBkpdn627G190 +-----END CERTIFICATE----- + +USERTrust RSA Certification Authority +===================================== +-----BEGIN CERTIFICATE----- +MIIF3jCCA8agAwIBAgIQAf1tMPyjylGoG7xkDjUDLTANBgkqhkiG9w0BAQwFADCBiDELMAkGA1UE +BhMCVVMxEzARBgNVBAgTCk5ldyBKZXJzZXkxFDASBgNVBAcTC0plcnNleSBDaXR5MR4wHAYDVQQK +ExVUaGUgVVNFUlRSVVNUIE5ldHdvcmsxLjAsBgNVBAMTJVVTRVJUcnVzdCBSU0EgQ2VydGlmaWNh +dGlvbiBBdXRob3JpdHkwHhcNMTAwMjAxMDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCBiDELMAkGA1UE +BhMCVVMxEzARBgNVBAgTCk5ldyBKZXJzZXkxFDASBgNVBAcTC0plcnNleSBDaXR5MR4wHAYDVQQK +ExVUaGUgVVNFUlRSVVNUIE5ldHdvcmsxLjAsBgNVBAMTJVVTRVJUcnVzdCBSU0EgQ2VydGlmaWNh +dGlvbiBBdXRob3JpdHkwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCAEmUXNg7D2wiz +0KxXDXbtzSfTTK1Qg2HiqiBNCS1kCdzOiZ/MPans9s/B3PHTsdZ7NygRK0faOca8Ohm0X6a9fZ2j +Y0K2dvKpOyuR+OJv0OwWIJAJPuLodMkYtJHUYmTbf6MG8YgYapAiPLz+E/CHFHv25B+O1ORRxhFn +RghRy4YUVD+8M/5+bJz/Fp0YvVGONaanZshyZ9shZrHUm3gDwFA66Mzw3LyeTP6vBZY1H1dat//O ++T23LLb2VN3I5xI6Ta5MirdcmrS3ID3KfyI0rn47aGYBROcBTkZTmzNg95S+UzeQc0PzMsNT79uq +/nROacdrjGCT3sTHDN/hMq7MkztReJVni+49Vv4M0GkPGw/zJSZrM233bkf6c0Plfg6lZrEpfDKE +Y1WJxA3Bk1QwGROs0303p+tdOmw1XNtB1xLaqUkL39iAigmTYo61Zs8liM2EuLE/pDkP2QKe6xJM +lXzzawWpXhaDzLhn4ugTncxbgtNMs+1b/97lc6wjOy0AvzVVdAlJ2ElYGn+SNuZRkg7zJn0cTRe8 +yexDJtC/QV9AqURE9JnnV4eeUB9XVKg+/XRjL7FQZQnmWEIuQxpMtPAlR1n6BB6T1CZGSlCBst6+ +eLf8ZxXhyVeEHg9j1uliutZfVS7qXMYoCAQlObgOK6nyTJccBz8NUvXt7y+CDwIDAQABo0IwQDAd +BgNVHQ4EFgQUU3m/WqorSs9UgOHYm8Cd8rIDZsswDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQF +MAMBAf8wDQYJKoZIhvcNAQEMBQADggIBAFzUfA3P9wF9QZllDHPFUp/L+M+ZBn8b2kMVn54CVVeW +FPFSPCeHlCjtHzoBN6J2/FNQwISbxmtOuowhT6KOVWKR82kV2LyI48SqC/3vqOlLVSoGIG1VeCkZ +7l8wXEskEVX/JJpuXior7gtNn3/3ATiUFJVDBwn7YKnuHKsSjKCaXqeYalltiz8I+8jRRa8YFWSQ +Eg9zKC7F4iRO/Fjs8PRF/iKz6y+O0tlFYQXBl2+odnKPi4w2r78NBc5xjeambx9spnFixdjQg3IM +8WcRiQycE0xyNN+81XHfqnHd4blsjDwSXWXavVcStkNr/+XeTWYRUc+ZruwXtuhxkYzeSf7dNXGi +FSeUHM9h4ya7b6NnJSFd5t0dCy5oGzuCr+yDZ4XUmFF0sbmZgIn/f3gZXHlKYC6SQK5MNyosycdi +yA5d9zZbyuAlJQG03RoHnHcAP9Dc1ew91Pq7P8yF1m9/qS3fuQL39ZeatTXaw2ewh0qpKJ4jjv9c +J2vhsE/zB+4ALtRZh8tSQZXq9EfX7mRBVXyNWQKV3WKdwrnuWih0hKWbt5DHDAff9Yk2dDLWKMGw +sAvgnEzDHNb842m1R0aBL6KCq9NjRHDEjf8tM7qtj3u1cIiuPhnPQCjY/MiQu12ZIvVS5ljFH4gx +Q+6IHdfGjjxDah2nGN59PRbxYvnKkKj9 +-----END CERTIFICATE----- + +USERTrust ECC Certification Authority +===================================== +-----BEGIN CERTIFICATE----- +MIICjzCCAhWgAwIBAgIQXIuZxVqUxdJxVt7NiYDMJjAKBggqhkjOPQQDAzCBiDELMAkGA1UEBhMC +VVMxEzARBgNVBAgTCk5ldyBKZXJzZXkxFDASBgNVBAcTC0plcnNleSBDaXR5MR4wHAYDVQQKExVU +aGUgVVNFUlRSVVNUIE5ldHdvcmsxLjAsBgNVBAMTJVVTRVJUcnVzdCBFQ0MgQ2VydGlmaWNhdGlv +biBBdXRob3JpdHkwHhcNMTAwMjAxMDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCBiDELMAkGA1UEBhMC +VVMxEzARBgNVBAgTCk5ldyBKZXJzZXkxFDASBgNVBAcTC0plcnNleSBDaXR5MR4wHAYDVQQKExVU +aGUgVVNFUlRSVVNUIE5ldHdvcmsxLjAsBgNVBAMTJVVTRVJUcnVzdCBFQ0MgQ2VydGlmaWNhdGlv +biBBdXRob3JpdHkwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQarFRaqfloI+d61SRvU8Za2EurxtW2 +0eZzca7dnNYMYf3boIkDuAUU7FfO7l0/4iGzzvfUinngo4N+LZfQYcTxmdwlkWOrfzCjtHDix6Ez +nPO/LlxTsV+zfTJ/ijTjeXmjQjBAMB0GA1UdDgQWBBQ64QmG1M8ZwpZ2dEl23OA1xmNjmjAOBgNV +HQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAKBggqhkjOPQQDAwNoADBlAjA2Z6EWCNzklwBB +HU6+4WMBzzuqQhFkoJ2UOQIReVx7Hfpkue4WQrO/isIJxOzksU0CMQDpKmFHjFJKS04YcPbWRNZu +9YO6bVi9JNlWSOrvxKJGgYhqOkbRqZtNyWHa0V1Xahg= +-----END CERTIFICATE----- + +GlobalSign ECC Root CA - R4 +=========================== +-----BEGIN CERTIFICATE----- +MIIB4TCCAYegAwIBAgIRKjikHJYKBN5CsiilC+g0mAIwCgYIKoZIzj0EAwIwUDEkMCIGA1UECxMb +R2xvYmFsU2lnbiBFQ0MgUm9vdCBDQSAtIFI0MRMwEQYDVQQKEwpHbG9iYWxTaWduMRMwEQYDVQQD +EwpHbG9iYWxTaWduMB4XDTEyMTExMzAwMDAwMFoXDTM4MDExOTAzMTQwN1owUDEkMCIGA1UECxMb +R2xvYmFsU2lnbiBFQ0MgUm9vdCBDQSAtIFI0MRMwEQYDVQQKEwpHbG9iYWxTaWduMRMwEQYDVQQD +EwpHbG9iYWxTaWduMFkwEwYHKoZIzj0CAQYIKoZIzj0DAQcDQgAEuMZ5049sJQ6fLjkZHAOkrprl +OQcJFspjsbmG+IpXwVfOQvpzofdlQv8ewQCybnMO/8ch5RikqtlxP6jUuc6MHaNCMEAwDgYDVR0P +AQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFFSwe61FuOJAf/sKbvu+M8k8o4TV +MAoGCCqGSM49BAMCA0gAMEUCIQDckqGgE6bPA7DmxCGXkPoUVy0D7O48027KqGx2vKLeuwIgJ6iF +JzWbVsaj8kfSt24bAgAXqmemFZHe+pTsewv4n4Q= +-----END CERTIFICATE----- + +GlobalSign ECC Root CA - R5 +=========================== +-----BEGIN CERTIFICATE----- +MIICHjCCAaSgAwIBAgIRYFlJ4CYuu1X5CneKcflK2GwwCgYIKoZIzj0EAwMwUDEkMCIGA1UECxMb +R2xvYmFsU2lnbiBFQ0MgUm9vdCBDQSAtIFI1MRMwEQYDVQQKEwpHbG9iYWxTaWduMRMwEQYDVQQD +EwpHbG9iYWxTaWduMB4XDTEyMTExMzAwMDAwMFoXDTM4MDExOTAzMTQwN1owUDEkMCIGA1UECxMb +R2xvYmFsU2lnbiBFQ0MgUm9vdCBDQSAtIFI1MRMwEQYDVQQKEwpHbG9iYWxTaWduMRMwEQYDVQQD +EwpHbG9iYWxTaWduMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAER0UOlvt9Xb/pOdEh+J8LttV7HpI6 +SFkc8GIxLcB6KP4ap1yztsyX50XUWPrRd21DosCHZTQKH3rd6zwzocWdTaRvQZU4f8kehOvRnkmS +h5SHDDqFSmafnVmTTZdhBoZKo0IwQDAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAd +BgNVHQ4EFgQUPeYpSJvqB8ohREom3m7e0oPQn1kwCgYIKoZIzj0EAwMDaAAwZQIxAOVpEslu28Yx +uglB4Zf4+/2a4n0Sye18ZNPLBSWLVtmg515dTguDnFt2KaAJJiFqYgIwcdK1j1zqO+F4CYWodZI7 +yFz9SO8NdCKoCOJuxUnOxwy8p2Fp8fc74SrL+SvzZpA3 +-----END CERTIFICATE----- + +Staat der Nederlanden Root CA - G3 +================================== +-----BEGIN CERTIFICATE----- +MIIFdDCCA1ygAwIBAgIEAJiiOTANBgkqhkiG9w0BAQsFADBaMQswCQYDVQQGEwJOTDEeMBwGA1UE +CgwVU3RhYXQgZGVyIE5lZGVybGFuZGVuMSswKQYDVQQDDCJTdGFhdCBkZXIgTmVkZXJsYW5kZW4g +Um9vdCBDQSAtIEczMB4XDTEzMTExNDExMjg0MloXDTI4MTExMzIzMDAwMFowWjELMAkGA1UEBhMC +TkwxHjAcBgNVBAoMFVN0YWF0IGRlciBOZWRlcmxhbmRlbjErMCkGA1UEAwwiU3RhYXQgZGVyIE5l +ZGVybGFuZGVuIFJvb3QgQ0EgLSBHMzCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAL4y +olQPcPssXFnrbMSkUeiFKrPMSjTysF/zDsccPVMeiAho2G89rcKezIJnByeHaHE6n3WWIkYFsO2t +x1ueKt6c/DrGlaf1F2cY5y9JCAxcz+bMNO14+1Cx3Gsy8KL+tjzk7FqXxz8ecAgwoNzFs21v0IJy +EavSgWhZghe3eJJg+szeP4TrjTgzkApyI/o1zCZxMdFyKJLZWyNtZrVtB0LrpjPOktvA9mxjeM3K +Tj215VKb8b475lRgsGYeCasH/lSJEULR9yS6YHgamPfJEf0WwTUaVHXvQ9Plrk7O53vDxk5hUUur +mkVLoR9BvUhTFXFkC4az5S6+zqQbwSmEorXLCCN2QyIkHxcE1G6cxvx/K2Ya7Irl1s9N9WMJtxU5 +1nus6+N86U78dULI7ViVDAZCopz35HCz33JvWjdAidiFpNfxC95DGdRKWCyMijmev4SH8RY7Ngzp +07TKbBlBUgmhHbBqv4LvcFEhMtwFdozL92TkA1CvjJFnq8Xy7ljY3r735zHPbMk7ccHViLVlvMDo +FxcHErVc0qsgk7TmgoNwNsXNo42ti+yjwUOH5kPiNL6VizXtBznaqB16nzaeErAMZRKQFWDZJkBE +41ZgpRDUajz9QdwOWke275dhdU/Z/seyHdTtXUmzqWrLZoQT1Vyg3N9udwbRcXXIV2+vD3dbAgMB +AAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBRUrfrHkleu +yjWcLhL75LpdINyUVzANBgkqhkiG9w0BAQsFAAOCAgEAMJmdBTLIXg47mAE6iqTnB/d6+Oea31BD +U5cqPco8R5gu4RV78ZLzYdqQJRZlwJ9UXQ4DO1t3ApyEtg2YXzTdO2PCwyiBwpwpLiniyMMB8jPq +KqrMCQj3ZWfGzd/TtiunvczRDnBfuCPRy5FOCvTIeuXZYzbB1N/8Ipf3YF3qKS9Ysr1YvY2WTxB1 +v0h7PVGHoTx0IsL8B3+A3MSs/mrBcDCw6Y5p4ixpgZQJut3+TcCDjJRYwEYgr5wfAvg1VUkvRtTA +8KCWAg8zxXHzniN9lLf9OtMJgwYh/WA9rjLA0u6NpvDntIJ8CsxwyXmA+P5M9zWEGYox+wrZ13+b +8KKaa8MFSu1BYBQw0aoRQm7TIwIEC8Zl3d1Sd9qBa7Ko+gE4uZbqKmxnl4mUnrzhVNXkanjvSr0r +mj1AfsbAddJu+2gw7OyLnflJNZoaLNmzlTnVHpL3prllL+U9bTpITAjc5CgSKL59NVzq4BZ+Extq +1z7XnvwtdbLBFNUjA9tbbws+eC8N3jONFrdI54OagQ97wUNNVQQXOEpR1VmiiXTTn74eS9fGbbeI +JG9gkaSChVtWQbzQRKtqE77RLFi3EjNYsjdj3BP1lB0/QFH1T/U67cjF68IeHRaVesd+QnGTbksV +tzDfqu1XhUisHWrdOWnk4Xl4vs4Fv6EM94B7IWcnMFk= +-----END CERTIFICATE----- + +Staat der Nederlanden EV Root CA +================================ +-----BEGIN CERTIFICATE----- +MIIFcDCCA1igAwIBAgIEAJiWjTANBgkqhkiG9w0BAQsFADBYMQswCQYDVQQGEwJOTDEeMBwGA1UE +CgwVU3RhYXQgZGVyIE5lZGVybGFuZGVuMSkwJwYDVQQDDCBTdGFhdCBkZXIgTmVkZXJsYW5kZW4g +RVYgUm9vdCBDQTAeFw0xMDEyMDgxMTE5MjlaFw0yMjEyMDgxMTEwMjhaMFgxCzAJBgNVBAYTAk5M +MR4wHAYDVQQKDBVTdGFhdCBkZXIgTmVkZXJsYW5kZW4xKTAnBgNVBAMMIFN0YWF0IGRlciBOZWRl +cmxhbmRlbiBFViBSb290IENBMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA48d+ifkk +SzrSM4M1LGns3Amk41GoJSt5uAg94JG6hIXGhaTK5skuU6TJJB79VWZxXSzFYGgEt9nCUiY4iKTW +O0Cmws0/zZiTs1QUWJZV1VD+hq2kY39ch/aO5ieSZxeSAgMs3NZmdO3dZ//BYY1jTw+bbRcwJu+r +0h8QoPnFfxZpgQNH7R5ojXKhTbImxrpsX23Wr9GxE46prfNeaXUmGD5BKyF/7otdBwadQ8QpCiv8 +Kj6GyzyDOvnJDdrFmeK8eEEzduG/L13lpJhQDBXd4Pqcfzho0LKmeqfRMb1+ilgnQ7O6M5HTp5gV +XJrm0w912fxBmJc+qiXbj5IusHsMX/FjqTf5m3VpTCgmJdrV8hJwRVXj33NeN/UhbJCONVrJ0yPr +08C+eKxCKFhmpUZtcALXEPlLVPxdhkqHz3/KRawRWrUgUY0viEeXOcDPusBCAUCZSCELa6fS/ZbV +0b5GnUngC6agIk440ME8MLxwjyx1zNDFjFE7PZQIZCZhfbnDZY8UnCHQqv0XcgOPvZuM5l5Tnrmd +74K74bzickFbIZTTRTeU0d8JOV3nI6qaHcptqAqGhYqCvkIH1vI4gnPah1vlPNOePqc7nvQDs/nx +fRN0Av+7oeX6AHkcpmZBiFxgV6YuCcS6/ZrPpx9Aw7vMWgpVSzs4dlG4Y4uElBbmVvMCAwEAAaNC +MEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFP6rAJCYniT8qcwa +ivsnuL8wbqg7MA0GCSqGSIb3DQEBCwUAA4ICAQDPdyxuVr5Os7aEAJSrR8kN0nbHhp8dB9O2tLsI +eK9p0gtJ3jPFrK3CiAJ9Brc1AsFgyb/E6JTe1NOpEyVa/m6irn0F3H3zbPB+po3u2dfOWBfoqSmu +c0iH55vKbimhZF8ZE/euBhD/UcabTVUlT5OZEAFTdfETzsemQUHSv4ilf0X8rLiltTMMgsT7B/Zq +5SWEXwbKwYY5EdtYzXc7LMJMD16a4/CrPmEbUCTCwPTxGfARKbalGAKb12NMcIxHowNDXLldRqAN +b/9Zjr7dn3LDWyvfjFvO5QxGbJKyCqNMVEIYFRIYvdr8unRu/8G2oGTYqV9Vrp9canaW2HNnh/tN +f1zuacpzEPuKqf2evTY4SUmH9A4U8OmHuD+nT3pajnnUk+S7aFKErGzp85hwVXIy+TSrK0m1zSBi +5Dp6Z2Orltxtrpfs/J92VoguZs9btsmksNcFuuEnL5O7Jiqik7Ab846+HUCjuTaPPoIaGl6I6lD4 +WeKDRikL40Rc4ZW2aZCaFG+XroHPaO+Zmr615+F/+PoTRxZMzG0IQOeLeG9QgkRQP2YGiqtDhFZK +DyAthg710tvSeopLzaXoTvFeJiUBWSOgftL2fiFX1ye8FVdMpEbB4IMeDExNH08GGeL5qPQ6gqGy +eUN51q1veieQA6TqJIc/2b3Z6fJfUEkc7uzXLg== +-----END CERTIFICATE----- + +IdenTrust Commercial Root CA 1 +============================== +-----BEGIN CERTIFICATE----- +MIIFYDCCA0igAwIBAgIQCgFCgAAAAUUjyES1AAAAAjANBgkqhkiG9w0BAQsFADBKMQswCQYDVQQG +EwJVUzESMBAGA1UEChMJSWRlblRydXN0MScwJQYDVQQDEx5JZGVuVHJ1c3QgQ29tbWVyY2lhbCBS +b290IENBIDEwHhcNMTQwMTE2MTgxMjIzWhcNMzQwMTE2MTgxMjIzWjBKMQswCQYDVQQGEwJVUzES +MBAGA1UEChMJSWRlblRydXN0MScwJQYDVQQDEx5JZGVuVHJ1c3QgQ29tbWVyY2lhbCBSb290IENB +IDEwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCnUBneP5k91DNG8W9RYYKyqU+PZ4ld +hNlT3Qwo2dfw/66VQ3KZ+bVdfIrBQuExUHTRgQ18zZshq0PirK1ehm7zCYofWjK9ouuU+ehcCuz/ +mNKvcbO0U59Oh++SvL3sTzIwiEsXXlfEU8L2ApeN2WIrvyQfYo3fw7gpS0l4PJNgiCL8mdo2yMKi +1CxUAGc1bnO/AljwpN3lsKImesrgNqUZFvX9t++uP0D1bVoE/c40yiTcdCMbXTMTEl3EASX2MN0C +XZ/g1Ue9tOsbobtJSdifWwLziuQkkORiT0/Br4sOdBeo0XKIanoBScy0RnnGF7HamB4HWfp1IYVl +3ZBWzvurpWCdxJ35UrCLvYf5jysjCiN2O/cz4ckA82n5S6LgTrx+kzmEB/dEcH7+B1rlsazRGMzy +NeVJSQjKVsk9+w8YfYs7wRPCTY/JTw436R+hDmrfYi7LNQZReSzIJTj0+kuniVyc0uMNOYZKdHzV +WYfCP04MXFL0PfdSgvHqo6z9STQaKPNBiDoT7uje/5kdX7rL6B7yuVBgwDHTc+XvvqDtMwt0viAg +xGds8AgDelWAf0ZOlqf0Hj7h9tgJ4TNkK2PXMl6f+cB7D3hvl7yTmvmcEpB4eoCHFddydJxVdHix +uuFucAS6T6C6aMN7/zHwcz09lCqxC0EOoP5NiGVreTO01wIDAQABo0IwQDAOBgNVHQ8BAf8EBAMC +AQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU7UQZwNPwBovupHu+QucmVMiONnYwDQYJKoZI +hvcNAQELBQADggIBAA2ukDL2pkt8RHYZYR4nKM1eVO8lvOMIkPkp165oCOGUAFjvLi5+U1KMtlwH +6oi6mYtQlNeCgN9hCQCTrQ0U5s7B8jeUeLBfnLOic7iPBZM4zY0+sLj7wM+x8uwtLRvM7Kqas6pg +ghstO8OEPVeKlh6cdbjTMM1gCIOQ045U8U1mwF10A0Cj7oV+wh93nAbowacYXVKV7cndJZ5t+qnt +ozo00Fl72u1Q8zW/7esUTTHHYPTa8Yec4kjixsU3+wYQ+nVZZjFHKdp2mhzpgq7vmrlR94gjmmmV +YjzlVYA211QC//G5Xc7UI2/YRYRKW2XviQzdFKcgyxilJbQN+QHwotL0AMh0jqEqSI5l2xPE4iUX +feu+h1sXIFRRk0pTAwvsXcoz7WL9RccvW9xYoIA55vrX/hMUpu09lEpCdNTDd1lzzY9GvlU47/ro +kTLql1gEIt44w8y8bckzOmoKaT+gyOpyj4xjhiO9bTyWnpXgSUyqorkqG5w2gXjtw+hG4iZZRHUe +2XWJUc0QhJ1hYMtd+ZciTY6Y5uN/9lu7rs3KSoFrXgvzUeF0K+l+J6fZmUlO+KWA2yUPHGNiiskz +Z2s8EIPGrd6ozRaOjfAHN3Gf8qv8QfXBi+wAN10J5U6A7/qxXDgGpRtK4dw4LTzcqx+QGtVKnO7R +cGzM7vRX+Bi6hG6H +-----END CERTIFICATE----- + +IdenTrust Public Sector Root CA 1 +================================= +-----BEGIN CERTIFICATE----- +MIIFZjCCA06gAwIBAgIQCgFCgAAAAUUjz0Z8AAAAAjANBgkqhkiG9w0BAQsFADBNMQswCQYDVQQG +EwJVUzESMBAGA1UEChMJSWRlblRydXN0MSowKAYDVQQDEyFJZGVuVHJ1c3QgUHVibGljIFNlY3Rv +ciBSb290IENBIDEwHhcNMTQwMTE2MTc1MzMyWhcNMzQwMTE2MTc1MzMyWjBNMQswCQYDVQQGEwJV +UzESMBAGA1UEChMJSWRlblRydXN0MSowKAYDVQQDEyFJZGVuVHJ1c3QgUHVibGljIFNlY3RvciBS +b290IENBIDEwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC2IpT8pEiv6EdrCvsnduTy +P4o7ekosMSqMjbCpwzFrqHd2hCa2rIFCDQjrVVi7evi8ZX3yoG2LqEfpYnYeEe4IFNGyRBb06tD6 +Hi9e28tzQa68ALBKK0CyrOE7S8ItneShm+waOh7wCLPQ5CQ1B5+ctMlSbdsHyo+1W/CD80/HLaXI +rcuVIKQxKFdYWuSNG5qrng0M8gozOSI5Cpcu81N3uURF/YTLNiCBWS2ab21ISGHKTN9T0a9SvESf +qy9rg3LvdYDaBjMbXcjaY8ZNzaxmMc3R3j6HEDbhuaR672BQssvKplbgN6+rNBM5Jeg5ZuSYeqoS +mJxZZoY+rfGwyj4GD3vwEUs3oERte8uojHH01bWRNszwFcYr3lEXsZdMUD2xlVl8BX0tIdUAvwFn +ol57plzy9yLxkA2T26pEUWbMfXYD62qoKjgZl3YNa4ph+bz27nb9cCvdKTz4Ch5bQhyLVi9VGxyh +LrXHFub4qjySjmm2AcG1hp2JDws4lFTo6tyePSW8Uybt1as5qsVATFSrsrTZ2fjXctscvG29ZV/v +iDUqZi/u9rNl8DONfJhBaUYPQxxp+pu10GFqzcpL2UyQRqsVWaFHVCkugyhfHMKiq3IXAAaOReyL +4jM9f9oZRORicsPfIsbyVtTdX5Vy7W1f90gDW/3FKqD2cyOEEBsB5wIDAQABo0IwQDAOBgNVHQ8B +Af8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU43HgntinQtnbcZFrlJPrw6PRFKMw +DQYJKoZIhvcNAQELBQADggIBAEf63QqwEZE4rU1d9+UOl1QZgkiHVIyqZJnYWv6IAcVYpZmxI1Qj +t2odIFflAWJBF9MJ23XLblSQdf4an4EKwt3X9wnQW3IV5B4Jaj0z8yGa5hV+rVHVDRDtfULAj+7A +mgjVQdZcDiFpboBhDhXAuM/FSRJSzL46zNQuOAXeNf0fb7iAaJg9TaDKQGXSc3z1i9kKlT/YPyNt +GtEqJBnZhbMX73huqVjRI9PHE+1yJX9dsXNw0H8GlwmEKYBhHfpe/3OsoOOJuBxxFcbeMX8S3OFt +m6/n6J91eEyrRjuazr8FGF1NFTwWmhlQBJqymm9li1JfPFgEKCXAZmExfrngdbkaqIHWchezxQMx +NRF4eKLg6TCMf4DfWN88uieW4oA0beOY02QnrEh+KHdcxiVhJfiFDGX6xDIvpZgF5PgLZxYWxoK4 +Mhn5+bl53B/N66+rDt0b20XkeucC4pVd/GnwU2lhlXV5C15V5jgclKlZM57IcXR5f1GJtshquDDI +ajjDbp7hNxbqBWJMWxJH7ae0s1hWx0nzfxJoCTFx8G34Tkf71oXuxVhAGaQdp/lLQzfcaFpPz+vC +ZHTetBXZ9FRUGi8c15dxVJCO2SCdUyt/q4/i6jC8UDfv8Ue1fXwsBOxonbRJRBD0ckscZOf85muQ +3Wl9af0AVqW3rLatt8o+Ae+c +-----END CERTIFICATE----- + +Entrust Root Certification Authority - G2 +========================================= +-----BEGIN CERTIFICATE----- +MIIEPjCCAyagAwIBAgIESlOMKDANBgkqhkiG9w0BAQsFADCBvjELMAkGA1UEBhMCVVMxFjAUBgNV +BAoTDUVudHJ1c3QsIEluYy4xKDAmBgNVBAsTH1NlZSB3d3cuZW50cnVzdC5uZXQvbGVnYWwtdGVy +bXMxOTA3BgNVBAsTMChjKSAyMDA5IEVudHJ1c3QsIEluYy4gLSBmb3IgYXV0aG9yaXplZCB1c2Ug +b25seTEyMDAGA1UEAxMpRW50cnVzdCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzIw +HhcNMDkwNzA3MTcyNTU0WhcNMzAxMjA3MTc1NTU0WjCBvjELMAkGA1UEBhMCVVMxFjAUBgNVBAoT +DUVudHJ1c3QsIEluYy4xKDAmBgNVBAsTH1NlZSB3d3cuZW50cnVzdC5uZXQvbGVnYWwtdGVybXMx +OTA3BgNVBAsTMChjKSAyMDA5IEVudHJ1c3QsIEluYy4gLSBmb3IgYXV0aG9yaXplZCB1c2Ugb25s +eTEyMDAGA1UEAxMpRW50cnVzdCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzIwggEi +MA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQC6hLZy254Ma+KZ6TABp3bqMriVQRrJ2mFOWHLP +/vaCeb9zYQYKpSfYs1/TRU4cctZOMvJyig/3gxnQaoCAAEUesMfnmr8SVycco2gvCoe9amsOXmXz +HHfV1IWNcCG0szLni6LVhjkCsbjSR87kyUnEO6fe+1R9V77w6G7CebI6C1XiUJgWMhNcL3hWwcKU +s/Ja5CeanyTXxuzQmyWC48zCxEXFjJd6BmsqEZ+pCm5IO2/b1BEZQvePB7/1U1+cPvQXLOZprE4y +TGJ36rfo5bs0vBmLrpxR57d+tVOxMyLlbc9wPBr64ptntoP0jaWvYkxN4FisZDQSA/i2jZRjJKRx +AgMBAAGjQjBAMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRqciZ6 +0B7vfec7aVHUbI2fkBJmqzANBgkqhkiG9w0BAQsFAAOCAQEAeZ8dlsa2eT8ijYfThwMEYGprmi5Z +iXMRrEPR9RP/jTkrwPK9T3CMqS/qF8QLVJ7UG5aYMzyorWKiAHarWWluBh1+xLlEjZivEtRh2woZ +Rkfz6/djwUAFQKXSt/S1mja/qYh2iARVBCuch38aNzx+LaUa2NSJXsq9rD1s2G2v1fN2D807iDgi +nWyTmsQ9v4IbZT+mD12q/OWyFcq1rca8PdCE6OoGcrBNOTJ4vz4RnAuknZoh8/CbCzB428Hch0P+ +vGOaysXCHMnHjf87ElgI5rY97HosTvuDls4MPGmHVHOkc8KT/1EQrBVUAdj8BbGJoX90g5pJ19xO +e4pIb4tF9g== +-----END CERTIFICATE----- + +Entrust Root Certification Authority - EC1 +========================================== +-----BEGIN CERTIFICATE----- +MIIC+TCCAoCgAwIBAgINAKaLeSkAAAAAUNCR+TAKBggqhkjOPQQDAzCBvzELMAkGA1UEBhMCVVMx +FjAUBgNVBAoTDUVudHJ1c3QsIEluYy4xKDAmBgNVBAsTH1NlZSB3d3cuZW50cnVzdC5uZXQvbGVn +YWwtdGVybXMxOTA3BgNVBAsTMChjKSAyMDEyIEVudHJ1c3QsIEluYy4gLSBmb3IgYXV0aG9yaXpl +ZCB1c2Ugb25seTEzMDEGA1UEAxMqRW50cnVzdCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5 +IC0gRUMxMB4XDTEyMTIxODE1MjUzNloXDTM3MTIxODE1NTUzNlowgb8xCzAJBgNVBAYTAlVTMRYw +FAYDVQQKEw1FbnRydXN0LCBJbmMuMSgwJgYDVQQLEx9TZWUgd3d3LmVudHJ1c3QubmV0L2xlZ2Fs +LXRlcm1zMTkwNwYDVQQLEzAoYykgMjAxMiBFbnRydXN0LCBJbmMuIC0gZm9yIGF1dGhvcml6ZWQg +dXNlIG9ubHkxMzAxBgNVBAMTKkVudHJ1c3QgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAt +IEVDMTB2MBAGByqGSM49AgEGBSuBBAAiA2IABIQTydC6bUF74mzQ61VfZgIaJPRbiWlH47jCffHy +AsWfoPZb1YsGGYZPUxBtByQnoaD41UcZYUx9ypMn6nQM72+WCf5j7HBdNq1nd67JnXxVRDqiY1Ef +9eNi1KlHBz7MIKNCMEAwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE +FLdj5xrdjekIplWDpOBqUEFlEUJJMAoGCCqGSM49BAMDA2cAMGQCMGF52OVCR98crlOZF7ZvHH3h +vxGU0QOIdeSNiaSKd0bebWHvAvX7td/M/k7//qnmpwIwW5nXhTcGtXsI/esni0qU+eH6p44mCOh8 +kmhtc9hvJqwhAriZtyZBWyVgrtBIGu4G +-----END CERTIFICATE----- + +CFCA EV ROOT +============ +-----BEGIN CERTIFICATE----- +MIIFjTCCA3WgAwIBAgIEGErM1jANBgkqhkiG9w0BAQsFADBWMQswCQYDVQQGEwJDTjEwMC4GA1UE +CgwnQ2hpbmEgRmluYW5jaWFsIENlcnRpZmljYXRpb24gQXV0aG9yaXR5MRUwEwYDVQQDDAxDRkNB +IEVWIFJPT1QwHhcNMTIwODA4MDMwNzAxWhcNMjkxMjMxMDMwNzAxWjBWMQswCQYDVQQGEwJDTjEw +MC4GA1UECgwnQ2hpbmEgRmluYW5jaWFsIENlcnRpZmljYXRpb24gQXV0aG9yaXR5MRUwEwYDVQQD +DAxDRkNBIEVWIFJPT1QwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDXXWvNED8fBVnV +BU03sQ7smCuOFR36k0sXgiFxEFLXUWRwFsJVaU2OFW2fvwwbwuCjZ9YMrM8irq93VCpLTIpTUnrD +7i7es3ElweldPe6hL6P3KjzJIx1qqx2hp/Hz7KDVRM8Vz3IvHWOX6Jn5/ZOkVIBMUtRSqy5J35DN +uF++P96hyk0g1CXohClTt7GIH//62pCfCqktQT+x8Rgp7hZZLDRJGqgG16iI0gNyejLi6mhNbiyW +ZXvKWfry4t3uMCz7zEasxGPrb382KzRzEpR/38wmnvFyXVBlWY9ps4deMm/DGIq1lY+wejfeWkU7 +xzbh72fROdOXW3NiGUgthxwG+3SYIElz8AXSG7Ggo7cbcNOIabla1jj0Ytwli3i/+Oh+uFzJlU9f +py25IGvPa931DfSCt/SyZi4QKPaXWnuWFo8BGS1sbn85WAZkgwGDg8NNkt0yxoekN+kWzqotaK8K +gWU6cMGbrU1tVMoqLUuFG7OA5nBFDWteNfB/O7ic5ARwiRIlk9oKmSJgamNgTnYGmE69g60dWIol +hdLHZR4tjsbftsbhf4oEIRUpdPA+nJCdDC7xij5aqgwJHsfVPKPtl8MeNPo4+QgO48BdK4PRVmrJ +tqhUUy54Mmc9gn900PvhtgVguXDbjgv5E1hvcWAQUhC5wUEJ73IfZzF4/5YFjQIDAQABo2MwYTAf +BgNVHSMEGDAWgBTj/i39KNALtbq2osS/BqoFjJP7LzAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB +/wQEAwIBBjAdBgNVHQ4EFgQU4/4t/SjQC7W6tqLEvwaqBYyT+y8wDQYJKoZIhvcNAQELBQADggIB +ACXGumvrh8vegjmWPfBEp2uEcwPenStPuiB/vHiyz5ewG5zz13ku9Ui20vsXiObTej/tUxPQ4i9q +ecsAIyjmHjdXNYmEwnZPNDatZ8POQQaIxffu2Bq41gt/UP+TqhdLjOztUmCypAbqTuv0axn96/Ua +4CUqmtzHQTb3yHQFhDmVOdYLO6Qn+gjYXB74BGBSESgoA//vU2YApUo0FmZ8/Qmkrp5nGm9BC2sG +E5uPhnEFtC+NiWYzKXZUmhH4J/qyP5Hgzg0b8zAarb8iXRvTvyUFTeGSGn+ZnzxEk8rUQElsgIfX +BDrDMlI1Dlb4pd19xIsNER9Tyx6yF7Zod1rg1MvIB671Oi6ON7fQAUtDKXeMOZePglr4UeWJoBjn +aH9dCi77o0cOPaYjesYBx4/IXr9tgFa+iiS6M+qf4TIRnvHST4D2G0CvOJ4RUHlzEhLN5mydLIhy +PDCBBpEi6lmt2hkuIsKNuYyH4Ga8cyNfIWRjgEj1oDwYPZTISEEdQLpe/v5WOaHIz16eGWRGENoX +kbcFgKyLmZJ956LYBws2J+dIeWCKw9cTXPhyQN9Ky8+ZAAoACxGV2lZFA4gKn2fQ1XmxqI1AbQ3C +ekD6819kR5LLU7m7Wc5P/dAVUwHY3+vZ5nbv0CO7O6l5s9UCKc2Jo5YPSjXnTkLAdc0Hz+Ys63su +-----END CERTIFICATE----- + +OISTE WISeKey Global Root GB CA +=============================== +-----BEGIN CERTIFICATE----- +MIIDtTCCAp2gAwIBAgIQdrEgUnTwhYdGs/gjGvbCwDANBgkqhkiG9w0BAQsFADBtMQswCQYDVQQG +EwJDSDEQMA4GA1UEChMHV0lTZUtleTEiMCAGA1UECxMZT0lTVEUgRm91bmRhdGlvbiBFbmRvcnNl +ZDEoMCYGA1UEAxMfT0lTVEUgV0lTZUtleSBHbG9iYWwgUm9vdCBHQiBDQTAeFw0xNDEyMDExNTAw +MzJaFw0zOTEyMDExNTEwMzFaMG0xCzAJBgNVBAYTAkNIMRAwDgYDVQQKEwdXSVNlS2V5MSIwIAYD +VQQLExlPSVNURSBGb3VuZGF0aW9uIEVuZG9yc2VkMSgwJgYDVQQDEx9PSVNURSBXSVNlS2V5IEds +b2JhbCBSb290IEdCIENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA2Be3HEokKtaX +scriHvt9OO+Y9bI5mE4nuBFde9IllIiCFSZqGzG7qFshISvYD06fWvGxWuR51jIjK+FTzJlFXHtP +rby/h0oLS5daqPZI7H17Dc0hBt+eFf1Biki3IPShehtX1F1Q/7pn2COZH8g/497/b1t3sWtuuMlk +9+HKQUYOKXHQuSP8yYFfTvdv37+ErXNku7dCjmn21HYdfp2nuFeKUWdy19SouJVUQHMD9ur06/4o +Qnc/nSMbsrY9gBQHTC5P99UKFg29ZkM3fiNDecNAhvVMKdqOmq0NpQSHiB6F4+lT1ZvIiwNjeOvg +GUpuuy9rM2RYk61pv48b74JIxwIDAQABo1EwTzALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/BAUwAwEB +/zAdBgNVHQ4EFgQUNQ/INmNe4qPs+TtmFc5RUuORmj0wEAYJKwYBBAGCNxUBBAMCAQAwDQYJKoZI +hvcNAQELBQADggEBAEBM+4eymYGQfp3FsLAmzYh7KzKNbrghcViXfa43FK8+5/ea4n32cZiZBKpD +dHij40lhPnOMTZTg+XHEthYOU3gf1qKHLwI5gSk8rxWYITD+KJAAjNHhy/peyP34EEY7onhCkRd0 +VQreUGdNZtGn//3ZwLWoo4rOZvUPQ82nK1d7Y0Zqqi5S2PTt4W2tKZB4SLrhI6qjiey1q5bAtEui +HZeeevJuQHHfaPFlTc58Bd9TZaml8LGXBHAVRgOY1NK/VLSgWH1Sb9pWJmLU2NuJMW8c8CLC02Ic +Nc1MaRVUGpCY3useX8p3x8uOPUNpnJpY0CQ73xtAln41rYHHTnG6iBM= +-----END CERTIFICATE----- + +SZAFIR ROOT CA2 +=============== +-----BEGIN CERTIFICATE----- +MIIDcjCCAlqgAwIBAgIUPopdB+xV0jLVt+O2XwHrLdzk1uQwDQYJKoZIhvcNAQELBQAwUTELMAkG +A1UEBhMCUEwxKDAmBgNVBAoMH0tyYWpvd2EgSXpiYSBSb3psaWN6ZW5pb3dhIFMuQS4xGDAWBgNV +BAMMD1NaQUZJUiBST09UIENBMjAeFw0xNTEwMTkwNzQzMzBaFw0zNTEwMTkwNzQzMzBaMFExCzAJ +BgNVBAYTAlBMMSgwJgYDVQQKDB9LcmFqb3dhIEl6YmEgUm96bGljemVuaW93YSBTLkEuMRgwFgYD +VQQDDA9TWkFGSVIgUk9PVCBDQTIwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQC3vD5Q +qEvNQLXOYeeWyrSh2gwisPq1e3YAd4wLz32ohswmUeQgPYUM1ljj5/QqGJ3a0a4m7utT3PSQ1hNK +DJA8w/Ta0o4NkjrcsbH/ON7Dui1fgLkCvUqdGw+0w8LBZwPd3BucPbOw3gAeqDRHu5rr/gsUvTaE +2g0gv/pby6kWIK05YO4vdbbnl5z5Pv1+TW9NL++IDWr63fE9biCloBK0TXC5ztdyO4mTp4CEHCdJ +ckm1/zuVnsHMyAHs6A6KCpbns6aH5db5BSsNl0BwPLqsdVqc1U2dAgrSS5tmS0YHF2Wtn2yIANwi +ieDhZNRnvDF5YTy7ykHNXGoAyDw4jlivAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0P +AQH/BAQDAgEGMB0GA1UdDgQWBBQuFqlKGLXLzPVvUPMjX/hd56zwyDANBgkqhkiG9w0BAQsFAAOC +AQEAtXP4A9xZWx126aMqe5Aosk3AM0+qmrHUuOQn/6mWmc5G4G18TKI4pAZw8PRBEew/R40/cof5 +O/2kbytTAOD/OblqBw7rHRz2onKQy4I9EYKL0rufKq8h5mOGnXkZ7/e7DDWQw4rtTw/1zBLZpD67 +oPwglV9PJi8RI4NOdQcPv5vRtB3pEAT+ymCPoky4rc/hkA/NrgrHXXu3UNLUYfrVFdvXn4dRVOul +4+vJhaAlIDf7js4MNIThPIGyd05DpYhfhmehPea0XGG2Ptv+tyjFogeutcrKjSoS75ftwjCkySp6 ++/NNIxuZMzSgLvWpCz/UXeHPhJ/iGcJfitYgHuNztw== +-----END CERTIFICATE----- + +Certum Trusted Network CA 2 +=========================== +-----BEGIN CERTIFICATE----- +MIIF0jCCA7qgAwIBAgIQIdbQSk8lD8kyN/yqXhKN6TANBgkqhkiG9w0BAQ0FADCBgDELMAkGA1UE +BhMCUEwxIjAgBgNVBAoTGVVuaXpldG8gVGVjaG5vbG9naWVzIFMuQS4xJzAlBgNVBAsTHkNlcnR1 +bSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTEkMCIGA1UEAxMbQ2VydHVtIFRydXN0ZWQgTmV0d29y +ayBDQSAyMCIYDzIwMTExMDA2MDgzOTU2WhgPMjA0NjEwMDYwODM5NTZaMIGAMQswCQYDVQQGEwJQ +TDEiMCAGA1UEChMZVW5pemV0byBUZWNobm9sb2dpZXMgUy5BLjEnMCUGA1UECxMeQ2VydHVtIENl +cnRpZmljYXRpb24gQXV0aG9yaXR5MSQwIgYDVQQDExtDZXJ0dW0gVHJ1c3RlZCBOZXR3b3JrIENB +IDIwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC9+Xj45tWADGSdhhuWZGc/IjoedQF9 +7/tcZ4zJzFxrqZHmuULlIEub2pt7uZld2ZuAS9eEQCsn0+i6MLs+CRqnSZXvK0AkwpfHp+6bJe+o +CgCXhVqqndwpyeI1B+twTUrWwbNWuKFBOJvR+zF/j+Bf4bE/D44WSWDXBo0Y+aomEKsq09DRZ40b +Rr5HMNUuctHFY9rnY3lEfktjJImGLjQ/KUxSiyqnwOKRKIm5wFv5HdnnJ63/mgKXwcZQkpsCLL2p +uTRZCr+ESv/f/rOf69me4Jgj7KZrdxYq28ytOxykh9xGc14ZYmhFV+SQgkK7QtbwYeDBoz1mo130 +GO6IyY0XRSmZMnUCMe4pJshrAua1YkV/NxVaI2iJ1D7eTiew8EAMvE0Xy02isx7QBlrd9pPPV3WZ +9fqGGmd4s7+W/jTcvedSVuWz5XV710GRBdxdaeOVDUO5/IOWOZV7bIBaTxNyxtd9KXpEulKkKtVB +Rgkg/iKgtlswjbyJDNXXcPiHUv3a76xRLgezTv7QCdpw75j6VuZt27VXS9zlLCUVyJ4ueE742pye +hizKV/Ma5ciSixqClnrDvFASadgOWkaLOusm+iPJtrCBvkIApPjW/jAux9JG9uWOdf3yzLnQh1vM +BhBgu4M1t15n3kfsmUjxpKEV/q2MYo45VU85FrmxY53/twIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MB0GA1UdDgQWBBS2oVQ5AsOgP46KvPrU+Bym0ToO/TAOBgNVHQ8BAf8EBAMCAQYwDQYJKoZI +hvcNAQENBQADggIBAHGlDs7k6b8/ONWJWsQCYftMxRQXLYtPU2sQF/xlhMcQSZDe28cmk4gmb3DW +Al45oPePq5a1pRNcgRRtDoGCERuKTsZPpd1iHkTfCVn0W3cLN+mLIMb4Ck4uWBzrM9DPhmDJ2vuA +L55MYIR4PSFk1vtBHxgP58l1cb29XN40hz5BsA72udY/CROWFC/emh1auVbONTqwX3BNXuMp8SMo +clm2q8KMZiYcdywmdjWLKKdpoPk79SPdhRB0yZADVpHnr7pH1BKXESLjokmUbOe3lEu6LaTaM4tM +pkT/WjzGHWTYtTHkpjx6qFcL2+1hGsvxznN3Y6SHb0xRONbkX8eftoEq5IVIeVheO/jbAoJnwTnb +w3RLPTYe+SmTiGhbqEQZIfCn6IENLOiTNrQ3ssqwGyZ6miUfmpqAnksqP/ujmv5zMnHCnsZy4Ypo +J/HkD7TETKVhk/iXEAcqMCWpuchxuO9ozC1+9eB+D4Kob7a6bINDd82Kkhehnlt4Fj1F4jNy3eFm +ypnTycUm/Q1oBEauttmbjL4ZvrHG8hnjXALKLNhvSgfZyTXaQHXyxKcZb55CEJh15pWLYLztxRLX +is7VmFxWlgPF7ncGNf/P5O4/E2Hu29othfDNrp2yGAlFw5Khchf8R7agCyzxxN5DaAhqXzvwdmP7 +zAYspsbiDrW5viSP +-----END CERTIFICATE----- + +Hellenic Academic and Research Institutions RootCA 2015 +======================================================= +-----BEGIN CERTIFICATE----- +MIIGCzCCA/OgAwIBAgIBADANBgkqhkiG9w0BAQsFADCBpjELMAkGA1UEBhMCR1IxDzANBgNVBAcT +BkF0aGVuczFEMEIGA1UEChM7SGVsbGVuaWMgQWNhZGVtaWMgYW5kIFJlc2VhcmNoIEluc3RpdHV0 +aW9ucyBDZXJ0LiBBdXRob3JpdHkxQDA+BgNVBAMTN0hlbGxlbmljIEFjYWRlbWljIGFuZCBSZXNl +YXJjaCBJbnN0aXR1dGlvbnMgUm9vdENBIDIwMTUwHhcNMTUwNzA3MTAxMTIxWhcNNDAwNjMwMTAx +MTIxWjCBpjELMAkGA1UEBhMCR1IxDzANBgNVBAcTBkF0aGVuczFEMEIGA1UEChM7SGVsbGVuaWMg +QWNhZGVtaWMgYW5kIFJlc2VhcmNoIEluc3RpdHV0aW9ucyBDZXJ0LiBBdXRob3JpdHkxQDA+BgNV +BAMTN0hlbGxlbmljIEFjYWRlbWljIGFuZCBSZXNlYXJjaCBJbnN0aXR1dGlvbnMgUm9vdENBIDIw +MTUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDC+Kk/G4n8PDwEXT2QNrCROnk8Zlrv +bTkBSRq0t89/TSNTt5AA4xMqKKYx8ZEA4yjsriFBzh/a/X0SWwGDD7mwX5nh8hKDgE0GPt+sr+eh +iGsxr/CL0BgzuNtFajT0AoAkKAoCFZVedioNmToUW/bLy1O8E00BiDeUJRtCvCLYjqOWXjrZMts+ +6PAQZe104S+nfK8nNLspfZu2zwnI5dMK/IhlZXQK3HMcXM1AsRzUtoSMTFDPaI6oWa7CJ06CojXd +FPQf/7J31Ycvqm59JCfnxssm5uX+Zwdj2EUN3TpZZTlYepKZcj2chF6IIbjV9Cz82XBST3i4vTwr +i5WY9bPRaM8gFH5MXF/ni+X1NYEZN9cRCLdmvtNKzoNXADrDgfgXy5I2XdGj2HUb4Ysn6npIQf1F +GQatJ5lOwXBH3bWfgVMS5bGMSF0xQxfjjMZ6Y5ZLKTBOhE5iGV48zpeQpX8B653g+IuJ3SWYPZK2 +fu/Z8VFRfS0myGlZYeCsargqNhEEelC9MoS+L9xy1dcdFkfkR2YgP/SWxa+OAXqlD3pk9Q0Yh9mu +iNX6hME6wGkoLfINaFGq46V3xqSQDqE3izEjR8EJCOtu93ib14L8hCCZSRm2Ekax+0VVFqmjZayc +Bw/qa9wfLgZy7IaIEuQt218FL+TwA9MmM+eAws1CoRc0CwIDAQABo0IwQDAPBgNVHRMBAf8EBTAD +AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUcRVnyMjJvXVdctA4GGqd83EkVAswDQYJKoZI +hvcNAQELBQADggIBAHW7bVRLqhBYRjTyYtcWNl0IXtVsyIe9tC5G8jH4fOpCtZMWVdyhDBKg2mF+ +D1hYc2Ryx+hFjtyp8iY/xnmMsVMIM4GwVhO+5lFc2JsKT0ucVlMC6U/2DWDqTUJV6HwbISHTGzrM +d/K4kPFox/la/vot9L/J9UUbzjgQKjeKeaO04wlshYaT/4mWJ3iBj2fjRnRUjtkNaeJK9E10A/+y +d+2VZ5fkscWrv2oj6NSU4kQoYsRL4vDY4ilrGnB+JGGTe08DMiUNRSQrlrRGar9KC/eaj8GsGsVn +82800vpzY4zvFrCopEYq+OsS7HK07/grfoxSwIuEVPkvPuNVqNxmsdnhX9izjFk0WaSrT2y7Hxjb +davYy5LNlDhhDgcGH0tGEPEVvo2FXDtKK4F5D7Rpn0lQl033DlZdwJVqwjbDG2jJ9SrcR5q+ss7F +Jej6A7na+RZukYT1HCjI/CbM1xyQVqdfbzoEvM14iQuODy+jqk+iGxI9FghAD/FGTNeqewjBCvVt +J94Cj8rDtSvK6evIIVM4pcw72Hc3MKJP2W/R8kCtQXoXxdZKNYm3QdV8hn9VTYNKpXMgwDqvkPGa +JI7ZjnHKe7iG2rKPmT4dEw0SEe7Uq/DpFXYC5ODfqiAeW2GFZECpkJcNrVPSWh2HagCXZWK0vm9q +p/UsQu0yrbYhnr68 +-----END CERTIFICATE----- + +Hellenic Academic and Research Institutions ECC RootCA 2015 +=========================================================== +-----BEGIN CERTIFICATE----- +MIICwzCCAkqgAwIBAgIBADAKBggqhkjOPQQDAjCBqjELMAkGA1UEBhMCR1IxDzANBgNVBAcTBkF0 +aGVuczFEMEIGA1UEChM7SGVsbGVuaWMgQWNhZGVtaWMgYW5kIFJlc2VhcmNoIEluc3RpdHV0aW9u +cyBDZXJ0LiBBdXRob3JpdHkxRDBCBgNVBAMTO0hlbGxlbmljIEFjYWRlbWljIGFuZCBSZXNlYXJj +aCBJbnN0aXR1dGlvbnMgRUNDIFJvb3RDQSAyMDE1MB4XDTE1MDcwNzEwMzcxMloXDTQwMDYzMDEw +MzcxMlowgaoxCzAJBgNVBAYTAkdSMQ8wDQYDVQQHEwZBdGhlbnMxRDBCBgNVBAoTO0hlbGxlbmlj +IEFjYWRlbWljIGFuZCBSZXNlYXJjaCBJbnN0aXR1dGlvbnMgQ2VydC4gQXV0aG9yaXR5MUQwQgYD +VQQDEztIZWxsZW5pYyBBY2FkZW1pYyBhbmQgUmVzZWFyY2ggSW5zdGl0dXRpb25zIEVDQyBSb290 +Q0EgMjAxNTB2MBAGByqGSM49AgEGBSuBBAAiA2IABJKgQehLgoRc4vgxEZmGZE4JJS+dQS8KrjVP +dJWyUWRrjWvmP3CV8AVER6ZyOFB2lQJajq4onvktTpnvLEhvTCUp6NFxW98dwXU3tNf6e3pCnGoK +Vlp8aQuqgAkkbH7BRqNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0O +BBYEFLQiC4KZJAEOnLvkDv2/+5cgk5kqMAoGCCqGSM49BAMCA2cAMGQCMGfOFmI4oqxiRaeplSTA +GiecMjvAwNW6qef4BENThe5SId6d9SWDPp5YSy/XZxMOIQIwBeF1Ad5o7SofTUwJCA3sS61kFyjn +dc5FZXIhF8siQQ6ME5g4mlRtm8rifOoCWCKR +-----END CERTIFICATE----- + +ISRG Root X1 +============ +-----BEGIN CERTIFICATE----- +MIIFazCCA1OgAwIBAgIRAIIQz7DSQONZRGPgu2OCiwAwDQYJKoZIhvcNAQELBQAwTzELMAkGA1UE +BhMCVVMxKTAnBgNVBAoTIEludGVybmV0IFNlY3VyaXR5IFJlc2VhcmNoIEdyb3VwMRUwEwYDVQQD +EwxJU1JHIFJvb3QgWDEwHhcNMTUwNjA0MTEwNDM4WhcNMzUwNjA0MTEwNDM4WjBPMQswCQYDVQQG +EwJVUzEpMCcGA1UEChMgSW50ZXJuZXQgU2VjdXJpdHkgUmVzZWFyY2ggR3JvdXAxFTATBgNVBAMT +DElTUkcgUm9vdCBYMTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAK3oJHP0FDfzm54r +Vygch77ct984kIxuPOZXoHj3dcKi/vVqbvYATyjb3miGbESTtrFj/RQSa78f0uoxmyF+0TM8ukj1 +3Xnfs7j/EvEhmkvBioZxaUpmZmyPfjxwv60pIgbz5MDmgK7iS4+3mX6UA5/TR5d8mUgjU+g4rk8K +b4Mu0UlXjIB0ttov0DiNewNwIRt18jA8+o+u3dpjq+sWT8KOEUt+zwvo/7V3LvSye0rgTBIlDHCN +Aymg4VMk7BPZ7hm/ELNKjD+Jo2FR3qyHB5T0Y3HsLuJvW5iB4YlcNHlsdu87kGJ55tukmi8mxdAQ +4Q7e2RCOFvu396j3x+UCB5iPNgiV5+I3lg02dZ77DnKxHZu8A/lJBdiB3QW0KtZB6awBdpUKD9jf +1b0SHzUvKBds0pjBqAlkd25HN7rOrFleaJ1/ctaJxQZBKT5ZPt0m9STJEadao0xAH0ahmbWnOlFu +hjuefXKnEgV4We0+UXgVCwOPjdAvBbI+e0ocS3MFEvzG6uBQE3xDk3SzynTnjh8BCNAw1FtxNrQH +usEwMFxIt4I7mKZ9YIqioymCzLq9gwQbooMDQaHWBfEbwrbwqHyGO0aoSCqI3Haadr8faqU9GY/r +OPNk3sgrDQoo//fb4hVC1CLQJ13hef4Y53CIrU7m2Ys6xt0nUW7/vGT1M0NPAgMBAAGjQjBAMA4G +A1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBR5tFnme7bl5AFzgAiIyBpY +9umbbjANBgkqhkiG9w0BAQsFAAOCAgEAVR9YqbyyqFDQDLHYGmkgJykIrGF1XIpu+ILlaS/V9lZL +ubhzEFnTIZd+50xx+7LSYK05qAvqFyFWhfFQDlnrzuBZ6brJFe+GnY+EgPbk6ZGQ3BebYhtF8GaV +0nxvwuo77x/Py9auJ/GpsMiu/X1+mvoiBOv/2X/qkSsisRcOj/KKNFtY2PwByVS5uCbMiogziUwt +hDyC3+6WVwW6LLv3xLfHTjuCvjHIInNzktHCgKQ5ORAzI4JMPJ+GslWYHb4phowim57iaztXOoJw +TdwJx4nLCgdNbOhdjsnvzqvHu7UrTkXWStAmzOVyyghqpZXjFaH3pO3JLF+l+/+sKAIuvtd7u+Nx +e5AW0wdeRlN8NwdCjNPElpzVmbUq4JUagEiuTDkHzsxHpFKVK7q4+63SM1N95R1NbdWhscdCb+ZA +JzVcoyi3B43njTOQ5yOf+1CceWxG1bQVs5ZufpsMljq4Ui0/1lvh+wjChP4kqKOJ2qxq4RgqsahD +YVvTH9w7jXbyLeiNdd8XM2w9U/t7y0Ff/9yi0GE44Za4rF2LN9d11TPAmRGunUHBcnWEvgJBQl9n +JEiU0Zsnvgc/ubhPgXRR4Xq37Z0j4r7g1SgEEzwxA57demyPxgcYxn/eR44/KJ4EBs+lVDR3veyJ +m+kXQ99b21/+jh5Xos1AnX5iItreGCc= +-----END CERTIFICATE----- + +AC RAIZ FNMT-RCM +================ +-----BEGIN CERTIFICATE----- +MIIFgzCCA2ugAwIBAgIPXZONMGc2yAYdGsdUhGkHMA0GCSqGSIb3DQEBCwUAMDsxCzAJBgNVBAYT +AkVTMREwDwYDVQQKDAhGTk1ULVJDTTEZMBcGA1UECwwQQUMgUkFJWiBGTk1ULVJDTTAeFw0wODEw +MjkxNTU5NTZaFw0zMDAxMDEwMDAwMDBaMDsxCzAJBgNVBAYTAkVTMREwDwYDVQQKDAhGTk1ULVJD +TTEZMBcGA1UECwwQQUMgUkFJWiBGTk1ULVJDTTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoC +ggIBALpxgHpMhm5/yBNtwMZ9HACXjywMI7sQmkCpGreHiPibVmr75nuOi5KOpyVdWRHbNi63URcf +qQgfBBckWKo3Shjf5TnUV/3XwSyRAZHiItQDwFj8d0fsjz50Q7qsNI1NOHZnjrDIbzAzWHFctPVr +btQBULgTfmxKo0nRIBnuvMApGGWn3v7v3QqQIecaZ5JCEJhfTzC8PhxFtBDXaEAUwED653cXeuYL +j2VbPNmaUtu1vZ5Gzz3rkQUCwJaydkxNEJY7kvqcfw+Z374jNUUeAlz+taibmSXaXvMiwzn15Cou +08YfxGyqxRxqAQVKL9LFwag0Jl1mpdICIfkYtwb1TplvqKtMUejPUBjFd8g5CSxJkjKZqLsXF3mw +WsXmo8RZZUc1g16p6DULmbvkzSDGm0oGObVo/CK67lWMK07q87Hj/LaZmtVC+nFNCM+HHmpxffnT +tOmlcYF7wk5HlqX2doWjKI/pgG6BU6VtX7hI+cL5NqYuSf+4lsKMB7ObiFj86xsc3i1w4peSMKGJ +47xVqCfWS+2QrYv6YyVZLag13cqXM7zlzced0ezvXg5KkAYmY6252TUtB7p2ZSysV4999AeU14EC +ll2jB0nVetBX+RvnU0Z1qrB5QstocQjpYL05ac70r8NWQMetUqIJ5G+GR4of6ygnXYMgrwTJbFaa +i0b1AgMBAAGjgYMwgYAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYE +FPd9xf3E6Jobd2Sn9R2gzL+HYJptMD4GA1UdIAQ3MDUwMwYEVR0gADArMCkGCCsGAQUFBwIBFh1o +dHRwOi8vd3d3LmNlcnQuZm5tdC5lcy9kcGNzLzANBgkqhkiG9w0BAQsFAAOCAgEAB5BK3/MjTvDD +nFFlm5wioooMhfNzKWtN/gHiqQxjAb8EZ6WdmF/9ARP67Jpi6Yb+tmLSbkyU+8B1RXxlDPiyN8+s +D8+Nb/kZ94/sHvJwnvDKuO+3/3Y3dlv2bojzr2IyIpMNOmqOFGYMLVN0V2Ue1bLdI4E7pWYjJ2cJ +j+F3qkPNZVEI7VFY/uY5+ctHhKQV8Xa7pO6kO8Rf77IzlhEYt8llvhjho6Tc+hj507wTmzl6NLrT +Qfv6MooqtyuGC2mDOL7Nii4LcK2NJpLuHvUBKwrZ1pebbuCoGRw6IYsMHkCtA+fdZn71uSANA+iW ++YJF1DngoABd15jmfZ5nc8OaKveri6E6FO80vFIOiZiaBECEHX5FaZNXzuvO+FB8TxxuBEOb+dY7 +Ixjp6o7RTUaN8Tvkasq6+yO3m/qZASlaWFot4/nUbQ4mrcFuNLwy+AwF+mWj2zs3gyLp1txyM/1d +8iC9djwj2ij3+RvrWWTV3F9yfiD8zYm1kGdNYno/Tq0dwzn+evQoFt9B9kiABdcPUXmsEKvU7ANm +5mqwujGSQkBqvjrTcuFqN1W8rB2Vt2lh8kORdOag0wokRqEIr9baRRmW1FMdW4R58MD3R++Lj8UG +rp1MYp3/RgT408m2ECVAdf4WqslKYIYvuu8wd+RU4riEmViAqhOLUTpPSPaLtrM= +-----END CERTIFICATE----- + +Amazon Root CA 1 +================ +-----BEGIN CERTIFICATE----- +MIIDQTCCAimgAwIBAgITBmyfz5m/jAo54vB4ikPmljZbyjANBgkqhkiG9w0BAQsFADA5MQswCQYD +VQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24gUm9vdCBDQSAxMB4XDTE1 +MDUyNjAwMDAwMFoXDTM4MDExNzAwMDAwMFowOTELMAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpv +bjEZMBcGA1UEAxMQQW1hem9uIFJvb3QgQ0EgMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC +ggEBALJ4gHHKeNXjca9HgFB0fW7Y14h29Jlo91ghYPl0hAEvrAIthtOgQ3pOsqTQNroBvo3bSMgH +FzZM9O6II8c+6zf1tRn4SWiw3te5djgdYZ6k/oI2peVKVuRF4fn9tBb6dNqcmzU5L/qwIFAGbHrQ +gLKm+a/sRxmPUDgH3KKHOVj4utWp+UhnMJbulHheb4mjUcAwhmahRWa6VOujw5H5SNz/0egwLX0t +dHA114gk957EWW67c4cX8jJGKLhD+rcdqsq08p8kDi1L93FcXmn/6pUCyziKrlA4b9v7LWIbxcce +VOF34GfID5yHI9Y/QCB/IIDEgEw+OyQmjgSubJrIqg0CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB +/zAOBgNVHQ8BAf8EBAMCAYYwHQYDVR0OBBYEFIQYzIU07LwMlJQuCFmcx7IQTgoIMA0GCSqGSIb3 +DQEBCwUAA4IBAQCY8jdaQZChGsV2USggNiMOruYou6r4lK5IpDB/G/wkjUu0yKGX9rbxenDIU5PM +CCjjmCXPI6T53iHTfIUJrU6adTrCC2qJeHZERxhlbI1Bjjt/msv0tadQ1wUsN+gDS63pYaACbvXy +8MWy7Vu33PqUXHeeE6V/Uq2V8viTO96LXFvKWlJbYK8U90vvo/ufQJVtMVT8QtPHRh8jrdkPSHCa +2XV4cdFyQzR1bldZwgJcJmApzyMZFo6IQ6XU5MsI+yMRQ+hDKXJioaldXgjUkK642M4UwtBV8ob2 +xJNDd2ZhwLnoQdeXeGADbkpyrqXRfboQnoZsG4q5WTP468SQvvG5 +-----END CERTIFICATE----- + +Amazon Root CA 2 +================ +-----BEGIN CERTIFICATE----- +MIIFQTCCAymgAwIBAgITBmyf0pY1hp8KD+WGePhbJruKNzANBgkqhkiG9w0BAQwFADA5MQswCQYD +VQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24gUm9vdCBDQSAyMB4XDTE1 +MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpv +bjEZMBcGA1UEAxMQQW1hem9uIFJvb3QgQ0EgMjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoC +ggIBAK2Wny2cSkxKgXlRmeyKy2tgURO8TW0G/LAIjd0ZEGrHJgw12MBvIITplLGbhQPDW9tK6Mj4 +kHbZW0/jTOgGNk3Mmqw9DJArktQGGWCsN0R5hYGCrVo34A3MnaZMUnbqQ523BNFQ9lXg1dKmSYXp +N+nKfq5clU1Imj+uIFptiJXZNLhSGkOQsL9sBbm2eLfq0OQ6PBJTYv9K8nu+NQWpEjTj82R0Yiw9 +AElaKP4yRLuH3WUnAnE72kr3H9rN9yFVkE8P7K6C4Z9r2UXTu/Bfh+08LDmG2j/e7HJV63mjrdvd +fLC6HM783k81ds8P+HgfajZRRidhW+mez/CiVX18JYpvL7TFz4QuK/0NURBs+18bvBt+xa47mAEx +kv8LV/SasrlX6avvDXbR8O70zoan4G7ptGmh32n2M8ZpLpcTnqWHsFcQgTfJU7O7f/aS0ZzQGPSS +btqDT6ZjmUyl+17vIWR6IF9sZIUVyzfpYgwLKhbcAS4y2j5L9Z469hdAlO+ekQiG+r5jqFoz7Mt0 +Q5X5bGlSNscpb/xVA1wf+5+9R+vnSUeVC06JIglJ4PVhHvG/LopyboBZ/1c6+XUyo05f7O0oYtlN +c/LMgRdg7c3r3NunysV+Ar3yVAhU/bQtCSwXVEqY0VThUWcI0u1ufm8/0i2BWSlmy5A5lREedCf+ +3euvAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSw +DPBMMPQFWAJI/TPlUq9LhONmUjANBgkqhkiG9w0BAQwFAAOCAgEAqqiAjw54o+Ci1M3m9Zh6O+oA +A7CXDpO8Wqj2LIxyh6mx/H9z/WNxeKWHWc8w4Q0QshNabYL1auaAn6AFC2jkR2vHat+2/XcycuUY ++gn0oJMsXdKMdYV2ZZAMA3m3MSNjrXiDCYZohMr/+c8mmpJ5581LxedhpxfL86kSk5Nrp+gvU5LE +YFiwzAJRGFuFjWJZY7attN6a+yb3ACfAXVU3dJnJUH/jWS5E4ywl7uxMMne0nxrpS10gxdr9HIcW +xkPo1LsmmkVwXqkLN1PiRnsn/eBG8om3zEK2yygmbtmlyTrIQRNg91CMFa6ybRoVGld45pIq2WWQ +gj9sAq+uEjonljYE1x2igGOpm/HlurR8FLBOybEfdF849lHqm/osohHUqS0nGkWxr7JOcQ3AWEbW +aQbLU8uz/mtBzUF+fUwPfHJ5elnNXkoOrJupmHN5fLT0zLm4BwyydFy4x2+IoZCn9Kr5v2c69BoV +Yh63n749sSmvZ6ES8lgQGVMDMBu4Gon2nL2XA46jCfMdiyHxtN/kHNGfZQIG6lzWE7OE76KlXIx3 +KadowGuuQNKotOrN8I1LOJwZmhsoVLiJkO/KdYE+HvJkJMcYr07/R54H9jVlpNMKVv/1F2Rs76gi +JUmTtt8AF9pYfl3uxRuw0dFfIRDH+fO6AgonB8Xx1sfT4PsJYGw= +-----END CERTIFICATE----- + +Amazon Root CA 3 +================ +-----BEGIN CERTIFICATE----- +MIIBtjCCAVugAwIBAgITBmyf1XSXNmY/Owua2eiedgPySjAKBggqhkjOPQQDAjA5MQswCQYDVQQG +EwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24gUm9vdCBDQSAzMB4XDTE1MDUy +NjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZ +MBcGA1UEAxMQQW1hem9uIFJvb3QgQ0EgMzBZMBMGByqGSM49AgEGCCqGSM49AwEHA0IABCmXp8ZB +f8ANm+gBG1bG8lKlui2yEujSLtf6ycXYqm0fc4E7O5hrOXwzpcVOho6AF2hiRVd9RFgdszflZwjr +Zt6jQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSrttvXBp43 +rDCGB5Fwx5zEGbF4wDAKBggqhkjOPQQDAgNJADBGAiEA4IWSoxe3jfkrBqWTrBqYaGFy+uGh0Psc +eGCmQ5nFuMQCIQCcAu/xlJyzlvnrxir4tiz+OpAUFteMYyRIHN8wfdVoOw== +-----END CERTIFICATE----- + +Amazon Root CA 4 +================ +-----BEGIN CERTIFICATE----- +MIIB8jCCAXigAwIBAgITBmyf18G7EEwpQ+Vxe3ssyBrBDjAKBggqhkjOPQQDAzA5MQswCQYDVQQG +EwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24gUm9vdCBDQSA0MB4XDTE1MDUy +NjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZ +MBcGA1UEAxMQQW1hem9uIFJvb3QgQ0EgNDB2MBAGByqGSM49AgEGBSuBBAAiA2IABNKrijdPo1MN +/sGKe0uoe0ZLY7Bi9i0b2whxIdIA6GO9mif78DluXeo9pcmBqqNbIJhFXRbb/egQbeOc4OO9X4Ri +83BkM6DLJC9wuoihKqB1+IGuYgbEgds5bimwHvouXKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNV +HQ8BAf8EBAMCAYYwHQYDVR0OBBYEFNPsxzplbszh2naaVvuc84ZtV+WBMAoGCCqGSM49BAMDA2gA +MGUCMDqLIfG9fhGt0O9Yli/W651+kI0rz2ZVwyzjKKlwCkcO8DdZEv8tmZQoTipPNU0zWgIxAOp1 +AE47xDqUEpHJWEadIRNyp4iciuRMStuW1KyLa2tJElMzrdfkviT8tQp21KW8EA== +-----END CERTIFICATE----- + +LuxTrust Global Root 2 +====================== +-----BEGIN CERTIFICATE----- +MIIFwzCCA6ugAwIBAgIUCn6m30tEntpqJIWe5rgV0xZ/u7EwDQYJKoZIhvcNAQELBQAwRjELMAkG +A1UEBhMCTFUxFjAUBgNVBAoMDUx1eFRydXN0IFMuQS4xHzAdBgNVBAMMFkx1eFRydXN0IEdsb2Jh +bCBSb290IDIwHhcNMTUwMzA1MTMyMTU3WhcNMzUwMzA1MTMyMTU3WjBGMQswCQYDVQQGEwJMVTEW +MBQGA1UECgwNTHV4VHJ1c3QgUy5BLjEfMB0GA1UEAwwWTHV4VHJ1c3QgR2xvYmFsIFJvb3QgMjCC +AiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANeFl78RmOnwYoNMPIf5U2o3C/IPPIfOb9wm +Kb3FibrJgz337spbxm1Jc7TJRqMbNBM/wYlFV/TZsfs2ZUv7COJIcRHIbjuend+JZTemhfY7RBi2 +xjcwYkSSl2l9QjAk5A0MiWtj3sXh306pFGxT4GHO9hcvHTy95iJMHZP1EMShduxq3sVs35a0VkBC +wGKSMKEtFZSg0iAGCW5qbeXrt77U8PEVfIvmTroTzEsnXpk8F12PgX8zPU/TPxvsXD/wPEx1bvKm +1Z3aLQdjAsZy6ZS8TEmVT4hSyNvoaYL4zDRbIvCGp4m9SAptZoFtyMhk+wHh9OHe2Z7d21vUKpkm +FRseTJIpgp7VkoGSQXAZ96Tlk0u8d2cx3Rz9MXANF5kM+Qw5GSoXtTBxVdUPrljhPS80m8+f9niF +wpN6cj5mj5wWEWCPnolvZ77gR1o7DJpni89Gxq44o/KnvObWhWszJHAiS8sIm7vI+AIpHb4gDEa/ +a4ebsypmQjVGbKq6rfmYe+lQVRQxv7HaLe2ArWgk+2mr2HETMOZns4dA/Yl+8kPREd8vZS9kzl8U +ubG/Mb2HeFpZZYiq/FkySIbWTLkpS5XTdvN3JW1CHDiDTf2jX5t/Lax5Gw5CMZdjpPuKadUiDTSQ +MC6otOBttpSsvItO13D8xTiOZCXhTTmQzsmHhFhxAgMBAAGjgagwgaUwDwYDVR0TAQH/BAUwAwEB +/zBCBgNVHSAEOzA5MDcGByuBKwEBAQowLDAqBggrBgEFBQcCARYeaHR0cHM6Ly9yZXBvc2l0b3J5 +Lmx1eHRydXN0Lmx1MA4GA1UdDwEB/wQEAwIBBjAfBgNVHSMEGDAWgBT/GCh2+UgFLKGu8SsbK7JT ++Et8szAdBgNVHQ4EFgQU/xgodvlIBSyhrvErGyuyU/hLfLMwDQYJKoZIhvcNAQELBQADggIBAGoZ +FO1uecEsh9QNcH7X9njJCwROxLHOk3D+sFTAMs2ZMGQXvw/l4jP9BzZAcg4atmpZ1gDlaCDdLnIN +H2pkMSCEfUmmWjfrRcmF9dTHF5kH5ptV5AzoqbTOjFu1EVzPig4N1qx3gf4ynCSecs5U89BvolbW +7MM3LGVYvlcAGvI1+ut7MV3CwRI9loGIlonBWVx65n9wNOeD4rHh4bhY79SV5GCc8JaXcozrhAIu +ZY+kt9J/Z93I055cqqmkoCUUBpvsT34tC38ddfEz2O3OuHVtPlu5mB0xDVbYQw8wkbIEa91WvpWA +VWe+2M2D2RjuLg+GLZKecBPs3lHJQ3gCpU3I+V/EkVhGFndadKpAvAefMLmx9xIX3eP/JEAdemrR +TxgKqpAd60Ae36EeRJIQmvKN4dFLRp7oRUKX6kWZ8+xm1QL68qZKJKrezrnK+T+Tb/mjuuqlPpmt +/f97mfVl7vBZKGfXkJWkE4SphMHozs51k2MavDzq1WQfLSoSOcbDWjLtR5EWDrw4wVDej8oqkDQc +7kGUnF4ZLvhFSZl0kbAEb+MEWrGrKqv+x9CWttrhSmQGbmBNvUJO/3jaJMobtNeWOWyu8Q6qp31I +iyBMz2TWuJdGsE7RKlY6oJO9r4Ak4Ap+58rVyuiFVdw2KuGUaJPHZnJED4AhMmwlxyOAgwrr +-----END CERTIFICATE----- + +TUBITAK Kamu SM SSL Kok Sertifikasi - Surum 1 +============================================= +-----BEGIN CERTIFICATE----- +MIIEYzCCA0ugAwIBAgIBATANBgkqhkiG9w0BAQsFADCB0jELMAkGA1UEBhMCVFIxGDAWBgNVBAcT +D0dlYnplIC0gS29jYWVsaTFCMEAGA1UEChM5VHVya2l5ZSBCaWxpbXNlbCB2ZSBUZWtub2xvamlr +IEFyYXN0aXJtYSBLdXJ1bXUgLSBUVUJJVEFLMS0wKwYDVQQLEyRLYW11IFNlcnRpZmlrYXN5b24g +TWVya2V6aSAtIEthbXUgU00xNjA0BgNVBAMTLVRVQklUQUsgS2FtdSBTTSBTU0wgS29rIFNlcnRp +ZmlrYXNpIC0gU3VydW0gMTAeFw0xMzExMjUwODI1NTVaFw00MzEwMjUwODI1NTVaMIHSMQswCQYD +VQQGEwJUUjEYMBYGA1UEBxMPR2ViemUgLSBLb2NhZWxpMUIwQAYDVQQKEzlUdXJraXllIEJpbGlt +c2VsIHZlIFRla25vbG9qaWsgQXJhc3Rpcm1hIEt1cnVtdSAtIFRVQklUQUsxLTArBgNVBAsTJEth +bXUgU2VydGlmaWthc3lvbiBNZXJrZXppIC0gS2FtdSBTTTE2MDQGA1UEAxMtVFVCSVRBSyBLYW11 +IFNNIFNTTCBLb2sgU2VydGlmaWthc2kgLSBTdXJ1bSAxMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8A +MIIBCgKCAQEAr3UwM6q7a9OZLBI3hNmNe5eA027n/5tQlT6QlVZC1xl8JoSNkvoBHToP4mQ4t4y8 +6Ij5iySrLqP1N+RAjhgleYN1Hzv/bKjFxlb4tO2KRKOrbEz8HdDc72i9z+SqzvBV96I01INrN3wc +wv61A+xXzry0tcXtAA9TNypN9E8Mg/uGz8v+jE69h/mniyFXnHrfA2eJLJ2XYacQuFWQfw4tJzh0 +3+f92k4S400VIgLI4OD8D62K18lUUMw7D8oWgITQUVbDjlZ/iSIzL+aFCr2lqBs23tPcLG07xxO9 +WSMs5uWk99gL7eqQQESolbuT1dCANLZGeA4fAJNG4e7p+exPFwIDAQABo0IwQDAdBgNVHQ4EFgQU +ZT/HiobGPN08VFw1+DrtUgxHV8gwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wDQYJ +KoZIhvcNAQELBQADggEBACo/4fEyjq7hmFxLXs9rHmoJ0iKpEsdeV31zVmSAhHqT5Am5EM2fKifh +AHe+SMg1qIGf5LgsyX8OsNJLN13qudULXjS99HMpw+0mFZx+CFOKWI3QSyjfwbPfIPP54+M638yc +lNhOT8NrF7f3cuitZjO1JVOr4PhMqZ398g26rrnZqsZr+ZO7rqu4lzwDGrpDxpa5RXI4s6ehlj2R +e37AIVNMh+3yC1SVUZPVIqUNivGTDj5UDrDYyU7c8jEyVupk+eq1nRZmQnLzf9OxMUP8pI4X8W0j +q5Rm+K37DwhuJi1/FwcJsoz7UMCflo3Ptv0AnVoUmr8CRPXBwp8iXqIPoeM= +-----END CERTIFICATE----- + +GDCA TrustAUTH R5 ROOT +====================== +-----BEGIN CERTIFICATE----- +MIIFiDCCA3CgAwIBAgIIfQmX/vBH6nowDQYJKoZIhvcNAQELBQAwYjELMAkGA1UEBhMCQ04xMjAw +BgNVBAoMKUdVQU5HIERPTkcgQ0VSVElGSUNBVEUgQVVUSE9SSVRZIENPLixMVEQuMR8wHQYDVQQD +DBZHRENBIFRydXN0QVVUSCBSNSBST09UMB4XDTE0MTEyNjA1MTMxNVoXDTQwMTIzMTE1NTk1OVow +YjELMAkGA1UEBhMCQ04xMjAwBgNVBAoMKUdVQU5HIERPTkcgQ0VSVElGSUNBVEUgQVVUSE9SSVRZ +IENPLixMVEQuMR8wHQYDVQQDDBZHRENBIFRydXN0QVVUSCBSNSBST09UMIICIjANBgkqhkiG9w0B +AQEFAAOCAg8AMIICCgKCAgEA2aMW8Mh0dHeb7zMNOwZ+Vfy1YI92hhJCfVZmPoiC7XJjDp6L3TQs +AlFRwxn9WVSEyfFrs0yw6ehGXTjGoqcuEVe6ghWinI9tsJlKCvLriXBjTnnEt1u9ol2x8kECK62p +OqPseQrsXzrj/e+APK00mxqriCZ7VqKChh/rNYmDf1+uKU49tm7srsHwJ5uu4/Ts765/94Y9cnrr +pftZTqfrlYwiOXnhLQiPzLyRuEH3FMEjqcOtmkVEs7LXLM3GKeJQEK5cy4KOFxg2fZfmiJqwTTQJ +9Cy5WmYqsBebnh52nUpmMUHfP/vFBu8btn4aRjb3ZGM74zkYI+dndRTVdVeSN72+ahsmUPI2JgaQ +xXABZG12ZuGR224HwGGALrIuL4xwp9E7PLOR5G62xDtw8mySlwnNR30YwPO7ng/Wi64HtloPzgsM +R6flPri9fcebNaBhlzpBdRfMK5Z3KpIhHtmVdiBnaM8Nvd/WHwlqmuLMc3GkL30SgLdTMEZeS1SZ +D2fJpcjyIMGC7J0R38IC+xo70e0gmu9lZJIQDSri3nDxGGeCjGHeuLzRL5z7D9Ar7Rt2ueQ5Vfj4 +oR24qoAATILnsn8JuLwwoC8N9VKejveSswoAHQBUlwbgsQfZxw9cZX08bVlX5O2ljelAU58VS6Bx +9hoh49pwBiFYFIeFd3mqgnkCAwEAAaNCMEAwHQYDVR0OBBYEFOLJQJ9NzuiaoXzPDj9lxSmIahlR +MA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4ICAQDRSVfg +p8xoWLoBDysZzY2wYUWsEe1jUGn4H3++Fo/9nesLqjJHdtJnJO29fDMylyrHBYZmDRd9FBUb1Ov9 +H5r2XpdptxolpAqzkT9fNqyL7FeoPueBihhXOYV0GkLH6VsTX4/5COmSdI31R9KrO9b7eGZONn35 +6ZLpBN79SWP8bfsUcZNnL0dKt7n/HipzcEYwv1ryL3ml4Y0M2fmyYzeMN2WFcGpcWwlyua1jPLHd ++PwyvzeG5LuOmCd+uh8W4XAR8gPfJWIyJyYYMoSf/wA6E7qaTfRPuBRwIrHKK5DOKcFw9C+df/KQ +HtZa37dG/OaG+svgIHZ6uqbL9XzeYqWxi+7egmaKTjowHz+Ay60nugxe19CxVsp3cbK1daFQqUBD +F8Io2c9Si1vIY9RCPqAzekYu9wogRlR+ak8x8YF+QnQ4ZXMn7sZ8uI7XpTrXmKGcjBBV09tL7ECQ +8s1uV9JiDnxXk7Gnbc2dg7sq5+W2O3FYrf3RRbxake5TFW/TRQl1brqQXR4EzzffHqhmsYzmIGrv +/EhOdJhCrylvLmrH+33RZjEizIYAfmaDDEL0vTSSwxrqT8p+ck0LcIymSLumoRT2+1hEmRSuqguT +aaApJUqlyyvdimYHFngVV3Eb7PVHhPOeMTd61X8kreS8/f3MboPoDKi3QWwH3b08hpcv0g== +-----END CERTIFICATE----- + +TrustCor RootCert CA-1 +====================== +-----BEGIN CERTIFICATE----- +MIIEMDCCAxigAwIBAgIJANqb7HHzA7AZMA0GCSqGSIb3DQEBCwUAMIGkMQswCQYDVQQGEwJQQTEP +MA0GA1UECAwGUGFuYW1hMRQwEgYDVQQHDAtQYW5hbWEgQ2l0eTEkMCIGA1UECgwbVHJ1c3RDb3Ig +U3lzdGVtcyBTLiBkZSBSLkwuMScwJQYDVQQLDB5UcnVzdENvciBDZXJ0aWZpY2F0ZSBBdXRob3Jp +dHkxHzAdBgNVBAMMFlRydXN0Q29yIFJvb3RDZXJ0IENBLTEwHhcNMTYwMjA0MTIzMjE2WhcNMjkx +MjMxMTcyMzE2WjCBpDELMAkGA1UEBhMCUEExDzANBgNVBAgMBlBhbmFtYTEUMBIGA1UEBwwLUGFu +YW1hIENpdHkxJDAiBgNVBAoMG1RydXN0Q29yIFN5c3RlbXMgUy4gZGUgUi5MLjEnMCUGA1UECwwe +VHJ1c3RDb3IgQ2VydGlmaWNhdGUgQXV0aG9yaXR5MR8wHQYDVQQDDBZUcnVzdENvciBSb290Q2Vy +dCBDQS0xMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAv463leLCJhJrMxnHQFgKq1mq +jQCj/IDHUHuO1CAmujIS2CNUSSUQIpidRtLByZ5OGy4sDjjzGiVoHKZaBeYei0i/mJZ0PmnK6bV4 +pQa81QBeCQryJ3pS/C3Vseq0iWEk8xoT26nPUu0MJLq5nux+AHT6k61sKZKuUbS701e/s/OojZz0 +JEsq1pme9J7+wH5COucLlVPat2gOkEz7cD+PSiyU8ybdY2mplNgQTsVHCJCZGxdNuWxu72CVEY4h +gLW9oHPY0LJ3xEXqWib7ZnZ2+AYfYW0PVcWDtxBWcgYHpfOxGgMFZA6dWorWhnAbJN7+KIor0Gqw +/Hqi3LJ5DotlDwIDAQABo2MwYTAdBgNVHQ4EFgQU7mtJPHo/DeOxCbeKyKsZn3MzUOcwHwYDVR0j +BBgwFoAU7mtJPHo/DeOxCbeKyKsZn3MzUOcwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC +AYYwDQYJKoZIhvcNAQELBQADggEBACUY1JGPE+6PHh0RU9otRCkZoB5rMZ5NDp6tPVxBb5UrJKF5 +mDo4Nvu7Zp5I/5CQ7z3UuJu0h3U/IJvOcs+hVcFNZKIZBqEHMwwLKeXx6quj7LUKdJDHfXLy11yf +ke+Ri7fc7Waiz45mO7yfOgLgJ90WmMCV1Aqk5IGadZQ1nJBfiDcGrVmVCrDRZ9MZyonnMlo2HD6C +qFqTvsbQZJG2z9m2GM/bftJlo6bEjhcxwft+dtvTheNYsnd6djtsL1Ac59v2Z3kf9YKVmgenFK+P +3CghZwnS1k1aHBkcjndcw5QkPTJrS37UeJSDvjdNzl/HHk484IkzlQsPpTLWPFp5LBk= +-----END CERTIFICATE----- + +TrustCor RootCert CA-2 +====================== +-----BEGIN CERTIFICATE----- +MIIGLzCCBBegAwIBAgIIJaHfyjPLWQIwDQYJKoZIhvcNAQELBQAwgaQxCzAJBgNVBAYTAlBBMQ8w +DQYDVQQIDAZQYW5hbWExFDASBgNVBAcMC1BhbmFtYSBDaXR5MSQwIgYDVQQKDBtUcnVzdENvciBT +eXN0ZW1zIFMuIGRlIFIuTC4xJzAlBgNVBAsMHlRydXN0Q29yIENlcnRpZmljYXRlIEF1dGhvcml0 +eTEfMB0GA1UEAwwWVHJ1c3RDb3IgUm9vdENlcnQgQ0EtMjAeFw0xNjAyMDQxMjMyMjNaFw0zNDEy +MzExNzI2MzlaMIGkMQswCQYDVQQGEwJQQTEPMA0GA1UECAwGUGFuYW1hMRQwEgYDVQQHDAtQYW5h +bWEgQ2l0eTEkMCIGA1UECgwbVHJ1c3RDb3IgU3lzdGVtcyBTLiBkZSBSLkwuMScwJQYDVQQLDB5U +cnVzdENvciBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkxHzAdBgNVBAMMFlRydXN0Q29yIFJvb3RDZXJ0 +IENBLTIwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCnIG7CKqJiJJWQdsg4foDSq8Gb +ZQWU9MEKENUCrO2fk8eHyLAnK0IMPQo+QVqedd2NyuCb7GgypGmSaIwLgQ5WoD4a3SwlFIIvl9Nk +RvRUqdw6VC0xK5mC8tkq1+9xALgxpL56JAfDQiDyitSSBBtlVkxs1Pu2YVpHI7TYabS3OtB0PAx1 +oYxOdqHp2yqlO/rOsP9+aij9JxzIsekp8VduZLTQwRVtDr4uDkbIXvRR/u8OYzo7cbrPb1nKDOOb +XUm4TOJXsZiKQlecdu/vvdFoqNL0Cbt3Nb4lggjEFixEIFapRBF37120Hapeaz6LMvYHL1cEksr1 +/p3C6eizjkxLAjHZ5DxIgif3GIJ2SDpxsROhOdUuxTTCHWKF3wP+TfSvPd9cW436cOGlfifHhi5q +jxLGhF5DUVCcGZt45vz27Ud+ez1m7xMTiF88oWP7+ayHNZ/zgp6kPwqcMWmLmaSISo5uZk3vFsQP +eSghYA2FFn3XVDjxklb9tTNMg9zXEJ9L/cb4Qr26fHMC4P99zVvh1Kxhe1fVSntb1IVYJ12/+Ctg +rKAmrhQhJ8Z3mjOAPF5GP/fDsaOGM8boXg25NSyqRsGFAnWAoOsk+xWq5Gd/bnc/9ASKL3x74xdh +8N0JqSDIvgmk0H5Ew7IwSjiqqewYmgeCK9u4nBit2uBGF6zPXQIDAQABo2MwYTAdBgNVHQ4EFgQU +2f4hQG6UnrybPZx9mCAZ5YwwYrIwHwYDVR0jBBgwFoAU2f4hQG6UnrybPZx9mCAZ5YwwYrIwDwYD +VR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQADggIBAJ5Fngw7tu/h +Osh80QA9z+LqBrWyOrsGS2h60COXdKcs8AjYeVrXWoSK2BKaG9l9XE1wxaX5q+WjiYndAfrs3fnp +kpfbsEZC89NiqpX+MWcUaViQCqoL7jcjx1BRtPV+nuN79+TMQjItSQzL/0kMmx40/W5ulop5A7Zv +2wnL/V9lFDfhOPXzYRZY5LVtDQsEGz9QLX+zx3oaFoBg+Iof6Rsqxvm6ARppv9JYx1RXCI/hOWB3 +S6xZhBqI8d3LT3jX5+EzLfzuQfogsL7L9ziUwOHQhQ+77Sxzq+3+knYaZH9bDTMJBzN7Bj8RpFxw +PIXAz+OQqIN3+tvmxYxoZxBnpVIt8MSZj3+/0WvitUfW2dCFmU2Umw9Lje4AWkcdEQOsQRivh7dv +DDqPys/cA8GiCcjl/YBeyGBCARsaU1q7N6a3vLqE6R5sGtRk2tRD/pOLS/IseRYQ1JMLiI+h2IYU +RpFHmygk71dSTlxCnKr3Sewn6EAes6aJInKc9Q0ztFijMDvd1GpUk74aTfOTlPf8hAs/hCBcNANE +xdqtvArBAs8e5ZTZ845b2EzwnexhF7sUMlQMAimTHpKG9n/v55IFDlndmQguLvqcAFLTxWYp5KeX +RKQOKIETNcX2b2TmQcTVL8w0RSXPQQCWPUouwpaYT05KnJe32x+SMsj/D1Fu1uwJ +-----END CERTIFICATE----- + +TrustCor ECA-1 +============== +-----BEGIN CERTIFICATE----- +MIIEIDCCAwigAwIBAgIJAISCLF8cYtBAMA0GCSqGSIb3DQEBCwUAMIGcMQswCQYDVQQGEwJQQTEP +MA0GA1UECAwGUGFuYW1hMRQwEgYDVQQHDAtQYW5hbWEgQ2l0eTEkMCIGA1UECgwbVHJ1c3RDb3Ig +U3lzdGVtcyBTLiBkZSBSLkwuMScwJQYDVQQLDB5UcnVzdENvciBDZXJ0aWZpY2F0ZSBBdXRob3Jp +dHkxFzAVBgNVBAMMDlRydXN0Q29yIEVDQS0xMB4XDTE2MDIwNDEyMzIzM1oXDTI5MTIzMTE3Mjgw +N1owgZwxCzAJBgNVBAYTAlBBMQ8wDQYDVQQIDAZQYW5hbWExFDASBgNVBAcMC1BhbmFtYSBDaXR5 +MSQwIgYDVQQKDBtUcnVzdENvciBTeXN0ZW1zIFMuIGRlIFIuTC4xJzAlBgNVBAsMHlRydXN0Q29y +IENlcnRpZmljYXRlIEF1dGhvcml0eTEXMBUGA1UEAwwOVHJ1c3RDb3IgRUNBLTEwggEiMA0GCSqG +SIb3DQEBAQUAA4IBDwAwggEKAoIBAQDPj+ARtZ+odnbb3w9U73NjKYKtR8aja+3+XzP4Q1HpGjOR +MRegdMTUpwHmspI+ap3tDvl0mEDTPwOABoJA6LHip1GnHYMma6ve+heRK9jGrB6xnhkB1Zem6g23 +xFUfJ3zSCNV2HykVh0A53ThFEXXQmqc04L/NyFIduUd+Dbi7xgz2c1cWWn5DkR9VOsZtRASqnKmc +p0yJF4OuowReUoCLHhIlERnXDH19MURB6tuvsBzvgdAsxZohmz3tQjtQJvLsznFhBmIhVE5/wZ0+ +fyCMgMsq2JdiyIMzkX2woloPV+g7zPIlstR8L+xNxqE6FXrntl019fZISjZFZtS6mFjBAgMBAAGj +YzBhMB0GA1UdDgQWBBREnkj1zG1I1KBLf/5ZJC+Dl5mahjAfBgNVHSMEGDAWgBREnkj1zG1I1KBL +f/5ZJC+Dl5mahjAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsF +AAOCAQEABT41XBVwm8nHc2FvcivUwo/yQ10CzsSUuZQRg2dd4mdsdXa/uwyqNsatR5Nj3B5+1t4u +/ukZMjgDfxT2AHMsWbEhBuH7rBiVDKP/mZb3Kyeb1STMHd3BOuCYRLDE5D53sXOpZCz2HAF8P11F +hcCF5yWPldwX8zyfGm6wyuMdKulMY/okYWLW2n62HGz1Ah3UKt1VkOsqEUc8Ll50soIipX1TH0Xs +J5F95yIW6MBoNtjG8U+ARDL54dHRHareqKucBK+tIA5kmE2la8BIWJZpTdwHjFGTot+fDz2LYLSC +jaoITmJF4PkL0uDgPFveXHEnJcLmA4GLEFPjx1WitJ/X5g== +-----END CERTIFICATE----- + +SSL.com Root Certification Authority RSA +======================================== +-----BEGIN CERTIFICATE----- +MIIF3TCCA8WgAwIBAgIIeyyb0xaAMpkwDQYJKoZIhvcNAQELBQAwfDELMAkGA1UEBhMCVVMxDjAM +BgNVBAgMBVRleGFzMRAwDgYDVQQHDAdIb3VzdG9uMRgwFgYDVQQKDA9TU0wgQ29ycG9yYXRpb24x +MTAvBgNVBAMMKFNTTC5jb20gUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSBSU0EwHhcNMTYw +MjEyMTczOTM5WhcNNDEwMjEyMTczOTM5WjB8MQswCQYDVQQGEwJVUzEOMAwGA1UECAwFVGV4YXMx +EDAOBgNVBAcMB0hvdXN0b24xGDAWBgNVBAoMD1NTTCBDb3Jwb3JhdGlvbjExMC8GA1UEAwwoU1NM +LmNvbSBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IFJTQTCCAiIwDQYJKoZIhvcNAQEBBQAD +ggIPADCCAgoCggIBAPkP3aMrfcvQKv7sZ4Wm5y4bunfh4/WvpOz6Sl2RxFdHaxh3a3by/ZPkPQ/C +Fp4LZsNWlJ4Xg4XOVu/yFv0AYvUiCVToZRdOQbngT0aXqhvIuG5iXmmxX9sqAn78bMrzQdjt0Oj8 +P2FI7bADFB0QDksZ4LtO7IZl/zbzXmcCC52GVWH9ejjt/uIZALdvoVBidXQ8oPrIJZK0bnoix/ge +oeOy3ZExqysdBP+lSgQ36YWkMyv94tZVNHwZpEpox7Ko07fKoZOI68GXvIz5HdkihCR0xwQ9aqkp +k8zruFvh/l8lqjRYyMEjVJ0bmBHDOJx+PYZspQ9AhnwC9FwCTyjLrnGfDzrIM/4RJTXq/LrFYD3Z +fBjVsqnTdXgDciLKOsMf7yzlLqn6niy2UUb9rwPW6mBo6oUWNmuF6R7As93EJNyAKoFBbZQ+yODJ +gUEAnl6/f8UImKIYLEJAs/lvOCdLToD0PYFH4Ih86hzOtXVcUS4cK38acijnALXRdMbX5J+tB5O2 +UzU1/Dfkw/ZdFr4hc96SCvigY2q8lpJqPvi8ZVWb3vUNiSYE/CUapiVpy8JtynziWV+XrOvvLsi8 +1xtZPCvM8hnIk2snYxnP/Okm+Mpxm3+T/jRnhE6Z6/yzeAkzcLpmpnbtG3PrGqUNxCITIJRWCk4s +bE6x/c+cCbqiM+2HAgMBAAGjYzBhMB0GA1UdDgQWBBTdBAkHovV6fVJTEpKV7jiAJQ2mWTAPBgNV +HRMBAf8EBTADAQH/MB8GA1UdIwQYMBaAFN0ECQei9Xp9UlMSkpXuOIAlDaZZMA4GA1UdDwEB/wQE +AwIBhjANBgkqhkiG9w0BAQsFAAOCAgEAIBgRlCn7Jp0cHh5wYfGVcpNxJK1ok1iOMq8bs3AD/CUr +dIWQPXhq9LmLpZc7tRiRux6n+UBbkflVma8eEdBcHadm47GUBwwyOabqG7B52B2ccETjit3E+ZUf +ijhDPwGFpUenPUayvOUiaPd7nNgsPgohyC0zrL/FgZkxdMF1ccW+sfAjRfSda/wZY52jvATGGAsl +u1OJD7OAUN5F7kR/q5R4ZJjT9ijdh9hwZXT7DrkT66cPYakylszeu+1jTBi7qUD3oFRuIIhxdRjq +erQ0cuAjJ3dctpDqhiVAq+8zD8ufgr6iIPv2tS0a5sKFsXQP+8hlAqRSAUfdSSLBv9jra6x+3uxj +MxW3IwiPxg+NQVrdjsW5j+VFP3jbutIbQLH+cU0/4IGiul607BXgk90IH37hVZkLId6Tngr75qNJ +vTYw/ud3sqB1l7UtgYgXZSD32pAAn8lSzDLKNXz1PQ/YK9f1JmzJBjSWFupwWRoyeXkLtoh/D1JI +Pb9s2KJELtFOt3JY04kTlf5Eq/jXixtunLwsoFvVagCvXzfh1foQC5ichucmj87w7G6KVwuA406y +wKBjYZC6VWg3dGq2ktufoYYitmUnDuy2n0Jg5GfCtdpBC8TTi2EbvPofkSvXRAdeuims2cXp71NI +WuuA8ShYIc2wBlX7Jz9TkHCpBB5XJ7k= +-----END CERTIFICATE----- + +SSL.com Root Certification Authority ECC +======================================== +-----BEGIN CERTIFICATE----- +MIICjTCCAhSgAwIBAgIIdebfy8FoW6gwCgYIKoZIzj0EAwIwfDELMAkGA1UEBhMCVVMxDjAMBgNV +BAgMBVRleGFzMRAwDgYDVQQHDAdIb3VzdG9uMRgwFgYDVQQKDA9TU0wgQ29ycG9yYXRpb24xMTAv +BgNVBAMMKFNTTC5jb20gUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSBFQ0MwHhcNMTYwMjEy +MTgxNDAzWhcNNDEwMjEyMTgxNDAzWjB8MQswCQYDVQQGEwJVUzEOMAwGA1UECAwFVGV4YXMxEDAO +BgNVBAcMB0hvdXN0b24xGDAWBgNVBAoMD1NTTCBDb3Jwb3JhdGlvbjExMC8GA1UEAwwoU1NMLmNv +bSBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IEVDQzB2MBAGByqGSM49AgEGBSuBBAAiA2IA +BEVuqVDEpiM2nl8ojRfLliJkP9x6jh3MCLOicSS6jkm5BBtHllirLZXI7Z4INcgn64mMU1jrYor+ +8FsPazFSY0E7ic3s7LaNGdM0B9y7xgZ/wkWV7Mt/qCPgCemB+vNH06NjMGEwHQYDVR0OBBYEFILR +hXMw5zUE044CkvvlpNHEIejNMA8GA1UdEwEB/wQFMAMBAf8wHwYDVR0jBBgwFoAUgtGFczDnNQTT +jgKS++Wk0cQh6M0wDgYDVR0PAQH/BAQDAgGGMAoGCCqGSM49BAMCA2cAMGQCMG/n61kRpGDPYbCW +e+0F+S8Tkdzt5fxQaxFGRrMcIQBiu77D5+jNB5n5DQtdcj7EqgIwH7y6C+IwJPt8bYBVCpk+gA0z +5Wajs6O7pdWLjwkspl1+4vAHCGht0nxpbl/f5Wpl +-----END CERTIFICATE----- + +SSL.com EV Root Certification Authority RSA R2 +============================================== +-----BEGIN CERTIFICATE----- +MIIF6zCCA9OgAwIBAgIIVrYpzTS8ePYwDQYJKoZIhvcNAQELBQAwgYIxCzAJBgNVBAYTAlVTMQ4w +DAYDVQQIDAVUZXhhczEQMA4GA1UEBwwHSG91c3RvbjEYMBYGA1UECgwPU1NMIENvcnBvcmF0aW9u +MTcwNQYDVQQDDC5TU0wuY29tIEVWIFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgUlNBIFIy +MB4XDTE3MDUzMTE4MTQzN1oXDTQyMDUzMDE4MTQzN1owgYIxCzAJBgNVBAYTAlVTMQ4wDAYDVQQI +DAVUZXhhczEQMA4GA1UEBwwHSG91c3RvbjEYMBYGA1UECgwPU1NMIENvcnBvcmF0aW9uMTcwNQYD +VQQDDC5TU0wuY29tIEVWIFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgUlNBIFIyMIICIjAN +BgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEAjzZlQOHWTcDXtOlG2mvqM0fNTPl9fb69LT3w23jh +hqXZuglXaO1XPqDQCEGD5yhBJB/jchXQARr7XnAjssufOePPxU7Gkm0mxnu7s9onnQqG6YE3Bf7w +cXHswxzpY6IXFJ3vG2fThVUCAtZJycxa4bH3bzKfydQ7iEGonL3Lq9ttewkfokxykNorCPzPPFTO +Zw+oz12WGQvE43LrrdF9HSfvkusQv1vrO6/PgN3B0pYEW3p+pKk8OHakYo6gOV7qd89dAFmPZiw+ +B6KjBSYRaZfqhbcPlgtLyEDhULouisv3D5oi53+aNxPN8k0TayHRwMwi8qFG9kRpnMphNQcAb9Zh +CBHqurj26bNg5U257J8UZslXWNvNh2n4ioYSA0e/ZhN2rHd9NCSFg83XqpyQGp8hLH94t2S42Oim +9HizVcuE0jLEeK6jj2HdzghTreyI/BXkmg3mnxp3zkyPuBQVPWKchjgGAGYS5Fl2WlPAApiiECto +RHuOec4zSnaqW4EWG7WK2NAAe15itAnWhmMOpgWVSbooi4iTsjQc2KRVbrcc0N6ZVTsj9CLg+Slm +JuwgUHfbSguPvuUCYHBBXtSuUDkiFCbLsjtzdFVHB3mBOagwE0TlBIqulhMlQg+5U8Sb/M3kHN48 ++qvWBkofZ6aYMBzdLNvcGJVXZsb/XItW9XcCAwEAAaNjMGEwDwYDVR0TAQH/BAUwAwEB/zAfBgNV +HSMEGDAWgBT5YLvU49U09rj1BoAlp3PbRmmonjAdBgNVHQ4EFgQU+WC71OPVNPa49QaAJadz20Zp +qJ4wDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4ICAQBWs47LCp1Jjr+kxJG7ZhcFUZh1 +++VQLHqe8RT6q9OKPv+RKY9ji9i0qVQBDb6Thi/5Sm3HXvVX+cpVHBK+Rw82xd9qt9t1wkclf7nx +Y/hoLVUE0fKNsKTPvDxeH3jnpaAgcLAExbf3cqfeIg29MyVGjGSSJuM+LmOW2puMPfgYCdcDzH2G +guDKBAdRUNf/ktUM79qGn5nX67evaOI5JpS6aLe/g9Pqemc9YmeuJeVy6OLk7K4S9ksrPJ/psEDz +OFSz/bdoyNrGj1E8svuR3Bznm53htw1yj+KkxKl4+esUrMZDBcJlOSgYAsOCsp0FvmXtll9ldDz7 +CTUue5wT/RsPXcdtgTpWD8w74a8CLyKsRspGPKAcTNZEtF4uXBVmCeEmKf7GUmG6sXP/wwyc5Wxq +lD8UykAWlYTzWamsX0xhk23RO8yilQwipmdnRC652dKKQbNmC1r7fSOl8hqw/96bg5Qu0T/fkreR +rwU7ZcegbLHNYhLDkBvjJc40vG93drEQw/cFGsDWr3RiSBd3kmmQYRzelYB0VI8YHMPzA9C/pEN1 +hlMYegouCRw2n5H9gooiS9EOUCXdywMMF8mDAAhONU2Ki+3wApRmLER/y5UnlhetCTCstnEXbosX +9hwJ1C07mKVx01QT2WDz9UtmT/rx7iASjbSsV7FFY6GsdqnC+w== +-----END CERTIFICATE----- + +SSL.com EV Root Certification Authority ECC +=========================================== +-----BEGIN CERTIFICATE----- +MIIClDCCAhqgAwIBAgIILCmcWxbtBZUwCgYIKoZIzj0EAwIwfzELMAkGA1UEBhMCVVMxDjAMBgNV +BAgMBVRleGFzMRAwDgYDVQQHDAdIb3VzdG9uMRgwFgYDVQQKDA9TU0wgQ29ycG9yYXRpb24xNDAy +BgNVBAMMK1NTTC5jb20gRVYgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSBFQ0MwHhcNMTYw +MjEyMTgxNTIzWhcNNDEwMjEyMTgxNTIzWjB/MQswCQYDVQQGEwJVUzEOMAwGA1UECAwFVGV4YXMx +EDAOBgNVBAcMB0hvdXN0b24xGDAWBgNVBAoMD1NTTCBDb3Jwb3JhdGlvbjE0MDIGA1UEAwwrU1NM +LmNvbSBFViBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IEVDQzB2MBAGByqGSM49AgEGBSuB +BAAiA2IABKoSR5CYG/vvw0AHgyBO8TCCogbR8pKGYfL2IWjKAMTH6kMAVIbc/R/fALhBYlzccBYy +3h+Z1MzFB8gIH2EWB1E9fVwHU+M1OIzfzZ/ZLg1KthkuWnBaBu2+8KGwytAJKaNjMGEwHQYDVR0O +BBYEFFvKXuXe0oGqzagtZFG22XKbl+ZPMA8GA1UdEwEB/wQFMAMBAf8wHwYDVR0jBBgwFoAUW8pe +5d7SgarNqC1kUbbZcpuX5k8wDgYDVR0PAQH/BAQDAgGGMAoGCCqGSM49BAMCA2gAMGUCMQCK5kCJ +N+vp1RPZytRrJPOwPYdGWBrssd9v+1a6cGvHOMzosYxPD/fxZ3YOg9AeUY8CMD32IygmTMZgh5Mm +m7I1HrrW9zzRHM76JTymGoEVW/MSD2zuZYrJh6j5B+BimoxcSg== +-----END CERTIFICATE----- + +GlobalSign Root CA - R6 +======================= +-----BEGIN CERTIFICATE----- +MIIFgzCCA2ugAwIBAgIORea7A4Mzw4VlSOb/RVEwDQYJKoZIhvcNAQEMBQAwTDEgMB4GA1UECxMX +R2xvYmFsU2lnbiBSb290IENBIC0gUjYxEzARBgNVBAoTCkdsb2JhbFNpZ24xEzARBgNVBAMTCkds +b2JhbFNpZ24wHhcNMTQxMjEwMDAwMDAwWhcNMzQxMjEwMDAwMDAwWjBMMSAwHgYDVQQLExdHbG9i +YWxTaWduIFJvb3QgQ0EgLSBSNjETMBEGA1UEChMKR2xvYmFsU2lnbjETMBEGA1UEAxMKR2xvYmFs +U2lnbjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAJUH6HPKZvnsFMp7PPcNCPG0RQss +grRIxutbPK6DuEGSMxSkb3/pKszGsIhrxbaJ0cay/xTOURQh7ErdG1rG1ofuTToVBu1kZguSgMpE +3nOUTvOniX9PeGMIyBJQbUJmL025eShNUhqKGoC3GYEOfsSKvGRMIRxDaNc9PIrFsmbVkJq3MQbF +vuJtMgamHvm566qjuL++gmNQ0PAYid/kD3n16qIfKtJwLnvnvJO7bVPiSHyMEAc4/2ayd2F+4OqM +PKq0pPbzlUoSB239jLKJz9CgYXfIWHSw1CM69106yqLbnQneXUQtkPGBzVeS+n68UARjNN9rkxi+ +azayOeSsJDa38O+2HBNXk7besvjihbdzorg1qkXy4J02oW9UivFyVm4uiMVRQkQVlO6jxTiWm05O +WgtH8wY2SXcwvHE35absIQh1/OZhFj931dmRl4QKbNQCTXTAFO39OfuD8l4UoQSwC+n+7o/hbguy +CLNhZglqsQY6ZZZZwPA1/cnaKI0aEYdwgQqomnUdnjqGBQCe24DWJfncBZ4nWUx2OVvq+aWh2IMP +0f/fMBH5hc8zSPXKbWQULHpYT9NLCEnFlWQaYw55PfWzjMpYrZxCRXluDocZXFSxZba/jJvcE+kN +b7gu3GduyYsRtYQUigAZcIN5kZeR1BonvzceMgfYFGM8KEyvAgMBAAGjYzBhMA4GA1UdDwEB/wQE +AwIBBjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBSubAWjkxPioufi1xzWx/B/yGdToDAfBgNV +HSMEGDAWgBSubAWjkxPioufi1xzWx/B/yGdToDANBgkqhkiG9w0BAQwFAAOCAgEAgyXt6NH9lVLN +nsAEoJFp5lzQhN7craJP6Ed41mWYqVuoPId8AorRbrcWc+ZfwFSY1XS+wc3iEZGtIxg93eFyRJa0 +lV7Ae46ZeBZDE1ZXs6KzO7V33EByrKPrmzU+sQghoefEQzd5Mr6155wsTLxDKZmOMNOsIeDjHfrY +BzN2VAAiKrlNIC5waNrlU/yDXNOd8v9EDERm8tLjvUYAGm0CuiVdjaExUd1URhxN25mW7xocBFym +Fe944Hn+Xds+qkxV/ZoVqW/hpvvfcDDpw+5CRu3CkwWJ+n1jez/QcYF8AOiYrg54NMMl+68KnyBr +3TsTjxKM4kEaSHpzoHdpx7Zcf4LIHv5YGygrqGytXm3ABdJ7t+uA/iU3/gKbaKxCXcPu9czc8FB1 +0jZpnOZ7BN9uBmm23goJSFmH63sUYHpkqmlD75HHTOwY3WzvUy2MmeFe8nI+z1TIvWfspA9MRf/T +uTAjB0yPEL+GltmZWrSZVxykzLsViVO6LAUP5MSeGbEYNNVMnbrt9x+vJJUEeKgDu+6B5dpffItK +oZB0JaezPkvILFa9x8jvOOJckvB595yEunQtYQEgfn7R8k8HWV+LLUNS60YMlOH1Zkd5d9VUWx+t +JDfLRVpOoERIyNiwmcUVhAn21klJwGW45hpxbqCo8YLoRT5s1gLXCmeDBVrJpBA= +-----END CERTIFICATE----- + +OISTE WISeKey Global Root GC CA +=============================== +-----BEGIN CERTIFICATE----- +MIICaTCCAe+gAwIBAgIQISpWDK7aDKtARb8roi066jAKBggqhkjOPQQDAzBtMQswCQYDVQQGEwJD +SDEQMA4GA1UEChMHV0lTZUtleTEiMCAGA1UECxMZT0lTVEUgRm91bmRhdGlvbiBFbmRvcnNlZDEo +MCYGA1UEAxMfT0lTVEUgV0lTZUtleSBHbG9iYWwgUm9vdCBHQyBDQTAeFw0xNzA1MDkwOTQ4MzRa +Fw00MjA1MDkwOTU4MzNaMG0xCzAJBgNVBAYTAkNIMRAwDgYDVQQKEwdXSVNlS2V5MSIwIAYDVQQL +ExlPSVNURSBGb3VuZGF0aW9uIEVuZG9yc2VkMSgwJgYDVQQDEx9PSVNURSBXSVNlS2V5IEdsb2Jh +bCBSb290IEdDIENBMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAETOlQwMYPchi82PG6s4nieUqjFqdr +VCTbUf/q9Akkwwsin8tqJ4KBDdLArzHkdIJuyiXZjHWd8dvQmqJLIX4Wp2OQ0jnUsYd4XxiWD1Ab +NTcPasbc2RNNpI6QN+a9WzGRo1QwUjAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAd +BgNVHQ4EFgQUSIcUrOPDnpBgOtfKie7TrYy0UGYwEAYJKwYBBAGCNxUBBAMCAQAwCgYIKoZIzj0E +AwMDaAAwZQIwJsdpW9zV57LnyAyMjMPdeYwbY9XJUpROTYJKcx6ygISpJcBMWm1JKWB4E+J+SOtk +AjEA2zQgMgj/mkkCtojeFK9dbJlxjRo/i9fgojaGHAeCOnZT/cKi7e97sIBPWA9LUzm9 +-----END CERTIFICATE----- + +GTS Root R1 +=========== +-----BEGIN CERTIFICATE----- +MIIFWjCCA0KgAwIBAgIQbkepxUtHDA3sM9CJuRz04TANBgkqhkiG9w0BAQwFADBHMQswCQYDVQQG +EwJVUzEiMCAGA1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJv +b3QgUjEwHhcNMTYwNjIyMDAwMDAwWhcNMzYwNjIyMDAwMDAwWjBHMQswCQYDVQQGEwJVUzEiMCAG +A1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3QgUjEwggIi +MA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC2EQKLHuOhd5s73L+UPreVp0A8of2C+X0yBoJx +9vaMf/vo27xqLpeXo4xL+Sv2sfnOhB2x+cWX3u+58qPpvBKJXqeqUqv4IyfLpLGcY9vXmX7wCl7r +aKb0xlpHDU0QM+NOsROjyBhsS+z8CZDfnWQpJSMHobTSPS5g4M/SCYe7zUjwTcLCeoiKu7rPWRnW +r4+wB7CeMfGCwcDfLqZtbBkOtdh+JhpFAz2weaSUKK0PfyblqAj+lug8aJRT7oM6iCsVlgmy4HqM +LnXWnOunVmSPlk9orj2XwoSPwLxAwAtcvfaHszVsrBhQf4TgTM2S0yDpM7xSma8ytSmzJSq0SPly +4cpk9+aCEI3oncKKiPo4Zor8Y/kB+Xj9e1x3+naH+uzfsQ55lVe0vSbv1gHR6xYKu44LtcXFilWr +06zqkUspzBmkMiVOKvFlRNACzqrOSbTqn3yDsEB750Orp2yjj32JgfpMpf/VjsPOS+C12LOORc92 +wO1AK/1TD7Cn1TsNsYqiA94xrcx36m97PtbfkSIS5r762DL8EGMUUXLeXdYWk70paDPvOmbsB4om +3xPXV2V4J95eSRQAogB/mqghtqmxlbCluQ0WEdrHbEg8QOB+DVrNVjzRlwW5y0vtOUucxD/SVRNu +JLDWcfr0wbrM7Rv1/oFB2ACYPTrIrnqYNxgFlQIDAQABo0IwQDAOBgNVHQ8BAf8EBAMCAQYwDwYD +VR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU5K8rJnEaK0gnhS9SZizv8IkTcT4wDQYJKoZIhvcNAQEM +BQADggIBADiWCu49tJYeX++dnAsznyvgyv3SjgofQXSlfKqE1OXyHuY3UjKcC9FhHb8owbZEKTV1 +d5iyfNm9dKyKaOOpMQkpAWBz40d8U6iQSifvS9efk+eCNs6aaAyC58/UEBZvXw6ZXPYfcX3v73sv +fuo21pdwCxXu11xWajOl40k4DLh9+42FpLFZXvRq4d2h9mREruZRgyFmxhE+885H7pwoHyXa/6xm +ld01D1zvICxi/ZG6qcz8WpyTgYMpl0p8WnK0OdC3d8t5/Wk6kjftbjhlRn7pYL15iJdfOBL07q9b +gsiG1eGZbYwE8na6SfZu6W0eX6DvJ4J2QPim01hcDyxC2kLGe4g0x8HYRZvBPsVhHdljUEn2NIVq +4BjFbkerQUIpm/ZgDdIx02OYI5NaAIFItO/Nis3Jz5nu2Z6qNuFoS3FJFDYoOj0dzpqPJeaAcWEr +tXvM+SUWgeExX6GjfhaknBZqlxi9dnKlC54dNuYvoS++cJEPqOba+MSSQGwlfnuzCdyyF62ARPBo +pY+Udf90WuioAnwMCeKpSwughQtiue+hMZL77/ZRBIls6Kl0obsXs7X9SQ98POyDGCBDTtWTurQ0 +sR8WNh8M5mQ5Fkzc4P4dyKliPUDqysU0ArSuiYgzNdwsE3PYJ/HQcu51OyLemGhmW/HGY0dVHLql +CFF1pkgl +-----END CERTIFICATE----- + +GTS Root R2 +=========== +-----BEGIN CERTIFICATE----- +MIIFWjCCA0KgAwIBAgIQbkepxlqz5yDFMJo/aFLybzANBgkqhkiG9w0BAQwFADBHMQswCQYDVQQG +EwJVUzEiMCAGA1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJv +b3QgUjIwHhcNMTYwNjIyMDAwMDAwWhcNMzYwNjIyMDAwMDAwWjBHMQswCQYDVQQGEwJVUzEiMCAG +A1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3QgUjIwggIi +MA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDO3v2m++zsFDQ8BwZabFn3GTXd98GdVarTzTuk +k3LvCvptnfbwhYBboUhSnznFt+4orO/LdmgUud+tAWyZH8QiHZ/+cnfgLFuv5AS/T3KgGjSY6Dlo +7JUle3ah5mm5hRm9iYz+re026nO8/4Piy33B0s5Ks40FnotJk9/BW9BuXvAuMC6C/Pq8tBcKSOWI +m8Wba96wyrQD8Nr0kLhlZPdcTK3ofmZemde4wj7I0BOdre7kRXuJVfeKH2JShBKzwkCX44ofR5Gm +dFrS+LFjKBC4swm4VndAoiaYecb+3yXuPuWgf9RhD1FLPD+M2uFwdNjCaKH5wQzpoeJ/u1U8dgbu +ak7MkogwTZq9TwtImoS1mKPV+3PBV2HdKFZ1E66HjucMUQkQdYhMvI35ezzUIkgfKtzra7tEscsz +cTJGr61K8YzodDqs5xoic4DSMPclQsciOzsSrZYuxsN2B6ogtzVJV+mSSeh2FnIxZyuWfoqjx5RW +Ir9qS34BIbIjMt/kmkRtWVtd9QCgHJvGeJeNkP+byKq0rxFROV7Z+2et1VsRnTKaG73Vululycsl +aVNVJ1zgyjbLiGH7HrfQy+4W+9OmTN6SpdTi3/UGVN4unUu0kzCqgc7dGtxRcw1PcOnlthYhGXmy +5okLdWTK1au8CcEYof/UVKGFPP0UJAOyh9OktwIDAQABo0IwQDAOBgNVHQ8BAf8EBAMCAQYwDwYD +VR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUu//KjiOfT5nK2+JopqUVJxce2Q4wDQYJKoZIhvcNAQEM +BQADggIBALZp8KZ3/p7uC4Gt4cCpx/k1HUCCq+YEtN/L9x0Pg/B+E02NjO7jMyLDOfxA325BS0JT +vhaI8dI4XsRomRyYUpOM52jtG2pzegVATX9lO9ZY8c6DR2Dj/5epnGB3GFW1fgiTz9D2PGcDFWEJ ++YF59exTpJ/JjwGLc8R3dtyDovUMSRqodt6Sm2T4syzFJ9MHwAiApJiS4wGWAqoC7o87xdFtCjMw +c3i5T1QWvwsHoaRc5svJXISPD+AVdyx+Jn7axEvbpxZ3B7DNdehyQtaVhJ2Gg/LkkM0JR9SLA3Da +WsYDQvTtN6LwG1BUSw7YhN4ZKJmBR64JGz9I0cNv4rBgF/XuIwKl2gBbbZCr7qLpGzvpx0QnRY5r +n/WkhLx3+WuXrD5RRaIRpsyF7gpo8j5QOHokYh4XIDdtak23CZvJ/KRY9bb7nE4Yu5UC56Gtmwfu +Nmsk0jmGwZODUNKBRqhfYlcsu2xkiAhu7xNUX90txGdj08+JN7+dIPT7eoOboB6BAFDC5AwiWVIQ +7UNWhwD4FFKnHYuTjKJNRn8nxnGbJN7k2oaLDX5rIMHAnuFl2GqjpuiFizoHCBy69Y9Vmhh1fuXs +gWbRIXOhNUQLgD1bnF5vKheW0YMjiGZt5obicDIvUiLnyOd/xCxgXS/Dr55FBcOEArf9LAhST4Ld +o/DUhgkC +-----END CERTIFICATE----- + +GTS Root R3 +=========== +-----BEGIN CERTIFICATE----- +MIICDDCCAZGgAwIBAgIQbkepx2ypcyRAiQ8DVd2NHTAKBggqhkjOPQQDAzBHMQswCQYDVQQGEwJV +UzEiMCAGA1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3Qg +UjMwHhcNMTYwNjIyMDAwMDAwWhcNMzYwNjIyMDAwMDAwWjBHMQswCQYDVQQGEwJVUzEiMCAGA1UE +ChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3QgUjMwdjAQBgcq +hkjOPQIBBgUrgQQAIgNiAAQfTzOHMymKoYTey8chWEGJ6ladK0uFxh1MJ7x/JlFyb+Kf1qPKzEUU +Rout736GjOyxfi//qXGdGIRFBEFVbivqJn+7kAHjSxm65FSWRQmx1WyRRK2EE46ajA2ADDL24Cej +QjBAMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBTB8Sa6oC2uhYHP +0/EqEr24Cmf9vDAKBggqhkjOPQQDAwNpADBmAjEAgFukfCPAlaUs3L6JbyO5o91lAFJekazInXJ0 +glMLfalAvWhgxeG4VDvBNhcl2MG9AjEAnjWSdIUlUfUk7GRSJFClH9voy8l27OyCbvWFGFPouOOa +KaqW04MjyaR7YbPMAuhd +-----END CERTIFICATE----- + +GTS Root R4 +=========== +-----BEGIN CERTIFICATE----- +MIICCjCCAZGgAwIBAgIQbkepyIuUtui7OyrYorLBmTAKBggqhkjOPQQDAzBHMQswCQYDVQQGEwJV +UzEiMCAGA1UEChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3Qg +UjQwHhcNMTYwNjIyMDAwMDAwWhcNMzYwNjIyMDAwMDAwWjBHMQswCQYDVQQGEwJVUzEiMCAGA1UE +ChMZR29vZ2xlIFRydXN0IFNlcnZpY2VzIExMQzEUMBIGA1UEAxMLR1RTIFJvb3QgUjQwdjAQBgcq +hkjOPQIBBgUrgQQAIgNiAATzdHOnaItgrkO4NcWBMHtLSZ37wWHO5t5GvWvVYRg1rkDdc/eJkTBa +6zzuhXyiQHY7qca4R9gq55KRanPpsXI5nymfopjTX15YhmUPoYRlBtHci8nHc8iMai/lxKvRHYqj +QjBAMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBSATNbrdP9JNqPV +2Py1PsVq8JQdjDAKBggqhkjOPQQDAwNnADBkAjBqUFJ0CMRw3J5QdCHojXohw0+WbhXRIjVhLfoI +N+4Zba3bssx9BzT1YBkstTTZbyACMANxsbqjYAuG7ZoIapVon+Kz4ZNkfF6Tpt95LY2F45TPI11x +zPKwTdb+mciUqXWi4w== +-----END CERTIFICATE----- + +UCA Global G2 Root +================== +-----BEGIN CERTIFICATE----- +MIIFRjCCAy6gAwIBAgIQXd+x2lqj7V2+WmUgZQOQ7zANBgkqhkiG9w0BAQsFADA9MQswCQYDVQQG +EwJDTjERMA8GA1UECgwIVW5pVHJ1c3QxGzAZBgNVBAMMElVDQSBHbG9iYWwgRzIgUm9vdDAeFw0x +NjAzMTEwMDAwMDBaFw00MDEyMzEwMDAwMDBaMD0xCzAJBgNVBAYTAkNOMREwDwYDVQQKDAhVbmlU +cnVzdDEbMBkGA1UEAwwSVUNBIEdsb2JhbCBHMiBSb290MIICIjANBgkqhkiG9w0BAQEFAAOCAg8A +MIICCgKCAgEAxeYrb3zvJgUno4Ek2m/LAfmZmqkywiKHYUGRO8vDaBsGxUypK8FnFyIdK+35KYmT +oni9kmugow2ifsqTs6bRjDXVdfkX9s9FxeV67HeToI8jrg4aA3++1NDtLnurRiNb/yzmVHqUwCoV +8MmNsHo7JOHXaOIxPAYzRrZUEaalLyJUKlgNAQLx+hVRZ2zA+te2G3/RVogvGjqNO7uCEeBHANBS +h6v7hn4PJGtAnTRnvI3HLYZveT6OqTwXS3+wmeOwcWDcC/Vkw85DvG1xudLeJ1uK6NjGruFZfc8o +LTW4lVYa8bJYS7cSN8h8s+1LgOGN+jIjtm+3SJUIsUROhYw6AlQgL9+/V087OpAh18EmNVQg7Mc/ +R+zvWr9LesGtOxdQXGLYD0tK3Cv6brxzks3sx1DoQZbXqX5t2Okdj4q1uViSukqSKwxW/YDrCPBe +KW4bHAyvj5OJrdu9o54hyokZ7N+1wxrrFv54NkzWbtA+FxyQF2smuvt6L78RHBgOLXMDj6DlNaBa +4kx1HXHhOThTeEDMg5PXCp6dW4+K5OXgSORIskfNTip1KnvyIvbJvgmRlld6iIis7nCs+dwp4wwc +OxJORNanTrAmyPPZGpeRaOrvjUYG0lZFWJo8DA+DuAUlwznPO6Q0ibd5Ei9Hxeepl2n8pndntd97 +8XplFeRhVmUCAwEAAaNCMEAwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0O +BBYEFIHEjMz15DD/pQwIX4wVZyF0Ad/fMA0GCSqGSIb3DQEBCwUAA4ICAQATZSL1jiutROTL/7lo +5sOASD0Ee/ojL3rtNtqyzm325p7lX1iPyzcyochltq44PTUbPrw7tgTQvPlJ9Zv3hcU2tsu8+Mg5 +1eRfB70VVJd0ysrtT7q6ZHafgbiERUlMjW+i67HM0cOU2kTC5uLqGOiiHycFutfl1qnN3e92mI0A +Ds0b+gO3joBYDic/UvuUospeZcnWhNq5NXHzJsBPd+aBJ9J3O5oUb3n09tDh05S60FdRvScFDcH9 +yBIw7m+NESsIndTUv4BFFJqIRNow6rSn4+7vW4LVPtateJLbXDzz2K36uGt/xDYotgIVilQsnLAX +c47QN6MUPJiVAAwpBVueSUmxX8fjy88nZY41F7dXyDDZQVu5FLbowg+UMaeUmMxq67XhJ/UQqAHo +jhJi6IjMtX9Gl8CbEGY4GjZGXyJoPd/JxhMnq1MGrKI8hgZlb7F+sSlEmqO6SWkoaY/X5V+tBIZk +bxqgDMUIYs6Ao9Dz7GjevjPHF1t/gMRMTLGmhIrDO7gJzRSBuhjjVFc2/tsvfEehOjPI+Vg7RE+x +ygKJBJYoaMVLuCaJu9YzL1DV/pqJuhgyklTGW+Cd+V7lDSKb9triyCGyYiGqhkCyLmTTX8jjfhFn +RR8F/uOi77Oos/N9j/gMHyIfLXC0uAE0djAA5SN4p1bXUB+K+wb1whnw0A== +-----END CERTIFICATE----- + +UCA Extended Validation Root +============================ +-----BEGIN CERTIFICATE----- +MIIFWjCCA0KgAwIBAgIQT9Irj/VkyDOeTzRYZiNwYDANBgkqhkiG9w0BAQsFADBHMQswCQYDVQQG +EwJDTjERMA8GA1UECgwIVW5pVHJ1c3QxJTAjBgNVBAMMHFVDQSBFeHRlbmRlZCBWYWxpZGF0aW9u +IFJvb3QwHhcNMTUwMzEzMDAwMDAwWhcNMzgxMjMxMDAwMDAwWjBHMQswCQYDVQQGEwJDTjERMA8G +A1UECgwIVW5pVHJ1c3QxJTAjBgNVBAMMHFVDQSBFeHRlbmRlZCBWYWxpZGF0aW9uIFJvb3QwggIi +MA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCpCQcoEwKwmeBkqh5DFnpzsZGgdT6o+uM4AHrs +iWogD4vFsJszA1qGxliG1cGFu0/GnEBNyr7uaZa4rYEwmnySBesFK5pI0Lh2PpbIILvSsPGP2KxF +Rv+qZ2C0d35qHzwaUnoEPQc8hQ2E0B92CvdqFN9y4zR8V05WAT558aopO2z6+I9tTcg1367r3CTu +eUWnhbYFiN6IXSV8l2RnCdm/WhUFhvMJHuxYMjMR83dksHYf5BA1FxvyDrFspCqjc/wJHx4yGVMR +59mzLC52LqGj3n5qiAno8geK+LLNEOfic0CTuwjRP+H8C5SzJe98ptfRr5//lpr1kXuYC3fUfugH +0mK1lTnj8/FtDw5lhIpjVMWAtuCeS31HJqcBCF3RiJ7XwzJE+oJKCmhUfzhTA8ykADNkUVkLo4KR +el7sFsLzKuZi2irbWWIQJUoqgQtHB0MGcIfS+pMRKXpITeuUx3BNr2fVUbGAIAEBtHoIppB/TuDv +B0GHr2qlXov7z1CymlSvw4m6WC31MJixNnI5fkkE/SmnTHnkBVfblLkWU41Gsx2VYVdWf6/wFlth +WG82UBEL2KwrlRYaDh8IzTY0ZRBiZtWAXxQgXy0MoHgKaNYs1+lvK9JKBZP8nm9rZ/+I8U6laUpS +NwXqxhaN0sSZ0YIrO7o1dfdRUVjzyAfd5LQDfwIDAQABo0IwQDAdBgNVHQ4EFgQU2XQ65DA9DfcS +3H5aBZ8eNJr34RQwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQEL +BQADggIBADaNl8xCFWQpN5smLNb7rhVpLGsaGvdftvkHTFnq88nIua7Mui563MD1sC3AO6+fcAUR +ap8lTwEpcOPlDOHqWnzcSbvBHiqB9RZLcpHIojG5qtr8nR/zXUACE/xOHAbKsxSQVBcZEhrxH9cM +aVr2cXj0lH2RC47skFSOvG+hTKv8dGT9cZr4QQehzZHkPJrgmzI5c6sq1WnIeJEmMX3ixzDx/BR4 +dxIOE/TdFpS/S2d7cFOFyrC78zhNLJA5wA3CXWvp4uXViI3WLL+rG761KIcSF3Ru/H38j9CHJrAb ++7lsq+KePRXBOy5nAliRn+/4Qh8st2j1da3Ptfb/EX3C8CSlrdP6oDyp+l3cpaDvRKS+1ujl5BOW +F3sGPjLtx7dCvHaj2GU4Kzg1USEODm8uNBNA4StnDG1KQTAYI1oyVZnJF+A83vbsea0rWBmirSwi +GpWOvpaQXUJXxPkUAzUrHC1RVwinOt4/5Mi0A3PCwSaAuwtCH60NryZy2sy+s6ODWA2CxR9GUeOc +GMyNm43sSet1UNWMKFnKdDTajAshqx7qG+XH/RU+wBeq+yNuJkbL+vmxcmtpzyKEC2IPrNkZAJSi +djzULZrtBJ4tBmIQN1IchXIbJ+XMxjHsN+xjWZsLHXbMfjKaiJUINlK73nZfdklJrX+9ZSCyycEr +dhh2n1ax +-----END CERTIFICATE----- + +Certigna Root CA +================ +-----BEGIN CERTIFICATE----- +MIIGWzCCBEOgAwIBAgIRAMrpG4nxVQMNo+ZBbcTjpuEwDQYJKoZIhvcNAQELBQAwWjELMAkGA1UE +BhMCRlIxEjAQBgNVBAoMCURoaW15b3RpczEcMBoGA1UECwwTMDAwMiA0ODE0NjMwODEwMDAzNjEZ +MBcGA1UEAwwQQ2VydGlnbmEgUm9vdCBDQTAeFw0xMzEwMDEwODMyMjdaFw0zMzEwMDEwODMyMjda +MFoxCzAJBgNVBAYTAkZSMRIwEAYDVQQKDAlEaGlteW90aXMxHDAaBgNVBAsMEzAwMDIgNDgxNDYz +MDgxMDAwMzYxGTAXBgNVBAMMEENlcnRpZ25hIFJvb3QgQ0EwggIiMA0GCSqGSIb3DQEBAQUAA4IC +DwAwggIKAoICAQDNGDllGlmx6mQWDoyUJJV8g9PFOSbcDO8WV43X2KyjQn+Cyu3NW9sOty3tRQgX +stmzy9YXUnIo245Onoq2C/mehJpNdt4iKVzSs9IGPjA5qXSjklYcoW9MCiBtnyN6tMbaLOQdLNyz +KNAT8kxOAkmhVECe5uUFoC2EyP+YbNDrihqECB63aCPuI9Vwzm1RaRDuoXrC0SIxwoKF0vJVdlB8 +JXrJhFwLrN1CTivngqIkicuQstDuI7pmTLtipPlTWmR7fJj6o0ieD5Wupxj0auwuA0Wv8HT4Ks16 +XdG+RCYyKfHx9WzMfgIhC59vpD++nVPiz32pLHxYGpfhPTc3GGYo0kDFUYqMwy3OU4gkWGQwFsWq +4NYKpkDfePb1BHxpE4S80dGnBs8B92jAqFe7OmGtBIyT46388NtEbVncSVmurJqZNjBBe3YzIoej +wpKGbvlw7q6Hh5UbxHq9MfPU0uWZ/75I7HX1eBYdpnDBfzwboZL7z8g81sWTCo/1VTp2lc5ZmIoJ +lXcymoO6LAQ6l73UL77XbJuiyn1tJslV1c/DeVIICZkHJC1kJWumIWmbat10TWuXekG9qxf5kBdI +jzb5LdXF2+6qhUVB+s06RbFo5jZMm5BX7CO5hwjCxAnxl4YqKE3idMDaxIzb3+KhF1nOJFl0Mdp/ +/TBt2dzhauH8XwIDAQABo4IBGjCCARYwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYw +HQYDVR0OBBYEFBiHVuBud+4kNTxOc5of1uHieX4rMB8GA1UdIwQYMBaAFBiHVuBud+4kNTxOc5of +1uHieX4rMEQGA1UdIAQ9MDswOQYEVR0gADAxMC8GCCsGAQUFBwIBFiNodHRwczovL3d3d3cuY2Vy +dGlnbmEuZnIvYXV0b3JpdGVzLzBtBgNVHR8EZjBkMC+gLaArhilodHRwOi8vY3JsLmNlcnRpZ25h +LmZyL2NlcnRpZ25hcm9vdGNhLmNybDAxoC+gLYYraHR0cDovL2NybC5kaGlteW90aXMuY29tL2Nl +cnRpZ25hcm9vdGNhLmNybDANBgkqhkiG9w0BAQsFAAOCAgEAlLieT/DjlQgi581oQfccVdV8AOIt +OoldaDgvUSILSo3L6btdPrtcPbEo/uRTVRPPoZAbAh1fZkYJMyjhDSSXcNMQH+pkV5a7XdrnxIxP +TGRGHVyH41neQtGbqH6mid2PHMkwgu07nM3A6RngatgCdTer9zQoKJHyBApPNeNgJgH60BGM+RFq +7q89w1DTj18zeTyGqHNFkIwgtnJzFyO+B2XleJINugHA64wcZr+shncBlA2c5uk5jR+mUYyZDDl3 +4bSb+hxnV29qao6pK0xXeXpXIs/NX2NGjVxZOob4Mkdio2cNGJHc+6Zr9UhhcyNZjgKnvETq9Emd +8VRY+WCv2hikLyhF3HqgiIZd8zvn/yk1gPxkQ5Tm4xxvvq0OKmOZK8l+hfZx6AYDlf7ej0gcWtSS +6Cvu5zHbugRqh5jnxV/vfaci9wHYTfmJ0A6aBVmknpjZbyvKcL5kwlWj9Omvw5Ip3IgWJJk8jSaY +tlu3zM63Nwf9JtmYhST/WSMDmu2dnajkXjjO11INb9I/bbEFa0nOipFGc/T2L/Coc3cOZayhjWZS +aX5LaAzHHjcng6WMxwLkFM1JAbBzs/3GkDpv0mztO+7skb6iQ12LAEpmJURw3kAP+HwV96LOPNde +E4yBFxgX0b3xdxA61GU5wSesVywlVP+i2k+KYTlerj1KjL0= +-----END CERTIFICATE----- + +emSign Root CA - G1 +=================== +-----BEGIN CERTIFICATE----- +MIIDlDCCAnygAwIBAgIKMfXkYgxsWO3W2DANBgkqhkiG9w0BAQsFADBnMQswCQYDVQQGEwJJTjET +MBEGA1UECxMKZW1TaWduIFBLSTElMCMGA1UEChMcZU11ZGhyYSBUZWNobm9sb2dpZXMgTGltaXRl +ZDEcMBoGA1UEAxMTZW1TaWduIFJvb3QgQ0EgLSBHMTAeFw0xODAyMTgxODMwMDBaFw00MzAyMTgx +ODMwMDBaMGcxCzAJBgNVBAYTAklOMRMwEQYDVQQLEwplbVNpZ24gUEtJMSUwIwYDVQQKExxlTXVk +aHJhIFRlY2hub2xvZ2llcyBMaW1pdGVkMRwwGgYDVQQDExNlbVNpZ24gUm9vdCBDQSAtIEcxMIIB +IjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAk0u76WaK7p1b1TST0Bsew+eeuGQzf2N4aLTN +LnF115sgxk0pvLZoYIr3IZpWNVrzdr3YzZr/k1ZLpVkGoZM0Kd0WNHVO8oG0x5ZOrRkVUkr+PHB1 +cM2vK6sVmjM8qrOLqs1D/fXqcP/tzxE7lM5OMhbTI0Aqd7OvPAEsbO2ZLIvZTmmYsvePQbAyeGHW +DV/D+qJAkh1cF+ZwPjXnorfCYuKrpDhMtTk1b+oDafo6VGiFbdbyL0NVHpENDtjVaqSW0RM8LHhQ +6DqS0hdW5TUaQBw+jSztOd9C4INBdN+jzcKGYEho42kLVACL5HZpIQ15TjQIXhTCzLG3rdd8cIrH +hQIDAQABo0IwQDAdBgNVHQ4EFgQU++8Nhp6w492pufEhF38+/PB3KxowDgYDVR0PAQH/BAQDAgEG +MA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQELBQADggEBAFn/8oz1h31xPaOfG1vR2vjTnGs2 +vZupYeveFix0PZ7mddrXuqe8QhfnPZHr5X3dPpzxz5KsbEjMwiI/aTvFthUvozXGaCocV685743Q +NcMYDHsAVhzNixl03r4PEuDQqqE/AjSxcM6dGNYIAwlG7mDgfrbESQRRfXBgvKqy/3lyeqYdPV8q ++Mri/Tm3R7nrft8EI6/6nAYH6ftjk4BAtcZsCjEozgyfz7MjNYBBjWzEN3uBL4ChQEKF6dk4jeih +U80Bv2noWgbyRQuQ+q7hv53yrlc8pa6yVvSLZUDp/TGBLPQ5Cdjua6e0ph0VpZj3AYHYhX3zUVxx +iN66zB+Afko= +-----END CERTIFICATE----- + +emSign ECC Root CA - G3 +======================= +-----BEGIN CERTIFICATE----- +MIICTjCCAdOgAwIBAgIKPPYHqWhwDtqLhDAKBggqhkjOPQQDAzBrMQswCQYDVQQGEwJJTjETMBEG +A1UECxMKZW1TaWduIFBLSTElMCMGA1UEChMcZU11ZGhyYSBUZWNobm9sb2dpZXMgTGltaXRlZDEg +MB4GA1UEAxMXZW1TaWduIEVDQyBSb290IENBIC0gRzMwHhcNMTgwMjE4MTgzMDAwWhcNNDMwMjE4 +MTgzMDAwWjBrMQswCQYDVQQGEwJJTjETMBEGA1UECxMKZW1TaWduIFBLSTElMCMGA1UEChMcZU11 +ZGhyYSBUZWNobm9sb2dpZXMgTGltaXRlZDEgMB4GA1UEAxMXZW1TaWduIEVDQyBSb290IENBIC0g +RzMwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQjpQy4LRL1KPOxst3iAhKAnjlfSU2fySU0WXTsuwYc +58Byr+iuL+FBVIcUqEqy6HyC5ltqtdyzdc6LBtCGI79G1Y4PPwT01xySfvalY8L1X44uT6EYGQIr +MgqCZH0Wk9GjQjBAMB0GA1UdDgQWBBR8XQKEE9TMipuBzhccLikenEhjQjAOBgNVHQ8BAf8EBAMC +AQYwDwYDVR0TAQH/BAUwAwEB/zAKBggqhkjOPQQDAwNpADBmAjEAvvNhzwIQHWSVB7gYboiFBS+D +CBeQyh+KTOgNG3qxrdWBCUfvO6wIBHxcmbHtRwfSAjEAnbpV/KlK6O3t5nYBQnvI+GDZjVGLVTv7 +jHvrZQnD+JbNR6iC8hZVdyR+EhCVBCyj +-----END CERTIFICATE----- + +emSign Root CA - C1 +=================== +-----BEGIN CERTIFICATE----- +MIIDczCCAlugAwIBAgILAK7PALrEzzL4Q7IwDQYJKoZIhvcNAQELBQAwVjELMAkGA1UEBhMCVVMx +EzARBgNVBAsTCmVtU2lnbiBQS0kxFDASBgNVBAoTC2VNdWRocmEgSW5jMRwwGgYDVQQDExNlbVNp +Z24gUm9vdCBDQSAtIEMxMB4XDTE4MDIxODE4MzAwMFoXDTQzMDIxODE4MzAwMFowVjELMAkGA1UE +BhMCVVMxEzARBgNVBAsTCmVtU2lnbiBQS0kxFDASBgNVBAoTC2VNdWRocmEgSW5jMRwwGgYDVQQD +ExNlbVNpZ24gUm9vdCBDQSAtIEMxMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAz+up +ufGZBczYKCFK83M0UYRWEPWgTywS4/oTmifQz/l5GnRfHXk5/Fv4cI7gklL35CX5VIPZHdPIWoU/ +Xse2B+4+wM6ar6xWQio5JXDWv7V7Nq2s9nPczdcdioOl+yuQFTdrHCZH3DspVpNqs8FqOp099cGX +OFgFixwR4+S0uF2FHYP+eF8LRWgYSKVGczQ7/g/IdrvHGPMF0Ybzhe3nudkyrVWIzqa2kbBPrH4V +I5b2P/AgNBbeCsbEBEV5f6f9vtKppa+cxSMq9zwhbL2vj07FOrLzNBL834AaSaTUqZX3noleooms +lMuoaJuvimUnzYnu3Yy1aylwQ6BpC+S5DwIDAQABo0IwQDAdBgNVHQ4EFgQU/qHgcB4qAzlSWkK+ +XJGFehiqTbUwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQELBQAD +ggEBAMJKVvoVIXsoounlHfv4LcQ5lkFMOycsxGwYFYDGrK9HWS8mC+M2sO87/kOXSTKZEhVb3xEp +/6tT+LvBeA+snFOvV71ojD1pM/CjoCNjO2RnIkSt1XHLVip4kqNPEjE2NuLe/gDEo2APJ62gsIq1 +NnpSob0n9CAnYuhNlCQT5AoE6TyrLshDCUrGYQTlSTR+08TI9Q/Aqum6VF7zYytPT1DU/rl7mYw9 +wC68AivTxEDkigcxHpvOJpkT+xHqmiIMERnHXhuBUDDIlhJu58tBf5E7oke3VIAb3ADMmpDqw8NQ +BmIMMMAVSKeoWXzhriKi4gp6D/piq1JM4fHfyr6DDUI= +-----END CERTIFICATE----- + +emSign ECC Root CA - C3 +======================= +-----BEGIN CERTIFICATE----- +MIICKzCCAbGgAwIBAgIKe3G2gla4EnycqDAKBggqhkjOPQQDAzBaMQswCQYDVQQGEwJVUzETMBEG +A1UECxMKZW1TaWduIFBLSTEUMBIGA1UEChMLZU11ZGhyYSBJbmMxIDAeBgNVBAMTF2VtU2lnbiBF +Q0MgUm9vdCBDQSAtIEMzMB4XDTE4MDIxODE4MzAwMFoXDTQzMDIxODE4MzAwMFowWjELMAkGA1UE +BhMCVVMxEzARBgNVBAsTCmVtU2lnbiBQS0kxFDASBgNVBAoTC2VNdWRocmEgSW5jMSAwHgYDVQQD +ExdlbVNpZ24gRUNDIFJvb3QgQ0EgLSBDMzB2MBAGByqGSM49AgEGBSuBBAAiA2IABP2lYa57JhAd +6bciMK4G9IGzsUJxlTm801Ljr6/58pc1kjZGDoeVjbk5Wum739D+yAdBPLtVb4OjavtisIGJAnB9 +SMVK4+kiVCJNk7tCDK93nCOmfddhEc5lx/h//vXyqaNCMEAwHQYDVR0OBBYEFPtaSNCAIEDyqOkA +B2kZd6fmw/TPMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MAoGCCqGSM49BAMDA2gA +MGUCMQC02C8Cif22TGK6Q04ThHK1rt0c3ta13FaPWEBaLd4gTCKDypOofu4SQMfWh0/434UCMBwU +ZOR8loMRnLDRWmFLpg9J0wD8ofzkpf9/rdcw0Md3f76BB1UwUCAU9Vc4CqgxUQ== +-----END CERTIFICATE----- + +Hongkong Post Root CA 3 +======================= +-----BEGIN CERTIFICATE----- +MIIFzzCCA7egAwIBAgIUCBZfikyl7ADJk0DfxMauI7gcWqQwDQYJKoZIhvcNAQELBQAwbzELMAkG +A1UEBhMCSEsxEjAQBgNVBAgTCUhvbmcgS29uZzESMBAGA1UEBxMJSG9uZyBLb25nMRYwFAYDVQQK +Ew1Ib25na29uZyBQb3N0MSAwHgYDVQQDExdIb25na29uZyBQb3N0IFJvb3QgQ0EgMzAeFw0xNzA2 +MDMwMjI5NDZaFw00MjA2MDMwMjI5NDZaMG8xCzAJBgNVBAYTAkhLMRIwEAYDVQQIEwlIb25nIEtv +bmcxEjAQBgNVBAcTCUhvbmcgS29uZzEWMBQGA1UEChMNSG9uZ2tvbmcgUG9zdDEgMB4GA1UEAxMX +SG9uZ2tvbmcgUG9zdCBSb290IENBIDMwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCz +iNfqzg8gTr7m1gNt7ln8wlffKWihgw4+aMdoWJwcYEuJQwy51BWy7sFOdem1p+/l6TWZ5Mwc50tf +jTMwIDNT2aa71T4Tjukfh0mtUC1Qyhi+AViiE3CWu4mIVoBc+L0sPOFMV4i707mV78vH9toxdCim +5lSJ9UExyuUmGs2C4HDaOym71QP1mbpV9WTRYA6ziUm4ii8F0oRFKHyPaFASePwLtVPLwpgchKOe +sL4jpNrcyCse2m5FHomY2vkALgbpDDtw1VAliJnLzXNg99X/NWfFobxeq81KuEXryGgeDQ0URhLj +0mRiikKYvLTGCAj4/ahMZJx2Ab0vqWwzD9g/KLg8aQFChn5pwckGyuV6RmXpwtZQQS4/t+TtbNe/ +JgERohYpSms0BpDsE9K2+2p20jzt8NYt3eEV7KObLyzJPivkaTv/ciWxNoZbx39ri1UbSsUgYT2u +y1DhCDq+sI9jQVMwCFk8mB13umOResoQUGC/8Ne8lYePl8X+l2oBlKN8W4UdKjk60FSh0Tlxnf0h ++bV78OLgAo9uliQlLKAeLKjEiafv7ZkGL7YKTE/bosw3Gq9HhS2KX8Q0NEwA/RiTZxPRN+ZItIsG +xVd7GYYKecsAyVKvQv83j+GjHno9UKtjBucVtT+2RTeUN7F+8kjDf8V1/peNRY8apxpyKBpADwID +AQABo2MwYTAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAfBgNVHSMEGDAWgBQXnc0e +i9Y5K3DTXNSguB+wAPzFYTAdBgNVHQ4EFgQUF53NHovWOStw01zUoLgfsAD8xWEwDQYJKoZIhvcN +AQELBQADggIBAFbVe27mIgHSQpsY1Q7XZiNc4/6gx5LS6ZStS6LG7BJ8dNVI0lkUmcDrudHr9Egw +W62nV3OZqdPlt9EuWSRY3GguLmLYauRwCy0gUCCkMpXRAJi70/33MvJJrsZ64Ee+bs7Lo3I6LWld +y8joRTnU+kLBEUx3XZL7av9YROXrgZ6voJmtvqkBZss4HTzfQx/0TW60uhdG/H39h4F5ag0zD/ov ++BS5gLNdTaqX4fnkGMX41TiMJjz98iji7lpJiCzfeT2OnpA8vUFKOt1b9pq0zj8lMH8yfaIDlNDc +eqFS3m6TjRgm/VWsvY+b0s+v54Ysyx8Jb6NvqYTUc79NoXQbTiNg8swOqn+knEwlqLJmOzj/2ZQw +9nKEvmhVEA/GcywWaZMH/rFF7buiVWqw2rVKAiUnhde3t4ZEFolsgCs+l6mc1X5VTMbeRRAc6uk7 +nwNT7u56AQIWeNTowr5GdogTPyK7SBIdUgC0An4hGh6cJfTzPV4e0hz5sy229zdcxsshTrD3mUcY +hcErulWuBurQB7Lcq9CClnXO0lD+mefPL5/ndtFhKvshuzHQqp9HpLIiyhY6UFfEW0NnxWViA0kB +60PZ2Pierc+xYw5F9KBaLJstxabArahH9CdMOA0uG0k7UvToiIMrVCjU8jVStDKDYmlkDJGcn5fq +dBb9HxEGmpv0 +-----END CERTIFICATE----- diff --git a/wp-content/plugins/stripe-payments/includes/stripe/init.php b/wp-content/plugins/stripe-payments/includes/stripe/init.php new file mode 100644 index 0000000..7dda8f1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/init.php @@ -0,0 +1,254 @@ +create and manage Express or + * Custom accounts. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|\Stripe\StripeObject $business_profile Business information about the account. + * @property null|string $business_type The business type. + * @property \Stripe\StripeObject $capabilities + * @property bool $charges_enabled Whether the account can create live charges. + * @property \Stripe\StripeObject $company + * @property \Stripe\StripeObject $controller + * @property string $country The account's country. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $default_currency Three-letter ISO currency code representing the default currency for the account. This must be a currency that Stripe supports in the account's country. + * @property bool $details_submitted Whether account details have been submitted. Standard accounts cannot receive payouts before this is true. + * @property null|string $email An email address associated with the account. You can treat this as metadata: it is not used for authentication or messaging account holders. + * @property \Stripe\Collection $external_accounts External accounts (bank accounts and debit cards) currently attached to this account + * @property \Stripe\StripeObject $future_requirements + * @property \Stripe\Person $individual

This is an object representing a person associated with a Stripe account.

A platform cannot access a Standard or Express account's persons after the account starts onboarding, such as after generating an account link for the account. See the Standard onboarding or Express onboarding documentation for information about platform pre-filling and account onboarding steps.

Related guide: Handling Identity Verification with the API.

+ * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property bool $payouts_enabled Whether Stripe can send payouts to this account. + * @property \Stripe\StripeObject $requirements + * @property null|\Stripe\StripeObject $settings Options for customizing how the account functions within Stripe. + * @property \Stripe\StripeObject $tos_acceptance + * @property string $type The Stripe account type. Can be standard, express, or custom. + */ +class Account extends ApiResource +{ + const OBJECT_NAME = 'account'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\NestedResource; + use ApiOperations\Update; + + const BUSINESS_TYPE_COMPANY = 'company'; + const BUSINESS_TYPE_GOVERNMENT_ENTITY = 'government_entity'; + const BUSINESS_TYPE_INDIVIDUAL = 'individual'; + const BUSINESS_TYPE_NON_PROFIT = 'non_profit'; + + const CAPABILITY_CARD_PAYMENTS = 'card_payments'; + const CAPABILITY_LEGACY_PAYMENTS = 'legacy_payments'; + const CAPABILITY_PLATFORM_PAYMENTS = 'platform_payments'; + const CAPABILITY_TRANSFERS = 'transfers'; + + const CAPABILITY_STATUS_ACTIVE = 'active'; + const CAPABILITY_STATUS_INACTIVE = 'inactive'; + const CAPABILITY_STATUS_PENDING = 'pending'; + + const TYPE_CUSTOM = 'custom'; + const TYPE_EXPRESS = 'express'; + const TYPE_STANDARD = 'standard'; + + use ApiOperations\Retrieve { + retrieve as protected _retrieve; + } + + public static function getSavedNestedResources() + { + static $savedNestedResources = null; + if (null === $savedNestedResources) { + $savedNestedResources = new Util\Set([ + 'external_account', + 'bank_account', + ]); + } + + return $savedNestedResources; + } + + public function instanceUrl() + { + if (null === $this['id']) { + return '/v1/account'; + } + + return parent::instanceUrl(); + } + + public function serializeParameters($force = false) + { + $update = parent::serializeParameters($force); + if (isset($this->_values['legal_entity'])) { + $entity = $this['legal_entity']; + if (isset($entity->_values['additional_owners'])) { + $owners = $entity['additional_owners']; + $entityUpdate = isset($update['legal_entity']) ? $update['legal_entity'] : []; + $entityUpdate['additional_owners'] = $this->serializeAdditionalOwners($entity, $owners); + $update['legal_entity'] = $entityUpdate; + } + } + if (isset($this->_values['individual'])) { + $individual = $this['individual']; + if (($individual instanceof Person) && !isset($update['individual'])) { + $update['individual'] = $individual->serializeParameters($force); + } + } + + return $update; + } + + private function serializeAdditionalOwners($legalEntity, $additionalOwners) + { + if (isset($legalEntity->_originalValues['additional_owners'])) { + $originalValue = $legalEntity->_originalValues['additional_owners']; + } else { + $originalValue = []; + } + if (($originalValue) && (\count($originalValue) > \count($additionalOwners))) { + throw new Exception\InvalidArgumentException( + 'You cannot delete an item from an array, you must instead set a new array' + ); + } + + $updateArr = []; + foreach ($additionalOwners as $i => $v) { + $update = ($v instanceof StripeObject) ? $v->serializeParameters() : $v; + + if ([] !== $update) { + if (!$originalValue + || !\array_key_exists($i, $originalValue) + || ($update !== $legalEntity->serializeParamsValue($originalValue[$i], null, false, true))) { + $updateArr[$i] = $update; + } + } + } + + return $updateArr; + } + + /** + * @param null|array|string $id the ID of the account to retrieve, or an + * options array containing an `id` key + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public static function retrieve($id = null, $opts = null) + { + if (!$opts && \is_string($id) && 'sk_' === \substr($id, 0, 3)) { + $opts = $id; + $id = null; + } + + return self::_retrieve($id, $opts); + } + + /** + * @param null|array $clientId + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject object containing the response from the API + */ + public function deauthorize($clientId = null, $opts = null) + { + $params = [ + 'client_id' => $clientId, + 'stripe_user_id' => $this->id, + ]; + + return OAuth::deauthorize($params, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of persons + */ + public function persons($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/persons'; + list($response, $opts) = $this->_request('get', $url, $params, $opts); + $obj = Util\Util::convertToStripeObject($response, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account the rejected account + */ + public function reject($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/reject'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /* + * Capabilities methods + * We can not add the capabilities() method today as the Account object already has a + * capabilities property which is a hash and not the sub-list of capabilities. + */ + + const PATH_CAPABILITIES = '/capabilities'; + + /** + * @param string $id the ID of the account on which to retrieve the capabilities + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of capabilities + */ + public static function allCapabilities($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_CAPABILITIES, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the capability belongs + * @param string $capabilityId the ID of the capability to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Capability + */ + public static function retrieveCapability($id, $capabilityId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_CAPABILITIES, $capabilityId, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the capability belongs + * @param string $capabilityId the ID of the capability to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Capability + */ + public static function updateCapability($id, $capabilityId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_CAPABILITIES, $capabilityId, $params, $opts); + } + const PATH_EXTERNAL_ACCOUNTS = '/external_accounts'; + + /** + * @param string $id the ID of the account on which to retrieve the external accounts + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of external accounts (BankAccount or Card) + */ + public static function allExternalAccounts($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_EXTERNAL_ACCOUNTS, $params, $opts); + } + + /** + * @param string $id the ID of the account on which to create the external account + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public static function createExternalAccount($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_EXTERNAL_ACCOUNTS, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the external account belongs + * @param string $externalAccountId the ID of the external account to delete + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public static function deleteExternalAccount($id, $externalAccountId, $params = null, $opts = null) + { + return self::_deleteNestedResource($id, static::PATH_EXTERNAL_ACCOUNTS, $externalAccountId, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the external account belongs + * @param string $externalAccountId the ID of the external account to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public static function retrieveExternalAccount($id, $externalAccountId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_EXTERNAL_ACCOUNTS, $externalAccountId, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the external account belongs + * @param string $externalAccountId the ID of the external account to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public static function updateExternalAccount($id, $externalAccountId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_EXTERNAL_ACCOUNTS, $externalAccountId, $params, $opts); + } + const PATH_LOGIN_LINKS = '/login_links'; + + /** + * @param string $id the ID of the account on which to create the login link + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\LoginLink + */ + public static function createLoginLink($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_LOGIN_LINKS, $params, $opts); + } + const PATH_PERSONS = '/persons'; + + /** + * @param string $id the ID of the account on which to retrieve the persons + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of persons + */ + public static function allPersons($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_PERSONS, $params, $opts); + } + + /** + * @param string $id the ID of the account on which to create the person + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public static function createPerson($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_PERSONS, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the person belongs + * @param string $personId the ID of the person to delete + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public static function deletePerson($id, $personId, $params = null, $opts = null) + { + return self::_deleteNestedResource($id, static::PATH_PERSONS, $personId, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the person belongs + * @param string $personId the ID of the person to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public static function retrievePerson($id, $personId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_PERSONS, $personId, $params, $opts); + } + + /** + * @param string $id the ID of the account to which the person belongs + * @param string $personId the ID of the person to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public static function updatePerson($id, $personId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_PERSONS, $personId, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/AccountLink.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/AccountLink.php new file mode 100644 index 0000000..24a9e68 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/AccountLink.php @@ -0,0 +1,26 @@ +Connect + * Onboarding. + * + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property int $expires_at The timestamp at which this account link will expire. + * @property string $url The URL for the account link. + */ +class AccountLink extends ApiResource +{ + const OBJECT_NAME = 'account_link'; + + use ApiOperations\Create; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/AlipayAccount.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/AlipayAccount.php new file mode 100644 index 0000000..1d6a509 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/AlipayAccount.php @@ -0,0 +1,75 @@ +json, $opts); + if (!($obj instanceof \Stripe\Collection)) { + throw new \Stripe\Exception\UnexpectedValueException( + 'Expected type ' . \Stripe\Collection::class . ', got "' . \get_class($obj) . '" instead.' + ); + } + $obj->setLastResponse($response); + $obj->setFilters($params); + + return $obj; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Create.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Create.php new file mode 100644 index 0000000..c435132 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Create.php @@ -0,0 +1,31 @@ +json, $opts); + $obj->setLastResponse($response); + + return $obj; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Delete.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Delete.php new file mode 100644 index 0000000..c6082ff --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Delete.php @@ -0,0 +1,30 @@ +instanceUrl(); + list($response, $opts) = $this->_request('delete', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/NestedResource.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/NestedResource.php new file mode 100644 index 0000000..180cacd --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/NestedResource.php @@ -0,0 +1,135 @@ +json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|string $nestedId + * + * @return string + */ + protected static function _nestedResourceUrl($id, $nestedPath, $nestedId = null) + { + $url = static::resourceUrl($id) . $nestedPath; + if (null !== $nestedId) { + $url .= "/{$nestedId}"; + } + + return $url; + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|array $params + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject + */ + protected static function _createNestedResource($id, $nestedPath, $params = null, $options = null) + { + $url = static::_nestedResourceUrl($id, $nestedPath); + + return self::_nestedResourceOperation('post', $url, $params, $options); + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|string $nestedId + * @param null|array $params + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject + */ + protected static function _retrieveNestedResource($id, $nestedPath, $nestedId, $params = null, $options = null) + { + $url = static::_nestedResourceUrl($id, $nestedPath, $nestedId); + + return self::_nestedResourceOperation('get', $url, $params, $options); + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|string $nestedId + * @param null|array $params + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject + */ + protected static function _updateNestedResource($id, $nestedPath, $nestedId, $params = null, $options = null) + { + $url = static::_nestedResourceUrl($id, $nestedPath, $nestedId); + + return self::_nestedResourceOperation('post', $url, $params, $options); + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|string $nestedId + * @param null|array $params + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject + */ + protected static function _deleteNestedResource($id, $nestedPath, $nestedId, $params = null, $options = null) + { + $url = static::_nestedResourceUrl($id, $nestedPath, $nestedId); + + return self::_nestedResourceOperation('delete', $url, $params, $options); + } + + /** + * @param string $id + * @param string $nestedPath + * @param null|array $params + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\StripeObject + */ + protected static function _allNestedResources($id, $nestedPath, $params = null, $options = null) + { + $url = static::_nestedResourceUrl($id, $nestedPath); + + return self::_nestedResourceOperation('get', $url, $params, $options); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Request.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Request.php new file mode 100644 index 0000000..a60ca79 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Request.php @@ -0,0 +1,100 @@ + 100, " + . "'currency' => 'usd', 'source' => 'tok_1234'])\")"; + + throw new \Stripe\Exception\InvalidArgumentException($message); + } + } + + /** + * @param string $method HTTP method ('get', 'post', etc.) + * @param string $url URL for the request + * @param array $params list of parameters for the request + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return array tuple containing (the JSON response, $options) + */ + protected function _request($method, $url, $params = [], $options = null) + { + $opts = $this->_opts->merge($options); + list($resp, $options) = static::_staticRequest($method, $url, $params, $opts); + $this->setLastResponse($resp); + + return [$resp->json, $options]; + } + + /** + * @param string $method HTTP method ('get', 'post', etc.) + * @param string $url URL for the request + * @param callable $readBodyChunk function that will receive chunks of data from a successful request body + * @param array $params list of parameters for the request + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + */ + protected function _requestStream($method, $url, $readBodyChunk, $params = [], $options = null) + { + $opts = $this->_opts->merge($options); + static::_staticStreamingRequest($method, $url, $readBodyChunk, $params, $opts); + } + + /** + * @param string $method HTTP method ('get', 'post', etc.) + * @param string $url URL for the request + * @param array $params list of parameters for the request + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return array tuple containing (the JSON response, $options) + */ + protected static function _staticRequest($method, $url, $params, $options) + { + $opts = \Stripe\Util\RequestOptions::parse($options); + $baseUrl = isset($opts->apiBase) ? $opts->apiBase : static::baseUrl(); + $requestor = new \Stripe\ApiRequestor($opts->apiKey, $baseUrl); + list($response, $opts->apiKey) = $requestor->request($method, $url, $params, $opts->headers); + $opts->discardNonPersistentHeaders(); + + return [$response, $opts]; + } + + /** + * @param string $method HTTP method ('get', 'post', etc.) + * @param string $url URL for the request + * @param callable $readBodyChunk function that will receive chunks of data from a successful request body + * @param array $params list of parameters for the request + * @param null|array|string $options + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + */ + protected static function _staticStreamingRequest($method, $url, $readBodyChunk, $params, $options) + { + $opts = \Stripe\Util\RequestOptions::parse($options); + $baseUrl = isset($opts->apiBase) ? $opts->apiBase : static::baseUrl(); + $requestor = new \Stripe\ApiRequestor($opts->apiKey, $baseUrl); + $requestor->requestStream($method, $url, $readBodyChunk, $params, $opts->headers); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Retrieve.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Retrieve.php new file mode 100644 index 0000000..5170afb --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Retrieve.php @@ -0,0 +1,30 @@ +refresh(); + + return $instance; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Update.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Update.php new file mode 100644 index 0000000..688f080 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiOperations/Update.php @@ -0,0 +1,52 @@ +json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return static the saved resource + */ + public function save($opts = null) + { + $params = $this->serializeParameters(); + if (\count($params) > 0) { + $url = $this->instanceUrl(); + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + } + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiRequestor.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiRequestor.php new file mode 100644 index 0000000..b2fa192 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiRequestor.php @@ -0,0 +1,619 @@ +_apiKey = $apiKey; + if (!$apiBase) { + $apiBase = Stripe::$apiBase; + } + $this->_apiBase = $apiBase; + } + + /** + * Creates a telemetry json blob for use in 'X-Stripe-Client-Telemetry' headers. + * + * @static + * + * @param RequestTelemetry $requestTelemetry + * + * @return string + */ + private static function _telemetryJson($requestTelemetry) + { + $payload = [ + 'last_request_metrics' => [ + 'request_id' => $requestTelemetry->requestId, + 'request_duration_ms' => $requestTelemetry->requestDuration, + ], + ]; + + $result = \json_encode($payload); + if (false !== $result) { + return $result; + } + Stripe::getLogger()->error('Serializing telemetry payload failed!'); + + return '{}'; + } + + /** + * @static + * + * @param ApiResource|array|bool|mixed $d + * + * @return ApiResource|array|mixed|string + */ + private static function _encodeObjects($d) + { + if ($d instanceof ApiResource) { + return Util\Util::utf8($d->id); + } + if (true === $d) { + return 'true'; + } + if (false === $d) { + return 'false'; + } + if (\is_array($d)) { + $res = []; + foreach ($d as $k => $v) { + $res[$k] = self::_encodeObjects($v); + } + + return $res; + } + + return Util\Util::utf8($d); + } + + /** + * @param string $method + * @param string $url + * @param null|array $params + * @param null|array $headers + * + * @throws Exception\ApiErrorException + * + * @return array tuple containing (ApiReponse, API key) + */ + public function request($method, $url, $params = null, $headers = null) + { + $params = $params ?: []; + $headers = $headers ?: []; + list($rbody, $rcode, $rheaders, $myApiKey) = + $this->_requestRaw($method, $url, $params, $headers); + $json = $this->_interpretResponse($rbody, $rcode, $rheaders); + $resp = new ApiResponse($rbody, $rcode, $rheaders, $json); + + return [$resp, $myApiKey]; + } + + /** + * @param string $method + * @param string $url + * @param callable $readBodyChunkCallable + * @param null|array $params + * @param null|array $headers + * + * @throws Exception\ApiErrorException + */ + public function requestStream($method, $url, $readBodyChunkCallable, $params = null, $headers = null) + { + $params = $params ?: []; + $headers = $headers ?: []; + list($rbody, $rcode, $rheaders, $myApiKey) = + $this->_requestRawStreaming($method, $url, $params, $headers, $readBodyChunkCallable); + if ($rcode >= 300) { + $this->_interpretResponse($rbody, $rcode, $rheaders); + } + } + + /** + * @param string $rbody a JSON string + * @param int $rcode + * @param array $rheaders + * @param array $resp + * + * @throws Exception\UnexpectedValueException + * @throws Exception\ApiErrorException + */ + public function handleErrorResponse($rbody, $rcode, $rheaders, $resp) + { + if (!\is_array($resp) || !isset($resp['error'])) { + $msg = "Invalid response object from API: {$rbody} " + . "(HTTP response code was {$rcode})"; + + throw new Exception\UnexpectedValueException($msg); + } + + $errorData = $resp['error']; + + $error = null; + if (\is_string($errorData)) { + $error = self::_specificOAuthError($rbody, $rcode, $rheaders, $resp, $errorData); + } + if (!$error) { + $error = self::_specificAPIError($rbody, $rcode, $rheaders, $resp, $errorData); + } + + throw $error; + } + + /** + * @static + * + * @param string $rbody + * @param int $rcode + * @param array $rheaders + * @param array $resp + * @param array $errorData + * + * @return Exception\ApiErrorException + */ + private static function _specificAPIError($rbody, $rcode, $rheaders, $resp, $errorData) + { + $msg = isset($errorData['message']) ? $errorData['message'] : null; + $param = isset($errorData['param']) ? $errorData['param'] : null; + $code = isset($errorData['code']) ? $errorData['code'] : null; + $type = isset($errorData['type']) ? $errorData['type'] : null; + $declineCode = isset($errorData['decline_code']) ? $errorData['decline_code'] : null; + + switch ($rcode) { + case 400: + // 'rate_limit' code is deprecated, but left here for backwards compatibility + // for API versions earlier than 2015-09-08 + if ('rate_limit' === $code) { + return Exception\RateLimitException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code, $param); + } + if ('idempotency_error' === $type) { + return Exception\IdempotencyException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code); + } + + // no break + case 404: + return Exception\InvalidRequestException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code, $param); + + case 401: + return Exception\AuthenticationException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code); + + case 402: + return Exception\CardException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code, $declineCode, $param); + + case 403: + return Exception\PermissionException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code); + + case 429: + return Exception\RateLimitException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code, $param); + + default: + return Exception\UnknownApiErrorException::factory($msg, $rcode, $rbody, $resp, $rheaders, $code); + } + } + + /** + * @static + * + * @param bool|string $rbody + * @param int $rcode + * @param array $rheaders + * @param array $resp + * @param string $errorCode + * + * @return Exception\OAuth\OAuthErrorException + */ + private static function _specificOAuthError($rbody, $rcode, $rheaders, $resp, $errorCode) + { + $description = isset($resp['error_description']) ? $resp['error_description'] : $errorCode; + + switch ($errorCode) { + case 'invalid_client': + return Exception\OAuth\InvalidClientException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + case 'invalid_grant': + return Exception\OAuth\InvalidGrantException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + case 'invalid_request': + return Exception\OAuth\InvalidRequestException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + case 'invalid_scope': + return Exception\OAuth\InvalidScopeException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + case 'unsupported_grant_type': + return Exception\OAuth\UnsupportedGrantTypeException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + case 'unsupported_response_type': + return Exception\OAuth\UnsupportedResponseTypeException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + + default: + return Exception\OAuth\UnknownOAuthErrorException::factory($description, $rcode, $rbody, $resp, $rheaders, $errorCode); + } + } + + /** + * @static + * + * @param null|array $appInfo + * + * @return null|string + */ + private static function _formatAppInfo($appInfo) + { + if (null !== $appInfo) { + $string = $appInfo['name']; + if (null !== $appInfo['version']) { + $string .= '/' . $appInfo['version']; + } + if (null !== $appInfo['url']) { + $string .= ' (' . $appInfo['url'] . ')'; + } + + return $string; + } + + return null; + } + + /** + * @static + * + * @param string $disabledFunctionsOutput - String value of the 'disable_function' setting, as output by \ini_get('disable_functions') + * @param string $functionName - Name of the function we are interesting in seeing whether or not it is disabled + * @param mixed $disableFunctionsOutput + * + * @return bool + */ + private static function _isDisabled($disableFunctionsOutput, $functionName) + { + $disabledFunctions = \explode(',', $disableFunctionsOutput); + foreach ($disabledFunctions as $disabledFunction) { + if (\trim($disabledFunction) === $functionName) { + return true; + } + } + + return false; + } + + /** + * @static + * + * @param string $apiKey + * @param null $clientInfo + * + * @return array + */ + private static function _defaultHeaders($apiKey, $clientInfo = null) + { + $uaString = 'Stripe/v1 PhpBindings/' . Stripe::VERSION; + + $langVersion = \PHP_VERSION; + $uname_disabled = static::_isDisabled(\ini_get('disable_functions'), 'php_uname'); + $uname = $uname_disabled ? '(disabled)' : \php_uname(); + + $appInfo = Stripe::getAppInfo(); + $ua = [ + 'bindings_version' => Stripe::VERSION, + 'lang' => 'php', + 'lang_version' => $langVersion, + 'publisher' => 'stripe', + 'uname' => $uname, + ]; + if ($clientInfo) { + $ua = \array_merge($clientInfo, $ua); + } + if (null !== $appInfo) { + $uaString .= ' ' . self::_formatAppInfo($appInfo); + $ua['application'] = $appInfo; + } + + return [ + 'X-Stripe-Client-User-Agent' => \json_encode($ua), + 'User-Agent' => $uaString, + 'Authorization' => 'Bearer ' . $apiKey, + ]; + } + + private function _prepareRequest($method, $url, $params, $headers) + { + $myApiKey = $this->_apiKey; + if (!$myApiKey) { + $myApiKey = Stripe::$apiKey; + } + + if (!$myApiKey) { + $msg = 'No API key provided. (HINT: set your API key using ' + . '"Stripe::setApiKey()". You can generate API keys from ' + . 'the Stripe web interface. See https://stripe.com/api for ' + . 'details, or email support@stripe.com if you have any questions.'; + + throw new Exception\AuthenticationException($msg); + } + + // Clients can supply arbitrary additional keys to be included in the + // X-Stripe-Client-User-Agent header via the optional getUserAgentInfo() + // method + $clientUAInfo = null; + if (\method_exists($this->httpClient(), 'getUserAgentInfo')) { + $clientUAInfo = $this->httpClient()->getUserAgentInfo(); + } + + if ($params && \is_array($params)) { + $optionKeysInParams = \array_filter( + static::$OPTIONS_KEYS, + function ($key) use ($params) { + return \array_key_exists($key, $params); + } + ); + if (\count($optionKeysInParams) > 0) { + $message = \sprintf('Options found in $params: %s. Options should ' + . 'be passed in their own array after $params. (HINT: pass an ' + . 'empty array to $params if you do not have any.)', \implode(', ', $optionKeysInParams)); + \trigger_error($message, \E_USER_WARNING); + } + } + + $absUrl = $this->_apiBase . $url; + $params = self::_encodeObjects($params); + $defaultHeaders = $this->_defaultHeaders($myApiKey, $clientUAInfo); + if (Stripe::$apiVersion) { + $defaultHeaders['Stripe-Version'] = Stripe::$apiVersion; + } + + if (Stripe::$accountId) { + $defaultHeaders['Stripe-Account'] = Stripe::$accountId; + } + + if (Stripe::$enableTelemetry && null !== self::$requestTelemetry) { + $defaultHeaders['X-Stripe-Client-Telemetry'] = self::_telemetryJson(self::$requestTelemetry); + } + + $hasFile = false; + foreach ($params as $k => $v) { + if (\is_resource($v)) { + $hasFile = true; + $params[$k] = self::_processResourceParam($v); + } elseif ($v instanceof \CURLFile) { + $hasFile = true; + } + } + + if ($hasFile) { + $defaultHeaders['Content-Type'] = 'multipart/form-data'; + } else { + $defaultHeaders['Content-Type'] = 'application/x-www-form-urlencoded'; + } + + $combinedHeaders = \array_merge($defaultHeaders, $headers); + $rawHeaders = []; + + foreach ($combinedHeaders as $header => $value) { + $rawHeaders[] = $header . ': ' . $value; + } + + return [$absUrl, $rawHeaders, $params, $hasFile, $myApiKey]; + } + + /** + * @param string $method + * @param string $url + * @param array $params + * @param array $headers + * + * @throws Exception\AuthenticationException + * @throws Exception\ApiConnectionException + * + * @return array + */ + private function _requestRaw($method, $url, $params, $headers) + { + list($absUrl, $rawHeaders, $params, $hasFile, $myApiKey) = $this->_prepareRequest($method, $url, $params, $headers); + + $requestStartMs = Util\Util::currentTimeMillis(); + + list($rbody, $rcode, $rheaders) = $this->httpClient()->request( + $method, + $absUrl, + $rawHeaders, + $params, + $hasFile + ); + + if (isset($rheaders['request-id']) + && \is_string($rheaders['request-id']) + && '' !== $rheaders['request-id']) { + self::$requestTelemetry = new RequestTelemetry( + $rheaders['request-id'], + Util\Util::currentTimeMillis() - $requestStartMs + ); + } + + return [$rbody, $rcode, $rheaders, $myApiKey]; + } + + /** + * @param string $method + * @param string $url + * @param array $params + * @param array $headers + * @param callable $readBodyChunk + * @param mixed $readBodyChunkCallable + * + * @throws Exception\AuthenticationException + * @throws Exception\ApiConnectionException + * + * @return array + */ + private function _requestRawStreaming($method, $url, $params, $headers, $readBodyChunkCallable) + { + list($absUrl, $rawHeaders, $params, $hasFile, $myApiKey) = $this->_prepareRequest($method, $url, $params, $headers); + + $requestStartMs = Util\Util::currentTimeMillis(); + + list($rbody, $rcode, $rheaders) = $this->streamingHttpClient()->requestStream( + $method, + $absUrl, + $rawHeaders, + $params, + $hasFile, + $readBodyChunkCallable + ); + + if (isset($rheaders['request-id']) + && \is_string($rheaders['request-id']) + && '' !== $rheaders['request-id']) { + self::$requestTelemetry = new RequestTelemetry( + $rheaders['request-id'], + Util\Util::currentTimeMillis() - $requestStartMs + ); + } + + return [$rbody, $rcode, $rheaders, $myApiKey]; + } + + /** + * @param resource $resource + * + * @throws Exception\InvalidArgumentException + * + * @return \CURLFile|string + */ + private function _processResourceParam($resource) + { + if ('stream' !== \get_resource_type($resource)) { + throw new Exception\InvalidArgumentException( + 'Attempted to upload a resource that is not a stream' + ); + } + + $metaData = \stream_get_meta_data($resource); + if ('plainfile' !== $metaData['wrapper_type']) { + throw new Exception\InvalidArgumentException( + 'Only plainfile resource streams are supported' + ); + } + + // We don't have the filename or mimetype, but the API doesn't care + return new \CURLFile($metaData['uri']); + } + + /** + * @param string $rbody + * @param int $rcode + * @param array $rheaders + * + * @throws Exception\UnexpectedValueException + * @throws Exception\ApiErrorException + * + * @return array + */ + private function _interpretResponse($rbody, $rcode, $rheaders) + { + $resp = \json_decode($rbody, true); + $jsonError = \json_last_error(); + if (null === $resp && \JSON_ERROR_NONE !== $jsonError) { + $msg = "Invalid response body from API: {$rbody} " + . "(HTTP response code was {$rcode}, json_last_error() was {$jsonError})"; + + throw new Exception\UnexpectedValueException($msg, $rcode); + } + + if ($rcode < 200 || $rcode >= 300) { + $this->handleErrorResponse($rbody, $rcode, $rheaders, $resp); + } + + return $resp; + } + + /** + * @static + * + * @param HttpClient\ClientInterface $client + */ + public static function setHttpClient($client) + { + self::$_httpClient = $client; + } + + /** + * @static + * + * @param HttpClient\StreamingClientInterface $client + */ + public static function setStreamingHttpClient($client) + { + self::$_streamingHttpClient = $client; + } + + /** + * @static + * + * Resets any stateful telemetry data + */ + public static function resetTelemetry() + { + self::$requestTelemetry = null; + } + + /** + * @return HttpClient\ClientInterface + */ + private function httpClient() + { + if (!self::$_httpClient) { + self::$_httpClient = HttpClient\CurlClient::instance(); + } + + return self::$_httpClient; + } + + /** + * @return HttpClient\StreamingClientInterface + */ + private function streamingHttpClient() + { + if (!self::$_streamingHttpClient) { + self::$_streamingHttpClient = HttpClient\CurlClient::instance(); + } + + return self::$_streamingHttpClient; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResource.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResource.php new file mode 100644 index 0000000..25c6b84 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResource.php @@ -0,0 +1,122 @@ +{$k}; + if ((static::getSavedNestedResources()->includes($k)) + && ($v instanceof ApiResource)) { + $v->saveWithParent = true; + } + } + + /** + * @throws Exception\ApiErrorException + * + * @return ApiResource the refreshed resource + */ + public function refresh() + { + $requestor = new ApiRequestor($this->_opts->apiKey, static::baseUrl()); + $url = $this->instanceUrl(); + + list($response, $this->_opts->apiKey) = $requestor->request( + 'get', + $url, + $this->_retrieveOptions, + $this->_opts->headers + ); + $this->setLastResponse($response); + $this->refreshFrom($response->json, $this->_opts); + + return $this; + } + + /** + * @return string the base URL for the given class + */ + public static function baseUrl() + { + return Stripe::$apiBase; + } + + /** + * @return string the endpoint URL for the given class + */ + public static function classUrl() + { + // Replace dots with slashes for namespaced resources, e.g. if the object's name is + // "foo.bar", then its URL will be "/v1/foo/bars". + + /** @phpstan-ignore-next-line */ + $base = \str_replace('.', '/', static::OBJECT_NAME); + + return "/v1/{$base}s"; + } + + /** + * @param null|string $id the ID of the resource + * + * @throws Exception\UnexpectedValueException if $id is null + * + * @return string the instance endpoint URL for the given class + */ + public static function resourceUrl($id) + { + if (null === $id) { + $class = static::class; + $message = 'Could not determine which URL to request: ' + . "{$class} instance has invalid ID: {$id}"; + + throw new Exception\UnexpectedValueException($message); + } + $id = Util\Util::utf8($id); + $base = static::classUrl(); + $extn = \urlencode($id); + + return "{$base}/{$extn}"; + } + + /** + * @return string the full API URL for this API resource + */ + public function instanceUrl() + { + return static::resourceUrl($this['id']); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResponse.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResponse.php new file mode 100644 index 0000000..e7ee2e9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApiResponse.php @@ -0,0 +1,45 @@ +body = $body; + $this->code = $code; + $this->headers = $headers; + $this->json = $json; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplePayDomain.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplePayDomain.php new file mode 100644 index 0000000..5f9489d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplePayDomain.php @@ -0,0 +1,31 @@ +true if the object exists in live mode or the value false if the object exists in test mode. + */ +class ApplePayDomain extends ApiResource +{ + const OBJECT_NAME = 'apple_pay_domain'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + + /** + * @return string The class URL for this resource. It needs to be special + * cased because it doesn't fit into the standard resource pattern. + */ + public static function classUrl() + { + return '/v1/apple_pay/domains'; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFee.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFee.php new file mode 100644 index 0000000..88aeed6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFee.php @@ -0,0 +1,90 @@ +ISO currency code, in lowercase. Must be a supported currency. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string|\Stripe\Charge $originating_transaction ID of the corresponding charge on the platform account, if this fee was the result of a charge using the destination parameter. + * @property bool $refunded Whether the fee has been fully refunded. If the fee is only partially refunded, this attribute will still be false. + * @property \Stripe\Collection $refunds A list of refunds that have been applied to the fee. + */ +class ApplicationFee extends ApiResource +{ + const OBJECT_NAME = 'application_fee'; + + use ApiOperations\All; + use ApiOperations\NestedResource; + use ApiOperations\Retrieve; + + const PATH_REFUNDS = '/refunds'; + + /** + * @param string $id the ID of the application fee on which to retrieve the fee refunds + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of fee refunds + */ + public static function allRefunds($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_REFUNDS, $params, $opts); + } + + /** + * @param string $id the ID of the application fee on which to create the fee refund + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public static function createRefund($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_REFUNDS, $params, $opts); + } + + /** + * @param string $id the ID of the application fee to which the fee refund belongs + * @param string $refundId the ID of the fee refund to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public static function retrieveRefund($id, $refundId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_REFUNDS, $refundId, $params, $opts); + } + + /** + * @param string $id the ID of the application fee to which the fee refund belongs + * @param string $refundId the ID of the fee refund to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public static function updateRefund($id, $refundId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_REFUNDS, $refundId, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFeeRefund.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFeeRefund.php new file mode 100644 index 0000000..dc7c34b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ApplicationFeeRefund.php @@ -0,0 +1,66 @@ +Application Fee Refund objects allow you to refund an application + * fee that has previously been created but not yet refunded. Funds will be + * refunded to the Stripe account from which the fee was originally collected. + * + * Related guide: Refunding + * Application Fees. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount, in %s. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction Balance transaction that describes the impact on your account balance. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string|\Stripe\ApplicationFee $fee ID of the application fee that was refunded. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + */ +class ApplicationFeeRefund extends ApiResource +{ + const OBJECT_NAME = 'fee_refund'; + + use ApiOperations\Update { + save as protected _save; + } + + /** + * @return string the API URL for this Stripe refund + */ + public function instanceUrl() + { + $id = $this['id']; + $fee = $this['fee']; + if (!$id) { + throw new Exception\UnexpectedValueException( + 'Could not determine which URL to request: ' . + "class instance has invalid ID: {$id}", + null + ); + } + $id = Util\Util::utf8($id); + $fee = Util\Util::utf8($fee); + + $base = ApplicationFee::classUrl(); + $feeExtn = \urlencode($fee); + $extn = \urlencode($id); + + return "{$base}/{$feeExtn}/refunds/{$extn}"; + } + + /** + * @param null|array|string $opts + * + * @return ApplicationFeeRefund the saved refund + */ + public function save($opts = null) + { + return $this->_save($opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Balance.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Balance.php new file mode 100644 index 0000000..0fdc285 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Balance.php @@ -0,0 +1,45 @@ +transactions + * that contributed to the balance (charges, payouts, and so forth). + * + * The available and pending amounts for each currency are broken down further by + * payment source types. + * + * Related guide: Understanding Connect + * Account Balances. + * + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject[] $available Funds that are available to be transferred or paid out, whether automatically by Stripe or explicitly via the Transfers API or Payouts API. The available balance for each currency and payment type can be found in the source_types property. + * @property \Stripe\StripeObject[] $connect_reserved Funds held due to negative balances on connected Custom accounts. The connect reserve balance for each currency and payment type can be found in the source_types property. + * @property \Stripe\StripeObject[] $instant_available Funds that can be paid out using Instant Payouts. + * @property \Stripe\StripeObject $issuing + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject[] $pending Funds that are not yet available in the balance, due to the 7-day rolling pay cycle. The pending balance for each currency, and for each payment type, can be found in the source_types property. + */ +class Balance extends SingletonApiResource +{ + const OBJECT_NAME = 'balance'; + + /** + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Balance + */ + public static function retrieve($opts = null) + { + return self::_singletonRetrieve($opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BalanceTransaction.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BalanceTransaction.php new file mode 100644 index 0000000..d7ddea4 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BalanceTransaction.php @@ -0,0 +1,71 @@ +Balance + * Transaction Types. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Gross amount of the transaction, in %s. + * @property int $available_on The date the transaction's net funds will become available in the Stripe balance. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|float $exchange_rate The exchange rate used, if applicable, for this transaction. Specifically, if money was converted from currency A to currency B, then the amount in currency A, times exchange_rate, would be the amount in currency B. For example, suppose you charged a customer 10.00 EUR. Then the PaymentIntent's amount would be 1000 and currency would be eur. Suppose this was converted into 12.34 USD in your Stripe account. Then the BalanceTransaction's amount would be 1234, currency would be usd, and exchange_rate would be 1.234. + * @property int $fee Fees (in %s) paid for this transaction. + * @property \Stripe\StripeObject[] $fee_details Detailed breakdown of fees (in %s) paid for this transaction. + * @property int $net Net amount of the transaction, in %s. + * @property string $reporting_category Learn more about how reporting categories can help you understand balance transactions from an accounting perspective. + * @property null|string|\Stripe\StripeObject $source The Stripe object to which this transaction is related. + * @property string $status If the transaction's net funds are available in the Stripe balance yet. Either available or pending. + * @property string $type Transaction type: adjustment, advance, advance_funding, anticipation_repayment, application_fee, application_fee_refund, charge, connect_collection_transfer, contribution, issuing_authorization_hold, issuing_authorization_release, issuing_dispute, issuing_transaction, payment, payment_failure_refund, payment_refund, payout, payout_cancel, payout_failure, refund, refund_failure, reserve_transaction, reserved_funds, stripe_fee, stripe_fx_fee, tax_fee, topup, topup_reversal, transfer, transfer_cancel, transfer_failure, or transfer_refund. Learn more about balance transaction types and what they represent. If you are looking to classify transactions for accounting purposes, you might want to consider reporting_category instead. + */ +class BalanceTransaction extends ApiResource +{ + const OBJECT_NAME = 'balance_transaction'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + + const TYPE_ADJUSTMENT = 'adjustment'; + const TYPE_ADVANCE = 'advance'; + const TYPE_ADVANCE_FUNDING = 'advance_funding'; + const TYPE_ANTICIPATION_REPAYMENT = 'anticipation_repayment'; + const TYPE_APPLICATION_FEE = 'application_fee'; + const TYPE_APPLICATION_FEE_REFUND = 'application_fee_refund'; + const TYPE_CHARGE = 'charge'; + const TYPE_CONNECT_COLLECTION_TRANSFER = 'connect_collection_transfer'; + const TYPE_CONTRIBUTION = 'contribution'; + const TYPE_ISSUING_AUTHORIZATION_HOLD = 'issuing_authorization_hold'; + const TYPE_ISSUING_AUTHORIZATION_RELEASE = 'issuing_authorization_release'; + const TYPE_ISSUING_DISPUTE = 'issuing_dispute'; + const TYPE_ISSUING_TRANSACTION = 'issuing_transaction'; + const TYPE_PAYMENT = 'payment'; + const TYPE_PAYMENT_FAILURE_REFUND = 'payment_failure_refund'; + const TYPE_PAYMENT_REFUND = 'payment_refund'; + const TYPE_PAYOUT = 'payout'; + const TYPE_PAYOUT_CANCEL = 'payout_cancel'; + const TYPE_PAYOUT_FAILURE = 'payout_failure'; + const TYPE_REFUND = 'refund'; + const TYPE_REFUND_FAILURE = 'refund_failure'; + const TYPE_RESERVE_TRANSACTION = 'reserve_transaction'; + const TYPE_RESERVED_FUNDS = 'reserved_funds'; + const TYPE_STRIPE_FEE = 'stripe_fee'; + const TYPE_STRIPE_FX_FEE = 'stripe_fx_fee'; + const TYPE_TAX_FEE = 'tax_fee'; + const TYPE_TOPUP = 'topup'; + const TYPE_TOPUP_REVERSAL = 'topup_reversal'; + const TYPE_TRANSFER = 'transfer'; + const TYPE_TRANSFER_CANCEL = 'transfer_cancel'; + const TYPE_TRANSFER_FAILURE = 'transfer_failure'; + const TYPE_TRANSFER_REFUND = 'transfer_refund'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BankAccount.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BankAccount.php new file mode 100644 index 0000000..57fd19b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BankAccount.php @@ -0,0 +1,133 @@ +Customer objects. + * + * On the other hand External Accounts are + * transfer destinations on Account objects for Custom accounts. They + * can be bank accounts or debit cards as well, and are documented in the links + * above. + * + * Related guide: Bank Debits and + * Transfers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string|\Stripe\Account $account The ID of the account that the bank account is associated with. + * @property null|string $account_holder_name The name of the person or business that owns the bank account. + * @property null|string $account_holder_type The type of entity that holds the account. This can be either individual or company. + * @property null|string $account_type The bank account type. This can only be checking or savings in most countries. In Japan, this can only be futsu or toza. + * @property null|string[] $available_payout_methods A set of available payout methods for this bank account. Only values from this set should be passed as the method when creating a payout. + * @property null|string $bank_name Name of the bank associated with the routing number (e.g., WELLS FARGO). + * @property string $country Two-letter ISO code representing the country the bank account is located in. + * @property string $currency Three-letter ISO code for the currency paid out to the bank account. + * @property null|string|\Stripe\Customer $customer The ID of the customer that the bank account is associated with. + * @property null|bool $default_for_currency Whether this bank account is the default external account for its currency. + * @property null|string $fingerprint Uniquely identifies this particular bank account. You can use this attribute to check whether two bank accounts are the same. + * @property string $last4 The last four digits of the bank account number. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $routing_number The routing transit number for the bank account. + * @property string $status

For bank accounts, possible values are new, validated, verified, verification_failed, or errored. A bank account that hasn't had any activity or validation performed is new. If Stripe can determine that the bank account exists, its status will be validated. Note that there often isn’t enough information to know (e.g., for smaller credit unions), and the validation is not always run. If customer bank account verification has succeeded, the bank account status will be verified. If the verification failed for any reason, such as microdeposit failure, the status will be verification_failed. If a transfer sent to this bank account fails, we'll set the status to errored and will not continue to send transfers until the bank details are updated.

For external accounts, possible values are new and errored. Validations aren't run against external accounts because they're only used for payouts. This means the other statuses don't apply. If a transfer fails, the status is set to errored and transfers are stopped until account details are updated.

+ */ +class BankAccount extends ApiResource +{ + const OBJECT_NAME = 'bank_account'; + + use ApiOperations\Delete; + use ApiOperations\Update; + + /** + * Possible string representations of the bank verification status. + * + * @see https://stripe.com/docs/api/external_account_bank_accounts/object#account_bank_account_object-status + */ + const STATUS_NEW = 'new'; + const STATUS_VALIDATED = 'validated'; + const STATUS_VERIFIED = 'verified'; + const STATUS_VERIFICATION_FAILED = 'verification_failed'; + const STATUS_ERRORED = 'errored'; + + /** + * @return string The instance URL for this resource. It needs to be special + * cased because it doesn't fit into the standard resource pattern. + */ + public function instanceUrl() + { + if ($this['customer']) { + $base = Customer::classUrl(); + $parent = $this['customer']; + $path = 'sources'; + } elseif ($this['account']) { + $base = Account::classUrl(); + $parent = $this['account']; + $path = 'external_accounts'; + } else { + $msg = 'Bank accounts cannot be accessed without a customer ID or account ID.'; + + throw new Exception\UnexpectedValueException($msg, null); + } + $parentExtn = \urlencode(Util\Util::utf8($parent)); + $extn = \urlencode(Util\Util::utf8($this['id'])); + + return "{$base}/{$parentExtn}/{$path}/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Bank accounts cannot be retrieved without a customer ID or ' . + 'an account ID. Retrieve a bank account using ' . + "`Customer::retrieveSource('customer_id', " . + "'bank_account_id')` or `Account::retrieveExternalAccount(" . + "'account_id', 'bank_account_id')`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param string $_id + * @param null|array $_params + * @param null|array|string $_options + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function update($_id, $_params = null, $_options = null) + { + $msg = 'Bank accounts cannot be updated without a customer ID or an ' . + 'account ID. Update a bank account using ' . + "`Customer::updateSource('customer_id', 'bank_account_id', " . + '$updateParams)` or `Account::updateExternalAccount(' . + "'account_id', 'bank_account_id', \$updateParams)`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return BankAccount the verified bank account + */ + public function verify($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/verify'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClient.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClient.php new file mode 100644 index 0000000..bfdfe86 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClient.php @@ -0,0 +1,288 @@ + */ + private $config; + + /** @var \Stripe\Util\RequestOptions */ + private $defaultOpts; + + /** + * Initializes a new instance of the {@link BaseStripeClient} class. + * + * The constructor takes a single argument. The argument can be a string, in which case it + * should be the API key. It can also be an array with various configuration settings. + * + * Configuration settings include the following options: + * + * - api_key (null|string): the Stripe API key, to be used in regular API requests. + * - client_id (null|string): the Stripe client ID, to be used in OAuth requests. + * - stripe_account (null|string): a Stripe account ID. If set, all requests sent by the client + * will automatically use the {@code Stripe-Account} header with that account ID. + * - stripe_version (null|string): a Stripe API verion. If set, all requests sent by the client + * will include the {@code Stripe-Version} header with that API version. + * + * The following configuration settings are also available, though setting these should rarely be necessary + * (only useful if you want to send requests to a mock server like stripe-mock): + * + * - api_base (string): the base URL for regular API requests. Defaults to + * {@link DEFAULT_API_BASE}. + * - connect_base (string): the base URL for OAuth requests. Defaults to + * {@link DEFAULT_CONNECT_BASE}. + * - files_base (string): the base URL for file creation requests. Defaults to + * {@link DEFAULT_FILES_BASE}. + * + * @param array|string $config the API key as a string, or an array containing + * the client configuration settings + */ + public function __construct($config = []) + { + if (\is_string($config)) { + $config = ['api_key' => $config]; + } elseif (!\is_array($config)) { + throw new \Stripe\Exception\InvalidArgumentException('$config must be a string or an array'); + } + + $config = \array_merge($this->getDefaultConfig(), $config); + $this->validateConfig($config); + + $this->config = $config; + + $this->defaultOpts = \Stripe\Util\RequestOptions::parse([ + 'stripe_account' => $config['stripe_account'], + 'stripe_version' => $config['stripe_version'], + ]); + } + + /** + * Gets the API key used by the client to send requests. + * + * @return null|string the API key used by the client to send requests + */ + public function getApiKey() + { + return $this->config['api_key']; + } + + /** + * Gets the client ID used by the client in OAuth requests. + * + * @return null|string the client ID used by the client in OAuth requests + */ + public function getClientId() + { + return $this->config['client_id']; + } + + /** + * Gets the base URL for Stripe's API. + * + * @return string the base URL for Stripe's API + */ + public function getApiBase() + { + return $this->config['api_base']; + } + + /** + * Gets the base URL for Stripe's OAuth API. + * + * @return string the base URL for Stripe's OAuth API + */ + public function getConnectBase() + { + return $this->config['connect_base']; + } + + /** + * Gets the base URL for Stripe's Files API. + * + * @return string the base URL for Stripe's Files API + */ + public function getFilesBase() + { + return $this->config['files_base']; + } + + /** + * Sends a request to Stripe's API. + * + * @param string $method the HTTP method + * @param string $path the path of the request + * @param array $params the parameters of the request + * @param array|\Stripe\Util\RequestOptions $opts the special modifiers of the request + * + * @return \Stripe\StripeObject the object returned by Stripe's API + */ + public function request($method, $path, $params, $opts) + { + $opts = $this->defaultOpts->merge($opts, true); + $baseUrl = $opts->apiBase ?: $this->getApiBase(); + $requestor = new \Stripe\ApiRequestor($this->apiKeyForRequest($opts), $baseUrl); + list($response, $opts->apiKey) = $requestor->request($method, $path, $params, $opts->headers); + $opts->discardNonPersistentHeaders(); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * Sends a request to Stripe's API, passing chunks of the streamed response + * into a user-provided $readBodyChunkCallable callback. + * + * @param string $method the HTTP method + * @param string $path the path of the request + * @param callable $readBodyChunkCallable a function that will be called + * @param array $params the parameters of the request + * @param array|\Stripe\Util\RequestOptions $opts the special modifiers of the request + * with chunks of bytes from the body if the request is successful + */ + public function requestStream($method, $path, $readBodyChunkCallable, $params, $opts) + { + $opts = $this->defaultOpts->merge($opts, true); + $baseUrl = $opts->apiBase ?: $this->getApiBase(); + $requestor = new \Stripe\ApiRequestor($this->apiKeyForRequest($opts), $baseUrl); + list($response, $opts->apiKey) = $requestor->requestStream($method, $path, $readBodyChunkCallable, $params, $opts->headers); + } + + /** + * Sends a request to Stripe's API. + * + * @param string $method the HTTP method + * @param string $path the path of the request + * @param array $params the parameters of the request + * @param array|\Stripe\Util\RequestOptions $opts the special modifiers of the request + * + * @return \Stripe\Collection of ApiResources + */ + public function requestCollection($method, $path, $params, $opts) + { + $obj = $this->request($method, $path, $params, $opts); + if (!($obj instanceof \Stripe\Collection)) { + $received_class = \get_class($obj); + $msg = "Expected to receive `Stripe\\Collection` object from Stripe API. Instead received `{$received_class}`."; + + throw new \Stripe\Exception\UnexpectedValueException($msg); + } + $obj->setFilters($params); + + return $obj; + } + + /** + * @param \Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\AuthenticationException + * + * @return string + */ + private function apiKeyForRequest($opts) + { + $apiKey = $opts->apiKey ?: $this->getApiKey(); + + if (null === $apiKey) { + $msg = 'No API key provided. Set your API key when constructing the ' + . 'StripeClient instance, or provide it on a per-request basis ' + . 'using the `api_key` key in the $opts argument.'; + + throw new \Stripe\Exception\AuthenticationException($msg); + } + + return $apiKey; + } + + /** + * TODO: replace this with a private constant when we drop support for PHP < 5. + * + * @return array + */ + private function getDefaultConfig() + { + return [ + 'api_key' => null, + 'client_id' => null, + 'stripe_account' => null, + 'stripe_version' => null, + 'api_base' => self::DEFAULT_API_BASE, + 'connect_base' => self::DEFAULT_CONNECT_BASE, + 'files_base' => self::DEFAULT_FILES_BASE, + ]; + } + + /** + * @param array $config + * + * @throws \Stripe\Exception\InvalidArgumentException + */ + private function validateConfig($config) + { + // api_key + if (null !== $config['api_key'] && !\is_string($config['api_key'])) { + throw new \Stripe\Exception\InvalidArgumentException('api_key must be null or a string'); + } + + if (null !== $config['api_key'] && ('' === $config['api_key'])) { + $msg = 'api_key cannot be the empty string'; + + throw new \Stripe\Exception\InvalidArgumentException($msg); + } + + if (null !== $config['api_key'] && (\preg_match('/\s/', $config['api_key']))) { + $msg = 'api_key cannot contain whitespace'; + + throw new \Stripe\Exception\InvalidArgumentException($msg); + } + + // client_id + if (null !== $config['client_id'] && !\is_string($config['client_id'])) { + throw new \Stripe\Exception\InvalidArgumentException('client_id must be null or a string'); + } + + // stripe_account + if (null !== $config['stripe_account'] && !\is_string($config['stripe_account'])) { + throw new \Stripe\Exception\InvalidArgumentException('stripe_account must be null or a string'); + } + + // stripe_version + if (null !== $config['stripe_version'] && !\is_string($config['stripe_version'])) { + throw new \Stripe\Exception\InvalidArgumentException('stripe_version must be null or a string'); + } + + // api_base + if (!\is_string($config['api_base'])) { + throw new \Stripe\Exception\InvalidArgumentException('api_base must be a string'); + } + + // connect_base + if (!\is_string($config['connect_base'])) { + throw new \Stripe\Exception\InvalidArgumentException('connect_base must be a string'); + } + + // files_base + if (!\is_string($config['files_base'])) { + throw new \Stripe\Exception\InvalidArgumentException('files_base must be a string'); + } + + // check absence of extra keys + $extraConfigKeys = \array_diff(\array_keys($config), \array_keys($this->getDefaultConfig())); + if (!empty($extraConfigKeys)) { + // Wrap in single quote to more easily catch trailing spaces errors + $invalidKeys = "'" . \implode("', '", $extraConfigKeys) . "'"; + + throw new \Stripe\Exception\InvalidArgumentException('Found unknown key(s) in configuration array: ' . $invalidKeys); + } + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClientInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClientInterface.php new file mode 100644 index 0000000..6b00457 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BaseStripeClientInterface.php @@ -0,0 +1,44 @@ +overriden when creating the session. + * @property \Stripe\StripeObject $features + * @property bool $is_default Whether the configuration is the default. If true, this configuration can be managed in the Dashboard and portal sessions will use this configuration unless it is overriden when creating the session. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property int $updated Time at which the object was last updated. Measured in seconds since the Unix epoch. + */ +class Configuration extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'billing_portal.configuration'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BillingPortal/Session.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BillingPortal/Session.php new file mode 100644 index 0000000..5cec9a4 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BillingPortal/Session.php @@ -0,0 +1,41 @@ +integration + * guide. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string|\Stripe\BillingPortal\Configuration $configuration The configuration used by this session, describing the features available. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $customer The ID of the customer for this session. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string $locale The IETF language tag of the locale Customer Portal is displayed in. If blank or auto, the customer’s preferred_locales or browser’s locale is used. + * @property null|string $on_behalf_of The account for which the session was created on behalf of. When specified, only subscriptions and invoices with this on_behalf_of account appear in the portal. For more information, see the docs. Use the Accounts API to modify the on_behalf_of account's branding settings, which the portal displays. + * @property string $return_url The URL to redirect customers to when they click on the portal's link to return to your website. + * @property string $url The short-lived URL of the session that gives customers access to the customer portal. + */ +class Session extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'billing_portal.session'; + + use \Stripe\ApiOperations\Create; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinReceiver.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinReceiver.php new file mode 100644 index 0000000..208610a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinReceiver.php @@ -0,0 +1,71 @@ +currency that you are collecting as payment. + * @property int $amount_received The amount of currency to which bitcoin_amount_received has been converted. + * @property int $bitcoin_amount The amount of bitcoin that the customer should send to fill the receiver. The bitcoin_amount is denominated in Satoshi: there are 10^8 Satoshi in one bitcoin. + * @property int $bitcoin_amount_received The amount of bitcoin that has been sent by the customer to this receiver. + * @property string $bitcoin_uri This URI can be displayed to the customer as a clickable link (to activate their bitcoin client) or as a QR code (for mobile wallets). + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO code for the currency to which the bitcoin will be converted. + * @property null|string $customer The customer ID of the bitcoin receiver. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string $email The customer's email address, set by the API call that creates the receiver. + * @property bool $filled This flag is initially false and updates to true when the customer sends the bitcoin_amount to this receiver. + * @property string $inbound_address A bitcoin address that is specific to this receiver. The customer can send bitcoin to this address to fill the receiver. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $payment The ID of the payment created from the receiver, if any. Hidden when viewing the receiver with a publishable key. + * @property null|string $refund_address The refund address of this bitcoin receiver. + * @property \Stripe\Collection $transactions A list with one entry for each time that the customer sent bitcoin to the receiver. Hidden when viewing the receiver with a publishable key. + * @property bool $uncaptured_funds This receiver contains uncaptured funds that can be used for a payment or refunded. + * @property null|bool $used_for_payment Indicate if this source is used for payment. + */ +class BitcoinReceiver extends ApiResource +{ + const OBJECT_NAME = 'bitcoin_receiver'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + + /** + * @return string The class URL for this resource. It needs to be special + * cased because it doesn't fit into the standard resource pattern. + */ + public static function classUrl() + { + return '/v1/bitcoin/receivers'; + } + + /** + * @return string The instance URL for this resource. It needs to be special + * cased because it doesn't fit into the standard resource pattern. + */ + public function instanceUrl() + { + if ($this['customer']) { + $base = Customer::classUrl(); + $parent = $this['customer']; + $path = 'sources'; + $parentExtn = \urlencode(Util\Util::utf8($parent)); + $extn = \urlencode(Util\Util::utf8($this['id'])); + + return "{$base}/{$parentExtn}/{$path}/{$extn}"; + } + + $base = BitcoinReceiver::classUrl(); + $extn = \urlencode(Util\Util::utf8($this['id'])); + + return "{$base}/{$extn}"; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinTransaction.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinTransaction.php new file mode 100644 index 0000000..3aa7118 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/BitcoinTransaction.php @@ -0,0 +1,19 @@ +currency that the transaction was converted to in real-time. + * @property int $bitcoin_amount The amount of bitcoin contained in the transaction. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO code for the currency to which this transaction was converted. + * @property string $receiver The receiver to which this transaction was sent. + */ +class BitcoinTransaction extends ApiResource +{ + const OBJECT_NAME = 'bitcoin_transaction'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Capability.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Capability.php new file mode 100644 index 0000000..f675d71 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Capability.php @@ -0,0 +1,88 @@ +Account + * capabilities. + * + * @property string $id The identifier for the capability. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string|\Stripe\Account $account The account for which the capability enables functionality. + * @property \Stripe\StripeObject $future_requirements + * @property bool $requested Whether the capability has been requested. + * @property null|int $requested_at Time at which the capability was requested. Measured in seconds since the Unix epoch. + * @property \Stripe\StripeObject $requirements + * @property string $status The status of the capability. Can be active, inactive, pending, or unrequested. + */ +class Capability extends ApiResource +{ + const OBJECT_NAME = 'capability'; + + use ApiOperations\Update; + + const STATUS_ACTIVE = 'active'; + const STATUS_INACTIVE = 'inactive'; + const STATUS_PENDING = 'pending'; + const STATUS_UNREQUESTED = 'unrequested'; + + /** + * @return string the API URL for this Stripe account reversal + */ + public function instanceUrl() + { + $id = $this['id']; + $account = $this['account']; + if (!$id) { + throw new Exception\UnexpectedValueException( + 'Could not determine which URL to request: ' . + "class instance has invalid ID: {$id}", + null + ); + } + $id = Util\Util::utf8($id); + $account = Util\Util::utf8($account); + + $base = Account::classUrl(); + $accountExtn = \urlencode($account); + $extn = \urlencode($id); + + return "{$base}/{$accountExtn}/capabilities/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Capabilities cannot be retrieved without an account ID. ' . + 'Retrieve a capability using `Account::retrieveCapability(' . + "'account_id', 'capability_id')`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param string $_id + * @param null|array $_params + * @param null|array|string $_options + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function update($_id, $_params = null, $_options = null) + { + $msg = 'Capabilities cannot be updated without an account ID. ' . + 'Update a capability using `Account::updateCapability(' . + "'account_id', 'capability_id', \$updateParams)`."; + + throw new Exception\BadMethodCallException($msg); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Card.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Card.php new file mode 100644 index 0000000..7f757d6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Card.php @@ -0,0 +1,142 @@ +Card Payments + * with Sources. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string|\Stripe\Account $account The account this card belongs to. This attribute will not be in the card object if the card belongs to a customer or recipient instead. + * @property null|string $address_city City/District/Suburb/Town/Village. + * @property null|string $address_country Billing address country, if provided when creating card. + * @property null|string $address_line1 Address line 1 (Street address/PO Box/Company name). + * @property null|string $address_line1_check If address_line1 was provided, results of the check: pass, fail, unavailable, or unchecked. + * @property null|string $address_line2 Address line 2 (Apartment/Suite/Unit/Building). + * @property null|string $address_state State/County/Province/Region. + * @property null|string $address_zip ZIP or postal code. + * @property null|string $address_zip_check If address_zip was provided, results of the check: pass, fail, unavailable, or unchecked. + * @property null|string[] $available_payout_methods A set of available payout methods for this card. Only values from this set should be passed as the method when creating a payout. + * @property string $brand Card brand. Can be American Express, Diners Club, Discover, JCB, MasterCard, UnionPay, Visa, or Unknown. + * @property null|string $country Two-letter ISO code representing the country of the card. You could use this attribute to get a sense of the international breakdown of cards you've collected. + * @property null|string $currency Three-letter ISO code for currency. Only applicable on accounts (not customers or recipients). The card can be used as a transfer destination for funds in this currency. + * @property null|string|\Stripe\Customer $customer The customer that this card belongs to. This attribute will not be in the card object if the card belongs to an account or recipient instead. + * @property null|string $cvc_check If a CVC was provided, results of the check: pass, fail, unavailable, or unchecked. A result of unchecked indicates that CVC was provided but hasn't been checked yet. Checks are typically performed when attaching a card to a Customer object, or when creating a charge. For more details, see Check if a card is valid without a charge. + * @property null|bool $default_for_currency Whether this card is the default external account for its currency. + * @property null|string $dynamic_last4 (For tokenized numbers only.) The last four digits of the device account number. + * @property int $exp_month Two-digit number representing the card's expiration month. + * @property int $exp_year Four-digit number representing the card's expiration year. + * @property null|string $fingerprint

Uniquely identifies this particular card number. You can use this attribute to check whether two customers who’ve signed up with you are using the same card number, for example. For payment methods that tokenize card information (Apple Pay, Google Pay), the tokenized number might be provided instead of the underlying card number.

Starting May 1, 2021, card fingerprint in India for Connect will change to allow two fingerprints for the same card --- one for India and one for the rest of the world.

+ * @property string $funding Card funding type. Can be credit, debit, prepaid, or unknown. + * @property string $last4 The last four digits of the card. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $name Cardholder name. + * @property null|string|\Stripe\Recipient $recipient The recipient that this card belongs to. This attribute will not be in the card object if the card belongs to a customer or account instead. + * @property null|string $tokenization_method If the card number is tokenized, this is the method that was used. Can be android_pay (includes Google Pay), apple_pay, masterpass, visa_checkout, or null. + */ +class Card extends ApiResource +{ + const OBJECT_NAME = 'card'; + + use ApiOperations\Delete; + use ApiOperations\Update; + + /** + * Possible string representations of the CVC check status. + * + * @see https://stripe.com/docs/api/cards/object#card_object-cvc_check + */ + const CVC_CHECK_FAIL = 'fail'; + const CVC_CHECK_PASS = 'pass'; + const CVC_CHECK_UNAVAILABLE = 'unavailable'; + const CVC_CHECK_UNCHECKED = 'unchecked'; + + /** + * Possible string representations of the funding of the card. + * + * @see https://stripe.com/docs/api/cards/object#card_object-funding + */ + const FUNDING_CREDIT = 'credit'; + const FUNDING_DEBIT = 'debit'; + const FUNDING_PREPAID = 'prepaid'; + const FUNDING_UNKNOWN = 'unknown'; + + /** + * Possible string representations of the tokenization method when using Apple Pay or Google Pay. + * + * @see https://stripe.com/docs/api/cards/object#card_object-tokenization_method + */ + const TOKENIZATION_METHOD_APPLE_PAY = 'apple_pay'; + const TOKENIZATION_METHOD_GOOGLE_PAY = 'google_pay'; + + /** + * @return string The instance URL for this resource. It needs to be special + * cased because cards are nested resources that may belong to different + * top-level resources. + */ + public function instanceUrl() + { + if ($this['customer']) { + $base = Customer::classUrl(); + $parent = $this['customer']; + $path = 'sources'; + } elseif ($this['account']) { + $base = Account::classUrl(); + $parent = $this['account']; + $path = 'external_accounts'; + } elseif ($this['recipient']) { + $base = Recipient::classUrl(); + $parent = $this['recipient']; + $path = 'cards'; + } else { + $msg = 'Cards cannot be accessed without a customer ID, account ID or recipient ID.'; + + throw new Exception\UnexpectedValueException($msg); + } + $parentExtn = \urlencode(Util\Util::utf8($parent)); + $extn = \urlencode(Util\Util::utf8($this['id'])); + + return "{$base}/{$parentExtn}/{$path}/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Cards cannot be retrieved without a customer ID or an ' . + 'account ID. Retrieve a card using ' . + "`Customer::retrieveSource('customer_id', 'card_id')` or " . + "`Account::retrieveExternalAccount('account_id', 'card_id')`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param string $_id + * @param null|array $_params + * @param null|array|string $_options + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function update($_id, $_params = null, $_options = null) + { + $msg = 'Cards cannot be updated without a customer ID or an ' . + 'account ID. Update a card using ' . + "`Customer::updateSource('customer_id', 'card_id', " . + '$updateParams)` or `Account::updateExternalAccount(' . + "'account_id', 'card_id', \$updateParams)`."; + + throw new Exception\BadMethodCallException($msg); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Charge.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Charge.php new file mode 100644 index 0000000..b9fc301 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Charge.php @@ -0,0 +1,146 @@ +Charge object. You + * can retrieve and refund individual charges as well as list all charges. Charges + * are identified by a unique, random ID. + * + * Related guide: Accept a + * payment with the Charges API. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount intended to be collected by this payment. A positive integer representing how much to charge in the smallest currency unit (e.g., 100 cents to charge $1.00 or 100 to charge ¥100, a zero-decimal currency). The minimum amount is $0.50 US or equivalent in charge currency. The amount value supports up to eight digits (e.g., a value of 99999999 for a USD charge of $999,999.99). + * @property int $amount_captured Amount in %s captured (can be less than the amount attribute on the charge if a partial capture was made). + * @property int $amount_refunded Amount in %s refunded (can be less than the amount attribute on the charge if a partial refund was issued). + * @property null|string|\Stripe\StripeObject $application ID of the Connect application that created the charge. + * @property null|string|\Stripe\ApplicationFee $application_fee The application fee (if any) for the charge. See the Connect documentation for details. + * @property null|int $application_fee_amount The amount of the application fee (if any) requested for the charge. See the Connect documentation for details. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction ID of the balance transaction that describes the impact of this charge on your account balance (not including refunds or disputes). + * @property \Stripe\StripeObject $billing_details + * @property null|string $calculated_statement_descriptor The full statement descriptor that is passed to card networks, and that is displayed on your customers' credit card and bank statements. Allows you to see what the statement descriptor looks like after the static and dynamic portions are combined. + * @property bool $captured If the charge was created without capturing, this Boolean represents whether it is still uncaptured or has since been captured. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Customer $customer ID of the customer this charge is for if one exists. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string|\Stripe\Account $destination ID of an existing, connected Stripe account to transfer funds to if transfer_data was specified in the charge request. + * @property null|string|\Stripe\Dispute $dispute Details about the dispute if the charge has been disputed. + * @property bool $disputed Whether the charge has been disputed. + * @property null|string $failure_code Error code explaining reason for charge failure if available (see the errors section for a list of codes). + * @property null|string $failure_message Message to user further explaining reason for charge failure if available. + * @property null|\Stripe\StripeObject $fraud_details Information on fraud assessments for the charge. + * @property null|string|\Stripe\Invoice $invoice ID of the invoice this charge is for if one exists. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string|\Stripe\Account $on_behalf_of The account (if any) the charge was made on behalf of without triggering an automatic transfer. See the Connect documentation for details. + * @property null|string|\Stripe\Order $order ID of the order this charge is for if one exists. + * @property null|\Stripe\StripeObject $outcome Details about whether the payment was accepted, and why. See understanding declines for details. + * @property bool $paid true if the charge succeeded, or was successfully authorized for later capture. + * @property null|string|\Stripe\PaymentIntent $payment_intent ID of the PaymentIntent associated with this charge, if one exists. + * @property null|string $payment_method ID of the payment method used in this charge. + * @property null|\Stripe\StripeObject $payment_method_details Details about the payment method at the time of the transaction. + * @property null|string $receipt_email This is the email address that the receipt for this charge was sent to. + * @property null|string $receipt_number This is the transaction number that appears on email receipts sent for this charge. This attribute will be null until a receipt has been sent. + * @property null|string $receipt_url This is the URL to view the receipt for this charge. The receipt is kept up-to-date to the latest state of the charge, including any refunds. If the charge is for an Invoice, the receipt will be stylized as an Invoice receipt. + * @property bool $refunded Whether the charge has been fully refunded. If the charge is only partially refunded, this attribute will still be false. + * @property \Stripe\Collection $refunds A list of refunds that have been applied to the charge. + * @property null|string|\Stripe\Review $review ID of the review associated with this charge if one exists. + * @property null|\Stripe\StripeObject $shipping Shipping information for the charge. + * @property null|\Stripe\Account|\Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source $source This is a legacy field that will be removed in the future. It contains the Source, Card, or BankAccount object used for the charge. For details about the payment method used for this charge, refer to payment_method or payment_method_details instead. + * @property null|string|\Stripe\Transfer $source_transfer The transfer ID which created this charge. Only present if the charge came from another Stripe account. See the Connect documentation for details. + * @property null|string $statement_descriptor For card charges, use statement_descriptor_suffix instead. Otherwise, you can use this value as the complete description of a charge on your customers’ statements. Must contain at least one letter, maximum 22 characters. + * @property null|string $statement_descriptor_suffix Provides information about the charge that customers see on their statements. Concatenated with the prefix (shortened descriptor) or statement descriptor that’s set on the account to form the complete statement descriptor. Maximum 22 characters for the concatenated descriptor. + * @property string $status The status of the payment is either succeeded, pending, or failed. + * @property string|\Stripe\Transfer $transfer ID of the transfer to the destination account (only applicable if the charge was created using the destination parameter). + * @property null|\Stripe\StripeObject $transfer_data An optional dictionary including the account to automatically transfer to as part of a destination charge. See the Connect documentation for details. + * @property null|string $transfer_group A string that identifies this transaction as part of a group. See the Connect documentation for details. + */ +class Charge extends ApiResource +{ + const OBJECT_NAME = 'charge'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const STATUS_FAILED = 'failed'; + const STATUS_PENDING = 'pending'; + const STATUS_SUCCEEDED = 'succeeded'; + + /** + * Possible string representations of decline codes. + * These strings are applicable to the decline_code property of the \Stripe\Exception\CardException exception. + * + * @see https://stripe.com/docs/declines/codes + */ + const DECLINED_AUTHENTICATION_REQUIRED = 'authentication_required'; + const DECLINED_APPROVE_WITH_ID = 'approve_with_id'; + const DECLINED_CALL_ISSUER = 'call_issuer'; + const DECLINED_CARD_NOT_SUPPORTED = 'card_not_supported'; + const DECLINED_CARD_VELOCITY_EXCEEDED = 'card_velocity_exceeded'; + const DECLINED_CURRENCY_NOT_SUPPORTED = 'currency_not_supported'; + const DECLINED_DO_NOT_HONOR = 'do_not_honor'; + const DECLINED_DO_NOT_TRY_AGAIN = 'do_not_try_again'; + const DECLINED_DUPLICATED_TRANSACTION = 'duplicate_transaction'; + const DECLINED_EXPIRED_CARD = 'expired_card'; + const DECLINED_FRAUDULENT = 'fraudulent'; + const DECLINED_GENERIC_DECLINE = 'generic_decline'; + const DECLINED_INCORRECT_NUMBER = 'incorrect_number'; + const DECLINED_INCORRECT_CVC = 'incorrect_cvc'; + const DECLINED_INCORRECT_PIN = 'incorrect_pin'; + const DECLINED_INCORRECT_ZIP = 'incorrect_zip'; + const DECLINED_INSUFFICIENT_FUNDS = 'insufficient_funds'; + const DECLINED_INVALID_ACCOUNT = 'invalid_account'; + const DECLINED_INVALID_AMOUNT = 'invalid_amount'; + const DECLINED_INVALID_CVC = 'invalid_cvc'; + const DECLINED_INVALID_EXPIRY_YEAR = 'invalid_expiry_year'; + const DECLINED_INVALID_NUMBER = 'invalid_number'; + const DECLINED_INVALID_PIN = 'invalid_pin'; + const DECLINED_ISSUER_NOT_AVAILABLE = 'issuer_not_available'; + const DECLINED_LOST_CARD = 'lost_card'; + const DECLINED_MERCHANT_BLACKLIST = 'merchant_blacklist'; + const DECLINED_NEW_ACCOUNT_INFORMATION_AVAILABLE = 'new_account_information_available'; + const DECLINED_NO_ACTION_TAKEN = 'no_action_taken'; + const DECLINED_NOT_PERMITTED = 'not_permitted'; + const DECLINED_OFFLINE_PIN_REQUIRED = 'offline_pin_required'; + const DECLINED_ONLINE_OR_OFFLINE_PIN_REQUIRED = 'online_or_offline_pin_required'; + const DECLINED_PICKUP_CARD = 'pickup_card'; + const DECLINED_PIN_TRY_EXCEEDED = 'pin_try_exceeded'; + const DECLINED_PROCESSING_ERROR = 'processing_error'; + const DECLINED_REENTER_TRANSACTION = 'reenter_transaction'; + const DECLINED_RESTRICTED_CARD = 'restricted_card'; + const DECLINED_REVOCATION_OF_ALL_AUTHORIZATIONS = 'revocation_of_all_authorizations'; + const DECLINED_REVOCATION_OF_AUTHORIZATION = 'revocation_of_authorization'; + const DECLINED_SECURITY_VIOLATION = 'security_violation'; + const DECLINED_SERVICE_NOT_ALLOWED = 'service_not_allowed'; + const DECLINED_STOLEN_CARD = 'stolen_card'; + const DECLINED_STOP_PAYMENT_ORDER = 'stop_payment_order'; + const DECLINED_TESTMODE_DECLINE = 'testmode_decline'; + const DECLINED_TRANSACTION_NOT_ALLOWED = 'transaction_not_allowed'; + const DECLINED_TRY_AGAIN_LATER = 'try_again_later'; + const DECLINED_WITHDRAWAL_COUNT_LIMIT_EXCEEDED = 'withdrawal_count_limit_exceeded'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Charge the captured charge + */ + public function capture($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/capture'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Checkout/Session.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Checkout/Session.php new file mode 100644 index 0000000..4f2e39b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Checkout/Session.php @@ -0,0 +1,132 @@ +Checkout or Payment Links. We + * recommend creating a new Session each time your customer attempts to pay. + * + * Once payment is successful, the Checkout Session will contain a reference to the + * Customer, and either the + * successful PaymentIntent or an + * active Subscription. + * + * You can create a Checkout Session on your server and pass its ID to the client + * to begin Checkout. + * + * Related guide: Checkout + * Server Quickstart. + * + * @property string $id Unique identifier for the object. Used to pass to redirectToCheckout in Stripe.js. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|\Stripe\StripeObject $after_expiration When set, provides configuration for actions to take if this Checkout Session expires. + * @property null|bool $allow_promotion_codes Enables user redeemable promotion codes. + * @property null|int $amount_subtotal Total of all items before discounts or taxes are applied. + * @property null|int $amount_total Total of all items after discounts and taxes are applied. + * @property \Stripe\StripeObject $automatic_tax + * @property null|string $billing_address_collection Describes whether Checkout should collect the customer's billing address. + * @property string $cancel_url The URL the customer will be directed to if they decide to cancel payment and return to your website. + * @property null|string $client_reference_id A unique string to reference the Checkout Session. This can be a customer ID, a cart ID, or similar, and can be used to reconcile the Session with your internal systems. + * @property null|\Stripe\StripeObject $consent Results of consent_collection for this session. + * @property null|\Stripe\StripeObject $consent_collection When set, provides configuration for the Checkout Session to gather active consent from customers. + * @property null|string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Customer $customer The ID of the customer for this Session. For Checkout Sessions in payment or subscription mode, Checkout will create a new customer object based on information provided during the payment flow unless an existing customer was provided when the Session was created. + * @property null|string $customer_creation Configure whether a Checkout Session creates a Customer when the Checkout Session completes. + * @property null|\Stripe\StripeObject $customer_details The customer details including the customer's tax exempt status and the customer's tax IDs. Only present on Sessions in payment or subscription mode. + * @property null|string $customer_email If provided, this value will be used when the Customer object is created. If not provided, customers will be asked to enter their email address. Use this parameter to prefill customer data if you already have an email on file. To access information about the customer once the payment flow is complete, use the customer attribute. + * @property int $expires_at The timestamp at which the Checkout Session will expire. + * @property \Stripe\Collection $line_items The line items purchased by the customer. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string $locale The IETF language tag of the locale Checkout is displayed in. If blank or auto, the browser's locale is used. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $mode The mode of the Checkout Session. + * @property null|string|\Stripe\PaymentIntent $payment_intent The ID of the PaymentIntent for Checkout Sessions in payment mode. + * @property null|\Stripe\StripeObject $payment_method_options Payment-method-specific configuration for the PaymentIntent or SetupIntent of this CheckoutSession. + * @property string[] $payment_method_types A list of the types of payment methods (e.g. card) this Checkout Session is allowed to accept. + * @property string $payment_status The payment status of the Checkout Session, one of paid, unpaid, or no_payment_required. You can use this value to decide when to fulfill your customer's order. + * @property \Stripe\StripeObject $phone_number_collection + * @property null|string $recovered_from The ID of the original expired Checkout Session that triggered the recovery flow. + * @property null|string|\Stripe\SetupIntent $setup_intent The ID of the SetupIntent for Checkout Sessions in setup mode. + * @property null|\Stripe\StripeObject $shipping Shipping information for this Checkout Session. + * @property null|\Stripe\StripeObject $shipping_address_collection When set, provides configuration for Checkout to collect a shipping address from a customer. + * @property \Stripe\StripeObject[] $shipping_options The shipping rate options applied to this Session. + * @property null|string|\Stripe\ShippingRate $shipping_rate The ID of the ShippingRate for Checkout Sessions in payment mode. + * @property null|string $status The status of the Checkout Session, one of open, complete, or expired. + * @property null|string $submit_type Describes the type of transaction being performed by Checkout in order to customize relevant text on the page, such as the submit button. submit_type can only be specified on Checkout Sessions in payment mode, but not Checkout Sessions in subscription or setup mode. + * @property null|string|\Stripe\Subscription $subscription The ID of the subscription for Checkout Sessions in subscription mode. + * @property string $success_url The URL the customer will be directed to after the payment or subscription creation is successful. + * @property \Stripe\StripeObject $tax_id_collection + * @property null|\Stripe\StripeObject $total_details Tax and discount details for the computed total amount. + * @property null|string $url The URL to the Checkout Session. + */ +class Session extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'checkout.session'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\NestedResource; + use \Stripe\ApiOperations\Retrieve; + + const BILLING_ADDRESS_COLLECTION_AUTO = 'auto'; + const BILLING_ADDRESS_COLLECTION_REQUIRED = 'required'; + + const CUSTOMER_CREATION_ALWAYS = 'always'; + const CUSTOMER_CREATION_IF_REQUIRED = 'if_required'; + + const MODE_PAYMENT = 'payment'; + const MODE_SETUP = 'setup'; + const MODE_SUBSCRIPTION = 'subscription'; + + const PAYMENT_STATUS_NO_PAYMENT_REQUIRED = 'no_payment_required'; + const PAYMENT_STATUS_PAID = 'paid'; + const PAYMENT_STATUS_UNPAID = 'unpaid'; + + const STATUS_COMPLETE = 'complete'; + const STATUS_EXPIRED = 'expired'; + const STATUS_OPEN = 'open'; + + const SUBMIT_TYPE_AUTO = 'auto'; + const SUBMIT_TYPE_BOOK = 'book'; + const SUBMIT_TYPE_DONATE = 'donate'; + const SUBMIT_TYPE_PAY = 'pay'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Checkout\Session the expired session + */ + public function expire($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/expire'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + const PATH_LINE_ITEMS = '/line_items'; + + /** + * @param string $id the ID of the session on which to retrieve the items + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of items + */ + public static function allLineItems($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_LINE_ITEMS, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Collection.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Collection.php new file mode 100644 index 0000000..294ea9d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Collection.php @@ -0,0 +1,284 @@ +filters; + } + + /** + * Sets the filters, removing paging options. + * + * @param array $filters the filters + */ + public function setFilters($filters) + { + $this->filters = $filters; + } + + #[\ReturnTypeWillChange] + public function offsetGet($k) + { + if (\is_string($k)) { + return parent::offsetGet($k); + } + $msg = "You tried to access the {$k} index, but Collection " . + 'types only support string keys. (HINT: List calls ' . + 'return an object with a `data` (which is the data ' . + "array). You likely want to call ->data[{$k}])"; + + throw new Exception\InvalidArgumentException($msg); + } + + public function all($params = null, $opts = null) + { + self::_validateParams($params); + list($url, $params) = $this->extractPathAndUpdateParams($params); + + list($response, $opts) = $this->_request('get', $url, $params, $opts); + $obj = Util\Util::convertToStripeObject($response, $opts); + if (!($obj instanceof \Stripe\Collection)) { + throw new \Stripe\Exception\UnexpectedValueException( + 'Expected type ' . \Stripe\Collection::class . ', got "' . \get_class($obj) . '" instead.' + ); + } + $obj->setFilters($params); + + return $obj; + } + + public function create($params = null, $opts = null) + { + self::_validateParams($params); + list($url, $params) = $this->extractPathAndUpdateParams($params); + + list($response, $opts) = $this->_request('post', $url, $params, $opts); + + return Util\Util::convertToStripeObject($response, $opts); + } + + public function retrieve($id, $params = null, $opts = null) + { + self::_validateParams($params); + list($url, $params) = $this->extractPathAndUpdateParams($params); + + $id = Util\Util::utf8($id); + $extn = \urlencode($id); + list($response, $opts) = $this->_request( + 'get', + "{$url}/{$extn}", + $params, + $opts + ); + + return Util\Util::convertToStripeObject($response, $opts); + } + + /** + * @return int the number of objects in the current page + */ + #[\ReturnTypeWillChange] + public function count() + { + return \count($this->data); + } + + /** + * @return \ArrayIterator an iterator that can be used to iterate + * across objects in the current page + */ + #[\ReturnTypeWillChange] + public function getIterator() + { + return new \ArrayIterator($this->data); + } + + /** + * @return \ArrayIterator an iterator that can be used to iterate + * backwards across objects in the current page + */ + public function getReverseIterator() + { + return new \ArrayIterator(\array_reverse($this->data)); + } + + /** + * @return \Generator|StripeObject[] A generator that can be used to + * iterate across all objects across all pages. As page boundaries are + * encountered, the next page will be fetched automatically for + * continued iteration. + */ + public function autoPagingIterator() + { + $page = $this; + + while (true) { + $filters = $this->filters ?: []; + if (\array_key_exists('ending_before', $filters) + && !\array_key_exists('starting_after', $filters)) { + foreach ($page->getReverseIterator() as $item) { + yield $item; + } + $page = $page->previousPage(); + } else { + foreach ($page as $item) { + yield $item; + } + $page = $page->nextPage(); + } + + if ($page->isEmpty()) { + break; + } + } + } + + /** + * Returns an empty collection. This is returned from {@see nextPage()} + * when we know that there isn't a next page in order to replicate the + * behavior of the API when it attempts to return a page beyond the last. + * + * @param null|array|string $opts + * + * @return Collection + */ + public static function emptyCollection($opts = null) + { + return Collection::constructFrom(['data' => []], $opts); + } + + /** + * Returns true if the page object contains no element. + * + * @return bool + */ + public function isEmpty() + { + return empty($this->data); + } + + /** + * Fetches the next page in the resource list (if there is one). + * + * This method will try to respect the limit of the current page. If none + * was given, the default limit will be fetched again. + * + * @param null|array $params + * @param null|array|string $opts + * + * @return Collection + */ + public function nextPage($params = null, $opts = null) + { + if (!$this->has_more) { + return static::emptyCollection($opts); + } + + $lastId = \end($this->data)->id; + + $params = \array_merge( + $this->filters ?: [], + ['starting_after' => $lastId], + $params ?: [] + ); + + return $this->all($params, $opts); + } + + /** + * Fetches the previous page in the resource list (if there is one). + * + * This method will try to respect the limit of the current page. If none + * was given, the default limit will be fetched again. + * + * @param null|array $params + * @param null|array|string $opts + * + * @return Collection + */ + public function previousPage($params = null, $opts = null) + { + if (!$this->has_more) { + return static::emptyCollection($opts); + } + + $firstId = $this->data[0]->id; + + $params = \array_merge( + $this->filters ?: [], + ['ending_before' => $firstId], + $params ?: [] + ); + + return $this->all($params, $opts); + } + + /** + * Gets the first item from the current page. Returns `null` if the current page is empty. + * + * @return null|\Stripe\StripeObject + */ + public function first() + { + return \count($this->data) > 0 ? $this->data[0] : null; + } + + /** + * Gets the last item from the current page. Returns `null` if the current page is empty. + * + * @return null|\Stripe\StripeObject + */ + public function last() + { + return \count($this->data) > 0 ? $this->data[\count($this->data) - 1] : null; + } + + private function extractPathAndUpdateParams($params) + { + $url = \parse_url($this->url); + if (!isset($url['path'])) { + throw new Exception\UnexpectedValueException("Could not parse list url into parts: {$url}"); + } + + if (isset($url['query'])) { + // If the URL contains a query param, parse it out into $params so they + // don't interact weirdly with each other. + $query = []; + \parse_str($url['query'], $query); + $params = \array_merge($params ?: [], $query); + } + + return [$url['path'], $params]; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/CountrySpec.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/CountrySpec.php new file mode 100644 index 0000000..223afb3 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/CountrySpec.php @@ -0,0 +1,30 @@ +an online guide. + * + * @property string $id Unique identifier for the object. Represented as the ISO country code for this country. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $default_currency The default currency for this country. This applies to both payment methods and bank accounts. + * @property \Stripe\StripeObject $supported_bank_account_currencies Currencies that can be accepted in the specific country (for transfers). + * @property string[] $supported_payment_currencies Currencies that can be accepted in the specified country (for payments). + * @property string[] $supported_payment_methods Payment methods available in the specified country. You may need to enable some payment methods (e.g., ACH) on your account before they appear in this list. The stripe payment method refers to charging through your platform. + * @property string[] $supported_transfer_countries Countries that can accept transfers from the specified country. + * @property \Stripe\StripeObject $verification_fields + */ +class CountrySpec extends ApiResource +{ + const OBJECT_NAME = 'country_spec'; + + use ApiOperations\All; + use ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Coupon.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Coupon.php new file mode 100644 index 0000000..0d84bd4 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Coupon.php @@ -0,0 +1,41 @@ +invoices or orders. + * Coupons do not work with conventional one-off charges. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|int $amount_off Amount (in the currency specified) that will be taken off the subtotal of any invoices for this customer. + * @property \Stripe\StripeObject $applies_to + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $currency If amount_off has been set, the three-letter ISO code for the currency of the amount to take off. + * @property string $duration One of forever, once, and repeating. Describes how long a customer who applies this coupon will get the discount. + * @property null|int $duration_in_months If duration is repeating, the number of months the coupon applies. Null if coupon duration is forever or once. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|int $max_redemptions Maximum number of times this coupon can be redeemed, in total, across all customers, before it is no longer valid. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $name Name of the coupon displayed to customers on for instance invoices or receipts. + * @property null|float $percent_off Percent that will be taken off the subtotal of any invoices for this customer for the duration of the coupon. For example, a coupon with percent_off of 50 will make a %s100 invoice %s50 instead. + * @property null|int $redeem_by Date after which the coupon can no longer be redeemed. + * @property int $times_redeemed Number of times this coupon has been applied to a customer. + * @property bool $valid Taking account of the above properties, whether this coupon can still be applied to a customer. + */ +class Coupon extends ApiResource +{ + const OBJECT_NAME = 'coupon'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNote.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNote.php new file mode 100644 index 0000000..591c5d7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNote.php @@ -0,0 +1,111 @@ +Credit Notes. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount The integer amount in %s representing the total amount of the credit note, including tax. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string|\Stripe\Customer $customer ID of the customer. + * @property null|string|\Stripe\CustomerBalanceTransaction $customer_balance_transaction Customer balance transaction related to this credit note. + * @property int $discount_amount The integer amount in %s representing the total amount of discount that was credited. + * @property \Stripe\StripeObject[] $discount_amounts The aggregate amounts calculated per discount for all line items. + * @property string|\Stripe\Invoice $invoice ID of the invoice. + * @property \Stripe\Collection $lines Line items that make up the credit note + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string $memo Customer-facing text that appears on the credit note PDF. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $number A unique number that identifies this particular credit note and appears on the PDF of the credit note and its associated invoice. + * @property null|int $out_of_band_amount Amount that was credited outside of Stripe. + * @property string $pdf The link to download the PDF of the credit note. + * @property null|string $reason Reason for issuing this credit note, one of duplicate, fraudulent, order_change, or product_unsatisfactory + * @property null|string|\Stripe\Refund $refund Refund related to this credit note. + * @property string $status Status of this credit note, one of issued or void. Learn more about voiding credit notes. + * @property int $subtotal The integer amount in %s representing the amount of the credit note, excluding tax and invoice level discounts. + * @property \Stripe\StripeObject[] $tax_amounts The aggregate amounts calculated per tax rate for all line items. + * @property int $total The integer amount in %s representing the total amount of the credit note, including tax and all discount. + * @property string $type Type of this credit note, one of pre_payment or post_payment. A pre_payment credit note means it was issued when the invoice was open. A post_payment credit note means it was issued when the invoice was paid. + * @property null|int $voided_at The time that the credit note was voided. + */ +class CreditNote extends ApiResource +{ + const OBJECT_NAME = 'credit_note'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\NestedResource; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const REASON_DUPLICATE = 'duplicate'; + const REASON_FRAUDULENT = 'fraudulent'; + const REASON_ORDER_CHANGE = 'order_change'; + const REASON_PRODUCT_UNSATISFACTORY = 'product_unsatisfactory'; + + const STATUS_ISSUED = 'issued'; + const STATUS_VOID = 'void'; + + const TYPE_POST_PAYMENT = 'post_payment'; + const TYPE_PRE_PAYMENT = 'pre_payment'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote the previewed credit note + */ + public static function preview($params = null, $opts = null) + { + $url = static::classUrl() . '/preview'; + list($response, $opts) = static::_staticRequest('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote the voided credit note + */ + public function voidCreditNote($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/void'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + const PATH_LINES = '/lines'; + + /** + * @param string $id the ID of the credit note on which to retrieve the credit note line items + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of credit note line items + */ + public static function allLines($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_LINES, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNoteLineItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNoteLineItem.php new file mode 100644 index 0000000..254886b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/CreditNoteLineItem.php @@ -0,0 +1,26 @@ +true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|int $quantity The number of units of product being credited. + * @property \Stripe\StripeObject[] $tax_amounts The amount of tax calculated per tax rate for this line item + * @property \Stripe\TaxRate[] $tax_rates The tax rates which apply to the line item. + * @property string $type The type of the credit note line item, one of invoice_line_item or custom_line_item. When the type is invoice_line_item there is an additional invoice_line_item property on the resource the value of which is the id of the credited line item on the invoice. + * @property null|int $unit_amount The cost of each unit of product being credited. + * @property null|string $unit_amount_decimal Same as unit_amount, but contains a decimal value with at most 12 decimal places. + */ +class CreditNoteLineItem extends ApiResource +{ + const OBJECT_NAME = 'credit_note_line_item'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Customer.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Customer.php new file mode 100644 index 0000000..3e42213 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Customer.php @@ -0,0 +1,294 @@ +Save a card during + * payment. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|\Stripe\StripeObject $address The customer's address. + * @property int $balance Current balance, if any, being stored on the customer. If negative, the customer has credit to apply to their next invoice. If positive, the customer has an amount owed that will be added to their next invoice. The balance does not refer to any unpaid invoices; it solely takes into account amounts that have yet to be successfully applied to any invoice. This balance is only taken into account as invoices are finalized. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $currency Three-letter ISO code for the currency the customer can be charged in for recurring billing purposes. + * @property null|string|\Stripe\Account|\Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source $default_source

ID of the default payment source for the customer.

If you are using payment methods created via the PaymentMethods API, see the invoice_settings.default_payment_method field instead.

+ * @property null|bool $delinquent

When the customer's latest invoice is billed by charging automatically, delinquent is true if the invoice's latest charge failed. When the customer's latest invoice is billed by sending an invoice, delinquent is true if the invoice isn't paid by its due date.

If an invoice is marked uncollectible by dunning, delinquent doesn't get reset to false.

+ * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|\Stripe\Discount $discount Describes the current discount active on the customer, if there is one. + * @property null|string $email The customer's email address. + * @property null|string $invoice_prefix The prefix for the customer used to generate unique invoice numbers. + * @property \Stripe\StripeObject $invoice_settings + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $name The customer's full name or business name. + * @property int $next_invoice_sequence The suffix of the customer's next invoice number, e.g., 0001. + * @property null|string $phone The customer's phone number. + * @property null|string[] $preferred_locales The customer's preferred locales (languages), ordered by preference. + * @property null|\Stripe\StripeObject $shipping Mailing and shipping address for the customer. Appears on invoices emailed to this customer. + * @property \Stripe\Collection $sources The customer's payment sources, if any. + * @property \Stripe\Collection $subscriptions The customer's current subscriptions, if any. + * @property \Stripe\StripeObject $tax + * @property null|string $tax_exempt Describes the customer's tax exemption status. One of none, exempt, or reverse. When set to reverse, invoice and receipt PDFs include the text "Reverse charge". + * @property \Stripe\Collection $tax_ids The customer's tax IDs. + */ +class Customer extends ApiResource +{ + const OBJECT_NAME = 'customer'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\NestedResource; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const TAX_EXEMPT_EXEMPT = 'exempt'; + const TAX_EXEMPT_NONE = 'none'; + const TAX_EXEMPT_REVERSE = 'reverse'; + + public static function getSavedNestedResources() + { + static $savedNestedResources = null; + if (null === $savedNestedResources) { + $savedNestedResources = new Util\Set([ + 'source', + ]); + } + + return $savedNestedResources; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @return \Stripe\Customer the updated customer + */ + public function deleteDiscount($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/discount'; + list($response, $opts) = $this->_request('delete', $url, $params, $opts); + $this->refreshFrom(['discount' => null], $opts, true); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * @param mixed $id + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection list of PaymentMethods + */ + public static function allPaymentMethods($id, $params = null, $opts = null) + { + $url = static::resourceUrl($id) . '/payment_methods'; + list($response, $opts) = static::_staticRequest('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + const PATH_BALANCE_TRANSACTIONS = '/balance_transactions'; + + /** + * @param string $id the ID of the customer on which to retrieve the customer balance transactions + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of customer balance transactions + */ + public static function allBalanceTransactions($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_BALANCE_TRANSACTIONS, $params, $opts); + } + + /** + * @param string $id the ID of the customer on which to create the customer balance transaction + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public static function createBalanceTransaction($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_BALANCE_TRANSACTIONS, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the customer balance transaction belongs + * @param string $balanceTransactionId the ID of the customer balance transaction to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public static function retrieveBalanceTransaction($id, $balanceTransactionId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_BALANCE_TRANSACTIONS, $balanceTransactionId, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the customer balance transaction belongs + * @param string $balanceTransactionId the ID of the customer balance transaction to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public static function updateBalanceTransaction($id, $balanceTransactionId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_BALANCE_TRANSACTIONS, $balanceTransactionId, $params, $opts); + } + const PATH_SOURCES = '/sources'; + + /** + * @param string $id the ID of the customer on which to retrieve the payment sources + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of payment sources (AlipayAccount, BankAccount, BitcoinReceiver, Card or Source) + */ + public static function allSources($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_SOURCES, $params, $opts); + } + + /** + * @param string $id the ID of the customer on which to create the payment source + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public static function createSource($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_SOURCES, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the payment source belongs + * @param string $sourceId the ID of the payment source to delete + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public static function deleteSource($id, $sourceId, $params = null, $opts = null) + { + return self::_deleteNestedResource($id, static::PATH_SOURCES, $sourceId, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the payment source belongs + * @param string $sourceId the ID of the payment source to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public static function retrieveSource($id, $sourceId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_SOURCES, $sourceId, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the payment source belongs + * @param string $sourceId the ID of the payment source to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public static function updateSource($id, $sourceId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_SOURCES, $sourceId, $params, $opts); + } + const PATH_TAX_IDS = '/tax_ids'; + + /** + * @param string $id the ID of the customer on which to retrieve the tax ids + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of tax ids + */ + public static function allTaxIds($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_TAX_IDS, $params, $opts); + } + + /** + * @param string $id the ID of the customer on which to create the tax id + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public static function createTaxId($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_TAX_IDS, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the tax id belongs + * @param string $taxIdId the ID of the tax id to delete + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public static function deleteTaxId($id, $taxIdId, $params = null, $opts = null) + { + return self::_deleteNestedResource($id, static::PATH_TAX_IDS, $taxIdId, $params, $opts); + } + + /** + * @param string $id the ID of the customer to which the tax id belongs + * @param string $taxIdId the ID of the tax id to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public static function retrieveTaxId($id, $taxIdId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_TAX_IDS, $taxIdId, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/CustomerBalanceTransaction.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/CustomerBalanceTransaction.php new file mode 100644 index 0000000..8c30676 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/CustomerBalanceTransaction.php @@ -0,0 +1,103 @@ +balance + * value, which denotes a debit or credit that's automatically applied to their + * next invoice upon finalization. You may modify the value directly by using the + * update customer API, + * or by creating a Customer Balance Transaction, which increments or decrements + * the customer's balance by the specified amount. + * + * Related guide: Customer Balance to + * learn more. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount The amount of the transaction. A negative value is a credit for the customer's balance, and a positive value is a debit to the customer's balance. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\CreditNote $credit_note The ID of the credit note (if any) related to the transaction. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string|\Stripe\Customer $customer The ID of the customer the transaction belongs to. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property int $ending_balance The customer's balance after the transaction was applied. A negative value decreases the amount due on the customer's next invoice. A positive value increases the amount due on the customer's next invoice. + * @property null|string|\Stripe\Invoice $invoice The ID of the invoice (if any) related to the transaction. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $type Transaction type: adjustment, applied_to_invoice, credit_note, initial, invoice_too_large, invoice_too_small, unspent_receiver_credit, or unapplied_from_invoice. See the Customer Balance page to learn more about transaction types. + */ +class CustomerBalanceTransaction extends ApiResource +{ + const OBJECT_NAME = 'customer_balance_transaction'; + + const TYPE_ADJUSTMENT = 'adjustment'; + const TYPE_APPLIED_TO_INVOICE = 'applied_to_invoice'; + const TYPE_CREDIT_NOTE = 'credit_note'; + const TYPE_INITIAL = 'initial'; + const TYPE_INVOICE_TOO_LARGE = 'invoice_too_large'; + const TYPE_INVOICE_TOO_SMALL = 'invoice_too_small'; + const TYPE_UNSPENT_RECEIVER_CREDIT = 'unspent_receiver_credit'; + + const TYPE_ADJUSTEMENT = 'adjustment'; + + /** + * @return string the API URL for this balance transaction + */ + public function instanceUrl() + { + $id = $this['id']; + $customer = $this['customer']; + if (!$id) { + throw new Exception\UnexpectedValueException( + "Could not determine which URL to request: class instance has invalid ID: {$id}", + null + ); + } + $id = Util\Util::utf8($id); + $customer = Util\Util::utf8($customer); + + $base = Customer::classUrl(); + $customerExtn = \urlencode($customer); + $extn = \urlencode($id); + + return "{$base}/{$customerExtn}/balance_transactions/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Customer Balance Transactions cannot be retrieved without a ' . + 'customer ID. Retrieve a Customer Balance Transaction using ' . + "`Customer::retrieveBalanceTransaction('customer_id', " . + "'balance_transaction_id')`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param string $_id + * @param null|array $_params + * @param null|array|string $_options + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function update($_id, $_params = null, $_options = null) + { + $msg = 'Customer Balance Transactions cannot be updated without a ' . + 'customer ID. Update a Customer Balance Transaction using ' . + "`Customer::updateBalanceTransaction('customer_id', " . + "'balance_transaction_id', \$updateParams)`."; + + throw new Exception\BadMethodCallException($msg); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Discount.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Discount.php new file mode 100644 index 0000000..f32e3c5 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Discount.php @@ -0,0 +1,23 @@ +Disputes and Fraud + * documentation. + * + * Related guide: Disputes and + * Fraud. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Disputed amount. Usually the amount of the charge, but can differ (usually because of currency fluctuation or because only part of the order is disputed). + * @property \Stripe\BalanceTransaction[] $balance_transactions List of zero, one, or two balance transactions that show funds withdrawn and reinstated to your Stripe account as a result of this dispute. + * @property string|\Stripe\Charge $charge ID of the charge that was disputed. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property \Stripe\StripeObject $evidence + * @property \Stripe\StripeObject $evidence_details + * @property bool $is_charge_refundable If true, it is still possible to refund the disputed payment. Once the payment has been fully refunded, no further funds will be withdrawn from your Stripe account as a result of this dispute. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $network_reason_code Network-dependent reason code for the dispute. + * @property null|string|\Stripe\PaymentIntent $payment_intent ID of the PaymentIntent that was disputed. + * @property string $reason Reason given by cardholder for dispute. Possible values are bank_cannot_process, check_returned, credit_not_processed, customer_initiated, debit_not_authorized, duplicate, fraudulent, general, incorrect_account_details, insufficient_funds, product_not_received, product_unacceptable, subscription_canceled, or unrecognized. Read more about dispute reasons. + * @property string $status Current status of dispute. Possible values are warning_needs_response, warning_under_review, warning_closed, needs_response, under_review, charge_refunded, won, or lost. + */ +class Dispute extends ApiResource +{ + const OBJECT_NAME = 'dispute'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const REASON_BANK_CANNOT_PROCESS = 'bank_cannot_process'; + const REASON_CHECK_RETURNED = 'check_returned'; + const REASON_CREDIT_NOT_PROCESSED = 'credit_not_processed'; + const REASON_CUSTOMER_INITIATED = 'customer_initiated'; + const REASON_DEBIT_NOT_AUTHORIZED = 'debit_not_authorized'; + const REASON_DUPLICATE = 'duplicate'; + const REASON_FRAUDULENT = 'fraudulent'; + const REASON_GENERAL = 'general'; + const REASON_INCORRECT_ACCOUNT_DETAILS = 'incorrect_account_details'; + const REASON_INSUFFICIENT_FUNDS = 'insufficient_funds'; + const REASON_PRODUCT_NOT_RECEIVED = 'product_not_received'; + const REASON_PRODUCT_UNACCEPTABLE = 'product_unacceptable'; + const REASON_SUBSCRIPTION_CANCELED = 'subscription_canceled'; + const REASON_UNRECOGNIZED = 'unrecognized'; + + const STATUS_CHARGE_REFUNDED = 'charge_refunded'; + const STATUS_LOST = 'lost'; + const STATUS_NEEDS_RESPONSE = 'needs_response'; + const STATUS_UNDER_REVIEW = 'under_review'; + const STATUS_WARNING_CLOSED = 'warning_closed'; + const STATUS_WARNING_NEEDS_RESPONSE = 'warning_needs_response'; + const STATUS_WARNING_UNDER_REVIEW = 'warning_under_review'; + const STATUS_WON = 'won'; + + /** + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Dispute the closed dispute + */ + // TODO: add $params to standardize signature + public function close($opts = null) + { + $url = $this->instanceUrl() . '/close'; + list($response, $opts) = $this->_request('post', $url, null, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/EphemeralKey.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/EphemeralKey.php new file mode 100644 index 0000000..253256c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/EphemeralKey.php @@ -0,0 +1,43 @@ +true if the object exists in live mode or the value false if the object exists in test mode. + * @property string $secret The key's secret. You can use this value to make authorized requests to the Stripe API. + * @property array $associated_objects + */ +class EphemeralKey extends ApiResource +{ + const OBJECT_NAME = 'ephemeral_key'; + + use ApiOperations\Create { + create as protected _create; + } + + use ApiOperations\Delete; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\InvalidArgumentException if stripe_version is missing + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\EphemeralKey the created key + */ + public static function create($params = null, $opts = null) + { + if (!$opts || !isset($opts['stripe_version'])) { + throw new Exception\InvalidArgumentException('stripe_version must be specified to create an ephemeral key'); + } + + return self::_create($params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ErrorObject.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ErrorObject.php new file mode 100644 index 0000000..ae83628 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ErrorObject.php @@ -0,0 +1,162 @@ + null, + 'code' => null, + 'decline_code' => null, + 'doc_url' => null, + 'message' => null, + 'param' => null, + 'payment_intent' => null, + 'payment_method' => null, + 'setup_intent' => null, + 'source' => null, + 'type' => null, + ], $values); + parent::refreshFrom($values, $opts, $partial); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Event.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Event.php new file mode 100644 index 0000000..ca394a1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Event.php @@ -0,0 +1,239 @@ +Event object. For example, when a charge succeeds, we create a + * charge.succeeded event; and when an invoice payment attempt fails, + * we create an invoice.payment_failed event. Note that many API + * requests may cause multiple events to be created. For example, if you create a + * new subscription for a customer, you will receive both a + * customer.subscription.created event and a + * charge.succeeded event. + * + * Events occur when the state of another API resource changes. The state of that + * resource at the time of the change is embedded in the event's data field. For + * example, a charge.succeeded event will contain a charge, and an + * invoice.payment_failed event will contain an invoice. + * + * As with other API resources, you can use endpoints to retrieve an individual event or a list of events from the API. + * We also have a separate webhooks system for sending the + * Event objects directly to an endpoint on your server. Webhooks are + * managed in your account + * settings, and our Using + * Webhooks guide will help you get set up. + * + * When using Connect, you can also + * receive notifications of events that occur in connected accounts. For these + * events, there will be an additional account attribute in the + * received Event object. + * + * NOTE: Right now, access to events through the Retrieve Event API is + * guaranteed only for 30 days. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $account The connected account that originated the event. + * @property null|string $api_version The Stripe API version used to render data. Note: This property is populated only for events on or after October 31, 2014. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property \Stripe\StripeObject $data + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property int $pending_webhooks Number of webhooks that have yet to be successfully delivered (i.e., to return a 20x response) to the URLs you've specified. + * @property null|\Stripe\StripeObject $request Information on the API request that instigated the event. + * @property string $type Description of the event (e.g., invoice.created or charge.refunded). + */ +class Event extends ApiResource +{ + const OBJECT_NAME = 'event'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + + /** + * Possible string representations of event types. + * + * @see https://stripe.com/docs/api#event_types + */ + const ACCOUNT_UPDATED = 'account.updated'; + const ACCOUNT_APPLICATION_AUTHORIZED = 'account.application.authorized'; + const ACCOUNT_APPLICATION_DEAUTHORIZED = 'account.application.deauthorized'; + const ACCOUNT_EXTERNAL_ACCOUNT_CREATED = 'account.external_account.created'; + const ACCOUNT_EXTERNAL_ACCOUNT_DELETED = 'account.external_account.deleted'; + const ACCOUNT_EXTERNAL_ACCOUNT_UPDATED = 'account.external_account.updated'; + const APPLICATION_FEE_CREATED = 'application_fee.created'; + const APPLICATION_FEE_REFUNDED = 'application_fee.refunded'; + const APPLICATION_FEE_REFUND_UPDATED = 'application_fee.refund.updated'; + const BALANCE_AVAILABLE = 'balance.available'; + const BILLING_PORTAL_CONFIGURATION_CREATED = 'billing_portal.configuration.created'; + const BILLING_PORTAL_CONFIGURATION_UPDATED = 'billing_portal.configuration.updated'; + const CAPABILITY_UPDATED = 'capability.updated'; + const CHARGE_CAPTURED = 'charge.captured'; + const CHARGE_EXPIRED = 'charge.expired'; + const CHARGE_FAILED = 'charge.failed'; + const CHARGE_PENDING = 'charge.pending'; + const CHARGE_REFUNDED = 'charge.refunded'; + const CHARGE_SUCCEEDED = 'charge.succeeded'; + const CHARGE_UPDATED = 'charge.updated'; + const CHARGE_DISPUTE_CLOSED = 'charge.dispute.closed'; + const CHARGE_DISPUTE_CREATED = 'charge.dispute.created'; + const CHARGE_DISPUTE_FUNDS_REINSTATED = 'charge.dispute.funds_reinstated'; + const CHARGE_DISPUTE_FUNDS_WITHDRAWN = 'charge.dispute.funds_withdrawn'; + const CHARGE_DISPUTE_UPDATED = 'charge.dispute.updated'; + const CHARGE_REFUND_UPDATED = 'charge.refund.updated'; + const CHECKOUT_SESSION_ASYNC_PAYMENT_FAILED = 'checkout.session.async_payment_failed'; + const CHECKOUT_SESSION_ASYNC_PAYMENT_SUCCEEDED = 'checkout.session.async_payment_succeeded'; + const CHECKOUT_SESSION_COMPLETED = 'checkout.session.completed'; + const COUPON_CREATED = 'coupon.created'; + const COUPON_DELETED = 'coupon.deleted'; + const COUPON_UPDATED = 'coupon.updated'; + const CREDIT_NOTE_CREATED = 'credit_note.created'; + const CREDIT_NOTE_UPDATED = 'credit_note.updated'; + const CREDIT_NOTE_VOIDED = 'credit_note.voided'; + const CUSTOMER_CREATED = 'customer.created'; + const CUSTOMER_DELETED = 'customer.deleted'; + const CUSTOMER_UPDATED = 'customer.updated'; + const CUSTOMER_DISCOUNT_CREATED = 'customer.discount.created'; + const CUSTOMER_DISCOUNT_DELETED = 'customer.discount.deleted'; + const CUSTOMER_DISCOUNT_UPDATED = 'customer.discount.updated'; + const CUSTOMER_SOURCE_CREATED = 'customer.source.created'; + const CUSTOMER_SOURCE_DELETED = 'customer.source.deleted'; + const CUSTOMER_SOURCE_EXPIRING = 'customer.source.expiring'; + const CUSTOMER_SOURCE_UPDATED = 'customer.source.updated'; + const CUSTOMER_SUBSCRIPTION_CREATED = 'customer.subscription.created'; + const CUSTOMER_SUBSCRIPTION_DELETED = 'customer.subscription.deleted'; + const CUSTOMER_SUBSCRIPTION_PENDING_UPDATE_APPLIED = 'customer.subscription.pending_update_applied'; + const CUSTOMER_SUBSCRIPTION_PENDING_UPDATE_EXPIRED = 'customer.subscription.pending_update_expired'; + const CUSTOMER_SUBSCRIPTION_TRIAL_WILL_END = 'customer.subscription.trial_will_end'; + const CUSTOMER_SUBSCRIPTION_UPDATED = 'customer.subscription.updated'; + const CUSTOMER_TAX_ID_CREATED = 'customer.tax_id.created'; + const CUSTOMER_TAX_ID_DELETED = 'customer.tax_id.deleted'; + const CUSTOMER_TAX_ID_UPDATED = 'customer.tax_id.updated'; + const FILE_CREATED = 'file.created'; + const IDENTITY_VERIFICATION_SESSION_CANCELED = 'identity.verification_session.canceled'; + const IDENTITY_VERIFICATION_SESSION_CREATED = 'identity.verification_session.created'; + const IDENTITY_VERIFICATION_SESSION_PROCESSING = 'identity.verification_session.processing'; + const IDENTITY_VERIFICATION_SESSION_REDACTED = 'identity.verification_session.redacted'; + const IDENTITY_VERIFICATION_SESSION_REQUIRES_INPUT = 'identity.verification_session.requires_input'; + const IDENTITY_VERIFICATION_SESSION_VERIFIED = 'identity.verification_session.verified'; + const INVOICE_CREATED = 'invoice.created'; + const INVOICE_DELETED = 'invoice.deleted'; + const INVOICE_FINALIZATION_FAILED = 'invoice.finalization_failed'; + const INVOICE_FINALIZED = 'invoice.finalized'; + const INVOICE_MARKED_UNCOLLECTIBLE = 'invoice.marked_uncollectible'; + const INVOICE_PAID = 'invoice.paid'; + const INVOICE_PAYMENT_ACTION_REQUIRED = 'invoice.payment_action_required'; + const INVOICE_PAYMENT_FAILED = 'invoice.payment_failed'; + const INVOICE_PAYMENT_SUCCEEDED = 'invoice.payment_succeeded'; + const INVOICE_SENT = 'invoice.sent'; + const INVOICE_UPCOMING = 'invoice.upcoming'; + const INVOICE_UPDATED = 'invoice.updated'; + const INVOICE_VOIDED = 'invoice.voided'; + const INVOICEITEM_CREATED = 'invoiceitem.created'; + const INVOICEITEM_DELETED = 'invoiceitem.deleted'; + const INVOICEITEM_UPDATED = 'invoiceitem.updated'; + const ISSUER_FRAUD_RECORD_CREATED = 'issuer_fraud_record.created'; + const ISSUING_AUTHORIZATION_CREATED = 'issuing_authorization.created'; + const ISSUING_AUTHORIZATION_REQUEST = 'issuing_authorization.request'; + const ISSUING_AUTHORIZATION_UPDATED = 'issuing_authorization.updated'; + const ISSUING_CARD_CREATED = 'issuing_card.created'; + const ISSUING_CARD_UPDATED = 'issuing_card.updated'; + const ISSUING_CARDHOLDER_CREATED = 'issuing_cardholder.created'; + const ISSUING_CARDHOLDER_UPDATED = 'issuing_cardholder.updated'; + const ISSUING_DISPUTE_CLOSED = 'issuing_dispute.closed'; + const ISSUING_DISPUTE_CREATED = 'issuing_dispute.created'; + const ISSUING_DISPUTE_FUNDS_REINSTATED = 'issuing_dispute.funds_reinstated'; + const ISSUING_DISPUTE_SUBMITTED = 'issuing_dispute.submitted'; + const ISSUING_DISPUTE_UPDATED = 'issuing_dispute.updated'; + const ISSUING_TRANSACTION_CREATED = 'issuing_transaction.created'; + const ISSUING_TRANSACTION_UPDATED = 'issuing_transaction.updated'; + const MANDATE_UPDATED = 'mandate.updated'; + const ORDER_CREATED = 'order.created'; + const ORDER_PAYMENT_FAILED = 'order.payment_failed'; + const ORDER_PAYMENT_SUCCEEDED = 'order.payment_succeeded'; + const ORDER_UPDATED = 'order.updated'; + const ORDER_RETURN_CREATED = 'order_return.created'; + const PAYMENT_INTENT_AMOUNT_CAPTURABLE_UPDATED = 'payment_intent.amount_capturable_updated'; + const PAYMENT_INTENT_CANCELED = 'payment_intent.canceled'; + const PAYMENT_INTENT_CREATED = 'payment_intent.created'; + const PAYMENT_INTENT_PAYMENT_FAILED = 'payment_intent.payment_failed'; + const PAYMENT_INTENT_PROCESSING = 'payment_intent.processing'; + const PAYMENT_INTENT_REQUIRES_ACTION = 'payment_intent.requires_action'; + const PAYMENT_INTENT_SUCCEEDED = 'payment_intent.succeeded'; + const PAYMENT_METHOD_ATTACHED = 'payment_method.attached'; + const PAYMENT_METHOD_AUTOMATICALLY_UPDATED = 'payment_method.automatically_updated'; + const PAYMENT_METHOD_CARD_AUTOMATICALLY_UPDATED = 'payment_method.card_automatically_updated'; + const PAYMENT_METHOD_DETACHED = 'payment_method.detached'; + const PAYMENT_METHOD_UPDATED = 'payment_method.updated'; + const PAYOUT_CANCELED = 'payout.canceled'; + const PAYOUT_CREATED = 'payout.created'; + const PAYOUT_FAILED = 'payout.failed'; + const PAYOUT_PAID = 'payout.paid'; + const PAYOUT_UPDATED = 'payout.updated'; + const PERSON_CREATED = 'person.created'; + const PERSON_DELETED = 'person.deleted'; + const PERSON_UPDATED = 'person.updated'; + const PING = 'ping'; + const PLAN_CREATED = 'plan.created'; + const PLAN_DELETED = 'plan.deleted'; + const PLAN_UPDATED = 'plan.updated'; + const PRICE_CREATED = 'price.created'; + const PRICE_DELETED = 'price.deleted'; + const PRICE_UPDATED = 'price.updated'; + const PRODUCT_CREATED = 'product.created'; + const PRODUCT_DELETED = 'product.deleted'; + const PRODUCT_UPDATED = 'product.updated'; + const PROMOTION_CODE_CREATED = 'promotion_code.created'; + const PROMOTION_CODE_DELETED = 'promotion_code.deleted'; + const PROMOTION_CODE_UPDATED = 'promotion_code.updated'; + const RADAR_EARLY_FRAUD_WARNING_CREATED = 'radar.early_fraud_warning.created'; + const RADAR_EARLY_FRAUD_WARNING_UPDATED = 'radar.early_fraud_warning.updated'; + const RECIPIENT_CREATED = 'recipient.created'; + const RECIPIENT_DELETED = 'recipient.deleted'; + const RECIPIENT_UPDATED = 'recipient.updated'; + const REPORTING_REPORT_RUN_FAILED = 'reporting.report_run.failed'; + const REPORTING_REPORT_RUN_SUCCEEDED = 'reporting.report_run.succeeded'; + const REPORTING_REPORT_TYPE_UPDATED = 'reporting.report_type.updated'; + const REVIEW_CLOSED = 'review.closed'; + const REVIEW_OPENED = 'review.opened'; + const SETUP_INTENT_CANCELED = 'setup_intent.canceled'; + const SETUP_INTENT_CREATED = 'setup_intent.created'; + const SETUP_INTENT_REQUIRES_ACTION = 'setup_intent.requires_action'; + const SETUP_INTENT_SETUP_FAILED = 'setup_intent.setup_failed'; + const SETUP_INTENT_SUCCEEDED = 'setup_intent.succeeded'; + const SIGMA_SCHEDULED_QUERY_RUN_CREATED = 'sigma.scheduled_query_run.created'; + const SKU_CREATED = 'sku.created'; + const SKU_DELETED = 'sku.deleted'; + const SKU_UPDATED = 'sku.updated'; + const SOURCE_CANCELED = 'source.canceled'; + const SOURCE_CHARGEABLE = 'source.chargeable'; + const SOURCE_FAILED = 'source.failed'; + const SOURCE_MANDATE_NOTIFICATION = 'source.mandate_notification'; + const SOURCE_REFUND_ATTRIBUTES_REQUIRED = 'source.refund_attributes_required'; + const SOURCE_TRANSACTION_CREATED = 'source.transaction.created'; + const SOURCE_TRANSACTION_UPDATED = 'source.transaction.updated'; + const SUBSCRIPTION_SCHEDULE_ABORTED = 'subscription_schedule.aborted'; + const SUBSCRIPTION_SCHEDULE_CANCELED = 'subscription_schedule.canceled'; + const SUBSCRIPTION_SCHEDULE_COMPLETED = 'subscription_schedule.completed'; + const SUBSCRIPTION_SCHEDULE_CREATED = 'subscription_schedule.created'; + const SUBSCRIPTION_SCHEDULE_EXPIRING = 'subscription_schedule.expiring'; + const SUBSCRIPTION_SCHEDULE_RELEASED = 'subscription_schedule.released'; + const SUBSCRIPTION_SCHEDULE_UPDATED = 'subscription_schedule.updated'; + const TAX_RATE_CREATED = 'tax_rate.created'; + const TAX_RATE_UPDATED = 'tax_rate.updated'; + const TOPUP_CANCELED = 'topup.canceled'; + const TOPUP_CREATED = 'topup.created'; + const TOPUP_FAILED = 'topup.failed'; + const TOPUP_REVERSED = 'topup.reversed'; + const TOPUP_SUCCEEDED = 'topup.succeeded'; + const TRANSFER_CREATED = 'transfer.created'; + const TRANSFER_REVERSED = 'transfer.reversed'; + const TRANSFER_UPDATED = 'transfer.updated'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ApiConnectionException.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ApiConnectionException.php new file mode 100644 index 0000000..33f2ede --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ApiConnectionException.php @@ -0,0 +1,12 @@ +setHttpStatus($httpStatus); + $instance->setHttpBody($httpBody); + $instance->setJsonBody($jsonBody); + $instance->setHttpHeaders($httpHeaders); + $instance->setStripeCode($stripeCode); + + $instance->setRequestId(null); + if ($httpHeaders && isset($httpHeaders['Request-Id'])) { + $instance->setRequestId($httpHeaders['Request-Id']); + } + + $instance->setError($instance->constructErrorObject()); + + return $instance; + } + + /** + * Gets the Stripe error object. + * + * @return null|\Stripe\ErrorObject + */ + public function getError() + { + return $this->error; + } + + /** + * Sets the Stripe error object. + * + * @param null|\Stripe\ErrorObject $error + */ + public function setError($error) + { + $this->error = $error; + } + + /** + * Gets the HTTP body as a string. + * + * @return null|string + */ + public function getHttpBody() + { + return $this->httpBody; + } + + /** + * Sets the HTTP body as a string. + * + * @param null|string $httpBody + */ + public function setHttpBody($httpBody) + { + $this->httpBody = $httpBody; + } + + /** + * Gets the HTTP headers array. + * + * @return null|array|\Stripe\Util\CaseInsensitiveArray + */ + public function getHttpHeaders() + { + return $this->httpHeaders; + } + + /** + * Sets the HTTP headers array. + * + * @param null|array|\Stripe\Util\CaseInsensitiveArray $httpHeaders + */ + public function setHttpHeaders($httpHeaders) + { + $this->httpHeaders = $httpHeaders; + } + + /** + * Gets the HTTP status code. + * + * @return null|int + */ + public function getHttpStatus() + { + return $this->httpStatus; + } + + /** + * Sets the HTTP status code. + * + * @param null|int $httpStatus + */ + public function setHttpStatus($httpStatus) + { + $this->httpStatus = $httpStatus; + } + + /** + * Gets the JSON deserialized body. + * + * @return null|array + */ + public function getJsonBody() + { + return $this->jsonBody; + } + + /** + * Sets the JSON deserialized body. + * + * @param null|array $jsonBody + */ + public function setJsonBody($jsonBody) + { + $this->jsonBody = $jsonBody; + } + + /** + * Gets the Stripe request ID. + * + * @return null|string + */ + public function getRequestId() + { + return $this->requestId; + } + + /** + * Sets the Stripe request ID. + * + * @param null|string $requestId + */ + public function setRequestId($requestId) + { + $this->requestId = $requestId; + } + + /** + * Gets the Stripe error code. + * + * Cf. the `CODE_*` constants on {@see \Stripe\ErrorObject} for possible + * values. + * + * @return null|string + */ + public function getStripeCode() + { + return $this->stripeCode; + } + + /** + * Sets the Stripe error code. + * + * @param null|string $stripeCode + */ + public function setStripeCode($stripeCode) + { + $this->stripeCode = $stripeCode; + } + + /** + * Returns the string representation of the exception. + * + * @return string + */ + public function __toString() + { + $statusStr = (null === $this->getHttpStatus()) ? '' : "(Status {$this->getHttpStatus()}) "; + $idStr = (null === $this->getRequestId()) ? '' : "(Request {$this->getRequestId()}) "; + + return "{$statusStr}{$idStr}{$this->getMessage()}"; + } + + protected function constructErrorObject() + { + if (null === $this->jsonBody || !\array_key_exists('error', $this->jsonBody)) { + return null; + } + + return \Stripe\ErrorObject::constructFrom($this->jsonBody['error']); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/AuthenticationException.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/AuthenticationException.php new file mode 100644 index 0000000..9e5c718 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/AuthenticationException.php @@ -0,0 +1,11 @@ +setDeclineCode($declineCode); + $instance->setStripeParam($stripeParam); + + return $instance; + } + + /** + * Gets the decline code. + * + * @return null|string + */ + public function getDeclineCode() + { + return $this->declineCode; + } + + /** + * Sets the decline code. + * + * @param null|string $declineCode + */ + public function setDeclineCode($declineCode) + { + $this->declineCode = $declineCode; + } + + /** + * Gets the parameter related to the error. + * + * @return null|string + */ + public function getStripeParam() + { + return $this->stripeParam; + } + + /** + * Sets the parameter related to the error. + * + * @param null|string $stripeParam + */ + public function setStripeParam($stripeParam) + { + $this->stripeParam = $stripeParam; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ExceptionInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ExceptionInterface.php new file mode 100644 index 0000000..c84f37d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/ExceptionInterface.php @@ -0,0 +1,22 @@ +setStripeParam($stripeParam); + + return $instance; + } + + /** + * Gets the parameter related to the error. + * + * @return null|string + */ + public function getStripeParam() + { + return $this->stripeParam; + } + + /** + * Sets the parameter related to the error. + * + * @param null|string $stripeParam + */ + public function setStripeParam($stripeParam) + { + $this->stripeParam = $stripeParam; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/ExceptionInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/ExceptionInterface.php new file mode 100644 index 0000000..dd42662 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/ExceptionInterface.php @@ -0,0 +1,10 @@ +jsonBody) { + return null; + } + + return \Stripe\OAuthErrorObject::constructFrom($this->jsonBody); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/UnknownOAuthErrorException.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/UnknownOAuthErrorException.php new file mode 100644 index 0000000..c8dba29 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/OAuth/UnknownOAuthErrorException.php @@ -0,0 +1,12 @@ +setHttpBody($httpBody); + $instance->setSigHeader($sigHeader); + + return $instance; + } + + /** + * Gets the HTTP body as a string. + * + * @return null|string + */ + public function getHttpBody() + { + return $this->httpBody; + } + + /** + * Sets the HTTP body as a string. + * + * @param null|string $httpBody + */ + public function setHttpBody($httpBody) + { + $this->httpBody = $httpBody; + } + + /** + * Gets the `Stripe-Signature` HTTP header. + * + * @return null|string + */ + public function getSigHeader() + { + return $this->sigHeader; + } + + /** + * Sets the `Stripe-Signature` HTTP header. + * + * @param null|string $sigHeader + */ + public function setSigHeader($sigHeader) + { + $this->sigHeader = $sigHeader; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/UnexpectedValueException.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/UnexpectedValueException.php new file mode 100644 index 0000000..0a629ed --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Exception/UnexpectedValueException.php @@ -0,0 +1,7 @@ +Exchange Rate objects allow you to determine the rates that Stripe + * is currently using to convert from one currency to another. Since this number is + * variable throughout the day, there are various reasons why you might want to + * know the current rate (for example, to dynamically price an item for a user with + * a default payment in a foreign currency). + * + * If you want a guarantee that the charge is made with a certain exchange rate you + * expect is current, you can pass in exchange_rate to charges + * endpoints. If the value is no longer up to date, the charge won't go through. + * Please refer to our Exchange + * Rates API guide for more details. + * + * @property string $id Unique identifier for the object. Represented as the three-letter ISO currency code in lowercase. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject $rates Hash where the keys are supported currencies and the values are the exchange rate at which the base id currency converts to the key currency. + */ +class ExchangeRate extends ApiResource +{ + const OBJECT_NAME = 'exchange_rate'; + + use ApiOperations\All; + use ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/File.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/File.php new file mode 100644 index 0000000..9f60564 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/File.php @@ -0,0 +1,87 @@ +create file request (for + * example, when uploading dispute evidence) or it may have been created by Stripe + * (for example, the results of a Sigma scheduled + * query). + * + * Related guide: File Upload + * Guide. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|int $expires_at The time at which the file expires and is no longer available in epoch seconds. + * @property null|string $filename A filename for the file, suitable for saving to a filesystem. + * @property null|\Stripe\Collection $links A list of file links that point at this file. + * @property string $purpose The purpose of the uploaded file. + * @property int $size The size in bytes of the file object. + * @property null|string $title A user friendly title for the document. + * @property null|string $type The type of the file returned (e.g., csv, pdf, jpg, or png). + * @property null|string $url The URL from which the file can be downloaded using your live secret API key. + */ +class File extends ApiResource +{ + const OBJECT_NAME = 'file'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + + const PURPOSE_ACCOUNT_REQUIREMENT = 'account_requirement'; + const PURPOSE_ADDITIONAL_VERIFICATION = 'additional_verification'; + const PURPOSE_BUSINESS_ICON = 'business_icon'; + const PURPOSE_BUSINESS_LOGO = 'business_logo'; + const PURPOSE_CUSTOMER_SIGNATURE = 'customer_signature'; + const PURPOSE_DISPUTE_EVIDENCE = 'dispute_evidence'; + const PURPOSE_DOCUMENT_PROVIDER_IDENTITY_DOCUMENT = 'document_provider_identity_document'; + const PURPOSE_FINANCE_REPORT_RUN = 'finance_report_run'; + const PURPOSE_IDENTITY_DOCUMENT = 'identity_document'; + const PURPOSE_IDENTITY_DOCUMENT_DOWNLOADABLE = 'identity_document_downloadable'; + const PURPOSE_PCI_DOCUMENT = 'pci_document'; + const PURPOSE_SELFIE = 'selfie'; + const PURPOSE_SIGMA_SCHEDULED_QUERY = 'sigma_scheduled_query'; + const PURPOSE_TAX_DOCUMENT_USER_UPLOAD = 'tax_document_user_upload'; + + // This resource can have two different object names. In latter API + // versions, only `file` is used, but since stripe-php may be used with + // any API version, we need to support deserializing the older + // `file_upload` object into the same class. + const OBJECT_NAME_ALT = 'file_upload'; + + use ApiOperations\Create { + create as protected _create; + } + + public static function classUrl() + { + return '/v1/files'; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\File the created file + */ + public static function create($params = null, $opts = null) + { + $opts = \Stripe\Util\RequestOptions::parse($opts); + if (null === $opts->apiBase) { + $opts->apiBase = Stripe::$apiUploadBase; + } + // Manually flatten params, otherwise curl's multipart encoder will + // choke on nested arrays. + $flatParams = \array_column(\Stripe\Util\Util::flattenParams($params), 1, 0); + + return static::_create($flatParams, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/FileLink.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/FileLink.php new file mode 100644 index 0000000..ce3b10b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/FileLink.php @@ -0,0 +1,30 @@ +File object with non-Stripe users, you + * can create a FileLink. FileLinks contain a URL that + * can be used to retrieve the contents of the file without authentication. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property bool $expired Whether this link is already expired. + * @property null|int $expires_at Time at which the link expires. + * @property string|\Stripe\File $file The file object this link points to. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $url The publicly accessible URL to download the file. + */ +class FileLink extends ApiResource +{ + const OBJECT_NAME = 'file_link'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/ClientInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/ClientInterface.php new file mode 100644 index 0000000..3c7861e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/ClientInterface.php @@ -0,0 +1,22 @@ +defaultOptions = $defaultOptions; + $this->randomGenerator = $randomGenerator ?: new Util\RandomGenerator(); + $this->initUserAgentInfo(); + + $this->enableHttp2 = $this->canSafelyUseHttp2(); + } + + public function __destruct() + { + $this->closeCurlHandle(); + } + + public function initUserAgentInfo() + { + $curlVersion = \curl_version(); + $this->userAgentInfo = [ + 'httplib' => 'curl ' . $curlVersion['version'], + 'ssllib' => $curlVersion['ssl_version'], + ]; + } + + public function getDefaultOptions() + { + return $this->defaultOptions; + } + + public function getUserAgentInfo() + { + return $this->userAgentInfo; + } + + /** + * @return bool + */ + public function getEnablePersistentConnections() + { + return $this->enablePersistentConnections; + } + + /** + * @param bool $enable + */ + public function setEnablePersistentConnections($enable) + { + $this->enablePersistentConnections = $enable; + } + + /** + * @return bool + */ + public function getEnableHttp2() + { + return $this->enableHttp2; + } + + /** + * @param bool $enable + */ + public function setEnableHttp2($enable) + { + $this->enableHttp2 = $enable; + } + + /** + * @return null|callable + */ + public function getRequestStatusCallback() + { + return $this->requestStatusCallback; + } + + /** + * Sets a callback that is called after each request. The callback will + * receive the following parameters: + *
    + *
  1. string $rbody The response body
  2. + *
  3. integer $rcode The response status code
  4. + *
  5. \Stripe\Util\CaseInsensitiveArray $rheaders The response headers
  6. + *
  7. integer $errno The curl error number
  8. + *
  9. string|null $message The curl error message
  10. + *
  11. boolean $shouldRetry Whether the request will be retried
  12. + *
  13. integer $numRetries The number of the retry attempt
  14. + *
. + * + * @param null|callable $requestStatusCallback + */ + public function setRequestStatusCallback($requestStatusCallback) + { + $this->requestStatusCallback = $requestStatusCallback; + } + + // USER DEFINED TIMEOUTS + + const DEFAULT_TIMEOUT = 80; + const DEFAULT_CONNECT_TIMEOUT = 30; + + private $timeout = self::DEFAULT_TIMEOUT; + private $connectTimeout = self::DEFAULT_CONNECT_TIMEOUT; + + public function setTimeout($seconds) + { + $this->timeout = (int) \max($seconds, 0); + + return $this; + } + + public function setConnectTimeout($seconds) + { + $this->connectTimeout = (int) \max($seconds, 0); + + return $this; + } + + public function getTimeout() + { + return $this->timeout; + } + + public function getConnectTimeout() + { + return $this->connectTimeout; + } + + // END OF USER DEFINED TIMEOUTS + + private function constructRequest($method, $absUrl, $headers, $params, $hasFile) + { + $method = \strtolower($method); + + $opts = []; + if (\is_callable($this->defaultOptions)) { // call defaultOptions callback, set options to return value + $opts = \call_user_func_array($this->defaultOptions, \func_get_args()); + if (!\is_array($opts)) { + throw new Exception\UnexpectedValueException('Non-array value returned by defaultOptions CurlClient callback'); + } + } elseif (\is_array($this->defaultOptions)) { // set default curlopts from array + $opts = $this->defaultOptions; + } + + $params = Util\Util::objectsToIds($params); + + if ('get' === $method) { + if ($hasFile) { + throw new Exception\UnexpectedValueException( + 'Issuing a GET request with a file parameter' + ); + } + $opts[\CURLOPT_HTTPGET] = 1; + if (\count($params) > 0) { + $encoded = Util\Util::encodeParameters($params); + $absUrl = "{$absUrl}?{$encoded}"; + } + } elseif ('post' === $method) { + $opts[\CURLOPT_POST] = 1; + $opts[\CURLOPT_POSTFIELDS] = $hasFile ? $params : Util\Util::encodeParameters($params); + } elseif ('delete' === $method) { + $opts[\CURLOPT_CUSTOMREQUEST] = 'DELETE'; + if (\count($params) > 0) { + $encoded = Util\Util::encodeParameters($params); + $absUrl = "{$absUrl}?{$encoded}"; + } + } else { + throw new Exception\UnexpectedValueException("Unrecognized method {$method}"); + } + + // It is only safe to retry network failures on POST requests if we + // add an Idempotency-Key header + if (('post' === $method) && (Stripe::$maxNetworkRetries > 0)) { + if (!$this->hasHeader($headers, 'Idempotency-Key')) { + $headers[] = 'Idempotency-Key: ' . $this->randomGenerator->uuid(); + } + } + + // By default for large request body sizes (> 1024 bytes), cURL will + // send a request without a body and with a `Expect: 100-continue` + // header, which gives the server a chance to respond with an error + // status code in cases where one can be determined right away (say + // on an authentication problem for example), and saves the "large" + // request body from being ever sent. + // + // Unfortunately, the bindings don't currently correctly handle the + // success case (in which the server sends back a 100 CONTINUE), so + // we'll error under that condition. To compensate for that problem + // for the time being, override cURL's behavior by simply always + // sending an empty `Expect:` header. + $headers[] = 'Expect: '; + + $absUrl = Util\Util::utf8($absUrl); + $opts[\CURLOPT_URL] = $absUrl; + $opts[\CURLOPT_RETURNTRANSFER] = true; + $opts[\CURLOPT_CONNECTTIMEOUT] = $this->connectTimeout; + $opts[\CURLOPT_TIMEOUT] = $this->timeout; + $opts[\CURLOPT_HTTPHEADER] = $headers; + $opts[\CURLOPT_CAINFO] = Stripe::getCABundlePath(); + if (!Stripe::getVerifySslCerts()) { + $opts[\CURLOPT_SSL_VERIFYPEER] = false; + } + + if (!isset($opts[\CURLOPT_HTTP_VERSION]) && $this->getEnableHttp2()) { + // For HTTPS requests, enable HTTP/2, if supported + $opts[\CURLOPT_HTTP_VERSION] = \CURL_HTTP_VERSION_2TLS; + } + + // Stripe's API servers are only accessible over IPv4. Force IPv4 resolving to avoid + // potential issues (cf. https://github.com/stripe/stripe-php/issues/1045). + $opts[\CURLOPT_IPRESOLVE] = \CURL_IPRESOLVE_V4; + + return [$opts, $absUrl]; + } + + public function request($method, $absUrl, $headers, $params, $hasFile) + { + list($opts, $absUrl) = $this->constructRequest($method, $absUrl, $headers, $params, $hasFile); + + list($rbody, $rcode, $rheaders) = $this->executeRequestWithRetries($opts, $absUrl); + + return [$rbody, $rcode, $rheaders]; + } + + public function requestStream($method, $absUrl, $headers, $params, $hasFile, $readBodyChunk) + { + list($opts, $absUrl) = $this->constructRequest($method, $absUrl, $headers, $params, $hasFile); + + $opts[\CURLOPT_RETURNTRANSFER] = false; + list($rbody, $rcode, $rheaders) = $this->executeStreamingRequestWithRetries($opts, $absUrl, $readBodyChunk); + + return [$rbody, $rcode, $rheaders]; + } + + /** + * Curl permits sending \CURLOPT_HEADERFUNCTION, which is called with lines + * from the header and \CURLOPT_WRITEFUNCTION, which is called with bytes + * from the body. You usually want to handle the body differently depending + * on what was in the header. + * + * This function makes it easier to specify different callbacks depending + * on the contents of the heeder. After the header has been completely read + * and the body begins to stream, it will call $determineWriteCallback with + * the array of headers. $determineWriteCallback should, based on the + * headers it receives, return a "writeCallback" that describes what to do + * with the incoming HTTP response body. + * + * @param array $opts + * @param callable $determineWriteCallback + * + * @return array + */ + private function useHeadersToDetermineWriteCallback($opts, $determineWriteCallback) + { + $rheaders = new Util\CaseInsensitiveArray(); + $headerCallback = function ($curl, $header_line) use (&$rheaders) { + return self::parseLineIntoHeaderArray($header_line, $rheaders); + }; + + $writeCallback = null; + $writeCallbackWrapper = function ($curl, $data) use (&$writeCallback, &$rheaders, &$determineWriteCallback) { + if (null === $writeCallback) { + $writeCallback = \call_user_func_array($determineWriteCallback, [$rheaders]); + } + + return \call_user_func_array($writeCallback, [$curl, $data]); + }; + + return [$headerCallback, $writeCallbackWrapper]; + } + + private static function parseLineIntoHeaderArray($line, &$headers) + { + if (false === \strpos($line, ':')) { + return \strlen($line); + } + list($key, $value) = \explode(':', \trim($line), 2); + $headers[\trim($key)] = \trim($value); + + return \strlen($line); + } + + /** + * Like `executeRequestWithRetries` except: + * 1. Does not buffer the body of a successful (status code < 300) + * response into memory -- instead, calls the caller-provided + * $readBodyChunk with each chunk of incoming data. + * 2. Does not retry if a network error occurs while streaming the + * body of a successful response. + * + * @param array $opts cURL options + * @param string $absUrl + * @param callable $readBodyChunk + * + * @return array + */ + public function executeStreamingRequestWithRetries($opts, $absUrl, $readBodyChunk) + { + /** @var bool */ + $shouldRetry = false; + /** @var int */ + $numRetries = 0; + + // Will contain the bytes of the body of the last request + // if it was not successful and should not be retries + /** @var null|string */ + $rbody = null; + + // Status code of the last request + /** @var null|bool */ + $rcode = null; + + // Array of headers from the last request + /** @var null|array */ + $lastRHeaders = null; + + $errno = null; + $message = null; + + $determineWriteCallback = function ($rheaders) use ( + &$readBodyChunk, + &$shouldRetry, + &$rbody, + &$numRetries, + &$rcode, + &$lastRHeaders, + &$errno + ) { + $lastRHeaders = $rheaders; + $errno = \curl_errno($this->curlHandle); + + $rcode = \curl_getinfo($this->curlHandle, \CURLINFO_HTTP_CODE); + + // Send the bytes from the body of a successful request to the caller-provided $readBodyChunk. + if ($rcode < 300) { + $rbody = null; + + return function ($curl, $data) use (&$readBodyChunk) { + // Don't expose the $curl handle to the user, and don't require them to + // return the length of $data. + \call_user_func_array($readBodyChunk, [$data]); + + return \strlen($data); + }; + } + + $shouldRetry = $this->shouldRetry($errno, $rcode, $rheaders, $numRetries); + + // Discard the body from an unsuccessful request that should be retried. + if ($shouldRetry) { + return function ($curl, $data) { + return \strlen($data); + }; + } else { + // Otherwise, buffer the body into $rbody. It will need to be parsed to determine + // which exception to throw to the user. + $rbody = ''; + + return function ($curl, $data) use (&$rbody) { + $rbody .= $data; + + return \strlen($data); + }; + } + }; + + while (true) { + list($headerCallback, $writeCallback) = $this->useHeadersToDetermineWriteCallback($opts, $determineWriteCallback); + $opts[\CURLOPT_HEADERFUNCTION] = $headerCallback; + $opts[\CURLOPT_WRITEFUNCTION] = $writeCallback; + + $shouldRetry = false; + $rbody = null; + $this->resetCurlHandle(); + \curl_setopt_array($this->curlHandle, $opts); + $result = \curl_exec($this->curlHandle); + $errno = \curl_errno($this->curlHandle); + if (0 !== $errno) { + $message = \curl_error($this->curlHandle); + } + if (!$this->getEnablePersistentConnections()) { + $this->closeCurlHandle(); + } + + if (\is_callable($this->getRequestStatusCallback())) { + \call_user_func_array( + $this->getRequestStatusCallback(), + [$rbody, $rcode, $lastRHeaders, $errno, $message, $shouldRetry, $numRetries] + ); + } + + if ($shouldRetry) { + ++$numRetries; + $sleepSeconds = $this->sleepTime($numRetries, $lastRHeaders); + \usleep((int) ($sleepSeconds * 1000000)); + } else { + break; + } + } + + if (0 !== $errno) { + $this->handleCurlError($absUrl, $errno, $message, $numRetries); + } + + return [$rbody, $rcode, $lastRHeaders]; + } + + /** + * @param array $opts cURL options + * @param string $absUrl + */ + public function executeRequestWithRetries($opts, $absUrl) + { + $numRetries = 0; + + while (true) { + $rcode = 0; + $errno = 0; + $message = null; + + // Create a callback to capture HTTP headers for the response + $rheaders = new Util\CaseInsensitiveArray(); + $headerCallback = function ($curl, $header_line) use (&$rheaders) { + return CurlClient::parseLineIntoHeaderArray($header_line, $rheaders); + }; + $opts[\CURLOPT_HEADERFUNCTION] = $headerCallback; + + $this->resetCurlHandle(); + \curl_setopt_array($this->curlHandle, $opts); + $rbody = \curl_exec($this->curlHandle); + + if (false === $rbody) { + $errno = \curl_errno($this->curlHandle); + $message = \curl_error($this->curlHandle); + } else { + $rcode = \curl_getinfo($this->curlHandle, \CURLINFO_HTTP_CODE); + } + if (!$this->getEnablePersistentConnections()) { + $this->closeCurlHandle(); + } + + $shouldRetry = $this->shouldRetry($errno, $rcode, $rheaders, $numRetries); + + if (\is_callable($this->getRequestStatusCallback())) { + \call_user_func_array( + $this->getRequestStatusCallback(), + [$rbody, $rcode, $rheaders, $errno, $message, $shouldRetry, $numRetries] + ); + } + + if ($shouldRetry) { + ++$numRetries; + $sleepSeconds = $this->sleepTime($numRetries, $rheaders); + \usleep((int) ($sleepSeconds * 1000000)); + } else { + break; + } + } + + if (false === $rbody) { + $this->handleCurlError($absUrl, $errno, $message, $numRetries); + } + + return [$rbody, $rcode, $rheaders]; + } + + /** + * @param string $url + * @param int $errno + * @param string $message + * @param int $numRetries + * + * @throws Exception\ApiConnectionException + */ + private function handleCurlError($url, $errno, $message, $numRetries) + { + switch ($errno) { + case \CURLE_COULDNT_CONNECT: + case \CURLE_COULDNT_RESOLVE_HOST: + case \CURLE_OPERATION_TIMEOUTED: + $msg = "Could not connect to Stripe ({$url}). Please check your " + . 'internet connection and try again. If this problem persists, ' + . "you should check Stripe's service status at " + . 'https://twitter.com/stripestatus, or'; + + break; + + case \CURLE_SSL_CACERT: + case \CURLE_SSL_PEER_CERTIFICATE: + $msg = "Could not verify Stripe's SSL certificate. Please make sure " + . 'that your network is not intercepting certificates. ' + . "(Try going to {$url} in your browser.) " + . 'If this problem persists,'; + + break; + + default: + $msg = 'Unexpected error communicating with Stripe. ' + . 'If this problem persists,'; + } + $msg .= ' let us know at support@stripe.com.'; + + $msg .= "\n\n(Network error [errno {$errno}]: {$message})"; + + if ($numRetries > 0) { + $msg .= "\n\nRequest was retried {$numRetries} times."; + } + + throw new Exception\ApiConnectionException($msg); + } + + /** + * Checks if an error is a problem that we should retry on. This includes both + * socket errors that may represent an intermittent problem and some special + * HTTP statuses. + * + * @param int $errno + * @param int $rcode + * @param array|\Stripe\Util\CaseInsensitiveArray $rheaders + * @param int $numRetries + * + * @return bool + */ + private function shouldRetry($errno, $rcode, $rheaders, $numRetries) + { + if ($numRetries >= Stripe::getMaxNetworkRetries()) { + return false; + } + + // Retry on timeout-related problems (either on open or read). + if (\CURLE_OPERATION_TIMEOUTED === $errno) { + return true; + } + + // Destination refused the connection, the connection was reset, or a + // variety of other connection failures. This could occur from a single + // saturated server, so retry in case it's intermittent. + if (\CURLE_COULDNT_CONNECT === $errno) { + return true; + } + + // The API may ask us not to retry (eg; if doing so would be a no-op) + // or advise us to retry (eg; in cases of lock timeouts); we defer to that. + if (isset($rheaders['stripe-should-retry'])) { + if ('false' === $rheaders['stripe-should-retry']) { + return false; + } + if ('true' === $rheaders['stripe-should-retry']) { + return true; + } + } + + // 409 Conflict + if (409 === $rcode) { + return true; + } + + // Retry on 500, 503, and other internal errors. + // + // Note that we expect the stripe-should-retry header to be false + // in most cases when a 500 is returned, since our idempotency framework + // would typically replay it anyway. + if ($rcode >= 500) { + return true; + } + + return false; + } + + /** + * Provides the number of seconds to wait before retrying a request. + * + * @param int $numRetries + * @param array|\Stripe\Util\CaseInsensitiveArray $rheaders + * + * @return int + */ + private function sleepTime($numRetries, $rheaders) + { + // Apply exponential backoff with $initialNetworkRetryDelay on the + // number of $numRetries so far as inputs. Do not allow the number to exceed + // $maxNetworkRetryDelay. + $sleepSeconds = \min( + Stripe::getInitialNetworkRetryDelay() * 1.0 * 2 ** ($numRetries - 1), + Stripe::getMaxNetworkRetryDelay() + ); + + // Apply some jitter by randomizing the value in the range of + // ($sleepSeconds / 2) to ($sleepSeconds). + $sleepSeconds *= 0.5 * (1 + $this->randomGenerator->randFloat()); + + // But never sleep less than the base sleep seconds. + $sleepSeconds = \max(Stripe::getInitialNetworkRetryDelay(), $sleepSeconds); + + // And never sleep less than the time the API asks us to wait, assuming it's a reasonable ask. + $retryAfter = isset($rheaders['retry-after']) ? (float) ($rheaders['retry-after']) : 0.0; + if (\floor($retryAfter) === $retryAfter && $retryAfter <= Stripe::getMaxRetryAfter()) { + $sleepSeconds = \max($sleepSeconds, $retryAfter); + } + + return $sleepSeconds; + } + + /** + * Initializes the curl handle. If already initialized, the handle is closed first. + */ + private function initCurlHandle() + { + $this->closeCurlHandle(); + $this->curlHandle = \curl_init(); + } + + /** + * Closes the curl handle if initialized. Do nothing if already closed. + */ + private function closeCurlHandle() + { + if (null !== $this->curlHandle) { + \curl_close($this->curlHandle); + $this->curlHandle = null; + } + } + + /** + * Resets the curl handle. If the handle is not already initialized, or if persistent + * connections are disabled, the handle is reinitialized instead. + */ + private function resetCurlHandle() + { + if (null !== $this->curlHandle && $this->getEnablePersistentConnections()) { + \curl_reset($this->curlHandle); + } else { + $this->initCurlHandle(); + } + } + + /** + * Indicates whether it is safe to use HTTP/2 or not. + * + * @return bool + */ + private function canSafelyUseHttp2() + { + // Versions of curl older than 7.60.0 don't respect GOAWAY frames + // (cf. https://github.com/curl/curl/issues/2416), which Stripe use. + $curlVersion = \curl_version()['version']; + + return \version_compare($curlVersion, '7.60.0') >= 0; + } + + /** + * Checks if a list of headers contains a specific header name. + * + * @param string[] $headers + * @param string $name + * + * @return bool + */ + private function hasHeader($headers, $name) + { + foreach ($headers as $header) { + if (0 === \strncasecmp($header, "{$name}: ", \strlen($name) + 2)) { + return true; + } + } + + return false; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/StreamingClientInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/StreamingClientInterface.php new file mode 100644 index 0000000..482f9a1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/HttpClient/StreamingClientInterface.php @@ -0,0 +1,23 @@ +type and options parameters used. You can find the + * result of each verification check performed in the appropriate sub-resource: + * document, id_number, selfie. + * + * Each VerificationReport contains a copy of any data collected by the user as + * well as reference IDs which can be used to access collected images through the + * FileUpload API. To configure and + * create VerificationReports, use the VerificationSession + * API. + * + * Related guides: Accessing + * verification results. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property \Stripe\StripeObject $document Result from a document check + * @property \Stripe\StripeObject $id_number Result from an id_number check + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $options + * @property \Stripe\StripeObject $selfie Result from a selfie check + * @property string $type Type of report. + * @property null|string $verification_session ID of the VerificationSession that created this report. + */ +class VerificationReport extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'identity.verification_report'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; + + const TYPE_DOCUMENT = 'document'; + const TYPE_ID_NUMBER = 'id_number'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Identity/VerificationSession.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Identity/VerificationSession.php new file mode 100644 index 0000000..5019399 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Identity/VerificationSession.php @@ -0,0 +1,88 @@ +verification check to perform. + * Only create one VerificationSession for each verification in your system. + * + * A VerificationSession transitions through multiple statuses throughout its + * lifetime as it progresses through the verification flow. The VerificationSession + * contains the user’s verified data after verification checks are complete. + * + * Related guide: The Verification + * Sessions API + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $client_secret The short-lived client secret used by Stripe.js to show a verification modal inside your app. This client secret expires after 24 hours and can only be used once. Don’t store it, log it, embed it in a URL, or expose it to anyone other than the user. Make sure that you have TLS enabled on any page that includes the client secret. Refer to our docs on passing the client secret to the frontend to learn more. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|\Stripe\StripeObject $last_error If present, this property tells you the last error encountered when processing the verification. + * @property null|string|\Stripe\Identity\VerificationReport $last_verification_report ID of the most recent VerificationReport. Learn more about accessing detailed verification results. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject $options + * @property null|\Stripe\StripeObject $redaction Redaction status of this VerificationSession. If the VerificationSession is not redacted, this field will be null. + * @property string $status Status of this VerificationSession. Learn more about the lifecycle of sessions. + * @property string $type The type of verification check to be performed. + * @property null|string $url The short-lived URL that you use to redirect a user to Stripe to submit their identity information. This URL expires after 48 hours and can only be used once. Don’t store it, log it, send it in emails or expose it to anyone other than the user. Refer to our docs on verifying identity documents to learn how to redirect users to Stripe. + * @property null|\Stripe\StripeObject $verified_outputs The user’s verified data. + */ +class VerificationSession extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'identity.verification_session'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; + + const STATUS_CANCELED = 'canceled'; + const STATUS_PROCESSING = 'processing'; + const STATUS_REQUIRES_INPUT = 'requires_input'; + const STATUS_VERIFIED = 'verified'; + + const TYPE_DOCUMENT = 'document'; + const TYPE_ID_NUMBER = 'id_number'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession the canceled verification session + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession the redacted verification session + */ + public function redact($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/redact'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Invoice.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Invoice.php new file mode 100644 index 0000000..7c2649d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Invoice.php @@ -0,0 +1,265 @@ +invoice + * items, and proration adjustments that may be caused by subscription + * upgrades/downgrades (if necessary). + * + * If your invoice is configured to be billed through automatic charges, Stripe + * automatically finalizes your invoice and attempts payment. Note that finalizing + * the invoice, when + * automatic, does not happen immediately as the invoice is created. Stripe + * waits until one hour after the last webhook was successfully sent (or the last + * webhook timed out after failing). If you (and the platforms you may have + * connected to) have no webhooks configured, Stripe waits one hour after creation + * to finalize the invoice. + * + * If your invoice is configured to be billed by sending an email, then based on + * your email + * settings, Stripe will email the invoice to your customer and await payment. + * These emails can contain a link to a hosted page to pay the invoice. + * + * Stripe applies any customer credit on the account before determining the amount + * due for the invoice (i.e., the amount that will be actually charged). If the + * amount due for the invoice is less than Stripe's minimum allowed + * charge per currency, the invoice is automatically marked paid, and we add + * the amount due to the customer's credit balance which is applied to the next + * invoice. + * + * More details on the customer's credit balance are here. + * + * Related guide: Send + * Invoices to Customers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $account_country The country of the business associated with this invoice, most often the business creating the invoice. + * @property null|string $account_name The public name of the business associated with this invoice, most often the business creating the invoice. + * @property null|(string|\Stripe\TaxId)[] $account_tax_ids The account tax IDs associated with the invoice. Only editable when the invoice is a draft. + * @property int $amount_due Final amount due at this time for this invoice. If the invoice's total is smaller than the minimum charge amount, for example, or if there is account credit that can be applied to the invoice, the amount_due may be 0. If there is a positive starting_balance for the invoice (the customer owes money), the amount_due will also take that into account. The charge that gets generated for the invoice will be for the amount specified in amount_due. + * @property int $amount_paid The amount, in %s, that was paid. + * @property int $amount_remaining The amount remaining, in %s, that is due. + * @property null|int $application_fee_amount The fee in %s that will be applied to the invoice and transferred to the application owner's Stripe account when the invoice is paid. + * @property int $attempt_count Number of payment attempts made for this invoice, from the perspective of the payment retry schedule. Any payment attempt counts as the first attempt, and subsequently only automatic retries increment the attempt count. In other words, manual payment attempts after the first attempt do not affect the retry schedule. + * @property bool $attempted Whether an attempt has been made to pay the invoice. An invoice is not attempted until 1 hour after the invoice.created webhook, for example, so you might not want to display that invoice as unpaid to your users. + * @property bool $auto_advance Controls whether Stripe will perform automatic collection of the invoice. When false, the invoice's state will not automatically advance without an explicit action. + * @property \Stripe\StripeObject $automatic_tax + * @property null|string $billing_reason Indicates the reason why the invoice was created. subscription_cycle indicates an invoice created by a subscription advancing into a new period. subscription_create indicates an invoice created due to creating a subscription. subscription_update indicates an invoice created due to updating a subscription. subscription is set for all old invoices to indicate either a change to a subscription or a period advancement. manual is set for all invoices unrelated to a subscription (for example: created via the invoice editor). The upcoming value is reserved for simulated invoices per the upcoming invoice endpoint. subscription_threshold indicates an invoice created due to a billing threshold being reached. + * @property null|string|\Stripe\Charge $charge ID of the latest charge generated for this invoice, if any. + * @property string $collection_method Either charge_automatically, or send_invoice. When charging automatically, Stripe will attempt to pay this invoice using the default source attached to the customer. When sending an invoice, Stripe will email this invoice to the customer with payment instructions. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|\Stripe\StripeObject[] $custom_fields Custom fields displayed on the invoice. + * @property null|string|\Stripe\Customer $customer The ID of the customer who will be billed. + * @property null|\Stripe\StripeObject $customer_address The customer's address. Until the invoice is finalized, this field will equal customer.address. Once the invoice is finalized, this field will no longer be updated. + * @property null|string $customer_email The customer's email. Until the invoice is finalized, this field will equal customer.email. Once the invoice is finalized, this field will no longer be updated. + * @property null|string $customer_name The customer's name. Until the invoice is finalized, this field will equal customer.name. Once the invoice is finalized, this field will no longer be updated. + * @property null|string $customer_phone The customer's phone number. Until the invoice is finalized, this field will equal customer.phone. Once the invoice is finalized, this field will no longer be updated. + * @property null|\Stripe\StripeObject $customer_shipping The customer's shipping information. Until the invoice is finalized, this field will equal customer.shipping. Once the invoice is finalized, this field will no longer be updated. + * @property null|string $customer_tax_exempt The customer's tax exempt status. Until the invoice is finalized, this field will equal customer.tax_exempt. Once the invoice is finalized, this field will no longer be updated. + * @property null|\Stripe\StripeObject[] $customer_tax_ids The customer's tax IDs. Until the invoice is finalized, this field will contain the same tax IDs as customer.tax_ids. Once the invoice is finalized, this field will no longer be updated. + * @property null|string|\Stripe\PaymentMethod $default_payment_method ID of the default payment method for the invoice. It must belong to the customer associated with the invoice. If not set, defaults to the subscription's default payment method, if any, or to the default payment method in the customer's invoice settings. + * @property null|string|\Stripe\Account|\Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source $default_source ID of the default payment source for the invoice. It must belong to the customer associated with the invoice and be in a chargeable state. If not set, defaults to the subscription's default source, if any, or to the customer's default source. + * @property \Stripe\TaxRate[] $default_tax_rates The tax rates applied to this invoice, if any. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. Referenced as 'memo' in the Dashboard. + * @property null|\Stripe\Discount $discount Describes the current discount applied to this invoice, if there is one. Not populated if there are multiple discounts. + * @property null|(string|\Stripe\Discount)[] $discounts The discounts applied to the invoice. Line item discounts are applied before invoice discounts. Use expand[]=discounts to expand each discount. + * @property null|int $due_date The date on which payment for this invoice is due. This value will be null for invoices where collection_method=charge_automatically. + * @property null|int $ending_balance Ending customer balance after the invoice is finalized. Invoices are finalized approximately an hour after successful webhook delivery or when payment collection is attempted for the invoice. If the invoice has not been finalized yet, this will be null. + * @property null|string $footer Footer displayed on the invoice. + * @property null|string $hosted_invoice_url The URL for the hosted invoice page, which allows customers to view and pay an invoice. If the invoice has not been finalized yet, this will be null. + * @property null|string $invoice_pdf The link to download the PDF for the invoice. If the invoice has not been finalized yet, this will be null. + * @property null|\Stripe\ErrorObject $last_finalization_error The error encountered during the previous attempt to finalize the invoice. This field is cleared when the invoice is successfully finalized. + * @property \Stripe\Collection $lines The individual line items that make up the invoice. lines is sorted as follows: invoice items in reverse chronological order, followed by the subscription, if any. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|int $next_payment_attempt The time at which payment will next be attempted. This value will be null for invoices where collection_method=send_invoice. + * @property null|string $number A unique, identifying string that appears on emails sent to the customer for this invoice. This starts with the customer's unique invoice_prefix if it is specified. + * @property null|string|\Stripe\Account $on_behalf_of The account (if any) for which the funds of the invoice payment are intended. If set, the invoice will be presented with the branding and support information of the specified account. See the Invoices with Connect documentation for details. + * @property bool $paid Whether payment was successfully collected for this invoice. An invoice can be paid (most commonly) with a charge or with credit from the customer's account balance. + * @property bool $paid_out_of_band Returns true if the invoice was manually marked paid, returns false if the invoice hasn't been paid yet or was paid on Stripe. + * @property null|string|\Stripe\PaymentIntent $payment_intent The PaymentIntent associated with this invoice. The PaymentIntent is generated when the invoice is finalized, and can then be used to pay the invoice. Note that voiding an invoice will cancel the PaymentIntent. + * @property \Stripe\StripeObject $payment_settings + * @property int $period_end End of the usage period during which invoice items were added to this invoice. + * @property int $period_start Start of the usage period during which invoice items were added to this invoice. + * @property int $post_payment_credit_notes_amount Total amount of all post-payment credit notes issued for this invoice. + * @property int $pre_payment_credit_notes_amount Total amount of all pre-payment credit notes issued for this invoice. + * @property null|string|\Stripe\Quote $quote The quote this invoice was generated from. + * @property null|string $receipt_number This is the transaction number that appears on email receipts sent for this invoice. + * @property int $starting_balance Starting customer balance before the invoice is finalized. If the invoice has not been finalized yet, this will be the current customer balance. + * @property null|string $statement_descriptor Extra information about an invoice for the customer's credit card statement. + * @property null|string $status The status of the invoice, one of draft, open, paid, uncollectible, or void. Learn more + * @property \Stripe\StripeObject $status_transitions + * @property null|string|\Stripe\Subscription $subscription The subscription that this invoice was prepared for, if any. + * @property int $subscription_proration_date Only set for upcoming invoices that preview prorations. The time used to calculate prorations. + * @property int $subtotal Total of all subscriptions, invoice items, and prorations on the invoice before any invoice level discount or tax is applied. Item discounts are already incorporated + * @property null|int $tax The amount of tax on this invoice. This is the sum of all the tax amounts on this invoice. + * @property \Stripe\StripeObject $threshold_reason + * @property int $total Total after discounts and taxes. + * @property null|\Stripe\StripeObject[] $total_discount_amounts The aggregate amounts calculated per discount across all line items. + * @property \Stripe\StripeObject[] $total_tax_amounts The aggregate amounts calculated per tax rate for all line items. + * @property null|int $webhooks_delivered_at Invoices are automatically paid or sent 1 hour after webhooks are delivered, or until all webhook delivery attempts have been exhausted. This field tracks the time when webhooks for this invoice were successfully delivered. If the invoice had no webhooks to deliver, this will be set while the invoice is being created. + */ +class Invoice extends ApiResource +{ + const OBJECT_NAME = 'invoice'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const BILLING_CHARGE_AUTOMATICALLY = 'charge_automatically'; + const BILLING_SEND_INVOICE = 'send_invoice'; + + const BILLING_REASON_MANUAL = 'manual'; + const BILLING_REASON_QUOTE_ACCEPT = 'quote_accept'; + const BILLING_REASON_SUBSCRIPTION = 'subscription'; + const BILLING_REASON_SUBSCRIPTION_CREATE = 'subscription_create'; + const BILLING_REASON_SUBSCRIPTION_CYCLE = 'subscription_cycle'; + const BILLING_REASON_SUBSCRIPTION_THRESHOLD = 'subscription_threshold'; + const BILLING_REASON_SUBSCRIPTION_UPDATE = 'subscription_update'; + const BILLING_REASON_UPCOMING = 'upcoming'; + + const COLLECTION_METHOD_CHARGE_AUTOMATICALLY = 'charge_automatically'; + const COLLECTION_METHOD_SEND_INVOICE = 'send_invoice'; + + const STATUS_DELETED = 'deleted'; + const STATUS_DRAFT = 'draft'; + const STATUS_OPEN = 'open'; + const STATUS_PAID = 'paid'; + const STATUS_UNCOLLECTIBLE = 'uncollectible'; + const STATUS_VOID = 'void'; + + use ApiOperations\NestedResource; + + const PATH_LINES = '/lines'; + + /** + * @param string $id the ID of the invoice on which to retrieve the lines + * @param null|array $params + * @param null|array|string $opts + * + * @throws StripeExceptionApiErrorException if the request fails + * + * @return \Stripe\Collection the list of lines (InvoiceLineItem) + */ + public static function allLines($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_LINES, $params, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the finalized invoice + */ + public function finalizeInvoice($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/finalize'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the uncollectible invoice + */ + public function markUncollectible($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/mark_uncollectible'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the paid invoice + */ + public function pay($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/pay'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the sent invoice + */ + public function sendInvoice($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/send'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the upcoming invoice + */ + public static function upcoming($params = null, $opts = null) + { + $url = static::classUrl() . '/upcoming'; + list($response, $opts) = static::_staticRequest('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice the voided invoice + */ + public function voidInvoice($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/void'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceItem.php new file mode 100644 index 0000000..6153bbf --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceItem.php @@ -0,0 +1,49 @@ +Subscription + * Invoices. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount (in the currency specified) of the invoice item. This should always be equal to unit_amount * quantity. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string|\Stripe\Customer $customer The ID of the customer who will be billed when this invoice item is billed. + * @property int $date Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property bool $discountable If true, discounts will apply to this invoice item. Always false for prorations. + * @property null|(string|\Stripe\Discount)[] $discounts The discounts which apply to the invoice item. Item discounts are applied before invoice discounts. Use expand[]=discounts to expand each discount. + * @property null|string|\Stripe\Invoice $invoice The ID of the invoice this invoice item belongs to. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject $period + * @property null|\Stripe\Plan $plan If the invoice item is a proration, the plan of the subscription that the proration was computed for. + * @property null|\Stripe\Price $price The price of the invoice item. + * @property bool $proration Whether the invoice item was created automatically as a proration adjustment when the customer switched plans. + * @property int $quantity Quantity of units for the invoice item. If the invoice item is a proration, the quantity of the subscription that the proration was computed for. + * @property null|string|\Stripe\Subscription $subscription The subscription that this invoice item has been created for, if any. + * @property string $subscription_item The subscription item that this invoice item has been created for, if any. + * @property null|\Stripe\TaxRate[] $tax_rates The tax rates which apply to the invoice item. When set, the default_tax_rates on the invoice do not apply to this invoice item. + * @property null|int $unit_amount Unit amount (in the currency specified) of the invoice item. + * @property null|string $unit_amount_decimal Same as unit_amount, but contains a decimal value with at most 12 decimal places. + */ +class InvoiceItem extends ApiResource +{ + const OBJECT_NAME = 'invoiceitem'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceLineItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceLineItem.php new file mode 100644 index 0000000..e579afb --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/InvoiceLineItem.php @@ -0,0 +1,33 @@ +ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|\Stripe\StripeObject[] $discount_amounts The amount of discount calculated per discount for this line item. + * @property bool $discountable If true, discounts will apply to this line item. Always false for prorations. + * @property null|(string|\Stripe\Discount)[] $discounts The discounts applied to the invoice line item. Line item discounts are applied before invoice discounts. Use expand[]=discounts to expand each discount. + * @property string $invoice_item The ID of the invoice item associated with this line item if any. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. Note that for line items with type=subscription this will reflect the metadata of the subscription that caused the line item to be created. + * @property \Stripe\StripeObject $period + * @property null|\Stripe\Plan $plan The plan of the subscription, if the line item is a subscription or a proration. + * @property null|\Stripe\Price $price The price of the line item. + * @property bool $proration Whether this is a proration. + * @property null|int $quantity The quantity of the subscription, if the line item is a subscription or a proration. + * @property null|string $subscription The subscription that the invoice item pertains to, if any. + * @property string $subscription_item The subscription item that generated this invoice item. Left empty if the line item is not an explicit result of a subscription. + * @property \Stripe\StripeObject[] $tax_amounts The amount of tax calculated per tax rate for this line item + * @property \Stripe\TaxRate[] $tax_rates The tax rates which apply to the line item. + * @property string $type A string identifying the type of the source of this line item, either an invoiceitem or a subscription. + */ +class InvoiceLineItem extends ApiResource +{ + const OBJECT_NAME = 'line_item'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Authorization.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Authorization.php new file mode 100644 index 0000000..7e597df --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Authorization.php @@ -0,0 +1,81 @@ +issued card is used to + * make a purchase, an Issuing Authorization object is created. Authorizations + * must be approved for the purchase to be completed successfully. + * + * Related guide: Issued Card + * Authorizations. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount The total amount that was authorized or rejected. This amount is in the card's currency and in the smallest currency unit. + * @property null|\Stripe\StripeObject $amount_details Detailed breakdown of amount components. These amounts are denominated in currency and in the smallest currency unit. + * @property bool $approved Whether the authorization has been approved. + * @property string $authorization_method How the card details were provided. + * @property \Stripe\BalanceTransaction[] $balance_transactions List of balance transactions associated with this authorization. + * @property \Stripe\Issuing\Card $card You can create physical or virtual cards that are issued to cardholders. + * @property null|string|\Stripe\Issuing\Cardholder $cardholder The cardholder to whom this authorization belongs. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property int $merchant_amount The total amount that was authorized or rejected. This amount is in the merchant_currency and in the smallest currency unit. + * @property string $merchant_currency The currency that was presented to the cardholder for the authorization. Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property \Stripe\StripeObject $merchant_data + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|\Stripe\StripeObject $pending_request The pending authorization request. This field will only be non-null during an issuing_authorization.request webhook. + * @property \Stripe\StripeObject[] $request_history History of every time pending_request was approved/denied, either by you directly or by Stripe (e.g. based on your spending_controls). If the merchant changes the authorization by performing an incremental authorization, you can look at this field to see the previous requests for the authorization. + * @property string $status The current status of the authorization in its lifecycle. + * @property \Stripe\Issuing\Transaction[] $transactions List of transactions associated with this authorization. + * @property \Stripe\StripeObject $verification_data + * @property null|string $wallet The digital wallet used for this authorization. One of apple_pay, google_pay, or samsung_pay. + */ +class Authorization extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'issuing.authorization'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization the approved authorization + */ + public function approve($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/approve'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization the declined authorization + */ + public function decline($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/decline'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Card.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Card.php new file mode 100644 index 0000000..31deaf3 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Card.php @@ -0,0 +1,60 @@ +create physical or + * virtual cards that are issued to cardholders. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $brand The brand of the card. + * @property null|string $cancellation_reason The reason why the card was canceled. + * @property \Stripe\Issuing\Cardholder $cardholder

An Issuing Cardholder object represents an individual or business entity who is issued cards.

Related guide: How to create a Cardholder

+ * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string $cvc The card's CVC. For security reasons, this is only available for virtual cards, and will be omitted unless you explicitly request it with the expand parameter. Additionally, it's only available via the "Retrieve a card" endpoint, not via "List all cards" or any other endpoint. + * @property int $exp_month The expiration month of the card. + * @property int $exp_year The expiration year of the card. + * @property string $last4 The last 4 digits of the card number. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $number The full unredacted card number. For security reasons, this is only available for virtual cards, and will be omitted unless you explicitly request it with the expand parameter. Additionally, it's only available via the "Retrieve a card" endpoint, not via "List all cards" or any other endpoint. + * @property null|string|\Stripe\Issuing\Card $replaced_by The latest card that replaces this card, if any. + * @property null|string|\Stripe\Issuing\Card $replacement_for The card this card replaces, if any. + * @property null|string $replacement_reason The reason why the previous card needed to be replaced. + * @property null|\Stripe\StripeObject $shipping Where and how the card will be shipped. + * @property \Stripe\StripeObject $spending_controls + * @property string $status Whether authorizations can be approved on this card. + * @property string $type The type of the card. + * @property null|\Stripe\StripeObject $wallets Information relating to digital wallets (like Apple Pay and Google Pay). + */ +class Card extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'issuing.card'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\CardDetails the card details associated with that issuing card + */ + public function details($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/details'; + list($response, $opts) = $this->_request('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response, $opts); + $obj->setLastResponse($response); + + return $obj; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/CardDetails.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/CardDetails.php new file mode 100644 index 0000000..98f4e0b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/CardDetails.php @@ -0,0 +1,19 @@ +Cardholder object represents an individual or business + * entity who is issued cards. + * + * Related guide: How to create a + * Cardholder + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject $billing + * @property null|\Stripe\StripeObject $company Additional information about a company cardholder. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $email The cardholder's email address. + * @property null|\Stripe\StripeObject $individual Additional information about an individual cardholder. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $name The cardholder's name. This will be printed on cards issued to them. + * @property null|string $phone_number The cardholder's phone number. This is required for all cardholders who will be creating EU cards. See the 3D Secure documentation for more details. + * @property \Stripe\StripeObject $requirements + * @property null|\Stripe\StripeObject $spending_controls Rules that control spending across this cardholder's cards. Refer to our documentation for more details. + * @property string $status Specifies whether to permit authorizations on this cardholder's cards. + * @property string $type One of individual or company. + */ +class Cardholder extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'issuing.cardholder'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Dispute.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Dispute.php new file mode 100644 index 0000000..1eeb17e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Dispute.php @@ -0,0 +1,53 @@ +card issuer, you can dispute + * transactions that the cardholder does not recognize, suspects to be fraudulent, + * or has other issues with. + * + * Related guide: Disputing + * Transactions + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Disputed amount. Usually the amount of the transaction, but can differ (usually because of currency fluctuation). + * @property null|\Stripe\BalanceTransaction[] $balance_transactions List of balance transactions associated with the dispute. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency The currency the transaction was made in. + * @property \Stripe\StripeObject $evidence + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $status Current status of the dispute. + * @property string|\Stripe\Issuing\Transaction $transaction The transaction being disputed. + */ +class Dispute extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'issuing.dispute'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Dispute the submited dispute + */ + public function submit($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/submit'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Transaction.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Transaction.php new file mode 100644 index 0000000..90a38ed --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Issuing/Transaction.php @@ -0,0 +1,44 @@ +issued card that + * results in funds entering or leaving your Stripe account, such as a completed + * purchase or refund, is represented by an Issuing Transaction + * object. + * + * Related guide: Issued Card + * Transactions. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount The transaction amount, which will be reflected in your balance. This amount is in your currency and in the smallest currency unit. + * @property null|\Stripe\StripeObject $amount_details Detailed breakdown of amount components. These amounts are denominated in currency and in the smallest currency unit. + * @property null|string|\Stripe\Issuing\Authorization $authorization The Authorization object that led to this transaction. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction ID of the balance transaction associated with this transaction. + * @property string|\Stripe\Issuing\Card $card The card used to make this transaction. + * @property null|string|\Stripe\Issuing\Cardholder $cardholder The cardholder to whom this transaction belongs. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Issuing\Dispute $dispute If you've disputed the transaction, the ID of the dispute. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property int $merchant_amount The amount that the merchant will receive, denominated in merchant_currency and in the smallest currency unit. It will be different from amount if the merchant is taking payment in a different currency. + * @property string $merchant_currency The currency with which the merchant is taking payment. + * @property \Stripe\StripeObject $merchant_data + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|\Stripe\StripeObject $purchase_details Additional purchase information that is optionally provided by the merchant. + * @property string $type The nature of the transaction. + * @property null|string $wallet The digital wallet used for this transaction. One of apple_pay, google_pay, or samsung_pay. + */ +class Transaction extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'issuing.transaction'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/LineItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/LineItem.php new file mode 100644 index 0000000..0a41346 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/LineItem.php @@ -0,0 +1,26 @@ +ISO currency code, in lowercase. Must be a supported currency. + * @property string $description An arbitrary string attached to the object. Often useful for displaying to users. Defaults to product name. + * @property \Stripe\StripeObject[] $discounts The discounts applied to the line item. + * @property null|\Stripe\Price $price The price used to generate the line item. + * @property null|int $quantity The quantity of products being purchased. + * @property \Stripe\StripeObject[] $taxes The taxes applied to the line item. + */ +class LineItem extends ApiResource +{ + const OBJECT_NAME = 'item'; + + use ApiOperations\All; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/LoginLink.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/LoginLink.php new file mode 100644 index 0000000..3351356 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/LoginLink.php @@ -0,0 +1,15 @@ +true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $multi_use + * @property string|\Stripe\PaymentMethod $payment_method ID of the payment method associated with this mandate. + * @property \Stripe\StripeObject $payment_method_details + * @property \Stripe\StripeObject $single_use + * @property string $status The status of the mandate, which indicates whether it can be used to initiate a payment. + * @property string $type The type of the mandate. + */ +class Mandate extends ApiResource +{ + const OBJECT_NAME = 'mandate'; + + use ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuth.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuth.php new file mode 100644 index 0000000..7b0886e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuth.php @@ -0,0 +1,101 @@ +request( + 'post', + '/oauth/token', + $params, + null + ); + + return Util\Util::convertToStripeObject($response->json, $opts); + } + + /** + * Disconnects an account from your platform. + * + * @param null|array $params + * @param null|array $opts + * + * @throws \Stripe\Exception\OAuth\OAuthErrorException if the request fails + * + * @return StripeObject object containing the response from the API + */ + public static function deauthorize($params = null, $opts = null) + { + $params = $params ?: []; + $base = ($opts && \array_key_exists('connect_base', $opts)) ? $opts['connect_base'] : Stripe::$connectBase; + $requestor = new ApiRequestor(null, $base); + $params['client_id'] = self::_getClientId($params); + list($response, $apiKey) = $requestor->request( + 'post', + '/oauth/deauthorize', + $params, + null + ); + + return Util\Util::convertToStripeObject($response->json, $opts); + } + + private static function _getClientId($params = null) + { + $clientId = ($params && \array_key_exists('client_id', $params)) ? $params['client_id'] : null; + if (null === $clientId) { + $clientId = Stripe::getClientId(); + } + if (null === $clientId) { + $msg = 'No client_id provided. (HINT: set your client_id using ' + . '"Stripe::setClientId()". You can find your client_ids ' + . 'in your Stripe dashboard at ' + . 'https://dashboard.stripe.com/account/applications/settings, ' + . 'after registering your account as a platform. See ' + . 'https://stripe.com/docs/connect/standard-accounts for details, ' + . 'or email support@stripe.com if you have any questions.'; + + throw new Exception\AuthenticationException($msg); + } + + return $clientId; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuthErrorObject.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuthErrorObject.php new file mode 100644 index 0000000..620c5bb --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/OAuthErrorObject.php @@ -0,0 +1,31 @@ + null, + 'error_description' => null, + ], $values); + parent::refreshFrom($values, $opts, $partial); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Order.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Order.php new file mode 100644 index 0000000..52fa2c7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Order.php @@ -0,0 +1,81 @@ +products. You can + * create, retrieve, and pay individual orders, as well as list all orders. Orders + * are identified by a unique, random ID. + * + * Related guide: Tax, Shipping, and + * Inventory. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount A positive integer in the smallest currency unit (that is, 100 cents for $1.00, or 1 for ¥1, Japanese Yen being a zero-decimal currency) representing the total amount for the order. + * @property null|int $amount_returned The total amount that was returned to the customer. + * @property null|string $application ID of the Connect Application that created the order. + * @property null|int $application_fee A fee in cents that will be applied to the order and transferred to the application owner’s Stripe account. The request must be made with an OAuth key or the Stripe-Account header in order to take an application fee. For more information, see the application fees documentation. + * @property null|string|\Stripe\Charge $charge The ID of the payment used to pay for the order. Present if the order status is paid, fulfilled, or refunded. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Customer $customer The customer used for the order. + * @property null|string $email The email address of the customer placing the order. + * @property string $external_coupon_code External coupon code to load for this order. + * @property \Stripe\OrderItem[] $items List of items constituting the order. An order can have up to 25 items. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|\Stripe\Collection $returns A list of returns that have taken place for this order. + * @property null|string $selected_shipping_method The shipping method that is currently selected for this order, if any. If present, it is equal to one of the ids of shipping methods in the shipping_methods array. At order creation time, if there are multiple shipping methods, Stripe will automatically selected the first method. + * @property null|\Stripe\StripeObject $shipping The shipping address for the order. Present if the order is for goods to be shipped. + * @property null|\Stripe\StripeObject[] $shipping_methods A list of supported shipping methods for this order. The desired shipping method can be specified either by updating the order, or when paying it. + * @property string $status Current order status. One of created, paid, canceled, fulfilled, or returned. More details in the Orders Guide. + * @property null|\Stripe\StripeObject $status_transitions The timestamps at which the order status was updated. + * @property null|int $updated Time at which the object was last updated. Measured in seconds since the Unix epoch. + * @property string $upstream_id The user's order ID if it is different from the Stripe order ID. + */ +class Order extends ApiResource +{ + const OBJECT_NAME = 'order'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\OrderReturn the newly created return + */ + public function returnOrder($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/returns'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + + return Util\Util::convertToStripeObject($response, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order the paid order + */ + public function pay($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/pay'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/OrderItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/OrderItem.php new file mode 100644 index 0000000..e2e6e39 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/OrderItem.php @@ -0,0 +1,19 @@ +order items. Returns always + * belong to an order, and may optionally contain a refund. + * + * Related guide: Handling + * Returns. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount A positive integer in the smallest currency unit (that is, 100 cents for $1.00, or 1 for ¥1, Japanese Yen being a zero-decimal currency) representing the total amount for the returned line item. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property \Stripe\OrderItem[] $items The items included in this order return. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string|\Stripe\Order $order The order that this return includes items from. + * @property null|string|\Stripe\Refund $refund The ID of the refund issued for this return. + */ +class OrderReturn extends ApiResource +{ + const OBJECT_NAME = 'order_return'; + + use ApiOperations\All; + use ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentIntent.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentIntent.php new file mode 100644 index 0000000..e70ee10 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentIntent.php @@ -0,0 +1,127 @@ +multiple + * statuses throughout its lifetime as it interfaces with Stripe.js to perform + * authentication flows and ultimately creates at most one successful charge. + * + * Related guide: Payment Intents API. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount intended to be collected by this PaymentIntent. A positive integer representing how much to charge in the smallest currency unit (e.g., 100 cents to charge $1.00 or 100 to charge ¥100, a zero-decimal currency). The minimum amount is $0.50 US or equivalent in charge currency. The amount value supports up to eight digits (e.g., a value of 99999999 for a USD charge of $999,999.99). + * @property int $amount_capturable Amount that can be captured from this PaymentIntent. + * @property int $amount_received Amount that was collected by this PaymentIntent. + * @property null|string|\Stripe\StripeObject $application ID of the Connect application that created the PaymentIntent. + * @property null|int $application_fee_amount The amount of the application fee (if any) that will be requested to be applied to the payment and transferred to the application owner's Stripe account. The amount of the application fee collected will be capped at the total payment amount. For more information, see the PaymentIntents use case for connected accounts. + * @property null|\Stripe\StripeObject $automatic_payment_methods Settings to configure compatible payment methods from the Stripe Dashboard + * @property null|int $canceled_at Populated when status is canceled, this is the time at which the PaymentIntent was canceled. Measured in seconds since the Unix epoch. + * @property null|string $cancellation_reason Reason for cancellation of this PaymentIntent, either user-provided (duplicate, fraudulent, requested_by_customer, or abandoned) or generated by Stripe internally (failed_invoice, void_invoice, or automatic). + * @property string $capture_method Controls when the funds will be captured from the customer's account. + * @property \Stripe\Collection $charges Charges that were created by this PaymentIntent, if any. + * @property null|string $client_secret

The client secret of this PaymentIntent. Used for client-side retrieval using a publishable key.

The client secret can be used to complete a payment from your frontend. It should not be stored, logged, embedded in URLs, or exposed to anyone other than the customer. Make sure that you have TLS enabled on any page that includes the client secret.

Refer to our docs to accept a payment and learn about how client_secret should be handled.

+ * @property string $confirmation_method + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Customer $customer

ID of the Customer this PaymentIntent belongs to, if one exists.

Payment methods attached to other Customers cannot be used with this PaymentIntent.

If present in combination with setup_future_usage, this PaymentIntent's payment method will be attached to the Customer after the PaymentIntent has been confirmed and any required actions from the user are complete.

+ * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string|\Stripe\Invoice $invoice ID of the invoice that created this PaymentIntent, if it exists. + * @property null|\Stripe\ErrorObject $last_payment_error The payment error encountered in the previous PaymentIntent confirmation. It will be cleared if the PaymentIntent is later updated for any reason. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. For more information, see the documentation. + * @property null|\Stripe\StripeObject $next_action If present, this property tells you what actions you need to take in order for your customer to fulfill a payment using the provided source. + * @property null|string|\Stripe\Account $on_behalf_of The account (if any) for which the funds of the PaymentIntent are intended. See the PaymentIntents use case for connected accounts for details. + * @property null|string|\Stripe\PaymentMethod $payment_method ID of the payment method used in this PaymentIntent. + * @property null|\Stripe\StripeObject $payment_method_options Payment-method-specific configuration for this PaymentIntent. + * @property string[] $payment_method_types The list of payment method types (e.g. card) that this PaymentIntent is allowed to use. + * @property null|\Stripe\StripeObject $processing If present, this property tells you about the processing state of the payment. + * @property null|string $receipt_email Email address that the receipt for the resulting payment will be sent to. If receipt_email is specified for a payment in live mode, a receipt will be sent regardless of your email settings. + * @property null|string|\Stripe\Review $review ID of the review associated with this PaymentIntent, if any. + * @property null|string $setup_future_usage

Indicates that you intend to make future payments with this PaymentIntent's payment method.

Providing this parameter will attach the payment method to the PaymentIntent's Customer, if present, after the PaymentIntent is confirmed and any required actions from the user are complete. If no Customer was provided, the payment method can still be attached to a Customer after the transaction completes.

When processing card payments, Stripe also uses setup_future_usage to dynamically optimize your payment flow and comply with regional legislation and network rules, such as SCA.

+ * @property null|\Stripe\StripeObject $shipping Shipping information for this PaymentIntent. + * @property null|string|\Stripe\Account|\Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source $source This is a legacy field that will be removed in the future. It is the ID of the Source object that is associated with this PaymentIntent, if one was supplied. + * @property null|string $statement_descriptor For non-card charges, you can use this value as the complete description that appears on your customers’ statements. Must contain at least one letter, maximum 22 characters. + * @property null|string $statement_descriptor_suffix Provides information about a card payment that customers see on their statements. Concatenated with the prefix (shortened descriptor) or statement descriptor that’s set on the account to form the complete statement descriptor. Maximum 22 characters for the concatenated descriptor. + * @property string $status Status of this PaymentIntent, one of requires_payment_method, requires_confirmation, requires_action, processing, requires_capture, canceled, or succeeded. Read more about each PaymentIntent status. + * @property null|\Stripe\StripeObject $transfer_data The data with which to automatically create a Transfer when the payment is finalized. See the PaymentIntents use case for connected accounts for details. + * @property null|string $transfer_group A string that identifies the resulting payment as part of a group. See the PaymentIntents use case for connected accounts for details. + */ +class PaymentIntent extends ApiResource +{ + const OBJECT_NAME = 'payment_intent'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const STATUS_CANCELED = 'canceled'; + const STATUS_PROCESSING = 'processing'; + const STATUS_REQUIRES_ACTION = 'requires_action'; + const STATUS_REQUIRES_CAPTURE = 'requires_capture'; + const STATUS_REQUIRES_CONFIRMATION = 'requires_confirmation'; + const STATUS_REQUIRES_PAYMENT_METHOD = 'requires_payment_method'; + const STATUS_SUCCEEDED = 'succeeded'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent the canceled payment intent + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent the captured payment intent + */ + public function capture($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/capture'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent the confirmed payment intent + */ + public function confirm($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/confirm'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentMethod.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentMethod.php new file mode 100644 index 0000000..b4ecd05 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/PaymentMethod.php @@ -0,0 +1,91 @@ +PaymentIntents to + * collect payments or saved to Customer objects to store instrument details for + * future payments. + * + * Related guides: Payment Methods and + * More Payment + * Scenarios. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject $acss_debit + * @property \Stripe\StripeObject $afterpay_clearpay + * @property \Stripe\StripeObject $alipay + * @property \Stripe\StripeObject $au_becs_debit + * @property \Stripe\StripeObject $bacs_debit + * @property \Stripe\StripeObject $bancontact + * @property \Stripe\StripeObject $billing_details + * @property \Stripe\StripeObject $boleto + * @property \Stripe\StripeObject $card + * @property \Stripe\StripeObject $card_present + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Customer $customer The ID of the Customer to which this PaymentMethod is saved. This will not be set when the PaymentMethod has not been saved to a Customer. + * @property \Stripe\StripeObject $eps + * @property \Stripe\StripeObject $fpx + * @property \Stripe\StripeObject $giropay + * @property \Stripe\StripeObject $grabpay + * @property \Stripe\StripeObject $ideal + * @property \Stripe\StripeObject $interac_present + * @property \Stripe\StripeObject $klarna + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject $oxxo + * @property \Stripe\StripeObject $p24 + * @property \Stripe\StripeObject $sepa_debit + * @property \Stripe\StripeObject $sofort + * @property string $type The type of the PaymentMethod. An additional hash is included on the PaymentMethod with a name matching this value. It contains additional information specific to the PaymentMethod type. + * @property \Stripe\StripeObject $wechat_pay + */ +class PaymentMethod extends ApiResource +{ + const OBJECT_NAME = 'payment_method'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod the attached payment method + */ + public function attach($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/attach'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod the detached payment method + */ + public function detach($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/detach'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Payout.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Payout.php new file mode 100644 index 0000000..edbe492 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Payout.php @@ -0,0 +1,108 @@ +Payout object is created when you receive funds from Stripe, or + * when you initiate a payout to either a bank account or debit card of a connected Stripe account. You + * can retrieve individual payouts, as well as list all payouts. Payouts are made + * on varying schedules, + * depending on your country and industry. + * + * Related guide: Receiving Payouts. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount (in %s) to be transferred to your bank account or debit card. + * @property int $arrival_date Date the payout is expected to arrive in the bank. This factors in delays like weekends or bank holidays. + * @property bool $automatic Returns true if the payout was created by an automated payout schedule, and false if it was requested manually. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction ID of the balance transaction that describes the impact of this payout on your account balance. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string|\Stripe\BankAccount|\Stripe\Card $destination ID of the bank account or card the payout was sent to. + * @property null|string|\Stripe\BalanceTransaction $failure_balance_transaction If the payout failed or was canceled, this will be the ID of the balance transaction that reversed the initial balance transaction, and puts the funds from the failed payout back in your balance. + * @property null|string $failure_code Error code explaining reason for payout failure if available. See Types of payout failures for a list of failure codes. + * @property null|string $failure_message Message to user further explaining reason for payout failure if available. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $method The method used to send this payout, which can be standard or instant. instant is only supported for payouts to debit cards. (See Instant payouts for marketplaces for more information.) + * @property null|string|\Stripe\Payout $original_payout If the payout reverses another, this is the ID of the original payout. + * @property null|string|\Stripe\Payout $reversed_by If the payout was reversed, this is the ID of the payout that reverses this payout. + * @property string $source_type The source balance this payout came from. One of card, fpx, or bank_account. + * @property null|string $statement_descriptor Extra information about a payout to be displayed on the user's bank statement. + * @property string $status Current status of the payout: paid, pending, in_transit, canceled or failed. A payout is pending until it is submitted to the bank, when it becomes in_transit. The status then changes to paid if the transaction goes through, or to failed or canceled (within 5 business days). Some failed payouts may initially show as paid but then change to failed. + * @property string $type Can be bank_account or card. + */ +class Payout extends ApiResource +{ + const OBJECT_NAME = 'payout'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const FAILURE_ACCOUNT_CLOSED = 'account_closed'; + const FAILURE_ACCOUNT_FROZEN = 'account_frozen'; + const FAILURE_BANK_ACCOUNT_RESTRICTED = 'bank_account_restricted'; + const FAILURE_BANK_OWNERSHIP_CHANGED = 'bank_ownership_changed'; + const FAILURE_COULD_NOT_PROCESS = 'could_not_process'; + const FAILURE_DEBIT_NOT_AUTHORIZED = 'debit_not_authorized'; + const FAILURE_DECLINED = 'declined'; + const FAILURE_INCORRECT_ACCOUNT_HOLDER_NAME = 'incorrect_account_holder_name'; + const FAILURE_INSUFFICIENT_FUNDS = 'insufficient_funds'; + const FAILURE_INVALID_ACCOUNT_NUMBER = 'invalid_account_number'; + const FAILURE_INVALID_CURRENCY = 'invalid_currency'; + const FAILURE_NO_ACCOUNT = 'no_account'; + const FAILURE_UNSUPPORTED_CARD = 'unsupported_card'; + + const METHOD_INSTANT = 'instant'; + const METHOD_STANDARD = 'standard'; + + const STATUS_CANCELED = 'canceled'; + const STATUS_FAILED = 'failed'; + const STATUS_IN_TRANSIT = 'in_transit'; + const STATUS_PAID = 'paid'; + const STATUS_PENDING = 'pending'; + + const TYPE_BANK_ACCOUNT = 'bank_account'; + const TYPE_CARD = 'card'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout the canceled payout + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout the reversed payout + */ + public function reverse($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/reverse'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Person.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Person.php new file mode 100644 index 0000000..a1df013 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Person.php @@ -0,0 +1,122 @@ +Standard onboarding + * or Express onboarding + * documentation for information about platform pre-filling and account + * onboarding steps. + * + * Related guide: Handling + * Identity Verification with the API. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $account The account the person is associated with. + * @property \Stripe\StripeObject $address + * @property null|\Stripe\StripeObject $address_kana The Kana variation of the person's address (Japan only). + * @property null|\Stripe\StripeObject $address_kanji The Kanji variation of the person's address (Japan only). + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property \Stripe\StripeObject $dob + * @property null|string $email The person's email address. + * @property null|string $first_name The person's first name. + * @property null|string $first_name_kana The Kana variation of the person's first name (Japan only). + * @property null|string $first_name_kanji The Kanji variation of the person's first name (Japan only). + * @property string[] $full_name_aliases A list of alternate names or aliases that the person is known by. + * @property null|\Stripe\StripeObject $future_requirements Information about the upcoming new requirements for this person, including what information needs to be collected, and by when. + * @property null|string $gender The person's gender (International regulations require either "male" or "female"). + * @property bool $id_number_provided Whether the person's id_number was provided. + * @property null|string $last_name The person's last name. + * @property null|string $last_name_kana The Kana variation of the person's last name (Japan only). + * @property null|string $last_name_kanji The Kanji variation of the person's last name (Japan only). + * @property null|string $maiden_name The person's maiden name. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $nationality The country where the person is a national. + * @property null|string $phone The person's phone number. + * @property string $political_exposure Indicates if the person or any of their representatives, family members, or other closely related persons, declares that they hold or have held an important public job or function, in any jurisdiction. + * @property \Stripe\StripeObject $relationship + * @property null|\Stripe\StripeObject $requirements Information about the requirements for this person, including what information needs to be collected, and by when. + * @property bool $ssn_last_4_provided Whether the last four digits of the person's Social Security number have been provided (U.S. only). + * @property \Stripe\StripeObject $verification + */ +class Person extends ApiResource +{ + const OBJECT_NAME = 'person'; + + use ApiOperations\Delete; + use ApiOperations\Update; + + const GENDER_FEMALE = 'female'; + const GENDER_MALE = 'male'; + + const POLITICAL_EXPOSURE_EXISTING = 'existing'; + const POLITICAL_EXPOSURE_NONE = 'none'; + + const VERIFICATION_STATUS_PENDING = 'pending'; + const VERIFICATION_STATUS_UNVERIFIED = 'unverified'; + const VERIFICATION_STATUS_VERIFIED = 'verified'; + + /** + * @return string the API URL for this Stripe account reversal + */ + public function instanceUrl() + { + $id = $this['id']; + $account = $this['account']; + if (!$id) { + throw new Exception\UnexpectedValueException( + 'Could not determine which URL to request: ' . + "class instance has invalid ID: {$id}", + null + ); + } + $id = Util\Util::utf8($id); + $account = Util\Util::utf8($account); + + $base = Account::classUrl(); + $accountExtn = \urlencode($account); + $extn = \urlencode($id); + + return "{$base}/{$accountExtn}/persons/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Persons cannot be retrieved without an account ID. Retrieve ' . + "a person using `Account::retrievePerson('account_id', " . + "'person_id')`."; + + throw new Exception\BadMethodCallException($msg); + } + + /** + * @param string $_id + * @param null|array $_params + * @param null|array|string $_options + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function update($_id, $_params = null, $_options = null) + { + $msg = 'Persons cannot be updated without an account ID. Update ' . + "a person using `Account::updatePerson('account_id', " . + "'person_id', \$updateParams)`."; + + throw new Exception\BadMethodCallException($msg); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Plan.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Plan.php new file mode 100644 index 0000000..2a818e4 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Plan.php @@ -0,0 +1,57 @@ +Prices API. It replaces the Plans + * API and is backwards compatible to simplify your migration. + * + * Plans define the base price, currency, and billing cycle for recurring purchases + * of products. Products help + * you track inventory or provisioning, and plans help you track pricing. Different + * physical goods or levels of service should be represented by products, and + * pricing options should be represented by plans. This approach lets you change + * prices without having to change your provisioning scheme. + * + * For example, you might have a single "gold" product that has plans for + * $10/month, $100/year, €9/month, and €90/year. + * + * Related guides: Set up + * a subscription and more about products and prices. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Whether the plan can be used for new purchases. + * @property null|string $aggregate_usage Specifies a usage aggregation strategy for plans of usage_type=metered. Allowed values are sum for summing up all usage during a period, last_during_period for using the last usage record reported within a period, last_ever for using the last usage record ever (across period bounds) or max which uses the usage record with the maximum reported usage during a period. Defaults to sum. + * @property null|int $amount The unit amount in %s to be charged, represented as a whole integer if possible. Only set if billing_scheme=per_unit. + * @property null|string $amount_decimal The unit amount in %s to be charged, represented as a decimal string with at most 12 decimal places. Only set if billing_scheme=per_unit. + * @property string $billing_scheme Describes how to compute the price per period. Either per_unit or tiered. per_unit indicates that the fixed amount (specified in amount) will be charged per unit in quantity (for plans with usage_type=licensed), or per unit of total usage (for plans with usage_type=metered). tiered indicates that the unit pricing will be computed using a tiering strategy as defined using the tiers and tiers_mode attributes. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string $interval The frequency at which a subscription is billed. One of day, week, month or year. + * @property int $interval_count The number of intervals (specified in the interval attribute) between subscription billings. For example, interval=month and interval_count=3 bills every 3 months. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $nickname A brief description of the plan, hidden from customers. + * @property null|string|\Stripe\Product $product The product whose pricing this plan determines. + * @property \Stripe\StripeObject[] $tiers Each element represents a pricing tier. This parameter requires billing_scheme to be set to tiered. See also the documentation for billing_scheme. + * @property null|string $tiers_mode Defines if the tiering price should be graduated or volume based. In volume-based tiering, the maximum quantity within a period determines the per unit price. In graduated tiering, pricing can change as the quantity grows. + * @property null|\Stripe\StripeObject $transform_usage Apply a transformation to the reported usage or set quantity before computing the amount billed. Cannot be combined with tiers. + * @property null|int $trial_period_days Default number of trial days when subscribing a customer to this plan using trial_from_plan=true. + * @property string $usage_type Configures how the quantity per period should be determined. Can be either metered or licensed. licensed automatically bills the quantity set when adding it to a subscription. metered aggregates the total usage based on usage records. Defaults to licensed. + */ +class Plan extends ApiResource +{ + const OBJECT_NAME = 'plan'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Price.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Price.php new file mode 100644 index 0000000..878a7a2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Price.php @@ -0,0 +1,67 @@ +Products help you track + * inventory or provisioning, and prices help you track payment terms. Different + * physical goods or levels of service should be represented by products, and + * pricing options should be represented by prices. This approach lets you change + * prices without having to change your provisioning scheme. + * + * For example, you might have a single "gold" product that has prices + * for $10/month, $100/year, and €9 once. + * + * Related guides: Set up + * a subscription, create an invoice, + * and more about products + * and prices. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Whether the price can be used for new purchases. + * @property string $billing_scheme Describes how to compute the price per period. Either per_unit or tiered. per_unit indicates that the fixed amount (specified in unit_amount or unit_amount_decimal) will be charged per unit in quantity (for prices with usage_type=licensed), or per unit of total usage (for prices with usage_type=metered). tiered indicates that the unit pricing will be computed using a tiering strategy as defined using the tiers and tiers_mode attributes. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string $lookup_key A lookup key used to retrieve prices dynamically from a static string. This may be up to 200 characters. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $nickname A brief description of the price, hidden from customers. + * @property string|\Stripe\Product $product The ID of the product this price is associated with. + * @property null|\Stripe\StripeObject $recurring The recurring components of a price such as interval and usage_type. + * @property null|string $tax_behavior Specifies whether the price is considered inclusive of taxes or exclusive of taxes. One of inclusive, exclusive, or unspecified. Once specified as either inclusive or exclusive, it cannot be changed. + * @property \Stripe\StripeObject[] $tiers Each element represents a pricing tier. This parameter requires billing_scheme to be set to tiered. See also the documentation for billing_scheme. + * @property null|string $tiers_mode Defines if the tiering price should be graduated or volume based. In volume-based tiering, the maximum quantity within a period determines the per unit price. In graduated tiering, pricing can change as the quantity grows. + * @property null|\Stripe\StripeObject $transform_quantity Apply a transformation to the reported usage or set quantity before computing the amount billed. Cannot be combined with tiers. + * @property string $type One of one_time or recurring depending on whether the price is for a one-time purchase or a recurring (subscription) purchase. + * @property null|int $unit_amount The unit amount in %s to be charged, represented as a whole integer if possible. Only set if billing_scheme=per_unit. + * @property null|string $unit_amount_decimal The unit amount in %s to be charged, represented as a decimal string with at most 12 decimal places. Only set if billing_scheme=per_unit. + */ +class Price extends ApiResource +{ + const OBJECT_NAME = 'price'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const BILLING_SCHEME_PER_UNIT = 'per_unit'; + const BILLING_SCHEME_TIERED = 'tiered'; + + const TAX_BEHAVIOR_EXCLUSIVE = 'exclusive'; + const TAX_BEHAVIOR_INCLUSIVE = 'inclusive'; + const TAX_BEHAVIOR_UNSPECIFIED = 'unspecified'; + + const TIERS_MODE_GRADUATED = 'graduated'; + const TIERS_MODE_VOLUME = 'volume'; + + const TYPE_ONE_TIME = 'one_time'; + const TYPE_RECURRING = 'recurring'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Product.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Product.php new file mode 100644 index 0000000..3164096 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Product.php @@ -0,0 +1,54 @@ +Prices to + * configure pricing in Checkout and Subscriptions. + * + * Related guides: Set up + * a subscription or accept one-time + * payments with Checkout and more about Products and Prices + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Whether the product is currently available for purchase. + * @property null|string[] $attributes A list of up to 5 attributes that each SKU can provide values for (e.g., ["color", "size"]). + * @property null|string $caption A short one-line description of the product, meant to be displayable to the customer. Only applicable to products of type=good. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string[] $deactivate_on An array of connect application identifiers that cannot purchase this product. Only applicable to products of type=good. + * @property null|string $description The product's description, meant to be displayable to the customer. Use this field to optionally store a long form explanation of the product being sold for your own rendering purposes. + * @property string[] $images A list of up to 8 URLs of images for this product, meant to be displayable to the customer. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $name The product's name, meant to be displayable to the customer. Whenever this product is sold via a subscription, name will show up on associated invoice line item descriptions. + * @property null|\Stripe\StripeObject $package_dimensions The dimensions of this product for shipping purposes. + * @property null|bool $shippable Whether this product is shipped (i.e., physical goods). + * @property null|string $statement_descriptor Extra information about a product which will appear on your customer's credit card statement. In the case that multiple products are billed at once, the first statement descriptor will be used. + * @property null|string|\Stripe\TaxCode $tax_code A tax code ID. + * @property string $type The type of the product. The product is either of type good, which is eligible for use with Orders and SKUs, or service, which is eligible for use with Subscriptions and Plans. + * @property null|string $unit_label A label that represents units of this product in Stripe and on customers’ receipts and invoices. When set, this will be included in associated invoice line item descriptions. + * @property int $updated Time at which the object was last updated. Measured in seconds since the Unix epoch. + * @property null|string $url A URL of a publicly-accessible webpage for this product. + */ +class Product extends ApiResource +{ + const OBJECT_NAME = 'product'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const TYPE_GOOD = 'good'; + const TYPE_SERVICE = 'service'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/PromotionCode.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/PromotionCode.php new file mode 100644 index 0000000..2457add --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/PromotionCode.php @@ -0,0 +1,33 @@ +invoices or orders. Coupons do not work with conventional one-off charges. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Customer $customer The customer that this promotion code can be used by. + * @property null|int $expires_at Date at which the promotion code can no longer be redeemed. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|int $max_redemptions Maximum number of times this promotion code can be redeemed. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject $restrictions + * @property int $times_redeemed Number of times this promotion code has been used. + */ +class PromotionCode extends ApiResource +{ + const OBJECT_NAME = 'promotion_code'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Quote.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Quote.php new file mode 100644 index 0000000..67fc627 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Quote.php @@ -0,0 +1,169 @@ +charge_automatically, or send_invoice. When charging automatically, Stripe will attempt to pay invoices at the end of the subscription cycle or on finalization using the default payment method attached to the subscription or customer. When sending an invoice, Stripe will email your customer an invoice with payment instructions. Defaults to charge_automatically. + * @property \Stripe\StripeObject $computed + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Customer $customer The customer which this quote belongs to. A customer is required before finalizing the quote. Once specified, it cannot be changed. + * @property (string|\Stripe\TaxRate)[] $default_tax_rates The tax rates applied to this quote. + * @property null|string $description A description that will be displayed on the quote PDF. + * @property (string|\Stripe\Discount)[] $discounts The discounts applied to this quote. + * @property int $expires_at The date on which the quote will be canceled if in open or draft status. Measured in seconds since the Unix epoch. + * @property null|string $footer A footer that will be displayed on the quote PDF. + * @property null|\Stripe\StripeObject $from_quote Details of the quote that was cloned. See the cloning documentation for more details. + * @property null|string $header A header that will be displayed on the quote PDF. + * @property null|string|\Stripe\Invoice $invoice The invoice that was created from this quote. + * @property null|\Stripe\StripeObject $invoice_settings All invoices will be billed using the specified settings. + * @property \Stripe\Collection $line_items A list of items the customer is being quoted for. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $number A unique number that identifies this particular quote. This number is assigned once the quote is finalized. + * @property null|string|\Stripe\Account $on_behalf_of The account on behalf of which to charge. See the Connect documentation for details. + * @property string $status The status of the quote. + * @property \Stripe\StripeObject $status_transitions + * @property null|string|\Stripe\Subscription $subscription The subscription that was created or updated from this quote. + * @property \Stripe\StripeObject $subscription_data + * @property null|string|\Stripe\SubscriptionSchedule $subscription_schedule The subscription schedule that was created or updated from this quote. + * @property \Stripe\StripeObject $total_details + * @property null|\Stripe\StripeObject $transfer_data The account (if any) the payments will be attributed to for tax reporting, and where funds from each payment will be transferred to for each of the invoices. + */ +class Quote extends ApiResource +{ + const OBJECT_NAME = 'quote'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const COLLECTION_METHOD_CHARGE_AUTOMATICALLY = 'charge_automatically'; + const COLLECTION_METHOD_SEND_INVOICE = 'send_invoice'; + + const STATUS_ACCEPTED = 'accepted'; + const STATUS_CANCELED = 'canceled'; + const STATUS_DRAFT = 'draft'; + const STATUS_OPEN = 'open'; + + /** + * @param callable $readBodyChunkCallable + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + */ + public function pdf($readBodyChunkCallable, $params = null, $opts = null) + { + $opts = \Stripe\Util\RequestOptions::parse($opts); + if (null === $opts->apiBase) { + $opts->apiBase = Stripe::$apiUploadBase; + } + + $url = $this->instanceUrl() . '/pdf'; + $this->_requestStream('get', $url, $readBodyChunkCallable, $params, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote the accepted quote + */ + public function accept($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/accept'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote the canceled quote + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote the finalized quote + */ + public function finalizeQuote($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/finalize'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * @param mixed $id + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection list of LineItems + */ + public static function allComputedUpfrontLineItems($id, $params = null, $opts = null) + { + $url = static::resourceUrl($id) . '/computed_upfront_line_items'; + list($response, $opts) = static::_staticRequest('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * @param mixed $id + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection list of LineItems + */ + public static function allLineItems($id, $params = null, $opts = null) + { + $url = static::resourceUrl($id) . '/line_items'; + list($response, $opts) = static::_staticRequest('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response->json, $opts); + $obj->setLastResponse($response); + + return $obj; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/EarlyFraudWarning.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/EarlyFraudWarning.php new file mode 100644 index 0000000..2dfd2ac --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/EarlyFraudWarning.php @@ -0,0 +1,38 @@ +Early + * Fraud Warnings. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $actionable An EFW is actionable if it has not received a dispute and has not been fully refunded. You may wish to proactively refund a charge that receives an EFW, in order to avoid receiving a dispute later. + * @property string|\Stripe\Charge $charge ID of the charge this early fraud warning is for, optionally expanded. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $fraud_type The type of fraud labelled by the issuer. One of card_never_received, fraudulent_card_application, made_with_counterfeit_card, made_with_lost_card, made_with_stolen_card, misc, unauthorized_use_of_card. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property string|\Stripe\PaymentIntent $payment_intent ID of the Payment Intent this early fraud warning is for, optionally expanded. + */ +class EarlyFraudWarning extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'radar.early_fraud_warning'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; + + const FRAUD_TYPE_CARD_NEVER_RECEIVED = 'card_never_received'; + const FRAUD_TYPE_FRAUDULENT_CARD_APPLICATION = 'fraudulent_card_application'; + const FRAUD_TYPE_MADE_WITH_COUNTERFEIT_CARD = 'made_with_counterfeit_card'; + const FRAUD_TYPE_MADE_WITH_LOST_CARD = 'made_with_lost_card'; + const FRAUD_TYPE_MADE_WITH_STOLEN_CARD = 'made_with_stolen_card'; + const FRAUD_TYPE_MISC = 'misc'; + const FRAUD_TYPE_UNAUTHORIZED_USE_OF_CARD = 'unauthorized_use_of_card'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueList.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueList.php new file mode 100644 index 0000000..ad37432 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueList.php @@ -0,0 +1,35 @@ +Default Stripe + * Lists. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $alias The name of the value list for use in rules. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $created_by The name or email address of the user who created this value list. + * @property string $item_type The type of items in the value list. One of card_fingerprint, card_bin, email, ip_address, country, string, case_sensitive_string, or customer_id. + * @property \Stripe\Collection $list_items List of items contained within this value list. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $name The name of the value list. + */ +class ValueList extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'radar.value_list'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Delete; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueListItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueListItem.php new file mode 100644 index 0000000..c4ab281 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Radar/ValueListItem.php @@ -0,0 +1,31 @@ +Managing List + * Items. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $created_by The name or email address of the user who added this item to the value list. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property string $value The value of the item. + * @property string $value_list The identifier of the value list this item belongs to. + */ +class ValueListItem extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'radar.value_list_item'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Delete; + use \Stripe\ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Recipient.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Recipient.php new file mode 100644 index 0000000..8d5ad4c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Recipient.php @@ -0,0 +1,44 @@ +Recipient objects, you can transfer money from your Stripe + * account to a third-party bank account or debit card. The API allows you to + * create, delete, and update your recipients. You can retrieve individual + * recipients as well as a list of all your recipients. + * + * Recipient objects have been deprecated in favor of Connect, specifically Connect's much + * more powerful Account objects. + * Stripe accounts that don't already use recipients can no longer begin doing so. + * Please use Account objects instead. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|\Stripe\BankAccount $active_account Hash describing the current account on the recipient, if there is one. + * @property null|\Stripe\Collection $cards + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Card $default_card The default card to use for creating transfers to this recipient. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string $email + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string|\Stripe\Account $migrated_to The ID of the Custom account this recipient was migrated to. If set, the recipient can no longer be updated, nor can transfers be made to it: use the Custom account instead. + * @property null|string $name Full, legal name of the recipient. + * @property string|\Stripe\Account $rolled_back_from + * @property string $type Type of the recipient, one of individual or corporation. + * @property bool $verified Whether the recipient has been verified. This field is non-standard, and maybe removed in the future + */ +class Recipient extends ApiResource +{ + const OBJECT_NAME = 'recipient'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/RecipientTransfer.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/RecipientTransfer.php new file mode 100644 index 0000000..5e2d436 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/RecipientTransfer.php @@ -0,0 +1,36 @@ +Refund objects allow you to refund a charge that has previously + * been created but not yet refunded. Funds will be refunded to the credit or debit + * card that was originally charged. + * + * Related guide: Refunds. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount, in %s. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction Balance transaction that describes the impact on your account balance. + * @property null|string|\Stripe\Charge $charge ID of the charge that was refunded. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property string $description An arbitrary string attached to the object. Often useful for displaying to users. (Available on non-card refunds only) + * @property string|\Stripe\BalanceTransaction $failure_balance_transaction If the refund failed, this balance transaction describes the adjustment made on your account balance that reverses the initial balance transaction. + * @property string $failure_reason If the refund failed, the reason for refund failure if known. Possible values are lost_or_stolen_card, expired_or_canceled_card, or unknown. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string|\Stripe\PaymentIntent $payment_intent ID of the PaymentIntent that was refunded. + * @property null|string $reason Reason for the refund, either user-provided (duplicate, fraudulent, or requested_by_customer) or generated by Stripe internally (expired_uncaptured_charge). + * @property null|string $receipt_number This is the transaction number that appears on email receipts sent for this refund. + * @property null|string|\Stripe\TransferReversal $source_transfer_reversal The transfer reversal that is associated with the refund. Only present if the charge came from another Stripe account. See the Connect documentation for details. + * @property null|string $status Status of the refund. For credit card refunds, this can be pending, succeeded, or failed. For other types of refunds, it can be pending, succeeded, failed, or canceled. Refer to our refunds documentation for more details. + * @property null|string|\Stripe\TransferReversal $transfer_reversal If the accompanying transfer was reversed, the transfer reversal object. Only applicable if the charge was created using the destination parameter. + */ +class Refund extends ApiResource +{ + const OBJECT_NAME = 'refund'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const FAILURE_REASON_EXPIRED_OR_CANCELED_CARD = 'expired_or_canceled_card'; + const FAILURE_REASON_LOST_OR_STOLEN_CARD = 'lost_or_stolen_card'; + const FAILURE_REASON_UNKNOWN = 'unknown'; + + const REASON_DUPLICATE = 'duplicate'; + const REASON_FRAUDULENT = 'fraudulent'; + const REASON_REQUESTED_BY_CUSTOMER = 'requested_by_customer'; + + const STATUS_CANCELED = 'canceled'; + const STATUS_FAILED = 'failed'; + const STATUS_PENDING = 'pending'; + const STATUS_SUCCEEDED = 'succeeded'; + + /** + * @deprecated use FAILURE_REASON_EXPIRED_OR_CANCELED_CARD instead + */ + const FAILURE_REASON = 'expired_or_canceled_card'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportRun.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportRun.php new file mode 100644 index 0000000..7c3d2a9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportRun.php @@ -0,0 +1,37 @@ +API Access to + * Reports. + * + * Note that certain report types can only be run based on your live-mode data (not + * test-mode data), and will error when queried without a live-mode API key. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $error If something should go wrong during the run, a message about the failure (populated when status=failed). + * @property bool $livemode true if the report is run on live mode data and false if it is run on test mode data. + * @property \Stripe\StripeObject $parameters + * @property string $report_type The ID of the report type to run, such as "balance.summary.1". + * @property null|\Stripe\File $result The file object representing the result of the report run (populated when status=succeeded). + * @property string $status Status of this report run. This will be pending when the run is initially created. When the run finishes, this will be set to succeeded and the result field will be populated. Rarely, we may encounter an error, at which point this will be set to failed and the error field will be populated. + * @property null|int $succeeded_at Timestamp at which this run successfully finished (populated when status=succeeded). Measured in seconds since the Unix epoch. + */ +class ReportRun extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'reporting.report_run'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportType.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportType.php new file mode 100644 index 0000000..4725656 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Reporting/ReportType.php @@ -0,0 +1,35 @@ +API Access to Reports + * documentation for those Report Type IDs, along with required and optional + * parameters. + * + * Note that certain report types can only be run based on your live-mode data (not + * test-mode data), and will error when queried without a live-mode API key. + * + * @property string $id The ID of the Report Type, such as balance.summary.1. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $data_available_end Most recent time for which this Report Type is available. Measured in seconds since the Unix epoch. + * @property int $data_available_start Earliest time for which this Report Type is available. Measured in seconds since the Unix epoch. + * @property null|string[] $default_columns List of column names that are included by default when this Report Type gets run. (If the Report Type doesn't support the columns parameter, this will be null.) + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property string $name Human-readable name of the Report Type + * @property int $updated When this Report Type was latest updated. Measured in seconds since the Unix epoch. + * @property int $version Version of the Report Type. Different versions report with the same ID will have the same purpose, but may take different run parameters or have different result schemas. + */ +class ReportType extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'reporting.report_type'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/RequestTelemetry.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/RequestTelemetry.php new file mode 100644 index 0000000..bf9074a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/RequestTelemetry.php @@ -0,0 +1,26 @@ +requestId = $requestId; + $this->requestDuration = $requestDuration; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Review.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Review.php new file mode 100644 index 0000000..af8f398 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Review.php @@ -0,0 +1,66 @@ +Radar and reviewing payments here. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $billing_zip The ZIP or postal code of the card used, if applicable. + * @property null|string|\Stripe\Charge $charge The charge associated with this review. + * @property null|string $closed_reason The reason the review was closed, or null if it has not yet been closed. One of approved, refunded, refunded_as_fraud, disputed, or redacted. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $ip_address The IP address where the payment originated. + * @property null|\Stripe\StripeObject $ip_address_location Information related to the location of the payment. Note that this information is an approximation and attempts to locate the nearest population center - it should not be used to determine a specific address. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property bool $open If true, the review needs action. + * @property string $opened_reason The reason the review was opened. One of rule or manual. + * @property string|\Stripe\PaymentIntent $payment_intent The PaymentIntent ID associated with this review, if one exists. + * @property string $reason The reason the review is currently open or closed. One of rule, manual, approved, refunded, refunded_as_fraud, disputed, or redacted. + * @property null|\Stripe\StripeObject $session Information related to the browsing session of the user who initiated the payment. + */ +class Review extends ApiResource +{ + const OBJECT_NAME = 'review'; + + use ApiOperations\All; + use ApiOperations\Retrieve; + + /** + * Possible string representations of the current, the opening or the closure reason of the review. + * Not all of these enumeration apply to all of the ´reason´ fields. Please consult the Review object to + * determine where these are apply. + * + * @see https://stripe.com/docs/api/radar/reviews/object + */ + const REASON_APPROVED = 'approved'; + const REASON_DISPUTED = 'disputed'; + const REASON_MANUAL = 'manual'; + const REASON_REFUNDED = 'refunded'; + const REASON_REFUNDED_AS_FRAUD = 'refunded_as_fraud'; + const REASON_RULE = 'rule'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Review the approved review + */ + public function approve($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/approve'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SKU.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SKU.php new file mode 100644 index 0000000..b418c6c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SKU.php @@ -0,0 +1,44 @@ +stock keeping units. + * SKUs describe specific product variations, taking into account any combination + * of: attributes, currency, and cost. For example, a product may be a T-shirt, + * whereas a specific SKU represents the size: large, color: + * red version of that shirt. + * + * Can also be used to manage inventory. + * + * Related guide: Tax, Shipping, and + * Inventory. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Whether the SKU is available for purchase. + * @property \Stripe\StripeObject $attributes A dictionary of attributes and values for the attributes defined by the product. If, for example, a product's attributes are ["size", "gender"], a valid SKU has the following dictionary of attributes: {"size": "Medium", "gender": "Unisex"}. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $image The URL of an image for this SKU, meant to be displayable to the customer. + * @property \Stripe\StripeObject $inventory + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|\Stripe\StripeObject $package_dimensions The dimensions of this SKU for shipping purposes. + * @property int $price The cost of the item as a positive integer in the smallest currency unit (that is, 100 cents to charge $1.00, or 100 to charge ¥100, Japanese Yen being a zero-decimal currency). + * @property string|\Stripe\Product $product The ID of the product this SKU is associated with. The product must be currently active. + * @property int $updated Time at which the object was last updated. Measured in seconds since the Unix epoch. + */ +class SKU extends ApiResource +{ + const OBJECT_NAME = 'sku'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractService.php new file mode 100644 index 0000000..12071c8 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractService.php @@ -0,0 +1,100 @@ +client = $client; + $this->streamingClient = $client; + } + + /** + * Gets the client used by this service to send requests. + * + * @return \Stripe\StripeClientInterface + */ + public function getClient() + { + return $this->client; + } + + /** + * Gets the client used by this service to send requests. + * + * @return \Stripe\StripeStreamingClientInterface + */ + public function getStreamingClient() + { + return $this->streamingClient; + } + + /** + * Translate null values to empty strings. For service methods, + * we interpret null as a request to unset the field, which + * corresponds to sending an empty string for the field to the + * API. + * + * @param null|array $params + */ + private static function formatParams($params) + { + if (null === $params) { + return null; + } + \array_walk_recursive($params, function (&$value, $key) { + if (null === $value) { + $value = ''; + } + }); + + return $params; + } + + protected function request($method, $path, $params, $opts) + { + return $this->getClient()->request($method, $path, static::formatParams($params), $opts); + } + + protected function requestStream($method, $path, $readBodyChunkCallable, $params, $opts) + { + return $this->getStreamingClient()->requestStream($method, $path, $readBodyChunkCallable, static::formatParams($params), $opts); + } + + protected function requestCollection($method, $path, $params, $opts) + { + return $this->getClient()->requestCollection($method, $path, static::formatParams($params), $opts); + } + + protected function buildPath($basePath, ...$ids) + { + foreach ($ids as $id) { + if (null === $id || '' === \trim($id)) { + $msg = 'The resource ID cannot be null or whitespace.'; + + throw new \Stripe\Exception\InvalidArgumentException($msg); + } + } + + return \sprintf($basePath, ...\array_map('\urlencode', $ids)); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractServiceFactory.php new file mode 100644 index 0000000..4aca686 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AbstractServiceFactory.php @@ -0,0 +1,59 @@ + */ + private $services; + + /** + * @param \Stripe\StripeClientInterface $client + */ + public function __construct($client) + { + $this->client = $client; + $this->services = []; + } + + /** + * @param string $name + * + * @return null|string + */ + abstract protected function getServiceClass($name); + + /** + * @param string $name + * + * @return null|AbstractService|AbstractServiceFactory + */ + public function __get($name) + { + $serviceClass = $this->getServiceClass($name); + if (null !== $serviceClass) { + if (!\array_key_exists($name, $this->services)) { + $this->services[$name] = new $serviceClass($this->client); + } + + return $this->services[$name]; + } + + \trigger_error('Undefined property: ' . static::class . '::$' . $name); + + return null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountLinkService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountLinkService.php new file mode 100644 index 0000000..2e90492 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountLinkService.php @@ -0,0 +1,25 @@ +request('post', '/v1/account_links', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountService.php new file mode 100644 index 0000000..e69c5ee --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/AccountService.php @@ -0,0 +1,381 @@ +Connect. If you’re not a platform, the list is empty. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/accounts', $params, $opts); + } + + /** + * Returns a list of capabilities associated with the account. The capabilities are + * returned sorted by creation date, with the most recent capability appearing + * first. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allCapabilities($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/accounts/%s/capabilities', $parentId), $params, $opts); + } + + /** + * List external accounts for an account. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allExternalAccounts($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/accounts/%s/external_accounts', $parentId), $params, $opts); + } + + /** + * Returns a list of people associated with the account’s legal entity. The people + * are returned sorted by creation date, with the most recent people appearing + * first. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allPersons($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/accounts/%s/persons', $parentId), $params, $opts); + } + + /** + * With Connect, you can create Stripe accounts for + * your users. To do this, you’ll first need to register your + * platform. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/accounts', $params, $opts); + } + + /** + * Create an external account for a given account. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public function createExternalAccount($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/external_accounts', $parentId), $params, $opts); + } + + /** + * Creates a single-use login link for an Express account to access their Stripe + * dashboard. + * + * You may only create login links for Express accounts connected to your + * platform. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\LoginLink + */ + public function createLoginLink($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/login_links', $parentId), $params, $opts); + } + + /** + * Creates a new person. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public function createPerson($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/persons', $parentId), $params, $opts); + } + + /** + * With Connect, you can delete accounts you manage. + * + * Accounts created using test-mode keys can be deleted at any time. Custom or + * Express accounts created using live-mode keys can only be deleted once all + * balances are zero. + * + * If you want to delete your own account, use the account information tab in your + * account settings instead. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/accounts/%s', $id), $params, $opts); + } + + /** + * Delete a specified external account for a given account. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public function deleteExternalAccount($parentId, $id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/accounts/%s/external_accounts/%s', $parentId, $id), $params, $opts); + } + + /** + * Deletes an existing person’s relationship to the account’s legal entity. Any + * person with a relationship for an account can be deleted through the API, except + * if the person is the account_opener. If your integration is using + * the executive parameter, you cannot delete the only verified + * executive on file. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public function deletePerson($parentId, $id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/accounts/%s/persons/%s', $parentId, $id), $params, $opts); + } + + /** + * With Connect, you may flag accounts as suspicious. + * + * Test-mode Custom and Express accounts can be rejected at any time. Accounts + * created using live-mode keys may only be rejected once all balances are zero. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public function reject($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/reject', $id), $params, $opts); + } + + /** + * Retrieves information about the specified Account Capability. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Capability + */ + public function retrieveCapability($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/accounts/%s/capabilities/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieve a specified external account for a given account. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public function retrieveExternalAccount($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/accounts/%s/external_accounts/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieves an existing person. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public function retrievePerson($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/accounts/%s/persons/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates a connected account by setting the + * values of the parameters passed. Any parameters not provided are left unchanged. + * Most parameters can be changed only for Custom accounts. (These are marked + * Custom Only below.) Parameters marked Custom and + * Express are not supported for Standard accounts. + * + * To update your own account, use the Dashboard. Refer to our Connect documentation to learn more + * about updating accounts. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s', $id), $params, $opts); + } + + /** + * Updates an existing Account Capability. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Capability + */ + public function updateCapability($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/capabilities/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates the metadata, account holder name, account holder type of a bank account + * belonging to a Custom account, and + * optionally sets it as the default for its currency. Other bank account details + * are not editable by design. + * + * You can re-enable a disabled bank account by performing an update call without + * providing any arguments or changes. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BankAccount|\Stripe\Card + */ + public function updateExternalAccount($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/external_accounts/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates an existing person. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Person + */ + public function updatePerson($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/accounts/%s/persons/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieves the details of an account. + * + * @param null|string $id + * @param null|array $params + * @param null|array|StripeUtilRequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Account + */ + public function retrieve($id = null, $params = null, $opts = null) + { + if (null === $id) { + return $this->request('get', '/v1/account', $params, $opts); + } + + return $this->request('get', $this->buildPath('/v1/accounts/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplePayDomainService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplePayDomainService.php new file mode 100644 index 0000000..6577b6b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplePayDomainService.php @@ -0,0 +1,70 @@ +requestCollection('get', '/v1/apple_pay/domains', $params, $opts); + } + + /** + * Create an apple pay domain. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplePayDomain + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/apple_pay/domains', $params, $opts); + } + + /** + * Delete an apple pay domain. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplePayDomain + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/apple_pay/domains/%s', $id), $params, $opts); + } + + /** + * Retrieve an apple pay domain. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplePayDomain + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/apple_pay/domains/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplicationFeeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplicationFeeService.php new file mode 100644 index 0000000..c05c3cd --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ApplicationFeeService.php @@ -0,0 +1,125 @@ +requestCollection('get', '/v1/application_fees', $params, $opts); + } + + /** + * You can see a list of the refunds belonging to a specific application fee. Note + * that the 10 most recent refunds are always available by default on the + * application fee object. If you need more than those 10, you can use this API + * method and the limit and starting_after parameters to + * page through additional refunds. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allRefunds($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/application_fees/%s/refunds', $parentId), $params, $opts); + } + + /** + * Refunds an application fee that has previously been collected but not yet + * refunded. Funds will be refunded to the Stripe account from which the fee was + * originally collected. + * + * You can optionally refund only part of an application fee. You can do so + * multiple times, until the entire fee has been refunded. + * + * Once entirely refunded, an application fee can’t be refunded again. This method + * will raise an error when called on an already-refunded application fee, or when + * trying to refund more money than is left on an application fee. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public function createRefund($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/application_fees/%s/refunds', $parentId), $params, $opts); + } + + /** + * Retrieves the details of an application fee that your account has collected. The + * same information is returned when refunding the application fee. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFee + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/application_fees/%s', $id), $params, $opts); + } + + /** + * By default, you can see the 10 most recent refunds stored directly on the + * application fee object, but you can also retrieve details about a specific + * refund stored on the application fee. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public function retrieveRefund($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/application_fees/%s/refunds/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates the specified application fee refund by setting the values of the + * parameters passed. Any parameters not provided will be left unchanged. + * + * This request only accepts metadata as an argument. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ApplicationFeeRefund + */ + public function updateRefund($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/application_fees/%s/refunds/%s', $parentId, $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceService.php new file mode 100644 index 0000000..0f55385 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceService.php @@ -0,0 +1,26 @@ +Accounting + * for negative balances. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Balance + */ + public function retrieve($params = null, $opts = null) + { + return $this->request('get', '/v1/balance', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceTransactionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceTransactionService.php new file mode 100644 index 0000000..fb1da50 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BalanceTransactionService.php @@ -0,0 +1,47 @@ +/v1/balance/history. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/balance_transactions', $params, $opts); + } + + /** + * Retrieves the balance transaction with the given ID. + * + * Note that this endpoint previously used the path + * /v1/balance/history/:id. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BalanceTransaction + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/balance_transactions/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/BillingPortalServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/BillingPortalServiceFactory.php new file mode 100644 index 0000000..23a4d30 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/BillingPortalServiceFactory.php @@ -0,0 +1,27 @@ + + */ + private static $classMap = [ + 'configurations' => ConfigurationService::class, + 'sessions' => SessionService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/ConfigurationService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/ConfigurationService.php new file mode 100644 index 0000000..5a0d70d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/ConfigurationService.php @@ -0,0 +1,73 @@ +requestCollection('get', '/v1/billing_portal/configurations', $params, $opts); + } + + /** + * Creates a configuration that describes the functionality and behavior of a + * PortalSession. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BillingPortal\Configuration + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/billing_portal/configurations', $params, $opts); + } + + /** + * Retrieves a configuration that describes the functionality of the customer + * portal. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BillingPortal\Configuration + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/billing_portal/configurations/%s', $id), $params, $opts); + } + + /** + * Updates a configuration that describes the functionality of the customer portal. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\BillingPortal\Configuration + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/billing_portal/configurations/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/SessionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/SessionService.php new file mode 100644 index 0000000..6b3e602 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/BillingPortal/SessionService.php @@ -0,0 +1,23 @@ +request('post', '/v1/billing_portal/sessions', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ChargeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ChargeService.php new file mode 100644 index 0000000..f8960ed --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ChargeService.php @@ -0,0 +1,102 @@ +requestCollection('get', '/v1/charges', $params, $opts); + } + + /** + * Capture the payment of an existing, uncaptured, charge. This is the second half + * of the two-step payment flow, where first you created a + * charge with the capture option set to false. + * + * Uncaptured payments expire a set number of days after they are created (7 by default). If they are not captured + * by that point in time, they will be marked as refunded and will no longer be + * capturable. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Charge + */ + public function capture($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/charges/%s/capture', $id), $params, $opts); + } + + /** + * To charge a credit card or other payment source, you create a + * Charge object. If your API key is in test mode, the supplied + * payment source (e.g., card) won’t actually be charged, although everything else + * will occur as if in live mode. (Stripe assumes that the charge would have + * completed successfully). + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Charge + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/charges', $params, $opts); + } + + /** + * Retrieves the details of a charge that has previously been created. Supply the + * unique charge ID that was returned from your previous request, and Stripe will + * return the corresponding charge information. The same information is returned + * when creating or refunding the charge. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Charge + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/charges/%s', $id), $params, $opts); + } + + /** + * Updates the specified charge by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Charge + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/charges/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/CheckoutServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/CheckoutServiceFactory.php new file mode 100644 index 0000000..bb26a83 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/CheckoutServiceFactory.php @@ -0,0 +1,25 @@ + + */ + private static $classMap = [ + 'sessions' => SessionService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/SessionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/SessionService.php new file mode 100644 index 0000000..b42ab8a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Checkout/SessionService.php @@ -0,0 +1,92 @@ +requestCollection('get', '/v1/checkout/sessions', $params, $opts); + } + + /** + * When retrieving a Checkout Session, there is an includable + * line_items property containing the first handful of those + * items. There is also a URL where you can retrieve the full (paginated) list of + * line items. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allLineItems($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/checkout/sessions/%s/line_items', $parentId), $params, $opts); + } + + /** + * Creates a Session object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Checkout\Session + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/checkout/sessions', $params, $opts); + } + + /** + * A Session can be expired when it is in one of these statuses: open. + * + * After it expires, a customer can’t complete a Session and customers loading the + * Session see a message saying the Session is expired. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Checkout\Session + */ + public function expire($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/checkout/sessions/%s/expire', $id), $params, $opts); + } + + /** + * Retrieves a Session object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Checkout\Session + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/checkout/sessions/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CoreServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CoreServiceFactory.php new file mode 100644 index 0000000..540d24d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CoreServiceFactory.php @@ -0,0 +1,133 @@ + + */ + private static $classMap = [ + 'accountLinks' => AccountLinkService::class, + 'accounts' => AccountService::class, + 'applePayDomains' => ApplePayDomainService::class, + 'applicationFees' => ApplicationFeeService::class, + 'balance' => BalanceService::class, + 'balanceTransactions' => BalanceTransactionService::class, + 'billingPortal' => BillingPortal\BillingPortalServiceFactory::class, + 'charges' => ChargeService::class, + 'checkout' => Checkout\CheckoutServiceFactory::class, + 'countrySpecs' => CountrySpecService::class, + 'coupons' => CouponService::class, + 'creditNotes' => CreditNoteService::class, + 'customers' => CustomerService::class, + 'disputes' => DisputeService::class, + 'ephemeralKeys' => EphemeralKeyService::class, + 'events' => EventService::class, + 'exchangeRates' => ExchangeRateService::class, + 'fileLinks' => FileLinkService::class, + 'files' => FileService::class, + 'identity' => Identity\IdentityServiceFactory::class, + 'invoiceItems' => InvoiceItemService::class, + 'invoices' => InvoiceService::class, + 'issuing' => Issuing\IssuingServiceFactory::class, + 'mandates' => MandateService::class, + 'oauth' => OAuthService::class, + 'orderReturns' => OrderReturnService::class, + 'orders' => OrderService::class, + 'paymentIntents' => PaymentIntentService::class, + 'paymentMethods' => PaymentMethodService::class, + 'payouts' => PayoutService::class, + 'plans' => PlanService::class, + 'prices' => PriceService::class, + 'products' => ProductService::class, + 'promotionCodes' => PromotionCodeService::class, + 'quotes' => QuoteService::class, + 'radar' => Radar\RadarServiceFactory::class, + 'refunds' => RefundService::class, + 'reporting' => Reporting\ReportingServiceFactory::class, + 'reviews' => ReviewService::class, + 'setupAttempts' => SetupAttemptService::class, + 'setupIntents' => SetupIntentService::class, + 'shippingRates' => ShippingRateService::class, + 'sigma' => Sigma\SigmaServiceFactory::class, + 'skus' => SkuService::class, + 'sources' => SourceService::class, + 'subscriptionItems' => SubscriptionItemService::class, + 'subscriptions' => SubscriptionService::class, + 'subscriptionSchedules' => SubscriptionScheduleService::class, + 'taxCodes' => TaxCodeService::class, + 'taxRates' => TaxRateService::class, + 'terminal' => Terminal\TerminalServiceFactory::class, + 'tokens' => TokenService::class, + 'topups' => TopupService::class, + 'transfers' => TransferService::class, + 'webhookEndpoints' => WebhookEndpointService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CountrySpecService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CountrySpecService.php new file mode 100644 index 0000000..573444f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CountrySpecService.php @@ -0,0 +1,39 @@ +requestCollection('get', '/v1/country_specs', $params, $opts); + } + + /** + * Returns a Country Spec for a given Country code. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CountrySpec + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/country_specs/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CouponService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CouponService.php new file mode 100644 index 0000000..82a880f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CouponService.php @@ -0,0 +1,104 @@ +requestCollection('get', '/v1/coupons', $params, $opts); + } + + /** + * You can create coupons easily via the coupon management page of the + * Stripe dashboard. Coupon creation is also accessible via the API if you need to + * create coupons on the fly. + * + * A coupon has either a percent_off or an amount_off and + * currency. If you set an amount_off, that amount will + * be subtracted from any invoice’s subtotal. For example, an invoice with a + * subtotal of 100 will have a final total of + * 0 if a coupon with an amount_off of + * 200 is applied to it and an invoice with a subtotal of + * 300 will have a final total of 100 if + * a coupon with an amount_off of 200 is applied to + * it. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Coupon + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/coupons', $params, $opts); + } + + /** + * You can delete coupons via the coupon management page of the + * Stripe dashboard. However, deleting a coupon does not affect any customers who + * have already applied the coupon; it means that new customers can’t redeem the + * coupon. You can also delete coupons via the API. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Coupon + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/coupons/%s', $id), $params, $opts); + } + + /** + * Retrieves the coupon with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Coupon + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/coupons/%s', $id), $params, $opts); + } + + /** + * Updates the metadata of a coupon. Other coupon details (currency, duration, + * amount_off) are, by design, not editable. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Coupon + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/coupons/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CreditNoteService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CreditNoteService.php new file mode 100644 index 0000000..2368140 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CreditNoteService.php @@ -0,0 +1,156 @@ +requestCollection('get', '/v1/credit_notes', $params, $opts); + } + + /** + * When retrieving a credit note, you’ll get a lines property + * containing the the first handful of those items. There is also a URL where you + * can retrieve the full (paginated) list of line items. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allLines($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/credit_notes/%s/lines', $parentId), $params, $opts); + } + + /** + * Issue a credit note to adjust the amount of a finalized invoice. For a + * status=open invoice, a credit note reduces its + * amount_due. For a status=paid invoice, a credit note + * does not affect its amount_due. Instead, it can result in any + * combination of the following:. + * + *
  • Refund: create a new refund (using refund_amount) or link + * an existing refund (using refund).
  • Customer balance + * credit: credit the customer’s balance (using credit_amount) which + * will be automatically applied to their next invoice when it’s finalized.
  • + *
  • Outside of Stripe credit: record the amount that is or will be credited + * outside of Stripe (using out_of_band_amount).
+ * + * For post-payment credit notes the sum of the refund, credit and outside of + * Stripe amounts must equal the credit note total. + * + * You may issue multiple credit notes for an invoice. Each credit note will + * increment the invoice’s pre_payment_credit_notes_amount or + * post_payment_credit_notes_amount depending on its + * status at the time of credit note creation. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/credit_notes', $params, $opts); + } + + /** + * Get a preview of a credit note without creating it. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote + */ + public function preview($params = null, $opts = null) + { + return $this->request('get', '/v1/credit_notes/preview', $params, $opts); + } + + /** + * When retrieving a credit note preview, you’ll get a lines + * property containing the first handful of those items. This URL you can retrieve + * the full (paginated) list of line items. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function previewLines($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/credit_notes/preview/lines', $params, $opts); + } + + /** + * Retrieves the credit note object with the given identifier. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/credit_notes/%s', $id), $params, $opts); + } + + /** + * Updates an existing credit note. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/credit_notes/%s', $id), $params, $opts); + } + + /** + * Marks a credit note as void. Learn more about voiding credit notes. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CreditNote + */ + public function voidCreditNote($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/credit_notes/%s/void', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CustomerService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CustomerService.php new file mode 100644 index 0000000..c05633c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/CustomerService.php @@ -0,0 +1,368 @@ +requestCollection('get', '/v1/customers', $params, $opts); + } + + /** + * Returns a list of transactions that updated the customer’s balances. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allBalanceTransactions($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/customers/%s/balance_transactions', $parentId), $params, $opts); + } + + /** + * Returns a list of PaymentMethods for a given Customer. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allPaymentMethods($id, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/customers/%s/payment_methods', $id), $params, $opts); + } + + /** + * List sources for a specified customer. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allSources($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/customers/%s/sources', $parentId), $params, $opts); + } + + /** + * Returns a list of tax IDs for a customer. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allTaxIds($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/customers/%s/tax_ids', $parentId), $params, $opts); + } + + /** + * Creates a new customer object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Customer + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/customers', $params, $opts); + } + + /** + * Creates an immutable transaction that updates the customer’s credit balance. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public function createBalanceTransaction($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/balance_transactions', $parentId), $params, $opts); + } + + /** + * When you create a new credit card, you must specify a customer or recipient on + * which to create it. + * + * If the card’s owner has no default card, then the new card will become the + * default. However, if the owner already has a default, then it will not change. + * To change the default, you should update the + * customer to have a new default_source. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public function createSource($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/sources', $parentId), $params, $opts); + } + + /** + * Creates a new TaxID object for a customer. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public function createTaxId($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/tax_ids', $parentId), $params, $opts); + } + + /** + * Permanently deletes a customer. It cannot be undone. Also immediately cancels + * any active subscriptions on the customer. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Customer + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/customers/%s', $id), $params, $opts); + } + + /** + * Removes the currently applied discount on a customer. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Customer + */ + public function deleteDiscount($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/customers/%s/discount', $id), $params, $opts); + } + + /** + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public function deleteSource($parentId, $id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/customers/%s/sources/%s', $parentId, $id), $params, $opts); + } + + /** + * Deletes an existing TaxID object. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public function deleteTaxId($parentId, $id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/customers/%s/tax_ids/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieves a Customer object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Customer + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/customers/%s', $id), $params, $opts); + } + + /** + * Retrieves a specific customer balance transaction that updated the customer’s balances. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public function retrieveBalanceTransaction($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/customers/%s/balance_transactions/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieve a specified source for a given customer. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public function retrieveSource($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/customers/%s/sources/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieves the TaxID object with the given identifier. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxId + */ + public function retrieveTaxId($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/customers/%s/tax_ids/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates the specified customer by setting the values of the parameters passed. + * Any parameters not provided will be left unchanged. For example, if you pass the + * source parameter, that becomes the customer’s active source + * (e.g., a card) to be used for all charges in the future. When you update a + * customer to a new valid card source by passing the source + * parameter: for each of the customer’s current subscriptions, if the subscription + * bills automatically and is in the past_due state, then the latest + * open invoice for the subscription with automatic collection enabled will be + * retried. This retry will not count as an automatic retry, and will not affect + * the next regularly scheduled payment for the invoice. Changing the + * default_source for a customer will not trigger this behavior. + * + * This request accepts mostly the same arguments as the customer creation call. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Customer + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s', $id), $params, $opts); + } + + /** + * Most credit balance transaction fields are immutable, but you may update its + * description and metadata. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\CustomerBalanceTransaction + */ + public function updateBalanceTransaction($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/balance_transactions/%s', $parentId, $id), $params, $opts); + } + + /** + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public function updateSource($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/sources/%s', $parentId, $id), $params, $opts); + } + + /** + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source + */ + public function verifySource($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/customers/%s/sources/%s/verify', $parentId, $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/DisputeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/DisputeService.php new file mode 100644 index 0000000..4eb1542 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/DisputeService.php @@ -0,0 +1,83 @@ +requestCollection('get', '/v1/disputes', $params, $opts); + } + + /** + * Closing the dispute for a charge indicates that you do not have any evidence to + * submit and are essentially dismissing the dispute, acknowledging it as lost. + * + * The status of the dispute will change from needs_response to + * lost. Closing a dispute is irreversible. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Dispute + */ + public function close($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/disputes/%s/close', $id), $params, $opts); + } + + /** + * Retrieves the dispute with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Dispute + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/disputes/%s', $id), $params, $opts); + } + + /** + * When you get a dispute, contacting your customer is always the best first step. + * If that doesn’t work, you can submit evidence to help us resolve the dispute in + * your favor. You can do this in your dashboard, but if you prefer, + * you can use the API to submit evidence programmatically. + * + * Depending on your dispute type, different evidence fields will give you a better + * chance of winning your dispute. To figure out which evidence fields to provide, + * see our guide to dispute types. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Dispute + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/disputes/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EphemeralKeyService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EphemeralKeyService.php new file mode 100644 index 0000000..3ca14c9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EphemeralKeyService.php @@ -0,0 +1,43 @@ +request('delete', $this->buildPath('/v1/ephemeral_keys/%s', $id), $params, $opts); + } + + /** + * Creates a short-lived API key for a given resource. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\EphemeralKey + */ + public function create($params = null, $opts = null) + { + if (!$opts || !isset($opts['stripe_version'])) { + throw new \Stripe\Exception\InvalidArgumentException('stripe_version must be specified to create an ephemeral key'); + } + + return $this->request('post', '/v1/ephemeral_keys', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EventService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EventService.php new file mode 100644 index 0000000..430b35a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/EventService.php @@ -0,0 +1,44 @@ +event object api_version + * attribute (not according to your current Stripe API version or + * Stripe-Version header). + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/events', $params, $opts); + } + + /** + * Retrieves the details of an event. Supply the unique identifier of the event, + * which you might have received in a webhook. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Event + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/events/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ExchangeRateService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ExchangeRateService.php new file mode 100644 index 0000000..fc78410 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ExchangeRateService.php @@ -0,0 +1,41 @@ +requestCollection('get', '/v1/exchange_rates', $params, $opts); + } + + /** + * Retrieves the exchange rates from the given currency to every supported + * currency. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ExchangeRate + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/exchange_rates/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileLinkService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileLinkService.php new file mode 100644 index 0000000..7a3a435 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileLinkService.php @@ -0,0 +1,70 @@ +requestCollection('get', '/v1/file_links', $params, $opts); + } + + /** + * Creates a new file link object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\FileLink + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/file_links', $params, $opts); + } + + /** + * Retrieves the file link with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\FileLink + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/file_links/%s', $id), $params, $opts); + } + + /** + * Updates an existing file link object. Expired links can no longer be updated. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\FileLink + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/file_links/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileService.php new file mode 100644 index 0000000..1484288 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/FileService.php @@ -0,0 +1,66 @@ +requestCollection('get', '/v1/files', $params, $opts); + } + + /** + * Retrieves the details of an existing file object. Supply the unique file ID from + * a file, and Stripe will return the corresponding file object. To access file + * contents, see the File Upload + * Guide. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\File + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/files/%s', $id), $params, $opts); + } + + /** + * Create a file. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @return \Stripe\File + */ + public function create($params = null, $opts = null) + { + $opts = \Stripe\Util\RequestOptions::parse($opts); + if (!isset($opts->apiBase)) { + $opts->apiBase = $this->getClient()->getFilesBase(); + } + + // Manually flatten params, otherwise curl's multipart encoder will + // choke on nested null|arrays. + $flatParams = \array_column(\Stripe\Util\Util::flattenParams($params), 1, 0); + + return $this->request('post', '/v1/files', $flatParams, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/IdentityServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/IdentityServiceFactory.php new file mode 100644 index 0000000..cf63146 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/IdentityServiceFactory.php @@ -0,0 +1,27 @@ + + */ + private static $classMap = [ + 'verificationReports' => VerificationReportService::class, + 'verificationSessions' => VerificationSessionService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationReportService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationReportService.php new file mode 100644 index 0000000..0393cd5 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationReportService.php @@ -0,0 +1,39 @@ +requestCollection('get', '/v1/identity/verification_reports', $params, $opts); + } + + /** + * Retrieves an existing VerificationReport. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationReport + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/identity/verification_reports/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationSessionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationSessionService.php new file mode 100644 index 0000000..1a763be --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Identity/VerificationSessionService.php @@ -0,0 +1,146 @@ +requestCollection('get', '/v1/identity/verification_sessions', $params, $opts); + } + + /** + * A VerificationSession object can be canceled when it is in + * requires_input status. + * + * Once canceled, future submission attempts are disabled. This cannot be undone. + * Learn more. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/identity/verification_sessions/%s/cancel', $id), $params, $opts); + } + + /** + * Creates a VerificationSession object. + * + * After the VerificationSession is created, display a verification modal using the + * session client_secret or send your users to the session’s + * url. + * + * If your API key is in test mode, verification checks won’t actually process, + * though everything else will occur as if in live mode. + * + * Related guide: Verify your + * users’ identity documents. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/identity/verification_sessions', $params, $opts); + } + + /** + * Redact a VerificationSession to remove all collected information from Stripe. + * This will redact the VerificationSession and all objects related to it, + * including VerificationReports, Events, request logs, etc. + * + * A VerificationSession object can be redacted when it is in + * requires_input or verified status. Redacting a + * VerificationSession in requires_action state will automatically + * cancel it. + * + * The redaction process may take up to four days. When the redaction process is in + * progress, the VerificationSession’s redaction.status field will be + * set to processing; when the process is finished, it will change to + * redacted and an identity.verification_session.redacted + * event will be emitted. + * + * Redaction is irreversible. Redacted objects are still accessible in the Stripe + * API, but all the fields that contain personal data will be replaced by the + * string [redacted] or a similar placeholder. The + * metadata field will also be erased. Redacted objects cannot be + * updated or used for any purpose. + * + * Learn more. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession + */ + public function redact($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/identity/verification_sessions/%s/redact', $id), $params, $opts); + } + + /** + * Retrieves the details of a VerificationSession that was previously created. + * + * When the session status is requires_input, you can use this method + * to retrieve a valid client_secret or url to allow + * re-submission. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/identity/verification_sessions/%s', $id), $params, $opts); + } + + /** + * Updates a VerificationSession object. + * + * When the session status is requires_input, you can use this method + * to update the verification check and options. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Identity\VerificationSession + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/identity/verification_sessions/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceItemService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceItemService.php new file mode 100644 index 0000000..0f0b9e9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceItemService.php @@ -0,0 +1,93 @@ +requestCollection('get', '/v1/invoiceitems', $params, $opts); + } + + /** + * Creates an item to be added to a draft invoice (up to 250 items per invoice). If + * no invoice is specified, the item will be on the next invoice created for the + * customer specified. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\InvoiceItem + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/invoiceitems', $params, $opts); + } + + /** + * Deletes an invoice item, removing it from an invoice. Deleting invoice items is + * only possible when they’re not attached to invoices, or if it’s attached to a + * draft invoice. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\InvoiceItem + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/invoiceitems/%s', $id), $params, $opts); + } + + /** + * Retrieves the invoice item with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\InvoiceItem + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/invoiceitems/%s', $id), $params, $opts); + } + + /** + * Updates the amount or description of an invoice item on an upcoming invoice. + * Updating an invoice item is only possible before the invoice it’s attached to is + * closed. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\InvoiceItem + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoiceitems/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceService.php new file mode 100644 index 0000000..4e2efe6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/InvoiceService.php @@ -0,0 +1,272 @@ +requestCollection('get', '/v1/invoices', $params, $opts); + } + + /** + * When retrieving an invoice, you’ll get a lines property + * containing the total count of line items and the first handful of those items. + * There is also a URL where you can retrieve the full (paginated) list of line + * items. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allLines($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/invoices/%s/lines', $parentId), $params, $opts); + } + + /** + * This endpoint creates a draft invoice for a given customer. The draft invoice + * created pulls in all pending invoice items on that customer, including + * prorations. The invoice remains a draft until you finalize the invoice, which allows you to pay or send the invoice to + * your customers. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/invoices', $params, $opts); + } + + /** + * Permanently deletes a one-off invoice draft. This cannot be undone. Attempts to + * delete invoices that are no longer in a draft state will fail; once an invoice + * has been finalized or if an invoice is for a subscription, it must be voided. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/invoices/%s', $id), $params, $opts); + } + + /** + * Stripe automatically finalizes drafts before sending and attempting payment on + * invoices. However, if you’d like to finalize a draft invoice manually, you can + * do so using this method. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function finalizeInvoice($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s/finalize', $id), $params, $opts); + } + + /** + * Marking an invoice as uncollectible is useful for keeping track of bad debts + * that can be written off for accounting purposes. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function markUncollectible($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s/mark_uncollectible', $id), $params, $opts); + } + + /** + * Stripe automatically creates and then attempts to collect payment on invoices + * for customers on subscriptions according to your subscriptions + * settings. However, if you’d like to attempt payment on an invoice out of the + * normal collection schedule or for some other reason, you can do so. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function pay($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s/pay', $id), $params, $opts); + } + + /** + * Retrieves the invoice with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/invoices/%s', $id), $params, $opts); + } + + /** + * Stripe will automatically send invoices to customers according to your subscriptions + * settings. However, if you’d like to manually send an invoice to your + * customer out of the normal schedule, you can do so. When sending invoices that + * have already been paid, there will be no reference to the payment in the email. + * + * Requests made in test-mode result in no emails being sent, despite sending an + * invoice.sent event. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function sendInvoice($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s/send', $id), $params, $opts); + } + + /** + * At any time, you can preview the upcoming invoice for a customer. This will show + * you all the charges that are pending, including subscription renewal charges, + * invoice item charges, etc. It will also show you any discounts that are + * applicable to the invoice. + * + * Note that when you are viewing an upcoming invoice, you are simply viewing a + * preview – the invoice has not yet been created. As such, the upcoming invoice + * will not show up in invoice listing calls, and you cannot use the API to pay or + * edit the invoice. If you want to change the amount that your customer will be + * billed, you can add, remove, or update pending invoice items, or update the + * customer’s discount. + * + * You can preview the effects of updating a subscription, including a preview of + * what proration will take place. To ensure that the actual proration is + * calculated exactly the same as the previewed proration, you should pass a + * proration_date parameter when doing the actual subscription update. + * The value passed in should be the same as the + * subscription_proration_date returned on the upcoming invoice + * resource. The recommended way to get only the prorations being previewed is to + * consider only proration line items where period[start] is equal to + * the subscription_proration_date on the upcoming invoice resource. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function upcoming($params = null, $opts = null) + { + return $this->request('get', '/v1/invoices/upcoming', $params, $opts); + } + + /** + * When retrieving an upcoming invoice, you’ll get a lines + * property containing the total count of line items and the first handful of those + * items. There is also a URL where you can retrieve the full (paginated) list of + * line items. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function upcomingLines($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/invoices/upcoming/lines', $params, $opts); + } + + /** + * Draft invoices are fully editable. Once an invoice is finalized, monetary values, + * as well as collection_method, become uneditable. + * + * If you would like to stop the Stripe Billing engine from automatically + * finalizing, reattempting payments on, sending reminders for, or automatically reconciling + * invoices, pass auto_advance=false. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s', $id), $params, $opts); + } + + /** + * Mark a finalized invoice as void. This cannot be undone. Voiding an invoice is + * similar to deletion, however it only applies to + * finalized invoices and maintains a papertrail where the invoice can still be + * found. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Invoice + */ + public function voidInvoice($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/invoices/%s/void', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/AuthorizationService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/AuthorizationService.php new file mode 100644 index 0000000..6fff70e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/AuthorizationService.php @@ -0,0 +1,97 @@ +Authorization objects. The objects are + * sorted in descending order by creation date, with the most recently created + * object appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/issuing/authorizations', $params, $opts); + } + + /** + * Approves a pending Issuing Authorization object. This request + * should be made within the timeout window of the real-time + * authorization flow. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization + */ + public function approve($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/authorizations/%s/approve', $id), $params, $opts); + } + + /** + * Declines a pending Issuing Authorization object. This request + * should be made within the timeout window of the real time + * authorization flow. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization + */ + public function decline($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/authorizations/%s/decline', $id), $params, $opts); + } + + /** + * Retrieves an Issuing Authorization object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/issuing/authorizations/%s', $id), $params, $opts); + } + + /** + * Updates the specified Issuing Authorization object by setting the + * values of the parameters passed. Any parameters not provided will be left + * unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Authorization + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/authorizations/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardService.php new file mode 100644 index 0000000..346d54a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardService.php @@ -0,0 +1,73 @@ +Card objects. The objects are sorted in + * descending order by creation date, with the most recently created object + * appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/issuing/cards', $params, $opts); + } + + /** + * Creates an Issuing Card object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Card + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/issuing/cards', $params, $opts); + } + + /** + * Retrieves an Issuing Card object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Card + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/issuing/cards/%s', $id), $params, $opts); + } + + /** + * Updates the specified Issuing Card object by setting the values of + * the parameters passed. Any parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Card + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/cards/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardholderService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardholderService.php new file mode 100644 index 0000000..5731b1b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/CardholderService.php @@ -0,0 +1,74 @@ +Cardholder objects. The objects are + * sorted in descending order by creation date, with the most recently created + * object appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/issuing/cardholders', $params, $opts); + } + + /** + * Creates a new Issuing Cardholder object that can be issued cards. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Cardholder + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/issuing/cardholders', $params, $opts); + } + + /** + * Retrieves an Issuing Cardholder object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Cardholder + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/issuing/cardholders/%s', $id), $params, $opts); + } + + /** + * Updates the specified Issuing Cardholder object by setting the + * values of the parameters passed. Any parameters not provided will be left + * unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Cardholder + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/cardholders/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/DisputeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/DisputeService.php new file mode 100644 index 0000000..ab5df5f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/DisputeService.php @@ -0,0 +1,99 @@ +Dispute objects. The objects are sorted + * in descending order by creation date, with the most recently created object + * appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/issuing/disputes', $params, $opts); + } + + /** + * Creates an Issuing Dispute object. Individual pieces of evidence + * within the evidence object are optional at this point. Stripe only + * validates that required evidence is present during submission. Refer to Dispute + * reasons and evidence for more details about evidence requirements. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Dispute + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/issuing/disputes', $params, $opts); + } + + /** + * Retrieves an Issuing Dispute object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Dispute + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/issuing/disputes/%s', $id), $params, $opts); + } + + /** + * Submits an Issuing Dispute to the card network. Stripe validates + * that all evidence fields required for the dispute’s reason are present. For more + * details, see Dispute + * reasons and evidence. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Dispute + */ + public function submit($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/disputes/%s/submit', $id), $params, $opts); + } + + /** + * Updates the specified Issuing Dispute object by setting the values + * of the parameters passed. Any parameters not provided will be left unchanged. + * Properties on the evidence object can be unset by passing in an + * empty string. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Dispute + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/disputes/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/IssuingServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/IssuingServiceFactory.php new file mode 100644 index 0000000..a8d5d0f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/IssuingServiceFactory.php @@ -0,0 +1,33 @@ + + */ + private static $classMap = [ + 'authorizations' => AuthorizationService::class, + 'cardholders' => CardholderService::class, + 'cards' => CardService::class, + 'disputes' => DisputeService::class, + 'transactions' => TransactionService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/TransactionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/TransactionService.php new file mode 100644 index 0000000..8fb0ee2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Issuing/TransactionService.php @@ -0,0 +1,59 @@ +Transaction objects. The objects are + * sorted in descending order by creation date, with the most recently created + * object appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/issuing/transactions', $params, $opts); + } + + /** + * Retrieves an Issuing Transaction object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Transaction + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/issuing/transactions/%s', $id), $params, $opts); + } + + /** + * Updates the specified Issuing Transaction object by setting the + * values of the parameters passed. Any parameters not provided will be left + * unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Issuing\Transaction + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/issuing/transactions/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/MandateService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/MandateService.php new file mode 100644 index 0000000..156bff0 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/MandateService.php @@ -0,0 +1,24 @@ +request('get', $this->buildPath('/v1/mandates/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OAuthService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OAuthService.php new file mode 100644 index 0000000..b745ad9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OAuthService.php @@ -0,0 +1,150 @@ +_parseOpts($opts); + $opts->apiBase = $this->_getBase($opts); + + return $this->request($method, $path, $params, $opts); + } + + /** + * Generates a URL to Stripe's OAuth form. + * + * @param null|array $params + * @param null|array $opts + * + * @return string the URL to Stripe's OAuth form + */ + public function authorizeUrl($params = null, $opts = null) + { + $params = $params ?: []; + + $opts = $this->_parseOpts($opts); + $base = $this->_getBase($opts); + + $params['client_id'] = $this->_getClientId($params); + if (!\array_key_exists('response_type', $params)) { + $params['response_type'] = 'code'; + } + $query = \Stripe\Util\Util::encodeParameters($params); + + return $base . '/oauth/authorize?' . $query; + } + + /** + * Use an authoriztion code to connect an account to your platform and + * fetch the user's credentials. + * + * @param null|array $params + * @param null|array $opts + * + * @throws \Stripe\Exception\OAuth\OAuthErrorException if the request fails + * + * @return \Stripe\StripeObject object containing the response from the API + */ + public function token($params = null, $opts = null) + { + $params = $params ?: []; + $params['client_secret'] = $this->_getClientSecret($params); + + return $this->requestConnect('post', '/oauth/token', $params, $opts); + } + + /** + * Disconnects an account from your platform. + * + * @param null|array $params + * @param null|array $opts + * + * @throws \Stripe\Exception\OAuth\OAuthErrorException if the request fails + * + * @return \Stripe\StripeObject object containing the response from the API + */ + public function deauthorize($params = null, $opts = null) + { + $params = $params ?: []; + $params['client_id'] = $this->_getClientId($params); + + return $this->requestConnect('post', '/oauth/deauthorize', $params, $opts); + } + + private function _getClientId($params = null) + { + $clientId = ($params && \array_key_exists('client_id', $params)) ? $params['client_id'] : null; + + if (null === $clientId) { + $clientId = $this->client->getClientId(); + } + if (null === $clientId) { + $msg = 'No client_id provided. (HINT: set your client_id using ' + . '`new \Stripe\StripeClient([clientId => + ])`)". You can find your client_ids ' + . 'in your Stripe dashboard at ' + . 'https://dashboard.stripe.com/account/applications/settings, ' + . 'after registering your account as a platform. See ' + . 'https://stripe.com/docs/connect/standard-accounts for details, ' + . 'or email support@stripe.com if you have any questions.'; + + throw new \Stripe\Exception\AuthenticationException($msg); + } + + return $clientId; + } + + private function _getClientSecret($params = null) + { + if (\array_key_exists('client_secret', $params)) { + return $params['client_secret']; + } + + return $this->client->getApiKey(); + } + + /** + * @param array|\Stripe\Util\RequestOptions $opts the special modifiers of the request + * + * @throws \Stripe\Exception\InvalidArgumentException + * + * @return \Stripe\Util\RequestOptions + */ + private function _parseOpts($opts) + { + if (\is_array($opts)) { + if (\array_key_exists('connect_base', $opts)) { + // Throw an exception for the convenience of anybody migrating to + // \Stripe\Service\OAuthService from \Stripe\OAuth, where `connect_base` + // was the name of the parameter that behaves as `api_base` does here. + throw new \Stripe\Exception\InvalidArgumentException('Use `api_base`, not `connect_base`'); + } + } + + return \Stripe\Util\RequestOptions::parse($opts); + } + + /** + * @param \Stripe\Util\RequestOptions $opts + * + * @return string + */ + private function _getBase($opts) + { + return isset($opts->apiBase) ? + $opts->apiBase : + $this->client->getConnectBase(); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderReturnService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderReturnService.php new file mode 100644 index 0000000..6183166 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderReturnService.php @@ -0,0 +1,42 @@ +requestCollection('get', '/v1/order_returns', $params, $opts); + } + + /** + * Retrieves the details of an existing order return. Supply the unique order ID + * from either an order return creation request or the order return list, and + * Stripe will return the corresponding order information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\OrderReturn + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/order_returns/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderService.php new file mode 100644 index 0000000..fa658fa --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/OrderService.php @@ -0,0 +1,109 @@ +requestCollection('get', '/v1/orders', $params, $opts); + } + + /** + * Creates a new order object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/orders', $params, $opts); + } + + /** + * Pay an order by providing a source to create a payment. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order + */ + public function pay($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/orders/%s/pay', $id), $params, $opts); + } + + /** + * Retrieves the details of an existing order. Supply the unique order ID from + * either an order creation request or the order list, and Stripe will return the + * corresponding order information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/orders/%s', $id), $params, $opts); + } + + /** + * Return all or part of an order. The order must have a status of + * paid or fulfilled before it can be returned. Once all + * items have been returned, the order will become canceled or + * returned depending on which status the order started in. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order + */ + public function returnOrder($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/orders/%s/returns', $id), $params, $opts); + } + + /** + * Updates the specific order by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Order + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/orders/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentIntentService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentIntentService.php new file mode 100644 index 0000000..912cec1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentIntentService.php @@ -0,0 +1,182 @@ +requestCollection('get', '/v1/payment_intents', $params, $opts); + } + + /** + * A PaymentIntent object can be canceled when it is in one of these statuses: + * requires_payment_method, requires_capture, + * requires_confirmation, requires_action, or + * processing. + * + * Once canceled, no additional charges will be made by the PaymentIntent and any + * operations on the PaymentIntent will fail with an error. For PaymentIntents with + * status=’requires_capture’, the remaining + * amount_capturable will automatically be refunded. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_intents/%s/cancel', $id), $params, $opts); + } + + /** + * Capture the funds of an existing uncaptured PaymentIntent when its status is + * requires_capture. + * + * Uncaptured PaymentIntents will be canceled a set number of days after they are + * created (7 by default). + * + * Learn more about separate authorization + * and capture. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function capture($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_intents/%s/capture', $id), $params, $opts); + } + + /** + * Confirm that your customer intends to pay with current or provided payment + * method. Upon confirmation, the PaymentIntent will attempt to initiate a payment. + * + * If the selected payment method requires additional authentication steps, the + * PaymentIntent will transition to the requires_action status and + * suggest additional actions via next_action. If payment fails, the + * PaymentIntent will transition to the requires_payment_method + * status. If payment succeeds, the PaymentIntent will transition to the + * succeeded status (or requires_capture, if + * capture_method is set to manual). + * + * If the confirmation_method is automatic, payment may + * be attempted using our client SDKs and + * the PaymentIntent’s client_secret. After + * next_actions are handled by the client, no additional confirmation + * is required to complete the payment. + * + * If the confirmation_method is manual, all payment + * attempts must be initiated using a secret key. If any actions are required for + * the payment, the PaymentIntent will return to the + * requires_confirmation state after those actions are completed. Your + * server needs to then explicitly re-confirm the PaymentIntent to initiate the + * next payment attempt. Read the expanded documentation to + * learn more about manual confirmation. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function confirm($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_intents/%s/confirm', $id), $params, $opts); + } + + /** + * Creates a PaymentIntent object. + * + * After the PaymentIntent is created, attach a payment method and confirm to continue the payment. + * You can read more about the different payment flows available via the Payment + * Intents API here. + * + * When confirm=true is used during creation, it is equivalent to + * creating and confirming the PaymentIntent in the same call. You may use any + * parameters available in the confirm + * API when confirm=true is supplied. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/payment_intents', $params, $opts); + } + + /** + * Retrieves the details of a PaymentIntent that has previously been created. + * + * Client-side retrieval using a publishable key is allowed when the + * client_secret is provided in the query string. + * + * When retrieved with a publishable key, only a subset of properties will be + * returned. Please refer to the payment + * intent object reference for more details. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/payment_intents/%s', $id), $params, $opts); + } + + /** + * Updates properties on a PaymentIntent object without confirming. + * + * Depending on which properties you update, you may need to confirm the + * PaymentIntent again. For example, updating the payment_method will + * always require you to confirm the PaymentIntent again. If you prefer to update + * and confirm at the same time, we recommend updating properties via the confirm API instead. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentIntent + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_intents/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentMethodService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentMethodService.php new file mode 100644 index 0000000..e7f341a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PaymentMethodService.php @@ -0,0 +1,129 @@ +List a Customer’s + * PaymentMethods. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/payment_methods', $params, $opts); + } + + /** + * Attaches a PaymentMethod object to a Customer. + * + * To attach a new PaymentMethod to a customer for future payments, we recommend + * you use a SetupIntent or a PaymentIntent + * with setup_future_usage. + * These approaches will perform any necessary steps to ensure that the + * PaymentMethod can be used in a future payment. Using the + * /v1/payment_methods/:id/attach endpoint does not ensure that future + * payments can be made with the attached PaymentMethod. See Optimizing cards for future + * payments for more information about setting up future payments. + * + * To use this PaymentMethod as the default for invoice or subscription payments, + * set invoice_settings.default_payment_method, + * on the Customer to the PaymentMethod’s ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod + */ + public function attach($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_methods/%s/attach', $id), $params, $opts); + } + + /** + * Creates a PaymentMethod object. Read the Stripe.js + * reference to learn how to create PaymentMethods via Stripe.js. + * + * Instead of creating a PaymentMethod directly, we recommend using the PaymentIntents API to accept a + * payment immediately or the SetupIntent API to collect payment + * method details ahead of a future payment. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/payment_methods', $params, $opts); + } + + /** + * Detaches a PaymentMethod object from a Customer. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod + */ + public function detach($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_methods/%s/detach', $id), $params, $opts); + } + + /** + * Retrieves a PaymentMethod object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/payment_methods/%s', $id), $params, $opts); + } + + /** + * Updates a PaymentMethod object. A PaymentMethod must be attached a customer to + * be updated. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PaymentMethod + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payment_methods/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PayoutService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PayoutService.php new file mode 100644 index 0000000..547e22d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PayoutService.php @@ -0,0 +1,127 @@ +requestCollection('get', '/v1/payouts', $params, $opts); + } + + /** + * A previously created payout can be canceled if it has not yet been paid out. + * Funds will be refunded to your available balance. You may not cancel automatic + * Stripe payouts. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payouts/%s/cancel', $id), $params, $opts); + } + + /** + * To send funds to your own bank account, you create a new payout object. Your Stripe balance must be able to cover the payout amount, or + * you’ll receive an “Insufficient Funds” error. + * + * If your API key is in test mode, money won’t actually be sent, though everything + * else will occur as if in live mode. + * + * If you are creating a manual payout on a Stripe account that uses multiple + * payment source types, you’ll need to specify the source type balance that the + * payout should draw from. The balance object + * details available and pending amounts by source type. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/payouts', $params, $opts); + } + + /** + * Retrieves the details of an existing payout. Supply the unique payout ID from + * either a payout creation request or the payout list, and Stripe will return the + * corresponding payout information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/payouts/%s', $id), $params, $opts); + } + + /** + * Reverses a payout by debiting the destination bank account. Only payouts for + * connected accounts to US bank accounts may be reversed at this time. If the + * payout is in the pending status, + * /v1/payouts/:id/cancel should be used instead. + * + * By requesting a reversal via /v1/payouts/:id/reverse, you confirm + * that the authorized signatory of the selected bank account has authorized the + * debit on the bank account and that no other authorization is required. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout + */ + public function reverse($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payouts/%s/reverse', $id), $params, $opts); + } + + /** + * Updates the specified payout by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. This request accepts only the + * metadata as arguments. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Payout + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/payouts/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PlanService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PlanService.php new file mode 100644 index 0000000..16625d2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PlanService.php @@ -0,0 +1,91 @@ +requestCollection('get', '/v1/plans', $params, $opts); + } + + /** + * You can now model subscriptions more flexibly using the Prices + * API. It replaces the Plans API and is backwards compatible to simplify your + * migration. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Plan + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/plans', $params, $opts); + } + + /** + * Deleting plans means new subscribers can’t be added. Existing subscribers aren’t + * affected. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Plan + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/plans/%s', $id), $params, $opts); + } + + /** + * Retrieves the plan with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Plan + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/plans/%s', $id), $params, $opts); + } + + /** + * Updates the specified plan by setting the values of the parameters passed. Any + * parameters not provided are left unchanged. By design, you cannot change a + * plan’s ID, amount, currency, or billing cycle. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Plan + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/plans/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PriceService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PriceService.php new file mode 100644 index 0000000..cc44f69 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PriceService.php @@ -0,0 +1,72 @@ +requestCollection('get', '/v1/prices', $params, $opts); + } + + /** + * Creates a new price for an existing product. The price can be recurring or + * one-time. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Price + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/prices', $params, $opts); + } + + /** + * Retrieves the price with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Price + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/prices/%s', $id), $params, $opts); + } + + /** + * Updates the specified price by setting the values of the parameters passed. Any + * parameters not provided are left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Price + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/prices/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ProductService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ProductService.php new file mode 100644 index 0000000..850cea5 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ProductService.php @@ -0,0 +1,92 @@ +requestCollection('get', '/v1/products', $params, $opts); + } + + /** + * Creates a new product object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Product + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/products', $params, $opts); + } + + /** + * Delete a product. Deleting a product is only possible if it has no prices + * associated with it. Additionally, deleting a product with type=good + * is only possible if it has no SKUs associated with it. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Product + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/products/%s', $id), $params, $opts); + } + + /** + * Retrieves the details of an existing product. Supply the unique product ID from + * either a product creation request or the product list, and Stripe will return + * the corresponding product information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Product + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/products/%s', $id), $params, $opts); + } + + /** + * Updates the specific product by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Product + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/products/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PromotionCodeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PromotionCodeService.php new file mode 100644 index 0000000..e4c3d20 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/PromotionCodeService.php @@ -0,0 +1,75 @@ +requestCollection('get', '/v1/promotion_codes', $params, $opts); + } + + /** + * A promotion code points to a coupon. You can optionally restrict the code to a + * specific customer, redemption limit, and expiration date. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PromotionCode + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/promotion_codes', $params, $opts); + } + + /** + * Retrieves the promotion code with the given ID. In order to retrieve a promotion + * code by the customer-facing code use list with the desired + * code. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PromotionCode + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/promotion_codes/%s', $id), $params, $opts); + } + + /** + * Updates the specified promotion code by setting the values of the parameters + * passed. Most fields are, by design, not editable. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\PromotionCode + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/promotion_codes/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/QuoteService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/QuoteService.php new file mode 100644 index 0000000..96f12a5 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/QuoteService.php @@ -0,0 +1,177 @@ +request('post', $this->buildPath('/v1/quotes/%s/accept', $id), $params, $opts); + } + + /** + * Returns a list of your quotes. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/quotes', $params, $opts); + } + + /** + * When retrieving a quote, there is an includable computed.upfront.line_items + * property containing the first handful of those items. There is also a URL where + * you can retrieve the full (paginated) list of upfront line items. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allComputedUpfrontLineItems($id, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/quotes/%s/computed_upfront_line_items', $id), $params, $opts); + } + + /** + * When retrieving a quote, there is an includable line_items + * property containing the first handful of those items. There is also a URL where + * you can retrieve the full (paginated) list of line items. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allLineItems($id, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/quotes/%s/line_items', $id), $params, $opts); + } + + /** + * Cancels the quote. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/quotes/%s/cancel', $id), $params, $opts); + } + + /** + * A quote models prices and services for a customer. Default options for + * header, description, footer, and + * expires_at can be set in the dashboard via the quote template. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/quotes', $params, $opts); + } + + /** + * Finalizes the quote. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote + */ + public function finalizeQuote($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/quotes/%s/finalize', $id), $params, $opts); + } + + /** + * Retrieves the quote with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/quotes/%s', $id), $params, $opts); + } + + /** + * A quote models prices and services for a customer. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Quote + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/quotes/%s', $id), $params, $opts); + } + + /** + * Download the PDF for a finalized quote. + * + * @param string $id + * @param callable $readBodyChunkCallable + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + */ + public function pdf($id, $readBodyChunkCallable, $params = null, $opts = null) + { + $opts = \Stripe\Util\RequestOptions::parse($opts); + if (!isset($opts->apiBase)) { + $opts->apiBase = $this->getClient()->getFilesBase(); + } + $this->requestStream('get', $this->buildPath('/v1/quotes/%s/pdf', $id), $readBodyChunkCallable, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/EarlyFraudWarningService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/EarlyFraudWarningService.php new file mode 100644 index 0000000..7b09734 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/EarlyFraudWarningService.php @@ -0,0 +1,43 @@ +requestCollection('get', '/v1/radar/early_fraud_warnings', $params, $opts); + } + + /** + * Retrieves the details of an early fraud warning that has previously been + * created. + * + * Please refer to the early fraud + * warning object reference for more details. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\EarlyFraudWarning + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/radar/early_fraud_warnings/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/RadarServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/RadarServiceFactory.php new file mode 100644 index 0000000..b093c67 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/RadarServiceFactory.php @@ -0,0 +1,29 @@ + + */ + private static $classMap = [ + 'earlyFraudWarnings' => EarlyFraudWarningService::class, + 'valueListItems' => ValueListItemService::class, + 'valueLists' => ValueListService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListItemService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListItemService.php new file mode 100644 index 0000000..89eba2a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListItemService.php @@ -0,0 +1,74 @@ +ValueListItem objects. The objects are sorted in + * descending order by creation date, with the most recently created object + * appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/radar/value_list_items', $params, $opts); + } + + /** + * Creates a new ValueListItem object, which is added to the specified + * parent value list. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueListItem + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/radar/value_list_items', $params, $opts); + } + + /** + * Deletes a ValueListItem object, removing it from its parent value + * list. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueListItem + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/radar/value_list_items/%s', $id), $params, $opts); + } + + /** + * Retrieves a ValueListItem object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueListItem + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/radar/value_list_items/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListService.php new file mode 100644 index 0000000..64ac2ee --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Radar/ValueListService.php @@ -0,0 +1,93 @@ +ValueList objects. The objects are sorted in + * descending order by creation date, with the most recently created object + * appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/radar/value_lists', $params, $opts); + } + + /** + * Creates a new ValueList object, which can then be referenced in + * rules. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueList + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/radar/value_lists', $params, $opts); + } + + /** + * Deletes a ValueList object, also deleting any items contained + * within the value list. To be deleted, a value list must not be referenced in any + * rules. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueList + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/radar/value_lists/%s', $id), $params, $opts); + } + + /** + * Retrieves a ValueList object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueList + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/radar/value_lists/%s', $id), $params, $opts); + } + + /** + * Updates a ValueList object by setting the values of the parameters + * passed. Any parameters not provided will be left unchanged. Note that + * item_type is immutable. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Radar\ValueList + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/radar/value_lists/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/RefundService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/RefundService.php new file mode 100644 index 0000000..49b4267 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/RefundService.php @@ -0,0 +1,76 @@ +requestCollection('get', '/v1/refunds', $params, $opts); + } + + /** + * Create a refund. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Refund + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/refunds', $params, $opts); + } + + /** + * Retrieves the details of an existing refund. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Refund + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/refunds/%s', $id), $params, $opts); + } + + /** + * Updates the specified refund by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * This request only accepts metadata as an argument. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Refund + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/refunds/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportRunService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportRunService.php new file mode 100644 index 0000000..692420c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportRunService.php @@ -0,0 +1,55 @@ +requestCollection('get', '/v1/reporting/report_runs', $params, $opts); + } + + /** + * Creates a new object and begin running the report. (Certain report types require + * a live-mode API key.). + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Reporting\ReportRun + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/reporting/report_runs', $params, $opts); + } + + /** + * Retrieves the details of an existing Report Run. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Reporting\ReportRun + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/reporting/report_runs/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportTypeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportTypeService.php new file mode 100644 index 0000000..e1b4ea5 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportTypeService.php @@ -0,0 +1,40 @@ +requestCollection('get', '/v1/reporting/report_types', $params, $opts); + } + + /** + * Retrieves the details of a Report Type. (Certain report types require a live-mode API key.). + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Reporting\ReportType + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/reporting/report_types/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportingServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportingServiceFactory.php new file mode 100644 index 0000000..7832e91 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Reporting/ReportingServiceFactory.php @@ -0,0 +1,27 @@ + + */ + private static $classMap = [ + 'reportRuns' => ReportRunService::class, + 'reportTypes' => ReportTypeService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ReviewService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ReviewService.php new file mode 100644 index 0000000..ea152f2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ReviewService.php @@ -0,0 +1,58 @@ +Review objects that have open set to + * true. The objects are sorted in descending order by creation date, + * with the most recently created object appearing first. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/reviews', $params, $opts); + } + + /** + * Approves a Review object, closing it and removing it from the list + * of reviews. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Review + */ + public function approve($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/reviews/%s/approve', $id), $params, $opts); + } + + /** + * Retrieves a Review object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Review + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/reviews/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupAttemptService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupAttemptService.php new file mode 100644 index 0000000..7376ea1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupAttemptService.php @@ -0,0 +1,23 @@ +requestCollection('get', '/v1/setup_attempts', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupIntentService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupIntentService.php new file mode 100644 index 0000000..3cbec50 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SetupIntentService.php @@ -0,0 +1,127 @@ +requestCollection('get', '/v1/setup_intents', $params, $opts); + } + + /** + * A SetupIntent object can be canceled when it is in one of these statuses: + * requires_payment_method, requires_confirmation, or + * requires_action. + * + * Once canceled, setup is abandoned and any operations on the SetupIntent will + * fail with an error. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/setup_intents/%s/cancel', $id), $params, $opts); + } + + /** + * Confirm that your customer intends to set up the current or provided payment + * method. For example, you would confirm a SetupIntent when a customer hits the + * “Save” button on a payment method management page on your website. + * + * If the selected payment method does not require any additional steps from the + * customer, the SetupIntent will transition to the succeeded status. + * + * Otherwise, it will transition to the requires_action status and + * suggest additional actions via next_action. If setup fails, the + * SetupIntent will transition to the requires_payment_method status. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent + */ + public function confirm($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/setup_intents/%s/confirm', $id), $params, $opts); + } + + /** + * Creates a SetupIntent object. + * + * After the SetupIntent is created, attach a payment method and confirm to collect any required + * permissions to charge the payment method later. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/setup_intents', $params, $opts); + } + + /** + * Retrieves the details of a SetupIntent that has previously been created. + * + * Client-side retrieval using a publishable key is allowed when the + * client_secret is provided in the query string. + * + * When retrieved with a publishable key, only a subset of properties will be + * returned. Please refer to the SetupIntent + * object reference for more details. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/setup_intents/%s', $id), $params, $opts); + } + + /** + * Updates a SetupIntent object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/setup_intents/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ShippingRateService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ShippingRateService.php new file mode 100644 index 0000000..d7b55a8 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/ShippingRateService.php @@ -0,0 +1,70 @@ +requestCollection('get', '/v1/shipping_rates', $params, $opts); + } + + /** + * Creates a new shipping rate object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ShippingRate + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/shipping_rates', $params, $opts); + } + + /** + * Returns the shipping rate object with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ShippingRate + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/shipping_rates/%s', $id), $params, $opts); + } + + /** + * Updates an existing shipping rate object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\ShippingRate + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/shipping_rates/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/ScheduledQueryRunService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/ScheduledQueryRunService.php new file mode 100644 index 0000000..9264175 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/ScheduledQueryRunService.php @@ -0,0 +1,39 @@ +requestCollection('get', '/v1/sigma/scheduled_query_runs', $params, $opts); + } + + /** + * Retrieves the details of an scheduled query run. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Sigma\ScheduledQueryRun + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/sigma/scheduled_query_runs/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/SigmaServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/SigmaServiceFactory.php new file mode 100644 index 0000000..356750f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Sigma/SigmaServiceFactory.php @@ -0,0 +1,25 @@ + + */ + private static $classMap = [ + 'scheduledQueryRuns' => ScheduledQueryRunService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SkuService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SkuService.php new file mode 100644 index 0000000..8934f20 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SkuService.php @@ -0,0 +1,95 @@ +requestCollection('get', '/v1/skus', $params, $opts); + } + + /** + * Creates a new SKU associated with a product. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SKU + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/skus', $params, $opts); + } + + /** + * Delete a SKU. Deleting a SKU is only possible until it has been used in an + * order. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SKU + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/skus/%s', $id), $params, $opts); + } + + /** + * Retrieves the details of an existing SKU. Supply the unique SKU identifier from + * either a SKU creation request or from the product, and Stripe will return the + * corresponding SKU information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SKU + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/skus/%s', $id), $params, $opts); + } + + /** + * Updates the specific SKU by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * Note that a SKU’s attributes are not editable. Instead, you would + * need to deactivate the existing SKU and create a new one with the new attribute + * values. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SKU + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/skus/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SourceService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SourceService.php new file mode 100644 index 0000000..c6cc059 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SourceService.php @@ -0,0 +1,110 @@ +request('get', $this->buildPath('/v1/sources/%s/source_transactions', $id), $params, $opts); + } + + /** + * Creates a new source object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/sources', $params, $opts); + } + + /** + * Delete a specified source for a given customer. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source + */ + public function detach($parentId, $id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/customers/%s/sources/%s', $parentId, $id), $params, $opts); + } + + /** + * Retrieves an existing source object. Supply the unique source ID from a source + * creation request and Stripe will return the corresponding up-to-date source + * object information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/sources/%s', $id), $params, $opts); + } + + /** + * Updates the specified source by setting the values of the parameters passed. Any + * parameters not provided will be left unchanged. + * + * This request accepts the metadata and owner as + * arguments. It is also possible to update type specific information for selected + * payment methods. Please refer to our payment method + * guides for more detail. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/sources/%s', $id), $params, $opts); + } + + /** + * Verify a given source. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source + */ + public function verify($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/sources/%s/verify', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionItemService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionItemService.php new file mode 100644 index 0000000..3b2aa2b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionItemService.php @@ -0,0 +1,151 @@ +requestCollection('get', '/v1/subscription_items', $params, $opts); + } + + /** + * For the specified subscription item, returns a list of summary objects. Each + * object in the list provides usage information that’s been summarized from + * multiple usage records and over a subscription billing period (e.g., 15 usage + * records in the month of September). + * + * The list is sorted in reverse-chronological order (newest first). The first list + * item represents the most current usage period that hasn’t ended yet. Since new + * usage records can still be added, the returned summary information for the + * subscription item’s ID should be seen as unstable until the subscription billing + * period ends. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allUsageRecordSummaries($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/subscription_items/%s/usage_record_summaries', $parentId), $params, $opts); + } + + /** + * Adds a new item to an existing subscription. No existing items will be changed + * or replaced. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionItem + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/subscription_items', $params, $opts); + } + + /** + * Creates a usage record for a specified subscription item and date, and fills it + * with a quantity. + * + * Usage records provide quantity information that Stripe uses to + * track how much a customer is using your service. With usage information and the + * pricing model set up by the metered + * billing plan, Stripe helps you send accurate invoices to your customers. + * + * The default calculation for usage is to add up all the quantity + * values of the usage records within a billing period. You can change this default + * behavior with the billing plan’s aggregate_usage parameter. When + * there is more than one usage record with the same timestamp, Stripe adds the + * quantity values together. In most cases, this is the desired + * resolution, however, you can change this behavior with the action + * parameter. + * + * The default pricing model for metered billing is per-unit pricing. + * For finer granularity, you can configure metered billing to have a tiered pricing + * model. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\UsageRecord + */ + public function createUsageRecord($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscription_items/%s/usage_records', $parentId), $params, $opts); + } + + /** + * Deletes an item from the subscription. Removing a subscription item from a + * subscription will not cancel the subscription. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionItem + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/subscription_items/%s', $id), $params, $opts); + } + + /** + * Retrieves the subscription item with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionItem + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/subscription_items/%s', $id), $params, $opts); + } + + /** + * Updates the plan or quantity of an item on a current subscription. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionItem + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscription_items/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionScheduleService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionScheduleService.php new file mode 100644 index 0000000..9eed460 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionScheduleService.php @@ -0,0 +1,113 @@ +requestCollection('get', '/v1/subscription_schedules', $params, $opts); + } + + /** + * Cancels a subscription schedule and its associated subscription immediately (if + * the subscription schedule has an active subscription). A subscription schedule + * can only be canceled if its status is not_started or + * active. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscription_schedules/%s/cancel', $id), $params, $opts); + } + + /** + * Creates a new subscription schedule object. Each customer can have up to 500 + * active or scheduled subscriptions. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/subscription_schedules', $params, $opts); + } + + /** + * Releases the subscription schedule immediately, which will stop scheduling of + * its phases, but leave any existing subscription in place. A schedule can only be + * released if its status is not_started or active. If + * the subscription schedule is currently associated with a subscription, releasing + * it will remove its subscription property and set the subscription’s + * ID to the released_subscription property. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule + */ + public function release($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscription_schedules/%s/release', $id), $params, $opts); + } + + /** + * Retrieves the details of an existing subscription schedule. You only need to + * supply the unique subscription schedule identifier that was returned upon + * subscription schedule creation. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/subscription_schedules/%s', $id), $params, $opts); + } + + /** + * Updates an existing subscription schedule. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscription_schedules/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionService.php new file mode 100644 index 0000000..f3ac768 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/SubscriptionService.php @@ -0,0 +1,124 @@ +status=canceled. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/subscriptions', $params, $opts); + } + + /** + * Cancels a customer’s subscription immediately. The customer will not be charged + * again for the subscription. + * + * Note, however, that any pending invoice items that you’ve created will still be + * charged for at the end of the period, unless manually deleted. If you’ve set the subscription to cancel + * at the end of the period, any pending prorations will also be left in place and + * collected at the end of the period. But if the subscription is set to cancel + * immediately, pending prorations will be removed. + * + * By default, upon subscription cancellation, Stripe will stop automatic + * collection of all finalized invoices for the customer. This is intended to + * prevent unexpected payment attempts after the customer has canceled a + * subscription. However, you can resume automatic collection of the invoices + * manually after subscription cancellation to have us proceed. Or, you could check + * for unpaid invoices before allowing the customer to cancel the subscription at + * all. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/subscriptions/%s', $id), $params, $opts); + } + + /** + * Creates a new subscription on an existing customer. Each customer can have up to + * 500 active or scheduled subscriptions. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/subscriptions', $params, $opts); + } + + /** + * Removes the currently applied discount on a subscription. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription + */ + public function deleteDiscount($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/subscriptions/%s/discount', $id), $params, $opts); + } + + /** + * Retrieves the subscription with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/subscriptions/%s', $id), $params, $opts); + } + + /** + * Updates an existing subscription on a customer to match the specified + * parameters. When changing plans or quantities, we will optionally prorate the + * price we charge next month to make up for any price changes. To preview how the + * proration will be calculated, use the upcoming + * invoice endpoint. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/subscriptions/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxCodeService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxCodeService.php new file mode 100644 index 0000000..007b771 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxCodeService.php @@ -0,0 +1,41 @@ +all tax codes + * available to add to Products in order to allow specific tax calculations. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/tax_codes', $params, $opts); + } + + /** + * Retrieves the details of an existing tax code. Supply the unique tax code ID and + * Stripe will return the corresponding tax code information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxCode + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/tax_codes/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxRateService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxRateService.php new file mode 100644 index 0000000..7cee1fe --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TaxRateService.php @@ -0,0 +1,71 @@ +requestCollection('get', '/v1/tax_rates', $params, $opts); + } + + /** + * Creates a new tax rate. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxRate + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/tax_rates', $params, $opts); + } + + /** + * Retrieves a tax rate with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxRate + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/tax_rates/%s', $id), $params, $opts); + } + + /** + * Updates an existing tax rate. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TaxRate + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/tax_rates/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ConnectionTokenService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ConnectionTokenService.php new file mode 100644 index 0000000..7b25b23 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ConnectionTokenService.php @@ -0,0 +1,25 @@ +request('post', '/v1/terminal/connection_tokens', $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/LocationService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/LocationService.php new file mode 100644 index 0000000..5a217be --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/LocationService.php @@ -0,0 +1,89 @@ +Location objects. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/terminal/locations', $params, $opts); + } + + /** + * Creates a new Location object. For further details, including which + * address fields are required in each country, see the Manage locations guide. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Location + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/terminal/locations', $params, $opts); + } + + /** + * Deletes a Location object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Location + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/terminal/locations/%s', $id), $params, $opts); + } + + /** + * Retrieves a Location object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Location + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/terminal/locations/%s', $id), $params, $opts); + } + + /** + * Updates a Location object by setting the values of the parameters + * passed. Any parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Location + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/terminal/locations/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ReaderService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ReaderService.php new file mode 100644 index 0000000..765015c --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/ReaderService.php @@ -0,0 +1,87 @@ +Reader objects. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function all($params = null, $opts = null) + { + return $this->requestCollection('get', '/v1/terminal/readers', $params, $opts); + } + + /** + * Creates a new Reader object. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Reader + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/terminal/readers', $params, $opts); + } + + /** + * Deletes a Reader object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Reader + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/terminal/readers/%s', $id), $params, $opts); + } + + /** + * Retrieves a Reader object. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Reader + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/terminal/readers/%s', $id), $params, $opts); + } + + /** + * Updates a Reader object by setting the values of the parameters + * passed. Any parameters not provided will be left unchanged. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Terminal\Reader + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/terminal/readers/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/TerminalServiceFactory.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/TerminalServiceFactory.php new file mode 100644 index 0000000..c70ac87 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/Terminal/TerminalServiceFactory.php @@ -0,0 +1,29 @@ + + */ + private static $classMap = [ + 'connectionTokens' => ConnectionTokenService::class, + 'locations' => LocationService::class, + 'readers' => ReaderService::class, + ]; + + protected function getServiceClass($name) + { + return \array_key_exists($name, self::$classMap) ? self::$classMap[$name] : null; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TokenService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TokenService.php new file mode 100644 index 0000000..1c72759 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TokenService.php @@ -0,0 +1,42 @@ +Custom + * account. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Token + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/tokens', $params, $opts); + } + + /** + * Retrieves the token with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Token + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/tokens/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TopupService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TopupService.php new file mode 100644 index 0000000..059dc20 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TopupService.php @@ -0,0 +1,89 @@ +requestCollection('get', '/v1/topups', $params, $opts); + } + + /** + * Cancels a top-up. Only pending top-ups can be canceled. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Topup + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/topups/%s/cancel', $id), $params, $opts); + } + + /** + * Top up the balance of an account. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Topup + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/topups', $params, $opts); + } + + /** + * Retrieves the details of a top-up that has previously been created. Supply the + * unique top-up ID that was returned from your previous request, and Stripe will + * return the corresponding top-up information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Topup + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/topups/%s', $id), $params, $opts); + } + + /** + * Updates the metadata of a top-up. Other top-up details are not editable by + * design. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Topup + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/topups/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TransferService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TransferService.php new file mode 100644 index 0000000..150bbf7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/TransferService.php @@ -0,0 +1,175 @@ +requestCollection('get', '/v1/transfers', $params, $opts); + } + + /** + * You can see a list of the reversals belonging to a specific transfer. Note that + * the 10 most recent reversals are always available by default on the transfer + * object. If you need more than those 10, you can use this API method and the + * limit and starting_after parameters to page through + * additional reversals. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection + */ + public function allReversals($parentId, $params = null, $opts = null) + { + return $this->requestCollection('get', $this->buildPath('/v1/transfers/%s/reversals', $parentId), $params, $opts); + } + + /** + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Transfer + */ + public function cancel($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/transfers/%s/cancel', $id), $params, $opts); + } + + /** + * To send funds from your Stripe account to a connected account, you create a new + * transfer object. Your Stripe balance must be able to + * cover the transfer amount, or you’ll receive an “Insufficient Funds” error. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Transfer + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/transfers', $params, $opts); + } + + /** + * When you create a new reversal, you must specify a transfer to create it on. + * + * When reversing transfers, you can optionally reverse part of the transfer. You + * can do so as many times as you wish until the entire transfer has been reversed. + * + * Once entirely reversed, a transfer can’t be reversed again. This method will + * return an error when called on an already-reversed transfer, or when trying to + * reverse more money than is left on a transfer. + * + * @param string $parentId + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public function createReversal($parentId, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/transfers/%s/reversals', $parentId), $params, $opts); + } + + /** + * Retrieves the details of an existing transfer. Supply the unique transfer ID + * from either a transfer creation request or the transfer list, and Stripe will + * return the corresponding transfer information. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Transfer + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/transfers/%s', $id), $params, $opts); + } + + /** + * By default, you can see the 10 most recent reversals stored directly on the + * transfer object, but you can also retrieve details about a specific reversal + * stored on the transfer. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public function retrieveReversal($parentId, $id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/transfers/%s/reversals/%s', $parentId, $id), $params, $opts); + } + + /** + * Updates the specified transfer by setting the values of the parameters passed. + * Any parameters not provided will be left unchanged. + * + * This request accepts only metadata as an argument. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Transfer + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/transfers/%s', $id), $params, $opts); + } + + /** + * Updates the specified reversal by setting the values of the parameters passed. + * Any parameters not provided will be left unchanged. + * + * This request only accepts metadata and description as arguments. + * + * @param string $parentId + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public function updateReversal($parentId, $id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/transfers/%s/reversals/%s', $parentId, $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/WebhookEndpointService.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/WebhookEndpointService.php new file mode 100644 index 0000000..01e6422 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Service/WebhookEndpointService.php @@ -0,0 +1,97 @@ +requestCollection('get', '/v1/webhook_endpoints', $params, $opts); + } + + /** + * A webhook endpoint must have a url and a list of + * enabled_events. You may optionally specify the Boolean + * connect parameter. If set to true, then a Connect webhook endpoint + * that notifies the specified url about events from all connected + * accounts is created; otherwise an account webhook endpoint that notifies the + * specified url only about events from your account is created. You + * can also create webhook endpoints in the webhooks settings + * section of the Dashboard. + * + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\WebhookEndpoint + */ + public function create($params = null, $opts = null) + { + return $this->request('post', '/v1/webhook_endpoints', $params, $opts); + } + + /** + * You can also delete webhook endpoints via the webhook endpoint + * management page of the Stripe dashboard. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\WebhookEndpoint + */ + public function delete($id, $params = null, $opts = null) + { + return $this->request('delete', $this->buildPath('/v1/webhook_endpoints/%s', $id), $params, $opts); + } + + /** + * Retrieves the webhook endpoint with the given ID. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\WebhookEndpoint + */ + public function retrieve($id, $params = null, $opts = null) + { + return $this->request('get', $this->buildPath('/v1/webhook_endpoints/%s', $id), $params, $opts); + } + + /** + * Updates the webhook endpoint. You may edit the url, the list of + * enabled_events, and the status of your endpoint. + * + * @param string $id + * @param null|array $params + * @param null|array|\Stripe\Util\RequestOptions $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\WebhookEndpoint + */ + public function update($id, $params = null, $opts = null) + { + return $this->request('post', $this->buildPath('/v1/webhook_endpoints/%s', $id), $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupAttempt.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupAttempt.php new file mode 100644 index 0000000..6c83b68 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupAttempt.php @@ -0,0 +1,32 @@ +application on the SetupIntent at the time of this confirmation. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Customer $customer The value of customer on the SetupIntent at the time of this confirmation. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string|\Stripe\Account $on_behalf_of The value of on_behalf_of on the SetupIntent at the time of this confirmation. + * @property string|\Stripe\PaymentMethod $payment_method ID of the payment method used with this SetupAttempt. + * @property \Stripe\StripeObject $payment_method_details + * @property null|\Stripe\ErrorObject $setup_error The error encountered during this attempt to confirm the SetupIntent, if any. + * @property string|\Stripe\SetupIntent $setup_intent ID of the SetupIntent that this attempt belongs to. + * @property string $status Status of this SetupAttempt, one of requires_confirmation, requires_action, processing, succeeded, failed, or abandoned. + * @property string $usage The value of usage on the SetupIntent at the time of this confirmation, one of off_session or on_session. + */ +class SetupAttempt extends ApiResource +{ + const OBJECT_NAME = 'setup_attempt'; + + use ApiOperations\All; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupIntent.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupIntent.php new file mode 100644 index 0000000..081bb2d --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SetupIntent.php @@ -0,0 +1,114 @@ +PaymentIntents to drive + * the payment flow. + * + * Create a SetupIntent as soon as you're ready to collect your customer's payment + * credentials. Do not maintain long-lived, unconfirmed SetupIntents as they may no + * longer be valid. The SetupIntent then transitions through multiple statuses as + * it guides you through the setup process. + * + * Successful SetupIntents result in payment credentials that are optimized for + * future payments. For example, cardholders in certain regions may need to be + * run through Strong Customer + * Authentication at the time of payment method collection in order to + * streamline later off-session payments. + * If the SetupIntent is used with a Customer, + * upon success, it will automatically attach the resulting payment method to that + * Customer. We recommend using SetupIntents or setup_future_usage + * on PaymentIntents to save payment methods in order to prevent saving invalid or + * unoptimized payment methods. + * + * By using SetupIntents, you ensure that your customers experience the minimum set + * of required friction, even as regulations change over time. + * + * Related guide: Setup + * Intents API. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string|\Stripe\StripeObject $application ID of the Connect application that created the SetupIntent. + * @property null|string $cancellation_reason Reason for cancellation of this SetupIntent, one of abandoned, requested_by_customer, or duplicate. + * @property null|string $client_secret

The client secret of this SetupIntent. Used for client-side retrieval using a publishable key.

The client secret can be used to complete payment setup from your frontend. It should not be stored, logged, embedded in URLs, or exposed to anyone other than the customer. Make sure that you have TLS enabled on any page that includes the client secret.

+ * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Customer $customer

ID of the Customer this SetupIntent belongs to, if one exists.

If present, the SetupIntent's payment method will be attached to the Customer on successful setup. Payment methods attached to other Customers cannot be used with this SetupIntent.

+ * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|\Stripe\ErrorObject $last_setup_error The error encountered in the previous SetupIntent confirmation. + * @property null|string|\Stripe\SetupAttempt $latest_attempt The most recent SetupAttempt for this SetupIntent. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string|\Stripe\Mandate $mandate ID of the multi use Mandate generated by the SetupIntent. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|\Stripe\StripeObject $next_action If present, this property tells you what actions you need to take in order for your customer to continue payment setup. + * @property null|string|\Stripe\Account $on_behalf_of The account (if any) for which the setup is intended. + * @property null|string|\Stripe\PaymentMethod $payment_method ID of the payment method used with this SetupIntent. + * @property null|\Stripe\StripeObject $payment_method_options Payment-method-specific configuration for this SetupIntent. + * @property string[] $payment_method_types The list of payment method types (e.g. card) that this SetupIntent is allowed to set up. + * @property null|string|\Stripe\Mandate $single_use_mandate ID of the single_use Mandate generated by the SetupIntent. + * @property string $status Status of this SetupIntent, one of requires_payment_method, requires_confirmation, requires_action, processing, canceled, or succeeded. + * @property string $usage

Indicates how the payment method is intended to be used in the future.

Use on_session if you intend to only reuse the payment method when the customer is in your checkout flow. Use off_session if your customer may or may not be in your checkout flow. If not provided, this value defaults to off_session.

+ */ +class SetupIntent extends ApiResource +{ + const OBJECT_NAME = 'setup_intent'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const STATUS_CANCELED = 'canceled'; + const STATUS_PROCESSING = 'processing'; + const STATUS_REQUIRES_ACTION = 'requires_action'; + const STATUS_REQUIRES_CONFIRMATION = 'requires_confirmation'; + const STATUS_REQUIRES_PAYMENT_METHOD = 'requires_payment_method'; + const STATUS_SUCCEEDED = 'succeeded'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent the canceled setup intent + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SetupIntent the confirmed setup intent + */ + public function confirm($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/confirm'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ShippingRate.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ShippingRate.php new file mode 100644 index 0000000..9091b68 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ShippingRate.php @@ -0,0 +1,40 @@ +Checkout Sessions + * to collect shipping costs. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Whether the shipping rate can be used for new purchases. Defaults to true. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|\Stripe\StripeObject $delivery_estimate The estimated range for how long shipping will take, meant to be displayable to the customer. This will appear on CheckoutSessions. + * @property null|string $display_name The name of the shipping rate, meant to be displayable to the customer. This will appear on CheckoutSessions. + * @property \Stripe\StripeObject $fixed_amount + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string $tax_behavior Specifies whether the rate is considered inclusive of taxes or exclusive of taxes. One of inclusive, exclusive, or unspecified. + * @property null|string|\Stripe\TaxCode $tax_code A tax code ID. The Shipping tax code is txcd_92010001. + * @property string $type The type of calculation to use on the shipping rate. Can only be fixed_amount for now. + */ +class ShippingRate extends ApiResource +{ + const OBJECT_NAME = 'shipping_rate'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const TAX_BEHAVIOR_EXCLUSIVE = 'exclusive'; + const TAX_BEHAVIOR_INCLUSIVE = 'inclusive'; + const TAX_BEHAVIOR_UNSPECIFIED = 'unspecified'; + + const TYPE_FIXED_AMOUNT = 'fixed_amount'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Sigma/ScheduledQueryRun.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Sigma/ScheduledQueryRun.php new file mode 100644 index 0000000..b109dde --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Sigma/ScheduledQueryRun.php @@ -0,0 +1,37 @@ +scheduled + * a Sigma query, you'll receive a + * sigma.scheduled_query_run.created webhook each time the query runs. + * The webhook contains a ScheduledQueryRun object, which you can use + * to retrieve the query results. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property int $data_load_time When the query was run, Sigma contained a snapshot of your Stripe data at this time. + * @property \Stripe\StripeObject $error + * @property null|\Stripe\File $file The file object representing the results of the query. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property int $result_available_until Time at which the result expires and is no longer available for download. + * @property string $sql SQL for the query. + * @property string $status The query's execution status, which will be completed for successful runs, and canceled, failed, or timed_out otherwise. + * @property string $title Title of the query. + */ +class ScheduledQueryRun extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'scheduled_query_run'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Retrieve; + + public static function classUrl() + { + return '/v1/sigma/scheduled_query_runs'; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SingletonApiResource.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SingletonApiResource.php new file mode 100644 index 0000000..a182ca9 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SingletonApiResource.php @@ -0,0 +1,40 @@ +refresh(); + + return $instance; + } + + /** + * @return string the endpoint associated with this singleton class + */ + public static function classUrl() + { + // Replace dots with slashes for namespaced resources, e.g. if the object's name is + // "foo.bar", then its URL will be "/v1/foo/bar". + + /** @phpstan-ignore-next-line */ + $base = \str_replace('.', '/', static::OBJECT_NAME); + + return "/v1/{$base}"; + } + + /** + * @return string the endpoint associated with this singleton API resource + */ + public function instanceUrl() + { + return static::classUrl(); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Source.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Source.php new file mode 100644 index 0000000..75e7594 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Source.php @@ -0,0 +1,168 @@ +Source objects allow you to accept a variety of payment methods. + * They represent a customer's payment instrument, and can be used with the Stripe + * API just like a Card object: once chargeable, they can be charged, + * or can be attached to customers. + * + * Related guides: Sources API and Sources & Customers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject $ach_credit_transfer + * @property \Stripe\StripeObject $ach_debit + * @property \Stripe\StripeObject $acss_debit + * @property \Stripe\StripeObject $alipay + * @property null|int $amount A positive integer in the smallest currency unit (that is, 100 cents for $1.00, or 1 for ¥1, Japanese Yen being a zero-decimal currency) representing the total amount associated with the source. This is the amount for which the source will be chargeable once ready. Required for single_use sources. + * @property \Stripe\StripeObject $au_becs_debit + * @property \Stripe\StripeObject $bancontact + * @property \Stripe\StripeObject $card + * @property \Stripe\StripeObject $card_present + * @property string $client_secret The client secret of the source. Used for client-side retrieval using a publishable key. + * @property \Stripe\StripeObject $code_verification + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $currency Three-letter ISO code for the currency associated with the source. This is the currency for which the source will be chargeable once ready. Required for single_use sources. + * @property string $customer The ID of the customer to which this source is attached. This will not be present when the source has not been attached to a customer. + * @property \Stripe\StripeObject $eps + * @property string $flow The authentication flow of the source. flow is one of redirect, receiver, code_verification, none. + * @property \Stripe\StripeObject $giropay + * @property \Stripe\StripeObject $ideal + * @property \Stripe\StripeObject $klarna + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject $multibanco + * @property null|\Stripe\StripeObject $owner Information about the owner of the payment instrument that may be used or required by particular source types. + * @property \Stripe\StripeObject $p24 + * @property \Stripe\StripeObject $receiver + * @property \Stripe\StripeObject $redirect + * @property \Stripe\StripeObject $sepa_credit_transfer + * @property \Stripe\StripeObject $sepa_debit + * @property \Stripe\StripeObject $sofort + * @property \Stripe\StripeObject $source_order + * @property null|string $statement_descriptor Extra information about a source. This will appear on your customer's statement every time you charge the source. + * @property string $status The status of the source, one of canceled, chargeable, consumed, failed, or pending. Only chargeable sources can be used to create a charge. + * @property \Stripe\StripeObject $three_d_secure + * @property string $type The type of the source. The type is a payment method, one of ach_credit_transfer, ach_debit, alipay, bancontact, card, card_present, eps, giropay, ideal, multibanco, klarna, p24, sepa_debit, sofort, three_d_secure, or wechat. An additional hash is included on the source with a name matching this value. It contains additional information specific to the payment method used. + * @property null|string $usage Either reusable or single_use. Whether this source should be reusable or not. Some source types may or may not be reusable by construction, while others may leave the option at creation. If an incompatible value is passed, an error will be returned. + * @property \Stripe\StripeObject $wechat + */ +class Source extends ApiResource +{ + const OBJECT_NAME = 'source'; + + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const FLOW_CODE_VERIFICATION = 'code_verification'; + const FLOW_NONE = 'none'; + const FLOW_RECEIVER = 'receiver'; + const FLOW_REDIRECT = 'redirect'; + + const STATUS_CANCELED = 'canceled'; + const STATUS_CHARGEABLE = 'chargeable'; + const STATUS_CONSUMED = 'consumed'; + const STATUS_FAILED = 'failed'; + const STATUS_PENDING = 'pending'; + + const USAGE_REUSABLE = 'reusable'; + const USAGE_SINGLE_USE = 'single_use'; + + use ApiOperations\NestedResource; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\UnexpectedValueException if the source is not attached to a customer + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source the detached source + */ + public function detach($params = null, $opts = null) + { + self::_validateParams($params); + + $id = $this['id']; + if (!$id) { + $class = static::class; + $msg = "Could not determine which URL to request: {$class} instance " + . "has invalid ID: {$id}"; + + throw new Exception\UnexpectedValueException($msg, null); + } + + if ($this['customer']) { + $base = Customer::classUrl(); + $parentExtn = \urlencode(Util\Util::utf8($this['customer'])); + $extn = \urlencode(Util\Util::utf8($id)); + $url = "{$base}/{$parentExtn}/sources/{$extn}"; + + list($response, $opts) = $this->_request('delete', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + $message = 'This source object does not appear to be currently attached ' + . 'to a customer object.'; + + throw new Exception\UnexpectedValueException($message); + } + + /** + * @deprecated sourceTransactions is deprecated. Please use Source::allSourceTransactions instead. + * + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of source transactions + */ + public function sourceTransactions($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/source_transactions'; + list($response, $opts) = $this->_request('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + /** + * @param string $id + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of source transactions + */ + public static function allSourceTransactions($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, '/source_transactions', $params, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Source the verified source + */ + public function verify($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/verify'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SourceTransaction.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SourceTransaction.php new file mode 100644 index 0000000..281f2a7 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SourceTransaction.php @@ -0,0 +1,20 @@ +coreServiceFactory) { + $this->coreServiceFactory = new \Stripe\Service\CoreServiceFactory($this); + } + + return $this->coreServiceFactory->__get($name); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeClientInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeClientInterface.php new file mode 100644 index 0000000..d5a8806 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeClientInterface.php @@ -0,0 +1,21 @@ + "old_value"] + * + * If we update the object with `metadata[new]=new_value`, the server side + * object now has *both* fields: + * + * metadata = ["old" => "old_value", "new" => "new_value"] + * + * This is okay in itself because usually users will want to treat it as + * additive: + * + * $obj->metadata["new"] = "new_value"; + * $obj->save(); + * + * However, in other cases, they may want to replace the entire existing + * contents: + * + * $obj->metadata = ["new" => "new_value"]; + * $obj->save(); + * + * This is where things get a little bit tricky because in order to clear + * any old keys that may have existed, we actually have to send an explicit + * empty string to the server. So the operation above would have to send + * this form to get the intended behavior: + * + * metadata[old]=&metadata[new]=new_value + * + * This method allows us to track which parameters are considered additive, + * and lets us behave correctly where appropriate when serializing + * parameters to be sent. + * + * @return Util\Set Set of additive parameters + */ + public static function getAdditiveParams() + { + static $additiveParams = null; + if (null === $additiveParams) { + // Set `metadata` as additive so that when it's set directly we remember + // to clear keys that may have been previously set by sending empty + // values for them. + // + // It's possible that not every object has `metadata`, but having this + // option set when there is no `metadata` field is not harmful. + $additiveParams = new Util\Set([ + 'metadata', + ]); + } + + return $additiveParams; + } + + public function __construct($id = null, $opts = null) + { + list($id, $this->_retrieveOptions) = Util\Util::normalizeId($id); + $this->_opts = Util\RequestOptions::parse($opts); + $this->_originalValues = []; + $this->_values = []; + $this->_unsavedValues = new Util\Set(); + $this->_transientValues = new Util\Set(); + if (null !== $id) { + $this->_values['id'] = $id; + } + } + + // Standard accessor magic methods + public function __set($k, $v) + { + if (static::getPermanentAttributes()->includes($k)) { + throw new Exception\InvalidArgumentException( + "Cannot set {$k} on this object. HINT: you can't set: " . + \implode(', ', static::getPermanentAttributes()->toArray()) + ); + } + + if ('' === $v) { + throw new Exception\InvalidArgumentException( + 'You cannot set \'' . $k . '\'to an empty string. ' + . 'We interpret empty strings as NULL in requests. ' + . 'You may set obj->' . $k . ' = NULL to delete the property' + ); + } + + $this->_values[$k] = Util\Util::convertToStripeObject($v, $this->_opts); + $this->dirtyValue($this->_values[$k]); + $this->_unsavedValues->add($k); + } + + public function __isset($k) + { + return isset($this->_values[$k]); + } + + public function __unset($k) + { + unset($this->_values[$k]); + $this->_transientValues->add($k); + $this->_unsavedValues->discard($k); + } + + public function &__get($k) + { + // function should return a reference, using $nullval to return a reference to null + $nullval = null; + if (!empty($this->_values) && \array_key_exists($k, $this->_values)) { + return $this->_values[$k]; + } + if (!empty($this->_transientValues) && $this->_transientValues->includes($k)) { + $class = static::class; + $attrs = \implode(', ', \array_keys($this->_values)); + $message = "Stripe Notice: Undefined property of {$class} instance: {$k}. " + . "HINT: The {$k} attribute was set in the past, however. " + . 'It was then wiped when refreshing the object ' + . "with the result returned by Stripe's API, " + . 'probably as a result of a save(). The attributes currently ' + . "available on this object are: {$attrs}"; + Stripe::getLogger()->error($message); + + return $nullval; + } + $class = static::class; + Stripe::getLogger()->error("Stripe Notice: Undefined property of {$class} instance: {$k}"); + + return $nullval; + } + + // Magic method for var_dump output. Only works with PHP >= 5.6 + public function __debugInfo() + { + return $this->_values; + } + + // ArrayAccess methods + #[\ReturnTypeWillChange] + public function offsetSet($k, $v) + { + $this->{$k} = $v; + } + + #[\ReturnTypeWillChange] + public function offsetExists($k) + { + return \array_key_exists($k, $this->_values); + } + + #[\ReturnTypeWillChange] + public function offsetUnset($k) + { + unset($this->{$k}); + } + + #[\ReturnTypeWillChange] + public function offsetGet($k) + { + return \array_key_exists($k, $this->_values) ? $this->_values[$k] : null; + } + + // Countable method + #[\ReturnTypeWillChange] + public function count() + { + return \count($this->_values); + } + + public function keys() + { + return \array_keys($this->_values); + } + + public function values() + { + return \array_values($this->_values); + } + + /** + * This unfortunately needs to be public to be used in Util\Util. + * + * @param array $values + * @param null|array|string|Util\RequestOptions $opts + * + * @return static the object constructed from the given values + */ + public static function constructFrom($values, $opts = null) + { + $obj = new static(isset($values['id']) ? $values['id'] : null); + $obj->refreshFrom($values, $opts); + + return $obj; + } + + /** + * Refreshes this object using the provided values. + * + * @param array $values + * @param null|array|string|Util\RequestOptions $opts + * @param bool $partial defaults to false + */ + public function refreshFrom($values, $opts, $partial = false) + { + $this->_opts = Util\RequestOptions::parse($opts); + + $this->_originalValues = self::deepCopy($values); + + if ($values instanceof StripeObject) { + $values = $values->toArray(); + } + + // Wipe old state before setting new. This is useful for e.g. updating a + // customer, where there is no persistent card parameter. Mark those values + // which don't persist as transient + if ($partial) { + $removed = new Util\Set(); + } else { + $removed = new Util\Set(\array_diff(\array_keys($this->_values), \array_keys($values))); + } + + foreach ($removed->toArray() as $k) { + unset($this->{$k}); + } + + $this->updateAttributes($values, $opts, false); + foreach ($values as $k => $v) { + $this->_transientValues->discard($k); + $this->_unsavedValues->discard($k); + } + } + + /** + * Mass assigns attributes on the model. + * + * @param array $values + * @param null|array|string|Util\RequestOptions $opts + * @param bool $dirty defaults to true + */ + public function updateAttributes($values, $opts = null, $dirty = true) + { + foreach ($values as $k => $v) { + // Special-case metadata to always be cast as a StripeObject + // This is necessary in case metadata is empty, as PHP arrays do + // not differentiate between lists and hashes, and we consider + // empty arrays to be lists. + if (('metadata' === $k) && (\is_array($v))) { + $this->_values[$k] = StripeObject::constructFrom($v, $opts); + } else { + $this->_values[$k] = Util\Util::convertToStripeObject($v, $opts); + } + if ($dirty) { + $this->dirtyValue($this->_values[$k]); + } + $this->_unsavedValues->add($k); + } + } + + /** + * @param bool $force defaults to false + * + * @return array a recursive mapping of attributes to values for this object, + * including the proper value for deleted attributes + */ + public function serializeParameters($force = false) + { + $updateParams = []; + + foreach ($this->_values as $k => $v) { + // There are a few reasons that we may want to add in a parameter for + // update: + // + // 1. The `$force` option has been set. + // 2. We know that it was modified. + // 3. Its value is a StripeObject. A StripeObject may contain modified + // values within in that its parent StripeObject doesn't know about. + // + $original = \array_key_exists($k, $this->_originalValues) ? $this->_originalValues[$k] : null; + $unsaved = $this->_unsavedValues->includes($k); + if ($force || $unsaved || $v instanceof StripeObject) { + $updateParams[$k] = $this->serializeParamsValue( + $this->_values[$k], + $original, + $unsaved, + $force, + $k + ); + } + } + + // a `null` that makes it out of `serializeParamsValue` signals an empty + // value that we shouldn't appear in the serialized form of the object + return \array_filter( + $updateParams, + function ($v) { + return null !== $v; + } + ); + } + + public function serializeParamsValue($value, $original, $unsaved, $force, $key = null) + { + // The logic here is that essentially any object embedded in another + // object that had a `type` is actually an API resource of a different + // type that's been included in the response. These other resources must + // be updated from their proper endpoints, and therefore they are not + // included when serializing even if they've been modified. + // + // There are _some_ known exceptions though. + // + // For example, if the value is unsaved (meaning the user has set it), and + // it looks like the API resource is persisted with an ID, then we include + // the object so that parameters are serialized with a reference to its + // ID. + // + // Another example is that on save API calls it's sometimes desirable to + // update a customer's default source by setting a new card (or other) + // object with `->source=` and then saving the customer. The + // `saveWithParent` flag to override the default behavior allows us to + // handle these exceptions. + // + // We throw an error if a property was set explicitly but we can't do + // anything with it because the integration is probably not working as the + // user intended it to. + if (null === $value) { + return ''; + } + if (($value instanceof ApiResource) && (!$value->saveWithParent)) { + if (!$unsaved) { + return null; + } + if (isset($value->id)) { + return $value; + } + + throw new Exception\InvalidArgumentException( + "Cannot save property `{$key}` containing an API resource of type " . + \get_class($value) . ". It doesn't appear to be persisted and is " . + 'not marked as `saveWithParent`.' + ); + } + if (\is_array($value)) { + if (Util\Util::isList($value)) { + // Sequential array, i.e. a list + $update = []; + foreach ($value as $v) { + $update[] = $this->serializeParamsValue($v, null, true, $force); + } + // This prevents an array that's unchanged from being resent. + if ($update !== $this->serializeParamsValue($original, null, true, $force, $key)) { + return $update; + } + } else { + // Associative array, i.e. a map + return Util\Util::convertToStripeObject($value, $this->_opts)->serializeParameters(); + } + } elseif ($value instanceof StripeObject) { + $update = $value->serializeParameters($force); + if ($original && $unsaved && $key && static::getAdditiveParams()->includes($key)) { + $update = \array_merge(self::emptyValues($original), $update); + } + + return $update; + } else { + return $value; + } + } + + #[\ReturnTypeWillChange] + public function jsonSerialize() + { + return $this->toArray(); + } + + /** + * Returns an associative array with the key and values composing the + * Stripe object. + * + * @return array the associative array + */ + public function toArray() + { + $maybeToArray = function ($value) { + if (null === $value) { + return null; + } + + return \is_object($value) && \method_exists($value, 'toArray') ? $value->toArray() : $value; + }; + + return \array_reduce(\array_keys($this->_values), function ($acc, $k) use ($maybeToArray) { + if ('_' === \substr((string) $k, 0, 1)) { + return $acc; + } + $v = $this->_values[$k]; + if (Util\Util::isList($v)) { + $acc[$k] = \array_map($maybeToArray, $v); + } else { + $acc[$k] = $maybeToArray($v); + } + + return $acc; + }, []); + } + + /** + * Returns a pretty JSON representation of the Stripe object. + * + * @return string the JSON representation of the Stripe object + */ + public function toJSON() + { + return \json_encode($this->toArray(), \JSON_PRETTY_PRINT); + } + + public function __toString() + { + $class = static::class; + + return $class . ' JSON: ' . $this->toJSON(); + } + + /** + * Sets all keys within the StripeObject as unsaved so that they will be + * included with an update when `serializeParameters` is called. This + * method is also recursive, so any StripeObjects contained as values or + * which are values in a tenant array are also marked as dirty. + */ + public function dirty() + { + $this->_unsavedValues = new Util\Set(\array_keys($this->_values)); + foreach ($this->_values as $k => $v) { + $this->dirtyValue($v); + } + } + + protected function dirtyValue($value) + { + if (\is_array($value)) { + foreach ($value as $v) { + $this->dirtyValue($v); + } + } elseif ($value instanceof StripeObject) { + $value->dirty(); + } + } + + /** + * Produces a deep copy of the given object including support for arrays + * and StripeObjects. + * + * @param mixed $obj + */ + protected static function deepCopy($obj) + { + if (\is_array($obj)) { + $copy = []; + foreach ($obj as $k => $v) { + $copy[$k] = self::deepCopy($v); + } + + return $copy; + } + if ($obj instanceof StripeObject) { + return $obj::constructFrom( + self::deepCopy($obj->_values), + clone $obj->_opts + ); + } + + return $obj; + } + + /** + * Returns a hash of empty values for all the values that are in the given + * StripeObject. + * + * @param mixed $obj + */ + public static function emptyValues($obj) + { + if (\is_array($obj)) { + $values = $obj; + } elseif ($obj instanceof StripeObject) { + $values = $obj->_values; + } else { + throw new Exception\InvalidArgumentException( + 'empty_values got unexpected object type: ' . \get_class($obj) + ); + } + + return \array_fill_keys(\array_keys($values), ''); + } + + /** + * @return null|ApiResponse The last response from the Stripe API + */ + public function getLastResponse() + { + return $this->_lastResponse; + } + + /** + * Sets the last response from the Stripe API. + * + * @param ApiResponse $resp + */ + public function setLastResponse($resp) + { + $this->_lastResponse = $resp; + } + + /** + * Indicates whether or not the resource has been deleted on the server. + * Note that some, but not all, resources can indicate whether they have + * been deleted. + * + * @return bool whether the resource is deleted + */ + public function isDeleted() + { + return isset($this->_values['deleted']) ? $this->_values['deleted'] : false; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeStreamingClientInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeStreamingClientInterface.php new file mode 100644 index 0000000..e5e34c1 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/StripeStreamingClientInterface.php @@ -0,0 +1,11 @@ +Creating + * Subscriptions. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|float $application_fee_percent A non-negative decimal between 0 and 100, with at most two decimal places. This represents the percentage of the subscription invoice subtotal that will be transferred to the application owner's Stripe account. + * @property \Stripe\StripeObject $automatic_tax + * @property int $billing_cycle_anchor Determines the date of the first full invoice, and, for plans with month or year intervals, the day of the month for subsequent invoices. + * @property null|\Stripe\StripeObject $billing_thresholds Define thresholds at which an invoice will be sent, and the subscription advanced to a new billing period + * @property null|int $cancel_at A date in the future at which the subscription will automatically get canceled + * @property bool $cancel_at_period_end If the subscription has been canceled with the at_period_end flag set to true, cancel_at_period_end on the subscription will be true. You can use this attribute to determine whether a subscription that has a status of active is scheduled to be canceled at the end of the current period. + * @property null|int $canceled_at If the subscription has been canceled, the date of that cancellation. If the subscription was canceled with cancel_at_period_end, canceled_at will reflect the time of the most recent update request, not the end of the subscription period when the subscription is automatically moved to a canceled state. + * @property string $collection_method Either charge_automatically, or send_invoice. When charging automatically, Stripe will attempt to pay this subscription at the end of the cycle using the default source attached to the customer. When sending an invoice, Stripe will email your customer an invoice with payment instructions. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property int $current_period_end End of the current period that the subscription has been invoiced for. At the end of this period, a new invoice will be created. + * @property int $current_period_start Start of the current period that the subscription has been invoiced for. + * @property string|\Stripe\Customer $customer ID of the customer who owns the subscription. + * @property null|int $days_until_due Number of days a customer has to pay invoices generated by this subscription. This value will be null for subscriptions where collection_method=charge_automatically. + * @property null|string|\Stripe\PaymentMethod $default_payment_method ID of the default payment method for the subscription. It must belong to the customer associated with the subscription. This takes precedence over default_source. If neither are set, invoices will use the customer's invoice_settings.default_payment_method or default_source. + * @property null|string|\Stripe\Account|\Stripe\AlipayAccount|\Stripe\BankAccount|\Stripe\BitcoinReceiver|\Stripe\Card|\Stripe\Source $default_source ID of the default payment source for the subscription. It must belong to the customer associated with the subscription and be in a chargeable state. If default_payment_method is also set, default_payment_method will take precedence. If neither are set, invoices will use the customer's invoice_settings.default_payment_method or default_source. + * @property null|\Stripe\TaxRate[] $default_tax_rates The tax rates that will apply to any subscription item that does not have tax_rates set. Invoices created will have their default_tax_rates populated from the subscription. + * @property null|\Stripe\Discount $discount Describes the current discount applied to this subscription, if there is one. When billing, a discount applied to a subscription overrides a discount applied on a customer-wide basis. + * @property null|int $ended_at If the subscription has ended, the date the subscription ended. + * @property \Stripe\Collection $items List of subscription items, each with an attached price. + * @property null|string|\Stripe\Invoice $latest_invoice The most recent invoice this subscription has generated. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|int $next_pending_invoice_item_invoice Specifies the approximate timestamp on which any pending invoice items will be billed according to the schedule provided at pending_invoice_item_interval. + * @property null|\Stripe\StripeObject $pause_collection If specified, payment collection for this subscription will be paused. + * @property null|\Stripe\StripeObject $payment_settings Payment settings passed on to invoices created by the subscription. + * @property null|\Stripe\StripeObject $pending_invoice_item_interval Specifies an interval for how often to bill for any pending invoice items. It is analogous to calling Create an invoice for the given subscription at the specified interval. + * @property null|string|\Stripe\SetupIntent $pending_setup_intent You can use this SetupIntent to collect user authentication when creating a subscription without immediate payment or updating a subscription's payment method, allowing you to optimize for off-session payments. Learn more in the SCA Migration Guide. + * @property null|\Stripe\StripeObject $pending_update If specified, pending updates that will be applied to the subscription once the latest_invoice has been paid. + * @property null|string|\Stripe\SubscriptionSchedule $schedule The schedule attached to the subscription + * @property int $start_date Date when the subscription was first created. The date might differ from the created date due to backdating. + * @property string $status

Possible values are incomplete, incomplete_expired, trialing, active, past_due, canceled, or unpaid.

For collection_method=charge_automatically a subscription moves into incomplete if the initial payment attempt fails. A subscription in this state can only have metadata and default_source updated. Once the first invoice is paid, the subscription moves into an active state. If the first invoice is not paid within 23 hours, the subscription transitions to incomplete_expired. This is a terminal state, the open invoice will be voided and no further invoices will be generated.

A subscription that is currently in a trial period is trialing and moves to active when the trial period is over.

If subscription collection_method=charge_automatically it becomes past_due when payment to renew it fails and canceled or unpaid (depending on your subscriptions settings) when Stripe has exhausted all payment retry attempts.

If subscription collection_method=send_invoice it becomes past_due when its invoice is not paid by the due date, and canceled or unpaid if it is still not paid by an additional deadline after that. Note that when a subscription has a status of unpaid, no subsequent invoices will be attempted (invoices will be created, but then immediately automatically closed). After receiving updated payment information from a customer, you may choose to reopen and pay their closed invoices.

+ * @property null|int $trial_end If the subscription has a trial, the end of that trial. + * @property null|int $trial_start If the subscription has a trial, the beginning of that trial. + */ +class Subscription extends ApiResource +{ + const OBJECT_NAME = 'subscription'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const PAYMENT_BEHAVIOR_ALLOW_INCOMPLETE = 'allow_incomplete'; + const PAYMENT_BEHAVIOR_ERROR_IF_INCOMPLETE = 'error_if_incomplete'; + const PAYMENT_BEHAVIOR_PENDING_IF_INCOMPLETE = 'pending_if_incomplete'; + + const PRORATION_BEHAVIOR_ALWAYS_INVOICE = 'always_invoice'; + const PRORATION_BEHAVIOR_CREATE_PRORATIONS = 'create_prorations'; + const PRORATION_BEHAVIOR_NONE = 'none'; + + const STATUS_ACTIVE = 'active'; + const STATUS_CANCELED = 'canceled'; + const STATUS_INCOMPLETE = 'incomplete'; + const STATUS_INCOMPLETE_EXPIRED = 'incomplete_expired'; + const STATUS_PAST_DUE = 'past_due'; + const STATUS_TRIALING = 'trialing'; + const STATUS_UNPAID = 'unpaid'; + + use ApiOperations\Delete { + delete as protected _delete; + } + + public static function getSavedNestedResources() + { + static $savedNestedResources = null; + if (null === $savedNestedResources) { + $savedNestedResources = new Util\Set([ + 'source', + ]); + } + + return $savedNestedResources; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription the deleted subscription + */ + public function cancel($params = null, $opts = null) + { + return $this->_delete($params, $opts); + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Subscription the updated subscription + */ + public function deleteDiscount($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/discount'; + list($response, $opts) = $this->_request('delete', $url, $params, $opts); + $this->refreshFrom(['discount' => null], $opts, true); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionItem.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionItem.php new file mode 100644 index 0000000..5bd25b2 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionItem.php @@ -0,0 +1,84 @@ +key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\Plan $plan

You can now model subscriptions more flexibly using the Prices API. It replaces the Plans API and is backwards compatible to simplify your migration.

Plans define the base price, currency, and billing cycle for recurring purchases of products. Products help you track inventory or provisioning, and plans help you track pricing. Different physical goods or levels of service should be represented by products, and pricing options should be represented by plans. This approach lets you change prices without having to change your provisioning scheme.

For example, you might have a single "gold" product that has plans for $10/month, $100/year, €9/month, and €90/year.

Related guides: Set up a subscription and more about products and prices.

+ * @property \Stripe\Price $price

Prices define the unit cost, currency, and (optional) billing cycle for both recurring and one-time purchases of products. Products help you track inventory or provisioning, and prices help you track payment terms. Different physical goods or levels of service should be represented by products, and pricing options should be represented by prices. This approach lets you change prices without having to change your provisioning scheme.

For example, you might have a single "gold" product that has prices for $10/month, $100/year, and €9 once.

Related guides: Set up a subscription, create an invoice, and more about products and prices.

+ * @property int $quantity The quantity of the plan to which the customer should be subscribed. + * @property string $subscription The subscription this subscription_item belongs to. + * @property null|\Stripe\TaxRate[] $tax_rates The tax rates which apply to this subscription_item. When set, the default_tax_rates on the subscription do not apply to this subscription_item. + */ +class SubscriptionItem extends ApiResource +{ + const OBJECT_NAME = 'subscription_item'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\NestedResource; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const PATH_USAGE_RECORDS = '/usage_records'; + + /** + * @param null|string $id the ID of the subscription item on which to create the usage record + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\UsageRecord + */ + public static function createUsageRecord($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_USAGE_RECORDS, $params, $opts); + } + + /** + * @deprecated usageRecordSummaries is deprecated. Please use SubscriptionItem::allUsageRecordSummaries instead. + * + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of usage record summaries + */ + public function usageRecordSummaries($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/usage_record_summaries'; + list($response, $opts) = $this->_request('get', $url, $params, $opts); + $obj = \Stripe\Util\Util::convertToStripeObject($response, $opts); + $obj->setLastResponse($response); + + return $obj; + } + + const PATH_USAGE_RECORD_SUMMARIES = '/usage_record_summaries'; + + /** + * @param string $id the ID of the subscription item on which to retrieve the usage record summaries + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of usage record summaries + */ + public static function allUsageRecordSummaries($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_USAGE_RECORD_SUMMARIES, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionSchedule.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionSchedule.php new file mode 100644 index 0000000..d10ea12 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/SubscriptionSchedule.php @@ -0,0 +1,74 @@ +Subscription + * Schedules. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|int $canceled_at Time at which the subscription schedule was canceled. Measured in seconds since the Unix epoch. + * @property null|int $completed_at Time at which the subscription schedule was completed. Measured in seconds since the Unix epoch. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|\Stripe\StripeObject $current_phase Object representing the start and end dates for the current phase of the subscription schedule, if it is active. + * @property string|\Stripe\Customer $customer ID of the customer who owns the subscription schedule. + * @property \Stripe\StripeObject $default_settings + * @property string $end_behavior Behavior of the subscription schedule and underlying subscription when it ends. Possible values are release and cancel. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\StripeObject[] $phases Configuration for the subscription schedule's phases. + * @property null|int $released_at Time at which the subscription schedule was released. Measured in seconds since the Unix epoch. + * @property null|string $released_subscription ID of the subscription once managed by the subscription schedule (if it is released). + * @property string $status The present status of the subscription schedule. Possible values are not_started, active, completed, released, and canceled. You can read more about the different states in our behavior guide. + * @property null|string|\Stripe\Subscription $subscription ID of the subscription managed by the subscription schedule. + */ +class SubscriptionSchedule extends ApiResource +{ + const OBJECT_NAME = 'subscription_schedule'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule the canceled subscription schedule + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\SubscriptionSchedule the released subscription schedule + */ + public function release($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/release'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxCode.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxCode.php new file mode 100644 index 0000000..bfdbf03 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxCode.php @@ -0,0 +1,22 @@ +Tax codes classify goods and + * services for tax purposes. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $description A detailed description of which types of products the tax code represents. + * @property string $name A short name for the tax code. + */ +class TaxCode extends ApiResource +{ + const OBJECT_NAME = 'tax_code'; + + use ApiOperations\All; + use ApiOperations\Retrieve; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxId.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxId.php new file mode 100644 index 0000000..987193b --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxId.php @@ -0,0 +1,115 @@ +customer. A customer's tax IDs + * are displayed on invoices and credit notes issued for the customer. + * + * Related guide: Customer + * Tax Identification Numbers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $country Two-letter ISO code representing the country of the tax ID. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string|\Stripe\Customer $customer ID of the customer. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property string $type Type of the tax ID, one of ae_trn, au_abn, au_arn, br_cnpj, br_cpf, ca_bn, ca_gst_hst, ca_pst_bc, ca_pst_mb, ca_pst_sk, ca_qst, ch_vat, cl_tin, es_cif, eu_vat, gb_vat, ge_vat, hk_br, id_npwp, il_vat, in_gst, jp_cn, jp_rn, kr_brn, li_uid, mx_rfc, my_frp, my_itn, my_sst, no_vat, nz_gst, ru_inn, ru_kpp, sa_vat, sg_gst, sg_uen, th_vat, tw_vat, ua_vat, us_ein, or za_vat. Note that some legacy tax IDs have type unknown + * @property string $value Value of the tax ID. + * @property null|\Stripe\StripeObject $verification Tax ID verification information. + */ +class TaxId extends ApiResource +{ + const OBJECT_NAME = 'tax_id'; + + use ApiOperations\Delete; + + const TYPE_AE_TRN = 'ae_trn'; + const TYPE_AU_ABN = 'au_abn'; + const TYPE_AU_ARN = 'au_arn'; + const TYPE_BR_CNPJ = 'br_cnpj'; + const TYPE_BR_CPF = 'br_cpf'; + const TYPE_CA_BN = 'ca_bn'; + const TYPE_CA_GST_HST = 'ca_gst_hst'; + const TYPE_CA_PST_BC = 'ca_pst_bc'; + const TYPE_CA_PST_MB = 'ca_pst_mb'; + const TYPE_CA_PST_SK = 'ca_pst_sk'; + const TYPE_CA_QST = 'ca_qst'; + const TYPE_CH_VAT = 'ch_vat'; + const TYPE_CL_TIN = 'cl_tin'; + const TYPE_ES_CIF = 'es_cif'; + const TYPE_EU_VAT = 'eu_vat'; + const TYPE_GB_VAT = 'gb_vat'; + const TYPE_GE_VAT = 'ge_vat'; + const TYPE_HK_BR = 'hk_br'; + const TYPE_ID_NPWP = 'id_npwp'; + const TYPE_IL_VAT = 'il_vat'; + const TYPE_IN_GST = 'in_gst'; + const TYPE_JP_CN = 'jp_cn'; + const TYPE_JP_RN = 'jp_rn'; + const TYPE_KR_BRN = 'kr_brn'; + const TYPE_LI_UID = 'li_uid'; + const TYPE_MX_RFC = 'mx_rfc'; + const TYPE_MY_FRP = 'my_frp'; + const TYPE_MY_ITN = 'my_itn'; + const TYPE_MY_SST = 'my_sst'; + const TYPE_NO_VAT = 'no_vat'; + const TYPE_NZ_GST = 'nz_gst'; + const TYPE_RU_INN = 'ru_inn'; + const TYPE_RU_KPP = 'ru_kpp'; + const TYPE_SA_VAT = 'sa_vat'; + const TYPE_SG_GST = 'sg_gst'; + const TYPE_SG_UEN = 'sg_uen'; + const TYPE_TH_VAT = 'th_vat'; + const TYPE_TW_VAT = 'tw_vat'; + const TYPE_UA_VAT = 'ua_vat'; + const TYPE_UNKNOWN = 'unknown'; + const TYPE_US_EIN = 'us_ein'; + const TYPE_ZA_VAT = 'za_vat'; + + const VERIFICATION_STATUS_PENDING = 'pending'; + const VERIFICATION_STATUS_UNAVAILABLE = 'unavailable'; + const VERIFICATION_STATUS_UNVERIFIED = 'unverified'; + const VERIFICATION_STATUS_VERIFIED = 'verified'; + + /** + * @return string the API URL for this tax id + */ + public function instanceUrl() + { + $id = $this['id']; + $customer = $this['customer']; + if (!$id) { + throw new Exception\UnexpectedValueException( + "Could not determine which URL to request: class instance has invalid ID: {$id}" + ); + } + $id = Util\Util::utf8($id); + $customer = Util\Util::utf8($customer); + + $base = Customer::classUrl(); + $customerExtn = \urlencode($customer); + $extn = \urlencode($id); + + return "{$base}/{$customerExtn}/tax_ids/{$extn}"; + } + + /** + * @param array|string $_id + * @param null|array|string $_opts + * + * @throws \Stripe\Exception\BadMethodCallException + */ + public static function retrieve($_id, $_opts = null) + { + $msg = 'Tax IDs cannot be retrieved without a customer ID. Retrieve ' . + "a tax ID using `Customer::retrieveTaxId('customer_id', " . + "'tax_id_id')`."; + + throw new Exception\BadMethodCallException($msg); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxRate.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxRate.php new file mode 100644 index 0000000..5a45637 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/TaxRate.php @@ -0,0 +1,50 @@ +invoices, subscriptions and + * Checkout + * Sessions to collect tax. + * + * Related guide: Tax + * Rates. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $active Defaults to true. When set to false, this tax rate cannot be used with new applications or Checkout Sessions, but will still work for subscriptions and invoices that already have it set. + * @property null|string $country Two-letter country code (ISO 3166-1 alpha-2). + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $description An arbitrary string attached to the tax rate for your internal use only. It will not be visible to your customers. + * @property string $display_name The display name of the tax rates as it will appear to your customer on their receipt email, PDF, and the hosted invoice page. + * @property bool $inclusive This specifies if the tax rate is inclusive or exclusive. + * @property null|string $jurisdiction The jurisdiction for the tax rate. You can use this label field for tax reporting purposes. It also appears on your customer’s invoice. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property float $percentage This represents the tax rate percent out of 100. + * @property null|string $state ISO 3166-2 subdivision code, without country prefix. For example, "NY" for New York, United States. + * @property null|string $tax_type The high-level tax type, such as vat or sales_tax. + */ +class TaxRate extends ApiResource +{ + const OBJECT_NAME = 'tax_rate'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const TAX_TYPE_GST = 'gst'; + const TAX_TYPE_HST = 'hst'; + const TAX_TYPE_JCT = 'jct'; + const TAX_TYPE_PST = 'pst'; + const TAX_TYPE_QST = 'qst'; + const TAX_TYPE_RST = 'rst'; + const TAX_TYPE_SALES_TAX = 'sales_tax'; + const TAX_TYPE_VAT = 'vat'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/ConnectionToken.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/ConnectionToken.php new file mode 100644 index 0000000..e49a0b0 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/ConnectionToken.php @@ -0,0 +1,22 @@ +Fleet + * Management. + * + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property string $location The id of the location that this connection token is scoped to. Note that location scoping only applies to internet-connected readers. For more details, see the docs on scoping connection tokens. + * @property string $secret Your application should pass this token to the Stripe Terminal SDK. + */ +class ConnectionToken extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'terminal.connection_token'; + + use \Stripe\ApiOperations\Create; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Location.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Location.php new file mode 100644 index 0000000..21a2c63 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Location.php @@ -0,0 +1,29 @@ +Fleet + * Management. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\StripeObject $address + * @property string $display_name The display name of the location. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + */ +class Location extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'terminal.location'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Delete; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Reader.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Reader.php new file mode 100644 index 0000000..28edf43 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Terminal/Reader.php @@ -0,0 +1,35 @@ +Connecting to a + * Reader. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $device_sw_version The current software version of the reader. + * @property string $device_type Type of reader, one of bbpos_chipper2x, bbpos_wisepos_e, or verifone_P400. + * @property null|string $ip_address The local IP address of the reader. + * @property string $label Custom label given to the reader for easier identification. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string|\Stripe\Terminal\Location $location The location identifier of the reader. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $serial_number Serial number of the reader. + * @property null|string $status The networking status of the reader. + */ +class Reader extends \Stripe\ApiResource +{ + const OBJECT_NAME = 'terminal.reader'; + + use \Stripe\ApiOperations\All; + use \Stripe\ApiOperations\Create; + use \Stripe\ApiOperations\Delete; + use \Stripe\ApiOperations\Retrieve; + use \Stripe\ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/ThreeDSecure.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/ThreeDSecure.php new file mode 100644 index 0000000..51b5691 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/ThreeDSecure.php @@ -0,0 +1,37 @@ +3D + * Secure object. Once the object has been created, you can use it to + * authenticate the cardholder and create a charge. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount of the charge that you will create when authentication completes. + * @property bool $authenticated True if the cardholder went through the authentication flow and their bank indicated that authentication succeeded. + * @property \Stripe\Card $card

You can store multiple cards on a customer in order to charge the customer later. You can also store multiple debit cards on a recipient in order to transfer to those cards later.

Related guide: Card Payments with Sources.

+ * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property null|string $redirect_url If present, this is the URL that you should send the cardholder to for authentication. If you are going to use Stripe.js to display the authentication page in an iframe, you should use the value "_callback". + * @property string $status Possible values are redirect_pending, succeeded, or failed. When the cardholder can be authenticated, the object starts with status redirect_pending. When liability will be shifted to the cardholder's bank (either because the cardholder was successfully authenticated, or because the bank has not implemented 3D Secure, the object wlil be in status succeeded. failed indicates that authentication was attempted unsuccessfully. + */ +class ThreeDSecure extends ApiResource +{ + const OBJECT_NAME = 'three_d_secure'; + + use ApiOperations\Create; + use ApiOperations\Retrieve; + + /** + * @return string the endpoint URL for the given class + */ + public static function classUrl() + { + return '/v1/3d_secure'; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Token.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Token.php new file mode 100644 index 0000000..18b33e8 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Token.php @@ -0,0 +1,57 @@ +recommended payments integrations to + * perform this process client-side. This ensures that no sensitive card data + * touches your server, and allows your integration to operate in a PCI-compliant + * way. + * + * If you cannot use client-side tokenization, you can also create tokens using the + * API with either your publishable or secret API key. Keep in mind that if your + * integration uses this method, you are responsible for any PCI compliance that + * may be required, and you must keep your secret API key safe. Unlike with + * client-side tokenization, your customer's information is not sent directly to + * Stripe, so we cannot determine how it is handled or stored. + * + * Tokens cannot be stored or used more than once. To store card or bank account + * information for later use, you can create Customer objects or Custom accounts. Note + * that Radar, our integrated solution + * for automatic fraud protection, performs best with integrations that use + * client-side tokenization. + * + * Related guide: Accept + * a payment + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property \Stripe\BankAccount $bank_account

These bank accounts are payment methods on Customer objects.

On the other hand External Accounts are transfer destinations on Account objects for Custom accounts. They can be bank accounts or debit cards as well, and are documented in the links above.

Related guide: Bank Debits and Transfers.

+ * @property \Stripe\Card $card

You can store multiple cards on a customer in order to charge the customer later. You can also store multiple debit cards on a recipient in order to transfer to those cards later.

Related guide: Card Payments with Sources.

+ * @property null|string $client_ip IP address of the client that generated the token. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property string $type Type of the token: account, bank_account, card, or pii. + * @property bool $used Whether this token has already been used (tokens can be used only once). + */ +class Token extends ApiResource +{ + const OBJECT_NAME = 'token'; + + use ApiOperations\Create; + use ApiOperations\Retrieve; + + const TYPE_ACCOUNT = 'account'; + const TYPE_BANK_ACCOUNT = 'bank_account'; + const TYPE_CARD = 'card'; + const TYPE_PII = 'pii'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Topup.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Topup.php new file mode 100644 index 0000000..69cdd68 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Topup.php @@ -0,0 +1,63 @@ +Topping Up your + * Platform Account. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount transferred. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction ID of the balance transaction that describes the impact of this top-up on your account balance. May not be specified depending on status of top-up. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|int $expected_availability_date Date the funds are expected to arrive in your Stripe account for payouts. This factors in delays like weekends or bank holidays. May not be specified depending on status of top-up. + * @property null|string $failure_code Error code explaining reason for top-up failure if available (see the errors section for a list of codes). + * @property null|string $failure_message Message to user further explaining reason for top-up failure if available. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\Source $source

Source objects allow you to accept a variety of payment methods. They represent a customer's payment instrument, and can be used with the Stripe API just like a Card object: once chargeable, they can be charged, or can be attached to customers.

Related guides: Sources API and Sources & Customers.

+ * @property null|string $statement_descriptor Extra information about a top-up. This will appear on your source's bank statement. It must contain at least one letter. + * @property string $status The status of the top-up is either canceled, failed, pending, reversed, or succeeded. + * @property null|string $transfer_group A string that identifies this top-up as part of a group. + */ +class Topup extends ApiResource +{ + const OBJECT_NAME = 'topup'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const STATUS_CANCELED = 'canceled'; + const STATUS_FAILED = 'failed'; + const STATUS_PENDING = 'pending'; + const STATUS_REVERSED = 'reversed'; + const STATUS_SUCCEEDED = 'succeeded'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Topup the canceled topup + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Transfer.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Transfer.php new file mode 100644 index 0000000..4fb0c6a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Transfer.php @@ -0,0 +1,130 @@ +Transfer object is created when you move funds between Stripe + * accounts as part of Connect. + * + * Before April 6, 2017, transfers also represented movement of funds from a Stripe + * account to a card or bank account. This behavior has since been split out into a + * Payout object, with + * corresponding payout endpoints. For more information, read about the transfer/payout split. + * + * Related guide: Creating Separate + * Charges and Transfers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount in %s to be transferred. + * @property int $amount_reversed Amount in %s reversed (can be less than the amount attribute on the transfer if a partial reversal was issued). + * @property null|string|\Stripe\BalanceTransaction $balance_transaction Balance transaction that describes the impact of this transfer on your account balance. + * @property int $created Time that this record of the transfer was first created. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string $description An arbitrary string attached to the object. Often useful for displaying to users. + * @property null|string|\Stripe\Account $destination ID of the Stripe account the transfer was sent to. + * @property string|\Stripe\Charge $destination_payment If the destination is a Stripe account, this will be the ID of the payment that the destination account received for the transfer. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property \Stripe\Collection $reversals A list of reversals that have been applied to the transfer. + * @property bool $reversed Whether the transfer has been fully reversed. If the transfer is only partially reversed, this attribute will still be false. + * @property null|string|\Stripe\Charge $source_transaction ID of the charge or payment that was used to fund the transfer. If null, the transfer was funded from the available balance. + * @property null|string $source_type The source balance this transfer came from. One of card, fpx, or bank_account. + * @property null|string $transfer_group A string that identifies this transaction as part of a group. See the Connect documentation for details. + */ +class Transfer extends ApiResource +{ + const OBJECT_NAME = 'transfer'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\NestedResource; + use ApiOperations\Retrieve; + use ApiOperations\Update; + + const SOURCE_TYPE_ALIPAY_ACCOUNT = 'alipay_account'; + const SOURCE_TYPE_BANK_ACCOUNT = 'bank_account'; + const SOURCE_TYPE_CARD = 'card'; + const SOURCE_TYPE_FINANCING = 'financing'; + + /** + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Transfer the canceled transfer + */ + public function cancel($params = null, $opts = null) + { + $url = $this->instanceUrl() . '/cancel'; + list($response, $opts) = $this->_request('post', $url, $params, $opts); + $this->refreshFrom($response, $opts); + + return $this; + } + + const PATH_REVERSALS = '/reversals'; + + /** + * @param string $id the ID of the transfer on which to retrieve the transfer reversals + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\Collection the list of transfer reversals + */ + public static function allReversals($id, $params = null, $opts = null) + { + return self::_allNestedResources($id, static::PATH_REVERSALS, $params, $opts); + } + + /** + * @param string $id the ID of the transfer on which to create the transfer reversal + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public static function createReversal($id, $params = null, $opts = null) + { + return self::_createNestedResource($id, static::PATH_REVERSALS, $params, $opts); + } + + /** + * @param string $id the ID of the transfer to which the transfer reversal belongs + * @param string $reversalId the ID of the transfer reversal to retrieve + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public static function retrieveReversal($id, $reversalId, $params = null, $opts = null) + { + return self::_retrieveNestedResource($id, static::PATH_REVERSALS, $reversalId, $params, $opts); + } + + /** + * @param string $id the ID of the transfer to which the transfer reversal belongs + * @param string $reversalId the ID of the transfer reversal to update + * @param null|array $params + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return \Stripe\TransferReversal + */ + public static function updateReversal($id, $reversalId, $params = null, $opts = null) + { + return self::_updateNestedResource($id, static::PATH_REVERSALS, $reversalId, $params, $opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/TransferReversal.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/TransferReversal.php new file mode 100644 index 0000000..b6167db --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/TransferReversal.php @@ -0,0 +1,79 @@ +Stripe Connect platforms can + * reverse transfers made to a connected account, either entirely or partially, and + * can also specify whether to refund any related application fees. Transfer + * reversals add to the platform's balance and subtract from the destination + * account's balance. + * + * Reversing a transfer that was made for a destination charge is allowed only + * up to the amount of the charge. It is possible to reverse a transfer_group + * transfer only if the destination account has enough balance to cover the + * reversal. + * + * Related guide: Reversing + * Transfers. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property int $amount Amount, in %s. + * @property null|string|\Stripe\BalanceTransaction $balance_transaction Balance transaction that describes the impact on your account balance. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property string $currency Three-letter ISO currency code, in lowercase. Must be a supported currency. + * @property null|string|\Stripe\Refund $destination_payment_refund Linked payment refund for the transfer reversal. + * @property null|\Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property null|string|\Stripe\Refund $source_refund ID of the refund responsible for the transfer reversal. + * @property string|\Stripe\Transfer $transfer ID of the transfer that was reversed. + */ +class TransferReversal extends ApiResource +{ + const OBJECT_NAME = 'transfer_reversal'; + + use ApiOperations\Update { + save as protected _save; + } + + /** + * @return string the API URL for this Stripe transfer reversal + */ + public function instanceUrl() + { + $id = $this['id']; + $transfer = $this['transfer']; + if (!$id) { + throw new Exception\UnexpectedValueException( + 'Could not determine which URL to request: ' . + "class instance has invalid ID: {$id}", + null + ); + } + $id = Util\Util::utf8($id); + $transfer = Util\Util::utf8($transfer); + + $base = Transfer::classUrl(); + $transferExtn = \urlencode($transfer); + $extn = \urlencode($id); + + return "{$base}/{$transferExtn}/reversals/{$extn}"; + } + + /** + * @param null|array|string $opts + * + * @throws \Stripe\Exception\ApiErrorException if the request fails + * + * @return TransferReversal the saved reversal + */ + public function save($opts = null) + { + return $this->_save($opts); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecord.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecord.php new file mode 100644 index 0000000..5522982 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecord.php @@ -0,0 +1,25 @@ +Metered + * Billing. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property int $quantity The usage quantity for the specified date. + * @property string $subscription_item The ID of the subscription item this usage record contains data for. + * @property int $timestamp The timestamp when this usage occurred. + */ +class UsageRecord extends ApiResource +{ + const OBJECT_NAME = 'usage_record'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecordSummary.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecordSummary.php new file mode 100644 index 0000000..174e14e --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/UsageRecordSummary.php @@ -0,0 +1,19 @@ +true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $period + * @property string $subscription_item The ID of the subscription item this summary is describing. + * @property int $total_usage The total usage within this usage period. + */ +class UsageRecordSummary extends ApiResource +{ + const OBJECT_NAME = 'usage_record_summary'; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/CaseInsensitiveArray.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/CaseInsensitiveArray.php new file mode 100644 index 0000000..9f11dc6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/CaseInsensitiveArray.php @@ -0,0 +1,78 @@ +container = \array_change_key_case($initial_array, \CASE_LOWER); + } + + #[\ReturnTypeWillChange] + public function count() + { + return \count($this->container); + } + + #[\ReturnTypeWillChange] + public function getIterator() + { + return new \ArrayIterator($this->container); + } + + #[\ReturnTypeWillChange] + public function offsetSet($offset, $value) + { + $offset = static::maybeLowercase($offset); + if (null === $offset) { + $this->container[] = $value; + } else { + $this->container[$offset] = $value; + } + } + + #[\ReturnTypeWillChange] + public function offsetExists($offset) + { + $offset = static::maybeLowercase($offset); + + return isset($this->container[$offset]); + } + + #[\ReturnTypeWillChange] + public function offsetUnset($offset) + { + $offset = static::maybeLowercase($offset); + unset($this->container[$offset]); + } + + #[\ReturnTypeWillChange] + public function offsetGet($offset) + { + $offset = static::maybeLowercase($offset); + + return isset($this->container[$offset]) ? $this->container[$offset] : null; + } + + private static function maybeLowercase($v) + { + if (\is_string($v)) { + return \strtolower($v); + } + + return $v; + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/DefaultLogger.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/DefaultLogger.php new file mode 100644 index 0000000..016cbe8 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/DefaultLogger.php @@ -0,0 +1,29 @@ + 0) { + throw new \Stripe\Exception\BadMethodCallException('DefaultLogger does not currently implement context. Please implement if you need it.'); + } + + if (null === $this->destination) { + \error_log($message, $this->messageType); + } else { + \error_log($message, $this->messageType, $this->destination); + } + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/LoggerInterface.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/LoggerInterface.php new file mode 100644 index 0000000..5603c81 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/LoggerInterface.php @@ -0,0 +1,34 @@ + \Stripe\Account::class, + \Stripe\AccountLink::OBJECT_NAME => \Stripe\AccountLink::class, + \Stripe\AlipayAccount::OBJECT_NAME => \Stripe\AlipayAccount::class, + \Stripe\ApplePayDomain::OBJECT_NAME => \Stripe\ApplePayDomain::class, + \Stripe\ApplicationFee::OBJECT_NAME => \Stripe\ApplicationFee::class, + \Stripe\ApplicationFeeRefund::OBJECT_NAME => \Stripe\ApplicationFeeRefund::class, + \Stripe\Balance::OBJECT_NAME => \Stripe\Balance::class, + \Stripe\BalanceTransaction::OBJECT_NAME => \Stripe\BalanceTransaction::class, + \Stripe\BankAccount::OBJECT_NAME => \Stripe\BankAccount::class, + \Stripe\BillingPortal\Configuration::OBJECT_NAME => \Stripe\BillingPortal\Configuration::class, + \Stripe\BillingPortal\Session::OBJECT_NAME => \Stripe\BillingPortal\Session::class, + \Stripe\BitcoinReceiver::OBJECT_NAME => \Stripe\BitcoinReceiver::class, + \Stripe\BitcoinTransaction::OBJECT_NAME => \Stripe\BitcoinTransaction::class, + \Stripe\Capability::OBJECT_NAME => \Stripe\Capability::class, + \Stripe\Card::OBJECT_NAME => \Stripe\Card::class, + \Stripe\Charge::OBJECT_NAME => \Stripe\Charge::class, + \Stripe\Checkout\Session::OBJECT_NAME => \Stripe\Checkout\Session::class, + \Stripe\Collection::OBJECT_NAME => \Stripe\Collection::class, + \Stripe\CountrySpec::OBJECT_NAME => \Stripe\CountrySpec::class, + \Stripe\Coupon::OBJECT_NAME => \Stripe\Coupon::class, + \Stripe\CreditNote::OBJECT_NAME => \Stripe\CreditNote::class, + \Stripe\CreditNoteLineItem::OBJECT_NAME => \Stripe\CreditNoteLineItem::class, + \Stripe\Customer::OBJECT_NAME => \Stripe\Customer::class, + \Stripe\CustomerBalanceTransaction::OBJECT_NAME => \Stripe\CustomerBalanceTransaction::class, + \Stripe\Discount::OBJECT_NAME => \Stripe\Discount::class, + \Stripe\Dispute::OBJECT_NAME => \Stripe\Dispute::class, + \Stripe\EphemeralKey::OBJECT_NAME => \Stripe\EphemeralKey::class, + \Stripe\Event::OBJECT_NAME => \Stripe\Event::class, + \Stripe\ExchangeRate::OBJECT_NAME => \Stripe\ExchangeRate::class, + \Stripe\File::OBJECT_NAME => \Stripe\File::class, + \Stripe\File::OBJECT_NAME_ALT => \Stripe\File::class, + \Stripe\FileLink::OBJECT_NAME => \Stripe\FileLink::class, + \Stripe\Identity\VerificationReport::OBJECT_NAME => \Stripe\Identity\VerificationReport::class, + \Stripe\Identity\VerificationSession::OBJECT_NAME => \Stripe\Identity\VerificationSession::class, + \Stripe\Invoice::OBJECT_NAME => \Stripe\Invoice::class, + \Stripe\InvoiceItem::OBJECT_NAME => \Stripe\InvoiceItem::class, + \Stripe\InvoiceLineItem::OBJECT_NAME => \Stripe\InvoiceLineItem::class, + \Stripe\Issuing\Authorization::OBJECT_NAME => \Stripe\Issuing\Authorization::class, + \Stripe\Issuing\Card::OBJECT_NAME => \Stripe\Issuing\Card::class, + \Stripe\Issuing\CardDetails::OBJECT_NAME => \Stripe\Issuing\CardDetails::class, + \Stripe\Issuing\Cardholder::OBJECT_NAME => \Stripe\Issuing\Cardholder::class, + \Stripe\Issuing\Dispute::OBJECT_NAME => \Stripe\Issuing\Dispute::class, + \Stripe\Issuing\Transaction::OBJECT_NAME => \Stripe\Issuing\Transaction::class, + \Stripe\LineItem::OBJECT_NAME => \Stripe\LineItem::class, + \Stripe\LoginLink::OBJECT_NAME => \Stripe\LoginLink::class, + \Stripe\Mandate::OBJECT_NAME => \Stripe\Mandate::class, + \Stripe\Order::OBJECT_NAME => \Stripe\Order::class, + \Stripe\OrderItem::OBJECT_NAME => \Stripe\OrderItem::class, + \Stripe\OrderReturn::OBJECT_NAME => \Stripe\OrderReturn::class, + \Stripe\PaymentIntent::OBJECT_NAME => \Stripe\PaymentIntent::class, + \Stripe\PaymentMethod::OBJECT_NAME => \Stripe\PaymentMethod::class, + \Stripe\Payout::OBJECT_NAME => \Stripe\Payout::class, + \Stripe\Person::OBJECT_NAME => \Stripe\Person::class, + \Stripe\Plan::OBJECT_NAME => \Stripe\Plan::class, + \Stripe\Price::OBJECT_NAME => \Stripe\Price::class, + \Stripe\Product::OBJECT_NAME => \Stripe\Product::class, + \Stripe\PromotionCode::OBJECT_NAME => \Stripe\PromotionCode::class, + \Stripe\Quote::OBJECT_NAME => \Stripe\Quote::class, + \Stripe\Radar\EarlyFraudWarning::OBJECT_NAME => \Stripe\Radar\EarlyFraudWarning::class, + \Stripe\Radar\ValueList::OBJECT_NAME => \Stripe\Radar\ValueList::class, + \Stripe\Radar\ValueListItem::OBJECT_NAME => \Stripe\Radar\ValueListItem::class, + \Stripe\Recipient::OBJECT_NAME => \Stripe\Recipient::class, + \Stripe\RecipientTransfer::OBJECT_NAME => \Stripe\RecipientTransfer::class, + \Stripe\Refund::OBJECT_NAME => \Stripe\Refund::class, + \Stripe\Reporting\ReportRun::OBJECT_NAME => \Stripe\Reporting\ReportRun::class, + \Stripe\Reporting\ReportType::OBJECT_NAME => \Stripe\Reporting\ReportType::class, + \Stripe\Review::OBJECT_NAME => \Stripe\Review::class, + \Stripe\SetupAttempt::OBJECT_NAME => \Stripe\SetupAttempt::class, + \Stripe\SetupIntent::OBJECT_NAME => \Stripe\SetupIntent::class, + \Stripe\ShippingRate::OBJECT_NAME => \Stripe\ShippingRate::class, + \Stripe\Sigma\ScheduledQueryRun::OBJECT_NAME => \Stripe\Sigma\ScheduledQueryRun::class, + \Stripe\SKU::OBJECT_NAME => \Stripe\SKU::class, + \Stripe\Source::OBJECT_NAME => \Stripe\Source::class, + \Stripe\SourceTransaction::OBJECT_NAME => \Stripe\SourceTransaction::class, + \Stripe\Subscription::OBJECT_NAME => \Stripe\Subscription::class, + \Stripe\SubscriptionItem::OBJECT_NAME => \Stripe\SubscriptionItem::class, + \Stripe\SubscriptionSchedule::OBJECT_NAME => \Stripe\SubscriptionSchedule::class, + \Stripe\TaxCode::OBJECT_NAME => \Stripe\TaxCode::class, + \Stripe\TaxId::OBJECT_NAME => \Stripe\TaxId::class, + \Stripe\TaxRate::OBJECT_NAME => \Stripe\TaxRate::class, + \Stripe\Terminal\ConnectionToken::OBJECT_NAME => \Stripe\Terminal\ConnectionToken::class, + \Stripe\Terminal\Location::OBJECT_NAME => \Stripe\Terminal\Location::class, + \Stripe\Terminal\Reader::OBJECT_NAME => \Stripe\Terminal\Reader::class, + \Stripe\ThreeDSecure::OBJECT_NAME => \Stripe\ThreeDSecure::class, + \Stripe\Token::OBJECT_NAME => \Stripe\Token::class, + \Stripe\Topup::OBJECT_NAME => \Stripe\Topup::class, + \Stripe\Transfer::OBJECT_NAME => \Stripe\Transfer::class, + \Stripe\TransferReversal::OBJECT_NAME => \Stripe\TransferReversal::class, + \Stripe\UsageRecord::OBJECT_NAME => \Stripe\UsageRecord::class, + \Stripe\UsageRecordSummary::OBJECT_NAME => \Stripe\UsageRecordSummary::class, + \Stripe\WebhookEndpoint::OBJECT_NAME => \Stripe\WebhookEndpoint::class, + ]; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/RandomGenerator.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/RandomGenerator.php new file mode 100644 index 0000000..ccf023a --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/RandomGenerator.php @@ -0,0 +1,36 @@ + a list of headers that should be persisted across requests + */ + public static $HEADERS_TO_PERSIST = [ + 'Stripe-Account', + 'Stripe-Version', + ]; + + /** @var array */ + public $headers; + + /** @var null|string */ + public $apiKey; + + /** @var null|string */ + public $apiBase; + + /** + * @param null|string $key + * @param array $headers + * @param null|string $base + */ + public function __construct($key = null, $headers = [], $base = null) + { + $this->apiKey = $key; + $this->headers = $headers; + $this->apiBase = $base; + } + + /** + * @return array + */ + public function __debugInfo() + { + return [ + 'apiKey' => $this->redactedApiKey(), + 'headers' => $this->headers, + 'apiBase' => $this->apiBase, + ]; + } + + /** + * Unpacks an options array and merges it into the existing RequestOptions + * object. + * + * @param null|array|RequestOptions|string $options a key => value array + * @param bool $strict when true, forbid string form and arbitrary keys in array form + * + * @return RequestOptions + */ + public function merge($options, $strict = false) + { + $other_options = self::parse($options, $strict); + if (null === $other_options->apiKey) { + $other_options->apiKey = $this->apiKey; + } + if (null === $other_options->apiBase) { + $other_options->apiBase = $this->apiBase; + } + $other_options->headers = \array_merge($this->headers, $other_options->headers); + + return $other_options; + } + + /** + * Discards all headers that we don't want to persist across requests. + */ + public function discardNonPersistentHeaders() + { + foreach ($this->headers as $k => $v) { + if (!\in_array($k, self::$HEADERS_TO_PERSIST, true)) { + unset($this->headers[$k]); + } + } + } + + /** + * Unpacks an options array into an RequestOptions object. + * + * @param null|array|RequestOptions|string $options a key => value array + * @param bool $strict when true, forbid string form and arbitrary keys in array form + * + * @throws \Stripe\Exception\InvalidArgumentException + * + * @return RequestOptions + */ + public static function parse($options, $strict = false) + { + if ($options instanceof self) { + return clone $options; + } + + if (null === $options) { + return new RequestOptions(null, [], null); + } + + if (\is_string($options)) { + if ($strict) { + $message = 'Do not pass a string for request options. If you want to set the ' + . 'API key, pass an array like ["api_key" => ] instead.'; + + throw new \Stripe\Exception\InvalidArgumentException($message); + } + + return new RequestOptions($options, [], null); + } + + if (\is_array($options)) { + $headers = []; + $key = null; + $base = null; + + if (\array_key_exists('api_key', $options)) { + $key = $options['api_key']; + unset($options['api_key']); + } + if (\array_key_exists('idempotency_key', $options)) { + $headers['Idempotency-Key'] = $options['idempotency_key']; + unset($options['idempotency_key']); + } + if (\array_key_exists('stripe_account', $options)) { + $headers['Stripe-Account'] = $options['stripe_account']; + unset($options['stripe_account']); + } + if (\array_key_exists('stripe_version', $options)) { + $headers['Stripe-Version'] = $options['stripe_version']; + unset($options['stripe_version']); + } + if (\array_key_exists('api_base', $options)) { + $base = $options['api_base']; + unset($options['api_base']); + } + + if ($strict && !empty($options)) { + $message = 'Got unexpected keys in options array: ' . \implode(', ', \array_keys($options)); + + throw new \Stripe\Exception\InvalidArgumentException($message); + } + + return new RequestOptions($key, $headers, $base); + } + + $message = 'The second argument to Stripe API method calls is an ' + . 'optional per-request apiKey, which must be a string, or ' + . 'per-request options, which must be an array. (HINT: you can set ' + . 'a global apiKey by "Stripe::setApiKey()")'; + + throw new \Stripe\Exception\InvalidArgumentException($message); + } + + private function redactedApiKey() + { + $pieces = \explode('_', $this->apiKey, 3); + $last = \array_pop($pieces); + $redactedLast = \strlen($last) > 4 + ? (\str_repeat('*', \strlen($last) - 4) . \substr($last, -4)) + : $last; + $pieces[] = $redactedLast; + + return \implode('_', $pieces); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Set.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Set.php new file mode 100644 index 0000000..c39d813 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Set.php @@ -0,0 +1,45 @@ +_elts = []; + foreach ($members as $item) { + $this->_elts[$item] = true; + } + } + + public function includes($elt) + { + return isset($this->_elts[$elt]); + } + + public function add($elt) + { + $this->_elts[$elt] = true; + } + + public function discard($elt) + { + unset($this->_elts[$elt]); + } + + public function toArray() + { + return \array_keys($this->_elts); + } + + #[\ReturnTypeWillChange] + public function getIterator() + { + return new ArrayIterator($this->toArray()); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Util.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Util.php new file mode 100644 index 0000000..4f39050 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Util/Util.php @@ -0,0 +1,265 @@ +id; + } + if (static::isList($h)) { + $results = []; + foreach ($h as $v) { + $results[] = static::objectsToIds($v); + } + + return $results; + } + if (\is_array($h)) { + $results = []; + foreach ($h as $k => $v) { + if (null === $v) { + continue; + } + $results[$k] = static::objectsToIds($v); + } + + return $results; + } + + return $h; + } + + /** + * @param array $params + * + * @return string + */ + public static function encodeParameters($params) + { + $flattenedParams = self::flattenParams($params); + $pieces = []; + foreach ($flattenedParams as $param) { + list($k, $v) = $param; + $pieces[] = self::urlEncode($k) . '=' . self::urlEncode($v); + } + + return \implode('&', $pieces); + } + + /** + * @param array $params + * @param null|string $parentKey + * + * @return array + */ + public static function flattenParams($params, $parentKey = null) + { + $result = []; + + foreach ($params as $key => $value) { + $calculatedKey = $parentKey ? "{$parentKey}[{$key}]" : $key; + + if (self::isList($value)) { + $result = \array_merge($result, self::flattenParamsList($value, $calculatedKey)); + } elseif (\is_array($value)) { + $result = \array_merge($result, self::flattenParams($value, $calculatedKey)); + } else { + \array_push($result, [$calculatedKey, $value]); + } + } + + return $result; + } + + /** + * @param array $value + * @param string $calculatedKey + * + * @return array + */ + public static function flattenParamsList($value, $calculatedKey) + { + $result = []; + + foreach ($value as $i => $elem) { + if (self::isList($elem)) { + $result = \array_merge($result, self::flattenParamsList($elem, $calculatedKey)); + } elseif (\is_array($elem)) { + $result = \array_merge($result, self::flattenParams($elem, "{$calculatedKey}[{$i}]")); + } else { + \array_push($result, ["{$calculatedKey}[{$i}]", $elem]); + } + } + + return $result; + } + + /** + * @param string $key a string to URL-encode + * + * @return string the URL-encoded string + */ + public static function urlEncode($key) + { + $s = \urlencode((string) $key); + + // Don't use strict form encoding by changing the square bracket control + // characters back to their literals. This is fine by the server, and + // makes these parameter strings easier to read. + $s = \str_replace('%5B', '[', $s); + + return \str_replace('%5D', ']', $s); + } + + public static function normalizeId($id) + { + if (\is_array($id)) { + $params = $id; + $id = $params['id']; + unset($params['id']); + } else { + $params = []; + } + + return [$id, $params]; + } + + /** + * Returns UNIX timestamp in milliseconds. + * + * @return int current time in millis + */ + public static function currentTimeMillis() + { + return (int) \round(\microtime(true) * 1000); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/Webhook.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/Webhook.php new file mode 100644 index 0000000..b9db2d6 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/Webhook.php @@ -0,0 +1,42 @@ +webhook + * endpoints via the API to be notified about events that happen in your Stripe + * account or connected accounts. + * + * Most users configure webhooks from the dashboard, which provides a + * user interface for registering and testing your webhook endpoints. + * + * Related guide: Setting up + * Webhooks. + * + * @property string $id Unique identifier for the object. + * @property string $object String representing the object's type. Objects of the same type share the same value. + * @property null|string $api_version The API version events are rendered as for this webhook endpoint. + * @property null|string $application The ID of the associated Connect application. + * @property int $created Time at which the object was created. Measured in seconds since the Unix epoch. + * @property null|string $description An optional description of what the webhook is used for. + * @property string[] $enabled_events The list of events to enable for this endpoint. ['*'] indicates that all events are enabled, except those that require explicit selection. + * @property bool $livemode Has the value true if the object exists in live mode or the value false if the object exists in test mode. + * @property \Stripe\StripeObject $metadata Set of key-value pairs that you can attach to an object. This can be useful for storing additional information about the object in a structured format. + * @property string $secret The endpoint's secret, used to generate webhook signatures. Only returned at creation. + * @property string $status The status of the webhook. It can be enabled or disabled. + * @property string $url The URL of the webhook endpoint. + */ +class WebhookEndpoint extends ApiResource +{ + const OBJECT_NAME = 'webhook_endpoint'; + + use ApiOperations\All; + use ApiOperations\Create; + use ApiOperations\Delete; + use ApiOperations\Retrieve; + use ApiOperations\Update; +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/lib/WebhookSignature.php b/wp-content/plugins/stripe-payments/includes/stripe/lib/WebhookSignature.php new file mode 100644 index 0000000..46cbb28 --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/lib/WebhookSignature.php @@ -0,0 +1,140 @@ + 0) && (\abs(\time() - $timestamp) > $tolerance)) { + throw Exception\SignatureVerificationException::factory( + 'Timestamp outside the tolerance zone', + $payload, + $header + ); + } + + return true; + } + + /** + * Extracts the timestamp in a signature header. + * + * @param string $header the signature header + * + * @return int the timestamp contained in the header, or -1 if no valid + * timestamp is found + */ + private static function getTimestamp($header) + { + $items = \explode(',', $header); + + foreach ($items as $item) { + $itemParts = \explode('=', $item, 2); + if ('t' === $itemParts[0]) { + if (!\is_numeric($itemParts[1])) { + return -1; + } + + return (int) ($itemParts[1]); + } + } + + return -1; + } + + /** + * Extracts the signatures matching a given scheme in a signature header. + * + * @param string $header the signature header + * @param string $scheme the signature scheme to look for + * + * @return array the list of signatures matching the provided scheme + */ + private static function getSignatures($header, $scheme) + { + $signatures = []; + $items = \explode(',', $header); + + foreach ($items as $item) { + $itemParts = \explode('=', $item, 2); + if (\trim($itemParts[0]) === $scheme) { + $signatures[] = $itemParts[1]; + } + } + + return $signatures; + } + + /** + * Computes the signature for a given payload and secret. + * + * The current scheme used by Stripe ("v1") is HMAC/SHA-256. + * + * @param string $payload the payload to sign + * @param string $secret the secret used to generate the signature + * + * @return string the signature as a string + */ + private static function computeSignature($payload, $secret) + { + return \hash_hmac('sha256', $payload, $secret); + } +} diff --git a/wp-content/plugins/stripe-payments/includes/stripe/phpdoc.dist.xml b/wp-content/plugins/stripe-payments/includes/stripe/phpdoc.dist.xml new file mode 100644 index 0000000..b1ea92f --- /dev/null +++ b/wp-content/plugins/stripe-payments/includes/stripe/phpdoc.dist.xml @@ -0,0 +1,31 @@ + + + + build/phpdoc + + + latest + + + lib + + api + + + php + + stripe-php + + +